Motif ID: Smad4
Z-value: 1.117
![logo of Smad4](../logos/Smad4.png)
Transcription factors associated with Smad4:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Smad4 | ENSMUSG00000024515.7 | Smad4 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Smad4 | mm10_v2_chr18_-_73703739_73703806 | 0.29 | 7.1e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.1 | 9.4 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
1.8 | 7.1 | GO:0015889 | cobalamin transport(GO:0015889) |
1.7 | 5.1 | GO:0060023 | soft palate development(GO:0060023) |
1.5 | 4.5 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
1.1 | 5.4 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.9 | 4.6 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
0.8 | 3.9 | GO:0019230 | proprioception(GO:0019230) |
0.8 | 3.8 | GO:0021764 | amygdala development(GO:0021764) |
0.7 | 2.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.7 | 3.3 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
0.6 | 2.5 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.6 | 11.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.6 | 1.7 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
0.5 | 11.5 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.5 | 2.4 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.5 | 1.9 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.5 | 1.4 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.4 | 2.4 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.4 | 9.5 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.4 | 5.6 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.4 | 1.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.4 | 0.7 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.3 | 1.0 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.3 | 3.1 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.3 | 1.6 | GO:0002339 | B cell selection(GO:0002339) |
0.3 | 2.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.3 | 1.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.3 | 1.9 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.3 | 0.8 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
0.3 | 1.5 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.2 | 2.2 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.2 | 1.0 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
0.2 | 1.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.2 | 1.7 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.2 | 1.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.2 | 1.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.2 | 1.0 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.2 | 1.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.2 | 0.4 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.2 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.2 | 0.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 2.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.2 | 1.0 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 0.3 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.7 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 2.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.1 | 1.7 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.1 | 1.3 | GO:0072189 | ureter development(GO:0072189) |
0.1 | 1.4 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
0.1 | 0.8 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.1 | 1.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 2.2 | GO:0031295 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
0.1 | 0.6 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 2.1 | GO:0001945 | lymph vessel development(GO:0001945) |
0.1 | 0.6 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.8 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 1.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 3.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.1 | 2.4 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.1 | 0.6 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 0.4 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 3.9 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.1 | 2.6 | GO:1901998 | toxin transport(GO:1901998) |
0.1 | 0.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 1.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 1.1 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 4.7 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.6 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.5 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.8 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.1 | GO:0071674 | mononuclear cell migration(GO:0071674) |
0.0 | 0.7 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 1.3 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.8 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.0 | 3.4 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.8 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.0 | 0.5 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.7 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.2 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
0.0 | 1.8 | GO:0006342 | chromatin silencing(GO:0006342) |
0.0 | 0.9 | GO:0070507 | regulation of microtubule cytoskeleton organization(GO:0070507) |
0.0 | 0.5 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 1.5 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 1.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
0.0 | 1.0 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.0 | 0.8 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.9 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 1.4 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 1.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 1.9 | GO:0007219 | Notch signaling pathway(GO:0007219) |
0.0 | 0.7 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 1.9 | GO:0043062 | extracellular matrix organization(GO:0030198) extracellular structure organization(GO:0043062) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.8 | 11.5 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
3.2 | 9.5 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
0.7 | 2.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.5 | 5.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.5 | 1.4 | GO:0036128 | CatSper complex(GO:0036128) |
0.2 | 7.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.2 | 0.7 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 1.5 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 1.1 | GO:0035976 | AP1 complex(GO:0035976) |
0.2 | 1.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 3.8 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
0.2 | 0.5 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.1 | 5.4 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 0.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 1.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 2.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.3 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
0.1 | 1.8 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 5.4 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 2.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 1.2 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 1.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 1.6 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 4.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 0.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 1.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 0.2 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.0 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 1.7 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.5 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.7 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.8 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 1.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.8 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.5 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.5 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 1.6 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 10.2 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.6 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 1.0 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 4.8 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.7 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.7 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 9.2 | GO:0050436 | microfibril binding(GO:0050436) |
1.5 | 4.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
1.0 | 7.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.6 | 7.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.6 | 11.5 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.5 | 2.4 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.4 | 1.8 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.4 | 9.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.2 | 1.0 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
0.2 | 2.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.2 | 0.5 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.2 | 4.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.2 | 2.5 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.2 | 2.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 2.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.2 | 3.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 2.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 1.6 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.8 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.8 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.6 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.1 | 0.8 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 3.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.3 | GO:0036004 | GAF domain binding(GO:0036004) |
0.1 | 1.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 4.7 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.7 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.1 | 1.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 1.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.6 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 1.4 | GO:0051861 | glycolipid binding(GO:0051861) |
0.1 | 0.8 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 3.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 2.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 12.3 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 1.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.1 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 1.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 1.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 11.5 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.8 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.6 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 1.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 1.0 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 5.8 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 4.7 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 2.6 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 1.9 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 1.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 1.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 2.4 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 2.2 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 26.0 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 7.1 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
0.1 | 3.5 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.1 | 6.1 | PID_AURORA_B_PATHWAY | Aurora B signaling |
0.1 | 3.3 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 2.2 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 4.4 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 3.0 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.1 | 1.7 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
0.1 | 3.8 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
0.0 | 3.5 | PID_LKB1_PATHWAY | LKB1 signaling events |
0.0 | 2.2 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.5 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
0.0 | 3.1 | ST_FAS_SIGNALING_PATHWAY | Fas Signaling Pathway |
0.0 | 0.5 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
0.0 | 0.8 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
0.0 | 1.1 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 2.1 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 1.5 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.9 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
0.0 | 1.9 | PID_PDGFRB_PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.3 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 1.5 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.4 | PID_ATR_PATHWAY | ATR signaling pathway |
0.0 | 0.7 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 15.3 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.4 | 4.5 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
0.3 | 10.9 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
0.2 | 5.4 | REACTOME_KINESINS | Genes involved in Kinesins |
0.1 | 1.7 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 1.1 | REACTOME_ACTIVATION_OF_THE_AP1_FAMILY_OF_TRANSCRIPTION_FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 2.1 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 0.4 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 4.3 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.1 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.8 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 4.6 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 3.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.0 | 0.9 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 1.0 | REACTOME_DOWNREGULATION_OF_TGF_BETA_RECEPTOR_SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.5 | REACTOME_ADENYLATE_CYCLASE_ACTIVATING_PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.8 | REACTOME_GAP_JUNCTION_DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.5 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 1.4 | REACTOME_MEIOTIC_SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.7 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 3.6 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.4 | REACTOME_SIGNALING_BY_ACTIVATED_POINT_MUTANTS_OF_FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 1.0 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 2.2 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.5 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 2.3 | REACTOME_DNA_REPAIR | Genes involved in DNA Repair |
0.0 | 1.4 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 1.0 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.7 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.8 | REACTOME_CDK_MEDIATED_PHOSPHORYLATION_AND_REMOVAL_OF_CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.0 | 0.9 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.6 | REACTOME_NETRIN1_SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.1 | REACTOME_GAP_JUNCTION_TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 0.2 | REACTOME_AUTODEGRADATION_OF_CDH1_BY_CDH1_APC_C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |