Motif ID: Sox14
Z-value: 1.151
Transcription factors associated with Sox14:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Sox14 | ENSMUSG00000053747.8 | Sox14 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Sox14 | mm10_v2_chr9_-_99876147_99876193 | 0.06 | 7.0e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 9.4 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.0 | 2.9 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.8 | 3.8 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.7 | 2.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.7 | 2.1 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.6 | 16.7 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.6 | 1.8 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.5 | 1.5 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.5 | 2.8 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.3 | 1.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 1.6 | GO:1901526 | negative regulation of mitochondrial membrane permeability(GO:0035795) positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.3 | 1.9 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.3 | 3.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.3 | 1.2 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.3 | 2.3 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.3 | 4.0 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.3 | 1.6 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.3 | 1.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.3 | 2.9 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.2 | 2.9 | GO:1901898 | negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.2 | 0.6 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.2 | 1.5 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.2 | 0.8 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 | 2.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 | 2.0 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.2 | 1.8 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.2 | 1.3 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.2 | 0.8 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.2 | 2.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.2 | 1.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.2 | 1.2 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 | 0.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 1.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 1.1 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.2 | 0.5 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.2 | 1.4 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 | 1.4 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 | 0.8 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.4 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.1 | 0.5 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 | 0.5 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.8 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.6 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 2.9 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.5 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 1.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 1.1 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.5 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.2 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 0.9 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.4 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.1 | 0.5 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 2.3 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 0.3 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 0.8 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.5 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 | 4.0 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 1.0 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.1 | 0.7 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 1.4 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.1 | 0.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.1 | 0.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 | 0.2 | GO:1904154 | trimming of terminal mannose on B branch(GO:0036509) positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.3 | GO:0050912 | detection of chemical stimulus involved in sensory perception(GO:0050907) detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.3 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 2.2 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
| 0.0 | 0.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.3 | GO:0061092 | involuntary skeletal muscle contraction(GO:0003011) regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.9 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 1.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 3.1 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
| 0.0 | 2.1 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.5 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.5 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 1.4 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 7.0 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.0 | 0.1 | GO:1902022 | L-lysine transport(GO:1902022) |
| 0.0 | 1.6 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 0.5 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 1.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.5 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 2.1 | GO:0070613 | regulation of protein processing(GO:0070613) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.7 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.7 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.0 | 1.8 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.2 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.3 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.0 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.0 | 0.4 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 1.2 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 | 0.9 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.2 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 2.5 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.6 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 2.3 | GO:0048675 | axon extension(GO:0048675) |
| 0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.8 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 | 0.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.2 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.2 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.9 | GO:0043113 | receptor clustering(GO:0043113) |
| 0.0 | 2.1 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 1.7 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
| 0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.5 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.2 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.3 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.6 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
| 0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.1 | GO:0008623 | CHRAC(GO:0008623) |
| 0.4 | 1.8 | GO:0090537 | CERF complex(GO:0090537) |
| 0.4 | 2.9 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.3 | 1.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.3 | 1.1 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.2 | 1.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.2 | 2.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.2 | 4.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.4 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
| 0.1 | 0.4 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.1 | 1.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 2.9 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.1 | 3.4 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 1.5 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 4.0 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 1.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.6 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 4.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 3.8 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.6 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 2.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 4.0 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 1.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 4.2 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 5.1 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 1.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.7 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 1.7 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 2.6 | GO:0014069 | postsynaptic density(GO:0014069) |
| 0.0 | 0.5 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 3.7 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 0.0 | 0.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 1.2 | GO:0005874 | microtubule(GO:0005874) |
| 0.0 | 35.6 | GO:0005829 | cytosol(GO:0005829) |
| 0.0 | 0.5 | GO:0097223 | sperm flagellum(GO:0036126) sperm part(GO:0097223) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.4 | 4.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.3 | 1.3 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.3 | 1.6 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.3 | 2.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.3 | 1.3 | GO:0005113 | patched binding(GO:0005113) |
| 0.3 | 0.8 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 1.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 1.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 2.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.2 | 0.8 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.2 | 2.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.2 | 1.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 1.4 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.1 | 0.4 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
| 0.1 | 1.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.4 | GO:0098973 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.1 | 2.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.4 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.1 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 1.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.4 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 1.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 2.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 5.0 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 1.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 2.9 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.3 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 0.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 2.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.5 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 0.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.9 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 2.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 5.3 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.1 | 0.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.4 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 1.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.5 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 2.7 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 2.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.2 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.1 | 1.8 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 0.8 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.8 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.2 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 8.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 3.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
| 0.0 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.6 | GO:0070402 | aldo-keto reductase (NADP) activity(GO:0004033) NADPH binding(GO:0070402) |
| 0.0 | 2.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 1.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.6 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.7 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.5 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 5.0 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.6 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.7 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 1.0 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 2.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 1.3 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 2.9 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.0 | 10.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 1.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.0 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 2.2 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 1.0 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.5 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 3.4 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.4 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.7 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.1 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 4.9 | SA_PTEN_PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 1.2 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 2.4 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.1 | 1.4 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 2.9 | PID_CD40_PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.7 | PID_RETINOIC_ACID_PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 0.5 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 1.3 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 1.6 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.6 | PID_IGF1_PATHWAY | IGF1 pathway |
| 0.0 | 0.7 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.9 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 2.8 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.5 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.4 | SIG_INSULIN_RECEPTOR_PATHWAY_IN_CARDIAC_MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 1.5 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.7 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.5 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.2 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.8 | PID_RHOA_PATHWAY | RhoA signaling pathway |
| 0.0 | 0.6 | PID_CDC42_REG_PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.3 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.5 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.4 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 2.6 | REACTOME_SIGNAL_ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 5.0 | REACTOME_DARPP_32_EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 2.9 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 2.9 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 1.4 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 2.2 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 2.3 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.4 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 1.2 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PC | Genes involved in Acyl chain remodelling of PC |
| 0.1 | 0.9 | REACTOME_GABA_A_RECEPTOR_ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.6 | REACTOME_PRE_NOTCH_TRANSCRIPTION_AND_TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 0.9 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.6 | REACTOME_IRAK1_RECRUITS_IKK_COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 1.6 | REACTOME_GLUCOSE_TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.7 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.6 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.3 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.3 | REACTOME_CLASS_C_3_METABOTROPIC_GLUTAMATE_PHEROMONE_RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.5 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.4 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.2 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.4 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 1.3 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 3.8 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.3 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_PLASMA_MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.6 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.3 | REACTOME_RNA_POL_I_TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.8 | REACTOME_GOLGI_ASSOCIATED_VESICLE_BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.3 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.3 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.3 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.2 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |


