| 10.2 |
30.7 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 9.0 |
27.0 |
GO:0060489 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 6.6 |
19.9 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 4.6 |
13.7 |
GO:0030421 |
defecation(GO:0030421) |
| 4.3 |
17.1 |
GO:1902724 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 4.0 |
15.9 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 3.9 |
23.6 |
GO:0003383 |
apical constriction(GO:0003383) |
| 3.8 |
19.2 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 3.8 |
7.6 |
GO:0060397 |
JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 3.8 |
15.0 |
GO:1904412 |
regulation of cardiac ventricle development(GO:1904412) |
| 3.7 |
11.0 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.6 |
3.6 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 3.5 |
6.9 |
GO:0070671 |
response to interleukin-12(GO:0070671) |
| 3.1 |
9.3 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 3.1 |
9.2 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 3.1 |
15.3 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 3.0 |
3.0 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 3.0 |
8.9 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 2.9 |
8.7 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 2.8 |
8.3 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 2.7 |
8.2 |
GO:0071898 |
odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.7 |
16.1 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 2.6 |
10.5 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 2.6 |
12.9 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 2.5 |
10.2 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 2.5 |
2.5 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 2.5 |
7.5 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.5 |
7.4 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 2.4 |
9.7 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 2.4 |
14.5 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 2.4 |
7.2 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 2.3 |
2.3 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 2.3 |
9.2 |
GO:0021764 |
amygdala development(GO:0021764) |
| 2.3 |
15.9 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 2.2 |
6.7 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 2.2 |
8.8 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 2.2 |
6.6 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 2.1 |
2.1 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 2.1 |
6.2 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 2.1 |
14.4 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 2.1 |
16.4 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 2.0 |
2.0 |
GO:1900224 |
positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 2.0 |
2.0 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 2.0 |
7.9 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 2.0 |
5.9 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 2.0 |
5.9 |
GO:0060853 |
arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel endothelial cell fate specification(GO:0097101) |
| 2.0 |
19.7 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 2.0 |
13.7 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 1.9 |
7.7 |
GO:0051316 |
attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 1.9 |
7.7 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 1.9 |
1.9 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 1.9 |
5.7 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 1.9 |
5.6 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.9 |
3.8 |
GO:0036515 |
serotonergic neuron axon guidance(GO:0036515) |
| 1.9 |
7.5 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.9 |
9.3 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 1.8 |
1.8 |
GO:0061113 |
pancreas morphogenesis(GO:0061113) |
| 1.8 |
7.2 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 1.8 |
10.8 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 1.8 |
9.0 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.8 |
5.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 1.7 |
3.5 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 1.7 |
10.4 |
GO:0048842 |
positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 1.7 |
1.7 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 1.7 |
10.3 |
GO:1904953 |
Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
| 1.7 |
6.7 |
GO:1902340 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 1.7 |
5.0 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 1.7 |
6.7 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.7 |
5.0 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.7 |
6.7 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 1.7 |
1.7 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.6 |
1.6 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 1.6 |
1.6 |
GO:0003134 |
BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 1.6 |
1.6 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 1.6 |
4.8 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 1.6 |
15.8 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 1.6 |
6.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 1.6 |
4.7 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 1.5 |
6.2 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of potassium ion export across plasma membrane(GO:1903764) regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
| 1.5 |
3.1 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 1.5 |
4.6 |
GO:0021649 |
vestibulocochlear nerve morphogenesis(GO:0021648) vestibulocochlear nerve structural organization(GO:0021649) ganglion morphogenesis(GO:0061552) dorsal root ganglion morphogenesis(GO:1904835) |
| 1.5 |
3.0 |
GO:1902751 |
positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 1.5 |
6.1 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 1.5 |
6.0 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 1.5 |
6.0 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 1.5 |
8.9 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 1.5 |
7.4 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.5 |
5.9 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 1.5 |
4.4 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.4 |
17.4 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.4 |
4.3 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.4 |
4.2 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 1.4 |
4.2 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.4 |
7.0 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 1.4 |
6.9 |
GO:0000279 |
M phase(GO:0000279) |
| 1.4 |
4.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.4 |
2.7 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.4 |
4.1 |
GO:0031660 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 1.4 |
4.1 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.4 |
1.4 |
GO:0031570 |
DNA integrity checkpoint(GO:0031570) |
| 1.4 |
2.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.4 |
4.1 |
GO:0007227 |
signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.3 |
8.1 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 1.3 |
1.3 |
GO:0001743 |
optic placode formation(GO:0001743) |
| 1.3 |
6.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.3 |
5.2 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 1.3 |
14.3 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.3 |
6.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.3 |
2.6 |
GO:0060023 |
soft palate development(GO:0060023) |
| 1.3 |
3.9 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 1.3 |
6.4 |
GO:0061198 |
fungiform papilla development(GO:0061196) fungiform papilla morphogenesis(GO:0061197) fungiform papilla formation(GO:0061198) |
| 1.3 |
3.8 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 1.3 |
1.3 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 1.3 |
1.3 |
GO:0002337 |
B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
| 1.3 |
3.8 |
GO:1904395 |
positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 1.3 |
3.8 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 1.3 |
1.3 |
GO:0080144 |
amino acid homeostasis(GO:0080144) |
| 1.2 |
1.2 |
GO:0060347 |
heart trabecula formation(GO:0060347) |
| 1.2 |
4.9 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 1.2 |
2.4 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 1.2 |
9.7 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 1.2 |
3.6 |
GO:0016321 |
female meiosis chromosome segregation(GO:0016321) |
| 1.2 |
3.6 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 1.2 |
3.5 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 1.2 |
3.5 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 1.2 |
4.6 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 1.1 |
1.1 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.1 |
3.4 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.1 |
2.3 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 1.1 |
2.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.1 |
4.5 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 1.1 |
21.4 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 1.1 |
3.4 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 1.1 |
2.2 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 1.1 |
7.9 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 1.1 |
3.4 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 1.1 |
4.5 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 1.1 |
13.4 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 1.1 |
6.6 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 1.1 |
9.9 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 1.1 |
14.2 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.1 |
3.3 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 1.1 |
14.1 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 1.1 |
21.6 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 1.1 |
3.2 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 1.1 |
1.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 |
3.2 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 1.1 |
3.2 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 1.1 |
1.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 1.1 |
2.1 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 1.1 |
10.5 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 1.1 |
4.2 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 1.1 |
3.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 1.0 |
9.4 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.0 |
5.2 |
GO:0051572 |
negative regulation of histone H3-K4 methylation(GO:0051572) |
| 1.0 |
5.2 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 1.0 |
4.1 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 1.0 |
1.0 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.0 |
1.0 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.0 |
7.1 |
GO:0044838 |
cell quiescence(GO:0044838) |
| 1.0 |
4.0 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 1.0 |
2.0 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 1.0 |
4.0 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 1.0 |
1.0 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.0 |
4.0 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 1.0 |
3.0 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.0 |
4.8 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 1.0 |
2.9 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 1.0 |
2.9 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 1.0 |
4.8 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 1.0 |
19.0 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.9 |
5.7 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.9 |
2.8 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.9 |
3.8 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.9 |
0.9 |
GO:0072236 |
metanephric loop of Henle development(GO:0072236) |
| 0.9 |
3.7 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.9 |
2.8 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 0.9 |
6.4 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.9 |
2.7 |
GO:1904959 |
elastin biosynthetic process(GO:0051542) copper ion export(GO:0060003) regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.9 |
2.7 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.9 |
1.8 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.9 |
4.5 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.9 |
6.3 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.9 |
6.3 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.9 |
11.7 |
GO:0048617 |
embryonic foregut morphogenesis(GO:0048617) |
| 0.9 |
2.7 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.9 |
2.7 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.9 |
4.5 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.9 |
4.5 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.9 |
2.7 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.9 |
4.4 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.9 |
0.9 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.9 |
13.3 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.9 |
2.6 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.9 |
3.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.9 |
4.4 |
GO:0061141 |
lung ciliated cell differentiation(GO:0061141) |
| 0.9 |
3.5 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.9 |
2.6 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.9 |
2.6 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 0.9 |
3.4 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.9 |
6.9 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.9 |
3.4 |
GO:0046210 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.9 |
2.6 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.9 |
3.4 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.8 |
9.3 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.8 |
5.9 |
GO:1901300 |
positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.8 |
9.2 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.8 |
1.7 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.8 |
2.4 |
GO:0010641 |
positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.8 |
3.3 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.8 |
2.4 |
GO:0070650 |
actin filament bundle distribution(GO:0070650) |
| 0.8 |
7.3 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.8 |
4.0 |
GO:0031022 |
nuclear migration along microfilament(GO:0031022) |
| 0.8 |
1.6 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.8 |
4.8 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.8 |
2.4 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.8 |
3.2 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.8 |
3.2 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.8 |
11.1 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.8 |
2.4 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.8 |
3.2 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.8 |
7.8 |
GO:0060213 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.8 |
10.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.8 |
14.0 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.8 |
10.1 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.8 |
0.8 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.8 |
10.8 |
GO:0006337 |
nucleosome disassembly(GO:0006337) |
| 0.8 |
2.3 |
GO:0035507 |
regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.8 |
3.1 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.8 |
0.8 |
GO:0042074 |
cell migration involved in gastrulation(GO:0042074) |
| 0.8 |
28.0 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.8 |
4.5 |
GO:0030913 |
paranodal junction assembly(GO:0030913) |
| 0.8 |
3.0 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.7 |
3.0 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) |
| 0.7 |
7.5 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.7 |
7.4 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.7 |
1.5 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.7 |
2.2 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.7 |
3.0 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.7 |
0.7 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.7 |
2.2 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.7 |
1.5 |
GO:0061180 |
mammary gland epithelium development(GO:0061180) |
| 0.7 |
0.7 |
GO:2000564 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.7 |
1.5 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.7 |
4.4 |
GO:0090005 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.7 |
6.5 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.7 |
1.4 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.7 |
2.9 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.7 |
1.4 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.7 |
0.7 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.7 |
5.0 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.7 |
2.1 |
GO:0030593 |
neutrophil chemotaxis(GO:0030593) neutrophil migration(GO:1990266) |
| 0.7 |
5.0 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.7 |
2.1 |
GO:0002035 |
brain renin-angiotensin system(GO:0002035) |
| 0.7 |
6.3 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.7 |
4.9 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.7 |
9.9 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.7 |
13.3 |
GO:0090224 |
regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.7 |
2.1 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.7 |
1.4 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.7 |
2.1 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.7 |
2.8 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.7 |
0.7 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.7 |
21.2 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.7 |
0.7 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.7 |
6.1 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.7 |
2.7 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.7 |
0.7 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 0.7 |
2.0 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.7 |
0.7 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.7 |
4.0 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.7 |
4.0 |
GO:0090298 |
negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.7 |
3.3 |
GO:0072530 |
purine-containing compound transmembrane transport(GO:0072530) |
| 0.7 |
4.6 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.7 |
5.2 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.6 |
5.2 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.6 |
1.9 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.6 |
7.1 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.6 |
6.4 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
2.6 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.6 |
7.0 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.6 |
3.2 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.6 |
3.8 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.6 |
0.6 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.6 |
1.3 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.6 |
5.7 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.6 |
1.9 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.6 |
5.7 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.6 |
6.9 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.6 |
5.6 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.6 |
1.9 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.6 |
1.9 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.6 |
1.2 |
GO:1902022 |
L-lysine transport(GO:1902022) |
| 0.6 |
4.4 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.6 |
5.0 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.6 |
8.7 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.6 |
1.2 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.6 |
1.8 |
GO:0090303 |
positive regulation of wound healing(GO:0090303) |
| 0.6 |
3.7 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.6 |
1.8 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.6 |
1.2 |
GO:0034242 |
negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.6 |
1.8 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.6 |
1.2 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.6 |
4.2 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.6 |
4.7 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.6 |
1.8 |
GO:0048007 |
antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.6 |
3.0 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.6 |
2.4 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.6 |
2.9 |
GO:0031018 |
endocrine pancreas development(GO:0031018) |
| 0.6 |
1.2 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.6 |
1.8 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.6 |
1.2 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.6 |
1.8 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.6 |
5.8 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.6 |
1.2 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.6 |
2.9 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.6 |
5.8 |
GO:0048596 |
embryonic camera-type eye morphogenesis(GO:0048596) |
| 0.6 |
2.9 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 |
20.1 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.6 |
1.7 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.6 |
1.7 |
GO:0090327 |
negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.6 |
1.7 |
GO:0034067 |
protein localization to Golgi apparatus(GO:0034067) |
| 0.6 |
1.1 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.6 |
3.4 |
GO:0090308 |
regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.6 |
2.8 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.6 |
1.1 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.6 |
1.1 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
| 0.6 |
1.1 |
GO:0032461 |
positive regulation of protein oligomerization(GO:0032461) |
| 0.6 |
2.2 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.6 |
2.8 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.6 |
3.3 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.6 |
6.1 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.6 |
3.9 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.5 |
2.7 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.5 |
1.1 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.5 |
1.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.5 |
6.0 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.5 |
2.7 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.5 |
2.2 |
GO:0048793 |
pronephros development(GO:0048793) |
| 0.5 |
1.6 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.5 |
2.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.5 |
0.5 |
GO:0060561 |
apoptotic process involved in morphogenesis(GO:0060561) |
| 0.5 |
2.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.5 |
2.1 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.5 |
2.1 |
GO:0061156 |
pulmonary artery morphogenesis(GO:0061156) |
| 0.5 |
2.1 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.5 |
2.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.5 |
3.7 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.5 |
1.6 |
GO:0014866 |
skeletal myofibril assembly(GO:0014866) |
| 0.5 |
1.1 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.5 |
5.3 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.5 |
1.6 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.5 |
1.0 |
GO:2000851 |
positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.5 |
0.5 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.5 |
0.5 |
GO:0060442 |
branching involved in prostate gland morphogenesis(GO:0060442) |
| 0.5 |
1.6 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.5 |
3.6 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.5 |
2.0 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.5 |
0.5 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.5 |
1.0 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.5 |
1.5 |
GO:0045414 |
regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.5 |
1.0 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.5 |
4.0 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.5 |
1.5 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.5 |
13.1 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.5 |
2.0 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.5 |
1.0 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.5 |
4.5 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.5 |
1.0 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.5 |
0.5 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.5 |
9.5 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.5 |
5.0 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.5 |
5.0 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.5 |
2.5 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.5 |
1.0 |
GO:1904468 |
negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.5 |
1.5 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) cardiac cell fate specification(GO:0060912) |
| 0.5 |
3.5 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.5 |
1.5 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.5 |
4.4 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.5 |
3.9 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.5 |
2.0 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.5 |
0.5 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.5 |
1.5 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.5 |
0.5 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.5 |
3.4 |
GO:0003281 |
ventricular septum development(GO:0003281) |
| 0.5 |
0.5 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.5 |
4.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.5 |
1.4 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.5 |
0.5 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.5 |
1.9 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.5 |
1.4 |
GO:0035878 |
nail development(GO:0035878) |
| 0.5 |
10.0 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.5 |
5.7 |
GO:0042789 |
mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.5 |
4.8 |
GO:1901409 |
positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.5 |
0.9 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.5 |
1.9 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.5 |
1.4 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.5 |
