Motif ID: Smad1
Z-value: 1.818
Transcription factors associated with Smad1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Smad1 | ENSMUSG00000031681.8 | Smad1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Smad1 | mm10_v2_chr8_-_79399513_79399532 | -0.30 | 6.2e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.6 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 1.4 | 4.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 1.2 | 3.5 | GO:0002586 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 1.1 | 3.2 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 1.1 | 3.2 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 1.0 | 4.0 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 1.0 | 3.0 | GO:1905072 | cardiac jelly development(GO:1905072) |
| 0.9 | 7.8 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.8 | 2.5 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.8 | 2.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.8 | 3.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.8 | 2.3 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.7 | 3.0 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.7 | 3.7 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.7 | 3.6 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 0.7 | 4.3 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.7 | 2.8 | GO:0050904 | diapedesis(GO:0050904) |
| 0.7 | 2.8 | GO:0071726 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.7 | 0.7 | GO:0033122 | regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.7 | 2.0 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.7 | 2.0 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.7 | 2.6 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.6 | 1.9 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.6 | 3.1 | GO:0002339 | B cell selection(GO:0002339) |
| 0.6 | 1.8 | GO:0036233 | glycine import(GO:0036233) |
| 0.6 | 2.2 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.6 | 1.7 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.6 | 2.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.5 | 2.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.5 | 2.7 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.5 | 1.6 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.5 | 3.1 | GO:1902998 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.5 | 1.5 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.5 | 0.5 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.5 | 2.0 | GO:1902340 | telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 0.5 | 2.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.5 | 2.4 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.5 | 1.0 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.5 | 1.4 | GO:0030421 | defecation(GO:0030421) |
| 0.5 | 1.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.5 | 1.8 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.5 | 1.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.4 | 1.3 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.4 | 1.8 | GO:0042228 | interleukin-8 biosynthetic process(GO:0042228) |
| 0.4 | 0.9 | GO:0002481 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 0.4 | 0.9 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.4 | 1.7 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.4 | 0.9 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.4 | 1.3 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
| 0.4 | 1.3 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.4 | 1.7 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.4 | 1.3 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.4 | 1.2 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.4 | 1.7 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.4 | 1.6 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.4 | 0.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.4 | 1.6 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.4 | 1.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 | 1.6 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.4 | 1.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.4 | 1.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.4 | 1.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.4 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.4 | 1.9 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.4 | 1.5 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.4 | 0.4 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.4 | 1.5 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.4 | 1.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.4 | 1.4 | GO:0061623 | glycolytic process from galactose(GO:0061623) |
| 0.4 | 1.4 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.4 | 0.7 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
| 0.4 | 1.4 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.4 | 1.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.4 | 2.1 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.3 | 0.7 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.3 | 0.7 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.3 | 1.7 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.3 | 1.0 | GO:0048289 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
| 0.3 | 2.7 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.3 | 1.3 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.3 | 1.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.3 | 1.7 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.3 | 2.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.3 | 2.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.3 | 0.7 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.3 | 1.0 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.3 | 1.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.3 | 1.3 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.3 | 1.3 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.3 | 1.3 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.3 | 1.9 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.3 | 2.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.3 | 1.6 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.3 | 0.6 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.3 | 1.2 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.3 | 0.9 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.3 | 1.2 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.3 | 8.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.3 | 0.9 | GO:0048611 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.3 | 0.6 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.3 | 1.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.3 | 0.9 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.3 | 4.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.3 | 1.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 | 0.3 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.3 | 0.9 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.3 | 1.8 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.3 | 0.6 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.3 | 1.2 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 0.3 | 0.9 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.3 | 2.1 | GO:0015862 | uridine transport(GO:0015862) |
| 0.3 | 0.6 | GO:0032423 | regulation of mismatch repair(GO:0032423) |
| 0.3 | 0.9 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.3 | 0.9 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.3 | 0.9 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.3 | 0.9 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.3 | 1.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.3 | 0.8 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.3 | 0.8 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 | 1.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.3 | 1.4 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.3 | 1.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.3 | 0.8 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.3 | 0.8 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.3 | 1.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.3 | 2.2 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.3 | 1.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.3 | 1.6 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.3 | 1.1 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.3 | 1.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.3 | 1.3 | GO:1905165 | regulation of lysosomal protein catabolic process(GO:1905165) |
| 0.3 | 1.6 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.3 | 0.8 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.3 | 1.6 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.3 | 1.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.3 | 0.8 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.3 | 1.6 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.3 | 1.6 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.3 | 0.8 | GO:0072720 | response to sorbitol(GO:0072708) response to dithiothreitol(GO:0072720) |
| 0.3 | 0.3 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.3 | 0.5 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.3 | 0.8 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.3 | 1.3 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.3 | 0.8 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.3 | 0.5 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 1.2 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.2 | 0.7 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.2 | 0.5 | GO:0035793 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.2 | 0.5 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 | 1.5 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.2 | 1.7 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.2 | 2.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 | 1.9 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.2 | 4.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.2 | 1.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.2 | 0.7 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.2 | 0.7 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.2 | 0.7 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.2 | 0.5 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.2 | 5.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.2 | 0.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.2 | 0.5 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.2 | 0.7 | GO:0032650 | regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) interleukin-1 alpha secretion(GO:0050703) |
| 0.2 | 1.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 2.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.2 | 0.7 | GO:2000830 | vacuolar phosphate transport(GO:0007037) motogenic signaling involved in postnatal olfactory bulb interneuron migration(GO:0021837) vitamin D3 metabolic process(GO:0070640) positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.2 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 2.0 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.2 | 0.4 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
| 0.2 | 0.7 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.2 | 1.6 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.2 | 0.9 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 | 0.7 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.2 | 1.8 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.2 | 0.4 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.2 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.2 | 0.8 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 | 1.7 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.2 | 2.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.2 | 0.6 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.2 | 0.6 | GO:0060022 | hard palate development(GO:0060022) |
| 0.2 | 0.6 | GO:0015817 | histidine transport(GO:0015817) |
| 0.2 | 0.4 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 1.0 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.2 | 1.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 1.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 | 0.8 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 | 0.6 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.2 | 0.8 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.2 | 1.0 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.2 | 3.3 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.2 | 0.8 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.2 | 2.2 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.2 | 1.0 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 0.8 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 0.8 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 | 0.8 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.2 | 1.6 | GO:0019835 | cytolysis(GO:0019835) |
| 0.2 | 0.6 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.2 | 0.8 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.2 | 1.5 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.2 | 0.6 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.2 | 0.2 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) positive regulation of mesoderm development(GO:2000382) |
| 0.2 | 0.8 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.2 | 0.6 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 0.8 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.2 | 1.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.2 | 2.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 | 1.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.2 | 0.9 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.2 | 1.7 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.2 | 0.6 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.2 | 1.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 1.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.2 | 0.9 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.2 | 0.9 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.2 | 0.4 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.2 | 0.9 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.2 | 1.1 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.2 | 0.9 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.2 | 0.6 | GO:0002861 | regulation of inflammatory response to antigenic stimulus(GO:0002861) |
| 0.2 | 0.7 | GO:1903294 | platelet dense granule organization(GO:0060155) regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
| 0.2 | 0.5 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.2 | 0.5 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.2 | 0.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 0.7 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.2 | 0.5 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.2 | 1.4 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.2 | 1.3 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.2 | 0.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 1.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.2 | 2.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.2 | 1.1 | GO:0046102 | inosine metabolic process(GO:0046102) |
| 0.2 | 0.7 | GO:0042160 | plasma lipoprotein particle oxidation(GO:0034441) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.2 | 1.4 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.2 | 0.5 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.2 | 0.9 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.2 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 | 0.5 | GO:0061744 | motor behavior(GO:0061744) |
| 0.2 | 2.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 | 2.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 | 2.6 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.2 | 0.9 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.2 | 0.7 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 | 2.6 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.2 | 2.2 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.2 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.2 | 1.7 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.2 | 1.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 | 1.5 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.2 | 5.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.2 | 1.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 0.3 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.2 | 2.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.2 | 0.3 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.2 | 0.8 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.2 | 0.3 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 0.2 | 1.3 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.2 | 2.6 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.2 | 0.8 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 | 1.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.2 | 0.5 | GO:0050748 | negative regulation of receptor biosynthetic process(GO:0010871) opioid receptor signaling pathway(GO:0038003) negative regulation of lipoprotein metabolic process(GO:0050748) glomerular mesangium development(GO:0072109) regulation of glomerulus development(GO:0090192) positive regulation of glomerulus development(GO:0090193) regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.2 | 0.5 | GO:0060785 | regulation of apoptosis involved in tissue homeostasis(GO:0060785) |
| 0.2 | 1.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.2 | 0.2 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.2 | 1.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 | 0.5 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
| 0.2 | 0.3 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.2 | 0.3 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.2 | 0.3 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.2 | 0.6 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 1.2 | GO:0042148 | strand invasion(GO:0042148) |
| 0.2 | 0.3 | GO:0060437 | lung growth(GO:0060437) |
| 0.2 | 0.5 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.2 | 2.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.2 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.2 | 0.5 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.2 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.2 | 0.6 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.2 | 0.9 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.2 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.9 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.1 | 1.0 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.1 | 0.3 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 | 0.6 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.6 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 1.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.6 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.1 | 1.0 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 1.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.3 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 0.3 | GO:0090494 | catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.1 | 0.1 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 0.6 | GO:0090282 | positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 0.1 | 0.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 2.6 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 2.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.6 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 1.4 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.4 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.7 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) positive regulation of catagen(GO:0051795) |
| 0.1 | 0.6 | GO:0010756 | regulation of plasminogen activation(GO:0010755) positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.8 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 | 0.1 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
| 0.1 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.7 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.1 | 0.5 | GO:1902224 | cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.1 | 0.5 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 1.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 4.0 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 | 0.5 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 | 0.5 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 | 0.8 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.1 | 0.7 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.3 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 0.4 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 1.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.5 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.8 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 1.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 1.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.1 | 0.7 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.1 | 0.4 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.1 | 0.5 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
| 0.1 | 2.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.4 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.5 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.1 | 0.4 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) regulation of vascular wound healing(GO:0061043) |
| 0.1 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) |
| 0.1 | 0.9 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 | 1.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 1.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.1 | 0.3 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 0.5 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.5 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.1 | 0.3 | GO:0000578 | embryonic axis specification(GO:0000578) |
| 0.1 | 0.1 | GO:0060003 | copper ion export(GO:0060003) |
| 0.1 | 0.4 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.1 | 1.0 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 0.5 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 1.8 | GO:0032438 | melanosome organization(GO:0032438) |
| 0.1 | 0.6 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 3.9 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.1 | 0.7 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
| 0.1 | 1.6 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.6 | GO:0010991 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 0.5 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 1.8 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.5 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.1 | 0.4 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 | 0.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 1.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 | 4.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.2 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.1 | 1.5 | GO:0001765 | membrane raft assembly(GO:0001765) |
| 0.1 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 0.2 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.1 | 0.4 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
| 0.1 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.9 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 0.5 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 2.7 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 | 1.2 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.5 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.1 | 1.7 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.1 | 0.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 0.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.6 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 0.1 | 0.9 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 1.5 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.5 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 1.0 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
| 0.1 | 1.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.1 | 0.5 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.1 | 0.5 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.5 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.1 | 0.8 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.7 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.5 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 0.7 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.6 | GO:0032274 | gonadotropin secretion(GO:0032274) |
| 0.1 | 0.9 | GO:0002544 | chronic inflammatory response(GO:0002544) |
| 0.1 | 0.3 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 | 0.4 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 | 0.3 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
| 0.1 | 0.4 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 | 0.4 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.9 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.3 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 1.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.9 | GO:1905216 | positive regulation of RNA binding(GO:1905216) |
| 0.1 | 0.3 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.3 | GO:0021586 | pons maturation(GO:0021586) |
| 0.1 | 1.0 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.5 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 1.0 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.7 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.5 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 1.0 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.1 | 1.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.1 | 1.7 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.8 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.5 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.6 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.4 | GO:0035553 | oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 1.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.1 | 0.6 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 0.4 | GO:0010922 | positive regulation of phosphatase activity(GO:0010922) |
| 0.1 | 1.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.1 | 0.9 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.6 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 | 0.2 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.1 | 0.3 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 | 0.7 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 1.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 | 0.3 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.1 | 0.2 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.4 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.4 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.5 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 0.4 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.2 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 1.3 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.1 | 0.1 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.1 | 0.8 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 | 0.8 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.9 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.1 | 2.3 | GO:0002526 | acute inflammatory response(GO:0002526) |
| 0.1 | 0.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.6 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.1 | 0.3 | GO:0006767 | water-soluble vitamin metabolic process(GO:0006767) |
| 0.1 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.1 | 0.7 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.8 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 4.8 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.3 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 | 1.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.4 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.1 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.1 | 0.6 | GO:0046348 | N-acetylneuraminate catabolic process(GO:0019262) amino sugar catabolic process(GO:0046348) |
| 0.1 | 0.4 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.1 | 0.4 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 0.1 | 0.6 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.1 | 1.3 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.6 | GO:0002931 | response to ischemia(GO:0002931) |
| 0.1 | 0.4 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.7 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 0.4 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.1 | 0.6 | GO:1902624 | positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) positive regulation of neutrophil migration(GO:1902624) |
| 0.1 | 0.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 0.3 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.1 | 0.5 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.1 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 | 0.3 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.1 | 0.9 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.1 | 1.1 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 1.4 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.1 | 0.3 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.3 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.4 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 1.6 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.1 | 0.2 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.2 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.1 | 1.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.5 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.8 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 | 0.7 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 2.1 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 | 0.7 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.4 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.2 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.1 | 0.2 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 0.7 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.8 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.1 | 0.1 | GO:2000192 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) negative regulation of fatty acid transport(GO:2000192) |
| 0.1 | 0.2 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.4 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 | 0.4 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
| 0.1 | 0.2 | GO:0071372 | response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 1.2 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 0.5 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.1 | 0.5 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.1 | 0.7 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.5 | GO:1904714 | chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 1.7 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.1 | 0.9 | GO:0010954 | positive regulation of protein processing(GO:0010954) |
| 0.1 | 0.4 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 1.2 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 | 2.1 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.1 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.2 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.1 | 0.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 1.0 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.1 | 0.6 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 1.0 | GO:0010574 | vascular endothelial growth factor production(GO:0010573) regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.1 | 0.2 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
| 0.1 | 1.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.4 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.6 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.1 | 0.7 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 | 2.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 1.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.5 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 | 0.2 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
| 0.1 | 1.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.4 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.1 | 0.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 0.4 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 0.1 | GO:0072044 | collecting duct development(GO:0072044) |
| 0.1 | 0.9 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.1 | 0.5 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.3 | GO:1990743 | protein sialylation(GO:1990743) |
| 0.1 | 0.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 0.4 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.3 | GO:1903867 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.1 | 0.3 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.1 | 0.5 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.1 | 0.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 0.5 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.5 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.1 | 1.8 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 | 0.9 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
| 0.1 | 0.3 | GO:0000423 | macromitophagy(GO:0000423) response to mitochondrial depolarisation(GO:0098780) |
| 0.1 | 0.5 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.3 | GO:0070120 | brainstem development(GO:0003360) ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.1 | 0.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.8 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.1 | 0.7 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.1 | 0.6 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 | 0.2 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.1 | 0.3 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.1 | 1.0 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.3 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.7 | GO:0002690 | positive regulation of leukocyte chemotaxis(GO:0002690) |
| 0.1 | 0.6 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.1 | 0.3 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.6 | GO:0014823 | response to activity(GO:0014823) |
| 0.1 | 0.3 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 | 0.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.9 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.1 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 0.2 | GO:0090063 | regulation of microtubule nucleation(GO:0010968) positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.4 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 0.8 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.1 | 0.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 2.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.1 | 0.5 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
| 0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.2 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.1 | 0.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.1 | 0.4 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 | 0.2 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.1 | 1.2 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.1 | 0.3 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) histone H3-S10 phosphorylation(GO:0043987) |
| 0.1 | 1.2 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.1 | 0.5 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.2 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.1 | 0.3 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
| 0.1 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 1.1 | GO:0007006 | mitochondrial membrane organization(GO:0007006) |
| 0.1 | 0.3 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
| 0.1 | 1.1 | GO:0019915 | lipid storage(GO:0019915) |
| 0.1 | 0.2 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.1 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.4 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.5 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.4 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 2.1 | GO:0015992 | proton transport(GO:0015992) |
| 0.1 | 0.3 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.6 | GO:1904407 | positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.1 | 0.9 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.1 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 | 0.1 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.1 | 0.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.6 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.9 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 | 0.3 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.7 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.1 | 1.3 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.1 | 0.2 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.1 | 0.6 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.1 | 0.6 | GO:0001553 | luteinization(GO:0001553) |
| 0.1 | 0.5 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.1 | 0.2 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 0.1 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
| 0.1 | 3.5 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.1 | 0.7 | GO:0061037 | negative regulation of cartilage development(GO:0061037) |
| 0.1 | 0.3 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 1.5 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) formin-nucleated actin cable assembly(GO:0070649) |
| 0.0 | 0.1 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.8 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.3 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.0 | 0.2 | GO:0030431 | sleep(GO:0030431) |
| 0.0 | 0.5 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.0 | 0.5 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 1.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.9 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.2 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 1.8 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.0 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.4 | GO:0002227 | innate immune response in mucosa(GO:0002227) organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 | 1.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.4 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.2 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 | 0.6 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 1.2 | GO:0061035 | regulation of cartilage development(GO:0061035) |
| 0.0 | 0.2 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.8 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.3 | GO:2000650 | negative regulation of sodium ion transmembrane transport(GO:1902306) negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.0 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.5 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.0 | 0.2 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.0 | 0.6 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.0 | 1.0 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.3 | GO:0097286 | iron ion import(GO:0097286) |
| 0.0 | 0.4 | GO:0072010 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 | 0.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 2.6 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.4 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.5 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.0 | 1.1 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.4 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 | 0.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 1.1 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 1.4 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.5 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.9 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 | 0.6 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.6 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.1 | GO:0002063 | chondrocyte development(GO:0002063) |
| 0.0 | 0.8 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 1.1 | GO:0051145 | smooth muscle cell differentiation(GO:0051145) |
| 0.0 | 0.3 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.1 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.4 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.0 | 0.5 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.2 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 2.2 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
| 0.0 | 0.1 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
| 0.0 | 0.2 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.4 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.2 | GO:1902231 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.5 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.2 | GO:0031295 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 | 0.1 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
| 0.0 | 0.3 | GO:0021924 | cell proliferation in hindbrain(GO:0021534) cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.5 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.8 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.4 | GO:0019229 | regulation of vasoconstriction(GO:0019229) |
| 0.0 | 0.7 | GO:0051881 | regulation of mitochondrial membrane potential(GO:0051881) |
| 0.0 | 0.2 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 | 0.4 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 0.2 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.2 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.4 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.3 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 1.1 | GO:0051453 | regulation of intracellular pH(GO:0051453) |
| 0.0 | 0.3 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:1902592 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.0 | 1.0 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.2 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.0 | 0.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.2 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.0 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.3 | GO:0098969 | neurotransmitter receptor transport to plasma membrane(GO:0098877) neurotransmitter receptor transport to postsynaptic membrane(GO:0098969) establishment of protein localization to postsynaptic membrane(GO:1903540) |
| 0.0 | 1.0 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.2 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.0 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.4 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.5 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.0 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.5 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.2 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.3 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.2 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.5 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.0 | 0.3 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.0 | 0.3 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) |
| 0.0 | 0.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.0 | 0.3 | GO:0051926 | negative regulation of calcium ion transport(GO:0051926) |
| 0.0 | 0.1 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.8 | GO:0034284 | response to hexose(GO:0009746) response to glucose(GO:0009749) response to monosaccharide(GO:0034284) |
| 0.0 | 0.4 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.3 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.0 | 0.0 | GO:0021852 | pyramidal neuron migration(GO:0021852) |
| 0.0 | 0.2 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.2 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.0 | 0.0 | GO:0021506 | anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
| 0.0 | 0.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.5 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
| 0.0 | 0.3 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.1 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.5 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.1 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.1 | GO:1990090 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
| 0.0 | 0.4 | GO:0006096 | glycolytic process(GO:0006096) ATP generation from ADP(GO:0006757) |
| 0.0 | 0.2 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 0.2 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.3 | GO:0050728 | negative regulation of inflammatory response(GO:0050728) |
| 0.0 | 0.2 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.0 | 0.0 | GO:0090004 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.0 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.0 | 0.7 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:0070344 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) |
| 0.0 | 0.5 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.3 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.2 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
| 0.0 | 0.0 | GO:1902803 | regulation of synaptic vesicle transport(GO:1902803) regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.1 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
| 0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.4 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.0 | 0.2 | GO:0031214 | biomineral tissue development(GO:0031214) |
| 0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.0 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.3 | GO:0032006 | regulation of TOR signaling(GO:0032006) |
| 0.0 | 0.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.2 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.3 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
| 0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.1 | GO:0097006 | regulation of plasma lipoprotein particle levels(GO:0097006) |
| 0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.2 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.1 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 10.0 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 1.1 | 4.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 1.0 | 4.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 1.0 | 5.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.9 | 5.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.8 | 9.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.8 | 3.8 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.7 | 2.2 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.6 | 1.7 | GO:0044299 | C-fiber(GO:0044299) |
| 0.6 | 2.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.5 | 2.6 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.4 | 3.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.4 | 3.5 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.4 | 1.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.4 | 2.7 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.4 | 1.5 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.4 | 1.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.3 | 4.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.3 | 1.0 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
| 0.3 | 1.3 | GO:0031310 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
| 0.3 | 1.6 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.3 | 1.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 1.3 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.3 | 1.2 | GO:0097574 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
| 0.3 | 2.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.3 | 0.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.3 | 1.8 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.3 | 0.9 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.3 | 2.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 2.8 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.3 | 0.9 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.3 | 0.9 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.3 | 1.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.3 | 0.3 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.3 | 9.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.3 | 1.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.3 | 1.8 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.3 | 3.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.3 | 1.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.3 | 2.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.3 | 3.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.2 | 1.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.2 | 18.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.2 | 4.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 2.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.2 | 0.7 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.2 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.2 | 3.4 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 1.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 1.5 | GO:0001740 | Barr body(GO:0001740) |
| 0.2 | 0.6 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 0.6 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.2 | 0.9 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.2 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 1.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.2 | 2.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.2 | 1.8 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.2 | 0.8 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 1.4 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.2 | 1.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.2 | 1.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.2 | 1.5 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 0.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 9.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.2 | 12.3 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.2 | 0.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.2 | 0.6 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.2 | 1.9 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 0.6 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 1.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.2 | 1.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.2 | 3.6 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.2 | 1.6 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.2 | 0.4 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.2 | 0.9 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.2 | 0.9 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.2 | 1.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 2.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.2 | 0.8 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 1.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.2 | 0.5 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.2 | 0.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.2 | 0.5 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.2 | 2.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.2 | 1.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.2 | 1.7 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.2 | 0.9 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 1.7 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.2 | 0.5 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.2 | 1.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.2 | 0.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 0.5 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.2 | 2.4 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.2 | 2.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 6.3 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.1 | 0.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 1.5 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
| 0.1 | 2.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 0.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.9 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.7 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 0.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 1.5 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 1.3 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.1 | 0.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 2.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.6 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 1.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.4 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.1 | 1.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.7 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 1.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.4 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 0.4 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.1 | 0.9 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 1.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 1.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 2.8 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.1 | 0.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 1.5 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.1 | 0.8 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 5.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.3 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 1.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 1.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.9 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.4 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.4 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.5 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 6.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.1 | 0.5 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.9 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.4 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 1.1 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.9 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 6.2 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.9 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 4.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.8 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 5.4 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 0.2 | GO:0005774 | vacuolar membrane(GO:0005774) |
| 0.1 | 1.6 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.1 | 0.7 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.3 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.1 | 1.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 1.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.3 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.1 | 1.5 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.5 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 1.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.7 | GO:0000243 | commitment complex(GO:0000243) |
| 0.1 | 0.7 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 2.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 1.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 4.5 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.1 | 1.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 1.9 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 3.8 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 2.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 1.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.1 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
| 0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.6 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 1.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.4 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 1.0 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.3 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.1 | 0.9 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.8 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.2 | GO:0043235 | receptor complex(GO:0043235) |
| 0.1 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.4 | GO:0042599 | lamellar body(GO:0042599) |
| 0.1 | 2.0 | GO:0031970 | organelle envelope lumen(GO:0031970) |
| 0.1 | 0.8 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
| 0.1 | 1.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 0.9 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.2 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.1 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.2 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.1 | 0.4 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.6 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.1 | 0.4 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 1.1 | GO:0005903 | brush border(GO:0005903) |
| 0.1 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 4.6 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.1 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.5 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 1.3 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.1 | 1.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.7 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 4.7 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.1 | 1.7 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 0.6 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.3 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 2.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.3 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 1.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 1.2 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.1 | 0.8 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 15.2 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 1.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 1.1 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.3 | GO:0030659 | cytoplasmic vesicle membrane(GO:0030659) |
| 0.0 | 1.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:0098830 | presynaptic endosome(GO:0098830) |
| 0.0 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 1.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 8.7 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 1.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 1.4 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 1.2 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 2.2 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.2 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.3 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.0 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.8 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 1.5 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 1.1 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 10.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 1.0 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 9.7 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 4.1 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.7 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 3.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.1 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 1.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 1.1 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.6 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 24.3 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 1.2 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.1 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.4 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 2.3 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.0 | 1.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 3.2 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.2 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 1.2 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.9 | GO:0030141 | secretory granule(GO:0030141) |
| 0.0 | 0.1 | GO:0031252 | cell leading edge(GO:0031252) |
| 0.0 | 0.2 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.1 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.0 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.7 | GO:0031982 | vesicle(GO:0031982) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.5 | 10.0 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 1.1 | 6.5 | GO:0019864 | immunoglobulin receptor activity(GO:0019763) IgG binding(GO:0019864) |
| 1.1 | 3.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.9 | 2.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.8 | 4.2 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
| 0.8 | 3.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.8 | 4.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.7 | 2.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.7 | 3.6 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.7 | 8.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.7 | 0.7 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.6 | 1.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.6 | 1.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.6 | 1.9 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.6 | 1.8 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
| 0.6 | 2.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.5 | 2.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.5 | 1.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.5 | 1.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.4 | 3.1 | GO:0016918 | retinal binding(GO:0016918) |
| 0.4 | 1.7 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.4 | 1.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.4 | 2.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.4 | 1.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.4 | 1.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.4 | 0.4 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.4 | 1.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 1.9 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.4 | 1.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.4 | 1.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.4 | 1.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.4 | 1.5 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) |
| 0.4 | 3.7 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.4 | 1.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.4 | 1.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.4 | 2.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.3 | 1.0 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.3 | 5.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.3 | 2.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.3 | 1.0 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 0.3 | 1.6 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.3 | 7.4 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.3 | 1.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.3 | 2.5 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.3 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.3 | 0.9 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.3 | 1.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.3 | 1.9 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.3 | 0.9 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.3 | 2.2 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.3 | 0.3 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.3 | 3.6 | GO:0031386 | protein tag(GO:0031386) |
| 0.3 | 1.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.3 | 0.9 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.3 | 1.8 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.3 | 1.2 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.3 | 3.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.3 | 2.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 1.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.3 | 0.9 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.3 | 1.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.3 | 0.8 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.3 | 0.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 1.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.3 | 1.6 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.3 | 0.8 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.3 | 0.8 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.3 | 0.8 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.3 | 1.9 | GO:0005047 | signal recognition particle binding(GO:0005047) 7S RNA binding(GO:0008312) |
| 0.3 | 1.3 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.3 | 1.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.3 | 0.8 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.3 | 4.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.3 | 0.8 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.3 | 0.5 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 0.7 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.2 | 0.7 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.2 | 2.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 1.7 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.2 | 1.5 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.2 | 0.7 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.2 | 2.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 1.7 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.2 | 0.7 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.2 | 0.7 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 1.9 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.2 | 0.7 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.2 | 1.4 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.2 | 2.5 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 1.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 0.5 | GO:0070905 | serine binding(GO:0070905) |
| 0.2 | 1.6 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 0.9 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 0.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.2 | 0.7 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.2 | 1.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.2 | 2.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 0.7 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
| 0.2 | 11.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.2 | 1.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.2 | 2.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.2 | 0.9 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.2 | 0.6 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.2 | 1.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 1.5 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.2 | 1.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.2 | 0.8 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 2.7 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 3.6 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 0.6 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.2 | 1.5 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.2 | 0.6 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.2 | 1.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 2.4 | GO:0048038 | quinone binding(GO:0048038) |
| 0.2 | 0.4 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.2 | 1.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.2 | 0.8 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.2 | 1.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.2 | 0.6 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.2 | 1.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 0.4 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
| 0.2 | 2.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 0.6 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
| 0.2 | 0.8 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.2 | 0.6 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.2 | 0.8 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.2 | 0.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 1.9 | GO:0008556 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.2 | 0.9 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.2 | 0.4 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.2 | 3.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.2 | 0.7 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.2 | 2.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.2 | 30.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.2 | 1.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.2 | 1.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.2 | 1.2 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 3.9 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 1.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 0.5 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.2 | 1.0 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.2 | 0.5 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.2 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.2 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 1.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.2 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 3.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 2.5 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.2 | 0.5 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.2 | 1.1 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.2 | 0.7 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.2 | 0.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.2 | 0.6 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.2 | 1.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.2 | 0.5 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
| 0.2 | 0.5 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.2 | 0.8 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 0.5 | GO:0019779 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
| 0.2 | 1.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.2 | 0.5 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.2 | 1.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 0.6 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.2 | 1.7 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.2 | 0.6 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 1.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 4.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.2 | 1.1 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.6 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
| 0.1 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 0.7 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.7 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 1.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 1.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.1 | 0.6 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.7 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 1.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.7 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 2.0 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 0.4 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.1 | 0.9 | GO:1990430 | G-protein coupled GABA receptor activity(GO:0004965) extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.3 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 2.0 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 0.7 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.1 | 0.7 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
| 0.1 | 0.4 | GO:0042806 | fucose binding(GO:0042806) |
| 0.1 | 1.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.1 | 1.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 1.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.6 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 1.7 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 1.8 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 1.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 1.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 2.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 1.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.5 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 0.5 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.7 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 4.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 1.0 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.4 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.1 | 0.4 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 2.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 1.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.5 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.6 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.1 | 0.1 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 0.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 4.2 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.7 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 2.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 1.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.5 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 1.0 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.1 | 0.5 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 0.4 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 1.3 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.5 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.7 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 1.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 0.5 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 4.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 2.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.8 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.5 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.2 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.1 | 0.3 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.1 | 0.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 0.2 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.1 | 0.4 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
| 0.1 | 2.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 5.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.3 | GO:0070061 | fructose binding(GO:0070061) |
| 0.1 | 1.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.0 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 1.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 1.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.3 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.1 | 4.1 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.1 | 0.6 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.6 | GO:0015250 | water channel activity(GO:0015250) |
| 0.1 | 1.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.3 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.1 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 1.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.4 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 1.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 1.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.8 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 2.7 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 1.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.5 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.7 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.4 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 2.0 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.1 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 0.3 | GO:0004980 | melanocortin receptor activity(GO:0004977) melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.9 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 0.4 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.1 | 0.4 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.1 | 3.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.5 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.1 | 0.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.7 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.3 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.1 | 0.3 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 1.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 1.1 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 0.4 | GO:0004954 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) prostaglandin receptor activity(GO:0004955) |
| 0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.7 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 1.2 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 1.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.7 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.1 | 0.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 0.6 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 0.9 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 1.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.5 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.1 | 6.4 | GO:0008201 | heparin binding(GO:0008201) |
| 0.1 | 0.5 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 3.7 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.1 | 0.7 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 1.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.8 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 1.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 1.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.5 | GO:0048029 | monosaccharide binding(GO:0048029) |
| 0.1 | 1.0 | GO:0031078 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.8 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.1 | 0.7 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.9 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 4.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.1 | 2.2 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 1.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.9 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.1 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.7 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 0.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.3 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.1 | 0.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 1.5 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 2.2 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 1.3 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 2.2 | GO:0005518 | collagen binding(GO:0005518) |
| 0.1 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.1 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.3 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 0.3 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.1 | 0.2 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.1 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 2.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.5 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.2 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 1.1 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.1 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 1.0 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 1.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.1 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.4 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.1 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 2.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 1.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.2 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 3.4 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.5 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.1 | GO:0030620 | second spliceosomal transesterification activity(GO:0000386) U2 snRNA binding(GO:0030620) |
| 0.0 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.9 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 3.5 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.3 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.0 | 1.4 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.6 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 4.0 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 1.1 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
| 0.0 | 0.9 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.3 | GO:0032554 | deoxyribonucleotide binding(GO:0032552) purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.4 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.8 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.8 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 1.6 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 0.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 1.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 1.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.5 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.8 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 1.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.0 | 0.5 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.6 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.7 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.2 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 1.3 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.3 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 1.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.3 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.0 | 0.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.9 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.4 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.7 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 2.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 2.2 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 0.3 | GO:0002020 | protease binding(GO:0002020) |
| 0.0 | 1.0 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 2.2 | GO:0019903 | protein phosphatase binding(GO:0019903) |
| 0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.4 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.3 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.5 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.4 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 1.3 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.5 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.7 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.2 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.3 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 6.7 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.8 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
| 0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.3 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.6 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.2 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.2 | GO:0015197 | peptide transporter activity(GO:0015197) |
| 0.0 | 0.2 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.6 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.2 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.0 | 0.0 | GO:0070699 | activin receptor binding(GO:0070697) type II activin receptor binding(GO:0070699) |
| 0.0 | 0.0 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 0.0 | 0.4 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.2 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.6 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.3 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.3 | GO:0017069 | snRNA binding(GO:0017069) |
| 0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.3 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.1 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.0 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.0 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 4.2 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.3 | 10.7 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.3 | 8.3 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.2 | 1.6 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.2 | 3.0 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.2 | 2.5 | PID_S1P_S1P2_PATHWAY | S1P2 pathway |
| 0.2 | 6.1 | PID_ALK1_PATHWAY | ALK1 signaling events |
| 0.2 | 3.4 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.2 | 1.3 | PID_S1P_META_PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.2 | 2.2 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
| 0.2 | 1.9 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 4.6 | PID_INTEGRIN3_PATHWAY | Beta3 integrin cell surface interactions |
| 0.2 | 3.5 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
| 0.1 | 0.4 | SA_FAS_SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 6.0 | PID_INTEGRIN_A4B1_PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 1.1 | PID_IL5_PATHWAY | IL5-mediated signaling events |
| 0.1 | 2.2 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 4.8 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 9.2 | PID_HIF1_TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 6.2 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 4.7 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
| 0.1 | 1.6 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.1 | 14.2 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 2.3 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.0 | SA_TRKA_RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 0.4 | PID_CXCR3_PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 2.1 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.2 | PID_IL3_PATHWAY | IL3-mediated signaling events |
| 0.1 | 1.4 | PID_IL2_PI3K_PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 1.4 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 11.0 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 0.2 | PID_AR_NONGENOMIC_PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.9 | ST_GRANULE_CELL_SURVIVAL_PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 2.2 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 1.6 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 1.5 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.1 | 0.6 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.2 | PID_RET_PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 2.5 | PID_ENDOTHELIN_PATHWAY | Endothelins |
| 0.1 | 1.5 | ST_GA12_PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.9 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.1 | 0.3 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.1 | 3.9 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 0.5 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 1.6 | PID_NFAT_3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 2.5 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 5.7 | PID_PDGFRB_PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 1.4 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.6 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 3.1 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 0.5 | PID_NEPHRIN_NEPH1_PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 3.1 | PID_LKB1_PATHWAY | LKB1 signaling events |
| 0.1 | 1.1 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.6 | SIG_PIP3_SIGNALING_IN_B_LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 1.8 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.1 | 0.8 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
| 0.1 | 0.3 | SA_CASPASE_CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 2.5 | PID_AR_TF_PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 6.2 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 0.3 | PID_PTP1B_PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 0.8 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 2.3 | PID_P53_REGULATION_PATHWAY | p53 pathway |
| 0.0 | 0.8 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.5 | PID_FGF_PATHWAY | FGF signaling pathway |
| 0.0 | 0.9 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.4 | PID_IL23_PATHWAY | IL23-mediated signaling events |
| 0.0 | 1.0 | PID_MTOR_4PATHWAY | mTOR signaling pathway |
| 0.0 | 1.9 | PID_P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.3 | PID_IFNG_PATHWAY | IFN-gamma pathway |
| 0.0 | 0.6 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.7 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.2 | PID_EPO_PATHWAY | EPO signaling pathway |
| 0.0 | 0.2 | PID_HIV_NEF_PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 2.0 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.4 | PID_FOXO_PATHWAY | FoxO family signaling |
| 0.0 | 0.4 | ST_FAS_SIGNALING_PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.7 | PID_ECADHERIN_NASCENT_AJ_PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.6 | PID_TNF_PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.2 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.0 | PID_TRKR_PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.4 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.5 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 4.5 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.4 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.2 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.1 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.6 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.0 | 0.7 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.4 | SIG_PIP3_SIGNALING_IN_CARDIAC_MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 1.2 | PID_P53_DOWNSTREAM_PATHWAY | Direct p53 effectors |
| 0.0 | 0.7 | PID_SMAD2_3NUCLEAR_PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.4 | PID_LYSOPHOSPHOLIPID_PATHWAY | LPA receptor mediated events |
| 0.0 | 0.3 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.2 | PID_REELIN_PATHWAY | Reelin signaling pathway |
| 0.0 | 0.2 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.4 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.4 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.1 | PID_MET_PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.3 | PID_ERBB1_DOWNSTREAM_PATHWAY | ErbB1 downstream signaling |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 8.3 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
| 0.6 | 1.1 | REACTOME_PD1_SIGNALING | Genes involved in PD-1 signaling |
| 0.5 | 8.6 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.5 | 4.2 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.4 | 4.5 | REACTOME_PLATELET_ADHESION_TO_EXPOSED_COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.3 | 2.0 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
| 0.3 | 3.7 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 0.3 | 2.0 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.3 | 0.7 | REACTOME_FORMATION_OF_TRANSCRIPTION_COUPLED_NER_TC_NER_REPAIR_COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.3 | 4.4 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 0.9 | REACTOME_EICOSANOID_LIGAND_BINDING_RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.3 | 0.9 | REACTOME_ENDOSOMAL_VACUOLAR_PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 1.2 | REACTOME_REGULATION_OF_COMPLEMENT_CASCADE | Genes involved in Regulation of Complement cascade |
| 0.3 | 2.3 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.3 | 2.0 | REACTOME_GAMMA_CARBOXYLATION_TRANSPORT_AND_AMINO_TERMINAL_CLEAVAGE_OF_PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.3 | 0.3 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 1.7 | REACTOME_THE_NLRP3_INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.2 | 24.6 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.2 | 3.7 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
| 0.2 | 6.9 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.2 | 4.7 | REACTOME_INSULIN_RECEPTOR_RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 0.2 | REACTOME_CD28_DEPENDENT_PI3K_AKT_SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.2 | 5.3 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 1.4 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.2 | 1.6 | REACTOME_INHIBITION_OF_INSULIN_SECRETION_BY_ADRENALINE_NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.2 | 0.4 | REACTOME_REGULATION_OF_AMPK_ACTIVITY_VIA_LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.2 | 15.6 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.2 | 4.3 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.2 | 3.0 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.2 | 1.7 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.2 | 1.6 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.2 | 4.1 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 0.7 | REACTOME_SIGNALING_BY_ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.2 | 3.0 | REACTOME_ACTIVATION_OF_THE_AP1_FAMILY_OF_TRANSCRIPTION_FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.2 | 5.1 | REACTOME_SRP_DEPENDENT_COTRANSLATIONAL_PROTEIN_TARGETING_TO_MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.2 | 2.2 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.2 | 1.8 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
| 0.2 | 1.5 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 1.7 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 2.8 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 2.3 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 3.8 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 1.3 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 0.7 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 1.0 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 2.8 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 1.1 | REACTOME_SIGNALING_BY_NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 2.8 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.3 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 2.3 | REACTOME_KERATAN_SULFATE_KERATIN_METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.1 | 6.5 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.6 | REACTOME_P53_INDEPENDENT_G1_S_DNA_DAMAGE_CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.1 | 1.5 | REACTOME_RIP_MEDIATED_NFKB_ACTIVATION_VIA_DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 2.4 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 7.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.1 | 0.4 | REACTOME_PLATELET_CALCIUM_HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 2.4 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 7.6 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_GLUCAGON_LIKE_PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 5.5 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 0.7 | REACTOME_ER_PHAGOSOME_PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 8.2 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 0.2 | REACTOME_CDK_MEDIATED_PHOSPHORYLATION_AND_REMOVAL_OF_CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.1 | 0.4 | REACTOME_CYCLIN_E_ASSOCIATED_EVENTS_DURING_G1_S_TRANSITION_ | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 1.1 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.1 | 5.8 | REACTOME_VIF_MEDIATED_DEGRADATION_OF_APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 1.5 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.6 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.7 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 3.1 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 1.4 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.7 | REACTOME_VIRAL_MESSENGER_RNA_SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 1.1 | REACTOME_SIGNAL_REGULATORY_PROTEIN_SIRP_FAMILY_INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 2.3 | REACTOME_ERK_MAPK_TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 1.6 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 1.5 | REACTOME_AKT_PHOSPHORYLATES_TARGETS_IN_THE_CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.1 | 0.5 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.1 | 0.4 | REACTOME_ABORTIVE_ELONGATION_OF_HIV1_TRANSCRIPT_IN_THE_ABSENCE_OF_TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.0 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 2.4 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 1.1 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 0.4 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 0.7 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 2.5 | REACTOME_SYNTHESIS_OF_PA | Genes involved in Synthesis of PA |
| 0.1 | 1.2 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 0.1 | 0.6 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.4 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 4.0 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.0 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 0.7 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 0.5 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 1.9 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.6 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.8 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 3.6 | REACTOME_TRANSLATION | Genes involved in Translation |
| 0.1 | 1.6 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 0.7 | REACTOME_SLBP_DEPENDENT_PROCESSING_OF_REPLICATION_DEPENDENT_HISTONE_PRE_MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 1.5 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 1.7 | REACTOME_PHASE_II_CONJUGATION | Genes involved in Phase II conjugation |
| 0.1 | 2.1 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.8 | REACTOME_IRON_UPTAKE_AND_TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 1.0 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 1.5 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.0 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 0.8 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.3 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.6 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.7 | REACTOME_GLUCOSE_TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.1 | REACTOME_FGFR_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.1 | 0.3 | REACTOME_SPRY_REGULATION_OF_FGF_SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 0.5 | REACTOME_IKK_COMPLEX_RECRUITMENT_MEDIATED_BY_RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.1 | 1.3 | REACTOME_BIOLOGICAL_OXIDATIONS | Genes involved in Biological oxidations |
| 0.1 | 0.7 | REACTOME_GENERIC_TRANSCRIPTION_PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.1 | 4.6 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
| 0.1 | 0.3 | REACTOME_CIRCADIAN_CLOCK | Genes involved in Circadian Clock |
| 0.1 | 2.5 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 0.5 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.7 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.1 | REACTOME_RESOLUTION_OF_AP_SITES_VIA_THE_MULTIPLE_NUCLEOTIDE_PATCH_REPLACEMENT_PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 1.2 | REACTOME_CYTOSOLIC_TRNA_AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 1.0 | REACTOME_INHIBITION_OF_THE_PROTEOLYTIC_ACTIVITY_OF_APC_C_REQUIRED_FOR_THE_ONSET_OF_ANAPHASE_BY_MITOTIC_SPINDLE_CHECKPOINT_COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.0 | 1.1 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.7 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.2 | REACTOME_PROCESSIVE_SYNTHESIS_ON_THE_LAGGING_STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.0 | 0.7 | REACTOME_RNA_POL_III_CHAIN_ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.1 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 1.6 | REACTOME_MEIOTIC_SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 1.3 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.6 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.0 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME_PROTEOLYTIC_CLEAVAGE_OF_SNARE_COMPLEX_PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.8 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.3 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
| 0.0 | 0.2 | REACTOME_ANTIGEN_PROCESSING_CROSS_PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 2.8 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.8 | REACTOME_RAS_ACTIVATION_UOPN_CA2_INFUX_THROUGH_NMDA_RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.7 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.5 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.6 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.5 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.6 | REACTOME_NUCLEAR_SIGNALING_BY_ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.3 | REACTOME_IL_3_5_AND_GM_CSF_SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.3 | REACTOME_EXTRACELLULAR_MATRIX_ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.6 | REACTOME_FANCONI_ANEMIA_PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.5 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.3 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.3 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.3 | REACTOME_RIG_I_MDA5_MEDIATED_INDUCTION_OF_IFN_ALPHA_BETA_PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.0 | 0.6 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.3 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_ACTIVATES_SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.6 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.3 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 4.5 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.4 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.3 | REACTOME_N_GLYCAN_ANTENNAE_ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.2 | REACTOME_GENERATION_OF_SECOND_MESSENGER_MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.3 | REACTOME_PURINE_SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.3 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 1.2 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.5 | REACTOME_ACTIVATED_AMPK_STIMULATES_FATTY_ACID_OXIDATION_IN_MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.2 | REACTOME_EARLY_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.3 | REACTOME_NGF_SIGNALLING_VIA_TRKA_FROM_THE_PLASMA_MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.0 | 0.2 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.4 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 1.0 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.2 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.5 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.4 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.5 | REACTOME_ASSOCIATION_OF_TRIC_CCT_WITH_TARGET_PROTEINS_DURING_BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.2 | REACTOME_GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.3 | REACTOME_NEGATIVE_REGULATORS_OF_RIG_I_MDA5_SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.1 | REACTOME_NUCLEOTIDE_LIKE_PURINERGIC_RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
