| 5.9 |
29.6 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 5.7 |
17.2 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 4.4 |
13.3 |
GO:0030421 |
defecation(GO:0030421) |
| 4.1 |
4.1 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 3.5 |
10.5 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 3.4 |
3.4 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 3.1 |
9.2 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 2.9 |
8.6 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 2.6 |
7.9 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.6 |
5.1 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 2.5 |
7.6 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 2.5 |
2.5 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 2.4 |
14.2 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 2.3 |
2.3 |
GO:0061113 |
pancreas morphogenesis(GO:0061113) |
| 1.9 |
5.8 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.9 |
5.6 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.8 |
5.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.7 |
1.7 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 1.7 |
13.4 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 1.6 |
1.6 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 1.6 |
1.6 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 1.6 |
6.4 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 1.6 |
6.3 |
GO:0060857 |
establishment of glial blood-brain barrier(GO:0060857) |
| 1.6 |
4.7 |
GO:0071579 |
regulation of zinc ion transport(GO:0071579) |
| 1.6 |
6.2 |
GO:0060032 |
notochord regression(GO:0060032) |
| 1.5 |
4.6 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.5 |
4.5 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 1.5 |
4.5 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.5 |
4.5 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.5 |
4.5 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 1.5 |
4.4 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 1.5 |
4.4 |
GO:0097402 |
optic vesicle morphogenesis(GO:0003404) neuroblast migration(GO:0097402) |
| 1.4 |
4.3 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 1.4 |
4.3 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 1.4 |
2.8 |
GO:0070671 |
response to interleukin-12(GO:0070671) |
| 1.3 |
2.7 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 1.3 |
5.3 |
GO:1902724 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 1.3 |
5.3 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.3 |
3.8 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 1.3 |
2.5 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 1.3 |
5.0 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 1.3 |
11.3 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.2 |
4.9 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 1.2 |
4.8 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 1.2 |
5.9 |
GO:0046864 |
retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 1.2 |
7.1 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.2 |
3.5 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 1.1 |
1.1 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.1 |
9.1 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) |
| 1.1 |
1.1 |
GO:0072069 |
DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 1.1 |
3.4 |
GO:0021998 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) positive regulation of cardiac ventricle development(GO:1904414) |
| 1.1 |
4.5 |
GO:1900224 |
positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 1.1 |
7.6 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 1.1 |
4.3 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 1.1 |
3.2 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 1.1 |
11.7 |
GO:0072189 |
ureter development(GO:0072189) |
| 1.1 |
2.1 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 1.1 |
5.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.1 |
10.5 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.0 |
2.1 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.0 |
3.1 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 1.0 |
5.1 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.0 |
5.1 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 1.0 |
4.0 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 1.0 |
18.0 |
GO:0010715 |
regulation of extracellular matrix disassembly(GO:0010715) |
| 1.0 |
6.0 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.0 |
9.0 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 1.0 |
3.0 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 1.0 |
5.9 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.0 |
15.7 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 1.0 |
3.9 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 1.0 |
1.0 |
GO:0070841 |
inclusion body assembly(GO:0070841) |
| 1.0 |
3.9 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 1.0 |
3.9 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 1.0 |
1.9 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.0 |
2.9 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.0 |
3.8 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 0.9 |
0.9 |
GO:0060307 |
regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.9 |
8.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.9 |
3.6 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.9 |
3.5 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.9 |
2.7 |
GO:0061341 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.9 |
1.8 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.9 |
2.6 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.9 |
4.3 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.8 |
2.5 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.8 |
2.5 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.8 |
4.1 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 0.8 |
2.5 |
GO:0002248 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
| 0.8 |
3.3 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.8 |
1.6 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.8 |
21.9 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.8 |
4.8 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.8 |
3.2 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.8 |
2.4 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.8 |
1.6 |
GO:0072554 |
blood vessel lumenization(GO:0072554) |
| 0.8 |
2.3 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.8 |
5.4 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.8 |
3.1 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.8 |
2.3 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.8 |
1.5 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.8 |
6.1 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.8 |
2.3 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.8 |
5.3 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.8 |
4.5 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.8 |
4.5 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.8 |
6.0 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.7 |
0.7 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.7 |
0.7 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 0.7 |
4.5 |
GO:0043622 |
cortical microtubule organization(GO:0043622) |
| 0.7 |
2.9 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 0.7 |
0.7 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.7 |
0.7 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.7 |
2.2 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 0.7 |
5.8 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.7 |
2.9 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.7 |
1.4 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.7 |
2.1 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 0.7 |
3.5 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.7 |
2.8 |
GO:1904672 |
regulation of somatic stem cell population maintenance(GO:1904672) |
| 0.7 |
1.4 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.7 |
0.7 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 0.7 |
7.6 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.7 |
6.9 |
GO:0007440 |
foregut morphogenesis(GO:0007440) |
| 0.7 |
2.7 |
GO:0000415 |
negative regulation of histone H3-K36 methylation(GO:0000415) negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.7 |
4.1 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.7 |
2.7 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.7 |
4.1 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.7 |
3.4 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.7 |
2.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
2.0 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.7 |
2.7 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.7 |
2.0 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.7 |
4.6 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.7 |
5.3 |
GO:0014842 |
regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.7 |
0.7 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.7 |
2.6 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.6 |
0.6 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.6 |
0.6 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.6 |
1.9 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.6 |
2.6 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.6 |
1.9 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 |
2.6 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.6 |
2.6 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.6 |
4.4 |
GO:0044838 |
cell quiescence(GO:0044838) |
| 0.6 |
5.1 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.6 |
2.5 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.6 |
3.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.6 |
3.7 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.6 |
4.9 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.6 |
2.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.6 |
3.0 |
GO:0061141 |
lung ciliated cell differentiation(GO:0061141) |
| 0.6 |
1.8 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.6 |
0.6 |
GO:0071378 |
growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.6 |
1.8 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.6 |
9.5 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.6 |
0.6 |
GO:0099525 |
presynaptic dense core granule exocytosis(GO:0099525) |
| 0.6 |
1.8 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.6 |
2.9 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.6 |
0.6 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.6 |
2.4 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.6 |
0.6 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.6 |
0.6 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 0.6 |
0.6 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.6 |
0.6 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 0.6 |
4.0 |
GO:0072081 |
pattern specification involved in kidney development(GO:0061004) proximal/distal pattern formation involved in nephron development(GO:0072047) renal system pattern specification(GO:0072048) specification of nephron tubule identity(GO:0072081) |
| 0.6 |
0.6 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.6 |
1.7 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.6 |
0.6 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.6 |
2.8 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.6 |
2.2 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.6 |
1.7 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.6 |
1.7 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.6 |
2.2 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.6 |
1.1 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.5 |
1.1 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.5 |
6.0 |
GO:0071481 |
cellular response to X-ray(GO:0071481) |
| 0.5 |
0.5 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.5 |
3.3 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.5 |
4.3 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.5 |
7.0 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.5 |
1.6 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.5 |
1.1 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.5 |
2.1 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.5 |
2.1 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.5 |
1.6 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.5 |
3.7 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.5 |
1.6 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 |
1.0 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.5 |
1.6 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.5 |
2.6 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.5 |
0.5 |
GO:0072711 |
cellular response to hydroxyurea(GO:0072711) |
| 0.5 |
4.1 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.5 |
1.5 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.5 |
2.6 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.5 |
1.5 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.5 |
1.0 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.5 |
4.5 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.5 |
5.0 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.5 |
1.5 |
GO:0090327 |
negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.5 |
1.5 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.5 |
4.4 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 |
3.9 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.5 |
3.4 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.5 |
1.0 |
GO:0042772 |
DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.5 |
3.4 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 0.5 |
3.4 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.5 |
3.4 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.5 |
7.3 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.5 |
4.8 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.5 |
5.3 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.5 |
3.9 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.5 |
1.4 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.5 |
2.4 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.5 |
1.4 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.5 |
0.5 |
GO:0051135 |
positive regulation of NK T cell activation(GO:0051135) |
| 0.5 |
4.2 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.5 |
1.4 |
GO:0021914 |
smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.5 |
2.3 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.5 |
2.8 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.5 |
0.9 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.5 |
0.9 |
GO:0035315 |
hair cell differentiation(GO:0035315) auditory receptor cell differentiation(GO:0042491) |
| 0.5 |
5.0 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.5 |
1.8 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.5 |
0.9 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.5 |
1.8 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.4 |
7.2 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.4 |
3.1 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 |
4.0 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.4 |
4.0 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.4 |
1.3 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.4 |
2.2 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.4 |
1.3 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.4 |
0.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.4 |
1.7 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.4 |
4.8 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
4.7 |
GO:0021924 |
cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.4 |
5.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.4 |
3.8 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.4 |
2.1 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.4 |
0.4 |
GO:0010635 |
regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
| 0.4 |
2.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.4 |
1.3 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.4 |
1.7 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.4 |
0.8 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.4 |
1.3 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.4 |
1.7 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.4 |
5.0 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.4 |
1.7 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.4 |
0.4 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.4 |
0.4 |
GO:0072235 |
distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
| 0.4 |
2.5 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.4 |
2.9 |
GO:0051256 |
mitotic spindle midzone assembly(GO:0051256) |
| 0.4 |
1.2 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.4 |
0.4 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.4 |
2.0 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.4 |
4.8 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.4 |
6.8 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.4 |
1.2 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.4 |
1.2 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.4 |
1.6 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.4 |
1.2 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.4 |
0.8 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) |
| 0.4 |
0.8 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.4 |
1.5 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.4 |
1.2 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.4 |
5.7 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.4 |
1.5 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.4 |
1.5 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.4 |
0.8 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.4 |
0.4 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.4 |
0.4 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 0.4 |
0.4 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.4 |
1.1 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.4 |
0.7 |
GO:1904975 |
response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.4 |
1.9 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.4 |
0.7 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.4 |
2.2 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 |
0.7 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 0.4 |
1.1 |
GO:0034250 |
positive regulation of cellular amide metabolic process(GO:0034250) |
| 0.4 |
0.4 |
GO:0061205 |
paramesonephric duct development(GO:0061205) |
| 0.4 |
0.7 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 |
1.1 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.4 |
1.4 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.4 |
0.4 |
GO:0060374 |
mast cell differentiation(GO:0060374) |
| 0.4 |
1.1 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.4 |
2.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.4 |
1.1 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.4 |
1.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.4 |
1.8 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.4 |
1.1 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.4 |
0.4 |
GO:0002200 |
somatic diversification of immune receptors(GO:0002200) |
| 0.4 |
2.8 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.4 |
2.5 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.4 |
3.5 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.4 |
2.1 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.3 |
2.4 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 |
2.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
5.6 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.3 |
0.3 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.3 |
1.4 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.3 |
0.3 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.3 |
1.7 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.3 |
1.0 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.3 |
2.0 |
GO:0014733 |
regulation of skeletal muscle adaptation(GO:0014733) |
| 0.3 |
0.7 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.3 |
0.3 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.3 |
2.7 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.3 |
1.0 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.3 |
5.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.3 |
1.0 |
GO:2001225 |
regulation of chloride transport(GO:2001225) |
| 0.3 |
0.7 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.3 |
2.3 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 |
0.3 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.3 |
2.3 |
GO:0090234 |
regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.3 |
2.3 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.3 |
1.0 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.3 |
1.3 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.3 |
1.6 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.3 |
1.0 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 0.3 |
4.5 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.3 |
0.3 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.3 |
1.0 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.3 |
0.6 |
GO:2000373 |
regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.3 |
0.6 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.3 |
3.2 |
GO:0010766 |
negative regulation of sodium ion transport(GO:0010766) |
| 0.3 |
1.6 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.3 |
0.3 |
GO:0098743 |
cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.3 |
6.0 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
1.3 |
GO:0032196 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
| 0.3 |
0.6 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.3 |
3.4 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.3 |
0.6 |
GO:0048162 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.3 |
1.6 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.3 |
0.3 |
GO:0035482 |
gastric motility(GO:0035482) gastric emptying(GO:0035483) |
| 0.3 |
0.3 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.3 |
0.6 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.3 |
2.5 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.3 |
2.1 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
1.8 |
GO:0051984 |
positive regulation of chromosome segregation(GO:0051984) |
| 0.3 |
1.5 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.3 |
0.3 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.3 |
1.5 |
GO:0098706 |
ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.3 |
0.3 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
1.8 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.3 |
5.5 |
GO:0048864 |
stem cell development(GO:0048864) |
| 0.3 |
0.9 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.3 |
0.3 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.3 |
0.9 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.3 |
3.0 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.3 |
1.2 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.3 |
0.3 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 |
1.5 |
GO:0015867 |
ATP transport(GO:0015867) |
| 0.3 |
0.6 |
GO:0007262 |
STAT protein import into nucleus(GO:0007262) |
| 0.3 |
1.5 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.3 |
1.5 |
GO:0043584 |
nose development(GO:0043584) |
| 0.3 |
0.3 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.3 |
0.3 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.3 |
0.3 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.3 |
0.6 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.3 |
1.7 |
GO:0021871 |
forebrain regionalization(GO:0021871) |
| 0.3 |
1.4 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.3 |
2.0 |
GO:0032596 |
protein transport into membrane raft(GO:0032596) |
| 0.3 |
1.1 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.3 |
2.0 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.3 |
0.3 |
GO:1900120 |
regulation of receptor binding(GO:1900120) |
| 0.3 |
0.3 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 0.3 |
0.8 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.3 |
4.8 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
3.1 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.3 |
1.4 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 |
3.1 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.3 |
0.6 |
GO:0071500 |
cellular response to nitrosative stress(GO:0071500) |
| 0.3 |
1.1 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.3 |
1.4 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 |
8.6 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.3 |
0.6 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.3 |
1.4 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.3 |
0.6 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.3 |
1.4 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.3 |
3.3 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.3 |
2.2 |
GO:0032495 |
response to muramyl dipeptide(GO:0032495) |
| 0.3 |
0.3 |
GO:1900127 |
positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.3 |
1.1 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 |
1.4 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.3 |
1.6 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.3 |
0.8 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.3 |
0.5 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.3 |
0.8 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.3 |
0.5 |
GO:0032415 |
regulation of sodium:proton antiporter activity(GO:0032415) |
| 0.3 |
0.3 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.3 |
3.7 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.3 |
0.3 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.3 |
0.5 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.3 |
0.5 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.3 |
1.3 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
2.6 |
GO:0071435 |
potassium ion export(GO:0071435) |
| 0.3 |
0.3 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.3 |
0.5 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.3 |
2.1 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.3 |
1.5 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.3 |
0.8 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.3 |
2.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.3 |
0.5 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.3 |
2.3 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.3 |
0.8 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.3 |
0.8 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.3 |
0.8 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 |
2.5 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.3 |
0.3 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.3 |
0.3 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
| 0.3 |
0.5 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.3 |
0.3 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.3 |
0.8 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.2 |
1.0 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.2 |
0.5 |
GO:2000851 |
positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.2 |
6.0 |
GO:1902186 |
regulation of viral release from host cell(GO:1902186) |
| 0.2 |
0.2 |
GO:0031497 |
chromatin assembly(GO:0031497) |
| 0.2 |
1.0 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.2 |
0.5 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.2 |
0.5 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.2 |
0.5 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 |
0.2 |
GO:0034239 |
regulation of macrophage fusion(GO:0034239) |
| 0.2 |
0.7 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.2 |
0.5 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.2 |
1.0 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.2 |
1.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 |
1.9 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.2 |
0.5 |
GO:0060923 |
cardiac cell fate commitment(GO:0060911) cardiac muscle cell fate commitment(GO:0060923) |
| 0.2 |
2.2 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 |
0.7 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.2 |
1.0 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.2 |
0.2 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.2 |
1.2 |
GO:1903961 |
positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) positive regulation of anion transmembrane transport(GO:1903961) |
| 0.2 |
1.2 |
GO:0033139 |
regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.2 |
0.2 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.2 |
0.9 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.2 |
2.6 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) |
| 0.2 |
0.5 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.2 |
1.4 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.2 |
1.4 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.2 |
0.5 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.2 |
0.7 |
GO:0051383 |
kinetochore organization(GO:0051383) |
| 0.2 |
0.9 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.2 |
0.2 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.2 |
6.3 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.2 |
1.8 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.2 |
7.2 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.2 |
0.9 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 |
3.1 |
GO:0031442 |
positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.2 |
0.7 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 |
1.1 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 |
0.9 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.2 |
0.7 |
GO:0048596 |
embryonic camera-type eye morphogenesis(GO:0048596) |
| 0.2 |
2.0 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.2 |
0.7 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) |
| 0.2 |
0.2 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.2 |
0.4 |
GO:0019827 |
stem cell population maintenance(GO:0019827) |
| 0.2 |
0.4 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.2 |
0.9 |
GO:0032682 |
negative regulation of chemokine production(GO:0032682) |
| 0.2 |
0.6 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.2 |
0.6 |
GO:0045080 |
positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.2 |
1.7 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.2 |
0.9 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.2 |
0.4 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 |
0.6 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.2 |
1.3 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.2 |
0.2 |
GO:0071649 |
chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.2 |
0.6 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 |
0.8 |
GO:0032962 |
regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.2 |
1.0 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.2 |
2.3 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.2 |
0.6 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 |
2.7 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.2 |
0.2 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
1.4 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.2 |
0.6 |
GO:0015793 |
renal water transport(GO:0003097) glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.2 |
2.9 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.2 |
2.5 |
GO:0001843 |
neural tube closure(GO:0001843) |
| 0.2 |
1.0 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 |
1.0 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 |
0.4 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.2 |
0.4 |
GO:0010273 |
detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
| 0.2 |
1.4 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.2 |
0.8 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.2 |
0.6 |
GO:0035937 |
estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.2 |
0.4 |
GO:0045076 |
regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.2 |
2.2 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.2 |
1.6 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 |
0.8 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.2 |
0.6 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.2 |
0.6 |
GO:1901843 |
positive regulation of high voltage-gated calcium channel activity(GO:1901843) positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
0.6 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.2 |
0.4 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 |
0.2 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 |
1.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.2 |
0.2 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
1.9 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.2 |
2.1 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
1.2 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.2 |
0.2 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.2 |
1.2 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.2 |
0.6 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 |
0.4 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.2 |
0.6 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.2 |
1.9 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
0.6 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.2 |
1.3 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.2 |
0.2 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.2 |
0.4 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 |
0.6 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.2 |
0.2 |
GO:0070828 |
heterochromatin organization(GO:0070828) |
| 0.2 |
0.4 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.2 |
0.6 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.2 |
1.3 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 |
3.4 |
GO:0048016 |
inositol phosphate-mediated signaling(GO:0048016) |
| 0.2 |
0.6 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.2 |
0.8 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.2 |
2.1 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.2 |
0.2 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.2 |
0.2 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.2 |
0.7 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.2 |
0.7 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.2 |
1.1 |
GO:0036006 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.2 |
0.4 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.2 |
1.1 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.2 |
0.2 |
GO:1901797 |
negative regulation of signal transduction by p53 class mediator(GO:1901797) |
| 0.2 |
3.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.2 |
1.3 |
GO:0071372 |
response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.2 |
0.7 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.2 |
0.9 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.2 |
0.2 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 |
0.2 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.2 |
0.4 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.2 |
0.5 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.2 |
1.6 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.2 |
0.5 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.2 |
2.8 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 0.2 |
0.7 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.2 |
0.7 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.2 |
0.9 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.2 |
0.7 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.2 |
1.0 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.2 |
0.5 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.2 |
0.7 |
GO:0061072 |
iris morphogenesis(GO:0061072) |
| 0.2 |
1.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
0.7 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.2 |
0.2 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.2 |
0.5 |
GO:2000679 |
positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.2 |
0.7 |
GO:0044793 |
negative regulation by host of viral process(GO:0044793) |
| 0.2 |
0.5 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
1.0 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.2 |
0.3 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.2 |
0.2 |
GO:1901387 |
positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.2 |
0.8 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.2 |
5.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.8 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.2 |
0.5 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.2 |
1.1 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.2 |
1.3 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.2 |
0.8 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.2 |
0.7 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
0.2 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.2 |
0.2 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.2 |
0.2 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.2 |
0.2 |
GO:2000272 |
negative regulation of receptor activity(GO:2000272) |
| 0.2 |
0.5 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 |
2.0 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.2 |
0.5 |
GO:0031999 |
negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.2 |
0.2 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.2 |
0.8 |
GO:2000394 |
positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.2 |
0.8 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.2 |
1.8 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.2 |
1.6 |
GO:2000114 |
regulation of establishment of cell polarity(GO:2000114) |
| 0.2 |
0.3 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
1.3 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 |
0.5 |
GO:0038033 |
positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.2 |
1.0 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.2 |
0.3 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.2 |
0.5 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.2 |
0.5 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.2 |
0.8 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.2 |
0.3 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.2 |
0.8 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.2 |
0.2 |
GO:0070873 |
regulation of glycogen metabolic process(GO:0070873) |
| 0.2 |
0.5 |
GO:0009445 |
putrescine metabolic process(GO:0009445) |
| 0.2 |
0.5 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.2 |
0.6 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.2 |
0.2 |
GO:0048021 |
regulation of secondary metabolic process(GO:0043455) regulation of melanin biosynthetic process(GO:0048021) regulation of secondary metabolite biosynthetic process(GO:1900376) |
| 0.2 |
0.6 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.2 |
0.6 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.2 |
0.5 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 |
0.2 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.2 |
0.6 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.1 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 |
0.6 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
0.4 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 0.1 |
0.7 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 |
0.3 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.1 |
0.1 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 |
1.0 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.1 |
0.1 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.1 |
1.9 |
GO:0030279 |
negative regulation of ossification(GO:0030279) |
| 0.1 |
0.9 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.1 |
0.1 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.6 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.1 |
0.3 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.1 |
0.3 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
0.4 |
GO:0060468 |
prevention of polyspermy(GO:0060468) |
| 0.1 |
0.9 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 |
0.6 |
GO:0030574 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.1 |
0.3 |
GO:0090647 |
modulation of age-related behavioral decline(GO:0090647) |
| 0.1 |
0.7 |
GO:0015669 |
gas transport(GO:0015669) oxygen transport(GO:0015671) |
| 0.1 |
0.3 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.1 |
0.1 |
GO:0098707 |
ferrous iron import(GO:0070627) iron ion import into cell(GO:0097459) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) iron ion import across plasma membrane(GO:0098711) |
| 0.1 |
0.1 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.7 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
0.6 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.1 |
0.1 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.1 |
1.0 |
GO:1901623 |
regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.1 |
1.8 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
0.7 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 |
0.1 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
4.3 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.7 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.1 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.1 |
0.5 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.1 |
0.3 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
3.3 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.1 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 |
0.5 |
GO:1902992 |
negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.1 |
0.5 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.1 |
0.3 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 |
0.1 |
GO:0051769 |
nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) |
| 0.1 |
0.8 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.1 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 |
1.2 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 |
0.8 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.8 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 |
0.1 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 |
1.6 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.1 |
0.3 |
GO:0033184 |
positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 |
0.5 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.1 |
0.8 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.1 |
0.4 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 |
0.8 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 |
0.4 |
GO:2000105 |
positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.1 |
0.1 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.5 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.1 |
0.5 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.1 |
0.1 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.1 |
0.4 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 |
1.9 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.1 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.1 |
0.3 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 |
1.0 |
GO:0010793 |
regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 |
0.3 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.1 |
1.1 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.4 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.1 |
0.8 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.1 |
1.5 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.4 |
GO:1903564 |
regulation of protein localization to cilium(GO:1903564) |
| 0.1 |
2.0 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 |
0.2 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.1 |
0.6 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.1 |
0.4 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.1 |
1.0 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 |
0.2 |
GO:1900226 |
negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.1 |
0.4 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
0.8 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 |
0.4 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.1 |
1.0 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
2.9 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.1 |
0.2 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 0.1 |
0.1 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 |
2.2 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.1 |
0.2 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.1 |
0.4 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.1 |
0.4 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.1 |
1.3 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 |
0.6 |
GO:0019885 |
antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.1 |
4.9 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 |
0.1 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.1 |
0.4 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.5 |
GO:0048333 |
mesodermal cell differentiation(GO:0048333) |
| 0.1 |
0.4 |
GO:0009074 |
aromatic amino acid family catabolic process(GO:0009074) |
| 0.1 |
0.6 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.1 |
0.2 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.1 |
0.7 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.1 |
0.3 |
GO:1902914 |
regulation of protein polyubiquitination(GO:1902914) |
| 0.1 |
0.1 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 |
0.5 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.1 |
0.2 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) |
| 0.1 |
4.0 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.1 |
0.7 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
0.9 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.1 |
0.3 |
GO:0035094 |
response to nicotine(GO:0035094) |
| 0.1 |
0.4 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 |
0.2 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.4 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.1 |
0.2 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.1 |
0.9 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 |
0.7 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.1 |
0.2 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 |
0.3 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 |
0.1 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
0.8 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.9 |
GO:0000077 |
DNA damage checkpoint(GO:0000077) |
| 0.1 |
0.2 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 |
0.8 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 |
0.5 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
0.2 |
GO:0061357 |
Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.1 |
0.1 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.5 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 |
0.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.5 |
GO:0006537 |
glutamate biosynthetic process(GO:0006537) |
| 0.1 |
0.7 |
GO:1904754 |
positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.1 |
0.7 |
GO:0033692 |
cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.1 |
0.4 |
GO:1904451 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.1 |
2.0 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.1 |
1.9 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.1 |
0.2 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.1 |
0.3 |
GO:0051569 |
regulation of histone H3-K4 methylation(GO:0051569) |
| 0.1 |
1.3 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
0.4 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.1 |
0.5 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 |
0.9 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 |
0.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 |
0.9 |
GO:2000095 |
regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
| 0.1 |
0.7 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
0.3 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 |
0.1 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 |
0.3 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 |
0.2 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.1 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.1 |
1.5 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.2 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 |
0.3 |
GO:2000052 |
positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 |
1.1 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.1 |
0.1 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 |
0.3 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.1 |
0.4 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
0.3 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.2 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.2 |
GO:0002700 |
regulation of production of molecular mediator of immune response(GO:0002700) regulation of cytokine production involved in immune response(GO:0002718) |
| 0.1 |
0.1 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 |
0.1 |
GO:0002589 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
| 0.1 |
0.2 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.1 |
0.1 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 |
1.0 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 |
1.8 |
GO:0032288 |
myelin assembly(GO:0032288) |
| 0.1 |
0.3 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.1 |
0.5 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 |
0.4 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 |
0.8 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 |
1.2 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.1 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 |
0.4 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 |
1.6 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.1 |
0.2 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
1.0 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
0.1 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
1.2 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
1.7 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
1.1 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.2 |
GO:0070227 |
lymphocyte apoptotic process(GO:0070227) |
| 0.1 |
1.4 |
GO:2001273 |
regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.2 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.1 |
0.3 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.1 |
1.0 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.1 |
0.1 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.1 |
0.2 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
0.6 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 |
0.2 |
GO:0001828 |
inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 |
4.9 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.1 |
0.4 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.1 |
0.3 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 |
0.7 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.3 |
GO:0060332 |
positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.1 |
0.3 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.1 |
0.7 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.1 |
0.5 |
GO:0071622 |
regulation of granulocyte chemotaxis(GO:0071622) |
| 0.1 |
1.7 |
GO:0001738 |
morphogenesis of a polarized epithelium(GO:0001738) |
| 0.1 |
1.8 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 |
0.5 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
0.8 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
0.7 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.1 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.1 |
0.2 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) |
| 0.1 |
1.2 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) |
| 0.1 |
0.1 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) oxidative demethylation(GO:0070989) |
| 0.1 |
0.2 |
GO:0006582 |
melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) secondary metabolite biosynthetic process(GO:0044550) |
| 0.1 |
0.7 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 |
0.7 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.1 |
0.4 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 |
0.4 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.1 |
0.2 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 |
0.4 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.1 |
0.4 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.1 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.1 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 |
0.4 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 |
0.1 |
GO:0042421 |
norepinephrine biosynthetic process(GO:0042421) |
| 0.1 |
0.4 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 |
0.1 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.1 |
0.2 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 |
0.1 |
GO:0019883 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous antigen(GO:0019883) |
| 0.1 |
0.2 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
0.2 |
GO:0072584 |
caveolin-mediated endocytosis(GO:0072584) |
| 0.1 |
0.4 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
1.1 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.1 |
0.7 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.1 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
0.1 |
GO:0045820 |
negative regulation of glycolytic process(GO:0045820) |
| 0.1 |
0.5 |
GO:0046502 |
uroporphyrinogen III metabolic process(GO:0046502) |
| 0.1 |
0.1 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.3 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.7 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 |
0.1 |
GO:0045713 |
low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 |
0.2 |
GO:0042415 |
norepinephrine metabolic process(GO:0042415) |
| 0.1 |
0.1 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.1 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.1 |
2.7 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 |
0.1 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.1 |
0.1 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.1 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.7 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.4 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
3.6 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
1.4 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
1.1 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
0.1 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 |
0.3 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.1 |
1.1 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.3 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 |
0.6 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.1 |
0.1 |
GO:0033563 |
dorsal/ventral axon guidance(GO:0033563) |
| 0.1 |
1.2 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.1 |
0.1 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 |
0.4 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
2.3 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
1.6 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.1 |
0.6 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 |
0.5 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.1 |
0.1 |
GO:0060218 |
hematopoietic stem cell differentiation(GO:0060218) |
| 0.1 |
0.2 |
GO:0034205 |
beta-amyloid formation(GO:0034205) |
| 0.1 |
0.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 |
6.1 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
0.3 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.1 |
0.1 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 |
0.2 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.2 |
GO:1904923 |
regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
| 0.1 |
0.4 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
0.2 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.1 |
0.3 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.1 |
0.3 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.7 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.1 |
0.1 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 |
0.3 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 |
0.3 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.1 |
0.3 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 |
0.1 |
GO:0002716 |
negative regulation of leukocyte mediated cytotoxicity(GO:0001911) negative regulation of natural killer cell mediated immunity(GO:0002716) negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.1 |
0.3 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
0.3 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.2 |
GO:0010712 |
regulation of collagen metabolic process(GO:0010712) |
| 0.1 |
0.1 |
GO:0035898 |
parathyroid hormone secretion(GO:0035898) |
| 0.1 |
1.9 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.1 |
GO:0045577 |
regulation of B cell differentiation(GO:0045577) |
| 0.1 |
0.5 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.4 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.1 |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.1 |
0.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.1 |
1.1 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.1 |
0.1 |
GO:0019614 |
phenol-containing compound catabolic process(GO:0019336) catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.1 |
0.2 |
GO:2000642 |
negative regulation of vacuolar transport(GO:1903336) negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.4 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.3 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.1 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.1 |
GO:1900078 |
positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 |
0.3 |
GO:2000370 |
positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.1 |
0.1 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 |
0.7 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.2 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 |
0.1 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.1 |
0.2 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.1 |
0.1 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.2 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.2 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 |
0.3 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.5 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 |
0.1 |
GO:0045835 |
negative regulation of meiotic nuclear division(GO:0045835) |
| 0.1 |
0.3 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.1 |
0.3 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.1 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 |
0.1 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.1 |
0.1 |
GO:0072044 |
collecting duct development(GO:0072044) |
| 0.1 |
0.1 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.1 |
0.3 |
GO:0051189 |
molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 |
0.2 |
GO:0006678 |
glucosylceramide metabolic process(GO:0006678) |
| 0.1 |
0.5 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 |
0.1 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 |
0.1 |
GO:0009838 |
abscission(GO:0009838) |
| 0.1 |
0.3 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.5 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.1 |
0.4 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.7 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 |
1.2 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.1 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
0.1 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.0 |
0.1 |
GO:0060452 |
positive regulation of striated muscle contraction(GO:0045989) positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.0 |
0.1 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.0 |
0.1 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 |
0.0 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.1 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 |
0.2 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.2 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.0 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.0 |
0.1 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.0 |
0.9 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.1 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 |
0.4 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.0 |
0.1 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.0 |
0.0 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.0 |
0.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.0 |
0.2 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 |
0.0 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 |
0.1 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 |
0.4 |
GO:0010922 |
positive regulation of phosphatase activity(GO:0010922) |
| 0.0 |
0.1 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.0 |
0.3 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 |
0.3 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 |
0.6 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 |
0.3 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.3 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.0 |
0.0 |
GO:0048524 |
positive regulation of viral process(GO:0048524) |
| 0.0 |
0.1 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 |
1.0 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.0 |
3.1 |
GO:0006402 |
mRNA catabolic process(GO:0006402) |
| 0.0 |
0.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 |
0.1 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.0 |
0.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.0 |
0.4 |
GO:0015697 |
quaternary ammonium group transport(GO:0015697) |
| 0.0 |
0.2 |
GO:0090207 |
regulation of triglyceride metabolic process(GO:0090207) |
| 0.0 |
0.1 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 |
0.2 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.2 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.0 |
1.4 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 |
0.0 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.0 |
0.5 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.0 |
0.1 |
GO:0002002 |
regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 |
1.0 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.1 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.0 |
0.2 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.6 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.3 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.0 |
0.2 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 |
0.0 |
GO:0072677 |
eosinophil chemotaxis(GO:0048245) eosinophil migration(GO:0072677) |
| 0.0 |
0.1 |
GO:0034724 |
DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.4 |
GO:0071467 |
cellular response to pH(GO:0071467) |
| 0.0 |
0.4 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
0.4 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
0.2 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.0 |
0.2 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.0 |
0.1 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.0 |
0.1 |
GO:0002335 |
mature B cell differentiation(GO:0002335) |
| 0.0 |
0.2 |
GO:0015842 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.0 |
0.3 |
GO:0000737 |
DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.0 |
0.1 |
GO:0035358 |
regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
| 0.0 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.0 |
0.1 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.0 |
1.6 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
1.1 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.0 |
0.7 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.0 |
0.1 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 |
0.2 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.0 |
0.1 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 |
0.6 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.0 |
0.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 |
0.1 |
GO:0043535 |
regulation of blood vessel endothelial cell migration(GO:0043535) |
| 0.0 |
0.1 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 |
0.1 |
GO:0022404 |
molting cycle process(GO:0022404) hair cycle process(GO:0022405) |
| 0.0 |
0.1 |
GO:0071354 |
cellular response to interleukin-6(GO:0071354) |
| 0.0 |
0.1 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.0 |
GO:0060602 |
branch elongation of an epithelium(GO:0060602) |
| 0.0 |
0.2 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.4 |
GO:1903313 |
positive regulation of mRNA metabolic process(GO:1903313) |
| 0.0 |
0.7 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.2 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.0 |
0.0 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.0 |
0.6 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.0 |
0.2 |
GO:0044068 |
modulation by symbiont of host cellular process(GO:0044068) |
| 0.0 |
0.1 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.0 |
0.1 |
GO:0032594 |
protein transport within lipid bilayer(GO:0032594) |
| 0.0 |
0.1 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.0 |
0.4 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.1 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 |
0.2 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 |
0.0 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.0 |
0.5 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
0.1 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 |
0.1 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.0 |
0.0 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.0 |
0.3 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.0 |
GO:0010453 |
regulation of cell fate commitment(GO:0010453) |
| 0.0 |
0.2 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.0 |
0.9 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.1 |
GO:0071236 |
cellular response to antibiotic(GO:0071236) |
| 0.0 |
0.1 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.0 |
0.1 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.0 |
0.1 |
GO:0016321 |
female meiosis chromosome segregation(GO:0016321) |
| 0.0 |
0.1 |
GO:1904751 |
positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 |
0.0 |
GO:0010713 |
negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) negative regulation of multicellular organismal metabolic process(GO:0044252) |
| 0.0 |
0.1 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.0 |
0.1 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.0 |
0.3 |
GO:0009208 |
pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
| 0.0 |
0.1 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
0.0 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.0 |
0.2 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.0 |
0.4 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.0 |
0.2 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.1 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.0 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 |
0.0 |
GO:0021933 |
radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 0.0 |
0.1 |
GO:1904292 |
regulation of ERAD pathway(GO:1904292) |
| 0.0 |
0.0 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.0 |
0.2 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.0 |
5.8 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.0 |
0.5 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 |
0.9 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.0 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) |
| 0.0 |
0.0 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 |
0.1 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 |
0.1 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of heart rate by epinephrine(GO:0003065) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.0 |
0.4 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.0 |
0.0 |
GO:0048714 |
positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 |
0.1 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 |
0.1 |
GO:1902850 |
microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 |
0.6 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.0 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.3 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 |
0.1 |
GO:0032365 |
intracellular lipid transport(GO:0032365) |
| 0.0 |
0.2 |
GO:0046500 |
S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 |
0.0 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 |
0.2 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
1.2 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.0 |
0.1 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 |
0.1 |
GO:0046512 |
sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.2 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.0 |
0.1 |
GO:1901629 |
regulation of presynaptic membrane organization(GO:1901629) |
| 0.0 |
0.1 |
GO:0044036 |
cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
0.1 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 |
0.1 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.0 |
0.0 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 |
0.0 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 |
0.1 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.0 |
0.1 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.0 |
0.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.1 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 |
0.1 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.0 |
0.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
0.2 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.2 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 |
0.0 |
GO:0048793 |
pronephros development(GO:0048793) |
| 0.0 |
0.1 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 |
0.0 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 |
0.0 |
GO:1901534 |
positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.0 |
0.1 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.0 |
0.0 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.0 |
0.1 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.0 |
0.0 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 0.0 |
0.1 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.3 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.0 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 |
0.1 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 |
0.1 |
GO:0007603 |
phototransduction, visible light(GO:0007603) |
| 0.0 |
0.0 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 |
0.2 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.0 |
0.0 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.0 |
0.9 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 |
0.0 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.0 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) sensory perception of bitter taste(GO:0050913) |
| 0.0 |
0.0 |
GO:0032305 |
positive regulation of icosanoid secretion(GO:0032305) regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) prostaglandin secretion(GO:0032310) |
| 0.0 |
0.0 |
GO:0030578 |
PML body organization(GO:0030578) |
| 0.0 |
0.1 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.0 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.0 |
0.0 |
GO:0010212 |
response to ionizing radiation(GO:0010212) |
| 0.0 |
0.0 |
GO:0019755 |
one-carbon compound transport(GO:0019755) |
| 0.0 |
0.1 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 |
0.0 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.0 |
0.0 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 |
0.1 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