2.8 |
GO:1904426 |
positive regulation of GTP binding(GO:1904426) |
| 0.5 |
3.2 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.5 |
6.0 |
GO:0030279 |
negative regulation of ossification(GO:0030279) |
| 0.5 |
4.1 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.5 |
3.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.5 |
0.9 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.5 |
0.5 |
GO:0032875 |
regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.5 |
1.4 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.5 |
1.4 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.5 |
5.4 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.5 |
0.9 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.5 |
1.8 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.5 |
0.9 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.4 |
0.9 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.4 |
3.6 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.4 |
3.6 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.4 |
2.2 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.4 |
1.8 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.4 |
1.8 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.4 |
2.2 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.4 |
3.1 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 |
1.8 |
GO:1904684 |
negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.4 |
1.3 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.4 |
1.7 |
GO:0072362 |
regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) regulation of glycolytic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072362) |
| 0.4 |
0.4 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.4 |
1.3 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of receptor clustering(GO:1903911) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.4 |
0.9 |
GO:0015810 |
aspartate transport(GO:0015810) |
| 0.4 |
2.2 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.4 |
0.9 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.4 |
8.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.4 |
1.3 |
GO:0015740 |
C4-dicarboxylate transport(GO:0015740) |
| 0.4 |
2.1 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.4 |
2.6 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.4 |
0.9 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.4 |
1.3 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.4 |
0.9 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.4 |
1.7 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.4 |
0.9 |
GO:0071772 |
response to BMP(GO:0071772) cellular response to BMP stimulus(GO:0071773) |
| 0.4 |
4.7 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.4 |
0.4 |
GO:0042448 |
progesterone metabolic process(GO:0042448) |
| 0.4 |
0.9 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.4 |
3.0 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.4 |
0.8 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.4 |
3.4 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.4 |
2.1 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.4 |
5.1 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.4 |
0.4 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.4 |
0.8 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.4 |
0.4 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.4 |
1.7 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 |
0.8 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.4 |
1.7 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.4 |
0.4 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.4 |
0.8 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.4 |
0.4 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.4 |
1.6 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.4 |
0.4 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.4 |
2.0 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.4 |
4.0 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 |
1.6 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.4 |
2.0 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.4 |
2.4 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.4 |
7.2 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.4 |
7.1 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.4 |
3.2 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.4 |
0.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.4 |
2.8 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.4 |
2.0 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.4 |
1.6 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.4 |
1.2 |
GO:1903069 |
regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.4 |
5.1 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.4 |
4.3 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.4 |
1.2 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.4 |
3.9 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.4 |
4.6 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.4 |
1.2 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.4 |
0.8 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.4 |
1.1 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.4 |
1.5 |
GO:1903286 |
regulation of potassium ion import(GO:1903286) |
| 0.4 |
2.7 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.4 |
2.7 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.4 |
0.4 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.4 |
7.6 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) |
| 0.4 |
4.5 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.4 |
1.1 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 0.4 |
0.4 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.4 |
0.8 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.4 |
1.9 |
GO:0033184 |
positive regulation of histone ubiquitination(GO:0033184) |
| 0.4 |
2.3 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
0.7 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.4 |
1.5 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.4 |
1.9 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.4 |
0.7 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.4 |
1.5 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.4 |
5.1 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.4 |
0.4 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.4 |
1.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.4 |
1.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.4 |
5.9 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.4 |
1.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.4 |
0.7 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.4 |
1.4 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.4 |
1.1 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.4 |
3.3 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.4 |
6.1 |
GO:0001947 |
heart looping(GO:0001947) |
| 0.4 |
1.8 |
GO:0030432 |
peristalsis(GO:0030432) |
| 0.4 |
7.2 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.4 |
0.7 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.4 |
0.7 |
GO:1905077 |
negative regulation of interleukin-17 secretion(GO:1905077) |
| 0.4 |
0.7 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.4 |
3.2 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.4 |
2.5 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.4 |
7.1 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.4 |
1.1 |
GO:0060174 |
limb bud formation(GO:0060174) |
| 0.4 |
0.4 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.4 |
1.8 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.4 |
1.4 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.4 |
4.2 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.4 |
3.9 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.4 |
4.6 |
GO:0010667 |
negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.4 |
2.1 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.3 |
1.0 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 |
0.3 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.3 |
1.0 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.3 |
1.7 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.3 |
2.4 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 |
2.4 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.3 |
1.0 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.3 |
3.5 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.3 |
0.7 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.3 |
1.7 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.3 |
4.1 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.3 |
2.7 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.3 |
1.7 |
GO:0032495 |
response to muramyl dipeptide(GO:0032495) |
| 0.3 |
0.7 |
GO:0035050 |
embryonic heart tube development(GO:0035050) |
| 0.3 |
0.7 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.3 |
1.3 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.3 |
6.7 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.3 |
1.0 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.3 |
1.0 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 |
2.0 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.3 |
0.7 |
GO:2000402 |
negative regulation of lymphocyte migration(GO:2000402) |
| 0.3 |
2.0 |
GO:0000132 |
establishment of mitotic spindle orientation(GO:0000132) |
| 0.3 |
4.6 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.3 |
1.0 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.3 |
0.7 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.3 |
1.0 |
GO:0045006 |
DNA deamination(GO:0045006) |
| 0.3 |
0.6 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.3 |
1.3 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.3 |
1.3 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.3 |
1.0 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.3 |
1.3 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.3 |
1.0 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) skeletal muscle cell proliferation(GO:0014856) |
| 0.3 |
0.6 |
GO:0045742 |
positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.3 |
0.3 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.3 |
1.9 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.3 |
9.3 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.3 |
1.6 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.3 |
0.6 |
GO:0090656 |
t-circle formation(GO:0090656) |
| 0.3 |
1.3 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
0.6 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.3 |
1.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.3 |
2.8 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 |
9.1 |
GO:0001738 |
morphogenesis of a polarized epithelium(GO:0001738) |
| 0.3 |
4.7 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.3 |
2.2 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.3 |
4.1 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.3 |
2.5 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.3 |
7.2 |
GO:0034724 |
DNA replication-independent nucleosome organization(GO:0034724) |
| 0.3 |
0.3 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.3 |
1.2 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.3 |
1.6 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.3 |
2.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.3 |
5.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.3 |
0.6 |
GO:0035826 |
rubidium ion transport(GO:0035826) |
| 0.3 |
0.6 |
GO:0021979 |
hypothalamus cell differentiation(GO:0021979) |
| 0.3 |
2.1 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.3 |
1.2 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.3 |
0.6 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.3 |
0.9 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.3 |
0.3 |
GO:1904192 |
cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.3 |
0.3 |
GO:1901668 |
regulation of superoxide dismutase activity(GO:1901668) |
| 0.3 |
0.9 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.3 |
1.5 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.3 |
2.1 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.3 |
3.9 |
GO:0051567 |
histone H3-K9 methylation(GO:0051567) |
| 0.3 |
0.9 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
0.6 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.3 |
0.9 |
GO:0033344 |
cholesterol efflux(GO:0033344) |
| 0.3 |
4.7 |
GO:0001967 |
suckling behavior(GO:0001967) |
| 0.3 |
1.5 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.3 |
0.6 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.3 |
0.9 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.3 |
1.2 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.3 |
4.7 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.3 |
0.9 |
GO:0043154 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043154) |
| 0.3 |
0.3 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.3 |
0.9 |
GO:0051569 |
regulation of histone H3-K4 methylation(GO:0051569) |
| 0.3 |
0.9 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.3 |
3.1 |
GO:0071378 |
growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.3 |
0.6 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.3 |
1.7 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.3 |
0.8 |
GO:0048644 |
muscle organ morphogenesis(GO:0048644) |
| 0.3 |
1.1 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.3 |
2.2 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.3 |
1.7 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.3 |
1.1 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.3 |
0.6 |
GO:1903422 |
negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.3 |
0.3 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.3 |
1.1 |
GO:0032682 |
negative regulation of chemokine production(GO:0032682) |
| 0.3 |
3.3 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.3 |
0.3 |
GO:0006312 |
mitotic recombination(GO:0006312) |
| 0.3 |
11.9 |
GO:0032608 |
interferon-beta production(GO:0032608) |
| 0.3 |
1.7 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.3 |
1.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.3 |
0.3 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.3 |
3.5 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.3 |
2.4 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.3 |
0.5 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.3 |
3.0 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) |
| 0.3 |
1.9 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.3 |
0.8 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.3 |
0.3 |
GO:0098743 |
cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.3 |
5.8 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.3 |
2.1 |
GO:0031571 |
mitotic G1 DNA damage checkpoint(GO:0031571) |
| 0.3 |
0.5 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.3 |
0.3 |
GO:0051254 |
positive regulation of RNA metabolic process(GO:0051254) |
| 0.3 |
5.0 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.3 |
0.3 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.3 |
1.3 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.3 |
0.5 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.3 |
1.3 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.3 |
0.3 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.3 |
3.4 |
GO:0090307 |
mitotic spindle assembly(GO:0090307) |
| 0.3 |
2.6 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.3 |
0.3 |
GO:0002327 |
immature B cell differentiation(GO:0002327) |
| 0.3 |
0.8 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.3 |
0.3 |
GO:0045840 |
positive regulation of mitotic nuclear division(GO:0045840) |
| 0.3 |
2.8 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.3 |
0.5 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.3 |
1.0 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.3 |
2.8 |
GO:0036120 |
cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.3 |
1.0 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.3 |
0.5 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.3 |
1.0 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
1.7 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.2 |
2.5 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.2 |
0.7 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.2 |
0.7 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.2 |
1.0 |
GO:1900221 |
regulation of beta-amyloid clearance(GO:1900221) |
| 0.2 |
0.2 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 |
1.2 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.2 |
4.7 |
GO:1902003 |
regulation of beta-amyloid formation(GO:1902003) |
| 0.2 |
0.5 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.2 |
2.9 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 |
0.7 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 |
2.0 |
GO:0035357 |
peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.2 |
1.5 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.2 |
1.2 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.2 |
1.0 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.2 |
1.0 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 |
1.4 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.2 |
0.2 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.2 |
1.9 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.2 |
4.8 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.2 |
1.9 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.2 |
1.2 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.2 |
2.6 |
GO:0007413 |
axonal fasciculation(GO:0007413) |
| 0.2 |
3.3 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.2 |
3.3 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.2 |
1.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.2 |
1.4 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.2 |
9.2 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
2.8 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 |
0.9 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.2 |
0.2 |
GO:1904729 |
regulation of intestinal lipid absorption(GO:1904729) |
| 0.2 |
0.7 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.2 |
0.5 |
GO:0045815 |
positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.2 |
0.7 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.2 |
0.9 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.2 |
0.2 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.2 |
1.6 |
GO:1990748 |
cellular detoxification(GO:1990748) |
| 0.2 |
0.2 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.2 |
1.8 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 |
0.2 |
GO:0032226 |
positive regulation of synaptic transmission, dopaminergic(GO:0032226) neurotransmitter reuptake(GO:0098810) |
| 0.2 |
11.1 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.2 |
0.5 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 0.2 |
0.7 |
GO:1904292 |
regulation of ERAD pathway(GO:1904292) |
| 0.2 |
0.7 |
GO:0034205 |
beta-amyloid formation(GO:0034205) |
| 0.2 |
0.5 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 |
1.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.2 |
1.6 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.2 |
1.1 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.2 |
0.4 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.2 |
1.8 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.2 |
0.9 |
GO:1904715 |
negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.2 |
1.3 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.2 |
0.4 |
GO:1990845 |
diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.2 |
0.2 |
GO:0015822 |
ornithine transport(GO:0015822) |
| 0.2 |
2.4 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.2 |
0.7 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.2 |
10.1 |
GO:0000381 |
regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.2 |
0.7 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 |
0.2 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.2 |
0.7 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.2 |
1.1 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.2 |
2.4 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.2 |
0.4 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.2 |
0.2 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.2 |
0.6 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.2 |
0.8 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 |
1.5 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.2 |
3.2 |
GO:0003382 |
epithelial cell morphogenesis(GO:0003382) |
| 0.2 |
1.5 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.2 |
0.4 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.2 |
0.6 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.2 |
1.0 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 |
1.2 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.2 |
1.4 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.2 |
0.8 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 |
0.2 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.2 |
1.0 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.2 |
1.0 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 |
9.5 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.2 |
1.4 |
GO:0010310 |
regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.2 |
1.0 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.2 |
2.0 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
1.6 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
0.8 |
GO:0045839 |
negative regulation of mitotic nuclear division(GO:0045839) |
| 0.2 |
3.8 |
GO:1902186 |
regulation of viral release from host cell(GO:1902186) |
| 0.2 |
0.6 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
0.4 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.2 |
2.0 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.2 |
0.4 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.2 |
0.6 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.2 |
0.4 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.2 |
0.8 |
GO:0032382 |
positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) |
| 0.2 |
0.4 |
GO:0021559 |
trigeminal nerve development(GO:0021559) |
| 0.2 |
1.6 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.2 |
0.6 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.2 |
1.2 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.2 |
1.0 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.2 |
5.7 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.2 |
1.5 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.2 |
0.8 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.2 |
4.4 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.2 |
0.4 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.2 |
0.6 |
GO:0019896 |
axonal transport of mitochondrion(GO:0019896) |
| 0.2 |
0.6 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) |
| 0.2 |
1.7 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.2 |
0.7 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
0.7 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.2 |
1.3 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) |
| 0.2 |
0.6 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.2 |
4.3 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.2 |
1.7 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.2 |
0.4 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.2 |
0.7 |
GO:1903337 |
positive regulation of vacuolar transport(GO:1903337) |
| 0.2 |
0.2 |
GO:1905076 |
regulation of interleukin-17 secretion(GO:1905076) |
| 0.2 |
2.2 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.2 |
2.5 |
GO:0046856 |
phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.2 |
3.1 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.2 |
0.4 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.2 |
4.1 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.2 |
1.2 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.2 |
0.4 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.2 |
0.9 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 |
0.7 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.2 |
0.9 |
GO:0031507 |
heterochromatin assembly(GO:0031507) |
| 0.2 |
0.5 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 |
5.4 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.2 |
0.2 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.2 |
0.5 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.2 |
1.0 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.2 |
17.7 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.2 |
1.0 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 |
2.6 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 |
1.2 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.2 |
0.2 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.2 |
0.7 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.2 |
0.5 |
GO:0044827 |
modulation by host of viral genome replication(GO:0044827) |
| 0.2 |
0.7 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 |
0.3 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.2 |
1.7 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 |
0.2 |
GO:1900673 |
olefin metabolic process(GO:1900673) |
| 0.2 |
3.1 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.2 |
1.1 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.2 |
1.3 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.2 |
1.6 |
GO:0016574 |
histone ubiquitination(GO:0016574) |
| 0.2 |
1.5 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.2 |
2.4 |
GO:0060323 |
head morphogenesis(GO:0060323) |
| 0.2 |
2.9 |
GO:0009994 |
oocyte differentiation(GO:0009994) |
| 0.2 |
1.1 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.2 |
0.5 |
GO:1903223 |
positive regulation of oxidative stress-induced neuron death(GO:1903223) positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.2 |
1.0 |
GO:1901184 |
regulation of ERBB signaling pathway(GO:1901184) |
| 0.2 |
0.6 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 |
2.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.2 |
1.1 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.2 |
0.5 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.2 |
2.2 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.2 |
0.9 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.2 |
0.3 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.2 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.2 |
0.5 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.2 |
1.4 |
GO:0032509 |
endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.2 |
0.3 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 |
0.5 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
1.1 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.2 |
0.3 |
GO:0045835 |
negative regulation of meiotic nuclear division(GO:0045835) |
| 0.1 |
0.3 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
1.3 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
0.4 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) transepithelial ammonium transport(GO:0070634) |
| 0.1 |
0.6 |
GO:0006970 |
response to osmotic stress(GO:0006970) |
| 0.1 |
0.4 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 |
0.1 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.1 |
0.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.1 |
1.5 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
1.6 |
GO:0046855 |
inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
0.4 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 |
0.7 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 |
0.3 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 |
1.3 |
GO:0030574 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.1 |
1.3 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.6 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.3 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
0.1 |
GO:0003156 |
regulation of organ formation(GO:0003156) |
| 0.1 |
0.6 |
GO:0035745 |
T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 |
0.4 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 |
1.1 |
GO:0019359 |
NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
| 0.1 |
0.4 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 |
1.1 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.4 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.5 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.1 |
0.8 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.1 |
0.3 |
GO:0051769 |
nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 |
2.9 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 |
0.8 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.1 |
2.8 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 |
0.4 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.4 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.3 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
0.4 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 |
1.0 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.5 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.1 |
1.8 |
GO:2001243 |
negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
| 0.1 |
0.3 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 |
0.4 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 |
1.5 |
GO:0010960 |
magnesium ion homeostasis(GO:0010960) |
| 0.1 |
0.1 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.1 |
2.6 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.4 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.1 |
0.4 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.1 |
0.4 |
GO:0019363 |
pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.1 |
1.2 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.1 |
0.1 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) |
| 0.1 |
0.7 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 |
0.2 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 |
0.2 |
GO:1903371 |
regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 |
0.4 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.1 |
0.1 |
GO:0048341 |
paraxial mesoderm formation(GO:0048341) |
| 0.1 |
0.7 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.1 |
0.4 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.5 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
0.6 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
2.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.4 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 |
0.5 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
0.2 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.1 |
0.9 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.1 |
1.3 |
GO:0035909 |
aorta morphogenesis(GO:0035909) |
| 0.1 |
3.1 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.1 |
1.0 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.2 |
GO:1904504 |
regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 |
1.4 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
0.2 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.1 |
0.4 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.7 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
1.0 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.2 |
GO:0090043 |
tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.1 |
0.5 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.1 |
0.2 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.1 |
0.2 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.1 |
0.3 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.3 |
GO:0033144 |
negative regulation of intracellular steroid hormone receptor signaling pathway(GO:0033144) |
| 0.1 |
0.2 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.1 |
0.2 |
GO:0010889 |
regulation of sequestering of triglyceride(GO:0010889) sequestering of triglyceride(GO:0030730) |
| 0.1 |
0.5 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
2.2 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
0.2 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.1 |
0.1 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.1 |
0.5 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 0.1 |
0.7 |
GO:0003170 |
heart valve development(GO:0003170) |
| 0.1 |
0.4 |
GO:0018022 |
peptidyl-lysine methylation(GO:0018022) |
| 0.1 |
0.6 |
GO:1902229 |
regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) |
| 0.1 |
0.4 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 |
0.4 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 |
0.2 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.1 |
0.2 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.1 |
0.6 |
GO:0033561 |
regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
| 0.1 |
1.9 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
1.1 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.1 |
6.4 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.1 |
0.7 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.3 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 |
0.4 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) |
| 0.1 |
0.5 |
GO:2000380 |
regulation of mesoderm development(GO:2000380) |
| 0.1 |
0.6 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.1 |
0.4 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.1 |
15.8 |
GO:0000398 |
RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.1 |
0.7 |
GO:0002183 |
cytoplasmic translational initiation(GO:0002183) |
| 0.1 |
0.1 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.1 |
0.8 |
GO:0046519 |
sphingoid metabolic process(GO:0046519) |
| 0.1 |
0.9 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.3 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.1 |
0.2 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.1 |
0.3 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 |
0.1 |
GO:1901298 |
regulation of hydrogen peroxide-mediated programmed cell death(GO:1901298) |
| 0.1 |
0.1 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 |
0.5 |
GO:0032288 |
myelin assembly(GO:0032288) |
| 0.1 |
0.2 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.3 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 |
0.1 |
GO:0031958 |
corticosteroid receptor signaling pathway(GO:0031958) |
| 0.1 |
0.1 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.1 |
1.0 |
GO:0006940 |
regulation of smooth muscle contraction(GO:0006940) |
| 0.1 |
0.1 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.1 |
0.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 |
0.2 |
GO:0050996 |
positive regulation of lipid catabolic process(GO:0050996) |
| 0.1 |
0.3 |
GO:2000303 |
regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.1 |
0.1 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.1 |
0.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.2 |
GO:0009212 |
dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.1 |
0.7 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.1 |
0.4 |
GO:0010863 |
positive regulation of phospholipase C activity(GO:0010863) |
| 0.1 |
0.2 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.1 |
0.4 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
0.2 |
GO:0071941 |
nitrogen cycle metabolic process(GO:0071941) |
| 0.1 |
0.2 |
GO:0035553 |
oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 |
0.3 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
0.5 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.1 |
0.4 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
3.1 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.4 |
GO:0033034 |
positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
| 0.1 |
0.1 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.1 |
0.1 |
GO:1903564 |
regulation of protein localization to cilium(GO:1903564) |
| 0.1 |
0.4 |
GO:0035247 |
peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 |
1.0 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.1 |
0.6 |
GO:1902750 |
negative regulation of cell cycle G2/M phase transition(GO:1902750) |
| 0.1 |
0.7 |
GO:1900026 |
positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.1 |
2.7 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.1 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.1 |
0.6 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 |
0.1 |
GO:0016573 |
histone acetylation(GO:0016573) |
| 0.1 |
0.1 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.1 |
GO:0051006 |
positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 |
3.7 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
1.9 |
GO:0051865 |
protein autoubiquitination(GO:0051865) |
| 0.1 |
0.1 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.1 |
0.1 |
GO:0035089 |
establishment of apical/basal cell polarity(GO:0035089) |
| 0.1 |
0.4 |
GO:0072673 |
lamellipodium morphogenesis(GO:0072673) |
| 0.1 |
0.2 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.1 |
0.1 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
2.1 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.1 |
0.3 |
GO:0015911 |
regulation of plasma membrane long-chain fatty acid transport(GO:0010746) plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
| 0.1 |
0.4 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 |
0.5 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.2 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 |
0.4 |
GO:0015695 |
organic cation transport(GO:0015695) |
| 0.1 |
3.8 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
0.2 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.1 |
0.2 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 |
0.2 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.1 |
1.9 |
GO:0045814 |
negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.1 |
0.2 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.1 |
0.1 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.2 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.3 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.1 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 |
0.2 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.1 |
0.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.4 |
GO:1903432 |
regulation of TORC1 signaling(GO:1903432) |
| 0.1 |
0.1 |
GO:0048843 |
negative regulation of axon extension involved in axon guidance(GO:0048843) |
| 0.1 |
0.9 |
GO:0000187 |
activation of MAPK activity(GO:0000187) |
| 0.1 |
0.2 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.0 |
1.2 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.2 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.0 |
0.1 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 |
0.6 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.0 |
0.2 |
GO:0002634 |
regulation of germinal center formation(GO:0002634) |
| 0.0 |
0.1 |
GO:0043323 |
regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.0 |
0.1 |
GO:0090085 |
regulation of protein deubiquitination(GO:0090085) |
| 0.0 |
0.5 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 |
0.0 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 |
0.5 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.4 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 |
0.0 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.0 |
0.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.0 |
0.2 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 |
0.0 |
GO:0070827 |
chromatin maintenance(GO:0070827) |
| 0.0 |
0.4 |
GO:0050868 |
negative regulation of T cell activation(GO:0050868) |
| 0.0 |
0.0 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.0 |
1.4 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.2 |
GO:0006678 |
glucosylceramide metabolic process(GO:0006678) |
| 0.0 |
0.1 |
GO:0000423 |
macromitophagy(GO:0000423) response to mitochondrial depolarisation(GO:0098780) |
| 0.0 |
0.8 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 |
0.1 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.0 |
0.3 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.1 |
GO:0016572 |
histone phosphorylation(GO:0016572) |
| 0.0 |
1.1 |
GO:0043666 |
regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 |
0.2 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.0 |
0.4 |
GO:0000002 |
mitochondrial genome maintenance(GO:0000002) |
| 0.0 |
0.2 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.0 |
0.1 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 |
0.6 |
GO:0034113 |
heterotypic cell-cell adhesion(GO:0034113) |
| 0.0 |
0.4 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 |
0.1 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 |
0.1 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 |
0.0 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 |
0.1 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.0 |
0.1 |
GO:1904714 |
chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 |
0.2 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.0 |
0.2 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 |
0.2 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 |
0.1 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.0 |
0.2 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.0 |
0.1 |
GO:0046931 |
pore complex assembly(GO:0046931) |
| 0.0 |
0.1 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.0 |
0.1 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.0 |
0.2 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.0 |
0.1 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.0 |
0.1 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.0 |
0.2 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.2 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 |
0.2 |
GO:0009067 |
aspartate family amino acid biosynthetic process(GO:0009067) |
| 0.0 |
0.6 |
GO:0044839 |
cell cycle G2/M phase transition(GO:0044839) |
| 0.0 |
0.1 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.0 |
0.0 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 |
0.1 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 |
0.2 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.1 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.0 |
0.1 |
GO:1903321 |
negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
| 0.0 |
0.0 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 |
0.2 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.0 |
0.1 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.0 |
0.1 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.0 |
0.0 |
GO:1903912 |
regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 |
0.0 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 |
0.1 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
| 0.0 |
0.1 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.2 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.0 |
2.7 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.0 |
0.1 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) |
| 0.0 |
0.1 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 |
0.5 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.1 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.0 |
0.8 |
GO:0050953 |
sensory perception of light stimulus(GO:0050953) |
| 0.0 |
0.1 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.0 |
0.1 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.0 |
0.0 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.0 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.0 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.0 |
0.0 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.0 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.0 |
0.0 |
GO:0072170 |
metanephric tubule development(GO:0072170) metanephric epithelium development(GO:0072207) |
| 0.0 |
0.1 |
GO:1901799 |
negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 |
0.1 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.0 |
0.0 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.0 |
0.1 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.0 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.4 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.0 |
0.0 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 |
0.0 |
GO:0043553 |
negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.0 |
0.0 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
