GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT5G62000
|
AT5G62000 | auxin response factor 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
ARF2 | arTal_v1_Chr5_+_24910191_24910358 | 0.37 | 1.9e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr2_-_17712290 | 4.71 |
AT2G42540.2
AT2G42540.4 AT2G42540.1 AT2G42540.3 |
COR15A
|
cold-regulated 15a |
Chr5_-_21992812 | 2.73 |
AT5G54190.2
AT5G54190.1 |
PORA
|
protochlorophyllide oxidoreductase A |
Chr5_+_21240717 | 2.67 |
AT5G52310.1
|
LTI78
|
low-temperature-responsive protein 78 (LTI78) / desiccation-responsive protein 29A (RD29A) |
Chr4_-_7406994 | 2.55 |
AT4G12480.1
|
EARLI1
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr1_-_9275193 | 2.50 |
AT1G26790.1
|
AT1G26790
|
Dof-type zinc finger DNA-binding family protein |
Chr2_+_1966806 | 2.16 |
AT2G05380.1
AT2G05380.2 |
GRP3S
|
glycine-rich protein 3 short isoform |
Chr3_-_489467 | 2.14 |
AT3G02380.1
|
COL2
|
CONSTANS-like 2 |
Chr2_+_1966610 | 2.13 |
AT2G05380.3
|
GRP3S
|
glycine-rich protein 3 short isoform |
Chr1_-_4651549 | 1.91 |
AT1G13600.1
|
bZIP58
|
basic leucine-zipper 58 |
Chr5_-_14753088 | 1.89 |
AT5G37260.1
|
RVE2
|
Homeodomain-like superfamily protein |
Chr3_+_4104463 | 1.86 |
AT3G12900.1
|
AT3G12900
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr2_-_19370478 | 1.84 |
AT2G47180.1
|
GolS1
|
galactinol synthase 1 |
Chr3_-_2569700 | 1.83 |
AT3G08040.2
AT3G08040.1 |
FRD3
|
MATE efflux family protein |
Chr4_+_8827600 | 1.82 |
AT4G15430.2
AT4G15430.1 |
AT4G15430
|
ERD (early-responsive to dehydration stress) family protein |
Chr5_+_8541713 | 1.81 |
AT5G24860.3
AT5G24860.1 |
FPF1
|
flowering promoting factor 1 |
Chr4_+_8804070 | 1.77 |
AT4G15393.2
AT4G15393.3 AT4G15393.1 |
CYP702A5
|
cytochrome P450, family 702, subfamily A, polypeptide 5 |
Chr2_+_9126263 | 1.77 |
AT2G21320.1
|
BBX18
|
B-box zinc finger family protein |
Chr5_-_19648362 | 1.72 |
AT5G48490.1
|
AT5G48490
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr4_+_9028262 | 1.71 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr2_+_16079679 | 1.70 |
AT2G38390.1
|
AT2G38390
|
Peroxidase superfamily protein |
Chr1_+_27778984 | 1.65 |
AT1G73870.1
|
BBX16
|
B-box type zinc finger protein with CCT domain-containing protein |
Chr3_+_17427950 | 1.63 |
AT3G47295.1
|
AT3G47295
|
hypothetical protein |
Chr3_-_18718396 | 1.61 |
AT3G50440.1
|
MES10
|
methylesterase |
Chr1_-_26163715 | 1.60 |
AT1G69570.1
|
AT1G69570
|
Dof-type zinc finger DNA-binding family protein |
Chr3_-_2699257 | 1.59 |
AT3G08860.2
|
PYD4
|
PYRIMIDINE 4 |
Chr2_+_2026162 | 1.57 |
AT2G05520.4
AT2G05520.5 AT2G05520.6 AT2G05520.3 |
GRP-3
|
glycine-rich protein 3 |
Chr3_-_2699420 | 1.56 |
AT3G08860.1
|
PYD4
|
PYRIMIDINE 4 |
Chr3_+_4729399 | 1.54 |
AT3G14210.1
AT3G14210.2 |
ESM1
|
GDSL-like lipase/acylhydrolase superfamily protein |
Chr2_+_13381767 | 1.53 |
AT2G31380.1
|
STH
|
salt tolerance homologue |
Chr1_-_12224000 | 1.51 |
AT1G33720.5
AT1G33720.1 AT1G33720.3 AT1G33720.2 AT1G33720.4 |
CYP76C6
|
cytochrome P450, family 76, subfamily C, polypeptide 6 |
Chr1_-_3481041 | 1.51 |
AT1G10550.1
|
XTH33
|
xyloglucan:xyloglucosyl transferase 33 |
Chr1_+_10477885 | 1.50 |
AT1G29930.1
|
CAB1
|
chlorophyll A/B binding protein 1 |
Chr1_-_23246949 | 1.49 |
AT1G62770.1
|
AT1G62770
|
Plant invertase/pectin methylesterase inhibitor superfamily protein |
Chr4_+_11854809 | 1.49 |
AT4G22513.1
|
AT4G22513
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr4_-_407142 | 1.49 |
AT4G00950.1
|
MEE47
|
hypothetical protein (DUF688) |
Chr1_-_29459493 | 1.49 |
AT1G78290.2
AT1G78290.3 |
SNRK2-8
|
Protein kinase superfamily protein |
Chr2_+_2025991 | 1.47 |
AT2G05520.2
AT2G05520.1 |
GRP-3
|
glycine-rich protein 3 |
Chr1_-_18238497 | 1.46 |
AT1G49310.1
|
AT1G49310
|
transmembrane protein |
Chr4_+_15451988 | 1.45 |
AT4G31940.1
|
CYP82C4
|
cytochrome P450, family 82, subfamily C, polypeptide 4 |
Chr1_-_22280593 | 1.45 |
AT1G60470.1
|
GolS4
|
galactinol synthase 4 |
Chr3_+_22635803 | 1.44 |
AT3G61160.3
AT3G61160.6 AT3G61160.5 AT3G61160.4 AT3G61160.2 AT3G61160.1 |
AT3G61160
|
Protein kinase superfamily protein |
Chr1_-_20804574 | 1.44 |
AT1G55675.1
|
AT1G55675
|
transmembrane protein |
Chr1_+_209208 | 1.43 |
AT1G01580.1
|
FRO2
|
ferric reduction oxidase 2 |
Chr1_+_208995 | 1.42 |
AT1G01580.2
|
FRO2
|
ferric reduction oxidase 2 |
Chr2_-_12415661 | 1.41 |
AT2G28900.1
|
OEP16-1
|
outer plastid envelope protein 16-1 |
Chr2_-_6493512 | 1.38 |
AT2G15020.1
|
AT2G15020
|
hypothetical protein |
Chr1_+_27241696 | 1.37 |
AT1G72360.2
AT1G72360.3 AT1G72360.1 |
ERF73
|
Integrase-type DNA-binding superfamily protein |
Chr4_+_13725546 | 1.37 |
AT4G27440.2
AT4G27440.1 |
PORB
|
protochlorophyllide oxidoreductase B |
Chr4_+_9865103 | 1.36 |
AT4G17730.2
AT4G17730.1 |
SYP23
|
syntaxin of plants 23 |
Chr2_-_827994 | 1.35 |
AT2G02850.1
|
ARPN
|
plantacyanin |
Chr3_-_21650347 | 1.32 |
AT3G58550.1
|
AT3G58550
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr4_+_10103866 | 1.29 |
AT4G18280.1
|
AT4G18280
|
glycine-rich cell wall protein-like protein |
Chr5_+_17526660 | 1.29 |
AT5G43630.2
AT5G43630.1 AT5G43630.3 AT5G43630.4 |
TZP
|
zinc knuckle (CCHC-type) family protein |
Chr2_+_5074384 | 1.29 |
AT2G12490.1
|
AT2G12490
|
|
Chr5_-_22991530 | 1.28 |
AT5G56860.1
|
GNC
|
GATA type zinc finger transcription factor family protein |
Chr4_+_994726 | 1.27 |
AT4G02280.1
|
SUS3
|
sucrose synthase 3 |
Chr5_-_18193328 | 1.27 |
AT5G45080.1
|
PP2-A6
|
phloem protein 2-A6 |
Chr5_+_17951442 | 1.27 |
AT5G44565.2
AT5G44565.1 AT5G44565.3 |
AT5G44565
|
transmembrane protein |
Chr1_-_30142697 | 1.25 |
AT1G80130.1
|
AT1G80130
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr5_+_451406 | 1.25 |
AT5G02240.1
|
AT5G02240
|
NAD(P)-binding Rossmann-fold superfamily protein |
Chr1_+_28498821 | 1.25 |
AT1G75900.1
|
AT1G75900
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr3_-_4974521 | 1.23 |
AT3G14810.1
AT3G14810.2 |
MSL5
|
mechanosensitive channel of small conductance-like 5 |
Chr1_+_29354944 | 1.21 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr1_-_8189220 | 1.21 |
AT1G23090.4
AT1G23090.1 AT1G23090.3 AT1G23090.2 |
AST91
|
sulfate transporter 91 |
Chr5_+_17973775 | 1.21 |
AT5G44575.1
|
AT5G44575
|
hypothetical protein |
Chr2_-_18082776 | 1.20 |
AT2G43590.1
|
AT2G43590
|
Chitinase family protein |
Chr1_+_21868190 | 1.20 |
AT1G59530.1
|
bZIP4
|
basic leucine-zipper 4 |
Chr1_-_4243201 | 1.20 |
AT1G12440.1
AT1G12440.3 |
AT1G12440
|
A20/AN1-like zinc finger family protein |
Chr3_+_3776177 | 1.20 |
AT3G11930.2
AT3G11930.3 AT3G11930.1 AT3G11930.4 |
AT3G11930
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr5_+_3347381 | 1.20 |
AT5G10580.3
AT5G10580.4 AT5G10580.1 AT5G10580.2 |
AT5G10580
|
plant/protein (Protein of unknown function, DUF599) |
Chr5_+_17977172 | 1.20 |
AT5G44578.2
AT5G44578.1 |
AT5G44578
|
transmembrane protein |
Chr1_-_4242963 | 1.19 |
AT1G12440.2
|
AT1G12440
|
A20/AN1-like zinc finger family protein |
Chr2_+_12666935 | 1.19 |
AT2G29630.3
AT2G29630.2 AT2G29630.1 |
THIC
|
thiaminC |
Chr1_-_23251195 | 1.19 |
AT1G62780.1
|
AT1G62780
|
dimethylallyl, adenosine tRNA methylthiotransferase |
Chr3_-_21103719 | 1.19 |
AT3G57030.1
|
AT3G57030
|
Calcium-dependent phosphotriesterase superfamily protein |
Chr4_-_1500100 | 1.18 |
AT4G03400.2
|
DFL2
|
Auxin-responsive GH3 family protein |
Chr2_+_9248525 | 1.17 |
AT2G21620.1
AT2G21620.2 |
RD2
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr3_-_10599042 | 1.16 |
AT3G28345.1
|
ABCB15
|
ABC transporter family protein |
Chr5_-_20489727 | 1.16 |
AT5G50335.1
|
AT5G50335
|
hypothetical protein |
Chr4_-_5456100 | 1.16 |
AT4G08570.1
|
AT4G08570
|
Heavy metal transport/detoxification superfamily protein |
Chr3_-_16074929 | 1.15 |
AT3G44450.1
|
AT3G44450
|
hypothetical protein |
Chr2_-_8495892 | 1.15 |
AT2G19650.1
|
AT2G19650
|
Cysteine/Histidine-rich C1 domain family protein |
Chr2_+_10241875 | 1.14 |
AT2G24090.1
|
PRPL35
|
Ribosomal protein L35 |
Chr4_+_12524186 | 1.14 |
AT4G24120.1
|
YSL1
|
YELLOW STRIPE like 1 |
Chr2_-_4007044 | 1.14 |
AT2G10410.1
|
SADHU1-1
|
|
Chr1_-_3518035 | 1.14 |
AT1G10640.1
|
AT1G10640
|
Pectin lyase-like superfamily protein |
Chr4_+_8839256 | 1.14 |
AT4G15450.1
AT4G15450.2 |
AT4G15450
|
Senescence/dehydration-associated protein-like protein |
Chr3_-_20629295 | 1.13 |
AT3G55610.1
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr3_-_7808046 | 1.13 |
AT3G22142.1
|
AT3G22142
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr2_+_10244745 | 1.13 |
AT2G24100.1
|
ASG1
|
ATP-dependent DNA helicase |
Chr3_+_3034477 | 1.13 |
AT3G09900.1
|
RABE1e
|
RAB GTPase homolog E1E |
Chr2_+_528179 | 1.12 |
AT2G02100.1
|
LCR69
|
low-molecular-weight cysteine-rich 69 |
Chr1_+_29356346 | 1.12 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr3_+_5705541 | 1.11 |
AT3G16770.1
|
EBP
|
ethylene-responsive element binding protein |
Chr1_-_28466971 | 1.11 |
AT1G75820.1
|
CLV1
|
Leucine-rich receptor-like protein kinase family protein |
Chr3_+_8941066 | 1.11 |
AT3G24520.1
|
HSFC1
|
heat shock transcription factor C1 |
Chr2_+_12667901 | 1.11 |
AT2G29630.4
|
THIC
|
thiaminC |
Chr3_-_20629093 | 1.10 |
AT3G55610.2
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr5_-_3595003 | 1.10 |
AT5G11260.2
AT5G11260.1 |
HY5
|
Basic-leucine zipper (bZIP) transcription factor family protein |
Chr5_+_21771811 | 1.10 |
AT5G53590.1
|
AT5G53590
|
SAUR-like auxin-responsive protein family |
Chr2_+_7316789 | 1.10 |
AT2G16890.3
AT2G16890.2 AT2G16890.1 AT2G16890.4 |
AT2G16890
|
UDP-Glycosyltransferase superfamily protein |
Chr1_+_16263805 | 1.10 |
AT1G43160.1
|
RAP2.6
|
related to AP2 6 |
Chr1_-_21626402 | 1.09 |
AT1G58290.1
|
HEMA1
|
Glutamyl-tRNA reductase family protein |
Chr3_-_8085669 | 1.09 |
AT3G22840.1
|
ELIP1
|
Chlorophyll A-B binding family protein |
Chr4_-_1501599 | 1.09 |
AT4G03400.1
|
DFL2
|
Auxin-responsive GH3 family protein |
Chr5_+_8541558 | 1.09 |
AT5G24860.2
|
FPF1
|
flowering promoting factor 1 |
Chr5_+_17937622 | 1.09 |
AT5G44530.3
AT5G44530.2 AT5G44530.1 |
AT5G44530
|
Subtilase family protein |
Chr3_-_17306633 | 1.09 |
AT3G46970.1
|
PHS2
|
alpha-glucan phosphorylase 2 |
Chr1_-_21580766 | 1.08 |
AT1G58235.1
|
AT1G58235
|
hypothetical protein |
Chr1_-_507268 | 1.06 |
AT1G02460.1
|
AT1G02460
|
Pectin lyase-like superfamily protein |
Chr5_-_15201168 | 1.06 |
AT5G38100.4
AT5G38100.1 AT5G38100.2 |
AT5G38100
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr1_-_21581165 | 1.06 |
AT1G58235.2
|
AT1G58235
|
hypothetical protein |
Chr5_-_5146458 | 1.05 |
AT5G15780.1
|
AT5G15780
|
Pollen Ole e 1 allergen and extensin family protein |
Chr1_-_22417244 | 1.05 |
AT1G60890.2
AT1G60890.1 |
AT1G60890
|
Phosphatidylinositol-4-phosphate 5-kinase family protein |
Chr2_+_17507343 | 1.05 |
AT2G41940.1
|
ZFP8
|
zinc finger protein 8 |
Chr3_+_19265141 | 1.05 |
AT3G51910.1
|
HSFA7A
|
heat shock transcription factor A7A |
Chr5_+_903470 | 1.04 |
AT5G03570.1
AT5G03570.3 |
IREG2
|
iron regulated 2 |
Chr2_+_12542933 | 1.04 |
AT2G29180.1
|
AT2G29180
|
transmembrane protein |
Chr1_+_17326530 | 1.04 |
AT1G47270.2
AT1G47270.1 |
TLP6
|
tubby like protein 6 |
Chr1_-_27498062 | 1.04 |
AT1G73120.1
|
AT1G73120
|
F-box/RNI superfamily protein |
Chr2_-_16664431 | 1.03 |
AT2G39920.4
AT2G39920.1 AT2G39920.3 AT2G39920.2 |
AT2G39920
|
HAD superfamily, subfamily IIIB acid phosphatase |
Chr1_+_25746697 | 1.03 |
AT1G68570.1
|
AT1G68570
|
Major facilitator superfamily protein |
Chr1_-_27755297 | 1.03 |
AT1G73810.1
|
AT1G73810
|
Core-2/I-branching beta-1,6-N-acetylglucosaminyltransferase family protein |
Chr3_+_10524181 | 1.02 |
AT3G28220.1
|
AT3G28220
|
TRAF-like family protein |
Chr2_-_521707 | 1.02 |
AT2G02080.4
AT2G02080.2 AT2G02080.5 AT2G02080.6 AT2G02080.3 AT2G02080.1 |
IDD4
|
indeterminate(ID)-domain 4 |
Chr4_-_13001948 | 1.02 |
AT4G25433.1
|
AT4G25433
|
peptidoglycan-binding LysM domain-containing protein |
Chr2_-_19165233 | 1.02 |
AT2G46670.1
|
AT2G46670
|
CCT motif family protein |
Chr1_-_4679594 | 1.01 |
AT1G13640.2
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
Chr1_+_25746994 | 1.01 |
AT1G68570.2
|
AT1G68570
|
Major facilitator superfamily protein |
Chr4_+_18160903 | 1.01 |
AT4G38960.2
AT4G38960.6 AT4G38960.5 AT4G38960.1 AT4G38960.4 |
BBX19
|
B-box type zinc finger family protein |
Chr5_-_21291928 | 1.01 |
AT5G52450.1
|
AT5G52450
|
MATE efflux family protein |
Chr5_+_6096149 | 1.00 |
AT5G18404.1
|
AT5G18404
|
hypothetical protein |
Chr1_+_20273567 | 1.00 |
AT1G54310.2
AT1G54310.1 |
AT1G54310
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr3_+_11810726 | 1.00 |
AT3G30180.1
|
BR6OX2
|
brassinosteroid-6-oxidase 2 |
Chr4_+_10861382 | 1.00 |
AT4G20070.1
AT4G20070.2 |
AAH
|
allantoate amidohydrolase |
Chr5_+_3157694 | 0.99 |
AT5G10100.1
AT5G10100.3 AT5G10100.4 |
TPPI
|
Haloacid dehalogenase-like hydrolase (HAD) superfamily protein |
Chr5_+_25286177 | 0.99 |
AT5G63030.1
|
GRXC1
|
Thioredoxin superfamily protein |
Chr5_-_816670 | 0.99 |
AT5G03350.1
|
AT5G03350
|
Legume lectin family protein |
Chr5_-_6850237 | 0.99 |
AT5G20280.1
|
SPS1F
|
sucrose phosphate synthase 1F |
Chr2_-_18191280 | 0.99 |
AT2G43920.3
AT2G43920.4 AT2G43920.1 AT2G43920.2 |
HOL2
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr1_-_4679862 | 0.99 |
AT1G13640.1
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
Chr5_+_19005547 | 0.98 |
AT5G46840.1
AT5G46840.2 |
AT5G46840
|
RNA-binding (RRM/RBD/RNP motifs) family protein |
Chr2_-_6175064 | 0.98 |
AT2G14510.1
AT2G14510.2 |
AT2G14510
|
Leucine-rich repeat protein kinase family protein |
Chr3_-_17506124 | 0.98 |
AT3G47500.1
|
CDF3
|
cycling DOF factor 3 |
Chr3_+_20991280 | 0.97 |
AT3G56680.1
|
AT3G56680
|
Single-stranded nucleic acid binding R3H protein |
Chr3_+_2907479 | 0.97 |
AT3G09450.1
|
AT3G09450
|
fusaric acid resistance family protein |
Chr5_-_4733225 | 0.97 |
AT5G14680.1
|
AT5G14680
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr1_-_21635344 | 0.96 |
AT1G58320.1
|
AT1G58320
|
PLAC8 family protein |
Chr4_-_18370698 | 0.96 |
AT4G39510.1
|
CYP96A12
|
cytochrome P450, family 96, subfamily A, polypeptide 12 |
Chr2_-_17379059 | 0.96 |
AT2G41680.1
|
NTRC
|
NADPH-dependent thioredoxin reductase C |
Chr1_+_10918267 | 0.95 |
AT1G30760.2
AT1G30760.1 |
AT1G30760
|
FAD-binding Berberine family protein |
Chr1_+_24901882 | 0.95 |
AT1G66760.2
AT1G66760.1 AT1G66760.4 AT1G66760.3 |
AT1G66760
|
MATE efflux family protein |
Chr4_-_1046993 | 0.95 |
AT4G02380.2
AT4G02380.1 AT4G02380.3 |
SAG21
|
senescence-associated gene 21 |
Chr1_+_25437900 | 0.95 |
AT1G67850.1
AT1G67850.4 AT1G67850.5 AT1G67850.3 AT1G67850.2 |
AT1G67850
|
lysine ketoglutarate reductase trans-splicing protein (DUF707) |
Chr5_-_10070899 | 0.94 |
AT5G28060.1
|
AT5G28060
|
Ribosomal protein S24e family protein |
Chr1_-_1286619 | 0.94 |
AT1G04620.1
|
HCAR
|
coenzyme F420 hydrogenase family / dehydrogenase, beta subunit family |
Chr4_+_13253084 | 0.94 |
AT4G26150.1
|
CGA1
|
cytokinin-responsive gata factor 1 |
Chr2_+_278124 | 0.94 |
AT2G01620.1
|
MEE11
|
RNI-like superfamily protein |
Chr1_-_8414886 | 0.94 |
AT1G23800.1
AT1G23800.2 |
ALDH2B7
|
aldehyde dehydrogenase 2B7 |
Chr5_+_16423919 | 0.94 |
AT5G41010.1
|
NRPB12
|
DNA directed RNA polymerase, 7 kDa subunit |
Chr4_-_433938 | 0.93 |
AT4G01000.2
AT4G01000.1 |
AT4G01000
|
Ubiquitin-like superfamily protein |
Chr1_-_26800483 | 0.93 |
AT1G71040.1
|
LPR2
|
Cupredoxin superfamily protein |
Chr1_+_21936278 | 0.93 |
AT1G59700.1
|
GSTU16
|
glutathione S-transferase TAU 16 |
Chr2_+_2029687 | 0.92 |
AT2G05530.1
AT2G05530.2 |
AT2G05530
|
Glycine-rich protein family |
Chr4_-_12745352 | 0.92 |
AT4G24700.1
|
AT4G24700
|
hypothetical protein |
Chr3_-_4657723 | 0.92 |
AT3G14060.1
|
AT3G14060
|
hypothetical protein |
Chr3_+_9475350 | 0.92 |
AT3G25890.2
AT3G25890.1 |
CRF11
|
Integrase-type DNA-binding superfamily protein |
Chr1_+_25701770 | 0.91 |
AT1G68500.1
|
AT1G68500
|
hypothetical protein |
Chr4_-_8095749 | 0.91 |
AT4G14020.1
|
AT4G14020
|
Rapid alkalinization factor (RALF) family protein |
Chr2_-_18956582 | 0.91 |
AT2G46110.1
|
KPHMT1
|
ketopantoate hydroxymethyltransferase 1 |
Chr5_+_904693 | 0.90 |
AT5G03570.4
|
IREG2
|
iron regulated 2 |
Chr4_+_6245916 | 0.90 |
AT4G09970.1
AT4G09970.2 |
AT4G09970
|
transmembrane protein |
Chr4_-_16644928 | 0.90 |
AT4G34950.1
|
AT4G34950
|
Major facilitator superfamily protein |
Chr1_-_20578308 | 0.90 |
AT1G55152.1
|
AT1G55152
|
hypothetical protein |
Chr3_+_8788814 | 0.89 |
AT3G24255.3
AT3G24255.5 AT3G24255.4 AT3G24255.6 AT3G24255.2 AT3G24255.1 AT3G24255.7 |
AT3G24255
|
RNA-directed DNA polymerase (reverse transcriptase)-related family protein |
Chr5_+_16979773 | 0.89 |
AT5G42460.1
|
AT5G42460
|
F-box and associated interaction domains-containing protein |
Chr2_+_7198127 | 0.88 |
AT2G16595.1
|
AT2G16595
|
Translocon-associated protein (TRAP), alpha subunit |
Chr5_+_7703041 | 0.88 |
AT5G23010.2
AT5G23010.1 AT5G23010.3 |
MAM1
|
methylthioalkylmalate synthase 1 |
Chr3_+_4544364 | 0.87 |
AT3G13810.5
AT3G13810.3 AT3G13810.4 AT3G13810.6 AT3G13810.2 AT3G13810.1 |
IDD11
|
indeterminate(ID)-domain 11 |
Chr1_-_11595982 | 0.87 |
AT1G32190.2
AT1G32190.1 |
AT1G32190
|
alpha/beta-Hydrolases superfamily protein |
Chr3_-_7704958 | 0.87 |
AT3G21870.1
|
CYCP2%3B1
|
cyclin p2;1 |
Chr5_+_7103384 | 0.87 |
AT5G20935.1
AT5G20935.2 |
CRR42
|
DUF3148 family protein |
Chr1_+_17326965 | 0.87 |
AT1G47270.3
|
TLP6
|
tubby like protein 6 |
Chr1_+_25999837 | 0.87 |
AT1G69160.1
|
AT1G69160
|
suppressor |
Chr1_+_23833485 | 0.86 |
AT1G64230.1
AT1G64230.3 AT1G64230.5 AT1G64230.4 AT1G64230.2 |
UBC28
|
ubiquitin-conjugating enzyme 28 |
Chr3_+_17629530 | 0.86 |
AT3G47790.2
AT3G47790.1 AT3G47790.3 |
ABCA8
|
ABC2 homolog 7 |
Chr3_+_3847743 | 0.86 |
AT3G12080.1
AT3G12080.2 |
emb2738
|
GTP-binding family protein |
Chr1_-_29869784 | 0.86 |
AT1G79410.1
|
OCT5
|
organic cation/carnitine transporter5 |
Chr5_-_7419335 | 0.86 |
AT5G22390.1
|
AT5G22390
|
FANTASTIC four-like protein (DUF3049) |
Chr5_-_4392429 | 0.86 |
AT5G13630.1
|
GUN5
|
magnesium-chelatase subunit chlH, chloroplast, putative / Mg-protoporphyrin IX chelatase, putative (CHLH) |
Chr5_-_4392227 | 0.85 |
AT5G13630.2
|
GUN5
|
magnesium-chelatase subunit chlH, chloroplast, putative / Mg-protoporphyrin IX chelatase, putative (CHLH) |
Chr1_-_11719988 | 0.85 |
AT1G32450.1
|
NRT1.5
|
nitrate transporter 1.5 |
Chr5_-_6184038 | 0.85 |
AT5G18600.1
|
AT5G18600
|
Thioredoxin superfamily protein |
Chr4_-_13112482 | 0.85 |
AT4G25750.1
|
ABCG4
|
ABC-2 type transporter family protein |
Chr2_+_17582673 | 0.85 |
AT2G42190.2
AT2G42190.1 AT2G42190.3 |
AT2G42190
|
rho GTPase-activating gacO-like protein |
Chr5_+_903756 | 0.84 |
AT5G03570.2
|
IREG2
|
iron regulated 2 |
Chr2_-_18190665 | 0.84 |
AT2G43920.6
AT2G43920.5 |
HOL2
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr4_-_10576619 | 0.84 |
AT4G19390.1
|
AT4G19390
|
Uncharacterized protein family (UPF0114) |
Chr3_-_9642779 | 0.84 |
AT3G26310.1
|
CYP71B35
|
cytochrome P450, family 71, subfamily B, polypeptide 35 |
Chr1_+_23953099 | 0.83 |
AT1G64500.1
|
AT1G64500
|
Glutaredoxin family protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | GO:0055068 | nickel cation transmembrane transport(GO:0035444) cobalt ion homeostasis(GO:0055068) |
0.8 | 2.3 | GO:0010266 | response to vitamin B1(GO:0010266) |
0.7 | 2.1 | GO:0071281 | cellular response to iron ion(GO:0071281) |
0.6 | 3.0 | GO:0009647 | skotomorphogenesis(GO:0009647) |
0.5 | 4.9 | GO:0009819 | drought recovery(GO:0009819) |
0.5 | 0.9 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.5 | 1.4 | GO:0051341 | regulation of oxidoreductase activity(GO:0051341) |
0.4 | 2.6 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.4 | 2.6 | GO:1902326 | positive regulation of chlorophyll biosynthetic process(GO:1902326) |
0.4 | 0.4 | GO:2001009 | regulation of plant-type cell wall cellulose biosynthetic process(GO:2001009) |
0.4 | 5.8 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
0.4 | 2.0 | GO:1903792 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
0.4 | 1.5 | GO:0009831 | plant-type cell wall modification involved in multidimensional cell growth(GO:0009831) |
0.4 | 1.5 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
0.4 | 1.4 | GO:1901600 | lactone metabolic process(GO:1901334) lactone biosynthetic process(GO:1901336) strigolactone metabolic process(GO:1901600) strigolactone biosynthetic process(GO:1901601) |
0.4 | 1.1 | GO:0045117 | thiamine pyrophosphate transport(GO:0030974) vitamin transmembrane transport(GO:0035461) azole transport(GO:0045117) |
0.3 | 2.1 | GO:0031116 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) positive regulation of microtubule polymerization(GO:0031116) |
0.3 | 4.5 | GO:0009608 | response to symbiont(GO:0009608) |
0.3 | 0.9 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.3 | 1.2 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
0.3 | 0.9 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.3 | 1.5 | GO:0010599 | production of lsiRNA involved in RNA interference(GO:0010599) |
0.3 | 1.5 | GO:0035627 | ceramide transport(GO:0035627) |
0.3 | 0.9 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.3 | 1.7 | GO:0034059 | response to anoxia(GO:0034059) |
0.3 | 1.9 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
0.3 | 0.8 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.3 | 1.1 | GO:2000736 | regulation of stem cell population maintenance(GO:2000036) regulation of stem cell differentiation(GO:2000736) |
0.3 | 0.8 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.3 | 1.0 | GO:0031297 | replication fork processing(GO:0031297) |
0.3 | 0.8 | GO:1990532 | stress response to nickel ion(GO:1990532) |
0.3 | 0.8 | GO:0006984 | ER-nucleus signaling pathway(GO:0006984) |
0.2 | 0.7 | GO:0035017 | cuticle pattern formation(GO:0035017) |
0.2 | 1.0 | GO:0071836 | nectar secretion(GO:0071836) |
0.2 | 0.2 | GO:0010377 | guard cell fate commitment(GO:0010377) |
0.2 | 0.7 | GO:0009228 | thiamine biosynthetic process(GO:0009228) thiamine-containing compound biosynthetic process(GO:0042724) |
0.2 | 0.7 | GO:0010433 | nectary development(GO:0010254) bract morphogenesis(GO:0010433) bract formation(GO:0010434) |
0.2 | 1.4 | GO:0015919 | peroxisomal membrane transport(GO:0015919) |
0.2 | 1.1 | GO:1901672 | positive regulation of systemic acquired resistance(GO:1901672) |
0.2 | 1.1 | GO:0051098 | regulation of binding(GO:0051098) |
0.2 | 0.7 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.2 | 1.1 | GO:0000084 | mitotic G1 phase(GO:0000080) mitotic S phase(GO:0000084) mitotic G2 phase(GO:0000085) G1 phase(GO:0051318) G2 phase(GO:0051319) S phase(GO:0051320) interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.2 | 0.6 | GO:0044277 | cell wall modification involved in abscission(GO:0009830) cell wall disassembly(GO:0044277) |
0.2 | 1.3 | GO:0010258 | NADH dehydrogenase complex (plastoquinone) assembly(GO:0010258) |
0.2 | 1.1 | GO:0010135 | ureide metabolic process(GO:0010135) ureide catabolic process(GO:0010136) |
0.2 | 0.6 | GO:0045827 | negative regulation of isoprenoid metabolic process(GO:0045827) |
0.2 | 0.4 | GO:1904589 | regulation of protein import(GO:1904589) |
0.2 | 0.8 | GO:0055073 | cadmium ion homeostasis(GO:0055073) |
0.2 | 0.6 | GO:0051204 | protein insertion into membrane from inner side(GO:0032978) protein insertion into mitochondrial membrane from inner side(GO:0032979) protein insertion into mitochondrial membrane(GO:0051204) |
0.2 | 2.4 | GO:0010044 | response to aluminum ion(GO:0010044) |
0.2 | 2.4 | GO:0017157 | regulation of exocytosis(GO:0017157) |
0.2 | 1.6 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.2 | 0.8 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.2 | 0.8 | GO:0016320 | endoplasmic reticulum membrane fusion(GO:0016320) |
0.2 | 0.6 | GO:1900151 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) |
0.2 | 0.6 | GO:0048729 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
0.2 | 0.7 | GO:0048656 | anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
0.2 | 0.9 | GO:0015940 | pantothenate metabolic process(GO:0015939) pantothenate biosynthetic process(GO:0015940) |
0.2 | 1.4 | GO:0010098 | suspensor development(GO:0010098) |
0.2 | 0.5 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.2 | 2.2 | GO:0010380 | regulation of chlorophyll biosynthetic process(GO:0010380) |
0.2 | 0.5 | GO:0009747 | hexokinase-dependent signaling(GO:0009747) |
0.2 | 2.2 | GO:0042793 | transcription from plastid promoter(GO:0042793) |
0.2 | 1.7 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
0.2 | 1.7 | GO:0010031 | circumnutation(GO:0010031) multicellular organismal movement(GO:0050879) |
0.2 | 0.5 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.2 | 0.3 | GO:0071217 | response to cycloheximide(GO:0046898) cellular response to external biotic stimulus(GO:0071217) |
0.2 | 0.5 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.2 | 2.4 | GO:0010039 | response to iron ion(GO:0010039) |
0.2 | 0.2 | GO:0006354 | DNA-templated transcription, elongation(GO:0006354) regulation of DNA-templated transcription, elongation(GO:0032784) |
0.2 | 0.5 | GO:1903428 | positive regulation of reactive oxygen species biosynthetic process(GO:1903428) |
0.2 | 0.3 | GO:0043954 | cellular component maintenance(GO:0043954) chromatin maintenance(GO:0070827) |
0.2 | 1.3 | GO:0010371 | regulation of gibberellin biosynthetic process(GO:0010371) |
0.2 | 0.5 | GO:0071258 | cellular response to gravity(GO:0071258) |
0.2 | 0.8 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.2 | 1.4 | GO:0048363 | mucilage pectin metabolic process(GO:0048363) |
0.2 | 3.0 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
0.2 | 0.9 | GO:0010255 | glucose mediated signaling pathway(GO:0010255) |
0.2 | 1.1 | GO:0009772 | photosynthetic electron transport in photosystem II(GO:0009772) |
0.2 | 0.6 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.2 | 1.1 | GO:0090059 | protoxylem development(GO:0090059) |
0.2 | 1.5 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.4 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.1 | 0.6 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.6 | GO:0009558 | embryo sac cellularization(GO:0009558) |
0.1 | 0.4 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 2.2 | GO:0009641 | shade avoidance(GO:0009641) |
0.1 | 0.6 | GO:0043693 | monoterpene biosynthetic process(GO:0043693) |
0.1 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.1 | 0.6 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.6 | GO:0032260 | response to jasmonic acid stimulus involved in jasmonic acid and ethylene-dependent systemic resistance(GO:0032260) |
0.1 | 0.4 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 1.2 | GO:0010190 | cytochrome b6f complex assembly(GO:0010190) |
0.1 | 6.3 | GO:0015995 | chlorophyll biosynthetic process(GO:0015995) |
0.1 | 0.6 | GO:0008333 | lysosomal transport(GO:0007041) endosome to lysosome transport(GO:0008333) |
0.1 | 0.9 | GO:0043480 | pigment accumulation in response to UV light(GO:0043478) pigment accumulation in tissues in response to UV light(GO:0043479) pigment accumulation in tissues(GO:0043480) anthocyanin accumulation in tissues in response to UV light(GO:0043481) |
0.1 | 0.4 | GO:0048439 | flower morphogenesis(GO:0048439) |
0.1 | 0.7 | GO:0080121 | AMP transport(GO:0080121) |
0.1 | 0.4 | GO:0048832 | specification of organ number(GO:0048832) specification of floral organ number(GO:0048833) |
0.1 | 1.7 | GO:0031539 | positive regulation of anthocyanin metabolic process(GO:0031539) |
0.1 | 0.7 | GO:0005980 | glycogen catabolic process(GO:0005980) |
0.1 | 0.6 | GO:0000455 | enzyme-directed rRNA pseudouridine synthesis(GO:0000455) |
0.1 | 2.8 | GO:0000373 | Group II intron splicing(GO:0000373) |
0.1 | 0.4 | GO:0000082 | G1/S transition of mitotic cell cycle(GO:0000082) |
0.1 | 0.8 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
0.1 | 0.6 | GO:0080094 | response to trehalose-6-phosphate(GO:0080094) |
0.1 | 1.0 | GO:0090356 | negative regulation of auxin metabolic process(GO:0090356) |
0.1 | 0.5 | GO:0010070 | zygote asymmetric cell division(GO:0010070) |
0.1 | 0.5 | GO:0010495 | long-distance posttranscriptional gene silencing(GO:0010495) |
0.1 | 4.6 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.1 | 0.5 | GO:0010336 | gibberellic acid homeostasis(GO:0010336) |
0.1 | 0.3 | GO:0010444 | guard mother cell differentiation(GO:0010444) |
0.1 | 0.7 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) histone demethylation(GO:0016577) histone lysine demethylation(GO:0070076) |
0.1 | 1.2 | GO:0009942 | longitudinal axis specification(GO:0009942) |
0.1 | 0.7 | GO:0080175 | phragmoplast microtubule organization(GO:0080175) |
0.1 | 2.9 | GO:2000033 | regulation of seed dormancy process(GO:2000033) |
0.1 | 0.5 | GO:0031538 | negative regulation of anthocyanin metabolic process(GO:0031538) |
0.1 | 2.3 | GO:0048015 | phosphatidylinositol-mediated signaling(GO:0048015) |
0.1 | 1.0 | GO:0032456 | endocytic recycling(GO:0032456) |
0.1 | 0.5 | GO:0006063 | uronic acid metabolic process(GO:0006063) galacturonate metabolic process(GO:0019586) |
0.1 | 0.5 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) monoterpenoid biosynthetic process(GO:0016099) |
0.1 | 0.3 | GO:1904276 | regulation of wax biosynthetic process(GO:1904276) positive regulation of wax biosynthetic process(GO:1904278) |
0.1 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.5 | GO:0048564 | photosystem I assembly(GO:0048564) |
0.1 | 0.5 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.1 | 0.4 | GO:1900032 | regulation of trichome patterning(GO:1900032) negative regulation of trichome patterning(GO:1900033) |
0.1 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.6 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 1.0 | GO:0051293 | establishment of mitotic spindle orientation(GO:0000132) establishment of mitotic spindle localization(GO:0040001) establishment of spindle localization(GO:0051293) establishment of spindle orientation(GO:0051294) spindle localization(GO:0051653) |
0.1 | 0.4 | GO:0033321 | homomethionine metabolic process(GO:0033321) glucosinolate biosynthetic process from homomethionine(GO:0033506) |
0.1 | 0.5 | GO:0080141 | regulation of jasmonic acid metabolic process(GO:0080140) regulation of jasmonic acid biosynthetic process(GO:0080141) |
0.1 | 0.4 | GO:0010618 | aerenchyma formation(GO:0010618) |
0.1 | 0.4 | GO:2001006 | regulation of beta-glucan metabolic process(GO:0032950) regulation of beta-glucan biosynthetic process(GO:0032951) regulation of cellulose biosynthetic process(GO:2001006) |
0.1 | 0.5 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 1.3 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.1 | 0.5 | GO:1901333 | positive regulation of lateral root development(GO:1901333) |
0.1 | 1.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 1.1 | GO:0009231 | riboflavin metabolic process(GO:0006771) riboflavin biosynthetic process(GO:0009231) |
0.1 | 0.4 | GO:0090213 | regulation of radial pattern formation(GO:0090213) |
0.1 | 1.0 | GO:0071585 | detoxification of cadmium ion(GO:0071585) |
0.1 | 0.5 | GO:0018315 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) |
0.1 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.5 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.1 | 0.5 | GO:0080005 | photosystem stoichiometry adjustment(GO:0080005) |
0.1 | 2.1 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
0.1 | 2.3 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.1 | 0.3 | GO:1902464 | histone H3-K27 trimethylation(GO:0098532) regulation of histone H3-K27 trimethylation(GO:1902464) |
0.1 | 0.7 | GO:2000306 | positive regulation of photomorphogenesis(GO:2000306) |
0.1 | 0.3 | GO:0032418 | lysosome localization(GO:0032418) |
0.1 | 1.5 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.6 | GO:0090056 | regulation of chlorophyll metabolic process(GO:0090056) |
0.1 | 0.3 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) regulation of cation transmembrane transport(GO:1904062) |
0.1 | 0.4 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
0.1 | 0.6 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.2 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
0.1 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.1 | GO:1903829 | positive regulation of protein transport(GO:0051222) positive regulation of intracellular protein transport(GO:0090316) positive regulation of cellular protein localization(GO:1903829) positive regulation of establishment of protein localization(GO:1904951) |
0.1 | 0.5 | GO:2000580 | regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 1.2 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) negative regulation of photosynthesis(GO:1905156) |
0.1 | 0.2 | GO:0040023 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) nucleus localization(GO:0051647) |
0.1 | 0.5 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.1 | 0.3 | GO:1903513 | retrograde protein transport, ER to cytosol(GO:0030970) endoplasmic reticulum to cytosol transport(GO:1903513) |
0.1 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.6 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
0.1 | 1.0 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.6 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.2 | GO:0032196 | transposition(GO:0032196) |
0.1 | 2.5 | GO:0045037 | protein import into chloroplast stroma(GO:0045037) |
0.1 | 0.3 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) positive regulation of lipid catabolic process(GO:0050996) |
0.1 | 0.6 | GO:1901332 | negative regulation of lateral root development(GO:1901332) |
0.1 | 0.7 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.7 | GO:0051127 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 1.2 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.1 | 1.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.9 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.6 | GO:0071329 | cellular response to sucrose stimulus(GO:0071329) |
0.1 | 0.3 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.6 | GO:0046865 | isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.1 | 0.5 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 1.7 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.1 | 0.5 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 1.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.4 | GO:0048464 | sepal development(GO:0048442) flower calyx development(GO:0048464) |
0.1 | 0.6 | GO:0016121 | carotene catabolic process(GO:0016121) terpene catabolic process(GO:0046247) |
0.1 | 0.4 | GO:1990170 | stress response to cadmium ion(GO:1990170) |
0.1 | 0.3 | GO:0060776 | simple leaf morphogenesis(GO:0060776) |
0.1 | 1.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 1.1 | GO:0071484 | cellular response to light intensity(GO:0071484) |
0.1 | 0.7 | GO:0000967 | rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.1 | 0.4 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 1.6 | GO:0071483 | cellular response to blue light(GO:0071483) |
0.1 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.5 | GO:0034644 | cellular response to UV(GO:0034644) |
0.1 | 0.6 | GO:0042360 | vitamin E biosynthetic process(GO:0010189) vitamin E metabolic process(GO:0042360) |
0.1 | 0.3 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.1 | 1.7 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.7 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 1.3 | GO:0006898 | receptor-mediated endocytosis(GO:0006898) |
0.1 | 0.3 | GO:0052746 | cellular phosphate ion homeostasis(GO:0030643) inositol phosphorylation(GO:0052746) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 2.9 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.5 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 3.4 | GO:0009911 | positive regulation of flower development(GO:0009911) |
0.1 | 1.8 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
0.1 | 0.8 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.2 | GO:0010343 | singlet oxygen-mediated programmed cell death(GO:0010343) |
0.1 | 0.6 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.7 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.1 | 0.3 | GO:0034414 | tRNA 3'-trailer cleavage, endonucleolytic(GO:0034414) |
0.1 | 0.3 | GO:0051211 | anisotropic cell growth(GO:0051211) |
0.1 | 0.6 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
0.1 | 0.4 | GO:1901002 | positive regulation of response to salt stress(GO:1901002) |
0.1 | 2.3 | GO:0051667 | chloroplast relocation(GO:0009902) establishment of plastid localization(GO:0051667) |
0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) hexitol biosynthetic process(GO:0019406) mannitol biosynthetic process(GO:0019593) mannitol metabolic process(GO:0019594) |
0.1 | 0.2 | GO:0048446 | petal morphogenesis(GO:0048446) |
0.1 | 0.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 1.4 | GO:0009768 | photosynthesis, light harvesting in photosystem I(GO:0009768) |
0.1 | 0.2 | GO:0048479 | style development(GO:0048479) |
0.1 | 0.4 | GO:0080190 | secondary growth(GO:0080117) lateral growth(GO:0080190) |
0.1 | 0.3 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.1 | 0.2 | GO:0070150 | mitochondrial glycyl-tRNA aminoacylation(GO:0070150) |
0.1 | 0.2 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.1 | 1.1 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.1 | 0.9 | GO:0010076 | maintenance of floral meristem identity(GO:0010076) |
0.1 | 0.3 | GO:0048530 | fruit morphogenesis(GO:0048530) |
0.1 | 0.3 | GO:0034389 | lipid particle organization(GO:0034389) |
0.1 | 0.4 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.1 | 1.5 | GO:0009934 | regulation of meristem structural organization(GO:0009934) |
0.1 | 0.3 | GO:0090309 | positive regulation of chromatin silencing(GO:0031937) regulation of methylation-dependent chromatin silencing(GO:0090308) positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.1 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) protein localization to microtubule cytoskeleton(GO:0072698) |
0.1 | 0.4 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.1 | 0.2 | GO:0010269 | response to selenium ion(GO:0010269) |
0.1 | 0.6 | GO:0009880 | embryonic pattern specification(GO:0009880) |
0.1 | 0.2 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.1 | 0.7 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.1 | 0.5 | GO:0009584 | detection of visible light(GO:0009584) |
0.1 | 0.1 | GO:0036292 | DNA rewinding(GO:0036292) |
0.1 | 0.6 | GO:0009854 | oxidative photosynthetic carbon pathway(GO:0009854) |
0.1 | 8.7 | GO:0009658 | chloroplast organization(GO:0009658) |
0.1 | 0.6 | GO:0018210 | peptidyl-threonine phosphorylation(GO:0018107) peptidyl-threonine modification(GO:0018210) |
0.1 | 0.6 | GO:0051513 | regulation of monopolar cell growth(GO:0051513) |
0.1 | 0.4 | GO:0046493 | lipid A biosynthetic process(GO:0009245) lipid A metabolic process(GO:0046493) lipooligosaccharide metabolic process(GO:1901269) lipooligosaccharide biosynthetic process(GO:1901271) |
0.1 | 1.4 | GO:0072598 | protein localization to chloroplast(GO:0072598) |
0.1 | 2.0 | GO:0042631 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
0.1 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.8 | GO:0060260 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.4 | GO:0006228 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
0.1 | 0.2 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.1 | 0.3 | GO:0009557 | antipodal cell differentiation(GO:0009557) |
0.1 | 0.7 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.5 | GO:0032890 | amine transport(GO:0015837) regulation of organic acid transport(GO:0032890) regulation of amine transport(GO:0051952) regulation of amino acid transport(GO:0051955) regulation of amino acid export(GO:0080143) |
0.1 | 2.0 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.2 | GO:0098609 | pollen tube adhesion(GO:0009865) cell-cell adhesion(GO:0098609) multi organism cell adhesion(GO:0098740) |
0.1 | 0.3 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
0.1 | 0.2 | GO:1901999 | homogentisate metabolic process(GO:1901999) homogentisate catabolic process(GO:1902000) |
0.1 | 0.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.4 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.1 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.1 | 0.1 | GO:1903321 | negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
0.1 | 0.6 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.2 | GO:0046705 | CDP metabolic process(GO:0046704) CDP biosynthetic process(GO:0046705) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.5 | GO:0010231 | maintenance of seed dormancy(GO:0010231) maintenance of dormancy(GO:0097437) |
0.1 | 2.3 | GO:0006414 | translational elongation(GO:0006414) |
0.1 | 0.2 | GO:0015669 | gas transport(GO:0015669) |
0.1 | 0.2 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.1 | 0.3 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.1 | 0.4 | GO:1901001 | negative regulation of response to salt stress(GO:1901001) |
0.1 | 0.5 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.1 | 0.5 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.1 | GO:2000573 | regulation of telomerase activity(GO:0051972) positive regulation of telomerase activity(GO:0051973) positive regulation of DNA biosynthetic process(GO:2000573) |
0.1 | 0.7 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.1 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.1 | 0.2 | GO:1900370 | positive regulation of RNA interference(GO:1900370) |
0.1 | 0.2 | GO:1900458 | negative regulation of brassinosteroid mediated signaling pathway(GO:1900458) |
0.1 | 0.6 | GO:0005987 | sucrose catabolic process(GO:0005987) |
0.1 | 1.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 1.1 | GO:0010072 | primary shoot apical meristem specification(GO:0010072) |
0.1 | 0.8 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.2 | GO:0019365 | pyridine nucleotide salvage(GO:0019365) |
0.1 | 0.2 | GO:0097438 | release of seed from dormancy(GO:0048838) exit from dormancy(GO:0097438) |
0.1 | 0.7 | GO:0070413 | trehalose metabolism in response to stress(GO:0070413) |
0.1 | 0.3 | GO:0008614 | pyridoxine metabolic process(GO:0008614) |
0.1 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 3.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 1.1 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.1 | 1.0 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.9 | GO:0015994 | chlorophyll metabolic process(GO:0015994) |
0.1 | 0.8 | GO:0051346 | negative regulation of hydrolase activity(GO:0051346) |
0.0 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.3 | GO:0009208 | CTP biosynthetic process(GO:0006241) pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
0.0 | 0.4 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.0 | 0.6 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.6 | GO:0031425 | chloroplast RNA processing(GO:0031425) |
0.0 | 1.2 | GO:0010091 | trichome branching(GO:0010091) |
0.0 | 0.1 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.3 | GO:0051181 | cofactor transport(GO:0051181) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) biotin biosynthetic process(GO:0009102) |
0.0 | 0.4 | GO:0010375 | stomatal complex patterning(GO:0010375) |
0.0 | 1.3 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.7 | GO:0008544 | epidermis development(GO:0008544) epidermal cell differentiation(GO:0009913) epithelial cell differentiation(GO:0030855) epithelium development(GO:0060429) |
0.0 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.3 | GO:0019685 | photosynthesis, dark reaction(GO:0019685) |
0.0 | 0.1 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.2 | GO:0080151 | positive regulation of salicylic acid mediated signaling pathway(GO:0080151) |
0.0 | 0.1 | GO:0002188 | translation reinitiation(GO:0002188) |
0.0 | 0.1 | GO:0010822 | positive regulation of mitochondrion organization(GO:0010822) |
0.0 | 0.4 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
0.0 | 0.3 | GO:0007187 | G-protein coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger(GO:0007187) adenylate cyclase-modulating G-protein coupled receptor signaling pathway(GO:0007188) |
0.0 | 0.4 | GO:1902290 | positive regulation of defense response to oomycetes(GO:1902290) |
0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.1 | GO:0030638 | polyketide metabolic process(GO:0030638) |
0.0 | 0.7 | GO:0006857 | oligopeptide transport(GO:0006857) peptide transport(GO:0015833) |
0.0 | 0.4 | GO:0009961 | response to 1-aminocyclopropane-1-carboxylic acid(GO:0009961) |
0.0 | 0.9 | GO:0016104 | triterpenoid biosynthetic process(GO:0016104) |
0.0 | 1.0 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.2 | GO:0015739 | sialic acid transport(GO:0015739) |
0.0 | 0.0 | GO:0033566 | chromatin remodeling at centromere(GO:0031055) gamma-tubulin complex localization(GO:0033566) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0006212 | uracil catabolic process(GO:0006212) beta-alanine metabolic process(GO:0019482) beta-alanine biosynthetic process(GO:0019483) |
0.0 | 0.2 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.0 | 0.3 | GO:0080142 | regulation of salicylic acid biosynthetic process(GO:0080142) |
0.0 | 0.1 | GO:1902584 | positive regulation of response to water deprivation(GO:1902584) |
0.0 | 0.3 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
0.0 | 0.6 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.6 | GO:0009269 | response to desiccation(GO:0009269) |
0.0 | 0.2 | GO:0048579 | negative regulation of long-day photoperiodism, flowering(GO:0048579) |
0.0 | 0.1 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.0 | 0.4 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 1.2 | GO:0048278 | vesicle docking(GO:0048278) |
0.0 | 0.8 | GO:0052546 | cell wall pectin metabolic process(GO:0052546) |
0.0 | 0.7 | GO:0009294 | genetic transfer(GO:0009292) DNA mediated transformation(GO:0009294) |
0.0 | 0.4 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.4 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.6 | GO:0046854 | lipid phosphorylation(GO:0046834) phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0009855 | determination of bilateral symmetry(GO:0009855) |
0.0 | 2.5 | GO:0042255 | ribosome assembly(GO:0042255) |
0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.0 | 0.4 | GO:0001709 | cell fate determination(GO:0001709) |
0.0 | 0.2 | GO:0045995 | regulation of embryonic development(GO:0045995) |
0.0 | 0.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.3 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
0.0 | 0.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 1.4 | GO:0045862 | positive regulation of proteolysis(GO:0045862) |
0.0 | 0.3 | GO:0070298 | negative regulation of ethylene-activated signaling pathway(GO:0010105) negative regulation of phosphorelay signal transduction system(GO:0070298) |
0.0 | 0.1 | GO:0080088 | spermidine hydroxycinnamate conjugate biosynthetic process(GO:0080088) |
0.0 | 0.2 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.1 | GO:1902288 | regulation of defense response to oomycetes(GO:1902288) |
0.0 | 0.9 | GO:0048510 | regulation of timing of meristematic phase transition(GO:0048506) regulation of timing of transition from vegetative to reproductive phase(GO:0048510) |
0.0 | 0.3 | GO:1990066 | nonphotochemical quenching(GO:0010196) energy quenching(GO:1990066) |
0.0 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.1 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
0.0 | 0.4 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.0 | 0.3 | GO:0034502 | protein localization to chromosome(GO:0034502) |
0.0 | 0.3 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.5 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) |
0.0 | 0.7 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.5 | GO:0045727 | positive regulation of translation(GO:0045727) |
0.0 | 0.4 | GO:0071248 | cellular response to metal ion(GO:0071248) |
0.0 | 0.6 | GO:0048574 | long-day photoperiodism, flowering(GO:0048574) |
0.0 | 0.2 | GO:0080187 | floral organ senescence(GO:0080187) |
0.0 | 3.3 | GO:0048511 | circadian rhythm(GO:0007623) rhythmic process(GO:0048511) |
0.0 | 0.7 | GO:0016573 | internal protein amino acid acetylation(GO:0006475) histone acetylation(GO:0016573) internal peptidyl-lysine acetylation(GO:0018393) peptidyl-lysine acetylation(GO:0018394) |
0.0 | 0.1 | GO:0009413 | response to flooding(GO:0009413) |
0.0 | 0.6 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
0.0 | 1.5 | GO:0034599 | cellular response to oxidative stress(GO:0034599) |
0.0 | 0.1 | GO:2000072 | regulation of defense response to fungus, incompatible interaction(GO:2000072) |
0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.4 | GO:0009098 | leucine biosynthetic process(GO:0009098) |
0.0 | 0.1 | GO:0031023 | microtubule organizing center organization(GO:0031023) |
0.0 | 0.3 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 1.3 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.1 | GO:0010597 | green leaf volatile biosynthetic process(GO:0010597) |
0.0 | 0.7 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.4 | GO:0010158 | abaxial cell fate specification(GO:0010158) |
0.0 | 0.1 | GO:0019377 | glycosylceramide metabolic process(GO:0006677) glucosylceramide metabolic process(GO:0006678) glucosylceramide catabolic process(GO:0006680) glycosphingolipid metabolic process(GO:0006687) glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
0.0 | 1.3 | GO:0048481 | plant ovule development(GO:0048481) |
0.0 | 0.5 | GO:0009959 | negative gravitropism(GO:0009959) |
0.0 | 0.2 | GO:0010821 | regulation of mitochondrion organization(GO:0010821) |
0.0 | 0.7 | GO:0009788 | negative regulation of abscisic acid-activated signaling pathway(GO:0009788) |
0.0 | 0.3 | GO:0005978 | glycogen biosynthetic process(GO:0005978) |
0.0 | 0.8 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.2 | GO:0080183 | response to photooxidative stress(GO:0080183) |
0.0 | 0.3 | GO:0009423 | chorismate biosynthetic process(GO:0009423) |
0.0 | 0.2 | GO:0046471 | phosphatidylglycerol biosynthetic process(GO:0006655) phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.3 | GO:0043574 | peroxisomal transport(GO:0043574) |
0.0 | 0.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) positive regulation of response to DNA damage stimulus(GO:2001022) |
0.0 | 0.0 | GO:0017145 | stem cell division(GO:0017145) |
0.0 | 0.3 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.2 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
0.0 | 0.3 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0009864 | induced systemic resistance, jasmonic acid mediated signaling pathway(GO:0009864) |
0.0 | 1.0 | GO:0009631 | cold acclimation(GO:0009631) |
0.0 | 1.5 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 1.2 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.2 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.5 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.3 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.7 | GO:0072599 | protein targeting to ER(GO:0045047) establishment of protein localization to endoplasmic reticulum(GO:0072599) |
0.0 | 0.3 | GO:0010030 | positive regulation of seed germination(GO:0010030) |
0.0 | 0.1 | GO:0010358 | leaf shaping(GO:0010358) |
0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.3 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
0.0 | 0.6 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 0.2 | GO:0046916 | cellular transition metal ion homeostasis(GO:0046916) |
0.0 | 0.0 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0042779 | termination of RNA polymerase III transcription(GO:0006386) tRNA 3'-trailer cleavage(GO:0042779) tRNA 3'-end processing(GO:0042780) |
0.0 | 1.6 | GO:0018209 | peptidyl-serine phosphorylation(GO:0018105) peptidyl-serine modification(GO:0018209) |
0.0 | 0.2 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
0.0 | 0.1 | GO:0031124 | mRNA 3'-end processing(GO:0031124) |
0.0 | 0.1 | GO:0006323 | DNA packaging(GO:0006323) |
0.0 | 0.2 | GO:1902074 | response to salt(GO:1902074) |
0.0 | 0.7 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.0 | 0.3 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA transport(GO:0051028) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.2 | GO:0046794 | movement in host(GO:0044000) multi-organism transport(GO:0044766) transport of virus in multicellular host(GO:0046739) transport of virus(GO:0046794) movement in other organism involved in symbiotic interaction(GO:0051814) movement in host environment(GO:0052126) movement in environment of other organism involved in symbiotic interaction(GO:0052192) multi-organism localization(GO:1902579) |
0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:0032886 | regulation of microtubule-based process(GO:0032886) |
0.0 | 0.3 | GO:0000165 | MAPK cascade(GO:0000165) |
0.0 | 0.6 | GO:0007166 | cell surface receptor signaling pathway(GO:0007166) |
0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.0 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.7 | GO:0016145 | S-glycoside catabolic process(GO:0016145) glycosinolate catabolic process(GO:0019759) glucosinolate catabolic process(GO:0019762) |
0.0 | 0.5 | GO:0000911 | cytokinesis by cell plate formation(GO:0000911) cytokinetic process(GO:0032506) mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:0046417 | chorismate metabolic process(GO:0046417) |
0.0 | 3.2 | GO:0016311 | dephosphorylation(GO:0016311) |
0.0 | 0.7 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.0 | 0.1 | GO:0048766 | root hair initiation(GO:0048766) |
0.0 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.0 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 4.5 | GO:0043043 | translation(GO:0006412) peptide biosynthetic process(GO:0043043) |
0.0 | 1.5 | GO:0010498 | proteasomal protein catabolic process(GO:0010498) |
0.0 | 0.0 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.1 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 3.5 | GO:0006366 | transcription from RNA polymerase II promoter(GO:0006366) |
0.0 | 0.1 | GO:0010206 | photosystem II repair(GO:0010206) |
0.0 | 0.7 | GO:0048544 | cell recognition(GO:0008037) recognition of pollen(GO:0048544) |
0.0 | 0.2 | GO:0010252 | auxin homeostasis(GO:0010252) |
0.0 | 0.1 | GO:0071588 | hydrogen peroxide mediated signaling pathway(GO:0071588) |
0.0 | 0.0 | GO:0043953 | protein transport by the Tat complex(GO:0043953) |
0.0 | 0.4 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.0 | 0.4 | GO:0043087 | regulation of GTPase activity(GO:0043087) |
0.0 | 0.1 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.4 | GO:0010007 | magnesium chelatase complex(GO:0010007) |
0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.7 | GO:0005712 | chiasma(GO:0005712) |
0.2 | 1.4 | GO:0030897 | HOPS complex(GO:0030897) |
0.2 | 0.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.2 | 1.0 | GO:0030141 | secretory granule(GO:0030141) |
0.2 | 1.5 | GO:0009840 | chloroplastic endopeptidase Clp complex(GO:0009840) |
0.2 | 1.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.2 | 1.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 0.5 | GO:0031897 | Tic complex(GO:0031897) |
0.2 | 1.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 0.5 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.2 | 3.0 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
0.2 | 1.6 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.9 | GO:0043078 | megasporocyte nucleus(GO:0043076) polar nucleus(GO:0043078) |
0.1 | 1.6 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.7 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.9 | GO:0090395 | plant cell papilla(GO:0090395) |
0.1 | 1.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.5 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
0.1 | 0.7 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 1.8 | GO:0009547 | plastid ribosome(GO:0009547) |
0.1 | 0.4 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 7.0 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
0.1 | 0.7 | GO:0009360 | DNA polymerase III complex(GO:0009360) |
0.1 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 2.4 | GO:0009508 | plastid chromosome(GO:0009508) |
0.1 | 2.8 | GO:0055028 | cortical microtubule(GO:0055028) |
0.1 | 0.3 | GO:0097196 | Shu complex(GO:0097196) |
0.1 | 0.5 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.1 | 0.5 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 0.6 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 1.8 | GO:0009574 | preprophase band(GO:0009574) |
0.1 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.7 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 0.6 | GO:0009533 | chloroplast stromal thylakoid(GO:0009533) |
0.1 | 0.6 | GO:0031380 | RNA-directed RNA polymerase complex(GO:0031379) nuclear RNA-directed RNA polymerase complex(GO:0031380) |
0.1 | 1.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.8 | GO:0000326 | storage vacuole(GO:0000322) protein storage vacuole(GO:0000326) |
0.1 | 0.9 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.0 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 2.1 | GO:0000419 | DNA-directed RNA polymerase V complex(GO:0000419) |
0.1 | 0.7 | GO:0009517 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
0.1 | 5.5 | GO:0031977 | thylakoid lumen(GO:0031977) |
0.1 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.8 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.7 | GO:0071556 | integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
0.1 | 0.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 1.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.5 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.7 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.6 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.2 | GO:0042709 | succinate-CoA ligase complex(GO:0042709) |
0.1 | 0.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 1.5 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.8 | GO:0009522 | photosystem I(GO:0009522) |
0.1 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.1 | GO:0031351 | intrinsic component of plastid membrane(GO:0031350) integral component of plastid membrane(GO:0031351) |
0.1 | 1.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.5 | GO:0005884 | actin filament(GO:0005884) |
0.1 | 0.3 | GO:0034515 | proteasome storage granule(GO:0034515) |
0.1 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.4 | GO:0030062 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.2 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 0.3 | GO:0031083 | BLOC complex(GO:0031082) BLOC-1 complex(GO:0031083) |
0.1 | 2.5 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 2.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.3 | GO:0030663 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
0.1 | 1.1 | GO:0042644 | chloroplast nucleoid(GO:0042644) |
0.1 | 0.7 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.1 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.5 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 0.8 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.6 | GO:0072686 | mitotic spindle(GO:0072686) |
0.1 | 0.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.6 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.5 | GO:0090544 | SWI/SNF complex(GO:0016514) BAF-type complex(GO:0090544) |
0.1 | 5.7 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.1 | 0.9 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.1 | 3.1 | GO:0031969 | chloroplast membrane(GO:0031969) |
0.0 | 1.0 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0098807 | chloroplast thylakoid membrane protein complex(GO:0098807) |
0.0 | 0.8 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.4 | GO:0010445 | nuclear dicing body(GO:0010445) |
0.0 | 3.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.4 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.4 | GO:0044436 | thylakoid part(GO:0044436) |
0.0 | 2.5 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 5.1 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.0 | 0.2 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.7 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 4.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 7.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.3 | GO:0000445 | transcription export complex(GO:0000346) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.5 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 15.2 | GO:0009941 | chloroplast envelope(GO:0009941) |
0.0 | 0.4 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 1.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.4 | GO:1903561 | extracellular organelle(GO:0043230) extracellular exosome(GO:0070062) extracellular vesicle(GO:1903561) |
0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0009532 | plastid stroma(GO:0009532) |
0.0 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.2 | GO:0034708 | methyltransferase complex(GO:0034708) |
0.0 | 0.1 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.0 | 0.3 | GO:0009654 | photosystem II oxygen evolving complex(GO:0009654) |
0.0 | 0.5 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.2 | GO:0032153 | cell division site(GO:0032153) |
0.0 | 0.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.3 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 3.0 | GO:0043656 | host(GO:0018995) host cell part(GO:0033643) host intracellular part(GO:0033646) host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) host cell nucleus(GO:0042025) intracellular region of host(GO:0043656) host cell(GO:0043657) other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 14.4 | GO:0044434 | chloroplast part(GO:0044434) |
0.0 | 0.9 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.3 | GO:0044445 | cytosolic part(GO:0044445) |
0.0 | 2.4 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 0.8 | GO:0000785 | chromatin(GO:0000785) |
0.0 | 0.3 | GO:0035838 | growing cell tip(GO:0035838) cell tip(GO:0051286) pollen tube tip(GO:0090404) |
0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
0.0 | 1.1 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.7 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.4 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.2 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.0 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:0005880 | nuclear microtubule(GO:0005880) |
0.0 | 2.9 | GO:0005768 | endosome(GO:0005768) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.1 | GO:0016630 | protochlorophyllide reductase activity(GO:0016630) |
0.9 | 2.8 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) nickel cation transmembrane transporter activity(GO:0015099) |
0.6 | 2.4 | GO:0015603 | iron chelate transmembrane transporter activity(GO:0015603) iron-nicotianamine transmembrane transporter activity(GO:0051980) |
0.6 | 2.2 | GO:0004350 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.4 | 2.4 | GO:0051002 | magnesium chelatase activity(GO:0016851) ligase activity, forming nitrogen-metal bonds(GO:0051002) ligase activity, forming nitrogen-metal bonds, forming coordination complexes(GO:0051003) |
0.4 | 3.3 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
0.4 | 1.1 | GO:0008883 | glutamyl-tRNA reductase activity(GO:0008883) |
0.4 | 1.1 | GO:0090422 | thiamine pyrophosphate transporter activity(GO:0090422) |
0.3 | 1.0 | GO:0046524 | sucrose-phosphate synthase activity(GO:0046524) |
0.3 | 1.0 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.3 | 0.9 | GO:0052592 | oxidoreductase activity, acting on CH or CH2 groups, with an iron-sulfur protein as acceptor(GO:0052592) |
0.3 | 3.4 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.3 | 1.8 | GO:0018708 | thiol S-methyltransferase activity(GO:0018708) |
0.3 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.3 | 0.9 | GO:0003864 | 3-methyl-2-oxobutanoate hydroxymethyltransferase activity(GO:0003864) |
0.3 | 1.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.3 | 1.5 | GO:0046624 | ceramide transporter activity(GO:0035620) sphingolipid transporter activity(GO:0046624) ceramide 1-phosphate binding(GO:1902387) ceramide 1-phosphate transporter activity(GO:1902388) |
0.3 | 0.9 | GO:0030941 | chloroplast targeting sequence binding(GO:0030941) |
0.3 | 0.9 | GO:0004528 | phosphodiesterase I activity(GO:0004528) double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.3 | 1.2 | GO:0004352 | glutamate dehydrogenase (NAD+) activity(GO:0004352) |
0.3 | 1.1 | GO:1990269 | phosphoserine binding(GO:0050815) RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
0.3 | 3.7 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.3 | 3.1 | GO:0016723 | ferric-chelate reductase activity(GO:0000293) oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.3 | 1.1 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.3 | 0.8 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.3 | 0.8 | GO:0016277 | [myelin basic protein]-arginine N-methyltransferase activity(GO:0016277) |
0.3 | 1.1 | GO:0008686 | GTP cyclohydrolase II activity(GO:0003935) 3,4-dihydroxy-2-butanone-4-phosphate synthase activity(GO:0008686) |
0.3 | 2.4 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
0.3 | 1.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.3 | 1.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.2 | 1.5 | GO:0019904 | protein domain specific binding(GO:0019904) |
0.2 | 0.5 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.2 | 0.2 | GO:0045547 | dehydrodolichyl diphosphate synthase activity(GO:0045547) |
0.2 | 1.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.2 | 0.9 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.2 | 1.4 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.2 | 0.9 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.2 | 0.9 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
0.2 | 0.6 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.2 | 1.3 | GO:0070547 | L-tyrosine:2-oxoglutarate aminotransferase activity(GO:0004838) L-tyrosine aminotransferase activity(GO:0070547) |
0.2 | 0.6 | GO:0080045 | quercetin 3'-O-glucosyltransferase activity(GO:0080045) |
0.2 | 2.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.2 | 2.1 | GO:0017022 | myosin binding(GO:0017022) |
0.2 | 1.4 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.2 | 1.0 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.2 | 1.2 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.2 | 5.5 | GO:0048029 | monosaccharide binding(GO:0048029) |
0.2 | 0.6 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.6 | GO:0043765 | T/G mismatch-specific endonuclease activity(GO:0043765) |
0.2 | 0.5 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.2 | 1.4 | GO:0016987 | core DNA-dependent RNA polymerase binding promoter specificity activity(GO:0000996) sigma factor activity(GO:0016987) |
0.2 | 0.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.2 | 0.5 | GO:0004742 | dihydrolipoyllysine-residue acetyltransferase activity(GO:0004742) S-acetyltransferase activity(GO:0016418) |
0.2 | 0.7 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 0.7 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.2 | 0.7 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
0.2 | 1.2 | GO:0005034 | osmosensor activity(GO:0005034) |
0.2 | 2.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 0.3 | GO:0010428 | methyl-CpNpG binding(GO:0010428) methyl-CpNpN binding(GO:0010429) |
0.2 | 0.5 | GO:0035671 | enone reductase activity(GO:0035671) |
0.2 | 1.4 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
0.2 | 1.3 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 0.5 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
0.2 | 3.0 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
0.2 | 0.8 | GO:0004473 | malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.2 | 0.5 | GO:0050997 | phosphatidylcholine binding(GO:0031210) quaternary ammonium group binding(GO:0050997) |
0.2 | 0.5 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
0.1 | 0.6 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
0.1 | 0.6 | GO:0070138 | ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.1 | 2.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 1.0 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.1 | 0.7 | GO:0004781 | sulfate adenylyltransferase (ATP) activity(GO:0004781) |
0.1 | 0.7 | GO:0080122 | AMP transmembrane transporter activity(GO:0080122) |
0.1 | 1.6 | GO:0043878 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (non-phosphorylating) activity(GO:0043878) |
0.1 | 1.7 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.7 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 1.8 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
0.1 | 0.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.9 | GO:0047274 | galactinol-sucrose galactosyltransferase activity(GO:0047274) |
0.1 | 0.7 | GO:1902417 | arsenite secondary active transmembrane transporter activity(GO:0008490) arsenite-transmembrane transporting ATPase activity(GO:0015446) anion transmembrane-transporting ATPase activity(GO:0043225) (+)-abscisic acid D-glucopyranosyl ester transmembrane transporter activity(GO:1902417) |
0.1 | 1.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 1.4 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 0.4 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.1 | 1.8 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 1.1 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.1 | 0.5 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.1 | 0.5 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.1 | 0.5 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
0.1 | 1.0 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 1.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 1.0 | GO:0010011 | auxin binding(GO:0010011) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.4 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.1 | 0.5 | GO:0003959 | NADPH dehydrogenase activity(GO:0003959) |
0.1 | 0.4 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.5 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
0.1 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 1.7 | GO:0016157 | sucrose synthase activity(GO:0016157) |
0.1 | 1.0 | GO:1904680 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
0.1 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.4 | GO:0004751 | ribose-5-phosphate isomerase activity(GO:0004751) |
0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.3 | GO:0042577 | sphingosine-1-phosphate phosphatase activity(GO:0042392) lipid phosphatase activity(GO:0042577) |
0.1 | 0.6 | GO:0004001 | adenosine kinase activity(GO:0004001) |
0.1 | 0.5 | GO:0045505 | dynein binding(GO:0045502) dynein intermediate chain binding(GO:0045505) dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.5 | GO:0010277 | chlorophyllide a oxygenase [overall] activity(GO:0010277) |
0.1 | 0.7 | GO:0046030 | inositol trisphosphate phosphatase activity(GO:0046030) |
0.1 | 3.6 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.1 | 0.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 1.1 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.7 | GO:0051018 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
0.1 | 0.6 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.9 | GO:0000400 | DNA secondary structure binding(GO:0000217) four-way junction DNA binding(GO:0000400) |
0.1 | 1.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.5 | GO:0051740 | ethylene receptor activity(GO:0038199) ethylene binding(GO:0051740) alkene binding(GO:0072328) |
0.1 | 0.6 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.1 | 0.3 | GO:0036381 | glutaminase activity(GO:0004359) pyridoxal 5'-phosphate synthase (glutamine hydrolysing) activity(GO:0036381) |
0.1 | 1.3 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.1 | 1.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.4 | GO:0000035 | acyl binding(GO:0000035) |
0.1 | 0.4 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) protein C-terminal S-isoprenylcysteine carboxyl O-methyltransferase activity(GO:0004671) |
0.1 | 1.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.3 | GO:0008839 | 4-hydroxy-tetrahydrodipicolinate reductase(GO:0008839) |
0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.3 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
0.1 | 0.5 | GO:0080041 | ADP-sugar diphosphatase activity(GO:0019144) ADP-ribose pyrophosphohydrolase activity(GO:0080041) |
0.1 | 0.6 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.1 | 0.6 | GO:0052853 | very-long-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052852) long-chain-(S)-2-hydroxy-long-chain-acid oxidase activity(GO:0052853) medium-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052854) |
0.1 | 0.2 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
0.1 | 0.9 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 3.8 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 0.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.2 | GO:1901474 | azole transmembrane transporter activity(GO:1901474) |
0.1 | 0.3 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.1 | 1.1 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.1 | 1.4 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.5 | GO:0050551 | myrcene synthase activity(GO:0050551) |
0.1 | 0.9 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.1 | 0.2 | GO:0047912 | galacturonokinase activity(GO:0047912) |
0.1 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.4 | GO:0003863 | 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.1 | 1.6 | GO:0016168 | chlorophyll binding(GO:0016168) |
0.1 | 0.9 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 1.2 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) |
0.1 | 1.0 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.1 | 1.6 | GO:0060090 | binding, bridging(GO:0060090) |
0.1 | 0.8 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.4 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
0.1 | 0.2 | GO:0070678 | preprotein binding(GO:0070678) |
0.1 | 1.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) ion gated channel activity(GO:0022839) |
0.1 | 0.8 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.8 | GO:0004673 | protein histidine kinase activity(GO:0004673) phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.1 | 0.2 | GO:0004775 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) succinate-CoA ligase (GDP-forming) activity(GO:0004776) |
0.1 | 0.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.5 | GO:0004567 | beta-mannosidase activity(GO:0004567) |
0.1 | 0.5 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.6 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.1 | 1.1 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.5 | GO:0003830 | beta-1,4-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0003830) |
0.1 | 0.3 | GO:0031409 | pigment binding(GO:0031409) |
0.1 | 0.9 | GO:0016208 | AMP binding(GO:0016208) |
0.1 | 0.3 | GO:0031956 | medium-chain fatty acid-CoA ligase activity(GO:0031956) |
0.1 | 1.2 | GO:0016844 | strictosidine synthase activity(GO:0016844) |
0.1 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 1.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.7 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.1 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.1 | 0.5 | GO:0043142 | ATP-dependent DNA helicase activity(GO:0004003) ATP-dependent helicase activity(GO:0008026) single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) single-stranded DNA-dependent ATPase activity(GO:0043142) purine NTP-dependent helicase activity(GO:0070035) |
0.1 | 0.4 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.4 | GO:0045431 | flavonol synthase activity(GO:0045431) |
0.1 | 0.1 | GO:0080146 | L-cysteine desulfhydrase activity(GO:0080146) |
0.1 | 0.5 | GO:0000095 | S-adenosyl-L-methionine transmembrane transporter activity(GO:0000095) coenzyme transporter activity(GO:0051185) |
0.1 | 0.7 | GO:0010329 | auxin efflux transmembrane transporter activity(GO:0010329) |
0.1 | 0.2 | GO:0004820 | glycine-tRNA ligase activity(GO:0004820) |
0.1 | 0.3 | GO:0050017 | L-3-cyanoalanine synthase activity(GO:0050017) |
0.1 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 2.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.1 | 0.3 | GO:0010179 | IAA-Ala conjugate hydrolase activity(GO:0010179) |
0.1 | 0.7 | GO:0016207 | 4-coumarate-CoA ligase activity(GO:0016207) |
0.1 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.8 | GO:0030955 | pyruvate kinase activity(GO:0004743) potassium ion binding(GO:0030955) alkali metal ion binding(GO:0031420) |
0.1 | 0.2 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.1 | 0.2 | GO:0019172 | glyoxalase III activity(GO:0019172) |
0.1 | 0.5 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.9 | GO:0042300 | beta-amyrin synthase activity(GO:0042300) |
0.1 | 0.7 | GO:0003825 | alpha,alpha-trehalose-phosphate synthase (UDP-forming) activity(GO:0003825) |
0.1 | 0.3 | GO:0030527 | structural constituent of chromatin(GO:0030527) |
0.1 | 0.6 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.1 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.3 | GO:0031683 | G-protein coupled receptor binding(GO:0001664) G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.3 | GO:0003913 | DNA photolyase activity(GO:0003913) |
0.1 | 3.1 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 1.8 | GO:0044212 | regulatory region DNA binding(GO:0000975) transcription regulatory region sequence-specific DNA binding(GO:0000976) regulatory region nucleic acid binding(GO:0001067) transcription regulatory region DNA binding(GO:0044212) |
0.1 | 0.2 | GO:0009678 | hydrogen-translocating pyrophosphatase activity(GO:0009678) |
0.1 | 1.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.3 | GO:0015288 | porin activity(GO:0015288) wide pore channel activity(GO:0022829) |
0.0 | 3.0 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.3 | GO:0004123 | cystathionine gamma-lyase activity(GO:0004123) |
0.0 | 2.0 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.0 | 0.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.2 | GO:0033862 | UMP kinase activity(GO:0033862) |
0.0 | 1.3 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 6.0 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 1.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 3.1 | GO:0004650 | polygalacturonase activity(GO:0004650) |
0.0 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.5 | GO:0016161 | beta-amylase activity(GO:0016161) |
0.0 | 0.4 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
0.0 | 0.5 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.3 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.7 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.5 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.6 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 2.8 | GO:0000989 | transcription factor activity, transcription factor binding(GO:0000989) transcription cofactor activity(GO:0003712) |
0.0 | 0.2 | GO:0015136 | sialic acid transmembrane transporter activity(GO:0015136) |
0.0 | 2.6 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 0.1 | GO:0015152 | hexose phosphate transmembrane transporter activity(GO:0015119) glucose-6-phosphate transmembrane transporter activity(GO:0015152) triose-phosphate transmembrane transporter activity(GO:0071917) |
0.0 | 0.2 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.3 | GO:0004739 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 9.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 1.3 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.0 | 0.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 2.2 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 2.0 | GO:0102483 | scopolin beta-glucosidase activity(GO:0102483) |
0.0 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 1.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.3 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.0 | 0.1 | GO:0070283 | radical SAM enzyme activity(GO:0070283) |
0.0 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 2.1 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.2 | GO:0000988 | transcription factor activity, protein binding(GO:0000988) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0010295 | (+)-abscisic acid 8'-hydroxylase activity(GO:0010295) |
0.0 | 2.4 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.2 | GO:0008878 | glucose-1-phosphate adenylyltransferase activity(GO:0008878) |
0.0 | 0.2 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.0 | 0.2 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 4.1 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.0 | 0.3 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.0 | 0.4 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.0 | 0.2 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
0.0 | 0.2 | GO:0016464 | chloroplast protein-transporting ATPase activity(GO:0016464) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0080104 | 3-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080102) 5-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080104) 7-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080106) |
0.0 | 0.1 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0004549 | ribonuclease P activity(GO:0004526) tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.9 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.1 | GO:0034432 | bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.9 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
0.0 | 1.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.5 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.1 | GO:0004106 | chorismate mutase activity(GO:0004106) |
0.0 | 0.1 | GO:0050734 | hydroxycinnamoyltransferase activity(GO:0050734) |
0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 1.2 | GO:0010857 | calmodulin-dependent protein kinase activity(GO:0004683) calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0016621 | cinnamoyl-CoA reductase activity(GO:0016621) |
0.0 | 0.9 | GO:0019208 | phosphatase regulator activity(GO:0019208) protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.2 | GO:0033926 | glycopeptide alpha-N-acetylgalactosaminidase activity(GO:0033926) |
0.0 | 0.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 1.8 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.1 | GO:0033744 | L-methionine:thioredoxin-disulfide S-oxidoreductase activity(GO:0033744) L-methionine-(S)-S-oxide reductase activity(GO:0036456) |
0.0 | 0.1 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) |
0.0 | 0.1 | GO:0045156 | electron transporter, transferring electrons within the cyclic electron transport pathway of photosynthesis activity(GO:0045156) |
0.0 | 3.1 | GO:0042803 | protein homodimerization activity(GO:0042803) |
0.0 | 0.1 | GO:0047158 | sinapoylglucose-sinapoylglucose O-sinapoyltransferase activity(GO:0047158) |
0.0 | 0.1 | GO:0010313 | phytochrome binding(GO:0010313) |
0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0003848 | 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine diphosphokinase activity(GO:0003848) dihydropteroate synthase activity(GO:0004156) |
0.0 | 0.3 | GO:0051219 | protein phosphorylated amino acid binding(GO:0045309) phosphoprotein binding(GO:0051219) |
0.0 | 0.2 | GO:0052381 | tRNA dimethylallyltransferase activity(GO:0052381) |
0.0 | 2.6 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.1 | GO:0004831 | tyrosine-tRNA ligase activity(GO:0004831) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.6 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.6 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.2 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.1 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.3 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.3 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.6 | GO:0000156 | phosphorelay response regulator activity(GO:0000156) |
0.0 | 2.2 | GO:0043492 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) ATPase activity, coupled to transmembrane movement of substances(GO:0042626) ATPase activity, coupled to movement of substances(GO:0043492) |
0.0 | 0.1 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
0.0 | 1.3 | GO:0004519 | endonuclease activity(GO:0004519) |
0.0 | 0.7 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 0.2 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 1.9 | GO:0008092 | cytoskeletal protein binding(GO:0008092) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 21.9 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.0 | 0.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.4 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.1 | GO:0016819 | hydrolase activity, acting on acid anhydrides, in sulfonyl-containing anhydrides(GO:0016819) adenylylsulfatase activity(GO:0047627) |
0.0 | 0.1 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.5 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 1.4 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.1 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 1.6 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.7 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0033925 | mannosyl-glycoprotein endo-beta-N-acetylglucosaminidase activity(GO:0033925) |
0.0 | 0.7 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.2 | 0.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.2 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.2 | 0.6 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 0.7 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.2 | 0.7 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.2 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 0.7 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.1 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.3 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.3 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.0 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.3 | 1.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.3 | 1.3 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.2 | 0.7 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.2 | 0.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.2 | 0.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.2 | 1.1 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.2 | 0.5 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.1 | 0.6 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.1 | 0.3 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.1 | 0.3 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.1 | 1.8 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 0.5 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.7 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.2 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 0.2 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.1 | 0.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.9 | REACTOME TRANSMEMBRANE TRANSPORT OF SMALL MOLECULES | Genes involved in Transmembrane transport of small molecules |
0.1 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 1.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.2 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.1 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |