ENCODE cell lines, expression (Ernst 2011)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
KLF1
|
ENSG00000105610.4 | KLF1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
KLF1 | hg19_v2_chr19_-_12997995_12998021 | -0.46 | 7.0e-02 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr10_+_17272608 | 12.15 |
ENST00000421459.2 |
VIM |
vimentin |
chr10_+_47746929 | 11.48 |
ENST00000340243.6 ENST00000374277.5 ENST00000449464.2 ENST00000538825.1 ENST00000335083.5 |
ANXA8L2 AL603965.1 |
annexin A8-like 2 Protein LOC100996760 |
chr10_-_47173994 | 11.39 |
ENST00000414655.2 ENST00000545298.1 ENST00000359178.4 ENST00000358140.4 ENST00000503031.1 |
ANXA8L1 LINC00842 |
annexin A8-like 1 long intergenic non-protein coding RNA 842 |
chr1_-_151965048 | 9.26 |
ENST00000368809.1 |
S100A10 |
S100 calcium binding protein A10 |
chr17_-_1619535 | 8.48 |
ENST00000573075.1 ENST00000574306.1 |
MIR22HG |
MIR22 host gene (non-protein coding) |
chr2_+_173292301 | 8.27 |
ENST00000264106.6 ENST00000375221.2 ENST00000343713.4 |
ITGA6 |
integrin, alpha 6 |
chr22_+_38071615 | 8.18 |
ENST00000215909.5 |
LGALS1 |
lectin, galactoside-binding, soluble, 1 |
chr17_-_1619491 | 8.11 |
ENST00000570416.1 ENST00000575626.1 ENST00000610106.1 ENST00000608198.1 ENST00000609442.1 ENST00000334146.3 ENST00000576489.1 ENST00000608245.1 ENST00000609398.1 ENST00000608913.1 ENST00000574016.1 ENST00000571091.1 ENST00000573127.1 ENST00000609990.1 ENST00000576749.1 |
MIR22HG |
MIR22 host gene (non-protein coding) |
chr19_-_51522955 | 7.78 |
ENST00000358789.3 |
KLK10 |
kallikrein-related peptidase 10 |
chr1_-_153508460 | 7.69 |
ENST00000462776.2 |
S100A6 |
S100 calcium binding protein A6 |
chr7_+_134430212 | 7.62 |
ENST00000436461.2 |
CALD1 |
caldesmon 1 |
chr7_-_80548667 | 6.94 |
ENST00000265361.3 |
SEMA3C |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3C |
chr8_-_42065187 | 6.75 |
ENST00000270189.6 ENST00000352041.3 ENST00000220809.4 |
PLAT |
plasminogen activator, tissue |
chr2_+_173292280 | 6.62 |
ENST00000264107.7 |
ITGA6 |
integrin, alpha 6 |
chr2_+_173292390 | 6.38 |
ENST00000442250.1 ENST00000458358.1 ENST00000409080.1 |
ITGA6 |
integrin, alpha 6 |
chr18_+_21452804 | 6.24 |
ENST00000269217.6 |
LAMA3 |
laminin, alpha 3 |
chr8_-_101963482 | 6.20 |
ENST00000419477.2 |
YWHAZ |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta |
chr19_+_35606692 | 5.82 |
ENST00000406242.3 ENST00000454903.2 |
FXYD3 |
FXYD domain containing ion transport regulator 3 |
chr15_-_60690163 | 5.81 |
ENST00000558998.1 ENST00000560165.1 ENST00000557986.1 ENST00000559780.1 ENST00000559467.1 ENST00000559956.1 ENST00000332680.4 ENST00000396024.3 ENST00000421017.2 ENST00000560466.1 ENST00000558132.1 ENST00000559113.1 ENST00000557906.1 ENST00000558558.1 ENST00000560468.1 ENST00000559370.1 ENST00000558169.1 ENST00000559725.1 ENST00000558985.1 ENST00000451270.2 |
ANXA2 |
annexin A2 |
chr12_-_8815299 | 5.55 |
ENST00000535336.1 |
MFAP5 |
microfibrillar associated protein 5 |
chr6_-_138428613 | 5.37 |
ENST00000421351.3 |
PERP |
PERP, TP53 apoptosis effector |
chr18_+_21452964 | 5.31 |
ENST00000587184.1 |
LAMA3 |
laminin, alpha 3 |
chr15_+_90931450 | 5.28 |
ENST00000268182.5 ENST00000560738.1 ENST00000560418.1 |
IQGAP1 |
IQ motif containing GTPase activating protein 1 |
chr12_-_8815215 | 5.23 |
ENST00000544889.1 ENST00000543369.1 |
MFAP5 |
microfibrillar associated protein 5 |
chr19_+_35607166 | 5.08 |
ENST00000604255.1 ENST00000346446.5 ENST00000344013.6 ENST00000603449.1 ENST00000406988.1 ENST00000605550.1 ENST00000604804.1 ENST00000605552.1 |
FXYD3 |
FXYD domain containing ion transport regulator 3 |
chr11_-_62521614 | 5.08 |
ENST00000527994.1 ENST00000394807.3 |
ZBTB3 |
zinc finger and BTB domain containing 3 |
chr1_-_94147385 | 5.05 |
ENST00000260502.6 |
BCAR3 |
breast cancer anti-estrogen resistance 3 |
chr15_+_43985084 | 4.96 |
ENST00000434505.1 ENST00000411750.1 |
CKMT1A |
creatine kinase, mitochondrial 1A |
chr13_-_45010939 | 4.75 |
ENST00000261489.2 |
TSC22D1 |
TSC22 domain family, member 1 |
chr12_-_8815404 | 4.74 |
ENST00000359478.2 ENST00000396549.2 |
MFAP5 |
microfibrillar associated protein 5 |
chr19_+_35606777 | 4.63 |
ENST00000604404.1 ENST00000435734.2 ENST00000603181.1 |
FXYD3 |
FXYD domain containing ion transport regulator 3 |
chr2_-_166651191 | 4.48 |
ENST00000392701.3 |
GALNT3 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 3 (GalNAc-T3) |
chr2_-_85637459 | 4.47 |
ENST00000409921.1 |
CAPG |
capping protein (actin filament), gelsolin-like |
chr16_+_31483374 | 4.43 |
ENST00000394863.3 |
TGFB1I1 |
transforming growth factor beta 1 induced transcript 1 |
chr18_+_29027696 | 4.41 |
ENST00000257189.4 |
DSG3 |
desmoglein 3 |
chr15_+_43885252 | 4.40 |
ENST00000453782.1 ENST00000300283.6 ENST00000437924.1 ENST00000450086.2 |
CKMT1B |
creatine kinase, mitochondrial 1B |
chr8_-_145018080 | 4.34 |
ENST00000354589.3 |
PLEC |
plectin |
chr17_-_7493390 | 4.33 |
ENST00000538513.2 ENST00000570788.1 ENST00000250055.2 |
SOX15 |
SRY (sex determining region Y)-box 15 |
chr16_+_31483451 | 4.33 |
ENST00000565360.1 ENST00000361773.3 |
TGFB1I1 |
transforming growth factor beta 1 induced transcript 1 |
chr17_-_74707037 | 4.28 |
ENST00000355797.3 ENST00000375036.2 ENST00000449428.2 |
MXRA7 |
matrix-remodelling associated 7 |
chrX_-_3264682 | 4.07 |
ENST00000217939.6 |
MXRA5 |
matrix-remodelling associated 5 |
chr1_+_27189631 | 4.04 |
ENST00000339276.4 |
SFN |
stratifin |
chr1_-_33168336 | 4.03 |
ENST00000373484.3 |
SYNC |
syncoilin, intermediate filament protein |
chr8_-_101962777 | 3.99 |
ENST00000395951.3 |
YWHAZ |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta |
chr12_-_85306594 | 3.98 |
ENST00000266682.5 |
SLC6A15 |
solute carrier family 6 (neutral amino acid transporter), member 15 |
chr6_+_7541808 | 3.94 |
ENST00000379802.3 |
DSP |
desmoplakin |
chr2_-_219151487 | 3.83 |
ENST00000444881.1 |
TMBIM1 |
transmembrane BAX inhibitor motif containing 1 |
chr4_-_90756769 | 3.78 |
ENST00000345009.4 ENST00000505199.1 ENST00000502987.1 |
SNCA |
synuclein, alpha (non A4 component of amyloid precursor) |
chr17_-_39553844 | 3.64 |
ENST00000251645.2 |
KRT31 |
keratin 31 |
chr17_-_40575535 | 3.56 |
ENST00000357037.5 |
PTRF |
polymerase I and transcript release factor |
chr13_+_73632897 | 3.55 |
ENST00000377687.4 |
KLF5 |
Kruppel-like factor 5 (intestinal) |
chr1_+_44398943 | 3.54 |
ENST00000372359.5 ENST00000414809.3 |
ARTN |
artemin |
chr19_-_51523275 | 3.37 |
ENST00000309958.3 |
KLK10 |
kallikrein-related peptidase 10 |
chr2_-_158732340 | 3.35 |
ENST00000539637.1 ENST00000413751.1 ENST00000434821.1 ENST00000424669.1 |
ACVR1 |
activin A receptor, type I |
chr22_-_36357671 | 3.27 |
ENST00000408983.2 |
RBFOX2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
chr19_-_51523412 | 3.21 |
ENST00000391805.1 ENST00000599077.1 |
KLK10 |
kallikrein-related peptidase 10 |
chr1_+_44399466 | 2.94 |
ENST00000498139.2 ENST00000491846.1 |
ARTN |
artemin |
chr14_-_105635090 | 2.92 |
ENST00000331782.3 ENST00000347004.2 |
JAG2 |
jagged 2 |
chr3_-_127542021 | 2.91 |
ENST00000434178.2 |
MGLL |
monoglyceride lipase |
chr5_+_95998746 | 2.89 |
ENST00000508608.1 |
CAST |
calpastatin |
chr1_-_117210290 | 2.82 |
ENST00000369483.1 ENST00000369486.3 |
IGSF3 |
immunoglobulin superfamily, member 3 |
chr3_-_49449350 | 2.75 |
ENST00000454011.2 ENST00000445425.1 ENST00000422781.1 |
RHOA |
ras homolog family member A |
chr7_+_17338239 | 2.74 |
ENST00000242057.4 |
AHR |
aryl hydrocarbon receptor |
chr17_-_1389228 | 2.71 |
ENST00000438665.2 |
MYO1C |
myosin IC |
chr1_+_165600436 | 2.68 |
ENST00000367888.4 ENST00000367885.1 ENST00000367884.2 |
MGST3 |
microsomal glutathione S-transferase 3 |
chr12_+_54332535 | 2.65 |
ENST00000243056.3 |
HOXC13 |
homeobox C13 |
chr22_+_31477296 | 2.65 |
ENST00000426927.1 ENST00000440425.1 ENST00000358743.1 ENST00000347557.2 ENST00000333137.7 |
SMTN |
smoothelin |
chr8_-_67525473 | 2.64 |
ENST00000522677.3 |
MYBL1 |
v-myb avian myeloblastosis viral oncogene homolog-like 1 |
chr19_-_42463418 | 2.63 |
ENST00000600292.1 ENST00000601078.1 ENST00000601891.1 ENST00000222008.6 |
RABAC1 |
Rab acceptor 1 (prenylated) |
chr3_+_49449636 | 2.58 |
ENST00000273590.3 |
TCTA |
T-cell leukemia translocation altered |
chr1_+_165600083 | 2.56 |
ENST00000367889.3 |
MGST3 |
microsomal glutathione S-transferase 3 |
chrX_+_54834791 | 2.56 |
ENST00000218439.4 ENST00000375058.1 ENST00000375060.1 |
MAGED2 |
melanoma antigen family D, 2 |
chr1_+_145575980 | 2.55 |
ENST00000393045.2 |
PIAS3 |
protein inhibitor of activated STAT, 3 |
chr16_+_67233007 | 2.54 |
ENST00000360833.1 ENST00000393997.2 |
ELMO3 |
engulfment and cell motility 3 |
chrX_-_153151586 | 2.53 |
ENST00000370060.1 ENST00000370055.1 ENST00000420165.1 |
L1CAM |
L1 cell adhesion molecule |
chr2_-_26205340 | 2.53 |
ENST00000264712.3 |
KIF3C |
kinesin family member 3C |
chr1_+_145576007 | 2.51 |
ENST00000369298.1 |
PIAS3 |
protein inhibitor of activated STAT, 3 |
chr6_-_84140757 | 2.50 |
ENST00000541327.1 ENST00000369705.3 ENST00000543031.1 |
ME1 |
malic enzyme 1, NADP(+)-dependent, cytosolic |
chr17_-_1389419 | 2.50 |
ENST00000575158.1 |
MYO1C |
myosin IC |
chr6_+_30850697 | 2.47 |
ENST00000509639.1 ENST00000412274.2 ENST00000507901.1 ENST00000507046.1 ENST00000437124.2 ENST00000454612.2 ENST00000396342.2 |
DDR1 |
discoidin domain receptor tyrosine kinase 1 |
chr20_+_33759854 | 2.39 |
ENST00000216968.4 |
PROCR |
protein C receptor, endothelial |
chr3_+_33318914 | 2.38 |
ENST00000484457.1 ENST00000538892.1 ENST00000538181.1 ENST00000446237.3 ENST00000507198.1 |
FBXL2 |
F-box and leucine-rich repeat protein 2 |
chr2_-_222436988 | 2.38 |
ENST00000409854.1 ENST00000281821.2 ENST00000392071.4 ENST00000443796.1 |
EPHA4 |
EPH receptor A4 |
chr1_-_59249732 | 2.32 |
ENST00000371222.2 |
JUN |
jun proto-oncogene |
chr5_+_95998070 | 2.29 |
ENST00000421689.2 ENST00000510756.1 ENST00000512620.1 |
CAST |
calpastatin |
chrX_-_23761317 | 2.25 |
ENST00000492081.1 ENST00000379303.5 ENST00000336430.7 |
ACOT9 |
acyl-CoA thioesterase 9 |
chr3_-_49449521 | 2.22 |
ENST00000431929.1 ENST00000418115.1 |
RHOA |
ras homolog family member A |
chr1_-_159893507 | 2.21 |
ENST00000368096.1 |
TAGLN2 |
transgelin 2 |
chr8_+_26435359 | 2.19 |
ENST00000311151.5 |
DPYSL2 |
dihydropyrimidinase-like 2 |
chr1_-_113249734 | 2.16 |
ENST00000484054.3 ENST00000369636.2 ENST00000369637.1 ENST00000285735.2 ENST00000369638.2 |
RHOC |
ras homolog family member C |
chr1_-_43833628 | 2.07 |
ENST00000413844.2 ENST00000372458.3 |
ELOVL1 |
ELOVL fatty acid elongase 1 |
chr2_+_85360499 | 2.04 |
ENST00000282111.3 |
TCF7L1 |
transcription factor 7-like 1 (T-cell specific, HMG-box) |
chr2_+_102314161 | 2.04 |
ENST00000425019.1 |
MAP4K4 |
mitogen-activated protein kinase kinase kinase kinase 4 |
chr2_+_201171372 | 2.02 |
ENST00000409140.3 |
SPATS2L |
spermatogenesis associated, serine-rich 2-like |
chr2_+_85132749 | 2.01 |
ENST00000233143.4 |
TMSB10 |
thymosin beta 10 |
chr10_-_99447024 | 2.00 |
ENST00000370626.3 |
AVPI1 |
arginine vasopressin-induced 1 |
chr9_+_137533615 | 2.00 |
ENST00000371817.3 |
COL5A1 |
collagen, type V, alpha 1 |
chr17_+_7210921 | 1.98 |
ENST00000573542.1 |
EIF5A |
eukaryotic translation initiation factor 5A |
chr2_+_219081817 | 1.97 |
ENST00000315717.5 ENST00000420104.1 ENST00000295685.10 |
ARPC2 |
actin related protein 2/3 complex, subunit 2, 34kDa |
chr16_+_89989687 | 1.94 |
ENST00000315491.7 ENST00000555576.1 ENST00000554336.1 ENST00000553967.1 |
TUBB3 |
Tubulin beta-3 chain |
chr3_+_50192499 | 1.93 |
ENST00000413852.1 |
SEMA3F |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F |
chrX_+_12993202 | 1.92 |
ENST00000451311.2 ENST00000380636.1 |
TMSB4X |
thymosin beta 4, X-linked |
chr8_-_143867946 | 1.87 |
ENST00000301263.4 |
LY6D |
lymphocyte antigen 6 complex, locus D |
chr3_+_50192537 | 1.85 |
ENST00000002829.3 |
SEMA3F |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F |
chr16_-_31147020 | 1.83 |
ENST00000568261.1 ENST00000567797.1 ENST00000317508.6 |
PRSS8 |
protease, serine, 8 |
chr14_-_103523745 | 1.83 |
ENST00000361246.2 |
CDC42BPB |
CDC42 binding protein kinase beta (DMPK-like) |
chr6_+_33589161 | 1.82 |
ENST00000605930.1 |
ITPR3 |
inositol 1,4,5-trisphosphate receptor, type 3 |
chr18_-_48723690 | 1.79 |
ENST00000406189.3 |
MEX3C |
mex-3 RNA binding family member C |
chr2_-_110371664 | 1.78 |
ENST00000545389.1 ENST00000423520.1 |
SEPT10 |
septin 10 |
chr12_-_58131931 | 1.77 |
ENST00000547588.1 |
AGAP2 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 2 |
chr1_-_185286461 | 1.74 |
ENST00000367498.3 |
IVNS1ABP |
influenza virus NS1A binding protein |
chr1_+_40505891 | 1.74 |
ENST00000372797.3 ENST00000372802.1 ENST00000449311.1 |
CAP1 |
CAP, adenylate cyclase-associated protein 1 (yeast) |
chr11_-_64014379 | 1.73 |
ENST00000309318.3 |
PPP1R14B |
protein phosphatase 1, regulatory (inhibitor) subunit 14B |
chr12_-_125398602 | 1.70 |
ENST00000541272.1 ENST00000535131.1 |
UBC |
ubiquitin C |
chr4_+_146403912 | 1.68 |
ENST00000507367.1 ENST00000394092.2 ENST00000515385.1 |
SMAD1 |
SMAD family member 1 |
chr1_-_113249678 | 1.66 |
ENST00000369633.2 ENST00000425265.2 ENST00000369632.2 ENST00000436685.2 |
RHOC |
ras homolog family member C |
chr17_-_39942940 | 1.64 |
ENST00000310706.5 ENST00000393931.3 ENST00000424457.1 ENST00000591690.1 |
JUP |
junction plakoglobin |
chr17_+_7210852 | 1.62 |
ENST00000576930.1 |
EIF5A |
eukaryotic translation initiation factor 5A |
chr12_+_48516357 | 1.57 |
ENST00000549022.1 ENST00000547587.1 ENST00000312352.7 |
PFKM |
phosphofructokinase, muscle |
chr13_+_102104952 | 1.54 |
ENST00000376180.3 |
ITGBL1 |
integrin, beta-like 1 (with EGF-like repeat domains) |
chr1_-_113249948 | 1.53 |
ENST00000339083.7 ENST00000369642.3 |
RHOC |
ras homolog family member C |
chr9_+_35732312 | 1.53 |
ENST00000353704.2 |
CREB3 |
cAMP responsive element binding protein 3 |
chr3_+_50273625 | 1.48 |
ENST00000536647.1 |
GNAI2 |
guanine nucleotide binding protein (G protein), alpha inhibiting activity polypeptide 2 |
chr12_-_125398654 | 1.47 |
ENST00000541645.1 ENST00000540351.1 |
UBC |
ubiquitin C |
chr19_+_54695098 | 1.46 |
ENST00000396388.2 |
TSEN34 |
TSEN34 tRNA splicing endonuclease subunit |
chr12_-_8815477 | 1.44 |
ENST00000433590.2 |
MFAP5 |
microfibrillar associated protein 5 |
chr1_-_117664317 | 1.42 |
ENST00000256649.4 ENST00000369464.3 ENST00000485032.1 |
TRIM45 |
tripartite motif containing 45 |
chr13_+_102104980 | 1.37 |
ENST00000545560.2 |
ITGBL1 |
integrin, beta-like 1 (with EGF-like repeat domains) |
chr2_-_55237484 | 1.36 |
ENST00000394609.2 |
RTN4 |
reticulon 4 |
chr5_-_16617162 | 1.35 |
ENST00000306320.9 |
FAM134B |
family with sequence similarity 134, member B |
chr10_+_99258625 | 1.34 |
ENST00000370664.3 |
UBTD1 |
ubiquitin domain containing 1 |
chr14_-_21979428 | 1.34 |
ENST00000538267.1 ENST00000298717.4 |
METTL3 |
methyltransferase like 3 |
chr8_-_101963677 | 1.34 |
ENST00000395956.3 ENST00000395953.2 |
YWHAZ |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta |
chr17_-_57184260 | 1.34 |
ENST00000376149.3 ENST00000393066.3 |
TRIM37 |
tripartite motif containing 37 |
chr5_+_82767583 | 1.33 |
ENST00000512590.2 ENST00000513960.1 ENST00000513984.1 ENST00000502527.2 |
VCAN |
versican |
chr3_-_48632593 | 1.32 |
ENST00000454817.1 ENST00000328333.8 |
COL7A1 |
collagen, type VII, alpha 1 |
chr20_+_44035200 | 1.32 |
ENST00000372717.1 ENST00000360981.4 |
DBNDD2 |
dysbindin (dystrobrevin binding protein 1) domain containing 2 |
chr12_+_26274917 | 1.31 |
ENST00000538142.1 |
SSPN |
sarcospan |
chr4_+_26585538 | 1.30 |
ENST00000264866.4 |
TBC1D19 |
TBC1 domain family, member 19 |
chr7_+_35840542 | 1.29 |
ENST00000435235.1 ENST00000399034.2 ENST00000350320.6 ENST00000469679.2 |
SEPT7 |
septin 7 |
chr1_-_153958805 | 1.26 |
ENST00000368575.3 |
RAB13 |
RAB13, member RAS oncogene family |
chr17_-_66453562 | 1.24 |
ENST00000262139.5 ENST00000546360.1 |
WIPI1 |
WD repeat domain, phosphoinositide interacting 1 |
chr14_+_93260569 | 1.24 |
ENST00000163416.2 |
GOLGA5 |
golgin A5 |
chr3_-_168864427 | 1.24 |
ENST00000468789.1 |
MECOM |
MDS1 and EVI1 complex locus |
chr18_-_28682374 | 1.23 |
ENST00000280904.6 |
DSC2 |
desmocollin 2 |
chr7_+_35840819 | 1.23 |
ENST00000399035.3 |
SEPT7 |
septin 7 |
chr3_-_48130314 | 1.23 |
ENST00000439356.1 ENST00000395734.3 ENST00000426837.2 |
MAP4 |
microtubule-associated protein 4 |
chr8_+_22423168 | 1.17 |
ENST00000518912.1 ENST00000428103.1 |
SORBS3 |
sorbin and SH3 domain containing 3 |
chr19_-_47349395 | 1.16 |
ENST00000597020.1 |
AP2S1 |
adaptor-related protein complex 2, sigma 1 subunit |
chr2_-_55276320 | 1.15 |
ENST00000357376.3 |
RTN4 |
reticulon 4 |
chr17_+_46125707 | 1.14 |
ENST00000584137.1 ENST00000362042.3 ENST00000585291.1 ENST00000357480.5 |
NFE2L1 |
nuclear factor, erythroid 2-like 1 |
chr11_+_1860832 | 1.13 |
ENST00000252898.7 |
TNNI2 |
troponin I type 2 (skeletal, fast) |
chr15_-_64995399 | 1.09 |
ENST00000559753.1 ENST00000560258.2 ENST00000559912.2 ENST00000326005.6 |
OAZ2 |
ornithine decarboxylase antizyme 2 |
chr3_+_8775466 | 1.09 |
ENST00000343849.2 ENST00000397368.2 |
CAV3 |
caveolin 3 |
chr19_+_13135790 | 1.07 |
ENST00000358552.3 |
NFIX |
nuclear factor I/X (CCAAT-binding transcription factor) |
chr10_-_79686284 | 1.05 |
ENST00000372391.2 ENST00000372388.2 |
DLG5 |
discs, large homolog 5 (Drosophila) |
chr17_-_2614927 | 1.04 |
ENST00000435359.1 |
CLUH |
clustered mitochondria (cluA/CLU1) homolog |
chr1_-_159894319 | 1.04 |
ENST00000320307.4 |
TAGLN2 |
transgelin 2 |
chr1_-_6526192 | 1.03 |
ENST00000377782.3 ENST00000351959.5 ENST00000356876.3 |
TNFRSF25 |
tumor necrosis factor receptor superfamily, member 25 |
chr17_+_65374075 | 1.03 |
ENST00000581322.1 |
PITPNC1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
chr10_+_120967072 | 1.02 |
ENST00000392870.2 |
GRK5 |
G protein-coupled receptor kinase 5 |
chr12_-_56122124 | 1.00 |
ENST00000552754.1 |
CD63 |
CD63 molecule |
chr4_+_110481348 | 1.00 |
ENST00000394650.4 |
CCDC109B |
coiled-coil domain containing 109B |
chr1_-_203144941 | 0.98 |
ENST00000255416.4 |
MYBPH |
myosin binding protein H |
chr14_+_102829300 | 0.96 |
ENST00000359520.7 |
TECPR2 |
tectonin beta-propeller repeat containing 2 |
chr11_+_65339820 | 0.94 |
ENST00000316409.2 ENST00000449319.2 ENST00000530349.1 |
FAM89B |
family with sequence similarity 89, member B |
chr17_-_7166500 | 0.93 |
ENST00000575313.1 ENST00000397317.4 |
CLDN7 |
claudin 7 |
chr12_-_56122220 | 0.93 |
ENST00000552692.1 |
CD63 |
CD63 molecule |
chr20_+_44035847 | 0.92 |
ENST00000372712.2 |
DBNDD2 |
dysbindin (dystrobrevin binding protein 1) domain containing 2 |
chr12_+_122326662 | 0.92 |
ENST00000261817.2 ENST00000538613.1 ENST00000542602.1 |
PSMD9 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 9 |
chr4_-_25865159 | 0.89 |
ENST00000502949.1 ENST00000264868.5 ENST00000513691.1 ENST00000514872.1 |
SEL1L3 |
sel-1 suppressor of lin-12-like 3 (C. elegans) |
chr20_-_62168672 | 0.89 |
ENST00000217185.2 |
PTK6 |
protein tyrosine kinase 6 |
chr17_+_46126135 | 0.89 |
ENST00000361665.3 ENST00000585062.1 |
NFE2L1 |
nuclear factor, erythroid 2-like 1 |
chr17_-_39507064 | 0.88 |
ENST00000007735.3 |
KRT33A |
keratin 33A |
chrX_+_47078069 | 0.85 |
ENST00000357227.4 ENST00000519758.1 ENST00000520893.1 ENST00000517426.1 |
CDK16 |
cyclin-dependent kinase 16 |
chr9_-_35111570 | 0.85 |
ENST00000378561.1 ENST00000603301.1 |
FAM214B |
family with sequence similarity 214, member B |
chr12_+_29302119 | 0.84 |
ENST00000536681.3 |
FAR2 |
fatty acyl CoA reductase 2 |
chr17_+_38171614 | 0.82 |
ENST00000583218.1 ENST00000394149.3 |
CSF3 |
colony stimulating factor 3 (granulocyte) |
chr14_+_96505659 | 0.82 |
ENST00000555004.1 |
C14orf132 |
chromosome 14 open reading frame 132 |
chr12_+_116997186 | 0.81 |
ENST00000306985.4 |
MAP1LC3B2 |
microtubule-associated protein 1 light chain 3 beta 2 |
chrX_+_56258844 | 0.80 |
ENST00000374928.3 |
KLF8 |
Kruppel-like factor 8 |
chr17_-_39538550 | 0.79 |
ENST00000394001.1 |
KRT34 |
keratin 34 |
chr17_-_39968855 | 0.79 |
ENST00000355468.3 ENST00000590496.1 |
LEPREL4 |
leprecan-like 4 |
chr9_-_135819987 | 0.78 |
ENST00000298552.3 ENST00000403810.1 |
TSC1 |
tuberous sclerosis 1 |
chr12_+_122326630 | 0.78 |
ENST00000541212.1 ENST00000340175.5 |
PSMD9 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 9 |
chr4_-_926161 | 0.78 |
ENST00000511163.1 |
GAK |
cyclin G associated kinase |
chrX_+_40944871 | 0.77 |
ENST00000378308.2 ENST00000324545.8 |
USP9X |
ubiquitin specific peptidase 9, X-linked |
chr5_-_112257914 | 0.76 |
ENST00000513339.1 ENST00000545426.1 ENST00000504247.1 |
REEP5 |
receptor accessory protein 5 |
chr17_-_42277203 | 0.74 |
ENST00000587097.1 |
ATXN7L3 |
ataxin 7-like 3 |
chr11_+_1860682 | 0.74 |
ENST00000381906.1 |
TNNI2 |
troponin I type 2 (skeletal, fast) |
chr5_+_176560007 | 0.73 |
ENST00000510954.1 ENST00000354179.4 |
NSD1 |
nuclear receptor binding SET domain protein 1 |
chr17_+_38171681 | 0.72 |
ENST00000225474.2 ENST00000331769.2 ENST00000394148.3 ENST00000577675.1 |
CSF3 |
colony stimulating factor 3 (granulocyte) |
chr19_+_18668572 | 0.71 |
ENST00000540691.1 ENST00000539106.1 ENST00000222307.4 |
KXD1 |
KxDL motif containing 1 |
chr9_-_130617029 | 0.71 |
ENST00000373203.4 |
ENG |
endoglin |
chr19_+_42363917 | 0.70 |
ENST00000598742.1 |
RPS19 |
ribosomal protein S19 |
chr17_-_7518145 | 0.69 |
ENST00000250113.7 ENST00000571597.1 |
FXR2 |
fragile X mental retardation, autosomal homolog 2 |
chr12_+_27677085 | 0.69 |
ENST00000545334.1 ENST00000540114.1 ENST00000537927.1 ENST00000318304.8 ENST00000535047.1 ENST00000542629.1 ENST00000228425.6 |
PPFIBP1 |
PTPRF interacting protein, binding protein 1 (liprin beta 1) |
chr11_-_6440624 | 0.69 |
ENST00000311051.3 |
APBB1 |
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
chr6_+_142622991 | 0.69 |
ENST00000230173.6 ENST00000367608.2 |
GPR126 |
G protein-coupled receptor 126 |
chr11_-_65625330 | 0.69 |
ENST00000531407.1 |
CFL1 |
cofilin 1 (non-muscle) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 6.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.7 | 2.9 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.6 | 1.9 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
0.6 | 1.8 | GO:2000097 | chronological cell aging(GO:0001300) regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.5 | 5.3 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.5 | 1.5 | GO:0018201 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) peptidyl-glycine modification(GO:0018201) |
0.4 | 1.6 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.4 | 7.8 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.4 | 3.5 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.4 | 0.4 | GO:1903384 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.3 | 2.0 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
0.3 | 0.9 | GO:0071988 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
0.3 | 0.6 | GO:0071284 | cellular response to lead ion(GO:0071284) |
0.3 | 1.7 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.3 | 0.9 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.3 | 1.1 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
0.3 | 1.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.3 | 0.5 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.3 | 1.0 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.3 | 0.8 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) cellular alkene metabolic process(GO:0043449) |
0.2 | 1.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 1.7 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
0.2 | 1.8 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.2 | 1.6 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.2 | 0.7 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.2 | 0.6 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
0.2 | 2.3 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.2 | 0.2 | GO:0043578 | nuclear matrix organization(GO:0043578) |
0.2 | 0.8 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.2 | 1.0 | GO:0030047 | actin modification(GO:0030047) |
0.2 | 0.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 1.7 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.2 | 1.1 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.7 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.2 | 0.7 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
0.2 | 0.8 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.2 | 0.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.2 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.2 | 0.8 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.2 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 1.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.2 | 0.2 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.2 | 1.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.2 | 0.5 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
0.1 | 0.4 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.1 | 0.4 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 2.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.6 | GO:0000023 | maltose metabolic process(GO:0000023) diaphragm contraction(GO:0002086) |
0.1 | 0.4 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
0.1 | 0.7 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
0.1 | 0.4 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.4 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
0.1 | 0.6 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.5 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
0.1 | 0.7 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.1 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.1 | 0.4 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
0.1 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.5 | GO:0032431 | activation of phospholipase A2 activity(GO:0032431) |
0.1 | 0.5 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 1.0 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
0.1 | 0.5 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
0.1 | 0.9 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.3 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.3 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
0.1 | 1.4 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.1 | 1.3 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.1 | 0.4 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
0.1 | 0.8 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.6 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.5 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.9 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 1.6 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.3 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.4 | GO:1903288 | protein transport into plasma membrane raft(GO:0044861) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.3 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 2.9 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.1 | 0.4 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
0.1 | 0.3 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
0.1 | 0.7 | GO:0042426 | choline catabolic process(GO:0042426) |
0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.2 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
0.1 | 0.5 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.3 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.1 | 0.6 | GO:0051106 | positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 1.0 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 2.5 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.4 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.3 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.1 | 0.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.4 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:0043606 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
0.1 | 0.1 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
0.1 | 0.2 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
0.1 | 0.2 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
0.1 | 0.2 | GO:0042351 | GDP-L-fucose biosynthetic process(GO:0042350) 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.1 | 0.4 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.4 | GO:0009838 | abscission(GO:0009838) |
0.1 | 0.4 | GO:0000050 | urea cycle(GO:0000050) |
0.1 | 1.1 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
0.1 | 0.5 | GO:0042048 | olfactory behavior(GO:0042048) |
0.1 | 1.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.7 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 3.8 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.1 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.1 | 0.2 | GO:0003169 | coronary vein morphogenesis(GO:0003169) cardiac vascular smooth muscle cell development(GO:0060948) regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.6 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.4 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.1 | 0.7 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.1 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.4 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.2 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
0.1 | 0.6 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.1 | 0.6 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.4 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.1 | 0.2 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
0.1 | 0.2 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.1 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.2 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.1 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 1.3 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.9 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.3 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.7 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 0.5 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.3 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
0.1 | 0.3 | GO:0019046 | release from viral latency(GO:0019046) |
0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.1 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
0.1 | 1.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.7 | GO:0060026 | convergent extension(GO:0060026) |
0.1 | 1.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) histone H2A phosphorylation(GO:1990164) |
0.1 | 0.2 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
0.1 | 0.2 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.4 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.2 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.1 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.3 | GO:0097338 | response to clozapine(GO:0097338) |
0.1 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
0.1 | 0.3 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.9 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.6 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.5 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.1 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
0.1 | 0.2 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.1 | 0.6 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.2 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.5 | GO:0030100 | regulation of endocytosis(GO:0030100) |
0.0 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.1 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
0.0 | 0.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 1.1 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0019477 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
0.0 | 0.4 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.2 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.0 | 1.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.8 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.6 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.2 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.1 | GO:0018153 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
0.0 | 0.2 | GO:0036018 | cellular response to erythropoietin(GO:0036018) |
0.0 | 0.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.1 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.0 | 1.1 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.0 | 0.1 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.1 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.4 | GO:0006552 | leucine catabolic process(GO:0006552) |
0.0 | 0.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.2 | GO:0003335 | corneocyte development(GO:0003335) |
0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 1.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.0 | 0.1 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.0 | 0.1 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.0 | 0.1 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.0 | 0.2 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.5 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.0 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
0.0 | 0.3 | GO:0040034 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.0 | 0.1 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.6 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.0 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.2 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.2 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.4 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
0.0 | 0.4 | GO:0046520 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.1 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.0 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0090083 | inclusion body assembly(GO:0070841) regulation of inclusion body assembly(GO:0090083) |
0.0 | 0.1 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.3 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.1 | GO:0071934 | thiamine transport(GO:0015888) thiamine transmembrane transport(GO:0071934) |
0.0 | 0.2 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.0 | 0.1 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.1 | GO:0086053 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.0 | 0.5 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 2.9 | GO:0046324 | regulation of glucose import(GO:0046324) |
0.0 | 0.1 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.0 | 0.1 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
0.0 | 0.1 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.0 | 0.1 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.0 | 0.5 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
0.0 | 0.1 | GO:0033023 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.0 | 0.3 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.8 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:1902109 | negative regulation of mitochondrial membrane permeability(GO:0035795) negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.3 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 1.1 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 1.8 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.9 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.4 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.3 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.0 | 0.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.0 | GO:0061439 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
0.0 | 0.1 | GO:0060318 | regulation of definitive erythrocyte differentiation(GO:0010724) definitive erythrocyte differentiation(GO:0060318) |
0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.8 | GO:0090102 | cochlea development(GO:0090102) |
0.0 | 0.4 | GO:0021795 | cerebral cortex cell migration(GO:0021795) |
0.0 | 0.4 | GO:0030539 | male genitalia development(GO:0030539) |
0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.1 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.0 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.0 | 0.1 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.3 | GO:0070542 | response to fatty acid(GO:0070542) |
0.0 | 0.3 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0030822 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
0.0 | 0.1 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
0.0 | 0.2 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.3 | GO:1902592 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
0.0 | 0.1 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.1 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
0.0 | 0.1 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
0.0 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
0.0 | 0.1 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
0.0 | 0.0 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.0 | 0.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.3 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
0.0 | 0.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.2 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.0 | 0.3 | GO:0007530 | sex determination(GO:0007530) |
0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:1903147 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
0.0 | 0.0 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.2 | GO:0043524 | negative regulation of neuron apoptotic process(GO:0043524) |
0.0 | 1.0 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
0.0 | 0.0 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.0 | 0.0 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
0.0 | 0.6 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
0.0 | 0.6 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.0 | 0.3 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.0 | 0.2 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.1 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.2 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.0 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.1 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
0.0 | 0.1 | GO:0042417 | dopamine metabolic process(GO:0042417) |
0.0 | 0.3 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.2 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0035900 | response to isolation stress(GO:0035900) |
0.0 | 0.0 | GO:0075528 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.2 | GO:0051412 | response to corticosterone(GO:0051412) |
0.0 | 0.2 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.6 | GO:0030516 | regulation of axon extension(GO:0030516) |
0.0 | 0.2 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.2 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.3 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.5 | GO:0043276 | anoikis(GO:0043276) |
0.0 | 0.1 | GO:0006069 | ethanol oxidation(GO:0006069) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.0 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.0 | GO:0034128 | negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
0.0 | 0.2 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.3 | GO:0046710 | GDP metabolic process(GO:0046710) |
0.0 | 0.0 | GO:0009080 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 4.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 2.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 1.7 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 1.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 1.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.9 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 2.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.8 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 1.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 2.7 | GO:0034711 | inhibin binding(GO:0034711) |
0.3 | 1.1 | GO:0038025 | glycoprotein transporter activity(GO:0034437) reelin receptor activity(GO:0038025) |
0.3 | 1.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 1.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.2 | 0.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.2 | 0.5 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.1 | 0.4 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.1 | 0.5 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
0.1 | 0.5 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.1 | 1.3 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
0.1 | 0.5 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.9 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 1.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.1 | 0.4 | GO:0039552 | RIG-I binding(GO:0039552) |
0.1 | 0.4 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.3 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.1 | 1.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.3 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
0.1 | 0.6 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 2.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
0.0 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.6 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 1.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
0.0 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.0 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.6 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.8 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.3 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
0.0 | 1.0 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 1.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.7 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.8 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 1.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.0 | 0.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.3 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.6 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 3.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 4.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.8 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.1 | 2.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 2.7 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 2.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 2.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.0 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.3 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.1 | 0.8 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.7 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 1.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 2.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 1.9 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.8 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.6 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 1.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 1.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 1.0 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.5 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 1.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.5 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.7 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.2 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.8 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.0 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 1.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 1.0 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.5 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 1.1 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.6 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
0.0 | 0.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 2.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.7 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 2.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.4 | GO:0070695 | FHF complex(GO:0070695) |
0.3 | 0.9 | GO:0055028 | cortical microtubule(GO:0055028) mitotic spindle astral microtubule(GO:0061673) |
0.3 | 0.9 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.3 | 1.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
0.2 | 0.7 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.2 | 0.2 | GO:0000806 | Y chromosome(GO:0000806) |
0.2 | 0.6 | GO:0044305 | calyx of Held(GO:0044305) |
0.2 | 1.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.2 | 1.1 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.2 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.2 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.2 | 0.8 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 2.3 | GO:0008091 | spectrin(GO:0008091) |
0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 0.5 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.7 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 1.9 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 1.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.6 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.6 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.9 | GO:0014802 | terminal cisterna(GO:0014802) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.9 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.2 | GO:0031213 | RSF complex(GO:0031213) |
0.1 | 0.6 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.1 | 11.9 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
0.1 | 1.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.4 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 1.9 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.4 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.9 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 1.6 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.6 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.7 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.1 | 0.8 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.8 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.7 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.8 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0031673 | H zone(GO:0031673) |
0.1 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 1.0 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
0.1 | 0.3 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
0.1 | 1.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.4 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.2 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
0.1 | 0.3 | GO:1990752 | microtubule plus-end(GO:0035371) microtubule end(GO:1990752) |
0.1 | 0.7 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.9 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.0 | 1.0 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 3.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 2.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.0 | 0.1 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 2.8 | GO:1904724 | tertiary granule lumen(GO:1904724) |
0.0 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
0.0 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.2 | GO:0030017 | sarcomere(GO:0030017) |
0.0 | 0.7 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 2.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 1.0 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.6 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.7 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 1.0 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.7 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.4 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.0 | 1.3 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 1.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.7 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 2.0 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.3 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 1.3 | GO:0035577 | azurophil granule membrane(GO:0035577) |
0.0 | 0.1 | GO:0070826 | paraferritin complex(GO:0070826) |
0.0 | 0.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.0 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.1 | GO:0035580 | specific granule lumen(GO:0035580) |
0.0 | 0.1 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 4.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.6 | GO:0098857 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.3 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.0 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.1 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 4.7 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.5 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.3 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.2 | GO:0008021 | synaptic vesicle(GO:0008021) exocytic vesicle(GO:0070382) |
0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.4 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.0 | GO:0032044 | DSIF complex(GO:0032044) |
0.0 | 0.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 1.3 | GO:0030496 | midbody(GO:0030496) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 1.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.2 | 0.8 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.6 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
0.1 | 0.9 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 2.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.3 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 1.4 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.9 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.3 | GO:1990812 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
0.0 | 0.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.9 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 2.2 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
0.0 | 1.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.6 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 1.0 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.0 | 1.6 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.4 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.9 | 7.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
1.1 | 24.9 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
1.0 | 1.0 | PID SHP2 PATHWAY | SHP2 signaling |
0.9 | 22.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.8 | 18.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.7 | 10.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.6 | 0.6 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.5 | 2.1 | PID ALK1 PATHWAY | ALK1 signaling events |
0.5 | 44.7 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.5 | 0.5 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.5 | 25.9 | PID ATM PATHWAY | ATM pathway |
0.5 | 15.0 | PID BARD1 PATHWAY | BARD1 signaling events |
0.5 | 0.9 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.5 | 18.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.5 | 36.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.4 | 1.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.4 | 7.6 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.4 | 20.0 | PID IFNG PATHWAY | IFN-gamma pathway |
0.4 | 24.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.4 | 3.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.4 | 27.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.4 | 7.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.4 | 4.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.4 | 27.2 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.4 | 4.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.3 | 15.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.3 | 20.0 | PID PLK1 PATHWAY | PLK1 signaling events |
0.3 | 6.9 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.3 | 4.9 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.3 | 4.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.3 | 8.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.3 | 2.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.3 | 7.2 | PID ATR PATHWAY | ATR signaling pathway |
0.3 | 3.2 | PID MYC PATHWAY | C-MYC pathway |
0.3 | 33.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.3 | 16.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.3 | 13.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.3 | 7.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.3 | 2.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.3 | 7.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.2 | 0.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 2.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 8.8 | PID AURORA A PATHWAY | Aurora A signaling |
0.2 | 2.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 7.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.2 | 0.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.2 | 8.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.2 | 3.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.2 | 12.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.2 | 11.4 | PID LKB1 PATHWAY | LKB1 signaling events |
0.2 | 3.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.2 | 4.1 | PID FOXO PATHWAY | FoxO family signaling |
0.2 | 3.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.2 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 2.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 0.9 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.2 | 9.5 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.2 | 7.0 | PID FGF PATHWAY | FGF signaling pathway |
0.2 | 2.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 5.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.2 | 1.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.1 | 2.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 2.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 2.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 5.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 1.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 2.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 5.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 9.1 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 2.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 2.9 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 1.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 0.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 1.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 1.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 1.8 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 2.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.1 | 1.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.9 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 2.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 3.8 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 4.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 2.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.9 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 1.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 1.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 0.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.6 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.1 | 1.0 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 1.0 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 1.9 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 1.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.6 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.6 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.8 | GO:0016403 | dimethylargininase activity(GO:0016403) |
0.5 | 1.5 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.4 | 3.1 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.3 | 0.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.2 | 0.5 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.4 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.1 | 0.5 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
0.1 | 0.8 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.8 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) polynucleotide phosphatase activity(GO:0098518) |
0.1 | 1.0 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.4 | GO:0042731 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) PH domain binding(GO:0042731) |
0.0 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.6 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.9 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 3.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.7 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 1.4 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.0 | 0.7 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.6 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.4 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 1.4 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.9 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 2.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 3.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 1.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 1.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 1.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.6 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.9 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 32.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.4 | 5.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.4 | 17.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.3 | 5.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.3 | 5.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.2 | 18.1 | PID NOTCH PATHWAY | Notch signaling pathway |
0.2 | 30.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.2 | 4.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.2 | 1.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 9.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 6.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 2.8 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 8.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 2.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 7.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 2.8 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 4.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 1.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 8.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 1.3 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 22.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.1 | 2.9 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 1.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 1.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 1.8 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 2.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 1.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 2.7 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 1.3 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.7 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 1.5 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.9 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.8 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 2.3 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 2.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 1.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.9 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 1.6 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
1.4 | 23.0 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
1.1 | 16.9 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
1.1 | 6.5 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
1.0 | 29.6 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
1.0 | 16.9 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
1.0 | 25.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.8 | 16.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.8 | 8.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.8 | 3.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.8 | 9.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.8 | 1.6 | REACTOME SIGNALING BY INSULIN RECEPTOR | Genes involved in Signaling by Insulin receptor |
0.7 | 12.9 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.7 | 18.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.7 | 9.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.7 | 26.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.7 | 3.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.7 | 25.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.6 | 8.9 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.6 | 17.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.6 | 7.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.6 | 13.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.6 | 22.9 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.6 | 4.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.6 | 10.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.6 | 12.8 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.5 | 23.5 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.5 | 1.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.5 | 1.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.5 | 12.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.5 | 3.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.5 | 5.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.5 | 12.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.4 | 8.8 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.4 | 12.6 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.4 | 0.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.4 | 9.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.4 | 5.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.4 | 22.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.4 | 9.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.4 | 10.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.4 | 2.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.4 | 7.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.4 | 7.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.4 | 2.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.4 | 2.4 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.4 | 10.7 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.4 | 6.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.4 | 7.7 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.4 | 5.7 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.4 | 3.8 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.4 | 7.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.4 | 0.7 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.4 | 5.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.4 | 6.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.4 | 8.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.4 | 0.4 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.3 | 5.9 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.3 | 8.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.3 | 2.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.3 | 20.0 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.3 | 3.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.3 | 6.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.3 | 6.0 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.3 | 45.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.3 | 5.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.3 | 7.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.3 | 5.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.3 | 1.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.3 | 5.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.3 | 10.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.3 | 7.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.3 | 7.9 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.3 | 20.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.3 | 0.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.3 | 2.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.3 | 5.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.3 | 10.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.3 | 0.6 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
0.3 | 7.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.3 | 1.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.3 | 1.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.3 | 0.6 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.3 | 14.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.3 | 2.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.3 | 11.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.3 | 7.1 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.3 | 6.7 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.3 | 1.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.3 | 8.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.3 | 3.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.3 | 6.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 8.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.3 | 5.3 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.3 | 13.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.2 | 0.5 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.2 | 14.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.2 | 2.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 0.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.2 | 3.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 2.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.2 | 4.8 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.2 | 20.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.2 | 0.9 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.2 | 2.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 3.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 1.8 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.2 | 1.8 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.2 | 2.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.9 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.2 | 4.4 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.2 | 1.8 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.2 | 4.8 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.2 | 2.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.2 | 6.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.2 | 2.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.2 | 2.3 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.2 | 10.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.2 | 12.7 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.2 | 3.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 8.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.2 | 1.4 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.2 | 6.5 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.2 | 37.3 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.2 | 0.8 | REACTOME METABOLISM OF LIPIDS AND LIPOPROTEINS | Genes involved in Metabolism of lipids and lipoproteins |
0.2 | 1.7 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.2 | 1.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.2 | 2.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.2 | 7.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 5.5 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 6.7 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.2 | 4.7 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.2 | 1.9 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.2 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.2 | 2.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.2 | 2.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.2 | 0.5 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 3.2 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 3.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.3 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
0.1 | 0.8 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 40.4 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.1 | 3.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 0.5 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.1 | 12.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.1 | 0.9 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 2.0 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 2.3 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.1 | 1.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 4.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 2.5 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 2.7 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 2.6 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.7 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 1.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 1.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 8.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.1 | 0.5 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
0.1 | 2.7 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 1.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.6 | REACTOME PI3K CASCADE | Genes involved in PI3K Cascade |
0.1 | 2.0 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 4.7 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 10.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 0.3 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.1 | 3.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 5.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 2.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 1.6 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 0.1 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.1 | 0.7 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 1.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 0.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 1.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 1.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 7.9 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 2.4 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 0.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 1.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.5 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.0 | 0.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 1.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.8 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME INNATE IMMUNE SYSTEM | Genes involved in Innate Immune System |
0.0 | 1.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 2.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.7 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 1.0 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 2.2 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 1.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.7 | REACTOME RNA POL II TRANSCRIPTION | Genes involved in RNA Polymerase II Transcription |
0.0 | 0.5 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.4 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.2 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.8 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.3 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.0 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 1.3 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 1.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 1.0 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.9 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.5 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.7 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.5 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.3 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.4 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.6 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 3.5 | GO:0071279 | cellular response to cobalt ion(GO:0071279) |
0.4 | 1.3 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
0.4 | 1.2 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.4 | 1.8 | GO:0072301 | regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) |
0.3 | 1.0 | GO:0021678 | fourth ventricle development(GO:0021592) third ventricle development(GO:0021678) |
0.3 | 0.3 | GO:0010637 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.3 | 1.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.3 | 0.6 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 0.8 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
0.2 | 0.8 | GO:0002084 | protein depalmitoylation(GO:0002084) |
0.2 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.2 | 0.5 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.2 | 0.9 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
0.1 | 0.4 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.9 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.7 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.9 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
0.1 | 0.8 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.1 | 0.3 | GO:2000861 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
0.1 | 0.4 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
0.1 | 1.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.3 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
0.1 | 0.7 | GO:2000467 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.3 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
0.1 | 0.4 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 0.4 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.1 | 0.4 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.6 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.9 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.2 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.1 | 0.6 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 1.1 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
0.1 | 1.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.4 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.4 | GO:1904044 | response to aldosterone(GO:1904044) |
0.1 | 0.3 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) positive regulation of synaptic vesicle clustering(GO:2000809) |
0.0 | 0.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.0 | 1.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.6 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.8 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.1 | GO:0018283 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
0.0 | 0.1 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.2 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.9 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.0 | 0.2 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.4 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.0 | 0.2 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.4 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.0 | 0.2 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
0.0 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
0.0 | 0.2 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.3 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.5 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.3 | GO:0045116 | response to UV-C(GO:0010225) protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.0 | GO:1990637 | response to prolactin(GO:1990637) |
0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.0 | 0.0 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 1.4 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.2 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.1 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
0.0 | 0.3 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:0032886 | regulation of microtubule-based process(GO:0032886) |
0.0 | 0.1 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.5 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
0.3 | 0.9 | GO:0048170 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) erythropoietin-mediated signaling pathway(GO:0038162) positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.3 | 0.8 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.3 | 1.4 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.3 | 0.8 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
0.2 | 1.0 | GO:0002254 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
0.2 | 3.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.2 | 3.8 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.2 | 0.9 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
0.2 | 0.8 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.2 | 0.7 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.2 | 0.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.2 | 0.6 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
0.1 | 0.4 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.1 | 0.5 | GO:0061289 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
0.1 | 0.7 | GO:0033121 | regulation of cyclic nucleotide catabolic process(GO:0030805) regulation of cAMP catabolic process(GO:0030820) regulation of purine nucleotide catabolic process(GO:0033121) |
0.1 | 0.7 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 0.3 | GO:0006788 | heme oxidation(GO:0006788) |
0.1 | 1.0 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.1 | 0.4 | GO:1903949 | positive regulation of cardiac conduction(GO:1903781) positive regulation of atrial cardiac muscle cell action potential(GO:1903949) positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
0.1 | 0.6 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
0.1 | 0.4 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.1 | 0.8 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 1.8 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.1 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.3 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
0.0 | 0.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.5 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
0.0 | 3.1 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 1.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.7 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.1 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
0.0 | 0.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 1.1 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
0.0 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.4 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.3 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
0.0 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 1.1 | GO:0006305 | DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
0.0 | 0.5 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
0.0 | 0.8 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
0.0 | 0.4 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.4 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.2 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.6 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 8.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
1.9 | 5.8 | GO:0032804 | negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
1.7 | 10.3 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
1.7 | 23.9 | GO:0035878 | nail development(GO:0035878) |
1.4 | 4.3 | GO:0048627 | myoblast development(GO:0048627) positive regulation of G0 to G1 transition(GO:0070318) |
1.3 | 6.5 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) lymphocyte migration into lymphoid organs(GO:0097021) |
1.2 | 2.4 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
1.2 | 6.9 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
1.1 | 4.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
1.1 | 3.4 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
1.1 | 8.8 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
1.0 | 11.5 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
1.0 | 11.5 | GO:0002934 | desmosome organization(GO:0002934) |
1.0 | 3.8 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
0.9 | 5.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.8 | 4.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.8 | 4.0 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.8 | 11.5 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.8 | 3.8 | GO:1903282 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) regulation of peroxidase activity(GO:2000468) positive regulation of peroxidase activity(GO:2000470) |
0.7 | 15.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.7 | 1.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.6 | 2.6 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.6 | 1.8 | GO:0050917 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
0.6 | 1.8 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.6 | 2.3 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
0.6 | 4.5 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.5 | 1.6 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
0.5 | 1.5 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.5 | 2.5 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
0.5 | 2.0 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.5 | 1.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.5 | 1.5 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.5 | 1.4 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.5 | 3.8 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
0.5 | 5.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.4 | 1.3 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.4 | 1.3 | GO:0001300 | chronological cell aging(GO:0001300) |
0.4 | 17.4 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.4 | 1.3 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.4 | 2.9 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.4 | 2.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.4 | 2.9 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.4 | 1.2 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
0.4 | 1.2 | GO:0048597 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.4 | 1.2 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.4 | 5.3 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.4 | 3.5 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.4 | 5.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.4 | 2.6 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.3 | 2.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.3 | 1.7 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 5.1 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.3 | 9.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.3 | 2.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.3 | 0.8 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.3 | 2.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.3 | 1.9 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.3 | 1.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.3 | 0.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.3 | 5.0 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.3 | 2.8 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.2 | 6.0 | GO:0031639 | plasminogen activation(GO:0031639) |
0.2 | 2.9 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
0.2 | 1.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.2 | 1.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 1.0 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.2 | 1.2 | GO:0051012 | microtubule sliding(GO:0051012) |
0.2 | 0.6 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
0.2 | 0.6 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.2 | 1.9 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.2 | 0.6 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
0.2 | 0.7 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
0.2 | 1.8 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.2 | 0.8 | GO:0090650 | rRNA transport(GO:0051029) response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.2 | 1.5 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.2 | 5.2 | GO:1901687 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
0.2 | 0.8 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.2 | 0.8 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.1 | 2.8 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 2.4 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.7 | GO:0051511 | regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) regulation of barbed-end actin filament capping(GO:2000812) positive regulation of barbed-end actin filament capping(GO:2000814) |
0.1 | 9.7 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.1 | 0.9 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.6 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.1 | 0.5 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.1 | 0.8 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 1.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 4.6 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.1 | 2.0 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 1.5 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.1 | 0.7 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.4 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.1 | 0.3 | GO:0051097 | negative regulation of helicase activity(GO:0051097) oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.6 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.1 | 0.6 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) |
0.1 | 1.2 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
0.1 | 1.0 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 7.5 | GO:0070268 | cornification(GO:0070268) |
0.1 | 0.1 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.1 | 4.9 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
0.1 | 0.5 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.1 | 1.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.2 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) |
0.1 | 0.5 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) |
0.1 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.1 | 0.3 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.2 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.1 | 2.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 2.4 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
0.1 | 0.5 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.0 | GO:1902822 | regulation of late endosome to lysosome transport(GO:1902822) |
0.0 | 2.0 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
0.0 | 2.5 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.8 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.5 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 1.3 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 2.0 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.4 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 4.3 | GO:0030516 | regulation of axon extension(GO:0030516) |
0.0 | 0.7 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.4 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.4 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 1.7 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 1.0 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 1.5 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.0 | 0.2 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
0.0 | 0.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.2 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 1.8 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
0.0 | 0.6 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.6 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.9 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.1 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
0.0 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.3 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.8 | GO:0048675 | axon extension(GO:0048675) |
0.0 | 2.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.7 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.9 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 0.6 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 2.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.0 | 0.5 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.4 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.7 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 1.3 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 1.9 | GO:0006939 | smooth muscle contraction(GO:0006939) |
0.0 | 1.0 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 1.2 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.0 | 0.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 3.3 | GO:0006936 | muscle contraction(GO:0006936) |
0.0 | 1.7 | GO:0000187 | activation of MAPK activity(GO:0000187) |
0.0 | 1.8 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
0.0 | 0.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
0.0 | 0.3 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
0.3 | 3.5 | GO:0043203 | axon hillock(GO:0043203) |
0.2 | 1.2 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 1.0 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.4 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.0 | 0.3 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.8 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.0 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 1.7 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.0 | 1.8 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.2 | 12.8 | GO:0043293 | apoptosome(GO:0043293) |
3.1 | 9.3 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
2.4 | 7.3 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
2.4 | 11.9 | GO:0005726 | perichromatin fibrils(GO:0005726) |
2.2 | 15.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
1.7 | 10.4 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
1.7 | 5.1 | GO:0031523 | Myb complex(GO:0031523) |
1.7 | 6.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
1.6 | 4.8 | GO:0005960 | glycine cleavage complex(GO:0005960) |
1.5 | 6.1 | GO:0032301 | MutSalpha complex(GO:0032301) |
1.5 | 4.4 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
1.5 | 3.0 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
1.5 | 35.1 | GO:0005861 | troponin complex(GO:0005861) |
1.3 | 5.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
1.3 | 5.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
1.3 | 6.6 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
1.3 | 14.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
1.3 | 3.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
1.3 | 27.9 | GO:0042627 | chylomicron(GO:0042627) |
1.3 | 7.6 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
1.3 | 11.3 | GO:0070652 | HAUS complex(GO:0070652) |
1.2 | 3.7 | GO:0031213 | RSF complex(GO:0031213) |
1.2 | 3.7 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
1.2 | 15.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
1.2 | 15.5 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
1.2 | 1.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
1.2 | 24.4 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
1.2 | 4.6 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
1.2 | 4.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
1.1 | 2.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
1.1 | 3.4 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
1.1 | 5.4 | GO:0097255 | R2TP complex(GO:0097255) |
1.1 | 4.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
1.1 | 7.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
1.0 | 11.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
1.0 | 5.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
1.0 | 4.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
1.0 | 3.9 | GO:0030314 | junctional membrane complex(GO:0030314) |
1.0 | 3.9 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
1.0 | 24.0 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.9 | 10.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.9 | 2.7 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.9 | 9.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.9 | 14.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.9 | 3.6 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.9 | 5.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.9 | 0.9 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
0.8 | 2.5 | GO:0034455 | t-UTP complex(GO:0034455) |
0.8 | 5.0 | GO:0001740 | Barr body(GO:0001740) |
0.8 | 1.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.8 | 4.2 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
0.8 | 0.8 | GO:0032302 | MutSbeta complex(GO:0032302) |
0.8 | 5.7 | GO:0001520 | outer dense fiber(GO:0001520) |
0.8 | 4.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.8 | 4.9 | GO:0000796 | condensin complex(GO:0000796) |
0.8 | 7.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.8 | 1.6 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
0.8 | 5.6 | GO:0032437 | cuticular plate(GO:0032437) |
0.8 | 4.0 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
0.8 | 4.0 | GO:0032021 | NELF complex(GO:0032021) |
0.8 | 5.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.8 | 3.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.8 | 7.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.7 | 2.9 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.7 | 2.1 | GO:0071745 | IgA immunoglobulin complex(GO:0071745) IgA immunoglobulin complex, circulating(GO:0071746) monomeric IgA immunoglobulin complex(GO:0071748) polymeric IgA immunoglobulin complex(GO:0071749) secretory IgA immunoglobulin complex(GO:0071751) |
0.7 | 0.7 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.7 | 7.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.7 | 5.6 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
0.7 | 3.4 | GO:0032584 | growth cone membrane(GO:0032584) |
0.7 | 1.4 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.7 | 2.0 | GO:0060187 | cell pole(GO:0060187) |
0.7 | 2.0 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.7 | 2.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.7 | 2.7 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.7 | 7.3 | GO:0042555 | MCM complex(GO:0042555) |
0.7 | 0.7 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.7 | 2.0 | GO:0042025 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
0.7 | 0.7 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
0.6 | 5.8 | GO:0032039 | integrator complex(GO:0032039) |
0.6 | 18.0 | GO:0034451 | centriolar satellite(GO:0034451) |
0.6 | 3.8 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.6 | 1.9 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
0.6 | 0.6 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.6 | 9.4 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.6 | 4.4 | GO:0070187 | telosome(GO:0070187) |
0.6 | 3.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.6 | 3.7 | GO:0090661 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
0.6 | 7.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.6 | 6.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.6 | 14.8 | GO:0071565 | nBAF complex(GO:0071565) |
0.6 | 6.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.6 | 2.9 | GO:0097422 | tubular endosome(GO:0097422) |
0.6 | 2.9 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.6 | 1.2 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.6 | 1.7 | GO:0071564 | npBAF complex(GO:0071564) |
0.6 | 4.5 | GO:0042382 | paraspeckles(GO:0042382) |
0.6 | 2.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.5 | 44.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.5 | 1.6 | GO:0043291 | RAVE complex(GO:0043291) |
0.5 | 1.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.5 | 2.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.5 | 11.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.5 | 1.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.5 | 2.1 | GO:0005749 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.5 | 3.7 | GO:0031415 | NatA complex(GO:0031415) |
0.5 | 2.6 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.5 | 1.5 | GO:0005638 | lamin filament(GO:0005638) nuclear lamina(GO:0005652) |
0.5 | 3.6 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.5 | 3.6 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.5 | 1.5 | GO:0036398 | TCR signalosome(GO:0036398) |
0.5 | 14.2 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.5 | 1.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.5 | 3.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.5 | 2.5 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
0.5 | 1.5 | GO:0044393 | microspike(GO:0044393) |
0.5 | 1.0 | GO:0010008 | endosome membrane(GO:0010008) |
0.5 | 7.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.5 | 2.0 | GO:1990357 | terminal web(GO:1990357) |
0.5 | 3.4 | GO:0090544 | BAF-type complex(GO:0090544) |
0.5 | 6.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.5 | 1.9 | GO:0070985 | TFIIK complex(GO:0070985) |
0.5 | 1.9 | GO:0000322 | storage vacuole(GO:0000322) |
0.5 | 3.9 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.5 | 4.3 | GO:0000125 | PCAF complex(GO:0000125) |
0.5 | 1.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.5 | 2.4 | GO:0043196 | varicosity(GO:0043196) |
0.5 | 9.0 | GO:0001891 | phagocytic cup(GO:0001891) |
0.5 | 3.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.5 | 1.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.5 | 18.9 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.5 | 3.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.5 | 1.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.5 | 6.4 | GO:0035102 | PRC1 complex(GO:0035102) |
0.5 | 1.8 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.4 | 1.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.4 | 5.3 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.4 | 2.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.4 | 4.8 | GO:0000124 | SAGA complex(GO:0000124) |
0.4 | 2.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.4 | 2.6 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.4 | 1.3 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
0.4 | 3.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.4 | 7.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.4 | 1.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.4 | 1.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.4 | 9.7 | GO:0031519 | PcG protein complex(GO:0031519) |
0.4 | 3.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.4 | 0.8 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.4 | 1.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.4 | 1.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.4 | 4.4 | GO:0005688 | U6 snRNP(GO:0005688) |
0.4 | 5.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.4 | 0.8 | GO:0034657 | GID complex(GO:0034657) |
0.4 | 6.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.4 | 2.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.4 | 3.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.4 | 3.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.4 | 1.9 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.4 | 3.8 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.4 | 2.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.4 | 9.5 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.4 | 3.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.4 | 1.9 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.4 | 2.6 | GO:0097427 | microtubule bundle(GO:0097427) |
0.4 | 4.4 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.4 | 2.6 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.4 | 2.1 | GO:0042825 | TAP complex(GO:0042825) |
0.4 | 6.3 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.4 | 0.4 | GO:0035061 | interchromatin granule(GO:0035061) |
0.4 | 1.8 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
0.3 | 1.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.3 | 2.8 | GO:0045179 | apical cortex(GO:0045179) |
0.3 | 1.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.3 | 2.1 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.3 | 1.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.3 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
0.3 | 3.8 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.3 | 0.7 | GO:0002102 | podosome(GO:0002102) |
0.3 | 16.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.3 | 6.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.3 | 3.3 | GO:0043198 | dendritic shaft(GO:0043198) |
0.3 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
0.3 | 5.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.3 | 9.4 | GO:0035861 | site of double-strand break(GO:0035861) |
0.3 | 1.3 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
0.3 | 5.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.3 | 6.8 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.3 | 2.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.3 | 1.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.3 | 0.3 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.3 | 1.0 | GO:0005686 | U2 snRNP(GO:0005686) |
0.3 | 24.5 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.3 | 3.5 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.3 | 3.1 | GO:0032420 | stereocilium(GO:0032420) |
0.3 | 3.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.3 | 17.8 | GO:0005871 | kinesin complex(GO:0005871) |
0.3 | 1.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.3 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.3 | 0.9 | GO:0030689 | Noc complex(GO:0030689) |
0.3 | 1.2 | GO:0001772 | immunological synapse(GO:0001772) |
0.3 | 0.3 | GO:0000502 | proteasome complex(GO:0000502) |
0.3 | 2.7 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.3 | 1.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.3 | 3.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.3 | 1.8 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.3 | 1.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.3 | 0.6 | GO:0061200 | clathrin-sculpted vesicle(GO:0060198) clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
0.3 | 1.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.3 | 3.8 | GO:0030681 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.3 | 1.8 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.3 | 0.9 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.3 | 4.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 0.9 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
0.3 | 2.9 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.3 | 1.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.3 | 8.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.3 | 1.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.3 | 1.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.3 | 3.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.3 | 2.8 | GO:0097486 | multivesicular body lumen(GO:0097486) |
0.3 | 1.4 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
0.3 | 3.9 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.3 | 0.6 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.3 | 34.1 | GO:0016605 | PML body(GO:0016605) |
0.3 | 0.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.3 | 1.1 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
0.3 | 1.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.3 | 0.3 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.3 | 7.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.3 | 1.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.3 | 25.8 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.3 | 0.8 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
0.3 | 5.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.3 | 0.8 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
0.3 | 3.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.3 | 3.7 | GO:0034709 | methylosome(GO:0034709) |
0.3 | 26.3 | GO:0016363 | nuclear matrix(GO:0016363) |
0.3 | 0.5 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.3 | 1.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.3 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.3 | 1.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 6.0 | GO:0031528 | microvillus membrane(GO:0031528) |
0.3 | 0.8 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.3 | 0.8 | GO:0001652 | granular component(GO:0001652) |
0.3 | 3.8 | GO:0032156 | septin cytoskeleton(GO:0032156) |
0.3 | 9.5 | GO:0015030 | Cajal body(GO:0015030) |
0.3 | 1.8 | GO:0016272 | prefoldin complex(GO:0016272) |
0.2 | 0.5 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 4.0 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.2 | 0.7 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.2 | 1.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.2 | 1.2 | GO:0005840 | ribosome(GO:0005840) |
0.2 | 2.4 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.2 | 2.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.2 | 2.6 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.2 | 13.4 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.2 | 1.4 | GO:0035976 | AP1 complex(GO:0035976) |
0.2 | 9.5 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.2 | 1.4 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.2 | 10.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.2 | 0.2 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.2 | 7.4 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.2 | 1.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.2 | 10.6 | GO:0030684 | preribosome(GO:0030684) |
0.2 | 2.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.2 | 1.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 1.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 0.2 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.2 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.2 | 1.1 | GO:0070826 | paraferritin complex(GO:0070826) |
0.2 | 2.4 | GO:0042588 | zymogen granule(GO:0042588) |
0.2 | 0.4 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.2 | 9.2 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 1.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 4.6 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.2 | 2.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 13.4 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.2 | 5.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.2 | 1.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.2 | 2.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.2 | 1.9 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 1.2 | GO:1990904 | ribonucleoprotein complex(GO:1990904) |
0.2 | 1.2 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.2 | 1.2 | GO:0030894 | replisome(GO:0030894) |
0.2 | 0.8 | GO:0032044 | DSIF complex(GO:0032044) |
0.2 | 2.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 2.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.2 | 0.2 | GO:0031527 | filopodium membrane(GO:0031527) |
0.2 | 6.2 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
0.2 | 0.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.2 | 0.4 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.2 | 1.9 | GO:0097386 | glial cell projection(GO:0097386) |
0.2 | 6.8 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.2 | 1.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.2 | 0.7 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
0.2 | 0.6 | GO:0097361 | CIA complex(GO:0097361) |
0.2 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 0.9 | GO:0070470 | plasma membrane respiratory chain complex I(GO:0045272) plasma membrane respiratory chain(GO:0070470) |
0.2 | 4.0 | GO:0000793 | condensed chromosome(GO:0000793) |
0.2 | 2.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.2 | 2.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.2 | 57.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.2 | 4.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.2 | 0.7 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
0.2 | 1.6 | GO:0016013 | syntrophin complex(GO:0016013) |
0.2 | 0.4 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.2 | 3.5 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.2 | 1.0 | GO:0097440 | apical dendrite(GO:0097440) |
0.2 | 1.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.2 | 18.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.2 | 1.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 0.5 | GO:0031905 | early endosome lumen(GO:0031905) |
0.2 | 0.5 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
0.2 | 2.0 | GO:0030008 | TRAPP complex(GO:0030008) |
0.2 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
0.2 | 3.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.2 | 2.8 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.2 | 0.8 | GO:0000938 | GARP complex(GO:0000938) |
0.2 | 6.5 | GO:0031526 | brush border membrane(GO:0031526) |
0.2 | 0.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.2 | 0.5 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
0.2 | 1.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 1.0 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.2 | 0.5 | GO:0033063 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 4.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.2 | 0.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.2 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 0.5 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.2 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 0.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 1.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 0.4 | GO:0018444 | translation release factor complex(GO:0018444) |
0.1 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.4 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 6.8 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
0.1 | 3.3 | GO:0005813 | centrosome(GO:0005813) |
0.1 | 0.6 | GO:0071014 | U2-type post-mRNA release spliceosomal complex(GO:0071008) post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 1.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 7.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 5.2 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.6 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 0.6 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.1 | 2.1 | GO:0034399 | nuclear periphery(GO:0034399) |
0.1 | 4.8 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
0.1 | 2.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.9 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 4.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 2.8 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 1.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 0.8 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.5 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
0.1 | 16.8 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.1 | 6.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 2.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.5 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
0.1 | 0.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.9 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 15.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.5 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 38.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 1.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 1.1 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.1 | 0.2 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
0.1 | 1.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 1.5 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 2.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 1.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.1 | 9.3 | GO:0070821 | tertiary granule membrane(GO:0070821) |
0.1 | 3.1 | GO:0005844 | polysome(GO:0005844) |
0.1 | 262.9 | GO:0005654 | nucleoplasm(GO:0005654) |
0.1 | 0.9 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.1 | 0.2 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
0.1 | 0.7 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 3.4 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
0.1 | 1.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 4.0 | GO:0031672 | A band(GO:0031672) |
0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.1 | 0.7 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 6.7 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.7 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.5 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.1 | 0.6 | GO:0031904 | endosome lumen(GO:0031904) |
0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 6.7 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.1 | 4.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.6 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.1 | 0.3 | GO:0036026 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
0.1 | 8.8 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.1 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 3.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
0.1 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
0.1 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.1 | 3.1 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.7 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.1 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.6 | GO:0060170 | ciliary membrane(GO:0060170) |
0.1 | 2.3 | GO:0030118 | clathrin coat(GO:0030118) |
0.1 | 7.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.8 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.2 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 4.7 | GO:0034705 | voltage-gated potassium channel complex(GO:0008076) potassium channel complex(GO:0034705) |
0.1 | 0.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.9 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
0.0 | 1.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.3 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
0.0 | 6.6 | GO:0031966 | mitochondrial membrane(GO:0031966) |
0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 4.7 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 2.9 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.6 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.2 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 2.6 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.1 | GO:0019867 | outer membrane(GO:0019867) |
0.0 | 0.1 | GO:0036020 | endolysosome membrane(GO:0036020) |
0.0 | 0.8 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.7 | GO:0005740 | mitochondrial envelope(GO:0005740) |
0.0 | 0.1 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.0 | 0.0 | GO:0031906 | late endosome lumen(GO:0031906) |
0.0 | 0.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.0 | GO:0036019 | endolysosome(GO:0036019) |
0.0 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.2 | GO:0072372 | nonmotile primary cilium(GO:0031513) primary cilium(GO:0072372) |
0.0 | 0.5 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
0.0 | 0.0 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 5.8 | GO:0016403 | dimethylargininase activity(GO:0016403) |
0.6 | 1.9 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.5 | 1.5 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
0.4 | 1.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.4 | 1.2 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
0.4 | 1.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.4 | 1.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.4 | 0.7 | GO:0048039 | quinone binding(GO:0048038) ubiquinone binding(GO:0048039) |
0.3 | 2.4 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.3 | 2.8 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.3 | 2.7 | GO:0042731 | PH domain binding(GO:0042731) |
0.3 | 1.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 1.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.3 | 1.0 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.2 | 1.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.2 | 0.7 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.2 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.2 | 0.2 | GO:0044389 | ubiquitin-like protein ligase binding(GO:0044389) |
0.2 | 4.0 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.2 | 0.6 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.2 | 0.6 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.2 | 1.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
0.2 | 2.3 | GO:0038132 | neuregulin binding(GO:0038132) |
0.2 | 1.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 0.7 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 0.7 | GO:0047708 | biotinidase activity(GO:0047708) |
0.2 | 1.5 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.2 | 0.5 | GO:0032093 | SAM domain binding(GO:0032093) |
0.2 | 0.8 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
0.2 | 1.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.2 | 0.8 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
0.1 | 0.4 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.1 | 0.6 | GO:0005046 | KDEL sequence binding(GO:0005046) |
0.1 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 1.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.5 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
0.1 | 2.9 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.1 | 0.4 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
0.1 | 0.5 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.7 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.8 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.9 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.8 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 1.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.4 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
0.1 | 0.3 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.1 | 0.7 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.5 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
0.1 | 0.4 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 1.7 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 3.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:0016731 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
0.1 | 1.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 0.4 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.1 | 0.3 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
0.1 | 0.2 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
0.1 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.7 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.4 | GO:0039552 | RIG-I binding(GO:0039552) |
0.1 | 1.3 | GO:0043295 | glutathione binding(GO:0043295) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.9 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.2 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.1 | 0.4 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 1.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.3 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
0.1 | 1.0 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.2 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
0.1 | 0.5 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.7 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.5 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.9 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.2 | GO:0052795 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 1.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.2 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
0.1 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.6 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
0.0 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 1.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.3 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.4 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 1.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.6 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 1.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.5 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 1.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0002060 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
0.0 | 0.2 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.8 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 1.0 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.2 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.6 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.5 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.0 | 0.1 | GO:0015403 | thiamine transmembrane transporter activity(GO:0015234) thiamine uptake transmembrane transporter activity(GO:0015403) |
0.0 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 0.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.0 | 0.1 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.2 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.6 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.0 | GO:0031701 | growth hormone receptor binding(GO:0005131) angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.1 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 2.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.4 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 1.0 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 1.2 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.4 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.4 | GO:0043236 | laminin binding(GO:0043236) |
0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.0 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.1 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 1.2 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 1.0 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.0 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 1.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 2.7 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.0 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.1 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.3 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.0 | GO:0016407 | acetyltransferase activity(GO:0016407) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.1 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
0.0 | 0.6 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.1 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 1.7 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.2 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
0.0 | 0.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.0 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.0 | 0.1 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.1 | GO:0052811 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.3 | 2.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 0.9 | GO:0032449 | CBM complex(GO:0032449) |
0.1 | 1.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.8 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 0.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.3 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.1 | 0.5 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.1 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.2 | GO:0031213 | RSF complex(GO:0031213) |
0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 1.0 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 1.2 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 1.1 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.5 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 1.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.6 | GO:0031105 | septin complex(GO:0031105) |
0.0 | 3.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.2 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 1.3 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.7 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.5 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.7 | 20.0 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
4.7 | 14.2 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
4.4 | 17.5 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
3.9 | 23.4 | GO:0030421 | defecation(GO:0030421) |
3.8 | 11.3 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
3.3 | 30.1 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
3.0 | 3.0 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
2.7 | 19.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
2.5 | 15.0 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
2.4 | 2.4 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
2.4 | 7.2 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
2.4 | 9.5 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
2.3 | 6.9 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
2.2 | 6.7 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
2.1 | 10.4 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
2.1 | 12.4 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
2.0 | 6.1 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
2.0 | 6.1 | GO:1902995 | regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
1.9 | 5.8 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
1.9 | 9.4 | GO:0051182 | coenzyme transport(GO:0051182) |
1.9 | 5.6 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
1.8 | 5.4 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
1.8 | 5.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
1.8 | 7.1 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
1.7 | 8.7 | GO:1903412 | response to bile acid(GO:1903412) |
1.7 | 5.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
1.7 | 1.7 | GO:0051606 | detection of stimulus(GO:0051606) |
1.7 | 11.8 | GO:0031398 | positive regulation of protein ubiquitination(GO:0031398) |
1.7 | 6.7 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
1.6 | 1.6 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
1.6 | 4.8 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
1.6 | 14.2 | GO:0060717 | chorion development(GO:0060717) |
1.6 | 4.7 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
1.6 | 20.3 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
1.6 | 4.7 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
1.5 | 4.5 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
1.5 | 2.9 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
1.5 | 8.8 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
1.5 | 4.4 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
1.4 | 5.8 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
1.4 | 22.8 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
1.4 | 4.3 | GO:0015743 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
1.4 | 8.4 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
1.4 | 7.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
1.4 | 16.7 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
1.4 | 8.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
1.4 | 4.2 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
1.4 | 4.2 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
1.4 | 5.5 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
1.4 | 8.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
1.4 | 6.8 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
1.4 | 1.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
1.4 | 6.8 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
1.3 | 9.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
1.3 | 3.9 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
1.3 | 2.6 | GO:1901656 | glycoside transport(GO:1901656) |
1.3 | 5.1 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
1.3 | 5.1 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
1.3 | 5.0 | GO:0072302 | posterior mesonephric tubule development(GO:0072166) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
1.3 | 3.8 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
1.3 | 2.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
1.2 | 6.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
1.2 | 2.5 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
1.2 | 3.7 | GO:1902227 | negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) |
1.2 | 7.4 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
1.2 | 2.4 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
1.2 | 4.9 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
1.2 | 4.8 | GO:0003185 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
1.2 | 6.0 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
1.2 | 3.6 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
1.2 | 22.5 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
1.2 | 5.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
1.2 | 4.6 | GO:0071895 | odontoblast differentiation(GO:0071895) |
1.2 | 1.2 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) negative regulation of cell cycle G2/M phase transition(GO:1902750) |
1.1 | 3.4 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
1.1 | 6.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
1.1 | 4.6 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
1.1 | 4.5 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
1.1 | 1.1 | GO:0040031 | snRNA modification(GO:0040031) |
1.1 | 5.7 | GO:0015862 | uridine transport(GO:0015862) |
1.1 | 6.8 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
1.1 | 2.2 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
1.1 | 1.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
1.1 | 4.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
1.1 | 6.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
1.1 | 3.3 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
1.1 | 5.5 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
1.1 | 27.2 | GO:0006337 | nucleosome disassembly(GO:0006337) |
1.1 | 7.6 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
1.1 | 6.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
1.1 | 5.3 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
1.1 | 3.2 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
1.1 | 3.2 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
1.0 | 7.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
1.0 | 15.6 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
1.0 | 5.2 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
1.0 | 1.0 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
1.0 | 2.1 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
1.0 | 10.3 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
1.0 | 16.3 | GO:0021670 | lateral ventricle development(GO:0021670) |
1.0 | 8.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
1.0 | 1.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
1.0 | 16.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
1.0 | 3.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
1.0 | 14.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
1.0 | 3.0 | GO:0048478 | replication fork protection(GO:0048478) |
1.0 | 5.0 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
1.0 | 1.0 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
1.0 | 6.9 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
1.0 | 4.9 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
1.0 | 2.9 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
1.0 | 1.0 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
1.0 | 5.9 | GO:0006642 | triglyceride mobilization(GO:0006642) |
1.0 | 9.7 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
1.0 | 1.9 | GO:0090003 | regulation of establishment of protein localization to plasma membrane(GO:0090003) |
1.0 | 6.7 | GO:0070269 | pyroptosis(GO:0070269) |
1.0 | 7.6 | GO:0044351 | macropinocytosis(GO:0044351) |
0.9 | 1.9 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.9 | 2.8 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
0.9 | 1.9 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.9 | 2.8 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
0.9 | 4.7 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.9 | 3.7 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
0.9 | 2.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.9 | 2.8 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
0.9 | 0.9 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.9 | 9.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.9 | 3.7 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.9 | 17.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.9 | 11.8 | GO:0015671 | oxygen transport(GO:0015671) |
0.9 | 3.6 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.9 | 8.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.9 | 2.7 | GO:1990519 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
0.9 | 1.8 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.9 | 4.4 | GO:0072553 | terminal button organization(GO:0072553) |
0.9 | 2.6 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.9 | 5.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.9 | 1.7 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.9 | 4.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.9 | 6.9 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.9 | 4.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.8 | 2.5 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.8 | 8.5 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.8 | 0.8 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.8 | 1.7 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.8 | 5.9 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.8 | 5.1 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
0.8 | 4.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.8 | 3.4 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
0.8 | 2.5 | GO:0032759 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) |
0.8 | 2.5 | GO:0006272 | leading strand elongation(GO:0006272) |
0.8 | 2.5 | GO:1904044 | response to aldosterone(GO:1904044) |
0.8 | 2.5 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
0.8 | 3.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.8 | 3.3 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
0.8 | 33.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.8 | 0.8 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.8 | 2.4 | GO:0009447 | putrescine catabolic process(GO:0009447) |
0.8 | 3.3 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.8 | 2.4 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.8 | 3.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.8 | 0.8 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
0.8 | 3.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.8 | 3.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.8 | 3.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.8 | 2.4 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
0.8 | 2.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.8 | 5.6 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.8 | 0.8 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.8 | 0.8 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.8 | 6.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.8 | 3.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.8 | 2.4 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
0.8 | 1.6 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.8 | 2.4 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
0.8 | 1.6 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
0.8 | 2.3 | GO:0051946 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
0.8 | 4.7 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.8 | 2.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.8 | 2.3 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
0.8 | 2.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.8 | 17.0 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.8 | 7.7 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
0.8 | 3.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
0.8 | 2.3 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
0.8 | 3.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
0.8 | 0.8 | GO:0010265 | SCF complex assembly(GO:0010265) |
0.8 | 0.8 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.8 | 2.3 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
0.8 | 0.8 | GO:1901998 | toxin transport(GO:1901998) |
0.8 | 1.5 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.8 | 4.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
0.7 | 3.7 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.7 | 2.2 | GO:1990502 | dense core granule maturation(GO:1990502) |
0.7 | 9.7 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.7 | 2.2 | GO:0048382 | mesendoderm development(GO:0048382) |
0.7 | 2.2 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
0.7 | 2.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
0.7 | 3.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.7 | 2.2 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.7 | 1.5 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
0.7 | 0.7 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.7 | 4.4 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.7 | 2.2 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
0.7 | 1.4 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.7 | 2.9 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
0.7 | 2.1 | GO:0048880 | sensory system development(GO:0048880) |
0.7 | 1.4 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) positive regulation of adenosine receptor signaling pathway(GO:0060168) |
0.7 | 5.7 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.7 | 8.5 | GO:0070986 | left/right axis specification(GO:0070986) |
0.7 | 5.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.7 | 1.4 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.7 | 1.4 | GO:0070265 | necrotic cell death(GO:0070265) |
0.7 | 2.8 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.7 | 2.8 | GO:0001743 | optic placode formation(GO:0001743) |
0.7 | 4.8 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.7 | 2.1 | GO:0033504 | floor plate development(GO:0033504) |
0.7 | 2.1 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
0.7 | 0.7 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.7 | 2.1 | GO:1904744 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) positive regulation of telomeric DNA binding(GO:1904744) |
0.7 | 1.4 | GO:0043634 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.7 | 2.7 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.7 | 0.7 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.7 | 2.7 | GO:0032072 | plasmacytoid dendritic cell activation(GO:0002270) T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) regulation of restriction endodeoxyribonuclease activity(GO:0032072) negative regulation of apoptotic cell clearance(GO:2000426) |
0.7 | 2.0 | GO:0019827 | stem cell population maintenance(GO:0019827) |
0.7 | 5.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.7 | 0.7 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.7 | 2.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.7 | 2.0 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.7 | 0.7 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) |
0.7 | 8.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.7 | 1.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.7 | 6.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.7 | 1.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.7 | 1.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.7 | 2.7 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
0.7 | 0.7 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.7 | 0.7 | GO:0034759 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
0.7 | 1.3 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.7 | 3.3 | GO:1902896 | terminal web assembly(GO:1902896) |
0.7 | 1.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.7 | 4.6 | GO:0072718 | response to cisplatin(GO:0072718) |
0.7 | 2.6 | GO:0005997 | xylulose metabolic process(GO:0005997) |
0.7 | 1.3 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.7 | 0.7 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.7 | 2.6 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.7 | 7.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.7 | 0.7 | GO:0090427 | embryonic nail plate morphogenesis(GO:0035880) activation of meiosis(GO:0090427) |
0.7 | 11.8 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.7 | 2.0 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
0.7 | 0.7 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.7 | 0.7 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.6 | 7.8 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.6 | 1.9 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
0.6 | 1.3 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.6 | 1.3 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.6 | 2.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.6 | 1.9 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
0.6 | 3.2 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.6 | 1.9 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
0.6 | 1.9 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.6 | 0.6 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.6 | 0.6 | GO:0072301 | metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) |
0.6 | 1.9 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
0.6 | 1.9 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
0.6 | 1.9 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.6 | 1.9 | GO:0060152 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
0.6 | 1.9 | GO:0042823 | pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
0.6 | 4.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.6 | 3.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.6 | 3.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.6 | 1.9 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.6 | 0.6 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.6 | 2.5 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.6 | 0.6 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.6 | 2.5 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.6 | 2.5 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.6 | 1.2 | GO:0046545 | development of primary female sexual characteristics(GO:0046545) |
0.6 | 2.5 | GO:0051958 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
0.6 | 5.6 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.6 | 1.9 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.6 | 0.6 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
0.6 | 3.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.6 | 2.5 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing by siRNA(GO:0090625) mRNA cleavage involved in gene silencing(GO:0098795) |
0.6 | 2.5 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
0.6 | 3.7 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.6 | 1.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.6 | 0.6 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
0.6 | 1.2 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.6 | 4.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.6 | 1.8 | GO:1902567 | negative regulation of eosinophil activation(GO:1902567) |
0.6 | 7.9 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.6 | 0.6 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
0.6 | 4.8 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.6 | 3.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.6 | 1.8 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.6 | 9.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.6 | 5.3 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.6 | 1.8 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
0.6 | 0.6 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
0.6 | 2.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.6 | 1.7 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) membrane raft localization(GO:0051665) |
0.6 | 2.3 | GO:0014038 | regulation of Schwann cell differentiation(GO:0014038) |
0.6 | 1.7 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.6 | 6.4 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.6 | 3.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.6 | 2.3 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
0.6 | 3.5 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.6 | 2.9 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.6 | 0.6 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.6 | 0.6 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
0.6 | 1.1 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
0.6 | 1.7 | GO:0042351 | GDP-L-fucose biosynthetic process(GO:0042350) 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.6 | 14.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.6 | 5.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.6 | 2.3 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.6 | 7.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.6 | 5.6 | GO:0045008 | depyrimidination(GO:0045008) |
0.6 | 1.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.6 | 2.8 | GO:0016240 | autophagosome docking(GO:0016240) |
0.6 | 0.6 | GO:0060374 | mast cell differentiation(GO:0060374) |
0.6 | 2.8 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.6 | 5.0 | GO:0051383 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.6 | 13.8 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.5 | 3.8 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.5 | 5.5 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
0.5 | 1.1 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
0.5 | 6.5 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.5 | 1.1 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.5 | 1.6 | GO:0048687 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
0.5 | 2.2 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
0.5 | 10.3 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.5 | 3.8 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.5 | 2.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.5 | 3.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.5 | 2.7 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
0.5 | 0.5 | GO:1904030 | negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.5 | 1.1 | GO:0048260 | positive regulation of receptor-mediated endocytosis(GO:0048260) |
0.5 | 15.0 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.5 | 1.6 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
0.5 | 4.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.5 | 1.6 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.5 | 2.7 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.5 | 1.1 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.5 | 4.2 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
0.5 | 1.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.5 | 5.8 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.5 | 1.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.5 | 1.6 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.5 | 3.7 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.5 | 1.0 | GO:0030261 | chromosome condensation(GO:0030261) |
0.5 | 2.6 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.5 | 0.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.5 | 1.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.5 | 3.1 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.5 | 4.7 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.5 | 0.5 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.5 | 0.5 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
0.5 | 1.0 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.5 | 1.0 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.5 | 2.0 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.5 | 1.5 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.5 | 3.1 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.5 | 0.5 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.5 | 0.5 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.5 | 1.5 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
0.5 | 2.5 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.5 | 42.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.5 | 1.5 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.5 | 2.0 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) |
0.5 | 1.0 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.5 | 2.5 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.5 | 1.0 | GO:1904903 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
0.5 | 5.9 | GO:0043486 | histone exchange(GO:0043486) |
0.5 | 12.8 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.5 | 1.5 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.5 | 1.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.5 | 1.5 | GO:1901355 | response to rapamycin(GO:1901355) |
0.5 | 2.0 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.5 | 1.5 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.5 | 26.9 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.5 | 1.0 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
0.5 | 1.0 | GO:0006941 | striated muscle contraction(GO:0006941) |
0.5 | 1.4 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.5 | 1.0 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.5 | 1.9 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.5 | 2.4 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) asymmetric stem cell division(GO:0098722) germline stem cell asymmetric division(GO:0098728) |
0.5 | 0.5 | GO:0050957 | equilibrioception(GO:0050957) |
0.5 | 0.5 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) |
0.5 | 0.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.5 | 4.3 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.5 | 0.5 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.5 | 2.9 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.5 | 5.7 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
0.5 | 0.5 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.5 | 3.8 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.5 | 3.3 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.5 | 0.9 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
0.5 | 1.9 | GO:0006740 | NADPH regeneration(GO:0006740) |
0.5 | 1.9 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
0.5 | 2.3 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
0.5 | 3.3 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.5 | 6.6 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.5 | 1.9 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.5 | 1.9 | GO:0032416 | negative regulation of sodium:proton antiporter activity(GO:0032416) |
0.5 | 5.1 | GO:0021924 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
0.5 | 0.9 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.5 | 3.7 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
0.5 | 1.4 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.5 | 0.9 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.5 | 1.4 | GO:1903660 | negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.5 | 0.9 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.5 | 3.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.5 | 1.8 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.5 | 1.4 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.5 | 2.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.5 | 1.4 | GO:0002159 | desmosome assembly(GO:0002159) |
0.5 | 0.9 | GO:0051866 | general adaptation syndrome(GO:0051866) |
0.5 | 0.9 | GO:0061724 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.5 | 1.4 | GO:0097056 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.5 | 0.9 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.5 | 2.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.4 | 1.3 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.4 | 2.7 | GO:0016926 | protein desumoylation(GO:0016926) |
0.4 | 8.5 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.4 | 0.9 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) |
0.4 | 0.9 | GO:0006574 | valine metabolic process(GO:0006573) valine catabolic process(GO:0006574) |
0.4 | 0.4 | GO:0010041 | response to iron(III) ion(GO:0010041) |
0.4 | 1.3 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
0.4 | 4.0 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.4 | 5.3 | GO:0021794 | thalamus development(GO:0021794) |
0.4 | 1.3 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.4 | 1.7 | GO:0003335 | corneocyte development(GO:0003335) |
0.4 | 1.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.4 | 0.4 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.4 | 1.7 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
0.4 | 5.6 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.4 | 1.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.4 | 0.4 | GO:0072079 | nephron tubule formation(GO:0072079) |
0.4 | 2.2 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.4 | 12.5 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.4 | 4.3 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.4 | 1.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.4 | 0.9 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.4 | 1.3 | GO:0071301 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
0.4 | 1.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.4 | 0.4 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.4 | 2.1 | GO:0021759 | globus pallidus development(GO:0021759) |
0.4 | 0.9 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.4 | 0.4 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.4 | 4.6 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
0.4 | 1.7 | GO:0015870 | acetylcholine transport(GO:0015870) |
0.4 | 2.9 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.4 | 0.8 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.4 | 2.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.4 | 2.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.4 | 0.4 | GO:1902075 | cellular response to salt(GO:1902075) |
0.4 | 30.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.4 | 4.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.4 | 2.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.4 | 4.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.4 | 7.0 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.4 | 0.8 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
0.4 | 0.8 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.4 | 7.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.4 | 3.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.4 | 1.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.4 | 1.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.4 | 1.6 | GO:2000410 | regulation of thymocyte migration(GO:2000410) |
0.4 | 0.8 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
0.4 | 0.4 | GO:0015879 | carnitine transport(GO:0015879) |
0.4 | 2.0 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.4 | 1.6 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.4 | 3.6 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.4 | 1.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.4 | 1.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.4 | 0.4 | GO:0070426 | positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
0.4 | 1.2 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.4 | 0.4 | GO:0090186 | regulation of pancreatic juice secretion(GO:0090186) |
0.4 | 0.4 | GO:0000154 | rRNA modification(GO:0000154) |
0.4 | 1.9 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.4 | 3.5 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.4 | 1.2 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.4 | 1.2 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.4 | 1.2 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.4 | 6.9 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.4 | 0.8 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
0.4 | 1.1 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.4 | 0.8 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
0.4 | 1.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
0.4 | 1.1 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.4 | 1.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.4 | 2.3 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
0.4 | 1.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.4 | 1.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
0.4 | 2.6 | GO:0006116 | NADH oxidation(GO:0006116) |
0.4 | 1.5 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.4 | 0.4 | GO:0061056 | sclerotome development(GO:0061056) |
0.4 | 1.5 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
0.4 | 1.5 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.4 | 0.4 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.4 | 5.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.4 | 2.2 | GO:0035799 | ureter maturation(GO:0035799) |
0.4 | 1.5 | GO:0014063 | regulation of serotonin secretion(GO:0014062) negative regulation of serotonin secretion(GO:0014063) |
0.4 | 1.9 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.4 | 3.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.4 | 7.0 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.4 | 0.7 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.4 | 4.4 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
0.4 | 2.2 | GO:0050658 | nucleic acid transport(GO:0050657) RNA transport(GO:0050658) |
0.4 | 1.5 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
0.4 | 0.7 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.4 | 0.7 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) positive regulation of glycogen metabolic process(GO:0070875) |
0.4 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.4 | 1.5 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.4 | 1.8 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.4 | 5.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.4 | 4.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.4 | 1.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.4 | 1.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.4 | 1.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.4 | 0.7 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.4 | 0.4 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.4 | 2.2 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
0.4 | 1.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
0.4 | 6.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.4 | 2.9 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.4 | 5.7 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
0.4 | 4.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.4 | 1.1 | GO:0019405 | alditol catabolic process(GO:0019405) |
0.4 | 1.1 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
0.4 | 3.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.4 | 0.7 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.4 | 0.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.3 | 0.7 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.3 | 7.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) |
0.3 | 0.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.3 | 2.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.3 | 9.0 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.3 | 1.4 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
0.3 | 1.4 | GO:2000611 | regulation of thyroid hormone generation(GO:2000609) positive regulation of thyroid hormone generation(GO:2000611) |
0.3 | 5.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.3 | 2.1 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
0.3 | 1.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.3 | 1.4 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.3 | 0.3 | GO:0010044 | response to aluminum ion(GO:0010044) |
0.3 | 1.0 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
0.3 | 2.1 | GO:0043631 | RNA polyadenylation(GO:0043631) |
0.3 | 1.7 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.3 | 2.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.3 | 2.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.3 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.3 | 1.0 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.3 | 0.3 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.3 | 2.4 | GO:0007141 | male meiosis I(GO:0007141) |
0.3 | 0.7 | GO:0030242 | pexophagy(GO:0030242) |
0.3 | 1.0 | GO:0071934 | thiamine transport(GO:0015888) thiamine transmembrane transport(GO:0071934) |
0.3 | 1.0 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
0.3 | 2.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.3 | 1.0 | GO:0016246 | RNA interference(GO:0016246) |
0.3 | 2.3 | GO:0006868 | glutamine transport(GO:0006868) |
0.3 | 1.0 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
0.3 | 1.0 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
0.3 | 0.3 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.3 | 2.3 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.3 | 0.3 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.3 | 0.3 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.3 | 1.3 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
0.3 | 1.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.3 | 2.9 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.3 | 1.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.3 | 9.0 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.3 | 8.3 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.3 | 1.3 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
0.3 | 1.6 | GO:0051013 | microtubule severing(GO:0051013) |
0.3 | 0.6 | GO:0034378 | chylomicron assembly(GO:0034378) |
0.3 | 1.9 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.3 | 1.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.3 | 0.3 | GO:0019086 | late viral transcription(GO:0019086) |
0.3 | 0.3 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
0.3 | 1.9 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.3 | 2.8 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.3 | 2.2 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
0.3 | 0.6 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.3 | 1.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.3 | 0.3 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.3 | 1.6 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.3 | 1.2 | GO:0032218 | riboflavin transport(GO:0032218) |
0.3 | 1.5 | GO:0071105 | response to interleukin-11(GO:0071105) |
0.3 | 0.9 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
0.3 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.3 | 7.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.3 | 4.6 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
0.3 | 1.5 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.3 | 0.3 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.3 | 1.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 2.1 | GO:0002021 | response to dietary excess(GO:0002021) |
0.3 | 5.7 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
0.3 | 0.6 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
0.3 | 3.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.3 | 0.6 | GO:0051403 | stress-activated MAPK cascade(GO:0051403) |
0.3 | 0.9 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.3 | 1.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.3 | 0.3 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.3 | 2.1 | GO:1905247 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
0.3 | 0.9 | GO:2000561 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
0.3 | 0.6 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.3 | 7.1 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.3 | 0.6 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.3 | 0.6 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.3 | 1.5 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
0.3 | 4.4 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.3 | 1.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.3 | 0.6 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.3 | 0.6 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
0.3 | 0.6 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.3 | 3.8 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.3 | 0.6 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.3 | 1.8 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.3 | 0.9 | GO:0051685 | maintenance of ER location(GO:0051685) |
0.3 | 0.3 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.3 | 0.9 | GO:0061081 | positive regulation of macrophage cytokine production(GO:0060907) positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
0.3 | 1.5 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.3 | 1.7 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.3 | 0.6 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.3 | 0.9 | GO:0035425 | autocrine signaling(GO:0035425) |
0.3 | 4.6 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.3 | 0.3 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.3 | 1.7 | GO:0055129 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
0.3 | 2.6 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.3 | 0.9 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.3 | 1.4 | GO:0032455 | nerve growth factor processing(GO:0032455) |
0.3 | 1.4 | GO:0030070 | insulin processing(GO:0030070) |
0.3 | 3.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.3 | 0.3 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.3 | 0.6 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.3 | 0.9 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.3 | 1.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
0.3 | 2.3 | GO:0009303 | rRNA transcription(GO:0009303) |
0.3 | 0.8 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.3 | 0.8 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.3 | 2.0 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.3 | 0.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
0.3 | 1.1 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
0.3 | 4.0 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.3 | 5.9 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.3 | 0.8 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.3 | 7.0 | GO:0006399 | tRNA metabolic process(GO:0006399) |
0.3 | 0.3 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.3 | 2.2 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
0.3 | 0.6 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.3 | 3.1 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.3 | 2.5 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
0.3 | 1.7 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.3 | 0.8 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.3 | 0.3 | GO:0099543 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
0.3 | 0.8 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.3 | 0.3 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
0.3 | 1.9 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
0.3 | 0.8 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 0.8 | GO:0070781 | response to biotin(GO:0070781) |
0.3 | 2.7 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.3 | 0.3 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
0.3 | 0.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.3 | 0.3 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.3 | 0.5 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
0.3 | 0.8 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.3 | 0.5 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
0.3 | 1.6 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.3 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
0.3 | 0.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.3 | 1.6 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.3 | 0.5 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.3 | 2.7 | GO:0051451 | myoblast migration(GO:0051451) |
0.3 | 0.8 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.3 | 0.3 | GO:0050772 | positive regulation of axonogenesis(GO:0050772) |
0.3 | 0.8 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.3 | 1.8 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.3 | 0.3 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.3 | 0.5 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.3 | 3.4 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.3 | 1.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.3 | 0.8 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.3 | 2.1 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
0.3 | 0.8 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.3 | 0.5 | GO:0051607 | defense response to virus(GO:0051607) |
0.3 | 0.3 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.3 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.3 | 2.9 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.3 | 9.4 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.3 | 1.0 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.3 | 2.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.3 | 1.3 | GO:0071233 | cellular response to leucine(GO:0071233) |
0.3 | 1.8 | GO:0030432 | peristalsis(GO:0030432) |
0.3 | 0.5 | GO:1903874 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
0.3 | 1.5 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.3 | 1.0 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.3 | 0.8 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.3 | 1.0 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
0.3 | 1.8 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.3 | 1.5 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.3 | 0.5 | GO:1902742 | apoptotic process involved in development(GO:1902742) |
0.3 | 3.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.3 | 0.8 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
0.3 | 1.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.3 | 1.0 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.3 | 1.3 | GO:0010389 | regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
0.3 | 1.3 | GO:0033227 | dsRNA transport(GO:0033227) |
0.3 | 1.0 | GO:0035624 | receptor transactivation(GO:0035624) |
0.3 | 1.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.3 | 1.3 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.2 | 0.5 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.2 | 10.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.2 | 6.0 | GO:0050779 | RNA destabilization(GO:0050779) |
0.2 | 0.5 | GO:0042262 | DNA protection(GO:0042262) |
0.2 | 1.2 | GO:0061756 | leukocyte adhesion to vascular endothelial cell(GO:0061756) |
0.2 | 1.2 | GO:0046600 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centriole replication(GO:0046600) |
0.2 | 2.7 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.2 | 0.5 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.2 | 0.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.2 | 1.2 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.2 | 0.5 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.2 | 0.2 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.2 | 0.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.2 | 1.2 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
0.2 | 2.9 | GO:0090671 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
0.2 | 0.7 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.2 | 0.7 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.2 | 5.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.2 | 6.0 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.2 | 1.0 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.2 | 3.8 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.2 | 1.9 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.2 | 4.1 | GO:0060736 | prostate gland growth(GO:0060736) |
0.2 | 3.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.2 | 2.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.2 | 13.3 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
0.2 | 3.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.2 | 0.9 | GO:0060290 | transdifferentiation(GO:0060290) |
0.2 | 0.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.2 | 1.2 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.2 | 1.2 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.2 | 1.6 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
0.2 | 0.5 | GO:2000330 | interleukin-23-mediated signaling pathway(GO:0038155) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
0.2 | 0.5 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
0.2 | 0.2 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.2 | 1.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.2 | 1.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.2 | 2.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.2 | 0.9 | GO:0010193 | response to ozone(GO:0010193) |
0.2 | 1.6 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.2 | 0.2 | GO:0045191 | regulation of isotype switching(GO:0045191) |
0.2 | 4.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.2 | 2.5 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.2 | 1.6 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.2 | 6.7 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.2 | 2.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.2 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.2 | 0.2 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.2 | 2.0 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
0.2 | 2.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.2 | 12.2 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
0.2 | 0.4 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
0.2 | 0.9 | GO:0043335 | protein unfolding(GO:0043335) |
0.2 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.2 | 1.1 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
0.2 | 0.4 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 0.7 | GO:0038188 | cholecystokinin signaling pathway(GO:0038188) |
0.2 | 1.3 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.2 | 3.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.2 | 0.4 | GO:0007518 | myoblast fate determination(GO:0007518) |
0.2 | 1.1 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.2 | 0.2 | GO:0003266 | regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.2 | 2.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.2 | 1.7 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.2 | 0.7 | GO:0042756 | drinking behavior(GO:0042756) |
0.2 | 0.2 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.2 | 2.6 | GO:0048857 | neural nucleus development(GO:0048857) |
0.2 | 0.4 | GO:0002028 | regulation of sodium ion transport(GO:0002028) |
0.2 | 1.7 | GO:0035306 | positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
0.2 | 2.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.2 | 0.9 | GO:0090299 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.2 | 0.6 | GO:0048821 | erythrocyte development(GO:0048821) |
0.2 | 0.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.2 | 1.3 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.2 | 0.2 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.2 | 1.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.2 | 2.1 | GO:0002483 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.2 | 0.4 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
0.2 | 0.9 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
0.2 | 0.6 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.2 | 12.6 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.2 | 1.9 | GO:0090278 | negative regulation of peptide secretion(GO:0002792) negative regulation of insulin secretion(GO:0046676) negative regulation of hormone secretion(GO:0046888) negative regulation of peptide hormone secretion(GO:0090278) |
0.2 | 2.5 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.2 | 0.6 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.2 | 1.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.2 | 6.9 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.2 | 3.6 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.2 | 3.6 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.2 | 0.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.2 | 6.7 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.2 | 0.6 | GO:0035377 | transepithelial water transport(GO:0035377) |
0.2 | 0.2 | GO:0060022 | hard palate development(GO:0060022) |
0.2 | 3.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.2 | 2.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.2 | 1.2 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.2 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.2 | 2.3 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
0.2 | 0.4 | GO:0070541 | response to platinum ion(GO:0070541) |
0.2 | 0.8 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.2 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.8 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.2 | 2.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.2 | 0.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.2 | 1.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.2 | 0.4 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.2 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.2 | 1.4 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.2 | 0.4 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
0.2 | 1.6 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.2 | 1.4 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.2 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.2 | 0.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.2 | 0.6 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) negative regulation of neutrophil degranulation(GO:0043314) |
0.2 | 1.2 | GO:0006265 | DNA topological change(GO:0006265) |
0.2 | 0.2 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.2 | 0.8 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.2 | 4.1 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.2 | 0.6 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 1.6 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.2 | 0.4 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.2 | 0.6 | GO:0021510 | spinal cord development(GO:0021510) |
0.2 | 0.4 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
0.2 | 1.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.6 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
0.2 | 0.2 | GO:0072603 | interleukin-5 secretion(GO:0072603) regulation of interleukin-5 secretion(GO:2000662) |
0.2 | 0.6 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.2 | 0.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.2 | 2.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.2 | 0.4 | GO:0007260 | tyrosine phosphorylation of STAT protein(GO:0007260) |
0.2 | 5.7 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.2 | 0.6 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.2 | 3.4 | GO:0098868 | bone growth(GO:0098868) |
0.2 | 0.9 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.2 | 0.8 | GO:0021997 | neural plate axis specification(GO:0021997) |
0.2 | 0.9 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.2 | 1.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.2 | 0.4 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.2 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.6 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.2 | 1.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.2 | 0.2 | GO:0043409 | negative regulation of MAPK cascade(GO:0043409) |
0.2 | 0.2 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.2 | 0.7 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.2 | 1.7 | GO:0006415 | translational termination(GO:0006415) |
0.2 | 0.9 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
0.2 | 0.4 | GO:0043092 | L-amino acid import(GO:0043092) |
0.2 | 1.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.2 | 0.9 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.2 | 1.3 | GO:0051340 | regulation of ligase activity(GO:0051340) |
0.2 | 0.4 | GO:0050893 | sensory processing(GO:0050893) |
0.2 | 0.5 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.2 | 0.7 | GO:0060125 | habituation(GO:0046959) negative regulation of growth hormone secretion(GO:0060125) |
0.2 | 0.5 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.2 | 7.0 | GO:0001510 | RNA methylation(GO:0001510) |
0.2 | 0.2 | GO:0090238 | negative regulation of icosanoid secretion(GO:0032304) regulation of arachidonic acid secretion(GO:0090237) positive regulation of arachidonic acid secretion(GO:0090238) |
0.2 | 0.4 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
0.2 | 4.1 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
0.2 | 2.5 | GO:0046889 | positive regulation of lipid biosynthetic process(GO:0046889) |
0.2 | 0.7 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.2 | 0.4 | GO:0015942 | formate metabolic process(GO:0015942) |
0.2 | 0.9 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.2 | 0.2 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.2 | 0.5 | GO:0033029 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) positive regulation of neutrophil apoptotic process(GO:0033031) |
0.2 | 1.1 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.2 | 1.2 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.2 | 0.2 | GO:2001021 | negative regulation of response to DNA damage stimulus(GO:2001021) |
0.2 | 1.8 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 1.8 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.2 | 0.5 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
0.2 | 0.9 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
0.2 | 0.9 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.2 | 0.3 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
0.2 | 1.0 | GO:0032916 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) positive regulation of transforming growth factor beta3 production(GO:0032916) chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
0.2 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.2 | 0.5 | GO:0006473 | protein acetylation(GO:0006473) |
0.2 | 5.9 | GO:0043038 | amino acid activation(GO:0043038) tRNA aminoacylation(GO:0043039) |
0.2 | 0.3 | GO:0015917 | aminophospholipid transport(GO:0015917) |
0.2 | 0.2 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.2 | 1.4 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.2 | 3.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.2 | 2.9 | GO:0006972 | hyperosmotic response(GO:0006972) |
0.2 | 0.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.2 | 0.7 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.5 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.2 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.2 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.8 | GO:0035965 | cardiolipin metabolic process(GO:0032048) cardiolipin acyl-chain remodeling(GO:0035965) |
0.2 | 0.3 | GO:1903659 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
0.2 | 3.2 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.2 | 0.7 | GO:0034371 | chylomicron remodeling(GO:0034371) |
0.2 | 0.2 | GO:2001179 | regulation of interleukin-10 secretion(GO:2001179) |
0.2 | 0.5 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
0.2 | 0.5 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.2 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
0.2 | 0.2 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 2.7 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.2 | 1.2 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.2 | 0.2 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.2 | 0.5 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 0.5 | GO:0002894 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.2 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.2 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.2 | 0.8 | GO:0090280 | positive regulation of calcium ion import(GO:0090280) |
0.2 | 2.5 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.2 | 0.5 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
0.2 | 0.3 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.2 | 0.7 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.2 | 0.3 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.2 | 1.1 | GO:0050702 | interleukin-1 secretion(GO:0050701) interleukin-1 beta secretion(GO:0050702) |
0.2 | 1.5 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.2 | 0.2 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.2 | 1.0 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) regulation of homocysteine metabolic process(GO:0050666) |
0.2 | 0.8 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
0.2 | 0.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.2 | 0.5 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
0.2 | 0.2 | GO:0033206 | meiotic chromosome movement towards spindle pole(GO:0016344) meiotic cytokinesis(GO:0033206) |
0.2 | 0.5 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.2 | 2.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.2 | 0.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.2 | 0.5 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
0.2 | 1.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.2 | 4.5 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.2 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.2 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.2 | 0.5 | GO:0008355 | olfactory learning(GO:0008355) |
0.2 | 0.8 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
0.2 | 0.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.2 | 0.6 | GO:0086091 | regulation of heart rate by cardiac conduction(GO:0086091) |
0.2 | 0.3 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
0.2 | 0.8 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.2 | 0.5 | GO:0050856 | regulation of T cell receptor signaling pathway(GO:0050856) |
0.2 | 0.3 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
0.2 | 0.5 | GO:0002369 | T cell cytokine production(GO:0002369) |
0.2 | 1.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.2 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.2 | 0.5 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.2 | 0.6 | GO:0007140 | male meiosis(GO:0007140) |
0.2 | 0.2 | GO:0071287 | cellular response to manganese ion(GO:0071287) response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
0.2 | 0.2 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.2 | 1.1 | GO:0007379 | segment specification(GO:0007379) |
0.2 | 1.7 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.2 | 0.3 | GO:0042048 | olfactory behavior(GO:0042048) |
0.2 | 0.9 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.2 | 2.6 | GO:2000637 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
0.2 | 0.3 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.2 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
0.2 | 0.8 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.2 | 0.3 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.7 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.3 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 0.7 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 1.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.1 | 0.4 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
0.1 | 1.8 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.1 | 0.6 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 2.5 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.1 | 0.9 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.4 | GO:0001694 | histamine biosynthetic process(GO:0001694) |
0.1 | 0.1 | GO:0051138 | NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 1.0 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.1 | 0.7 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.1 | 0.1 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
0.1 | 0.6 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
0.1 | 0.6 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.1 | 0.6 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 2.0 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.1 | 0.4 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.1 | 1.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 4.3 | GO:0071426 | ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
0.1 | 1.7 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.1 | 0.3 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.1 | 2.9 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
0.1 | 0.3 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.1 | 1.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.3 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
0.1 | 0.3 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.1 | 0.4 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 1.3 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
0.1 | 0.3 | GO:0021591 | ventricular system development(GO:0021591) |
0.1 | 0.6 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
0.1 | 0.7 | GO:1904358 | positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
0.1 | 0.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 3.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.4 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 1.1 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.1 | 4.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.6 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.4 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.1 | 6.2 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.1 | 0.3 | GO:0033594 | response to hydroxyisoflavone(GO:0033594) |
0.1 | 0.3 | GO:1904693 | midbrain morphogenesis(GO:1904693) |
0.1 | 1.5 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.1 | 1.2 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
0.1 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.3 | GO:0050433 | regulation of catecholamine secretion(GO:0050433) |
0.1 | 0.3 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.1 | 0.8 | GO:0044550 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) secondary metabolite biosynthetic process(GO:0044550) |
0.1 | 15.1 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
0.1 | 7.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 9.4 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.4 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.1 | 0.8 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 1.6 | GO:0045076 | regulation of interleukin-2 biosynthetic process(GO:0045076) |
0.1 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 3.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.8 | GO:0009148 | pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) |
0.1 | 2.1 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.3 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 1.7 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 1.7 | GO:0016073 | snRNA metabolic process(GO:0016073) |
0.1 | 0.8 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 1.0 | GO:0019083 | viral transcription(GO:0019083) |
0.1 | 2.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 3.0 | GO:1901983 | regulation of protein acetylation(GO:1901983) |
0.1 | 0.5 | GO:0036269 | swimming behavior(GO:0036269) |
0.1 | 0.5 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 0.8 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.8 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.6 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.1 | 0.4 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
0.1 | 0.4 | GO:0070944 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
0.1 | 0.9 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
0.1 | 3.7 | GO:0006301 | postreplication repair(GO:0006301) |
0.1 | 0.7 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 2.4 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.5 | GO:0072658 | positive regulation of cell communication by electrical coupling(GO:0010650) maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
0.1 | 0.2 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
0.1 | 1.2 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
0.1 | 8.9 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.1 | 0.4 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 0.2 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 2.3 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 0.8 | GO:0071315 | cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
0.1 | 0.6 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.1 | 1.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.1 | 0.5 | GO:2000650 | negative regulation of sodium ion transmembrane transport(GO:1902306) negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.1 | 1.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 1.4 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.1 | 0.2 | GO:0010626 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.1 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
0.1 | 4.9 | GO:0002279 | mast cell activation involved in immune response(GO:0002279) mast cell degranulation(GO:0043303) |
0.1 | 0.4 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
0.1 | 1.5 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 2.3 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
0.1 | 1.9 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.5 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.1 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.6 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 0.8 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.5 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
0.1 | 0.2 | GO:0051973 | regulation of telomerase activity(GO:0051972) positive regulation of telomerase activity(GO:0051973) |
0.1 | 3.8 | GO:0006342 | chromatin silencing(GO:0006342) |
0.1 | 2.1 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.1 | 1.0 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.1 | 0.1 | GO:0015669 | gas transport(GO:0015669) |
0.1 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.1 | 0.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.6 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.4 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.1 | 2.9 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.1 | 0.9 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.1 | 0.3 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.1 | 0.3 | GO:0060088 | auditory receptor cell morphogenesis(GO:0002093) auditory receptor cell stereocilium organization(GO:0060088) |
0.1 | 0.1 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
0.1 | 0.2 | GO:0034128 | negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
0.1 | 0.9 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.4 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
0.1 | 0.2 | GO:0030101 | natural killer cell activation(GO:0030101) |
0.1 | 0.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 1.5 | GO:0032094 | response to food(GO:0032094) |
0.1 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 1.1 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.1 | 1.9 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
0.1 | 0.4 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
0.1 | 0.5 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.1 | 0.6 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.1 | 0.2 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 1.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.1 | 0.3 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.1 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.1 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.5 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.1 | 0.9 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.1 | 3.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.4 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.1 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.3 | GO:0050851 | antigen receptor-mediated signaling pathway(GO:0050851) |
0.1 | 0.5 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
0.1 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.4 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.1 | 0.4 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 1.0 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
0.1 | 0.6 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.1 | 1.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.3 | GO:0070528 | protein kinase C signaling(GO:0070528) |
0.1 | 0.2 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.1 | 0.1 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.1 | 0.4 | GO:0023035 | CD40 signaling pathway(GO:0023035) regulation of CD40 signaling pathway(GO:2000348) |
0.1 | 0.1 | GO:0050720 | interleukin-1 biosynthetic process(GO:0042222) interleukin-1 beta biosynthetic process(GO:0050720) |
0.1 | 0.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.5 | GO:0060157 | urinary bladder development(GO:0060157) |
0.1 | 0.5 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.1 | 6.7 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.5 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
0.1 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 1.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.1 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
0.1 | 2.0 | GO:0016575 | histone deacetylation(GO:0016575) |
0.1 | 0.5 | GO:0000022 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) |
0.1 | 0.1 | GO:0015793 | glycerol transport(GO:0015793) |
0.1 | 0.7 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
0.1 | 1.5 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.1 | 0.3 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
0.1 | 0.6 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.1 | GO:0051932 | synaptic transmission, GABAergic(GO:0051932) |
0.1 | 0.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 2.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 1.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.7 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.3 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.1 | 0.3 | GO:0072114 | regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) pronephros morphogenesis(GO:0072114) |
0.1 | 0.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.1 | 1.4 | GO:0046324 | regulation of glucose import(GO:0046324) |
0.1 | 0.3 | GO:0032352 | positive regulation of hormone metabolic process(GO:0032352) |
0.1 | 1.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.9 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.1 | 0.3 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 0.2 | GO:0042304 | regulation of fatty acid biosynthetic process(GO:0042304) |
0.1 | 2.9 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
0.1 | 1.7 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 1.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.1 | 1.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.1 | 0.6 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.8 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.8 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.3 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 1.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 0.3 | GO:0061107 | seminal vesicle development(GO:0061107) |
0.1 | 0.1 | GO:0050906 | detection of stimulus involved in sensory perception(GO:0050906) |
0.1 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 1.3 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.1 | 0.5 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.2 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
0.1 | 0.2 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
0.1 | 2.6 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.1 | 0.4 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 2.1 | GO:0006094 | gluconeogenesis(GO:0006094) |
0.1 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.6 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.1 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.4 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 0.5 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.6 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.1 | 0.2 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.1 | 0.5 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.1 | 1.4 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.1 | 2.0 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.2 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.1 | 2.6 | GO:0016925 | protein sumoylation(GO:0016925) |
0.1 | 0.3 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
0.1 | 0.5 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.1 | 0.2 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.1 | 0.3 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.1 | 12.6 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.1 | 0.4 | GO:0022900 | electron transport chain(GO:0022900) |
0.1 | 0.2 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
0.1 | 0.1 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.1 | 0.2 | GO:0032849 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.5 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.1 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 0.5 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
0.1 | 0.1 | GO:0044782 | cilium organization(GO:0044782) |
0.1 | 7.8 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.1 | 0.3 | GO:0007512 | adult heart development(GO:0007512) |
0.1 | 0.3 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.1 | 0.6 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 1.0 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.1 | 0.7 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
0.1 | 0.9 | GO:0007625 | grooming behavior(GO:0007625) |
0.1 | 0.2 | GO:0046968 | peptide antigen transport(GO:0046968) |
0.1 | 0.1 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
0.1 | 0.4 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.2 | GO:0098905 | regulation of bundle of His cell action potential(GO:0098905) |
0.1 | 0.1 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
0.1 | 0.9 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.3 | GO:0001764 | neuron migration(GO:0001764) |
0.1 | 1.6 | GO:0046677 | response to antibiotic(GO:0046677) |
0.1 | 0.1 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
0.1 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 0.6 | GO:0045730 | respiratory burst(GO:0045730) |
0.1 | 0.2 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.1 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.8 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.5 | GO:1901685 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.6 | GO:0010447 | response to acidic pH(GO:0010447) |
0.1 | 0.3 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.1 | 0.3 | GO:1905225 | thyroid-stimulating hormone signaling pathway(GO:0038194) cellular response to glycoprotein(GO:1904588) response to thyrotropin-releasing hormone(GO:1905225) cellular response to thyrotropin-releasing hormone(GO:1905229) |
0.1 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 2.2 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.5 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.1 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.2 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.2 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.1 | 0.6 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.1 | 0.1 | GO:1901098 | regulation of autophagosome maturation(GO:1901096) positive regulation of autophagosome maturation(GO:1901098) |
0.1 | 1.3 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.7 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.1 | 0.3 | GO:0014842 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
0.1 | 0.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 1.0 | GO:0031663 | lipopolysaccharide-mediated signaling pathway(GO:0031663) |
0.1 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.1 | 0.3 | GO:0046689 | response to mercury ion(GO:0046689) |
0.1 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.1 | GO:2001251 | negative regulation of chromosome organization(GO:2001251) |
0.1 | 0.6 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.1 | 0.3 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.1 | 0.6 | GO:0035518 | histone H2A ubiquitination(GO:0033522) histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.1 | GO:0044416 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
0.1 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.2 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.1 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.3 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
0.1 | 0.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.1 | 1.0 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.1 | 0.1 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.3 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.4 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.1 | 0.6 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.4 | GO:0048298 | regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.1 | 0.7 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.1 | 1.0 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.1 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.1 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
0.1 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.1 | GO:0007320 | insemination(GO:0007320) |
0.1 | 0.2 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.1 | 0.1 | GO:0060992 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) response to fungicide(GO:0060992) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
0.1 | 1.0 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.1 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.1 | 0.4 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.3 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.7 | GO:0009060 | aerobic respiration(GO:0009060) |
0.1 | 0.4 | GO:0044784 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
0.1 | 0.3 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
0.1 | 0.6 | GO:0043113 | receptor clustering(GO:0043113) |
0.1 | 0.1 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.1 | 0.4 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
0.1 | 0.1 | GO:0021988 | olfactory lobe development(GO:0021988) |
0.1 | 0.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 0.2 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.1 | 0.6 | GO:0050892 | intestinal absorption(GO:0050892) |
0.1 | 2.7 | GO:0071824 | protein-DNA complex subunit organization(GO:0071824) |
0.1 | 0.4 | GO:0061097 | regulation of protein tyrosine kinase activity(GO:0061097) |
0.1 | 0.2 | GO:0033555 | multicellular organismal response to stress(GO:0033555) |
0.1 | 0.5 | GO:0009409 | response to cold(GO:0009409) |
0.1 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
0.1 | 0.3 | GO:0060579 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
0.0 | 1.3 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.2 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.3 | GO:0072386 | plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.1 | GO:0048867 | stem cell fate determination(GO:0048867) |
0.0 | 0.1 | GO:0098759 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
0.0 | 0.2 | GO:0010458 | exit from mitosis(GO:0010458) |
0.0 | 0.3 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.2 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.2 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
0.0 | 0.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.1 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
0.0 | 0.7 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 1.3 | GO:0030317 | sperm motility(GO:0030317) |
0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.1 | GO:0015851 | nucleobase transport(GO:0015851) |
0.0 | 0.0 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
0.0 | 0.3 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.0 | 0.3 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
0.0 | 0.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.0 | 0.2 | GO:0051132 | NK T cell activation(GO:0051132) |
0.0 | 0.2 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.0 | 0.2 | GO:1900101 | regulation of endoplasmic reticulum unfolded protein response(GO:1900101) |
0.0 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.1 | GO:0009080 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.2 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0016048 | detection of temperature stimulus(GO:0016048) sensory perception of temperature stimulus(GO:0050951) |
0.0 | 0.0 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
0.0 | 0.5 | GO:0019081 | viral translation(GO:0019081) |
0.0 | 0.8 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.1 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.2 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.0 | 0.7 | GO:0045333 | cellular respiration(GO:0045333) |
0.0 | 0.3 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
0.0 | 0.2 | GO:0016569 | covalent chromatin modification(GO:0016569) |
0.0 | 2.0 | GO:0016573 | histone acetylation(GO:0016573) |
0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.3 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.0 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.1 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.3 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.0 | 0.1 | GO:0030098 | lymphocyte differentiation(GO:0030098) |
0.0 | 0.0 | GO:1990086 | regulation of neural retina development(GO:0061074) regulation of retina development in camera-type eye(GO:1902866) lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.3 | GO:0098761 | interleukin-7-mediated signaling pathway(GO:0038111) response to interleukin-7(GO:0098760) cellular response to interleukin-7(GO:0098761) |
0.0 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.0 | 0.2 | GO:0015868 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.6 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.1 | GO:0005985 | sucrose metabolic process(GO:0005985) |
0.0 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.5 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.1 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.0 | 0.1 | GO:0061373 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) melanocyte migration(GO:0097324) positive regulation of lens fiber cell differentiation(GO:1902748) |
0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 1.7 | GO:0007286 | spermatid development(GO:0007286) |
0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.2 | GO:0009651 | response to salt stress(GO:0009651) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 3.0 | GO:0006281 | DNA repair(GO:0006281) |
0.0 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
0.0 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.3 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
0.0 | 0.1 | GO:1904647 | response to rotenone(GO:1904647) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0044266 | angiotensin catabolic process in blood(GO:0002005) multicellular organismal protein catabolic process(GO:0044254) protein digestion(GO:0044256) multicellular organismal macromolecule catabolic process(GO:0044266) multicellular organismal protein metabolic process(GO:0044268) |
0.0 | 1.4 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.4 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.2 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 6.7 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.1 | GO:0040020 | regulation of meiotic nuclear division(GO:0040020) |
0.0 | 0.1 | GO:0072077 | renal vesicle morphogenesis(GO:0072077) renal vesicle development(GO:0072087) |
0.0 | 0.2 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0030730 | regulation of sequestering of triglyceride(GO:0010889) negative regulation of sequestering of triglyceride(GO:0010891) sequestering of triglyceride(GO:0030730) |
0.0 | 0.0 | GO:0008589 | regulation of smoothened signaling pathway(GO:0008589) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.1 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.0 | 0.1 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
0.0 | 0.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
0.0 | 0.1 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) positive regulation of cell proliferation in bone marrow(GO:0071864) |
0.0 | 0.0 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 2.6 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.2 | GO:0006536 | glutamate metabolic process(GO:0006536) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.4 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.0 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.0 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.9 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.0 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 0.0 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.0 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.1 | GO:0070670 | response to interleukin-4(GO:0070670) |
0.0 | 0.0 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:0045347 | regulation of MHC class II biosynthetic process(GO:0045346) negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0033260 | nuclear DNA replication(GO:0033260) |
0.0 | 0.9 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.0 | 0.1 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.1 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.7 | 20.0 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
4.7 | 14.2 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
4.7 | 19.0 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
3.9 | 15.6 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
3.6 | 14.6 | GO:0004998 | transferrin receptor activity(GO:0004998) |
3.0 | 24.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
2.8 | 11.4 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
2.6 | 10.5 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
2.6 | 36.1 | GO:0031014 | troponin T binding(GO:0031014) |
2.4 | 7.2 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
2.3 | 6.9 | GO:0047726 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
2.3 | 6.8 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
2.2 | 6.7 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
2.2 | 6.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
2.1 | 10.3 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
1.9 | 5.8 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
1.9 | 5.6 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
1.6 | 4.9 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
1.6 | 4.9 | GO:0016731 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
1.6 | 1.6 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
1.6 | 4.7 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
1.5 | 6.1 | GO:0032143 | single thymine insertion binding(GO:0032143) |
1.5 | 7.5 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
1.5 | 4.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
1.4 | 1.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
1.4 | 4.3 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
1.4 | 8.4 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
1.4 | 4.1 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
1.3 | 9.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
1.2 | 3.7 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
1.2 | 3.7 | GO:0097677 | STAT family protein binding(GO:0097677) |
1.2 | 7.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
1.2 | 10.9 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
1.2 | 6.0 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
1.2 | 9.6 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
1.2 | 4.7 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
1.2 | 3.5 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
1.2 | 4.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
1.2 | 11.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
1.1 | 3.4 | GO:0033149 | FFAT motif binding(GO:0033149) |
1.1 | 4.6 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
1.1 | 5.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
1.1 | 10.3 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
1.1 | 5.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
1.1 | 4.4 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
1.1 | 9.8 | GO:0004969 | histamine receptor activity(GO:0004969) |
1.1 | 4.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
1.1 | 4.3 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
1.1 | 3.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
1.1 | 3.2 | GO:0004603 | phenylethanolamine N-methyltransferase activity(GO:0004603) |
1.1 | 6.3 | GO:0004104 | cholinesterase activity(GO:0004104) |
1.0 | 3.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
1.0 | 2.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
1.0 | 4.1 | GO:0035939 | microsatellite binding(GO:0035939) |
1.0 | 8.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
1.0 | 3.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
1.0 | 4.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
1.0 | 11.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
1.0 | 9.8 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
1.0 | 2.9 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
1.0 | 2.9 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
1.0 | 6.8 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
1.0 | 17.5 | GO:0070628 | proteasome binding(GO:0070628) |
1.0 | 2.9 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
1.0 | 5.7 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.9 | 3.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
0.9 | 2.8 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
0.9 | 2.8 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
0.9 | 3.7 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.9 | 3.7 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.9 | 5.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.9 | 3.7 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
0.9 | 16.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.9 | 2.7 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.9 | 2.7 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.9 | 8.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.9 | 2.7 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
0.9 | 0.9 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.9 | 3.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.9 | 5.4 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.9 | 11.6 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.9 | 4.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.9 | 1.8 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.9 | 7.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.9 | 2.6 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
0.9 | 6.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.8 | 6.8 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.8 | 10.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.8 | 3.4 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.8 | 0.8 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) double-strand/single-strand DNA junction binding(GO:0000406) single guanine insertion binding(GO:0032142) dinucleotide repeat insertion binding(GO:0032181) |
0.8 | 6.6 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.8 | 3.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.8 | 1.6 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.8 | 2.4 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
0.8 | 12.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.8 | 4.0 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
0.8 | 4.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.8 | 3.1 | GO:0045118 | azole transporter activity(GO:0045118) |
0.8 | 3.9 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.8 | 15.6 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.8 | 4.7 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.8 | 5.4 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.8 | 10.7 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.8 | 8.4 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.8 | 2.3 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
0.8 | 3.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.7 | 3.7 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.7 | 0.7 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.7 | 2.2 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.7 | 4.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.7 | 0.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.7 | 10.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.7 | 6.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.7 | 5.8 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.7 | 3.6 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
0.7 | 11.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.7 | 2.8 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
0.7 | 2.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.7 | 5.6 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.7 | 2.8 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.7 | 2.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.7 | 5.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.7 | 2.1 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.7 | 7.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.7 | 5.5 | GO:0089720 | caspase binding(GO:0089720) |
0.7 | 7.5 | GO:0051430 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.7 | 2.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.7 | 2.0 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.7 | 1.3 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.7 | 2.0 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
0.7 | 11.4 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.7 | 2.0 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
0.7 | 3.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.7 | 4.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.7 | 5.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.7 | 2.6 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.7 | 2.6 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
0.7 | 2.0 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.6 | 33.8 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.6 | 1.9 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.6 | 1.9 | GO:0098770 | FBXO family protein binding(GO:0098770) |
0.6 | 3.9 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.6 | 1.9 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.6 | 6.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.6 | 3.8 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.6 | 5.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.6 | 10.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.6 | 1.9 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.6 | 2.5 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
0.6 | 26.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.6 | 2.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
0.6 | 1.9 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.6 | 11.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.6 | 4.9 | GO:0034711 | inhibin binding(GO:0034711) |
0.6 | 1.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.6 | 17.6 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.6 | 2.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.6 | 10.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.6 | 1.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.6 | 2.4 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
0.6 | 2.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.6 | 4.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.6 | 1.8 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.6 | 1.8 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.6 | 3.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.6 | 0.6 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
0.6 | 9.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.6 | 8.7 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.6 | 2.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.6 | 3.5 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.6 | 2.9 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.6 | 2.3 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.6 | 1.7 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
0.6 | 1.7 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.6 | 6.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.6 | 2.9 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.6 | 4.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.6 | 1.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.6 | 2.3 | GO:0004803 | transposase activity(GO:0004803) |
0.6 | 2.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.6 | 9.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.6 | 2.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.6 | 1.7 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.5 | 1.6 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.5 | 2.7 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.5 | 2.2 | GO:0004793 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.5 | 0.5 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.5 | 2.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.5 | 3.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.5 | 1.6 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
0.5 | 1.6 | GO:0032090 | Pyrin domain binding(GO:0032090) |
0.5 | 2.1 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
0.5 | 1.6 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
0.5 | 4.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.5 | 3.6 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.5 | 0.5 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.5 | 9.3 | GO:0035173 | histone kinase activity(GO:0035173) |
0.5 | 2.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.5 | 4.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.5 | 3.6 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.5 | 1.5 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
0.5 | 3.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.5 | 1.5 | GO:0035473 | lipase binding(GO:0035473) |
0.5 | 1.5 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
0.5 | 2.5 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
0.5 | 1.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.5 | 5.0 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.5 | 0.5 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.5 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.5 | 1.5 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.5 | 12.3 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.5 | 1.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.5 | 1.9 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.5 | 5.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.5 | 1.4 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.5 | 2.4 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.5 | 1.9 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.5 | 2.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.5 | 0.9 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.5 | 0.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.5 | 1.9 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.5 | 8.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.5 | 7.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.5 | 1.9 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
0.5 | 1.8 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
0.5 | 18.0 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.5 | 2.8 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.5 | 3.2 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
0.5 | 0.9 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.5 | 0.9 | GO:0034046 | poly(G) binding(GO:0034046) |
0.5 | 1.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.5 | 2.3 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.4 | 2.7 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.4 | 1.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.4 | 1.8 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.4 | 0.9 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.4 | 7.6 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.4 | 2.7 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.4 | 0.9 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.4 | 0.4 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.4 | 2.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.4 | 21.6 | GO:0019213 | deacetylase activity(GO:0019213) |
0.4 | 2.2 | GO:0070404 | NADH binding(GO:0070404) |
0.4 | 2.6 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.4 | 2.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.4 | 0.9 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.4 | 0.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.4 | 5.6 | GO:0015926 | glucosidase activity(GO:0015926) |
0.4 | 1.3 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
0.4 | 2.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
0.4 | 12.7 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.4 | 0.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.4 | 1.7 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.4 | 1.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.4 | 1.3 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.4 | 74.1 | GO:0042393 | histone binding(GO:0042393) |
0.4 | 4.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.4 | 1.2 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
0.4 | 0.8 | GO:0009374 | biotin binding(GO:0009374) |
0.4 | 1.6 | GO:0019826 | oxygen sensor activity(GO:0019826) |
0.4 | 2.0 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.4 | 1.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.4 | 1.6 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.4 | 12.8 | GO:0005123 | death receptor binding(GO:0005123) |
0.4 | 1.6 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.4 | 2.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.4 | 2.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.4 | 3.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.4 | 1.2 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.4 | 0.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.4 | 0.4 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.4 | 3.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.4 | 3.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.4 | 1.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.4 | 2.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.4 | 2.3 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.4 | 2.6 | GO:0050682 | AF-2 domain binding(GO:0050682) |
0.4 | 1.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.4 | 1.5 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.4 | 2.2 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
0.4 | 4.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.4 | 4.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.4 | 0.7 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.4 | 1.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
0.4 | 2.6 | GO:0050733 | RS domain binding(GO:0050733) |
0.4 | 1.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.4 | 2.9 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.4 | 8.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.4 | 1.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.4 | 3.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.4 | 7.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.4 | 1.8 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.4 | 3.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.4 | 2.5 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.3 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.3 | 6.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.3 | 3.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.3 | 1.7 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
0.3 | 2.1 | GO:0047086 | phenanthrene 9,10-monooxygenase activity(GO:0018636) ketosteroid monooxygenase activity(GO:0047086) trans-1,2-dihydrobenzene-1,2-diol dehydrogenase activity(GO:0047115) |
0.3 | 1.7 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.3 | 3.4 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.3 | 1.0 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.3 | 3.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.3 | 6.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.3 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.3 | 4.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.3 | 1.0 | GO:0052830 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.3 | 3.0 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.3 | 2.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 1.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.3 | 0.7 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.3 | 0.3 | GO:0070888 | E-box binding(GO:0070888) |
0.3 | 2.0 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.3 | 7.0 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.3 | 9.0 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.3 | 1.7 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
0.3 | 23.4 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.3 | 2.6 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.3 | 3.2 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.3 | 2.3 | GO:0071253 | connexin binding(GO:0071253) |
0.3 | 1.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.3 | 11.3 | GO:0000049 | tRNA binding(GO:0000049) |
0.3 | 1.6 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.3 | 1.6 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.3 | 4.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.3 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.3 | 1.6 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.3 | 2.8 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.3 | 0.6 | GO:0043566 | structure-specific DNA binding(GO:0043566) |
0.3 | 0.6 | GO:1901618 | organic hydroxy compound transmembrane transporter activity(GO:1901618) |
0.3 | 0.9 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.3 | 0.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.3 | 4.7 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.3 | 0.9 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.3 | 3.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.3 | 3.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.3 | 2.2 | GO:0072349 | modified amino acid transmembrane transporter activity(GO:0072349) |
0.3 | 0.3 | GO:0003909 | DNA ligase activity(GO:0003909) |
0.3 | 4.0 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.3 | 8.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.3 | 2.8 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.3 | 1.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.3 | 2.1 | GO:0015288 | porin activity(GO:0015288) |
0.3 | 0.9 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.3 | 3.6 | GO:0030371 | translation repressor activity(GO:0030371) |
0.3 | 0.9 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.3 | 1.5 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.3 | 6.0 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.3 | 1.5 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.3 | 1.5 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.3 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.3 | 0.9 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.3 | 6.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.3 | 3.9 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
0.3 | 1.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.3 | 1.2 | GO:0031208 | POZ domain binding(GO:0031208) |
0.3 | 1.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.3 | 0.9 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.3 | 1.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 5.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.3 | 2.0 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
0.3 | 4.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.3 | 0.9 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.3 | 0.8 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.3 | 0.8 | GO:0071532 | somatostatin receptor binding(GO:0031877) ankyrin repeat binding(GO:0071532) |
0.3 | 2.0 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.3 | 10.0 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.3 | 0.8 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
0.3 | 0.6 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.3 | 2.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.3 | 0.8 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.3 | 0.8 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.3 | 4.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.3 | 0.8 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.3 | 3.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.3 | 7.8 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
0.3 | 1.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 2.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.3 | 10.9 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.3 | 18.0 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.3 | 1.9 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.3 | 20.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.3 | 6.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.3 | 3.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.3 | 2.4 | GO:0035198 | miRNA binding(GO:0035198) |
0.3 | 0.8 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.3 | 2.9 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.3 | 0.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.3 | 5.0 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.3 | 1.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.3 | 2.8 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.3 | 2.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.3 | 2.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.3 | 5.9 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.3 | 11.3 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.3 | 1.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
0.3 | 0.5 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.3 | 1.0 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.3 | 2.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.3 | 4.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.3 | 12.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.3 | 1.0 | GO:0005499 | vitamin D binding(GO:0005499) |
0.3 | 0.8 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
0.3 | 1.0 | GO:0004335 | galactokinase activity(GO:0004335) |
0.3 | 1.5 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.3 | 2.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.3 | 1.8 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.2 | 2.5 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 2.0 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.2 | 3.5 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.2 | 11.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.2 | 1.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.2 | 2.5 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.2 | 1.0 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 2.9 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.2 | 2.9 | GO:0031996 | thioesterase binding(GO:0031996) |
0.2 | 2.4 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.2 | 1.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 26.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.2 | 1.0 | GO:0050700 | CARD domain binding(GO:0050700) |
0.2 | 5.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.2 | 3.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.2 | 1.0 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 5.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.2 | 5.0 | GO:0031402 | sodium ion binding(GO:0031402) |
0.2 | 0.7 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.2 | 2.6 | GO:0097016 | L27 domain binding(GO:0097016) |
0.2 | 1.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 2.6 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
0.2 | 1.6 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.2 | 1.6 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.2 | 1.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.2 | 5.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.2 | 3.9 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.2 | 1.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.2 | 1.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.2 | 4.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.2 | 1.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 5.0 | GO:0030332 | cyclin binding(GO:0030332) |
0.2 | 0.7 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
0.2 | 0.7 | GO:0051379 | epinephrine binding(GO:0051379) |
0.2 | 1.6 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
0.2 | 0.7 | GO:0017129 | triglyceride binding(GO:0017129) |
0.2 | 1.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.2 | 1.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 1.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.2 | 0.4 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
0.2 | 0.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.2 | 1.1 | GO:0015087 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) ferrous iron transmembrane transporter activity(GO:0015093) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
0.2 | 0.7 | GO:0004951 | cholecystokinin receptor activity(GO:0004951) |
0.2 | 5.3 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.2 | 0.7 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
0.2 | 1.7 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.2 | 6.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.2 | 2.4 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.2 | 0.9 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.2 | 4.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.2 | 5.6 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.2 | 0.6 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
0.2 | 0.9 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.2 | 0.9 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.2 | 2.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.2 | 0.6 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 1.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.2 | 3.2 | GO:0001047 | core promoter binding(GO:0001047) |
0.2 | 0.6 | GO:0034041 | lipid-transporting ATPase activity(GO:0034040) sterol-transporting ATPase activity(GO:0034041) |
0.2 | 0.4 | GO:0015925 | galactosidase activity(GO:0015925) |
0.2 | 1.9 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.2 | 1.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 0.6 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 0.6 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.2 | 0.6 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
0.2 | 2.3 | GO:0016918 | retinal binding(GO:0016918) |
0.2 | 0.4 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
0.2 | 4.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.2 | 1.0 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.2 | 1.0 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 0.8 | GO:0004527 | exonuclease activity(GO:0004527) |
0.2 | 2.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.2 | 0.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 1.2 | GO:0031491 | nucleosome binding(GO:0031491) |
0.2 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
0.2 | 0.2 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.2 | 0.4 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
0.2 | 0.8 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.2 | 0.6 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.2 | 2.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.2 | 0.6 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 23.4 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.2 | 0.4 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.2 | 0.8 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.2 | 1.2 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.2 | 2.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.2 | 0.6 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
0.2 | 6.9 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.2 | 1.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.2 | 6.7 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.2 | 2.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.2 | 3.4 | GO:0032451 | demethylase activity(GO:0032451) |
0.2 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.2 | 4.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.2 | 0.7 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.2 | 1.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.2 | 0.4 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
0.2 | 7.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.2 | 0.9 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 2.0 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.2 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.2 | 1.6 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 0.5 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.2 | 4.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.2 | 9.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.2 | 0.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.2 | 10.6 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
0.2 | 1.2 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
0.2 | 0.5 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.2 | 1.0 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
0.2 | 1.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.2 | 78.5 | GO:0000976 | transcription regulatory region sequence-specific DNA binding(GO:0000976) |
0.2 | 1.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.2 | 2.7 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.2 | 0.7 | GO:0038025 | reelin receptor activity(GO:0038025) |
0.2 | 0.8 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
0.2 | 0.5 | GO:0016215 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
0.2 | 0.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.2 | 2.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 11.0 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.2 | 1.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 1.2 | GO:0015250 | water channel activity(GO:0015250) |
0.2 | 2.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.2 | 2.9 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 3.3 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.2 | 2.6 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.2 | 0.6 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.2 | 1.7 | GO:0016594 | glycine binding(GO:0016594) |
0.2 | 12.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.2 | 0.5 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.2 | 2.6 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.2 | 1.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.2 | 0.2 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.2 | 5.0 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
0.2 | 2.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.2 | 30.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.2 | 3.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 5.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.1 | 1.2 | GO:0019158 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.3 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 2.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.6 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 3.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 4.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 1.7 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 1.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 7.5 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.1 | 1.4 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 4.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.7 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 3.0 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.1 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.4 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 2.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.4 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.1 | 0.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.6 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.5 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
0.1 | 10.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 3.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 3.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 3.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 5.7 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 1.1 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
0.1 | 3.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 65.8 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.1 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 1.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
0.1 | 0.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.1 | 6.9 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 0.5 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.6 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 1.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.4 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 4.7 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.5 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
0.1 | 1.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.6 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 1.3 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 1.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 1.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.9 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.1 | 0.3 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.1 | 0.6 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.8 | GO:1901567 | icosanoid binding(GO:0050542) icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.1 | 2.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 1.6 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.1 | 1.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 1.1 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.1 | 0.7 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.1 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.7 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.5 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.7 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
0.1 | 0.2 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 3.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.4 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
0.1 | 2.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.6 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.1 | 0.5 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 2.6 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.3 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
0.1 | 0.3 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
0.1 | 0.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 1.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.4 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.1 | 0.4 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
0.1 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.1 | 0.7 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 1.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 1.3 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 1.0 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 0.6 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.1 | 2.8 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 60.8 | GO:0003677 | DNA binding(GO:0003677) |
0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.5 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.1 | 0.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
0.1 | 0.6 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.5 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.5 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
0.1 | 0.8 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.2 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.5 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 0.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 1.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.2 | GO:0005231 | excitatory extracellular ligand-gated ion channel activity(GO:0005231) |
0.1 | 0.6 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 1.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.7 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.3 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.1 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 1.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.3 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.1 | 2.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.1 | 1.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.3 | GO:0030614 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
0.1 | 1.0 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.2 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
0.1 | 0.3 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
0.1 | 2.9 | GO:0005267 | potassium channel activity(GO:0005267) |
0.1 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 1.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.4 | GO:0004672 | protein kinase activity(GO:0004672) |
0.1 | 0.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
0.1 | 0.7 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 1.2 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 5.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.1 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.1 | 0.7 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.1 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 1.8 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
0.1 | 0.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.1 | 0.4 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 3.7 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.0 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 1.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 1.0 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.5 | GO:0070700 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.2 | GO:0052795 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 0.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.2 | GO:0016779 | nucleotidyltransferase activity(GO:0016779) |
0.0 | 0.9 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
0.0 | 0.4 | GO:0015370 | solute:sodium symporter activity(GO:0015370) |
0.0 | 0.2 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 2.5 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.4 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.0 | 0.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 10.5 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.8 | GO:0070405 | ammonium ion binding(GO:0070405) |
0.0 | 1.5 | GO:0030295 | protein kinase activator activity(GO:0030295) |
0.0 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.1 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 2.3 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 1.8 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
0.0 | 0.5 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
0.0 | 0.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.5 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.2 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.2 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0005230 | extracellular ligand-gated ion channel activity(GO:0005230) |
0.0 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.1 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
0.0 | 0.1 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.3 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 1.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.1 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.0 | 0.0 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.3 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.0 | 0.0 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.0 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0004518 | nuclease activity(GO:0004518) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 0.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 1.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 1.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 1.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 1.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.6 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.4 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 1.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.8 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 12.2 | GO:1990254 | keratin filament binding(GO:1990254) |
1.5 | 19.2 | GO:0038132 | neuregulin binding(GO:0038132) |
1.3 | 4.0 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
1.2 | 8.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
1.0 | 8.8 | GO:0048495 | Roundabout binding(GO:0048495) |
1.0 | 5.8 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.9 | 7.0 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.9 | 5.2 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
0.8 | 5.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.8 | 3.3 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.8 | 4.0 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.8 | 6.8 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
0.8 | 3.8 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
0.7 | 2.2 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
0.7 | 13.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.7 | 2.7 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
0.6 | 10.7 | GO:0038191 | neuropilin binding(GO:0038191) |
0.5 | 2.5 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.5 | 1.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.5 | 1.8 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.4 | 1.3 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.4 | 2.5 | GO:0008948 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) |
0.3 | 2.1 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.3 | 1.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.3 | 2.5 | GO:0031014 | troponin T binding(GO:0031014) |
0.3 | 5.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.3 | 4.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.3 | 7.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.3 | 0.8 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.3 | 15.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.3 | 1.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.3 | 4.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.3 | 12.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.2 | 0.7 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
0.2 | 5.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.2 | 2.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.2 | 2.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.2 | 2.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 2.9 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.2 | 1.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.2 | 1.3 | GO:0005534 | galactose binding(GO:0005534) |
0.2 | 19.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.2 | 3.8 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.2 | 0.9 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.2 | 0.8 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.2 | 4.3 | GO:0030506 | ankyrin binding(GO:0030506) |
0.2 | 0.3 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
0.1 | 2.3 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.1 | 0.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 2.5 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.6 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.1 | 1.7 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 20.5 | GO:0044325 | ion channel binding(GO:0044325) |
0.1 | 1.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 3.8 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.4 | GO:0070984 | SET domain binding(GO:0070984) |
0.1 | 1.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.6 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.1 | 1.9 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 1.5 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 1.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.5 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 3.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 19.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.1 | 3.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.1 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.6 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.1 | 0.6 | GO:1990380 | Lys63-specific deubiquitinase activity(GO:0061578) Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 1.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.2 | GO:0061714 | folic acid receptor activity(GO:0061714) |
0.0 | 3.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.7 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 8.5 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 4.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.3 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 1.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.9 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 16.2 | GO:0005198 | structural molecule activity(GO:0005198) |
0.0 | 1.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 1.2 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 3.6 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.9 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 1.8 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 1.5 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.8 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 4.9 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.9 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 1.1 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 1.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 2.5 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
7.1 | 21.3 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
1.4 | 11.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
1.3 | 5.2 | GO:0045160 | myosin I complex(GO:0045160) |
1.2 | 5.8 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.8 | 17.0 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
0.7 | 2.7 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.7 | 2.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.7 | 5.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.7 | 2.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.5 | 7.6 | GO:0030478 | actin cap(GO:0030478) |
0.5 | 16.5 | GO:0030057 | desmosome(GO:0030057) |
0.4 | 1.3 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.4 | 1.3 | GO:0072563 | endothelial microparticle(GO:0072563) |
0.4 | 4.5 | GO:0090543 | Flemming body(GO:0090543) |
0.4 | 4.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.4 | 1.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.3 | 1.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.3 | 2.3 | GO:0035976 | AP1 complex(GO:0035976) |
0.3 | 1.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.2 | 4.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 4.9 | GO:0044295 | axonal growth cone(GO:0044295) |
0.2 | 0.8 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.2 | 2.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 20.6 | GO:0005882 | intermediate filament(GO:0005882) |
0.2 | 2.5 | GO:0097227 | sperm annulus(GO:0097227) |
0.2 | 3.3 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.2 | 5.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.2 | 1.5 | GO:1990812 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
0.2 | 1.3 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 0.6 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.1 | 9.3 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 1.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 10.9 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 2.4 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 3.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 1.9 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 2.5 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.8 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 1.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.6 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.1 | 1.7 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.4 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 0.9 | GO:0009986 | cell surface(GO:0009986) |
0.1 | 1.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 1.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 3.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 2.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 1.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 9.3 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
0.0 | 7.4 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 21.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 3.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 3.5 | GO:0035579 | specific granule membrane(GO:0035579) |
0.0 | 0.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.0 | 2.0 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
0.0 | 0.5 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.5 | GO:0044224 | paranode region of axon(GO:0033270) juxtaparanode region of axon(GO:0044224) |
0.0 | 0.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 2.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.7 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.0 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 1.0 | GO:0031430 | M band(GO:0031430) |
0.0 | 2.4 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.0 | 1.2 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 1.7 | GO:0035578 | azurophil granule lumen(GO:0035578) |
0.0 | 1.0 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 2.0 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.8 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 15.6 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 1.1 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 1.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 1.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.8 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
0.2 | 0.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 1.3 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.8 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 1.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.6 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.3 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
0.1 | 0.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.3 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 1.5 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.1 | 0.2 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.8 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 1.1 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.2 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
0.0 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 1.0 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.9 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 1.4 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.2 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
0.0 | 1.1 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.5 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.3 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 3.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 1.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.4 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0000995 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) transcription factor activity, core RNA polymerase III binding(GO:0000995) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.0 | 0.4 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.7 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.3 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.2 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 0.0 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.9 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 1.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.3 | GO:0030506 | ankyrin binding(GO:0030506) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 8.9 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.4 | 11.5 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.4 | 13.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.3 | 2.9 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.2 | 5.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 4.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.2 | 5.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.2 | 1.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 5.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 4.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 2.6 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.1 | 8.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 12.8 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.1 | 0.9 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 7.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 4.5 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 2.9 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 2.1 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 4.5 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 3.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.5 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 3.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.1 | 1.5 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 1.6 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 1.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 1.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 4.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 2.8 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.7 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 2.8 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 1.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 2.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 2.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 1.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 1.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 3.3 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 3.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 0.8 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 3.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 2.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 3.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 1.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 1.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 2.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 1.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 1.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 1.0 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 1.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 1.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.8 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.9 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.4 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.5 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.9 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.4 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0048627 | myoblast development(GO:0048627) |
0.5 | 1.6 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.3 | 0.9 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.3 | 0.9 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.3 | 1.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 1.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.7 | GO:1905064 | epithelial to mesenchymal transition involved in cardiac fibroblast development(GO:0060940) negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
0.2 | 0.5 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
0.2 | 1.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 1.0 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
0.2 | 0.6 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
0.1 | 0.6 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.7 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.4 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.4 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
0.1 | 0.6 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
0.1 | 0.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.5 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.4 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.1 | 0.5 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) cellular response to cobalt ion(GO:0071279) |
0.1 | 0.3 | GO:1990502 | dense core granule maturation(GO:1990502) |
0.1 | 0.2 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 0.3 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.1 | 0.3 | GO:0044828 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.3 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
0.1 | 0.6 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.5 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 0.3 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
0.1 | 0.5 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.2 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
0.1 | 0.5 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
0.1 | 0.4 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
0.1 | 0.7 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 1.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.5 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.3 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
0.1 | 0.8 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.1 | 0.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.1 | 2.8 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.1 | 0.2 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.5 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 1.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.1 | 0.5 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.1 | 0.1 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.1 | 0.2 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.1 | 0.5 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.4 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.9 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.2 | GO:0097368 | histone H4-K20 trimethylation(GO:0034773) establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.8 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.8 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.3 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) gamma-aminobutyric acid catabolic process(GO:0009450) |
0.0 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.2 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.0 | 0.1 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.7 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.3 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.6 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.5 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.4 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 1.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.8 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.9 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.2 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.0 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.0 | 0.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
0.0 | 0.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.2 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.3 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.1 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
0.0 | 0.1 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.3 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.0 | 1.1 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.0 | 0.0 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.2 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 2.1 | GO:0030879 | mammary gland development(GO:0030879) |
0.0 | 0.2 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.0 | 0.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.1 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 1.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.0 | 0.1 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) cellular response to fibroblast growth factor stimulus(GO:0044344) |
0.0 | 0.1 | GO:0006260 | DNA replication(GO:0006260) |
0.0 | 0.1 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |