Motif ID: Rad21_Smc3
Z-value: 0.672
Transcription factors associated with Rad21_Smc3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Rad21 | ENSMUSG00000022314.9 | Rad21 |
| Smc3 | ENSMUSG00000024974.10 | Smc3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Rad21 | mm10_v2_chr15_-_51991679_51991760 | 0.13 | 4.5e-01 | Click! |
| Smc3 | mm10_v2_chr19_+_53600377_53600435 | 0.06 | 7.2e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.8 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 0.9 | 2.7 | GO:1903002 | regulation of lipid transport across blood brain barrier(GO:1903000) positive regulation of lipid transport across blood brain barrier(GO:1903002) |
| 0.9 | 2.7 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.8 | 2.3 | GO:0009814 | defense response, incompatible interaction(GO:0009814) |
| 0.7 | 2.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.7 | 2.0 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.5 | 1.4 | GO:1902071 | positive regulation of cellular response to hypoxia(GO:1900039) regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.4 | 1.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.4 | 2.9 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.3 | 1.0 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.3 | 0.9 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.3 | 1.7 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.3 | 1.4 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.3 | 2.4 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 0.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.2 | 1.0 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 0.9 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 0.2 | 0.7 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.2 | 0.7 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.2 | 0.8 | GO:0032439 | endosome localization(GO:0032439) |
| 0.2 | 0.6 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 | 1.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 0.9 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.2 | 0.5 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.2 | 0.5 | GO:0032240 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.2 | 0.5 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.2 | 1.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.2 | 0.8 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.7 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) positive regulation of NAD(P)H oxidase activity(GO:0033864) positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 0.4 | GO:0046104 | thymidine metabolic process(GO:0046104) deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.9 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 0.6 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 1.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.5 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.1 | 0.9 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.8 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.5 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 0.2 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
| 0.1 | 0.3 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.1 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.7 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 1.8 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 | 0.2 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.1 | 0.3 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.3 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.5 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.2 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.5 | GO:0003431 | growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.5 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 | 1.3 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.1 | 0.2 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
| 0.1 | 1.3 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.2 | GO:0036233 | glycine import(GO:0036233) |
| 0.1 | 0.1 | GO:0045938 | positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.1 | 0.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.6 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.1 | 0.3 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.1 | 0.8 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 1.1 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 0.8 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.7 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.4 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.1 | GO:0009118 | regulation of oxidative phosphorylation(GO:0002082) regulation of nucleoside metabolic process(GO:0009118) regulation of ATP metabolic process(GO:1903578) |
| 0.1 | 0.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.1 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 0.9 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 0.6 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.4 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 | 0.2 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.1 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.7 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.2 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.1 | 0.3 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.1 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 0.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.4 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.4 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.4 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.8 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.6 | GO:0060253 | negative regulation of glial cell proliferation(GO:0060253) |
| 0.0 | 1.2 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.0 | 0.3 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.0 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.3 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 | 0.2 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.0 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.7 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 | 1.6 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.0 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.1 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.0 | 0.4 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.2 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.0 | 0.6 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:0045974 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 2.1 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.2 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.2 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.1 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.1 | GO:1900864 | tRNA wobble position uridine thiolation(GO:0002143) mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.9 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.5 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
| 0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.0 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.5 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.6 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.1 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.0 | 0.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.2 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.6 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.3 | GO:0048535 | lymph node development(GO:0048535) |
| 0.0 | 0.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.0 | 0.3 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.5 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.5 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.6 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.2 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.6 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.3 | GO:0071353 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.1 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.9 | 2.6 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.3 | 2.0 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.2 | 1.4 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 0.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.2 | 1.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.2 | 0.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 2.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 3.5 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 0.4 | GO:0071438 | integrin alpha3-beta1 complex(GO:0034667) invadopodium membrane(GO:0071438) |
| 0.1 | 0.4 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 1.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.4 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.6 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.2 | GO:0035101 | FACT complex(GO:0035101) |
| 0.1 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.9 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.6 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.5 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.6 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.2 | GO:1990131 | Iml1 complex(GO:1990130) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.4 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 1.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.7 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 1.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.6 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 1.9 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 1.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 1.0 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 1.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 1.9 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.4 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 1.0 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.3 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.0 | 1.3 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 1.1 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.0 | 0.3 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.2 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.3 | GO:0005871 | kinesin complex(GO:0005871) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0046911 | hydroxyapatite binding(GO:0046848) metal chelating activity(GO:0046911) phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.7 | 2.0 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.5 | 2.0 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
| 0.3 | 0.9 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.3 | 1.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.3 | 1.1 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
| 0.3 | 2.9 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.2 | 0.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.2 | 2.8 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.2 | 0.6 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.2 | 0.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.2 | 1.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.2 | 0.8 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.2 | 0.5 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.2 | 0.6 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.1 | 2.3 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.8 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.5 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.5 | GO:0070573 | tripeptidyl-peptidase activity(GO:0008240) metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.4 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.4 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.7 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 1.0 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.3 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 1.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 1.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.4 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 0.2 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.1 | 1.2 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.1 | 1.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 1.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 1.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.2 | GO:0098973 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.1 | 0.7 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 2.4 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 1.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.7 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.3 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.6 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.2 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.0 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.9 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 2.5 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.7 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.0 | 0.6 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 1.4 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.5 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 2.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.0 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.0 | 0.5 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.5 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 1.4 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 1.6 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 2.8 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 3.3 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 1.7 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 2.3 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 0.1 | 1.4 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 1.0 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.5 | PID_AR_NONGENOMIC_PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.7 | ST_B_CELL_ANTIGEN_RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 1.0 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.7 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.7 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.0 | 0.3 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.1 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.5 | PID_AURORA_A_PATHWAY | Aurora A signaling |
| 0.0 | 0.2 | PID_IL5_PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.0 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.5 | SIG_CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.6 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 2.2 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.1 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.8 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.4 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.5 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.7 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.6 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 0.0 | 0.1 | ST_TYPE_I_INTERFERON_PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.8 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.3 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.9 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 1.1 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 2.0 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 2.0 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.1 | 1.9 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 2.0 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 1.2 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 0.8 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 0.7 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.4 | REACTOME_PYRIMIDINE_CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.1 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.2 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.3 | REACTOME_IRAK2_MEDIATED_ACTIVATION_OF_TAK1_COMPLEX_UPON_TLR7_8_OR_9_STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 1.1 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.8 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.3 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.5 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.8 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.4 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.2 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.9 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.2 | REACTOME_PD1_SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.8 | REACTOME_REGULATION_OF_WATER_BALANCE_BY_RENAL_AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 2.2 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.7 | REACTOME_REGULATION_OF_GLUCOKINASE_BY_GLUCOKINASE_REGULATORY_PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.2 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.2 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.7 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.5 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.7 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 0.0 | 0.3 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.4 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.1 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.4 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.3 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_GOLGI_MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.1 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.4 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.3 | REACTOME_TAK1_ACTIVATES_NFKB_BY_PHOSPHORYLATION_AND_ACTIVATION_OF_IKKS_COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.8 | REACTOME_LATE_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.8 | REACTOME_GOLGI_ASSOCIATED_VESICLE_BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.1 | REACTOME_FRS2_MEDIATED_CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.6 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 2.4 | REACTOME_METABOLISM_OF_CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
| 0.0 | 0.2 | REACTOME_ARMS_MEDIATED_ACTIVATION | Genes involved in ARMS-mediated activation |
|
|
|