Motif ID: Glis3
Z-value: 0.745
Transcription factors associated with Glis3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Glis3 | ENSMUSG00000052942.7 | Glis3 |
| Glis3 | ENSMUSG00000091294.1 | Glis3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Glis3 | mm10_v2_chr19_-_28680077_28680122 | 0.27 | 9.1e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 14.5 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 1.2 | 8.2 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.8 | 4.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.7 | 2.0 | GO:1905072 | detection of oxygen(GO:0003032) cardiac jelly development(GO:1905072) |
| 0.3 | 0.8 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.3 | 2.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.3 | 7.9 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.2 | 0.7 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.2 | 0.7 | GO:0071336 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.2 | 0.8 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.2 | 0.4 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.2 | 0.9 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.2 | 1.5 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 1.0 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.2 | 0.5 | GO:0003100 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) regulation of systemic arterial blood pressure by endothelin(GO:0003100) beta selection(GO:0043366) response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
| 0.1 | 0.9 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.1 | 0.4 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.1 | 1.0 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.6 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.4 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.1 | 0.5 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.7 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 0.4 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.7 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.2 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
| 0.1 | 0.6 | GO:0071455 | response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.8 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.1 | 1.0 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.5 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.1 | GO:0070172 | oculomotor nerve development(GO:0021557) positive regulation of tooth mineralization(GO:0070172) |
| 0.0 | 0.4 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.9 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.2 | GO:0032811 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) negative regulation of epinephrine secretion(GO:0032811) |
| 0.0 | 1.1 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.0 | 0.3 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.4 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.8 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 1.3 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.6 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.7 | GO:0071385 | cellular response to glucocorticoid stimulus(GO:0071385) |
| 0.0 | 0.3 | GO:0099628 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
| 0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) regulation of wound healing, spreading of epidermal cells(GO:1903689) positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.3 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 | 0.4 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 1.1 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.3 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.0 | 0.3 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.1 | GO:0046985 | histone H3-K4 acetylation(GO:0043973) positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.8 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.0 | 0.5 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.6 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 2.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 8.0 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.5 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.9 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.7 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.2 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.0 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 2.5 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.5 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.7 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 1.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.7 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 14.5 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 2.1 | 8.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 1.3 | 7.9 | GO:0043426 | MRF binding(GO:0043426) |
| 0.7 | 4.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.4 | 2.0 | GO:0005534 | galactose binding(GO:0005534) |
| 0.3 | 0.8 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.2 | 1.0 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.2 | 0.7 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.2 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.2 | 0.7 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.1 | 0.7 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.7 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.1 | 1.0 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.9 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 2.1 | GO:0043539 | insulin-like growth factor receptor binding(GO:0005159) protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.8 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.7 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.8 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.3 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.0 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.6 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.3 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.3 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 1.6 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 8.1 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.2 | 13.7 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.2 | 8.7 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.1 | 0.8 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 2.0 | PID_ALK1_PATHWAY | ALK1 signaling events |
| 0.1 | 0.7 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 0.0 | 2.1 | PID_AJDISS_2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 1.5 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 1.3 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.4 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.5 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 1.4 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 2.7 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.7 | ST_GA13_PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.9 | PID_HDAC_CLASSI_PATHWAY | Signaling events mediated by HDAC Class I |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 10.0 | REACTOME_SEMA4D_IN_SEMAPHORIN_SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.2 | 7.9 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 2.1 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.8 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 0.7 | REACTOME_FGFR1_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.1 | 1.0 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.7 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.4 | REACTOME_INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.6 | REACTOME_REGULATION_OF_GENE_EXPRESSION_IN_BETA_CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.4 | REACTOME_RIP_MEDIATED_NFKB_ACTIVATION_VIA_DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.3 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.2 | REACTOME_CLASS_C_3_METABOTROPIC_GLUTAMATE_PHEROMONE_RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.4 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.4 | REACTOME_RNA_POL_I_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.3 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |


