Motif ID: Pou3f2
Z-value: 0.808
Transcription factors associated with Pou3f2:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Pou3f2 | ENSMUSG00000095139.1 | Pou3f2 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Pou3f2 | mm10_v2_chr4_-_22488296_22488366 | 0.34 | 3.7e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 4.7 | GO:0042891 | antibiotic transport(GO:0042891) dipeptide transport(GO:0042938) |
| 0.9 | 3.7 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.8 | 7.0 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.8 | 4.5 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.5 | 4.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.5 | 1.8 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.4 | 3.8 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.4 | 1.2 | GO:0032240 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.4 | 1.5 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.4 | 1.1 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.3 | 2.8 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.3 | 2.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.3 | 1.1 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.3 | 1.9 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 1.6 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.2 | 1.4 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.2 | 1.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.2 | 0.5 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.2 | 1.4 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.2 | 0.5 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.1 | 0.6 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.1 | 0.6 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 1.9 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 | 3.9 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.1 | 1.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 0.9 | GO:0002674 | negative regulation of acute inflammatory response(GO:0002674) |
| 0.1 | 1.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.7 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.1 | 3.5 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.1 | 1.0 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.7 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.6 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 1.5 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 2.0 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.1 | 1.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.1 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 2.2 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.1 | 0.7 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 4.2 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.7 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.5 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 1.1 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.9 | GO:0007338 | single fertilization(GO:0007338) |
| 0.0 | 0.4 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 3.5 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.4 | 4.0 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 1.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.3 | 7.0 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.3 | 4.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.2 | 1.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.2 | 2.0 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.2 | 3.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 1.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 3.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 1.9 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 1.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.7 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 1.0 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 2.8 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 2.1 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 1.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 2.1 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 1.6 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.8 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.7 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
| 0.7 | 3.7 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.4 | 2.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.4 | 4.0 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.4 | 1.5 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.3 | 7.0 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.3 | 1.1 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
| 0.3 | 3.9 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.2 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.2 | 2.8 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.2 | 1.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 1.6 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.2 | 0.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 1.1 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 1.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 1.8 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 1.0 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 4.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.5 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 3.5 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 3.8 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.2 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 1.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 1.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.7 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.6 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 1.7 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.6 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.7 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 4.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.6 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 2.8 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.7 | GO:0019213 | deacetylase activity(GO:0019213) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.8 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.3 | 3.5 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.2 | 3.5 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.9 | PID_AURORA_A_PATHWAY | Aurora A signaling |
| 0.1 | 3.8 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.9 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 2.1 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.0 | 3.2 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.0 | 2.0 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 0.0 | 1.8 | ST_T_CELL_SIGNAL_TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 1.2 | PID_RETINOIC_ACID_PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 1.6 | PID_THROMBIN_PAR1_PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.7 | PID_ANGIOPOIETIN_RECEPTOR_PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.5 | ST_JNK_MAPK_PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.6 | PID_P53_REGULATION_PATHWAY | p53 pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 10.4 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 1.4 | REACTOME_TRANSLOCATION_OF_ZAP_70_TO_IMMUNOLOGICAL_SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.2 | 9.6 | REACTOME_AMINO_ACID_AND_OLIGOPEPTIDE_SLC_TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 2.1 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 3.7 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 3.9 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 0.1 | 1.5 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 1.1 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.5 | REACTOME_REGULATION_OF_PYRUVATE_DEHYDROGENASE_PDH_COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 1.2 | REACTOME_NEP_NS2_INTERACTS_WITH_THE_CELLULAR_EXPORT_MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.5 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
| 0.0 | 1.1 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.6 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.5 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.4 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.2 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
