Motif ID: Dmc1
Z-value: 1.097
Transcription factors associated with Dmc1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Dmc1 | ENSMUSG00000022429.10 | Dmc1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Dmc1 | mm10_v2_chr15_-_79605084_79605114 | 0.22 | 2.0e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 3.7 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.9 | 2.7 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 0.5 | 1.6 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.5 | 2.0 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.4 | 2.2 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.4 | 2.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.4 | 1.1 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.3 | 1.0 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.3 | 0.9 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.3 | 0.9 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.3 | 1.2 | GO:0002428 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.3 | 1.1 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 | 1.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.3 | 1.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 | 1.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 | 1.2 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.2 | 1.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.2 | 1.0 | GO:0072683 | T cell extravasation(GO:0072683) |
| 0.2 | 1.6 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.2 | 1.2 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 1.7 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 | 2.0 | GO:0046512 | sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.2 | 0.9 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 3.3 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) |
| 0.2 | 1.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.2 | 0.7 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.5 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.2 | 5.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.1 | 0.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 4.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.5 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.7 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 1.0 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.3 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
| 0.1 | 0.4 | GO:0010248 | B cell negative selection(GO:0002352) response to mycotoxin(GO:0010046) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.7 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 1.6 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.1 | 0.8 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.6 | GO:0000019 | regulation of mitotic recombination(GO:0000019) telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 1.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 2.0 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.1 | 0.5 | GO:2000319 | negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.1 | 0.3 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 | 0.5 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.3 | GO:0032240 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 | 0.7 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.6 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.5 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.1 | 1.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 1.5 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 0.3 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 1.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.8 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.1 | 0.3 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.1 | 0.8 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.3 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 | 1.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.4 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.9 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.1 | 0.3 | GO:0050748 | negative regulation of receptor biosynthetic process(GO:0010871) transforming growth factor-beta secretion(GO:0038044) negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.1 | 0.5 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 | 1.4 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 | 0.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.4 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 0.4 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.2 | GO:1903726 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) negative regulation of phospholipid metabolic process(GO:1903726) |
| 0.1 | 0.5 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.2 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.3 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.7 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.2 | GO:0048389 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) intermediate mesoderm development(GO:0048389) pronephros development(GO:0048793) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) ureter urothelium development(GO:0072190) kidney smooth muscle tissue development(GO:0072194) |
| 0.1 | 0.2 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) thermoception(GO:0050955) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 | 0.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.6 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.6 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.1 | 0.2 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 1.9 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.2 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.1 | 1.4 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.6 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.3 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.0 | 1.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.5 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 1.0 | GO:0097435 | fibril organization(GO:0097435) |
| 0.0 | 0.1 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.0 | 0.4 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.0 | 0.3 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.6 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 6.0 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.0 | 0.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
| 0.0 | 0.5 | GO:0001706 | endoderm formation(GO:0001706) peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.7 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.7 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.2 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.0 | 2.6 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.3 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 1.6 | GO:0031102 | neuron projection regeneration(GO:0031102) |
| 0.0 | 0.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.5 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.5 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.4 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.0 | 0.3 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
| 0.0 | 0.4 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.0 | 2.0 | GO:0007601 | visual perception(GO:0007601) |
| 0.0 | 1.4 | GO:0009063 | cellular amino acid catabolic process(GO:0009063) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.9 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.0 | 0.3 | GO:0006767 | water-soluble vitamin metabolic process(GO:0006767) |
| 0.0 | 0.9 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.0 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.5 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.2 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.0 | 1.0 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.4 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.1 | GO:0051096 | maintenance of DNA repeat elements(GO:0043570) positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.2 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.1 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.4 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.7 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.0 | 0.0 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.4 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.7 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.6 | 1.8 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.4 | 1.1 | GO:0044299 | C-fiber(GO:0044299) |
| 0.3 | 1.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.3 | 1.0 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.3 | 0.8 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 1.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) tertiary granule(GO:0070820) |
| 0.2 | 0.8 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 1.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.5 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 0.7 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 1.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 3.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.6 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 1.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 0.3 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.1 | 1.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.5 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.9 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.4 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.4 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.0 | 1.3 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.7 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.1 | GO:1990075 | kinesin II complex(GO:0016939) periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.5 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 2.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.4 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 1.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 4.7 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.0 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.5 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.3 | GO:0005675 | DNA replication factor A complex(GO:0005662) holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 14.2 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
| 0.0 | 0.4 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.3 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.9 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.5 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 1.7 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.7 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.0 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.7 | 2.7 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.6 | 2.8 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.5 | 1.6 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.5 | 2.0 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.4 | 6.0 | GO:0005537 | mannose binding(GO:0005537) |
| 0.3 | 1.0 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.3 | 1.0 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 0.3 | 2.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.3 | 1.7 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.3 | 2.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.3 | 1.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.3 | 1.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.3 | 1.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.3 | 1.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.2 | 3.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.2 | 2.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.2 | 1.0 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 0.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.7 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.5 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.2 | 0.5 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.6 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.1 | 1.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 4.1 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 3.3 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.1 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.1 | 0.4 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 1.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.5 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 1.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 0.3 | GO:0004534 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.1 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.1 | 0.7 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.1 | 0.6 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.3 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.3 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 1.1 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.3 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 1.2 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 2.0 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 1.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.4 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.1 | 0.2 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.1 | 0.3 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 4.6 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.1 | 1.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.8 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.2 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.1 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.4 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 1.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.3 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 1.0 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.7 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.4 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.3 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.8 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.2 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.0 | 1.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.6 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) single guanine insertion binding(GO:0032142) |
| 0.0 | 0.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 1.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 2.3 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.0 | 1.0 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.4 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 1.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 2.2 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 1.0 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.9 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 1.0 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 1.4 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.8 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.0 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 3.0 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 1.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.6 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.0 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 2.2 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.0 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.6 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.1 | 1.3 | PID_ERBB_NETWORK_PATHWAY | ErbB receptor signaling network |
| 0.1 | 3.8 | PID_TCPTP_PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 1.2 | PID_IL23_PATHWAY | IL23-mediated signaling events |
| 0.1 | 1.1 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
| 0.0 | 1.6 | ST_ADRENERGIC | Adrenergic Pathway |
| 0.0 | 1.3 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.0 | 5.5 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 2.9 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 1.5 | PID_ATM_PATHWAY | ATM pathway |
| 0.0 | 1.3 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.7 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.0 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.5 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.2 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.2 | PID_IL27_PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.4 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.8 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 2.6 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.5 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.0 | 0.2 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.1 | REACTOME_ENDOSOMAL_VACUOLAR_PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.2 | 1.4 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 2.1 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 0.7 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 1.0 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 2.6 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 3.5 | REACTOME_CROSS_PRESENTATION_OF_SOLUBLE_EXOGENOUS_ANTIGENS_ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 0.6 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.9 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.9 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 2.5 | REACTOME_ASSOCIATION_OF_TRIC_CCT_WITH_TARGET_PROTEINS_DURING_BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.7 | REACTOME_REGULATION_OF_PYRUVATE_DEHYDROGENASE_PDH_COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 0.8 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 1.4 | REACTOME_RAS_ACTIVATION_UOPN_CA2_INFUX_THROUGH_NMDA_RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.8 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 1.2 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.5 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.8 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.6 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.3 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.3 | REACTOME_TRAFFICKING_AND_PROCESSING_OF_ENDOSOMAL_TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.8 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.6 | REACTOME_MICRORNA_MIRNA_BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.3 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 1.1 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.4 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.7 | REACTOME_RNA_POL_I_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.5 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 1.1 | REACTOME_PEPTIDE_LIGAND_BINDING_RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.4 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.3 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 0.2 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME_ADENYLATE_CYCLASE_ACTIVATING_PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.9 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.2 | REACTOME_RNA_POL_III_CHAIN_ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.3 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.4 | REACTOME_NOD1_2_SIGNALING_PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.3 | REACTOME_REGULATION_OF_GLUCOKINASE_BY_GLUCOKINASE_REGULATORY_PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.2 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
