GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT5G06100
|
AT5G06100 | myb domain protein 33 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
MYB33 | arTal_v1_Chr5_+_1837835_1837914 | 0.08 | 8.0e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr5_-_21992812 | 1.03 |
AT5G54190.2
AT5G54190.1 |
PORA
|
protochlorophyllide oxidoreductase A |
Chr2_+_11135624 | 0.88 |
AT2G26150.2
AT2G26150.1 AT2G26150.4 AT2G26150.3 |
HSFA2
|
heat shock transcription factor A2 |
Chr5_-_816670 | 0.71 |
AT5G03350.1
|
AT5G03350
|
Legume lectin family protein |
Chr2_-_10454591 | 0.70 |
AT2G24600.2
AT2G24600.3 AT2G24600.4 AT2G24600.1 |
AT2G24600
|
Ankyrin repeat family protein |
Chr3_+_11005638 | 0.70 |
AT3G29000.1
|
AT3G29000
|
Calcium-binding EF-hand family protein |
Chr2_-_8850111 | 0.68 |
AT2G20560.1
|
AT2G20560
|
DNAJ heat shock family protein |
Chr3_+_8918679 | 0.66 |
AT3G24500.2
|
MBF1C
|
multiprotein bridging factor 1C |
Chr1_+_3530353 | 0.64 |
AT1G10657.4
AT1G10657.2 AT1G10657.3 AT1G10657.1 |
AT1G10657
|
transmembrane protein |
Chr5_-_19693845 | 0.63 |
AT5G48570.1
|
AT5G48570
|
FKBP-type peptidyl-prolyl cis-trans isomerase family protein |
Chr3_+_8918267 | 0.63 |
AT3G24500.1
|
MBF1C
|
multiprotein bridging factor 1C |
Chr5_+_733887 | 0.62 |
AT5G03120.1
AT5G03120.2 |
AT5G03120
|
transmembrane protein |
Chr4_+_12686459 | 0.60 |
AT4G24570.1
|
DIC2
|
dicarboxylate carrier 2 |
Chr3_+_6154363 | 0.59 |
AT3G18000.1
|
XPL1
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr4_-_7406994 | 0.58 |
AT4G12480.1
|
EARLI1
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr5_+_5718498 | 0.58 |
AT5G17350.1
|
AT5G17350
|
hypothetical protein |
Chr5_+_17987591 | 0.58 |
AT5G44590.2
AT5G44590.1 |
AT5G44590
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr1_+_24602033 | 0.58 |
AT1G66090.1
|
AT1G66090
|
Disease resistance protein (TIR-NBS class) |
Chr5_+_17973775 | 0.57 |
AT5G44575.1
|
AT5G44575
|
hypothetical protein |
Chr3_+_4729399 | 0.57 |
AT3G14210.1
AT3G14210.2 |
ESM1
|
GDSL-like lipase/acylhydrolase superfamily protein |
Chr4_-_7410406 | 0.56 |
AT4G12490.1
|
AT4G12490
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr3_-_3993886 | 0.55 |
AT3G12580.1
|
HSP70
|
heat shock protein 70 |
Chr3_-_5445329 | 0.53 |
AT3G16050.1
|
PDX1.2
|
pyridoxine biosynthesis 1.2 |
Chr1_-_9956960 | 0.53 |
AT1G28370.1
AT1G28370.2 |
ERF11
|
ERF domain protein 11 |
Chr5_+_5209717 | 0.53 |
AT5G15960.1
|
KIN1
|
stress-responsive protein (KIN1) / stress-induced protein (KIN1) |
Chr3_+_19265141 | 0.51 |
AT3G51910.1
|
HSFA7A
|
heat shock transcription factor A7A |
Chr4_-_12393982 | 0.51 |
AT4G23810.1
|
WRKY53
|
WRKY family transcription factor |
Chr2_+_18495215 | 0.51 |
AT2G44840.1
|
ERF13
|
ethylene-responsive element binding factor 13 |
Chr4_+_12137995 | 0.50 |
AT4G23180.1
AT4G23180.3 AT4G23180.2 |
CRK10
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 10 |
Chr4_+_1032350 | 0.50 |
AT4G02330.1
|
ATPMEPCRB
|
Plant invertase/pectin methylesterase inhibitor superfamily |
Chr5_+_8541713 | 0.50 |
AT5G24860.3
AT5G24860.1 |
FPF1
|
flowering promoting factor 1 |
Chr1_-_20180354 | 0.50 |
AT1G54050.2
|
AT1G54050
|
HSP20-like chaperones superfamily protein |
Chr4_-_7992429 | 0.50 |
AT4G13770.1
|
CYP83A1
|
cytochrome P450, family 83, subfamily A, polypeptide 1 |
Chr5_+_9475679 | 0.49 |
AT5G26920.1
AT5G26920.2 AT5G26920.3 |
CBP60G
|
Cam-binding protein 60-like G |
Chr4_-_16644928 | 0.49 |
AT4G34950.1
|
AT4G34950
|
Major facilitator superfamily protein |
Chr1_-_3481041 | 0.48 |
AT1G10550.1
|
XTH33
|
xyloglucan:xyloglucosyl transferase 33 |
Chr2_-_9564850 | 0.48 |
AT2G22500.1
|
UCP5
|
uncoupling protein 5 |
Chr1_-_20180566 | 0.47 |
AT1G54050.1
|
AT1G54050
|
HSP20-like chaperones superfamily protein |
Chr1_+_30383561 | 0.47 |
AT1G80840.1
|
WRKY40
|
WRKY DNA-binding protein 40 |
Chr3_+_16892702 | 0.47 |
AT3G45960.2
AT3G45960.1 |
EXLA3
|
expansin-like A3 |
Chr1_+_480650 | 0.47 |
AT1G02390.1
|
GPAT2
|
glycerol-3-phosphate acyltransferase 2 |
Chr5_-_8406132 | 0.47 |
AT5G24570.1
AT5G24575.1 |
AT5G24570
AT5G24575
|
hypothetical protein hypothetical protein |
Chr1_+_4934120 | 0.46 |
AT1G14430.1
|
AT1G14430
|
glyoxal oxidase-related protein |
Chr4_-_13664621 | 0.45 |
AT4G27280.1
|
AT4G27280
|
Calcium-binding EF-hand family protein |
Chr1_+_11767485 | 0.45 |
AT1G32540.2
AT1G32540.1 AT1G32540.3 AT1G32540.4 AT1G32540.5 AT1G32540.6 AT1G32540.7 |
LOL1
|
lsd one like 1 |
Chr5_-_17962276 | 0.45 |
AT5G44568.1
|
AT5G44568
|
transmembrane protein |
Chr1_+_10371675 | 0.45 |
AT1G29660.1
|
AT1G29660
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr3_+_10565674 | 0.44 |
AT3G28300.1
|
AT14A
|
transmembrane protein, putative (DUF677) |
Chr5_+_1536057 | 0.44 |
AT5G05180.2
AT5G05180.1 AT5G05180.3 |
AT5G05180
|
myosin heavy chain, striated protein |
Chr1_+_12851983 | 0.44 |
AT1G35140.1
|
PHI-1
|
Phosphate-responsive 1 family protein |
Chr5_+_16768935 | 0.44 |
AT5G41900.1
|
AT5G41900
|
alpha/beta-Hydrolases superfamily protein |
Chr1_-_23706005 | 0.44 |
AT1G63860.3
AT1G63860.4 AT1G63860.1 AT1G63860.5 AT1G63860.2 AT1G63860.6 |
AT1G63860
|
Disease resistance protein (TIR-NBS-LRR class) family |
Chr1_+_22628264 | 0.43 |
AT1G61340.1
AT1G61340.2 |
FBS1
|
F-box family protein |
Chr5_-_14999619 | 0.43 |
AT5G37770.1
AT5G37770.2 |
TCH2
|
EF hand calcium-binding protein family |
Chr4_-_8273903 | 0.43 |
AT4G14365.1
|
XBAT34
|
hypothetical protein |
Chr1_-_21626402 | 0.42 |
AT1G58290.1
|
HEMA1
|
Glutamyl-tRNA reductase family protein |
Chr1_-_1307973 | 0.42 |
AT1G04680.1
|
AT1G04680
|
Pectin lyase-like superfamily protein |
Chr1_-_59215 | 0.42 |
AT1G01120.1
|
KCS1
|
3-ketoacyl-CoA synthase 1 |
Chr2_-_19563960 | 0.42 |
AT2G47750.1
|
GH3.9
|
putative indole-3-acetic acid-amido synthetase GH3.9 |
Chr1_+_6697874 | 0.42 |
AT1G19380.1
|
AT1G19380
|
sugar, putative (DUF1195) |
Chr5_+_16151772 | 0.41 |
AT5G40380.3
AT5G40380.2 |
CRK42
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 42 |
Chr1_-_2260089 | 0.41 |
AT1G07350.6
AT1G07350.3 AT1G07350.2 AT1G07350.5 AT1G07350.4 AT1G07350.1 |
SR45a
|
RNA-binding (RRM/RBD/RNP motifs) family protein |
Chr4_-_16583075 | 0.41 |
AT4G34760.1
|
AT4G34760
|
SAUR-like auxin-responsive protein family |
Chr3_-_1136397 | 0.41 |
AT3G04290.1
|
LTL1
|
Li-tolerant lipase 1 |
Chr3_-_9464676 | 0.41 |
AT3G25870.1
|
AT3G25870
|
hypothetical protein |
Chr3_-_629845 | 0.41 |
AT3G02870.2
AT3G02870.3 AT3G02870.1 |
VTC4
|
Inositol monophosphatase family protein |
Chr3_-_4714698 | 0.41 |
AT3G14200.1
|
AT3G14200
|
Chaperone DnaJ-domain superfamily protein |
Chr4_+_1249971 | 0.41 |
AT4G02800.1
|
AT4G02800
|
GRIP/coiled-coil protein |
Chr5_-_20489727 | 0.41 |
AT5G50335.1
|
AT5G50335
|
hypothetical protein |
Chr2_+_11566288 | 0.40 |
AT2G27080.1
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
Chr1_+_10477885 | 0.40 |
AT1G29930.1
|
CAB1
|
chlorophyll A/B binding protein 1 |
Chr4_+_12524186 | 0.40 |
AT4G24120.1
|
YSL1
|
YELLOW STRIPE like 1 |
Chr1_+_27991165 | 0.40 |
AT1G74470.1
|
AT1G74470
|
Pyridine nucleotide-disulfide oxidoreductase family protein |
Chr4_+_13128394 | 0.40 |
AT4G25810.1
|
XTR6
|
xyloglucan endotransglycosylase 6 |
Chr5_-_27504 | 0.40 |
AT5G01075.1
|
AT5G01075
|
Glycosyl hydrolase family 35 protein |
Chr3_+_17228642 | 0.40 |
AT3G46780.1
|
PTAC16
|
plastid transcriptionally active 16 |
Chr4_+_5740219 | 0.40 |
AT4G08950.1
|
EXO
|
Phosphate-responsive 1 family protein |
Chr5_+_20090648 | 0.39 |
AT5G49520.1
|
WRKY48
|
WRKY DNA-binding protein 48 |
Chr3_-_5764760 | 0.39 |
AT3G16870.1
|
GATA17
|
GATA transcription factor 17 |
Chr5_-_17289958 | 0.39 |
AT5G43070.1
|
WPP1
|
WPP domain protein 1 |
Chr4_-_9668356 | 0.39 |
AT4G17240.2
|
AT4G17240
|
structural maintenance of chromosomes protein |
Chr1_-_12897675 | 0.39 |
AT1G35210.1
|
AT1G35210
|
hypothetical protein |
Chr4_+_6018021 | 0.39 |
AT4G09500.2
AT4G09500.1 |
AT4G09500
|
UDP-Glycosyltransferase superfamily protein |
Chr1_-_10475969 | 0.39 |
AT1G29920.1
|
CAB2
|
chlorophyll A/B-binding protein 2 |
Chr5_+_2657054 | 0.39 |
AT5G08260.1
|
scpl35
|
serine carboxypeptidase-like 35 |
Chr5_-_25813620 | 0.38 |
AT5G64570.3
AT5G64570.2 AT5G64570.1 |
XYL4
|
beta-D-xylosidase 4 |
Chr3_-_2175686 | 0.38 |
AT3G06880.1
AT3G06880.5 AT3G06880.4 AT3G06880.3 AT3G06880.2 |
AT3G06880
|
Transducin/WD40 repeat-like superfamily protein |
Chr5_+_17951442 | 0.38 |
AT5G44565.2
AT5G44565.1 AT5G44565.3 |
AT5G44565
|
transmembrane protein |
Chr3_-_18883033 | 0.38 |
AT3G50800.1
|
AT3G50800
|
hypothetical protein |
Chr1_+_27439240 | 0.38 |
AT1G72930.1
|
TIR
|
toll/interleukin-1 receptor-like protein |
Chr5_+_17864376 | 0.38 |
AT5G44350.1
|
AT5G44350
|
ethylene-responsive nuclear protein-like protein |
Chr4_-_9668507 | 0.38 |
AT4G17240.1
|
AT4G17240
|
structural maintenance of chromosomes protein |
Chr2_-_17992047 | 0.38 |
AT2G43290.1
|
MSS3
|
Calcium-binding EF-hand family protein |
Chr1_-_11147547 | 0.38 |
AT1G31200.1
|
PP2-A9
|
phloem protein 2-A9 |
Chr1_-_1940463 | 0.38 |
AT1G06360.1
AT1G06360.2 |
AT1G06360
|
Fatty acid desaturase family protein |
Chr1_+_22073352 | 0.38 |
AT1G59970.1
|
AT1G59970
|
Matrixin family protein |
Chr1_-_23469247 | 0.38 |
AT1G63260.4
AT1G63260.1 AT1G63260.2 AT1G63260.3 AT1G63260.5 AT1G63260.6 |
TET10
|
tetraspanin10 |
Chr1_+_7444749 | 0.38 |
AT1G21270.1
|
WAK2
|
wall-associated kinase 2 |
Chr1_+_27439452 | 0.38 |
AT1G72930.2
|
TIR
|
toll/interleukin-1 receptor-like protein |
Chr1_+_29178705 | 0.38 |
AT1G77640.1
|
AT1G77640
|
Integrase-type DNA-binding superfamily protein |
Chr1_-_18430497 | 0.38 |
AT1G49780.1
|
PUB26
|
plant U-box 26 |
Chr3_+_5249112 | 0.37 |
AT3G15518.1
|
AT3G15518
|
hypothetical protein |
Chr5_-_4743512 | 0.37 |
AT5G14700.2
AT5G14700.1 |
AT5G14700
|
NAD(P)-binding Rossmann-fold superfamily protein |
Chr3_-_8268961 | 0.37 |
AT3G23170.1
|
AT3G23170
|
hypothetical protein |
Chr4_-_14841067 | 0.37 |
AT4G30340.2
AT4G30340.1 |
DGK7
|
diacylglycerol kinase 7 |
Chr5_-_18518909 | 0.37 |
AT5G45650.2
AT5G45650.1 |
AT5G45650
|
subtilase family protein |
Chr2_-_19044955 | 0.37 |
AT2G46400.1
|
WRKY46
|
WRKY DNA-binding protein 46 |
Chr2_-_15797059 | 0.37 |
AT2G37660.1
|
AT2G37660
|
NAD(P)-binding Rossmann-fold superfamily protein |
Chr3_+_18046144 | 0.37 |
AT3G48720.1
|
DCF
|
HXXXD-type acyl-transferase family protein |
Chr3_+_20296130 | 0.37 |
AT3G54810.2
|
BME3
|
Plant-specific GATA-type zinc finger transcription factor family protein |
Chr4_-_1046993 | 0.37 |
AT4G02380.2
AT4G02380.1 AT4G02380.3 |
SAG21
|
senescence-associated gene 21 |
Chr4_+_11941001 | 0.37 |
AT4G22730.2
AT4G22730.1 |
AT4G22730
|
Leucine-rich repeat protein kinase family protein |
Chr4_+_16135157 | 0.37 |
AT4G33560.1
|
AT4G33560
|
Wound-responsive family protein |
Chr5_+_18945543 | 0.37 |
AT5G46690.2
AT5G46690.1 |
bHLH071
|
beta HLH protein 71 |
Chr1_-_28554810 | 0.37 |
AT1G76100.1
AT1G76100.2 |
PETE1
|
plastocyanin 1 |
Chr4_+_8294446 | 0.37 |
AT4G14400.2
AT4G14400.3 |
ACD6
|
ankyrin repeat family protein |
Chr5_-_22712441 | 0.37 |
AT5G56080.1
|
NAS2
|
nicotianamine synthase 2 |
Chr4_+_15819489 | 0.37 |
AT4G32800.1
|
AT4G32800
|
Integrase-type DNA-binding superfamily protein |
Chr3_+_20296416 | 0.37 |
AT3G54810.1
|
BME3
|
Plant-specific GATA-type zinc finger transcription factor family protein |
Chr4_-_17777445 | 0.37 |
AT4G37800.1
|
XTH7
|
xyloglucan endotransglucosylase/hydrolase 7 |
Chr2_+_1094702 | 0.36 |
AT2G03590.1
AT2G03590.2 |
UPS1
|
ureide permease 1 |
Chr5_-_12565780 | 0.36 |
AT5G33300.1
|
AT5G33300
|
chromosome-associated kinesin-like protein |
Chr4_+_9028262 | 0.36 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr2_-_14862178 | 0.36 |
AT2G35290.1
|
AT2G35290
|
hypothetical protein |
Chr3_+_16945433 | 0.36 |
AT3G46130.3
AT3G46130.4 |
MYB48
|
myb domain protein 48 |
Chr5_-_6240916 | 0.36 |
AT5G18700.1
|
AT5G18700
|
kinase family with ARM repeat domain-containing protein |
Chr3_+_10505711 | 0.36 |
AT3G28180.1
|
CSLC04
|
Cellulose-synthase-like C4 |
Chr5_-_19639529 | 0.36 |
AT5G48460.1
|
AT5G48460
|
Actin binding Calponin homology (CH) domain-containing protein |
Chr2_+_17582673 | 0.36 |
AT2G42190.2
AT2G42190.1 AT2G42190.3 |
AT2G42190
|
rho GTPase-activating gacO-like protein |
Chr4_+_14579563 | 0.36 |
AT4G29780.1
|
AT4G29780
|
nuclease |
Chr5_+_4206738 | 0.36 |
AT5G13200.2
AT5G13200.1 |
AT5G13200
|
GRAM domain family protein |
Chr1_-_6138500 | 0.36 |
AT1G17830.1
|
AT1G17830
|
hypothetical protein (DUF789) |
Chr2_+_11723398 | 0.36 |
AT2G27402.2
|
AT2G27402
|
plastid transcriptionally active protein |
Chr1_+_21707175 | 0.35 |
AT1G58420.1
|
AT1G58420
|
Uncharacterized conserved protein UCP031279 |
Chr5_+_22721373 | 0.35 |
AT5G56120.1
|
AT5G56120
|
RNA polymerase II elongation factor |
Chr2_-_8736577 | 0.35 |
AT2G20250.3
AT2G20250.1 AT2G20250.2 |
AT2G20250
|
hypothetical protein |
Chr4_+_1358267 | 0.35 |
AT4G03070.1
|
AOP1
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr1_+_27452748 | 0.35 |
AT1G72970.1
AT1G72970.2 |
HTH
|
Glucose-methanol-choline (GMC) oxidoreductase family protein |
Chr2_+_16108235 | 0.35 |
AT2G38470.1
|
WRKY33
|
WRKY DNA-binding protein 33 |
Chr5_+_16815310 | 0.35 |
AT5G42050.1
|
AT5G42050
|
DCD (Development and Cell Death) domain protein |
Chr1_-_27994178 | 0.35 |
AT1G74480.1
|
RKD2
|
RWP-RK domain-containing protein |
Chr3_+_21836579 | 0.35 |
AT3G59080.2
|
AT3G59080
|
Eukaryotic aspartyl protease family protein |
Chr3_-_18375784 | 0.35 |
AT3G49580.3
AT3G49580.2 |
LSU1
|
response to low sulfur 1 |
Chr5_+_4826141 | 0.35 |
AT5G14920.1
AT5G14920.2 |
AT5G14920
|
Gibberellin-regulated family protein |
Chr1_-_1043887 | 0.35 |
AT1G04040.1
|
AT1G04040
|
HAD superfamily, subfamily IIIB acid phosphatase |
Chr3_+_3967058 | 0.35 |
AT3G12510.1
|
AT3G12510
|
MADS-box family protein |
Chr1_-_19472582 | 0.34 |
AT1G52290.2
AT1G52290.1 |
PERK15
|
Protein kinase superfamily protein |
Chr3_+_7194771 | 0.34 |
AT3G20600.1
|
NDR1
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
Chr2_-_108803 | 0.34 |
AT2G01180.7
AT2G01180.2 AT2G01180.5 AT2G01180.1 AT2G01180.8 AT2G01180.4 AT2G01180.3 |
PAP1
|
phosphatidic acid phosphatase 1 |
Chr3_+_21836406 | 0.34 |
AT3G59080.1
|
AT3G59080
|
Eukaryotic aspartyl protease family protein |
Chr3_-_20813046 | 0.34 |
AT3G56080.2
AT3G56080.1 |
AT3G56080
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr5_-_740319 | 0.34 |
AT5G03140.1
|
AT5G03140
|
Concanavalin A-like lectin protein kinase family protein |
Chr3_+_3189918 | 0.34 |
AT3G10310.2
AT3G10310.1 |
AT3G10310
|
P-loop nucleoside triphosphate hydrolases superfamily protein with CH (Calponin Homology) domain-containing protein |
Chr1_+_24349399 | 0.34 |
AT1G65486.3
AT1G65486.4 AT1G65486.1 AT1G65486.2 |
AT1G65486
|
transmembrane protein |
Chr3_-_9492655 | 0.34 |
AT3G25920.1
|
RPL15
|
ribosomal protein L15 |
Chr4_-_2413447 | 0.34 |
AT4G04745.1
|
AT4G04745
|
hypothetical protein |
Chr2_+_12814271 | 0.34 |
AT2G30020.1
|
AT2G30020
|
Protein phosphatase 2C family protein |
Chr4_-_7883926 | 0.34 |
AT4G13560.2
AT4G13560.1 |
UNE15
|
Late embryogenesis abundant protein (LEA) family protein |
Chr2_-_151971 | 0.34 |
AT2G01300.1
|
AT2G01300
|
mediator of RNA polymerase II transcription subunit |
Chr4_-_11334168 | 0.34 |
AT4G21270.1
|
ATK1
|
kinesin 1 |
Chr2_+_10629662 | 0.33 |
AT2G25000.1
AT2G25000.2 AT2G25000.3 AT2G25000.4 |
WRKY60
|
WRKY DNA-binding protein 60 |
Chr5_-_5642623 | 0.33 |
AT5G17160.1
|
AT5G17160
|
aspartic/glutamic acid-rich protein |
Chr2_-_16908152 | 0.33 |
AT2G40475.1
|
ASG8
|
hypothetical protein |
Chr2_-_7496292 | 0.33 |
AT2G17230.1
|
EXL5
|
EXORDIUM like 5 |
Chr1_+_5638779 | 0.33 |
AT1G16500.1
|
AT1G16500
|
filamentous hemagglutinin transporter |
Chr5_+_6127773 | 0.33 |
AT5G18470.1
|
AT5G18470
|
Curculin-like (mannose-binding) lectin family protein |
Chr3_-_17976774 | 0.33 |
AT3G48520.1
|
CYP94B3
|
cytochrome P450, family 94, subfamily B, polypeptide 3 |
Chr5_-_16832357 | 0.33 |
AT5G42110.1
|
AT5G42110
|
hypothetical protein |
Chr5_-_20307943 | 0.33 |
AT5G49920.1
|
AT5G49920
|
Octicosapeptide/Phox/Bem1p family protein |
Chr4_+_14215473 | 0.33 |
AT4G28780.1
|
AT4G28780
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr5_-_23248865 | 0.33 |
AT5G57380.2
|
VIN3
|
Fibronectin type III domain-containing protein |
Chr5_-_23249504 | 0.33 |
AT5G57380.1
|
VIN3
|
Fibronectin type III domain-containing protein |
Chr3_+_3698658 | 0.33 |
AT3G11700.1
|
FLA18
|
FASCICLIN-like arabinogalactan protein 18 precursor |
Chr3_+_9306776 | 0.33 |
AT3G25600.1
|
AT3G25600
|
Calcium-binding EF-hand family protein |
Chr2_-_12702443 | 0.33 |
AT2G29720.1
|
CTF2B
|
FAD/NAD(P)-binding oxidoreductase family protein |
Chr1_-_23460884 | 0.33 |
AT1G63245.1
|
CLE14
|
CLAVATA3/ESR-RELATED 14 |
Chr1_-_12688543 | 0.33 |
AT1G34640.1
|
AT1G34640
|
peptidase |
Chr5_+_26236964 | 0.33 |
AT5G65640.1
AT5G65640.2 |
bHLH093
|
beta HLH protein 93 |
Chr4_+_460395 | 0.33 |
AT4G01060.3
AT4G01060.2 AT4G01060.1 |
CPL3
|
CAPRICE-like MYB3 |
Chr3_+_16945230 | 0.32 |
AT3G46130.2
AT3G46130.1 |
MYB48
|
myb domain protein 48 |
Chr4_-_846792 | 0.32 |
AT4G01950.1
AT4G01950.2 |
GPAT3
|
glycerol-3-phosphate acyltransferase 3 |
Chr4_+_14166094 | 0.32 |
AT4G28703.1
|
AT4G28703
|
RmlC-like cupins superfamily protein |
Chr1_-_3396953 | 0.32 |
AT1G10360.1
|
GSTU18
|
glutathione S-transferase TAU 18 |
Chr1_+_25558794 | 0.32 |
AT1G68190.2
AT1G68190.3 |
BBX27
|
B-box zinc finger family protein |
Chr1_+_29759030 | 0.32 |
AT1G79110.2
AT1G79110.3 AT1G79110.1 |
BRG2
|
zinc ion binding protein |
Chr2_+_11563933 | 0.32 |
AT2G27080.2
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
Chr1_-_25758411 | 0.32 |
AT1G68590.1
|
PSRP3/1
|
Ribosomal protein PSRP-3/Ycf65 |
Chr1_-_25758232 | 0.32 |
AT1G68590.2
|
PSRP3/1
|
Ribosomal protein PSRP-3/Ycf65 |
Chr3_+_7507240 | 0.32 |
AT3G21330.1
|
AT3G21330
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr5_-_17626487 | 0.32 |
AT5G43840.1
|
HSFA6A
|
heat shock transcription factor A6A |
Chr4_-_12400231 | 0.32 |
AT4G23820.1
|
AT4G23820
|
Pectin lyase-like superfamily protein |
Chr5_+_16151522 | 0.32 |
AT5G40380.1
|
CRK42
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 42 |
Chr3_-_21924412 | 0.32 |
AT3G59310.2
AT3G59310.3 AT3G59310.1 |
AT3G59310
|
solute carrier family 35 protein (DUF914) |
Chr1_+_16933699 | 0.32 |
AT1G44830.1
|
AT1G44830
|
Integrase-type DNA-binding superfamily protein |
Chr2_+_9089226 | 0.32 |
AT2G21220.1
|
AT2G21220
|
SAUR-like auxin-responsive protein family |
Chr5_+_5237970 | 0.32 |
AT5G16030.1
AT5G16030.4 AT5G16030.2 AT5G16030.3 |
AT5G16030
|
mental retardation GTPase activating protein |
Chr1_+_9740508 | 0.32 |
AT1G27950.1
|
LTPG1
|
glycosylphosphatidylinositol-anchored lipid protein transfer 1 |
Chr5_-_1293723 | 0.32 |
AT5G04530.1
|
KCS19
|
3-ketoacyl-CoA synthase 19 |
Chr1_-_20706893 | 0.32 |
AT1G55450.2
|
AT1G55450
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr3_-_21008064 | 0.32 |
AT3G56710.1
AT3G56710.2 |
SIB1
|
sigma factor binding protein 1 |
Chr1_-_20707071 | 0.32 |
AT1G55450.1
|
AT1G55450
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0071422 | thiosulfate transport(GO:0015709) succinate transmembrane transport(GO:0071422) |
0.3 | 0.9 | GO:1901031 | regulation of response to reactive oxygen species(GO:1901031) |
0.2 | 0.7 | GO:0019695 | choline metabolic process(GO:0019695) |
0.2 | 0.6 | GO:0036292 | DNA rewinding(GO:0036292) |
0.2 | 0.6 | GO:0050685 | positive regulation of mRNA processing(GO:0050685) |
0.2 | 1.0 | GO:0009647 | skotomorphogenesis(GO:0009647) |
0.2 | 1.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.2 | 0.7 | GO:0009831 | plant-type cell wall modification involved in multidimensional cell growth(GO:0009831) |
0.2 | 0.5 | GO:0010069 | zygote asymmetric cytokinesis in embryo sac(GO:0010069) |
0.2 | 1.1 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.2 | 0.6 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.2 | 0.8 | GO:0000084 | mitotic G1 phase(GO:0000080) mitotic S phase(GO:0000084) mitotic G2 phase(GO:0000085) G1 phase(GO:0051318) G2 phase(GO:0051319) S phase(GO:0051320) interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.1 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 0.4 | GO:0060967 | negative regulation of gene silencing by RNA(GO:0060967) negative regulation of RNA interference(GO:1900369) |
0.1 | 0.4 | GO:0080051 | cutin transport(GO:0080051) |
0.1 | 0.3 | GO:0031297 | replication fork processing(GO:0031297) |
0.1 | 0.8 | GO:0045038 | protein import into chloroplast thylakoid membrane(GO:0045038) |
0.1 | 0.9 | GO:0009772 | photosynthetic electron transport in photosystem II(GO:0009772) |
0.1 | 0.6 | GO:0051091 | positive regulation of sequence-specific DNA binding transcription factor activity(GO:0051091) |
0.1 | 0.7 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
0.1 | 1.1 | GO:0060866 | leaf abscission(GO:0060866) |
0.1 | 0.4 | GO:0071485 | cellular response to absence of light(GO:0071485) |
0.1 | 0.8 | GO:0010438 | cellular response to sulfur starvation(GO:0010438) |
0.1 | 0.5 | GO:0071312 | cellular response to alkaloid(GO:0071312) cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) negative regulation of cellular response to caffeine(GO:1901181) |
0.1 | 0.6 | GO:0009558 | embryo sac cellularization(GO:0009558) |
0.1 | 0.1 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) phragmoplast assembly(GO:0000914) assembly of actomyosin apparatus involved in mitotic cytokinesis(GO:1902407) |
0.1 | 0.2 | GO:0090342 | cell aging(GO:0007569) regulation of cell aging(GO:0090342) |
0.1 | 0.5 | GO:0006569 | tryptophan catabolic process(GO:0006569) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.6 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
0.1 | 1.9 | GO:0009768 | photosynthesis, light harvesting in photosystem I(GO:0009768) |
0.1 | 0.5 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
0.1 | 0.3 | GO:0046506 | sulfolipid metabolic process(GO:0046505) sulfolipid biosynthetic process(GO:0046506) |
0.1 | 0.3 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
0.1 | 0.3 | GO:0010376 | stomatal complex formation(GO:0010376) |
0.1 | 0.6 | GO:0080151 | positive regulation of salicylic acid mediated signaling pathway(GO:0080151) |
0.1 | 0.3 | GO:0015696 | ammonium transport(GO:0015696) |
0.1 | 0.4 | GO:0010495 | long-distance posttranscriptional gene silencing(GO:0010495) |
0.1 | 0.4 | GO:0015720 | allantoin transport(GO:0015720) |
0.1 | 0.4 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.5 | GO:0010450 | inflorescence meristem growth(GO:0010450) |
0.1 | 0.3 | GO:0060776 | simple leaf morphogenesis(GO:0060776) |
0.1 | 0.8 | GO:1902290 | positive regulation of defense response to oomycetes(GO:1902290) |
0.1 | 0.2 | GO:0051291 | protein heterooligomerization(GO:0051291) |
0.1 | 0.3 | GO:1901537 | positive regulation of DNA demethylation(GO:1901537) |
0.1 | 0.4 | GO:0071323 | cellular response to chitin(GO:0071323) |
0.1 | 0.3 | GO:0043157 | response to cation stress(GO:0043157) |
0.1 | 0.6 | GO:0046209 | nitric oxide metabolic process(GO:0046209) |
0.1 | 0.4 | GO:0034051 | negative regulation of plant-type hypersensitive response(GO:0034051) |
0.1 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.1 | 0.3 | GO:0035264 | multicellular organism growth(GO:0035264) |
0.1 | 0.3 | GO:0090549 | response to carbon starvation(GO:0090549) |
0.1 | 0.3 | GO:0043987 | histone-serine phosphorylation(GO:0035404) histone H3-S10 phosphorylation(GO:0043987) |
0.1 | 0.2 | GO:0002698 | negative regulation of immune effector process(GO:0002698) negative regulation of defense response to virus(GO:0050687) |
0.1 | 0.6 | GO:0009745 | sucrose mediated signaling(GO:0009745) |
0.1 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.6 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.1 | 0.3 | GO:0048480 | stigma development(GO:0048480) |
0.1 | 0.7 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.1 | 0.2 | GO:1904215 | regulation of protein import into chloroplast stroma(GO:1904215) |
0.1 | 0.4 | GO:0046713 | borate transport(GO:0046713) |
0.1 | 0.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.1 | 0.4 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 3.3 | GO:0006986 | response to unfolded protein(GO:0006986) |
0.1 | 0.1 | GO:0051101 | regulation of DNA binding(GO:0051101) |
0.1 | 0.1 | GO:2000029 | regulation of proanthocyanidin biosynthetic process(GO:2000029) |
0.1 | 0.5 | GO:1902584 | positive regulation of response to water deprivation(GO:1902584) |
0.1 | 0.1 | GO:0051447 | negative regulation of meiotic nuclear division(GO:0045835) negative regulation of meiotic cell cycle(GO:0051447) |
0.1 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 1.0 | GO:0010244 | response to low fluence blue light stimulus by blue low-fluence system(GO:0010244) |
0.1 | 1.2 | GO:0046501 | protoporphyrinogen IX biosynthetic process(GO:0006782) protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.3 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
0.1 | 0.3 | GO:0009759 | indole glucosinolate biosynthetic process(GO:0009759) |
0.1 | 0.3 | GO:0010226 | response to lithium ion(GO:0010226) |
0.1 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.3 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.1 | GO:0010343 | singlet oxygen-mediated programmed cell death(GO:0010343) |
0.1 | 0.9 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.3 | GO:0043618 | regulation of transcription from RNA polymerase II promoter in response to stress(GO:0043618) |
0.1 | 0.1 | GO:0034502 | protein localization to chromosome(GO:0034502) |
0.1 | 0.1 | GO:0043953 | protein transport by the Tat complex(GO:0043953) |
0.1 | 0.1 | GO:2000045 | regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
0.1 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.3 | GO:1901271 | lipid A biosynthetic process(GO:0009245) lipid A metabolic process(GO:0046493) lipooligosaccharide metabolic process(GO:1901269) lipooligosaccharide biosynthetic process(GO:1901271) |
0.1 | 0.2 | GO:0080175 | phragmoplast microtubule organization(GO:0080175) |
0.1 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.4 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) |
0.1 | 0.7 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.4 | GO:2000037 | regulation of stomatal complex patterning(GO:2000037) |
0.1 | 0.2 | GO:0071266 | L-methionine biosynthetic process from L-homoserine via cystathionine(GO:0019279) 'de novo' L-methionine biosynthetic process(GO:0071266) |
0.1 | 0.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.1 | GO:0050000 | chromosome localization(GO:0050000) |
0.1 | 0.2 | GO:0071258 | cellular response to gravity(GO:0071258) |
0.1 | 0.4 | GO:0010120 | camalexin biosynthetic process(GO:0010120) camalexin metabolic process(GO:0052317) |
0.1 | 0.3 | GO:0045730 | respiratory burst involved in defense response(GO:0002679) respiratory burst(GO:0045730) |
0.1 | 0.1 | GO:0044848 | cell cycle phase(GO:0022403) biological phase(GO:0044848) mitotic cell cycle phase(GO:0098763) |
0.1 | 0.1 | GO:0097468 | cell death in response to oxidative stress(GO:0036473) programmed cell death in response to reactive oxygen species(GO:0097468) |
0.1 | 0.2 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
0.1 | 0.1 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) uracil transport(GO:0015857) |
0.1 | 0.5 | GO:0006670 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.3 | GO:0010067 | procambium histogenesis(GO:0010067) |
0.1 | 0.2 | GO:0033321 | homomethionine metabolic process(GO:0033321) glucosinolate biosynthetic process from homomethionine(GO:0033506) |
0.1 | 0.9 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
0.1 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) regulation of methylation-dependent chromatin silencing(GO:0090308) positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.5 | GO:0010371 | regulation of gibberellin biosynthetic process(GO:0010371) |
0.1 | 0.2 | GO:0006666 | 3-keto-sphinganine metabolic process(GO:0006666) |
0.1 | 0.2 | GO:0010213 | non-photoreactive DNA repair(GO:0010213) |
0.1 | 0.4 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.1 | GO:0043479 | pigmentation(GO:0043473) pigment accumulation(GO:0043476) pigment accumulation in response to UV light(GO:0043478) pigment accumulation in tissues in response to UV light(GO:0043479) pigment accumulation in tissues(GO:0043480) anthocyanin accumulation in tissues in response to UV light(GO:0043481) |
0.1 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.9 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.3 | GO:0070212 | protein ADP-ribosylation(GO:0006471) protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 3.4 | GO:0007018 | microtubule-based movement(GO:0007018) |
0.1 | 0.3 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.1 | 0.2 | GO:0090227 | regulation of red or far-red light signaling pathway(GO:0090227) |
0.1 | 0.2 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.1 | 0.7 | GO:0032544 | plastid translation(GO:0032544) |
0.1 | 0.3 | GO:0009228 | thiamine biosynthetic process(GO:0009228) thiamine-containing compound biosynthetic process(GO:0042724) |
0.0 | 0.4 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.6 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.2 | GO:0008615 | pyridoxine biosynthetic process(GO:0008615) |
0.0 | 0.1 | GO:0043447 | alkane biosynthetic process(GO:0043447) |
0.0 | 0.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.3 | GO:2000601 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:0015904 | tetracycline transport(GO:0015904) antibiotic transport(GO:0042891) |
0.0 | 0.0 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.0 | 0.2 | GO:0042780 | tRNA 3'-trailer cleavage(GO:0042779) tRNA 3'-end processing(GO:0042780) |
0.0 | 0.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.4 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.4 | GO:0006168 | adenine salvage(GO:0006168) purine nucleobase salvage(GO:0043096) |
0.0 | 0.1 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.0 | 0.2 | GO:0055073 | cadmium ion homeostasis(GO:0055073) |
0.0 | 0.3 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.2 | GO:0032210 | regulation of telomere maintenance via telomerase(GO:0032210) regulation of telomere maintenance via telomere lengthening(GO:1904356) negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.2 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.0 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.2 | GO:0090506 | axillary shoot meristem initiation(GO:0090506) |
0.0 | 0.2 | GO:0010321 | regulation of vegetative phase change(GO:0010321) |
0.0 | 0.4 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 1.1 | GO:0009934 | regulation of meristem structural organization(GO:0009934) |
0.0 | 1.8 | GO:0009625 | response to insect(GO:0009625) |
0.0 | 0.1 | GO:0010184 | cytokinin transport(GO:0010184) |
0.0 | 0.7 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.3 | GO:0009090 | homoserine biosynthetic process(GO:0009090) |
0.0 | 0.4 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.2 | GO:0019860 | uracil metabolic process(GO:0019860) |
0.0 | 0.2 | GO:0015939 | pantothenate metabolic process(GO:0015939) pantothenate biosynthetic process(GO:0015940) |
0.0 | 0.2 | GO:2000736 | regulation of stem cell population maintenance(GO:2000036) regulation of stem cell differentiation(GO:2000736) |
0.0 | 0.4 | GO:0009961 | response to 1-aminocyclopropane-1-carboxylic acid(GO:0009961) |
0.0 | 0.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.0 | 0.2 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.3 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) actin filament capping(GO:0051693) |
0.0 | 0.2 | GO:0010358 | leaf shaping(GO:0010358) |
0.0 | 0.1 | GO:0009093 | cysteine catabolic process(GO:0009093) |
0.0 | 0.9 | GO:0009292 | genetic transfer(GO:0009292) DNA mediated transformation(GO:0009294) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.2 | GO:0070509 | calcium ion import(GO:0070509) |
0.0 | 0.4 | GO:0009942 | longitudinal axis specification(GO:0009942) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 1.4 | GO:0009816 | defense response to bacterium, incompatible interaction(GO:0009816) |
0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.3 | GO:0043410 | activation of protein kinase activity(GO:0032147) positive regulation of MAPK cascade(GO:0043410) |
0.0 | 0.1 | GO:0033258 | plastid DNA metabolic process(GO:0033258) plastid DNA replication(GO:0033259) |
0.0 | 0.3 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.0 | 0.2 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.0 | 0.3 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.5 | GO:0051784 | negative regulation of mitotic nuclear division(GO:0045839) negative regulation of nuclear division(GO:0051784) |
0.0 | 0.1 | GO:0007098 | centrosome cycle(GO:0007098) centriole replication(GO:0007099) centrosome organization(GO:0051297) centrosome duplication(GO:0051298) centriole assembly(GO:0098534) |
0.0 | 0.1 | GO:0009590 | detection of gravity(GO:0009590) |
0.0 | 0.1 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
0.0 | 1.0 | GO:0042335 | cuticle development(GO:0042335) |
0.0 | 0.1 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.6 | GO:1901259 | chloroplast rRNA processing(GO:1901259) |
0.0 | 0.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.1 | GO:0051204 | protein insertion into membrane from inner side(GO:0032978) protein insertion into mitochondrial membrane from inner side(GO:0032979) protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:0042539 | hypotonic salinity response(GO:0042539) |
0.0 | 0.1 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) protein localization to microtubule cytoskeleton(GO:0072698) |
0.0 | 0.1 | GO:0042547 | cell wall modification involved in multidimensional cell growth(GO:0042547) |
0.0 | 0.1 | GO:2001294 | fatty-acyl-CoA catabolic process(GO:0036115) malonyl-CoA catabolic process(GO:2001294) |
0.0 | 0.2 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.0 | 0.9 | GO:0008360 | regulation of cell shape(GO:0008360) |
0.0 | 0.3 | GO:0009799 | specification of symmetry(GO:0009799) |
0.0 | 0.1 | GO:0010289 | homogalacturonan biosynthetic process(GO:0010289) |
0.0 | 0.2 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
0.0 | 1.1 | GO:0060548 | negative regulation of cell death(GO:0060548) |
0.0 | 0.3 | GO:0009405 | pathogenesis(GO:0009405) |
0.0 | 0.1 | GO:0071836 | nectar secretion(GO:0071836) |
0.0 | 0.2 | GO:0051180 | vitamin transport(GO:0051180) |
0.0 | 0.1 | GO:1900363 | regulation of mRNA 3'-end processing(GO:0031440) regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.1 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.0 | 1.5 | GO:0015995 | chlorophyll biosynthetic process(GO:0015995) |
0.0 | 0.3 | GO:0009854 | oxidative photosynthetic carbon pathway(GO:0009854) |
0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.0 | 0.2 | GO:0033617 | respiratory chain complex IV assembly(GO:0008535) mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.4 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
0.0 | 0.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 1.7 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.4 | GO:0060261 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 0.1 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) |
0.0 | 0.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.1 | GO:0009865 | pollen tube adhesion(GO:0009865) cell-cell adhesion(GO:0098609) multi organism cell adhesion(GO:0098740) |
0.0 | 0.4 | GO:1903530 | regulation of secretion(GO:0051046) regulation of secretion by cell(GO:1903530) |
0.0 | 0.3 | GO:0010190 | cytochrome b6f complex assembly(GO:0010190) |
0.0 | 0.3 | GO:0010098 | suspensor development(GO:0010098) |
0.0 | 0.2 | GO:0010258 | NADH dehydrogenase complex (plastoquinone) assembly(GO:0010258) |
0.0 | 0.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 2.4 | GO:0009873 | ethylene-activated signaling pathway(GO:0009873) |
0.0 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0043132 | NAD transport(GO:0043132) |
0.0 | 0.4 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.0 | GO:1901002 | positive regulation of response to salt stress(GO:1901002) |
0.0 | 0.1 | GO:0051055 | negative regulation of lipid biosynthetic process(GO:0051055) |
0.0 | 0.7 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
0.0 | 0.1 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
0.0 | 0.4 | GO:0009870 | defense response signaling pathway, resistance gene-dependent(GO:0009870) |
0.0 | 0.3 | GO:0052541 | plant-type cell wall cellulose metabolic process(GO:0052541) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.0 | GO:0008614 | pyridoxine metabolic process(GO:0008614) |
0.0 | 0.1 | GO:0009304 | tRNA transcription(GO:0009304) |
0.0 | 0.2 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.5 | GO:0030148 | sphingolipid biosynthetic process(GO:0030148) |
0.0 | 0.1 | GO:0032956 | regulation of actin cytoskeleton organization(GO:0032956) |
0.0 | 0.1 | GO:0080094 | response to trehalose-6-phosphate(GO:0080094) |
0.0 | 0.8 | GO:0007166 | cell surface receptor signaling pathway(GO:0007166) |
0.0 | 0.1 | GO:0080088 | spermidine hydroxycinnamate conjugate biosynthetic process(GO:0080088) |
0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0015717 | triose phosphate transport(GO:0015717) triose phosphate transmembrane transport(GO:0035436) |
0.0 | 0.2 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.0 | 0.0 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.3 | GO:0010206 | photosystem II repair(GO:0010206) |
0.0 | 0.2 | GO:2000904 | regulation of starch metabolic process(GO:2000904) |
0.0 | 0.9 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:0005980 | glycogen catabolic process(GO:0005980) |
0.0 | 0.3 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.1 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) positive regulation of protein acetylation(GO:1901985) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.0 | 0.1 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.0 | 0.8 | GO:0030041 | actin filament polymerization(GO:0030041) |
0.0 | 0.1 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.1 | GO:0052542 | defense response by callose deposition(GO:0052542) |
0.0 | 0.2 | GO:0010199 | organ boundary specification between lateral organs and the meristem(GO:0010199) |
0.0 | 0.2 | GO:0010158 | abaxial cell fate specification(GO:0010158) |
0.0 | 0.3 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.0 | 0.1 | GO:0010229 | inflorescence development(GO:0010229) |
0.0 | 0.5 | GO:0009904 | chloroplast accumulation movement(GO:0009904) |
0.0 | 0.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.1 | GO:0071486 | cellular response to high light intensity(GO:0071486) |
0.0 | 0.3 | GO:0042814 | monopolar cell growth(GO:0042814) |
0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.0 | 0.3 | GO:0009684 | indoleacetic acid biosynthetic process(GO:0009684) |
0.0 | 0.3 | GO:0009089 | lysine biosynthetic process via diaminopimelate(GO:0009089) diaminopimelate metabolic process(GO:0046451) |
0.0 | 0.3 | GO:0048564 | photosystem I assembly(GO:0048564) |
0.0 | 0.1 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.4 | GO:0000919 | cell plate assembly(GO:0000919) |
0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.0 | GO:2000692 | negative regulation of seed maturation(GO:2000692) |
0.0 | 1.1 | GO:0045489 | pectin biosynthetic process(GO:0045489) |
0.0 | 0.1 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.0 | 0.0 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.1 | GO:0034629 | protein complex localization(GO:0031503) cellular protein complex localization(GO:0034629) |
0.0 | 0.3 | GO:0010332 | response to gamma radiation(GO:0010332) |
0.0 | 0.1 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.0 | 0.4 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) unsaturated fatty acid metabolic process(GO:0033559) |
0.0 | 0.1 | GO:0022898 | regulation of transmembrane transporter activity(GO:0022898) regulation of ion transmembrane transporter activity(GO:0032412) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0046102 | inosine catabolic process(GO:0006148) inosine metabolic process(GO:0046102) |
0.0 | 0.1 | GO:0046704 | CDP metabolic process(GO:0046704) CDP biosynthetic process(GO:0046705) |
0.0 | 0.1 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
0.0 | 0.1 | GO:0019567 | pentose biosynthetic process(GO:0019322) arabinose biosynthetic process(GO:0019567) |
0.0 | 0.3 | GO:0010047 | fruit dehiscence(GO:0010047) |
0.0 | 1.0 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.4 | GO:0010337 | regulation of salicylic acid metabolic process(GO:0010337) |
0.0 | 0.5 | GO:0043572 | chloroplast fission(GO:0010020) plastid fission(GO:0043572) |
0.0 | 0.0 | GO:0044843 | cell cycle G1/S phase transition(GO:0044843) |
0.0 | 0.1 | GO:1905182 | regulation of urease activity(GO:1905181) positive regulation of urease activity(GO:1905182) |
0.0 | 0.1 | GO:0035305 | negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
0.0 | 0.0 | GO:0071216 | cellular response to biotic stimulus(GO:0071216) |
0.0 | 0.1 | GO:1901001 | negative regulation of response to salt stress(GO:1901001) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.4 | GO:0009773 | photosynthetic electron transport in photosystem I(GO:0009773) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.0 | GO:0043489 | RNA stabilization(GO:0043489) |
0.0 | 0.0 | GO:0006571 | tyrosine biosynthetic process(GO:0006571) |
0.0 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0051202 | phytochromobilin biosynthetic process(GO:0010024) phytochromobilin metabolic process(GO:0051202) |
0.0 | 0.2 | GO:1990937 | xylan acetylation(GO:1990937) |
0.0 | 0.1 | GO:0007187 | G-protein coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger(GO:0007187) adenylate cyclase-modulating G-protein coupled receptor signaling pathway(GO:0007188) |
0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.3 | GO:0048497 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
0.0 | 0.2 | GO:0009704 | de-etiolation(GO:0009704) |
0.0 | 0.1 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.0 | 0.1 | GO:0009726 | detection of hormone stimulus(GO:0009720) detection of endogenous stimulus(GO:0009726) |
0.0 | 0.2 | GO:0034644 | cellular response to UV(GO:0034644) |
0.0 | 0.3 | GO:0009938 | negative regulation of gibberellic acid mediated signaling pathway(GO:0009938) |
0.0 | 0.7 | GO:0043067 | regulation of programmed cell death(GO:0043067) |
0.0 | 0.8 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.5 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.1 | GO:0019419 | sulfate reduction(GO:0019419) |
0.0 | 0.2 | GO:0000967 | rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.0 | 0.0 | GO:0010107 | potassium ion import(GO:0010107) potassium ion import across plasma membrane(GO:1990573) |
0.0 | 0.1 | GO:0051238 | sequestering of metal ion(GO:0051238) |
0.0 | 0.1 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.0 | 0.3 | GO:2000762 | regulation of phenylpropanoid metabolic process(GO:2000762) |
0.0 | 0.5 | GO:0009695 | jasmonic acid biosynthetic process(GO:0009695) |
0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 1.3 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
0.0 | 0.5 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
0.0 | 0.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.1 | GO:0071514 | regulation of gene expression by genetic imprinting(GO:0006349) genetic imprinting(GO:0071514) |
0.0 | 0.7 | GO:0009828 | plant-type cell wall loosening(GO:0009828) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.8 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.3 | GO:0048574 | long-day photoperiodism, flowering(GO:0048574) |
0.0 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) |
0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.0 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.5 | GO:0019758 | S-glycoside biosynthetic process(GO:0016144) glycosinolate biosynthetic process(GO:0019758) glucosinolate biosynthetic process(GO:0019761) |
0.0 | 0.2 | GO:0005987 | sucrose catabolic process(GO:0005987) |
0.0 | 0.0 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.0 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.0 | 0.7 | GO:0019684 | photosynthesis, light reaction(GO:0019684) |
0.0 | 0.1 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
0.0 | 0.0 | GO:0043433 | negative regulation of sequence-specific DNA binding transcription factor activity(GO:0043433) |
0.0 | 0.7 | GO:0009911 | positive regulation of flower development(GO:0009911) |
0.0 | 0.1 | GO:0015695 | organic cation transport(GO:0015695) |
0.0 | 0.1 | GO:0009202 | deoxyribonucleoside triphosphate metabolic process(GO:0009200) deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.2 | GO:0010088 | phloem development(GO:0010088) |
0.0 | 0.2 | GO:0009615 | response to virus(GO:0009615) |
0.0 | 0.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.0 | 0.1 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:0010440 | stomatal lineage progression(GO:0010440) |
0.0 | 0.5 | GO:0032506 | cytokinetic process(GO:0032506) mitotic cytokinetic process(GO:1902410) |
0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.1 | GO:1900457 | regulation of brassinosteroid mediated signaling pathway(GO:1900457) |
0.0 | 0.0 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.1 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.0 | 0.3 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.0 | 0.1 | GO:1990066 | nonphotochemical quenching(GO:0010196) energy quenching(GO:1990066) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.0 | 2.7 | GO:0046777 | protein autophosphorylation(GO:0046777) |
0.0 | 0.4 | GO:2000012 | regulation of auxin polar transport(GO:2000012) |
0.0 | 0.0 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) |
0.0 | 0.0 | GO:0048455 | stamen formation(GO:0048455) |
0.0 | 0.0 | GO:0051782 | negative regulation of cell division(GO:0051782) |
0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.1 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.1 | GO:0007155 | cell adhesion(GO:0007155) biological adhesion(GO:0022610) |
0.0 | 0.4 | GO:0009644 | response to high light intensity(GO:0009644) |
0.0 | 0.2 | GO:0071483 | cellular response to blue light(GO:0071483) |
0.0 | 0.1 | GO:0042793 | transcription from plastid promoter(GO:0042793) |
0.0 | 0.2 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.1 | GO:0080024 | indolebutyric acid metabolic process(GO:0080024) |
0.0 | 0.1 | GO:0009823 | cytokinin catabolic process(GO:0009823) hormone catabolic process(GO:0042447) |
0.0 | 0.2 | GO:1901348 | positive regulation of secondary cell wall biogenesis(GO:1901348) positive regulation of cell wall organization or biogenesis(GO:1903340) |
0.0 | 0.1 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.0 | 0.3 | GO:0015770 | sucrose transport(GO:0015770) |
0.0 | 0.1 | GO:0043693 | monoterpene biosynthetic process(GO:0043693) |
0.0 | 0.4 | GO:0045036 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
0.0 | 0.1 | GO:0010417 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
0.0 | 0.2 | GO:0009969 | xyloglucan biosynthetic process(GO:0009969) |
0.0 | 0.1 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.0 | GO:0009139 | UDP biosynthetic process(GO:0006225) nucleoside diphosphate biosynthetic process(GO:0009133) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) ribonucleoside diphosphate biosynthetic process(GO:0009188) pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) pyrimidine ribonucleoside diphosphate biosynthetic process(GO:0009194) UDP metabolic process(GO:0046048) |
0.0 | 0.2 | GO:0008361 | regulation of cell size(GO:0008361) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0000455 | enzyme-directed rRNA pseudouridine synthesis(GO:0000455) |
0.0 | 0.1 | GO:0006614 | cotranslational protein targeting to membrane(GO:0006613) SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.2 | GO:0044070 | regulation of anion transport(GO:0044070) |
0.0 | 0.1 | GO:2000306 | positive regulation of photomorphogenesis(GO:2000306) |
0.0 | 0.1 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
0.0 | 0.4 | GO:0051607 | defense response to virus(GO:0051607) |
0.0 | 0.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.0 | GO:0015802 | basic amino acid transport(GO:0015802) |
0.0 | 0.1 | GO:0060919 | auxin influx(GO:0060919) |
0.0 | 0.3 | GO:0010027 | thylakoid membrane organization(GO:0010027) |
0.0 | 0.1 | GO:0019745 | pentacyclic triterpenoid metabolic process(GO:0019742) pentacyclic triterpenoid biosynthetic process(GO:0019745) |
0.0 | 0.4 | GO:0043547 | positive regulation of GTPase activity(GO:0043547) |
0.0 | 0.0 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.0 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.0 | 0.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:0010351 | lithium ion transport(GO:0010351) |
0.0 | 0.1 | GO:0010929 | positive regulation of auxin mediated signaling pathway(GO:0010929) |
0.0 | 0.2 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 0.1 | GO:0010731 | protein glutathionylation(GO:0010731) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.6 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0005978 | glycogen biosynthetic process(GO:0005978) |
0.0 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.1 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.0 | 0.1 | GO:0080112 | seed growth(GO:0080112) regulation of seed growth(GO:0080113) |
0.0 | 2.6 | GO:0002376 | immune system process(GO:0002376) |
0.0 | 0.3 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.0 | 0.1 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.0 | 0.2 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
0.0 | 0.0 | GO:1900908 | regulation of ethylene biosynthetic process(GO:0010364) regulation of sulfur amino acid metabolic process(GO:0031335) regulation of olefin metabolic process(GO:1900908) regulation of olefin biosynthetic process(GO:1900911) |
0.0 | 0.0 | GO:0046786 | viral replication complex formation and maintenance(GO:0046786) |
0.0 | 0.0 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.0 | 0.1 | GO:0042374 | phylloquinone biosynthetic process(GO:0042372) phylloquinone metabolic process(GO:0042374) |
0.0 | 0.1 | GO:0009554 | megasporogenesis(GO:0009554) |
0.0 | 0.2 | GO:2000034 | regulation of seed maturation(GO:2000034) |
0.0 | 0.0 | GO:0009102 | biotin metabolic process(GO:0006768) biotin biosynthetic process(GO:0009102) |
0.0 | 0.0 | GO:0099636 | cytoplasmic streaming(GO:0099636) |
0.0 | 0.1 | GO:0007142 | male meiosis II(GO:0007142) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.1 | GO:0043266 | regulation of potassium ion transport(GO:0043266) |
0.0 | 0.0 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) malonyl-CoA biosynthetic process(GO:2001295) |
0.0 | 0.2 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.2 | GO:1900864 | mitochondrial mRNA modification(GO:0080156) mitochondrial RNA modification(GO:1900864) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.4 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.1 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.0 | 0.0 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
0.0 | 0.1 | GO:0080060 | integument development(GO:0080060) |
0.0 | 0.1 | GO:0032351 | negative regulation of hormone metabolic process(GO:0032351) negative regulation of auxin metabolic process(GO:0090356) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.3 | GO:0033281 | TAT protein transport complex(GO:0033281) |
0.2 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.4 | GO:0043235 | receptor complex(GO:0043235) |
0.1 | 0.6 | GO:0010007 | magnesium chelatase complex(GO:0010007) |
0.1 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 0.4 | GO:0097196 | Shu complex(GO:0097196) |
0.1 | 0.5 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.6 | GO:0034425 | etioplast envelope(GO:0034425) etioplast membrane(GO:0034426) |
0.1 | 0.7 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.4 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 0.8 | GO:0009538 | photosystem I reaction center(GO:0009538) |
0.1 | 0.6 | GO:0000311 | plastid large ribosomal subunit(GO:0000311) |
0.1 | 0.9 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.1 | 0.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.8 | GO:0009522 | photosystem I(GO:0009522) |
0.1 | 0.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.3 | GO:1990298 | bub1-bub3 complex(GO:1990298) |
0.1 | 0.3 | GO:0070505 | pollen coat(GO:0070505) |
0.1 | 3.5 | GO:0009543 | chloroplast thylakoid lumen(GO:0009543) plastid thylakoid lumen(GO:0031978) |
0.1 | 1.1 | GO:0098807 | chloroplast thylakoid membrane protein complex(GO:0098807) |
0.1 | 1.8 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.2 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.1 | 0.6 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
0.1 | 0.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.1 | 0.8 | GO:0009523 | photosystem II(GO:0009523) |
0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.3 | GO:0030141 | secretory granule(GO:0030141) |
0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.9 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.1 | 0.3 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.3 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.2 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.3 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) nuclear RNA-directed RNA polymerase complex(GO:0031380) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.3 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.0 | 0.3 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.7 | GO:0072686 | mitotic spindle(GO:0072686) |
0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.0 | 0.1 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.8 | GO:0009508 | plastid chromosome(GO:0009508) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.2 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.0 | 0.5 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.7 | GO:0000792 | heterochromatin(GO:0000792) |
0.0 | 0.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0005814 | centrosome(GO:0005813) centriole(GO:0005814) |
0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.6 | GO:0010319 | stromule(GO:0010319) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.1 | GO:0000839 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.0 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.8 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.0 | 1.7 | GO:0010287 | plastoglobule(GO:0010287) |
0.0 | 0.1 | GO:0031897 | Tic complex(GO:0031897) |
0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 4.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.3 | GO:0000312 | plastid small ribosomal subunit(GO:0000312) |
0.0 | 0.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 2.8 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.3 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.0 | 0.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.3 | GO:0010168 | ER body(GO:0010168) |
0.0 | 0.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.7 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
0.0 | 0.5 | GO:0000418 | DNA-directed RNA polymerase IV complex(GO:0000418) |
0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.4 | GO:0010598 | NAD(P)H dehydrogenase complex (plastoquinone)(GO:0010598) |
0.0 | 0.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.3 | GO:0005880 | nuclear microtubule(GO:0005880) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.3 | GO:0048500 | signal recognition particle(GO:0048500) |
0.0 | 0.0 | GO:0035371 | microtubule plus-end(GO:0035371) spindle midzone(GO:0051233) |
0.0 | 0.0 | GO:0031352 | intrinsic component of plastid inner membrane(GO:0031352) integral component of plastid inner membrane(GO:0031353) intrinsic component of chloroplast inner membrane(GO:0031356) integral component of chloroplast inner membrane(GO:0031357) |
0.0 | 0.8 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.3 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.2 | GO:0030118 | clathrin coat(GO:0030118) |
0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.3 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 1.9 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:0009569 | chloroplast starch grain(GO:0009569) starch grain(GO:0043036) |
0.0 | 1.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 7.1 | GO:0009579 | thylakoid(GO:0009579) |
0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) DNA packaging complex(GO:0044815) |
0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.3 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0090397 | stigma papilla(GO:0090397) |
0.0 | 0.9 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
0.0 | 0.5 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 1.9 | GO:0044216 | host(GO:0018995) host cell part(GO:0033643) host intracellular part(GO:0033646) host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) host cell nucleus(GO:0042025) intracellular region of host(GO:0043656) host cell(GO:0043657) other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 0.2 | GO:0042644 | chloroplast nucleoid(GO:0042644) |
0.0 | 2.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.2 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) INO80-type complex(GO:0097346) |
0.0 | 0.0 | GO:0090395 | plant cell papilla(GO:0090395) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.0 | GO:0032153 | cell division site(GO:0032153) |
0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) BLOC-1 complex(GO:0031083) |
0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.2 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 0.1 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.0 | 1.2 | GO:0015630 | microtubule cytoskeleton(GO:0015630) |
0.0 | 1.8 | GO:0098791 | Golgi subcompartment(GO:0098791) |
0.0 | 0.5 | GO:0044440 | endosomal part(GO:0044440) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.6 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 2.2 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.0 | 0.1 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.0 | 0.0 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) |
0.3 | 1.0 | GO:0016630 | protochlorophyllide reductase activity(GO:0016630) |
0.2 | 0.6 | GO:0004071 | aspartate-ammonia ligase activity(GO:0004071) |
0.2 | 0.6 | GO:0000234 | phosphoethanolamine N-methyltransferase activity(GO:0000234) |
0.2 | 0.7 | GO:0015603 | iron chelate transmembrane transporter activity(GO:0015603) iron-nicotianamine transmembrane transporter activity(GO:0051980) |
0.1 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.6 | GO:0004512 | inositol-3-phosphate synthase activity(GO:0004512) |
0.1 | 0.4 | GO:0008883 | glutamyl-tRNA reductase activity(GO:0008883) |
0.1 | 0.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.6 | GO:0031956 | medium-chain fatty acid-CoA ligase activity(GO:0031956) |
0.1 | 0.5 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.6 | GO:0051003 | magnesium chelatase activity(GO:0016851) ligase activity, forming nitrogen-metal bonds(GO:0051002) ligase activity, forming nitrogen-metal bonds, forming coordination complexes(GO:0051003) |
0.1 | 0.3 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.1 | 0.4 | GO:0047782 | coniferin beta-glucosidase activity(GO:0047782) |
0.1 | 0.3 | GO:0008481 | sphinganine kinase activity(GO:0008481) |
0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) wide pore channel activity(GO:0022829) |
0.1 | 2.2 | GO:0102337 | 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0004057 | arginyltransferase activity(GO:0004057) |
0.1 | 0.5 | GO:0004473 | malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.4 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol-1,3,4,5-tetrakisphosphate 5-phosphatase activity(GO:0052659) inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 0.5 | GO:0050734 | hydroxycinnamoyltransferase activity(GO:0050734) |
0.1 | 0.3 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.1 | 0.3 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 0.4 | GO:0010277 | chlorophyllide a oxygenase [overall] activity(GO:0010277) |
0.1 | 2.2 | GO:0016168 | chlorophyll binding(GO:0016168) |
0.1 | 0.3 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
0.1 | 0.4 | GO:0005366 | myo-inositol:proton symporter activity(GO:0005366) |
0.1 | 0.2 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
0.1 | 0.5 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
0.1 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.5 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
0.1 | 0.4 | GO:0046715 | borate transmembrane transporter activity(GO:0046715) borate efflux transmembrane transporter activity(GO:0080139) |
0.1 | 0.5 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.1 | 0.1 | GO:0031409 | pigment binding(GO:0031409) |
0.1 | 0.2 | GO:0080132 | fatty acid alpha-hydroxylase activity(GO:0080132) |
0.1 | 0.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
0.1 | 0.3 | GO:0004350 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.1 | 0.3 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
0.1 | 0.2 | GO:0045437 | uridine nucleosidase activity(GO:0045437) ribosylpyrimidine nucleosidase activity(GO:0050263) |
0.1 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.6 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.2 | GO:0030941 | chloroplast targeting sequence binding(GO:0030941) |
0.1 | 0.2 | GO:1901618 | organic hydroxy compound transmembrane transporter activity(GO:1901618) |
0.1 | 0.2 | GO:0052635 | C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.1 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.1 | 0.4 | GO:0005274 | allantoin uptake transmembrane transporter activity(GO:0005274) uracil:cation symporter activity(GO:0015505) uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.2 | GO:0003864 | 3-methyl-2-oxobutanoate hydroxymethyltransferase activity(GO:0003864) |
0.1 | 0.1 | GO:0008835 | diaminohydroxyphosphoribosylaminopyrimidine deaminase activity(GO:0008835) |
0.1 | 0.2 | GO:0046524 | sucrose-phosphate synthase activity(GO:0046524) |
0.1 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.3 | GO:0046593 | mandelonitrile lyase activity(GO:0046593) |
0.1 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.7 | GO:0047259 | glucomannan 4-beta-mannosyltransferase activity(GO:0047259) |
0.1 | 0.7 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.8 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 0.2 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.1 | 0.2 | GO:0051669 | levanase activity(GO:0031219) fructan beta-fructosidase activity(GO:0051669) |
0.1 | 3.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 0.5 | GO:0003999 | adenine phosphoribosyltransferase activity(GO:0003999) |
0.1 | 0.4 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.1 | 0.2 | GO:0047804 | cysteine-S-conjugate beta-lyase activity(GO:0047804) |
0.1 | 0.8 | GO:0002020 | protease binding(GO:0002020) |
0.1 | 0.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.2 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
0.1 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.1 | GO:0015210 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) uracil transmembrane transporter activity(GO:0015210) |
0.1 | 0.2 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
0.1 | 0.3 | GO:0010179 | IAA-Ala conjugate hydrolase activity(GO:0010179) |
0.1 | 0.3 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
0.1 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.2 | GO:0010296 | prenylcysteine methylesterase activity(GO:0010296) |
0.1 | 0.2 | GO:0047912 | galacturonokinase activity(GO:0047912) |
0.1 | 0.3 | GO:0004072 | aspartate kinase activity(GO:0004072) |
0.1 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.4 | GO:0003830 | beta-1,4-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0003830) |
0.1 | 0.2 | GO:0047560 | 3-dehydrosphinganine reductase activity(GO:0047560) |
0.1 | 0.4 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.1 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.2 | GO:1990518 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) single-stranded DNA-dependent ATP-dependent 3'-5' DNA helicase activity(GO:1990518) |
0.1 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.1 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.4 | GO:0016247 | channel regulator activity(GO:0016247) |
0.1 | 0.2 | GO:0010242 | oxygen evolving activity(GO:0010242) |
0.1 | 0.2 | GO:0035516 | oxidative DNA demethylase activity(GO:0035516) |
0.1 | 0.4 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
0.1 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 2.3 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 0.2 | GO:0010285 | L,L-diaminopimelate aminotransferase activity(GO:0010285) |
0.0 | 0.1 | GO:0001016 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 3 promoter sequence-specific DNA binding(GO:0001006) RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
0.0 | 0.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.0 | 0.3 | GO:0051018 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
0.0 | 0.2 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.6 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
0.0 | 0.2 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
0.0 | 0.4 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
0.0 | 1.8 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.0 | 0.4 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) |
0.0 | 0.3 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.0 | 0.2 | GO:0030267 | glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.1 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.0 | 0.9 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.7 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.3 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.3 | GO:0045156 | electron transporter, transferring electrons within the cyclic electron transport pathway of photosynthesis activity(GO:0045156) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.2 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 1.2 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
0.0 | 0.7 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
0.0 | 4.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.0 | 0.4 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
0.0 | 0.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0004042 | acetyl-CoA:L-glutamate N-acetyltransferase activity(GO:0004042) |
0.0 | 0.2 | GO:0046423 | allene-oxide cyclase activity(GO:0046423) |
0.0 | 0.4 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.6 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.3 | GO:0016794 | guanosine-3',5'-bis(diphosphate) 3'-diphosphatase activity(GO:0008893) diphosphoric monoester hydrolase activity(GO:0016794) |
0.0 | 0.3 | GO:0004834 | tryptophan synthase activity(GO:0004834) |
0.0 | 0.1 | GO:0080104 | 3-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080102) 5-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080104) 7-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080106) |
0.0 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.4 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.3 | GO:0010428 | methyl-CpNpG binding(GO:0010428) methyl-CpNpN binding(GO:0010429) |
0.0 | 0.1 | GO:0010291 | carotene beta-ring hydroxylase activity(GO:0010291) |
0.0 | 0.3 | GO:0008878 | glucose-1-phosphate adenylyltransferase activity(GO:0008878) |
0.0 | 0.2 | GO:1902388 | ceramide transporter activity(GO:0035620) sphingolipid transporter activity(GO:0046624) ceramide 1-phosphate binding(GO:1902387) ceramide 1-phosphate transporter activity(GO:1902388) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.2 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.2 | GO:0052854 | very-long-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052852) long-chain-(S)-2-hydroxy-long-chain-acid oxidase activity(GO:0052853) medium-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052854) |
0.0 | 0.2 | GO:0004325 | ferrochelatase activity(GO:0004325) |
0.0 | 0.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0008963 | phospho-N-acetylmuramoyl-pentapeptide-transferase activity(GO:0008963) |
0.0 | 0.1 | GO:0052628 | 4-aminobenzoate amino acid synthetase activity(GO:0052625) benzoate amino acid synthetase activity(GO:0052626) vanillate amino acid synthetase activity(GO:0052627) 4-hydroxybenzoate amino acid synthetase activity(GO:0052628) |
0.0 | 0.4 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0001664 | G-protein coupled receptor binding(GO:0001664) G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.3 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.5 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.0 | 0.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 1.9 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.3 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
0.0 | 0.1 | GO:0052901 | spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 1.5 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.1 | GO:0042577 | sphingosine-1-phosphate phosphatase activity(GO:0042392) lipid phosphatase activity(GO:0042577) |
0.0 | 0.3 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.1 | GO:0070138 | ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.0 | 0.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) |
0.0 | 0.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.1 | GO:0000170 | sphingosine hydroxylase activity(GO:0000170) |
0.0 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.3 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.2 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.1 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.6 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.2 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.0 | 0.1 | GO:0004788 | thiamine diphosphokinase activity(GO:0004788) thiamine binding(GO:0030975) |
0.0 | 0.3 | GO:0016847 | 1-aminocyclopropane-1-carboxylate synthase activity(GO:0016847) |
0.0 | 0.1 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
0.0 | 0.3 | GO:0000210 | NAD+ diphosphatase activity(GO:0000210) |
0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.2 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.1 | GO:0046577 | long-chain-alcohol oxidase activity(GO:0046577) |
0.0 | 0.3 | GO:0033926 | glycopeptide alpha-N-acetylgalactosaminidase activity(GO:0033926) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.5 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 1.6 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.2 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.5 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.7 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
0.0 | 0.2 | GO:0010328 | auxin influx transmembrane transporter activity(GO:0010328) |
0.0 | 0.0 | GO:0004134 | 4-alpha-glucanotransferase activity(GO:0004134) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.7 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.0 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 2.6 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 0.3 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.2 | GO:0034647 | histone demethylase activity (H3-K4 specific)(GO:0032453) histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.0 | 0.1 | GO:0042895 | tetracycline transporter activity(GO:0008493) toxin transporter activity(GO:0019534) antibiotic transporter activity(GO:0042895) |
0.0 | 4.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 1.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.1 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 3.1 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.2 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.9 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0004640 | phosphoribosylanthranilate isomerase activity(GO:0004640) |
0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.0 | 0.2 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.2 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.1 | GO:0070818 | oxygen-dependent protoporphyrinogen oxidase activity(GO:0004729) protoporphyrinogen oxidase activity(GO:0070818) |
0.0 | 0.1 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.0 | 0.1 | GO:0004133 | glycogen debranching enzyme activity(GO:0004133) |
0.0 | 0.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.1 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) |
0.0 | 0.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0033843 | xyloglucan 6-xylosyltransferase activity(GO:0033843) |
0.0 | 0.2 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.1 | GO:0004333 | fumarate hydratase activity(GO:0004333) |
0.0 | 0.1 | GO:0015136 | sialic acid transmembrane transporter activity(GO:0015136) |
0.0 | 0.0 | GO:0004150 | dihydroneopterin aldolase activity(GO:0004150) |
0.0 | 0.2 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.1 | GO:0005354 | galactose transmembrane transporter activity(GO:0005354) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0080122 | AMP transmembrane transporter activity(GO:0080122) |
0.0 | 0.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.3 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) mannan synthase activity(GO:0051753) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.1 | GO:0019139 | cytokinin dehydrogenase activity(GO:0019139) |
0.0 | 0.3 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.5 | GO:0033612 | receptor serine/threonine kinase binding(GO:0033612) |
0.0 | 0.1 | GO:0030527 | structural constituent of chromatin(GO:0030527) |
0.0 | 0.1 | GO:0098599 | palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.0 | 0.0 | GO:0010354 | homogentisate prenyltransferase activity(GO:0010354) |
0.0 | 0.1 | GO:0015367 | oxoglutarate:malate antiporter activity(GO:0015367) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.0 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.3 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.0 | 0.2 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.1 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 1.7 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.1 | GO:0004845 | uracil phosphoribosyltransferase activity(GO:0004845) |
0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.1 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
0.0 | 0.0 | GO:0050997 | phosphatidylcholine binding(GO:0031210) quaternary ammonium group binding(GO:0050997) |
0.0 | 0.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0080097 | L-tryptophan:pyruvate aminotransferase activity(GO:0080097) |
0.0 | 0.0 | GO:0003838 | sterol 24-C-methyltransferase activity(GO:0003838) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 0.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.1 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.4 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.3 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.0 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.0 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.0 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.1 | 0.3 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.1 | 0.3 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.1 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.3 | REACTOME INNATE IMMUNE SYSTEM | Genes involved in Innate Immune System |
0.0 | 0.9 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.5 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.0 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.0 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.0 | 0.1 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.1 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 0.1 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.0 | 0.1 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.0 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.1 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.1 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.1 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.1 | REACTOME MEIOSIS | Genes involved in Meiosis |
0.0 | 0.0 | REACTOME TRANSLATION | Genes involved in Translation |