A549 cells infected with RSV Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZEB1
|
ENSG00000148516.17 | zinc finger E-box binding homeobox 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZEB1 | hg19_v2_chr10_+_31608054_31608156 | -0.73 | 2.7e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr20_-_62199427 | 1.44 |
ENST00000427522.2
|
HELZ2
|
helicase with zinc finger 2, transcriptional coactivator |
| chr12_+_56732658 | 0.98 |
ENST00000228534.4
|
IL23A
|
interleukin 23, alpha subunit p19 |
| chr9_-_131940526 | 0.96 |
ENST00000372491.2
|
IER5L
|
immediate early response 5-like |
| chr3_-_45187843 | 0.84 |
ENST00000296129.1
ENST00000425231.2 |
CDCP1
|
CUB domain containing protein 1 |
| chr17_+_68165657 | 0.76 |
ENST00000243457.3
|
KCNJ2
|
potassium inwardly-rectifying channel, subfamily J, member 2 |
| chr15_+_45722727 | 0.75 |
ENST00000396650.2
ENST00000558435.1 ENST00000344300.3 |
C15orf48
|
chromosome 15 open reading frame 48 |
| chr8_-_145060593 | 0.72 |
ENST00000313059.5
ENST00000524918.1 ENST00000313028.7 ENST00000525773.1 |
PARP10
|
poly (ADP-ribose) polymerase family, member 10 |
| chr15_+_41221536 | 0.71 |
ENST00000249749.5
|
DLL4
|
delta-like 4 (Drosophila) |
| chr19_+_39786962 | 0.69 |
ENST00000333625.2
|
IFNL1
|
interferon, lambda 1 |
| chr3_-_49851313 | 0.64 |
ENST00000333486.3
|
UBA7
|
ubiquitin-like modifier activating enzyme 7 |
| chr15_+_89182156 | 0.62 |
ENST00000379224.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chrX_+_14891598 | 0.61 |
ENST00000497603.2
|
MOSPD2
|
motile sperm domain containing 2 |
| chr11_-_615570 | 0.58 |
ENST00000525445.1
ENST00000348655.6 ENST00000397566.1 |
IRF7
|
interferon regulatory factor 7 |
| chr15_+_89182178 | 0.57 |
ENST00000559876.1
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr1_+_183155373 | 0.57 |
ENST00000493293.1
ENST00000264144.4 |
LAMC2
|
laminin, gamma 2 |
| chr16_-_11350036 | 0.54 |
ENST00000332029.2
|
SOCS1
|
suppressor of cytokine signaling 1 |
| chr19_+_35532612 | 0.54 |
ENST00000600390.1
ENST00000597419.1 |
HPN
|
hepsin |
| chr14_+_101302041 | 0.53 |
ENST00000522618.1
|
MEG3
|
maternally expressed 3 (non-protein coding) |
| chr11_-_627143 | 0.52 |
ENST00000176195.3
|
SCT
|
secretin |
| chr14_-_67859422 | 0.51 |
ENST00000556532.1
|
PLEK2
|
pleckstrin 2 |
| chr19_-_49371711 | 0.50 |
ENST00000355496.5
ENST00000263265.6 |
PLEKHA4
|
pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 4 |
| chr17_+_7482785 | 0.49 |
ENST00000250092.6
ENST00000380498.6 ENST00000584502.1 |
CD68
|
CD68 molecule |
| chr1_-_223537475 | 0.47 |
ENST00000344029.6
ENST00000494793.2 ENST00000366878.4 ENST00000366877.3 |
SUSD4
|
sushi domain containing 4 |
| chr15_-_42186248 | 0.47 |
ENST00000320955.6
|
SPTBN5
|
spectrin, beta, non-erythrocytic 5 |
| chr19_-_40730820 | 0.46 |
ENST00000513948.1
|
CNTD2
|
cyclin N-terminal domain containing 2 |
| chr2_+_220306745 | 0.46 |
ENST00000431523.1
ENST00000396698.1 ENST00000396695.2 |
SPEG
|
SPEG complex locus |
| chr17_+_73717407 | 0.45 |
ENST00000579662.1
|
ITGB4
|
integrin, beta 4 |
| chr22_-_24622080 | 0.44 |
ENST00000425408.1
|
GGT5
|
gamma-glutamyltransferase 5 |
| chr17_+_73717516 | 0.44 |
ENST00000200181.3
ENST00000339591.3 |
ITGB4
|
integrin, beta 4 |
| chr11_-_417308 | 0.44 |
ENST00000397632.3
ENST00000382520.2 |
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chr15_+_89181974 | 0.43 |
ENST00000306072.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr12_-_107168696 | 0.43 |
ENST00000551505.1
|
RP11-144F15.1
|
Uncharacterized protein |
| chr17_+_73717551 | 0.43 |
ENST00000450894.3
|
ITGB4
|
integrin, beta 4 |
| chr22_-_50970506 | 0.42 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr17_+_79989500 | 0.41 |
ENST00000306897.4
|
RAC3
|
ras-related C3 botulinum toxin substrate 3 (rho family, small GTP binding protein Rac3) |
| chr3_-_121740969 | 0.41 |
ENST00000393631.1
ENST00000273691.3 ENST00000344209.5 |
ILDR1
|
immunoglobulin-like domain containing receptor 1 |
| chr2_-_55920952 | 0.41 |
ENST00000447944.2
|
PNPT1
|
polyribonucleotide nucleotidyltransferase 1 |
| chr11_+_57308979 | 0.40 |
ENST00000457912.1
|
SMTNL1
|
smoothelin-like 1 |
| chr8_+_38065104 | 0.40 |
ENST00000521311.1
|
BAG4
|
BCL2-associated athanogene 4 |
| chr1_+_153330322 | 0.40 |
ENST00000368738.3
|
S100A9
|
S100 calcium binding protein A9 |
| chr15_+_80351910 | 0.40 |
ENST00000261749.6
ENST00000561060.1 |
ZFAND6
|
zinc finger, AN1-type domain 6 |
| chr11_-_417388 | 0.39 |
ENST00000332725.3
|
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chr2_-_231084820 | 0.38 |
ENST00000258382.5
ENST00000338556.3 |
SP110
|
SP110 nuclear body protein |
| chr14_-_67878917 | 0.38 |
ENST00000216446.4
|
PLEK2
|
pleckstrin 2 |
| chr2_-_231084659 | 0.37 |
ENST00000258381.6
ENST00000358662.4 ENST00000455674.1 ENST00000392048.3 |
SP110
|
SP110 nuclear body protein |
| chr4_-_78740511 | 0.37 |
ENST00000504123.1
ENST00000264903.4 ENST00000515441.1 |
CNOT6L
|
CCR4-NOT transcription complex, subunit 6-like |
| chr19_+_10197463 | 0.37 |
ENST00000590378.1
ENST00000397881.3 |
C19orf66
|
chromosome 19 open reading frame 66 |
| chr12_+_7072354 | 0.37 |
ENST00000537269.1
|
U47924.27
|
U47924.27 |
| chr11_+_60699222 | 0.37 |
ENST00000536409.1
|
TMEM132A
|
transmembrane protein 132A |
| chr19_-_55895966 | 0.36 |
ENST00000444469.3
|
TMEM238
|
transmembrane protein 238 |
| chr7_+_12726623 | 0.36 |
ENST00000439721.1
|
ARL4A
|
ADP-ribosylation factor-like 4A |
| chr17_-_38657849 | 0.35 |
ENST00000254051.6
|
TNS4
|
tensin 4 |
| chr19_-_12886327 | 0.35 |
ENST00000397668.3
ENST00000587178.1 ENST00000264827.5 |
HOOK2
|
hook microtubule-tethering protein 2 |
| chr2_+_210288760 | 0.35 |
ENST00000199940.6
|
MAP2
|
microtubule-associated protein 2 |
| chr12_-_4488872 | 0.35 |
ENST00000237837.1
|
FGF23
|
fibroblast growth factor 23 |
| chr20_+_34287194 | 0.34 |
ENST00000374078.1
ENST00000374077.3 |
ROMO1
|
reactive oxygen species modulator 1 |
| chr15_+_41245160 | 0.33 |
ENST00000444189.2
ENST00000446533.3 |
CHAC1
|
ChaC, cation transport regulator homolog 1 (E. coli) |
| chr1_-_95285764 | 0.33 |
ENST00000414374.1
ENST00000421997.1 ENST00000418366.2 ENST00000452922.1 |
LINC01057
|
long intergenic non-protein coding RNA 1057 |
| chr19_+_39759154 | 0.33 |
ENST00000331982.5
|
IFNL2
|
interferon, lambda 2 |
| chr17_-_56609302 | 0.33 |
ENST00000581607.1
ENST00000317256.6 ENST00000426861.1 ENST00000580809.1 ENST00000577729.1 ENST00000583291.1 |
SEPT4
|
septin 4 |
| chr20_-_35580240 | 0.33 |
ENST00000262878.4
|
SAMHD1
|
SAM domain and HD domain 1 |
| chr6_+_53794780 | 0.33 |
ENST00000505762.1
ENST00000511369.1 ENST00000431554.2 |
MLIP
RP11-411K7.1
|
muscular LMNA-interacting protein RP11-411K7.1 |
| chr20_+_34287364 | 0.33 |
ENST00000374072.1
ENST00000397416.1 ENST00000336695.4 |
ROMO1
|
reactive oxygen species modulator 1 |
| chr17_-_72968837 | 0.32 |
ENST00000581676.1
|
HID1
|
HID1 domain containing |
| chr16_-_67190152 | 0.32 |
ENST00000486556.1
|
TRADD
|
TNFRSF1A-associated via death domain |
| chr8_-_145086922 | 0.32 |
ENST00000530478.1
|
PARP10
|
poly (ADP-ribose) polymerase family, member 10 |
| chr6_-_36355513 | 0.32 |
ENST00000340181.4
ENST00000373737.4 |
ETV7
|
ets variant 7 |
| chr1_-_41328018 | 0.31 |
ENST00000372638.2
|
CITED4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
| chr4_+_89299885 | 0.31 |
ENST00000380265.5
ENST00000273960.3 |
HERC6
|
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
| chr3_-_48594248 | 0.31 |
ENST00000545984.1
ENST00000232375.3 ENST00000416568.1 ENST00000383734.2 ENST00000541519.1 ENST00000412035.1 |
PFKFB4
|
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 |
| chr4_+_89299994 | 0.31 |
ENST00000264346.7
|
HERC6
|
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
| chr5_-_147211226 | 0.30 |
ENST00000296695.5
|
SPINK1
|
serine peptidase inhibitor, Kazal type 1 |
| chr2_-_163175133 | 0.30 |
ENST00000421365.2
ENST00000263642.2 |
IFIH1
|
interferon induced with helicase C domain 1 |
| chr2_+_121493717 | 0.30 |
ENST00000418323.1
|
GLI2
|
GLI family zinc finger 2 |
| chr8_-_16859690 | 0.30 |
ENST00000180166.5
|
FGF20
|
fibroblast growth factor 20 |
| chr7_+_100770328 | 0.30 |
ENST00000223095.4
ENST00000445463.2 |
SERPINE1
|
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1 |
| chr10_+_99258625 | 0.30 |
ENST00000370664.3
|
UBTD1
|
ubiquitin domain containing 1 |
| chr17_-_54893250 | 0.29 |
ENST00000397862.2
|
C17orf67
|
chromosome 17 open reading frame 67 |
| chr9_+_95820966 | 0.29 |
ENST00000375472.3
ENST00000465709.1 |
SUSD3
|
sushi domain containing 3 |
| chr8_-_110988070 | 0.29 |
ENST00000524391.1
|
KCNV1
|
potassium channel, subfamily V, member 1 |
| chr12_-_48298785 | 0.29 |
ENST00000550325.1
ENST00000546653.1 ENST00000549336.1 ENST00000535672.1 ENST00000229022.3 ENST00000548664.1 |
VDR
|
vitamin D (1,25- dihydroxyvitamin D3) receptor |
| chr8_-_23712312 | 0.29 |
ENST00000290271.2
|
STC1
|
stanniocalcin 1 |
| chr17_+_7758374 | 0.29 |
ENST00000301599.6
ENST00000574668.1 |
TMEM88
|
transmembrane protein 88 |
| chr2_-_216878305 | 0.29 |
ENST00000263268.6
|
MREG
|
melanoregulin |
| chr11_+_118868830 | 0.29 |
ENST00000334418.1
|
CCDC84
|
coiled-coil domain containing 84 |
| chr17_+_2264983 | 0.29 |
ENST00000574650.1
|
SGSM2
|
small G protein signaling modulator 2 |
| chr8_+_145321517 | 0.29 |
ENST00000340210.1
|
SCXB
|
scleraxis homolog B (mouse) |
| chr14_-_37051798 | 0.28 |
ENST00000258829.5
|
NKX2-8
|
NK2 homeobox 8 |
| chr20_+_49348081 | 0.28 |
ENST00000371610.2
|
PARD6B
|
par-6 family cell polarity regulator beta |
| chr14_+_101297740 | 0.28 |
ENST00000555928.1
|
MEG3
|
maternally expressed 3 (non-protein coding) |
| chr13_+_114462193 | 0.27 |
ENST00000375353.3
|
TMEM255B
|
transmembrane protein 255B |
| chr19_+_16254488 | 0.27 |
ENST00000588246.1
ENST00000593031.1 |
HSH2D
|
hematopoietic SH2 domain containing |
| chr11_+_18287801 | 0.27 |
ENST00000532858.1
ENST00000405158.2 |
SAA1
|
serum amyloid A1 |
| chr2_-_231084617 | 0.27 |
ENST00000409815.2
|
SP110
|
SP110 nuclear body protein |
| chr5_-_136834242 | 0.27 |
ENST00000282223.7
|
SPOCK1
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 1 |
| chr14_-_76127519 | 0.27 |
ENST00000256319.6
|
C14orf1
|
chromosome 14 open reading frame 1 |
| chr16_-_88752889 | 0.27 |
ENST00000332281.5
|
SNAI3
|
snail family zinc finger 3 |
| chr2_+_233527443 | 0.27 |
ENST00000410095.1
|
EFHD1
|
EF-hand domain family, member D1 |
| chr5_+_72416387 | 0.27 |
ENST00000287773.5
|
TMEM171
|
transmembrane protein 171 |
| chr19_+_18723660 | 0.27 |
ENST00000262817.3
|
TMEM59L
|
transmembrane protein 59-like |
| chr8_-_139926236 | 0.26 |
ENST00000303045.6
ENST00000435777.1 |
COL22A1
|
collagen, type XXII, alpha 1 |
| chr9_-_100881466 | 0.26 |
ENST00000341469.2
ENST00000342043.3 ENST00000375098.3 |
TRIM14
|
tripartite motif containing 14 |
| chr5_-_139726181 | 0.26 |
ENST00000507104.1
ENST00000230990.6 |
HBEGF
|
heparin-binding EGF-like growth factor |
| chr19_+_55587266 | 0.26 |
ENST00000201647.6
ENST00000540810.1 |
EPS8L1
|
EPS8-like 1 |
| chr22_+_19744226 | 0.26 |
ENST00000332710.4
ENST00000329705.7 ENST00000359500.3 |
TBX1
|
T-box 1 |
| chr17_+_74372662 | 0.26 |
ENST00000591651.1
ENST00000545180.1 |
SPHK1
|
sphingosine kinase 1 |
| chr17_-_78450398 | 0.26 |
ENST00000306773.4
|
NPTX1
|
neuronal pentraxin I |
| chr12_+_57984965 | 0.25 |
ENST00000540759.2
ENST00000551772.1 ENST00000550465.1 ENST00000354947.5 |
PIP4K2C
|
phosphatidylinositol-5-phosphate 4-kinase, type II, gamma |
| chr1_+_8378140 | 0.25 |
ENST00000377479.2
|
SLC45A1
|
solute carrier family 45, member 1 |
| chr19_-_39735646 | 0.25 |
ENST00000413851.2
|
IFNL3
|
interferon, lambda 3 |
| chr11_+_18287721 | 0.24 |
ENST00000356524.4
|
SAA1
|
serum amyloid A1 |
| chr17_-_56605341 | 0.24 |
ENST00000583114.1
|
SEPT4
|
septin 4 |
| chr17_+_48046671 | 0.24 |
ENST00000505318.2
|
DLX4
|
distal-less homeobox 4 |
| chr9_+_137533615 | 0.24 |
ENST00000371817.3
|
COL5A1
|
collagen, type V, alpha 1 |
| chr5_-_131826457 | 0.24 |
ENST00000437654.1
ENST00000245414.4 |
IRF1
|
interferon regulatory factor 1 |
| chr22_-_50970566 | 0.24 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr1_+_44401479 | 0.24 |
ENST00000438616.3
|
ARTN
|
artemin |
| chr19_+_55897699 | 0.24 |
ENST00000558131.1
ENST00000558752.1 ENST00000458349.2 |
RPL28
|
ribosomal protein L28 |
| chr2_+_10560147 | 0.24 |
ENST00000422133.1
|
HPCAL1
|
hippocalcin-like 1 |
| chr12_+_130822606 | 0.24 |
ENST00000546060.1
ENST00000539400.1 |
PIWIL1
|
piwi-like RNA-mediated gene silencing 1 |
| chr16_+_88704978 | 0.23 |
ENST00000244241.4
|
IL17C
|
interleukin 17C |
| chr17_-_42452063 | 0.23 |
ENST00000588098.1
|
ITGA2B
|
integrin, alpha 2b (platelet glycoprotein IIb of IIb/IIIa complex, antigen CD41) |
| chr19_-_3547305 | 0.23 |
ENST00000589063.1
|
MFSD12
|
major facilitator superfamily domain containing 12 |
| chr19_-_40732594 | 0.23 |
ENST00000430325.2
ENST00000433940.1 |
CNTD2
|
cyclin N-terminal domain containing 2 |
| chr2_+_8822113 | 0.23 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr19_-_44174330 | 0.23 |
ENST00000340093.3
|
PLAUR
|
plasminogen activator, urokinase receptor |
| chr19_+_51153045 | 0.23 |
ENST00000458538.1
|
C19orf81
|
chromosome 19 open reading frame 81 |
| chr19_+_35739597 | 0.23 |
ENST00000361790.3
|
LSR
|
lipolysis stimulated lipoprotein receptor |
| chr6_-_36355486 | 0.23 |
ENST00000538992.1
|
ETV7
|
ets variant 7 |
| chr1_-_3447967 | 0.23 |
ENST00000294599.4
|
MEGF6
|
multiple EGF-like-domains 6 |
| chr16_+_771663 | 0.22 |
ENST00000568916.1
|
FAM173A
|
family with sequence similarity 173, member A |
| chr1_+_201159914 | 0.22 |
ENST00000335211.4
ENST00000451870.2 ENST00000295591.8 |
IGFN1
|
immunoglobulin-like and fibronectin type III domain containing 1 |
| chr6_-_170599561 | 0.22 |
ENST00000366756.3
|
DLL1
|
delta-like 1 (Drosophila) |
| chr4_+_166794862 | 0.22 |
ENST00000513213.1
|
TLL1
|
tolloid-like 1 |
| chr16_+_2286726 | 0.22 |
ENST00000382437.4
ENST00000569184.1 |
DNASE1L2
|
deoxyribonuclease I-like 2 |
| chr16_+_3070313 | 0.22 |
ENST00000326577.4
|
TNFRSF12A
|
tumor necrosis factor receptor superfamily, member 12A |
| chr16_+_57023406 | 0.22 |
ENST00000262510.6
ENST00000308149.7 ENST00000436936.1 |
NLRC5
|
NLR family, CARD domain containing 5 |
| chr6_+_53659877 | 0.22 |
ENST00000370882.1
|
LRRC1
|
leucine rich repeat containing 1 |
| chr17_+_43299241 | 0.22 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
| chr6_+_31895480 | 0.22 |
ENST00000418949.2
ENST00000383177.3 ENST00000477310.1 |
C2
CFB
|
complement component 2 Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr11_-_18270182 | 0.22 |
ENST00000528349.1
ENST00000526900.1 ENST00000529528.1 ENST00000414546.2 ENST00000256733.4 |
SAA2
|
serum amyloid A2 |
| chr1_-_153585539 | 0.22 |
ENST00000368706.4
|
S100A16
|
S100 calcium binding protein A16 |
| chr6_+_117198400 | 0.22 |
ENST00000332958.2
|
RFX6
|
regulatory factor X, 6 |
| chr4_+_155665123 | 0.22 |
ENST00000336356.3
|
LRAT
|
lecithin retinol acyltransferase (phosphatidylcholine--retinol O-acyltransferase) |
| chr6_+_31895467 | 0.22 |
ENST00000556679.1
ENST00000456570.1 |
CFB
CFB
|
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr16_+_71660079 | 0.21 |
ENST00000565261.1
ENST00000268485.3 ENST00000299952.4 |
MARVELD3
|
MARVEL domain containing 3 |
| chr15_+_40544749 | 0.21 |
ENST00000559617.1
ENST00000560684.1 |
PAK6
|
p21 protein (Cdc42/Rac)-activated kinase 6 |
| chr15_-_60695071 | 0.21 |
ENST00000557904.1
|
ANXA2
|
annexin A2 |
| chr21_-_45196326 | 0.21 |
ENST00000291568.5
|
CSTB
|
cystatin B (stefin B) |
| chr18_+_21594384 | 0.21 |
ENST00000584250.1
|
TTC39C
|
tetratricopeptide repeat domain 39C |
| chr16_+_3068393 | 0.21 |
ENST00000573001.1
|
TNFRSF12A
|
tumor necrosis factor receptor superfamily, member 12A |
| chr19_-_36342739 | 0.21 |
ENST00000378910.5
ENST00000353632.6 |
NPHS1
|
nephrosis 1, congenital, Finnish type (nephrin) |
| chr1_+_113217309 | 0.21 |
ENST00000544796.1
ENST00000369644.1 |
MOV10
|
Mov10, Moloney leukemia virus 10, homolog (mouse) |
| chr12_+_52626898 | 0.21 |
ENST00000331817.5
|
KRT7
|
keratin 7 |
| chr9_+_100174344 | 0.21 |
ENST00000422139.2
|
TDRD7
|
tudor domain containing 7 |
| chr17_+_72428218 | 0.21 |
ENST00000392628.2
|
GPRC5C
|
G protein-coupled receptor, family C, group 5, member C |
| chr7_+_142498725 | 0.21 |
ENST00000466254.1
|
TRBC2
|
T cell receptor beta constant 2 |
| chr17_+_48133459 | 0.21 |
ENST00000320031.8
|
ITGA3
|
integrin, alpha 3 (antigen CD49C, alpha 3 subunit of VLA-3 receptor) |
| chr11_-_18258342 | 0.21 |
ENST00000278222.4
|
SAA4
|
serum amyloid A4, constitutive |
| chr3_-_122283100 | 0.21 |
ENST00000492382.1
ENST00000462315.1 |
PARP9
|
poly (ADP-ribose) polymerase family, member 9 |
| chr5_+_49962772 | 0.21 |
ENST00000281631.5
ENST00000513738.1 ENST00000503665.1 ENST00000514067.2 ENST00000503046.1 |
PARP8
|
poly (ADP-ribose) polymerase family, member 8 |
| chr15_+_63340858 | 0.21 |
ENST00000560615.1
|
TPM1
|
tropomyosin 1 (alpha) |
| chr14_+_103592636 | 0.21 |
ENST00000333007.1
|
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr6_-_32784687 | 0.21 |
ENST00000447394.1
ENST00000438763.2 |
HLA-DOB
|
major histocompatibility complex, class II, DO beta |
| chr17_+_72428266 | 0.21 |
ENST00000582473.1
|
GPRC5C
|
G protein-coupled receptor, family C, group 5, member C |
| chr14_+_78227105 | 0.21 |
ENST00000439131.2
ENST00000355883.3 ENST00000557011.1 ENST00000556047.1 |
C14orf178
|
chromosome 14 open reading frame 178 |
| chr11_-_124806297 | 0.21 |
ENST00000298251.4
|
HEPACAM
|
hepatic and glial cell adhesion molecule |
| chr16_+_2564254 | 0.21 |
ENST00000565223.1
|
ATP6V0C
|
ATPase, H+ transporting, lysosomal 16kDa, V0 subunit c |
| chr1_-_229569834 | 0.21 |
ENST00000366684.3
ENST00000366683.2 |
ACTA1
|
actin, alpha 1, skeletal muscle |
| chr7_-_8301768 | 0.21 |
ENST00000265577.7
|
ICA1
|
islet cell autoantigen 1, 69kDa |
| chr12_-_58220078 | 0.21 |
ENST00000549039.1
|
CTDSP2
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 2 |
| chr2_+_30670127 | 0.20 |
ENST00000540623.1
ENST00000476038.1 |
LCLAT1
|
lysocardiolipin acyltransferase 1 |
| chr19_+_35739631 | 0.20 |
ENST00000602003.1
ENST00000360798.3 ENST00000354900.3 |
LSR
|
lipolysis stimulated lipoprotein receptor |
| chr22_+_18121562 | 0.20 |
ENST00000355028.3
|
BCL2L13
|
BCL2-like 13 (apoptosis facilitator) |
| chr17_-_39684550 | 0.20 |
ENST00000455635.1
ENST00000361566.3 |
KRT19
|
keratin 19 |
| chr17_-_76124812 | 0.20 |
ENST00000592063.1
ENST00000589271.1 ENST00000322933.4 ENST00000589553.1 |
TMC6
|
transmembrane channel-like 6 |
| chr8_+_145490549 | 0.20 |
ENST00000340695.2
|
SCXA
|
scleraxis homolog A (mouse) |
| chr19_-_44174305 | 0.20 |
ENST00000601723.1
ENST00000339082.3 |
PLAUR
|
plasminogen activator, urokinase receptor |
| chr5_-_172756506 | 0.20 |
ENST00000265087.4
|
STC2
|
stanniocalcin 2 |
| chr11_-_31839488 | 0.20 |
ENST00000419022.1
ENST00000379132.3 ENST00000379129.2 |
PAX6
|
paired box 6 |
| chr14_-_69350920 | 0.20 |
ENST00000553290.1
|
ACTN1
|
actinin, alpha 1 |
| chr5_+_148521046 | 0.20 |
ENST00000326685.7
ENST00000356541.3 ENST00000309868.7 |
ABLIM3
|
actin binding LIM protein family, member 3 |
| chr19_+_46732988 | 0.20 |
ENST00000437936.1
|
IGFL1
|
IGF-like family member 1 |
| chr17_+_29815113 | 0.20 |
ENST00000583755.1
|
RAB11FIP4
|
RAB11 family interacting protein 4 (class II) |
| chr2_-_113999260 | 0.20 |
ENST00000468980.2
|
PAX8
|
paired box 8 |
| chr19_+_8429031 | 0.20 |
ENST00000301455.2
ENST00000541807.1 ENST00000393962.2 |
ANGPTL4
|
angiopoietin-like 4 |
| chr12_-_120805872 | 0.20 |
ENST00000546985.1
|
MSI1
|
musashi RNA-binding protein 1 |
| chr8_+_32406179 | 0.20 |
ENST00000405005.3
|
NRG1
|
neuregulin 1 |
| chr17_+_79990058 | 0.19 |
ENST00000584341.1
|
RAC3
|
ras-related C3 botulinum toxin substrate 3 (rho family, small GTP binding protein Rac3) |
| chr8_+_21777243 | 0.19 |
ENST00000521303.1
|
XPO7
|
exportin 7 |
| chr11_-_615942 | 0.19 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr19_+_10400615 | 0.19 |
ENST00000221980.4
|
ICAM5
|
intercellular adhesion molecule 5, telencephalin |
| chr19_+_13906250 | 0.19 |
ENST00000254323.2
|
ZSWIM4
|
zinc finger, SWIM-type containing 4 |
| chr11_+_71710973 | 0.19 |
ENST00000393707.4
|
IL18BP
|
interleukin 18 binding protein |
| chr20_-_35580104 | 0.19 |
ENST00000373694.5
|
SAMHD1
|
SAM domain and HD domain 1 |
| chr16_+_67280799 | 0.19 |
ENST00000566345.2
|
SLC9A5
|
solute carrier family 9, subfamily A (NHE5, cation proton antiporter 5), member 5 |
| chr17_-_48277552 | 0.19 |
ENST00000507689.1
|
COL1A1
|
collagen, type I, alpha 1 |
| chrX_-_108976449 | 0.19 |
ENST00000469857.1
|
ACSL4
|
acyl-CoA synthetase long-chain family member 4 |
| chr7_-_132261253 | 0.19 |
ENST00000321063.4
|
PLXNA4
|
plexin A4 |
| chr6_+_30614886 | 0.19 |
ENST00000376471.4
|
C6orf136
|
chromosome 6 open reading frame 136 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.6 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.2 | 1.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.2 | 1.1 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.2 | 0.8 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.2 | 1.4 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.2 | 0.8 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.2 | 0.7 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.2 | 0.5 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.2 | 0.5 | GO:2000627 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.2 | 0.8 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.2 | 0.5 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
| 0.1 | 0.4 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 0.9 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.7 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.1 | 0.6 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.6 | GO:0006696 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.1 | 0.3 | GO:1902568 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
| 0.1 | 0.1 | GO:0051155 | positive regulation of striated muscle cell differentiation(GO:0051155) |
| 0.1 | 0.6 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.1 | 0.5 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.3 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.1 | 0.8 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 0.3 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.1 | 0.2 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.1 | 0.2 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.1 | 0.3 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 0.3 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 | 0.7 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.1 | 0.3 | GO:0052363 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.1 | 0.4 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.2 | GO:0032773 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.1 | 0.2 | GO:1904204 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.1 | 0.3 | GO:0034343 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.1 | 0.2 | GO:2000657 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.1 | 0.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.4 | GO:0003068 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.1 | 0.4 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.1 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 | 0.2 | GO:1904351 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.1 | 0.2 | GO:0002586 | regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.2 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.3 | GO:0033383 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) farnesyl diphosphate metabolic process(GO:0045338) |
| 0.1 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.1 | 0.5 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 | 1.1 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.7 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.2 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.2 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 | 0.3 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.1 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 0.1 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 0.9 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 | 0.4 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.2 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.6 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.2 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.1 | 0.2 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.1 | 0.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 | 0.2 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.1 | 0.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) copper ion homeostasis(GO:0055070) |
| 0.1 | 0.2 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.2 | GO:0018282 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.1 | 0.3 | GO:0009609 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.0 | 0.1 | GO:0021502 | neural fold elevation formation(GO:0021502) allantois development(GO:1905069) |
| 0.0 | 0.0 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.0 | 0.3 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.1 | GO:2000502 | negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 0.0 | 0.3 | GO:1902572 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.0 | 0.1 | GO:1903797 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.0 | 0.3 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.0 | 0.2 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.9 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.0 | 0.0 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.0 | 0.1 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.1 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.0 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.1 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.2 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.0 | 0.1 | GO:0002818 | intracellular defense response(GO:0002818) |
| 0.0 | 0.2 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.0 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) negative regulation of hydrogen peroxide catabolic process(GO:2000296) regulation of oxygen metabolic process(GO:2000374) |
| 0.0 | 0.1 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.0 | 0.3 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
| 0.0 | 0.1 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.0 | 0.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0060474 | positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.0 | 0.1 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.3 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 0.6 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.0 | 0.5 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.0 | 0.2 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.2 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.3 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.0 | 0.0 | GO:0009217 | purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.0 | 0.1 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.0 | GO:1902822 | regulation of late endosome to lysosome transport(GO:1902822) positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.0 | GO:0032460 | regulation of protein oligomerization(GO:0032459) negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.3 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.5 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.2 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.0 | 0.3 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:2000364 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.1 | GO:0002775 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.5 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.2 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.3 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.0 | 0.1 | GO:0002522 | leukocyte migration involved in immune response(GO:0002522) |
| 0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.0 | GO:0090342 | regulation of cell aging(GO:0090342) |
| 0.0 | 0.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.2 | GO:0039526 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host apoptotic process(GO:0039526) |
| 0.0 | 0.2 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.2 | GO:1904209 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 0.0 | GO:0060428 | lung epithelium development(GO:0060428) |
| 0.0 | 0.0 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.3 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 0.3 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.1 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.1 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.0 | 0.3 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:1902811 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.0 | 0.3 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.0 | 0.1 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.3 | GO:0051271 | negative regulation of cellular component movement(GO:0051271) |
| 0.0 | 0.2 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.2 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) |
| 0.0 | 0.1 | GO:0032208 | regulation of telomere maintenance via recombination(GO:0032207) negative regulation of telomere maintenance via recombination(GO:0032208) negative regulation of single strand break repair(GO:1903517) negative regulation of beta-galactosidase activity(GO:1903770) telomere single strand break repair(GO:1903823) negative regulation of telomere single strand break repair(GO:1903824) |
| 0.0 | 0.1 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.1 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 | 0.2 | GO:0035306 | positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.0 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.2 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.0 | 0.0 | GO:0072209 | metanephric mesangial cell differentiation(GO:0072209) metanephric glomerular mesangial cell differentiation(GO:0072254) |
| 0.0 | 0.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.1 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.2 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.0 | 0.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.0 | 0.1 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.2 | GO:1902460 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.1 | GO:0006006 | glucose metabolic process(GO:0006006) |
| 0.0 | 0.1 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.0 | 0.1 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 | 0.4 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.0 | 0.1 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
| 0.0 | 0.3 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.3 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.5 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.1 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.0 | 0.7 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.0 | 0.0 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.1 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.0 | 0.1 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.0 | 0.3 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
| 0.0 | 0.1 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.0 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.0 | 0.2 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.6 | GO:0006625 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.1 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 0.1 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 0.0 | 0.6 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.3 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.2 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
| 0.0 | 0.1 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.0 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.0 | 0.1 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:2000683 | mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) regulation of cellular response to X-ray(GO:2000683) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:0070374 | positive regulation of ERK1 and ERK2 cascade(GO:0070374) |
| 0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.1 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.1 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.0 | 0.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.0 | 0.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.4 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.2 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.0 | GO:0052047 | interaction with other organism via secreted substance involved in symbiotic interaction(GO:0052047) |
| 0.0 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.0 | 0.0 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.1 | GO:1903597 | negative regulation of gap junction assembly(GO:1903597) |
| 0.0 | 0.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.6 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| 0.0 | 0.1 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
| 0.0 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.1 | GO:0042704 | detection of oxygen(GO:0003032) uterine wall breakdown(GO:0042704) frontal suture morphogenesis(GO:0060364) |
| 0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.1 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.0 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
| 0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.1 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.1 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.0 | GO:0003292 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.1 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
| 0.0 | 0.0 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0021767 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) melanocyte migration(GO:0097324) positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.0 | 0.0 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.0 | GO:0060032 | notochord regression(GO:0060032) |
| 0.0 | 0.1 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
| 0.0 | 0.1 | GO:0072299 | visceral serous pericardium development(GO:0061032) negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.0 | 1.0 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.1 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.1 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.0 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.0 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.0 | 0.0 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.0 | 0.0 | GO:0021834 | chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.0 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 0.1 | GO:2001303 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.0 | 0.4 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.0 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.7 | GO:0010863 | positive regulation of phospholipase C activity(GO:0010863) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.0 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 | 0.2 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) |
| 0.0 | 0.2 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.0 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.0 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.3 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.0 | 0.1 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0035766 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 0.0 | GO:0035854 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.1 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.1 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 0.0 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.0 | 0.0 | GO:1903980 | negative regulation of macrophage chemotaxis(GO:0010760) negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) positive regulation of microglial cell activation(GO:1903980) |
| 0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.0 | 0.0 | GO:0002892 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.0 | 0.1 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0006939 | smooth muscle contraction(GO:0006939) |
| 0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.0 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.0 | 0.1 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.1 | GO:0055001 | muscle cell development(GO:0055001) |
| 0.0 | 0.1 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.0 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.1 | GO:0015820 | leucine transport(GO:0015820) |
| 0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.0 | 0.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.0 | GO:0090100 | positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.1 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.1 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 | 0.0 | GO:0046056 | dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) dADP metabolic process(GO:0046056) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.0 | GO:0048041 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
| 0.0 | 0.1 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.0 | 0.0 | GO:2000570 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.1 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.0 | 0.1 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.0 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.2 | GO:1903831 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.0 | 0.2 | GO:0051957 | positive regulation of amino acid transport(GO:0051957) |
| 0.0 | 0.2 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.0 | GO:0070105 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.0 | 0.1 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.0 | 0.0 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.0 | 0.3 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.0 | GO:0016072 | rRNA metabolic process(GO:0016072) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.1 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.1 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.1 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.0 | 0.1 | GO:0015866 | ADP transport(GO:0015866) ATP transport(GO:0015867) |
| 0.0 | 0.1 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.0 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.2 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 0.6 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.1 | 0.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.4 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.1 | 0.4 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.8 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.3 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.1 | 1.2 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.2 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.1 | 0.3 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.3 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 1.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.4 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.4 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.6 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.2 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.1 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.0 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.6 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 1.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.1 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.0 | 0.0 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 1.6 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.2 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.3 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 1.0 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.0 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.0 | 0.0 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.0 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.5 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.1 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.3 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.0 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 0.0 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.0 | 0.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.3 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.0 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.2 | 0.5 | GO:0047676 | arachidonate-CoA ligase activity(GO:0047676) |
