Motif ID: Gli2
Z-value: 0.795
Transcription factors associated with Gli2:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Gli2 | ENSMUSG00000048402.8 | Gli2 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Gli2 | mm10_v2_chr1_-_118982551_118982606 | 0.29 | 7.3e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 6.3 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 1.5 | 9.0 | GO:0003383 | apical constriction(GO:0003383) |
| 1.1 | 6.5 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.9 | 4.4 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.5 | 2.0 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.5 | 1.5 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.4 | 2.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.4 | 1.2 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.3 | 1.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.3 | 2.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 | 3.1 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.3 | 2.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.3 | 1.0 | GO:0019230 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
| 0.3 | 2.6 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 0.8 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 | 1.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.2 | 0.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 0.7 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.2 | 0.5 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.2 | 1.9 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.2 | 0.5 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.2 | 1.0 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.4 | GO:0042713 | sperm ejaculation(GO:0042713) negative regulation of gastric acid secretion(GO:0060455) |
| 0.1 | 3.2 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.1 | 1.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 1.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 1.0 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.1 | 0.5 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.6 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.6 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.5 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.7 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.1 | 0.9 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.3 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.4 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 1.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 1.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.8 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.5 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 1.0 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 3.3 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 3.8 | GO:0008286 | insulin receptor signaling pathway(GO:0008286) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.4 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 1.4 | GO:0030148 | sphingolipid biosynthetic process(GO:0030148) |
| 0.0 | 0.4 | GO:0010212 | response to ionizing radiation(GO:0010212) |
| 0.0 | 0.8 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.3 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.5 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 9.0 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.6 | 2.5 | GO:0090537 | CERF complex(GO:0090537) |
| 0.3 | 1.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 1.1 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.2 | 3.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 1.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 2.6 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 2.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 3.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 3.6 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.5 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.9 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.1 | 1.5 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.8 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.6 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.8 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 2.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.5 | GO:0098839 | postsynaptic density membrane(GO:0098839) postsynaptic specialization membrane(GO:0099634) |
| 0.0 | 0.4 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 2.4 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 5.6 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 1.0 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.9 | 2.6 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.6 | 2.3 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.5 | 1.4 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.4 | 1.5 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
| 0.3 | 2.6 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.3 | 3.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.2 | 12.3 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.2 | 0.7 | GO:0005119 | smoothened binding(GO:0005119) hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.4 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.1 | 2.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 1.6 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 1.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.4 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 1.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 4.1 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.8 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 1.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 6.3 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 1.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.7 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 1.3 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 0.4 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 1.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 6.8 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 1.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 1.2 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 1.3 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.6 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.0 | 5.6 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 1.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.5 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 1.3 | GO:0003774 | motor activity(GO:0003774) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 8.9 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.2 | 13.4 | SIG_INSULIN_RECEPTOR_PATHWAY_IN_CARDIAC_MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 2.2 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.3 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 1.5 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.0 | 1.9 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.7 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.0 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.7 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.5 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.9 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 9.0 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.3 | 2.3 | REACTOME_APOBEC3G_MEDIATED_RESISTANCE_TO_HIV1_INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 2.6 | REACTOME_HYALURONAN_METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 2.3 | REACTOME_RNA_POL_III_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 3.0 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.7 | REACTOME_FGFR2C_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.9 | REACTOME_GABA_A_RECEPTOR_ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 0.5 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 1.2 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 1.0 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 1.4 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 2.6 | REACTOME_PEPTIDE_LIGAND_BINDING_RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.5 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.9 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 2.2 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.6 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.1 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.4 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.5 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.9 | REACTOME_LOSS_OF_NLP_FROM_MITOTIC_CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.4 | REACTOME_REGULATION_OF_MRNA_STABILITY_BY_PROTEINS_THAT_BIND_AU_RICH_ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |


