Motif ID: Smad4
Z-value: 1.049
Transcription factors associated with Smad4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Smad4 | ENSMUSG00000024515.7 | Smad4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Smad4 | mm10_v2_chr18_-_73703739_73703806 | 0.52 | 9.2e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 6.2 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 1.5 | 4.5 | GO:0060023 | soft palate development(GO:0060023) |
| 1.4 | 4.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 1.2 | 4.7 | GO:0015889 | cobalamin transport(GO:0015889) |
| 1.1 | 5.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 1.1 | 5.3 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.8 | 4.2 | GO:0021764 | amygdala development(GO:0021764) |
| 0.7 | 3.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.7 | 2.0 | GO:1904347 | intestine smooth muscle contraction(GO:0014827) regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) regulation of small intestine smooth muscle contraction(GO:1904347) small intestine smooth muscle contraction(GO:1990770) |
| 0.6 | 1.8 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
| 0.5 | 2.7 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
| 0.4 | 8.5 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.4 | 10.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.4 | 2.5 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.4 | 2.0 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.4 | 1.5 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 | 1.4 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.3 | 2.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.3 | 3.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.3 | 1.9 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.3 | 1.5 | GO:1902309 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.3 | 0.9 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.3 | 4.2 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.3 | 2.5 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.3 | 0.8 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 | 1.5 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 3.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.2 | 0.7 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 | 5.9 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.2 | 1.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
| 0.2 | 2.7 | GO:0072189 | ureter development(GO:0072189) |
| 0.2 | 1.8 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.2 | 0.7 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.2 | 0.9 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.2 | 1.1 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 0.6 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 0.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 | 2.6 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.2 | 1.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.2 | 1.1 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 | 1.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.2 | 0.5 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.2 | 1.9 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.2 | 1.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 1.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.1 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 | 1.9 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.6 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 3.4 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.1 | 1.7 | GO:0031295 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 1.2 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.1 | 0.9 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
| 0.1 | 0.6 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 3.0 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 3.8 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 | 2.4 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.9 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 1.5 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 | 0.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.7 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 1.6 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.9 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 1.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 1.1 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 4.1 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.0 | 0.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 | 0.3 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.0 | 2.1 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 2.1 | GO:0001701 | in utero embryonic development(GO:0001701) |
| 0.0 | 1.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.0 | 0.1 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.0 | 0.4 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 2.7 | GO:0007219 | Notch signaling pathway(GO:0007219) |
| 0.0 | 1.5 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
| 0.0 | 0.6 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.2 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.5 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.0 | 0.0 | GO:0071674 | mononuclear cell migration(GO:0071674) |
| 0.0 | 0.3 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.7 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.2 | GO:0046888 | negative regulation of hormone secretion(GO:0046888) |
| 0.0 | 0.5 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.5 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 10.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 2.0 | 5.9 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.4 | 4.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.4 | 1.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.3 | 0.9 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
| 0.3 | 1.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.3 | 0.8 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 0.7 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.2 | 5.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 0.6 | GO:0043293 | apoptosome(GO:0043293) |
| 0.2 | 2.0 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 3.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 1.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 4.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 4.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.1 | 4.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 2.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.4 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 1.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.9 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.8 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 1.0 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 1.4 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 1.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 2.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 1.2 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 6.2 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 1.9 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 2.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 4.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 5.1 | GO:0005874 | microtubule(GO:0005874) |
| 0.0 | 2.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.0 | 0.0 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 6.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 1.4 | 4.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.7 | 4.7 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.6 | 7.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.5 | 10.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.5 | 3.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.4 | 1.4 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
| 0.3 | 0.9 | GO:0036004 | GAF domain binding(GO:0036004) |
| 0.3 | 2.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.3 | 6.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.3 | 1.8 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.2 | 4.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.2 | 2.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 1.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.2 | 1.1 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 1.9 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.2 | 2.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.2 | 2.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 1.8 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.9 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 3.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 1.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 3.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.3 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.1 | 0.9 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 1.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 1.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 4.0 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 3.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 3.2 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 2.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 4.2 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.5 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 1.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 1.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 1.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.6 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 1.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.4 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 1.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.7 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.0 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 8.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 6.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 5.1 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 3.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 5.6 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.7 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 1.2 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.0 | 0.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.7 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.1 | 7.5 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.1 | 5.9 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.1 | 14.7 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 3.4 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
| 0.1 | 1.9 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.1 | 2.0 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 4.2 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.1 | 3.6 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 1.8 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.0 | 2.5 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.6 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 2.0 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 2.1 | ST_FAS_SIGNALING_PATHWAY | Fas Signaling Pathway |
| 0.0 | 2.6 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 1.7 | PID_LKB1_PATHWAY | LKB1 signaling events |
| 0.0 | 1.1 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.2 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 2.1 | PID_PDGFRB_PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.3 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.8 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.6 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 12.2 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.4 | 4.1 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 0.3 | 3.4 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 8.2 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.2 | 5.5 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.2 | 3.5 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 1.8 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 6.6 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.4 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 2.6 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 2.1 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 5.3 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.6 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.9 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 1.4 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.9 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 1.1 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME_GAP_JUNCTION_DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 3.5 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 2.3 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 1.9 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.7 | REACTOME_MEIOTIC_SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 1.1 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.6 | REACTOME_INTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.9 | REACTOME_G_ALPHA_S_SIGNALLING_EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 1.2 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.4 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