| 0.1 | 0.4 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 0.4 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 0.1 | 0.4 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.1 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.3 | GO:0004310 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.1 | 0.3 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.2 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.1 | 0.5 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.3 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.4 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.1 | 0.4 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.2 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 0.2 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 0.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.2 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.6 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.1 | 0.2 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.1 | 0.2 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.1 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.0 | 0.4 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 1.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.1 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.0 | 0.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.2 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.2 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.3 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.3 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.0 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.2 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.1 | GO:0090556 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.0 | 0.1 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.0 | 0.0 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.0 | 0.0 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 1.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.0 | 0.5 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.8 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 0.0 | 0.2 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.0 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0015254 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) glycerol channel activity(GO:0015254) urea channel activity(GO:0015265) |
| 0.0 | 0.1 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 1.0 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.0 | 0.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.2 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 0.1 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.0 | 0.1 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 0.1 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 1.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.0 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.1 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.1 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.0 | 0.4 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.0 | 0.1 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.0 | 0.1 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.0 | 0.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.2 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.0 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.0 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.4 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.0 | GO:0042562 | hormone binding(GO:0042562) |
| 0.0 | 0.3 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 0.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.0 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.0 | 0.1 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.0 | 0.0 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.0 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.0 | GO:0031768 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
| 0.0 | 0.1 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.1 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.4 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.0 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.0 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
| 0.0 | 0.0 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.0 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.0 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.0 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.0 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.8 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.0 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 1.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 1.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 1.0 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 1.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.6 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.7 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.2 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.1 | 1.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.1 | 0.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 1.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.7 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.4 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 2.4 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.7 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.2 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.2 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.8 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.7 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.4 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.8 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.6 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.6 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.4 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 1.5 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.3 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.4 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.4 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |