Project
GNF SymAtlas + NCI-60 cancer cell lines, human (Su, 2004; Ross, 2000)
Navigation
Downloads
Results for TFAP2C
Z-value: 1.88
Motif logo
Transcription factors associated with TFAP2C
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFAP2C
|
ENSG00000087510.7 | TFAP2C |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFAP2C | hg38_v1_chr20_+_56629296_56629321 | -0.37 | 2.1e-08 | Click! |
Activity profile of TFAP2C motif
Sorted Z-values of TFAP2C motif
Network of associatons between targets according to the STRING database.
First level regulatory network of TFAP2C
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 8.4 | 67.3 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 7.4 | 29.7 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 6.9 | 20.8 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 5.8 | 29.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 5.5 | 5.5 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 5.4 | 16.3 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 5.4 | 16.3 | GO:0070662 | mast cell proliferation(GO:0070662) |
| 5.2 | 15.6 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 5.2 | 31.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 5.1 | 30.5 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 5.0 | 15.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 4.6 | 18.3 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 4.5 | 18.1 | GO:0052031 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 4.3 | 13.0 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 4.3 | 4.3 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 4.1 | 4.1 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 4.0 | 12.1 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 4.0 | 11.9 | GO:1902771 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 3.9 | 15.7 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 3.8 | 19.2 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
| 3.8 | 19.1 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 3.8 | 11.4 | GO:0061011 | hepatic duct development(GO:0061011) |
| 3.8 | 15.2 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 3.8 | 19.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 3.6 | 21.7 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 3.6 | 14.4 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 3.5 | 3.5 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 3.5 | 10.5 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 3.5 | 10.5 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 3.4 | 10.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 3.2 | 12.9 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 3.2 | 19.1 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 3.1 | 18.9 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 3.1 | 6.3 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 3.1 | 9.4 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 3.1 | 6.2 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 3.1 | 12.4 | GO:0032764 | negative regulation of mast cell cytokine production(GO:0032764) |
| 3.0 | 29.9 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 3.0 | 9.0 | GO:2000307 | tumor necrosis factor (ligand) superfamily member 11 production(GO:0072535) regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000307) |
| 3.0 | 8.9 | GO:0060005 | vestibular reflex(GO:0060005) |
| 2.9 | 8.8 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) |
| 2.9 | 8.7 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 2.9 | 17.2 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 2.8 | 13.9 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 2.8 | 8.3 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 2.7 | 8.2 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 2.7 | 16.3 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 2.7 | 8.1 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 2.7 | 13.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 2.6 | 10.5 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 2.6 | 18.3 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 2.6 | 2.6 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 2.6 | 2.6 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 2.6 | 13.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 2.6 | 7.8 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 2.6 | 15.5 | GO:0035603 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 2.6 | 7.8 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 2.6 | 10.3 | GO:0021759 | globus pallidus development(GO:0021759) |
| 2.6 | 33.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 2.6 | 7.7 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 2.5 | 7.6 | GO:0051939 | gamma-aminobutyric acid import(GO:0051939) |
| 2.5 | 10.2 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 2.5 | 2.5 | GO:0070316 | regulation of G0 to G1 transition(GO:0070316) |
| 2.5 | 17.2 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 2.4 | 4.9 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 2.4 | 12.0 | GO:1902996 | regulation of neurofibrillary tangle assembly(GO:1902996) |
| 2.4 | 50.6 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 2.4 | 2.4 | GO:0051877 | pigment granule aggregation in cell center(GO:0051877) |
| 2.4 | 7.1 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 2.4 | 16.5 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 2.3 | 44.6 | GO:0097320 | membrane tubulation(GO:0097320) |
| 2.3 | 16.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 2.3 | 7.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 2.3 | 27.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 2.3 | 9.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 2.2 | 2.2 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 2.2 | 6.7 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 2.2 | 15.5 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 2.2 | 8.8 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 2.2 | 21.7 | GO:0033227 | dsRNA transport(GO:0033227) |
| 2.2 | 2.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 2.2 | 12.9 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 2.1 | 8.5 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 2.1 | 10.6 | GO:0001315 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 2.1 | 31.6 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 2.1 | 44.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 2.1 | 4.2 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 2.1 | 6.2 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 2.1 | 6.2 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 2.1 | 6.2 | GO:0071529 | cementum mineralization(GO:0071529) |
| 2.1 | 6.2 | GO:0098758 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 2.1 | 6.2 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 2.0 | 8.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) negative regulation of G-protein coupled receptor internalization(GO:1904021) |
| 2.0 | 6.1 | GO:0019482 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) beta-alanine metabolic process(GO:0019482) thymine metabolic process(GO:0019859) |
| 2.0 | 6.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 2.0 | 14.2 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 2.0 | 6.1 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
| 2.0 | 8.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 2.0 | 6.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 2.0 | 13.8 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 2.0 | 5.9 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 1.9 | 11.7 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 1.9 | 13.6 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 1.9 | 5.8 | GO:1902809 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 1.9 | 19.3 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 1.9 | 5.8 | GO:1990637 | response to prolactin(GO:1990637) |
| 1.9 | 3.8 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 1.9 | 5.7 | GO:0019075 | virus maturation(GO:0019075) |
| 1.9 | 5.7 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 1.9 | 5.7 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 1.9 | 7.6 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 1.9 | 9.5 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 1.9 | 5.6 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
| 1.9 | 11.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 1.8 | 5.5 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 1.8 | 12.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 1.8 | 1.8 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 1.8 | 7.3 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 1.8 | 5.5 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 1.8 | 5.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 1.8 | 10.9 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 1.8 | 1.8 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 1.8 | 14.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 1.8 | 3.6 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 1.8 | 1.8 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 1.8 | 5.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 1.8 | 3.5 | GO:0032762 | mast cell cytokine production(GO:0032762) |
| 1.8 | 5.3 | GO:0019046 | release from viral latency(GO:0019046) |
| 1.8 | 7.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.8 | 33.6 | GO:0015671 | oxygen transport(GO:0015671) |
| 1.8 | 7.0 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 1.7 | 10.4 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 1.7 | 8.7 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 1.7 | 5.2 | GO:0036048 | protein demalonylation(GO:0036046) peptidyl-lysine demalonylation(GO:0036047) protein desuccinylation(GO:0036048) peptidyl-lysine desuccinylation(GO:0036049) protein deglutarylation(GO:0061698) peptidyl-lysine deglutarylation(GO:0061699) |
| 1.7 | 3.4 | GO:0002767 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 1.7 | 5.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 1.7 | 5.1 | GO:0008355 | olfactory learning(GO:0008355) |
| 1.7 | 5.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 1.7 | 5.1 | GO:2001303 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 1.7 | 6.8 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 1.7 | 8.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 1.7 | 8.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 1.7 | 6.6 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 1.7 | 16.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 1.7 | 14.9 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 1.6 | 1.6 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 1.6 | 11.4 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 1.6 | 1.6 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
| 1.6 | 21.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 1.6 | 6.5 | GO:1900166 | glial cell-derived neurotrophic factor secretion(GO:0044467) regulation of glial cell-derived neurotrophic factor secretion(GO:1900166) positive regulation of glial cell-derived neurotrophic factor secretion(GO:1900168) |
| 1.6 | 6.4 | GO:0071110 | protein biotinylation(GO:0009305) histone biotinylation(GO:0071110) |
| 1.6 | 6.4 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 1.6 | 7.9 | GO:0035624 | receptor transactivation(GO:0035624) |
| 1.6 | 11.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 1.6 | 11.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 1.6 | 4.7 | GO:0036510 | trimming of terminal mannose on C branch(GO:0036510) |
| 1.6 | 1.6 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 1.6 | 3.1 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 1.6 | 1.6 | GO:1904432 | positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
| 1.5 | 6.2 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 1.5 | 12.3 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 1.5 | 4.6 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 1.5 | 27.6 | GO:0097186 | amelogenesis(GO:0097186) |
| 1.5 | 47.0 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 1.5 | 9.1 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 1.5 | 6.0 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 1.5 | 1.5 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 1.5 | 7.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 1.5 | 11.7 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 1.5 | 11.7 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 1.5 | 4.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 1.5 | 5.8 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 1.5 | 14.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 1.5 | 4.4 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 1.5 | 2.9 | GO:0070055 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 1.4 | 30.4 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 1.4 | 7.1 | GO:0035802 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 1.4 | 12.8 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 1.4 | 2.8 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 1.4 | 22.4 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 1.4 | 13.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 1.4 | 9.7 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 1.4 | 4.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 1.4 | 5.5 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 1.4 | 30.4 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 1.4 | 22.0 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 1.4 | 2.7 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 1.4 | 4.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 1.4 | 1.4 | GO:0033058 | directional locomotion(GO:0033058) |
| 1.3 | 2.7 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 1.3 | 5.4 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 1.3 | 4.0 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 1.3 | 5.3 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 1.3 | 3.9 | GO:0099541 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 1.3 | 2.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 1.3 | 20.7 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 1.3 | 3.9 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 1.3 | 5.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 1.3 | 3.8 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 1.3 | 6.4 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 1.3 | 15.2 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 1.3 | 1.3 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 1.2 | 12.5 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 1.2 | 3.7 | GO:0051710 | regulation of cytolysis in other organism(GO:0051710) |
| 1.2 | 1.2 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 1.2 | 7.4 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 1.2 | 8.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 1.2 | 7.4 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 1.2 | 17.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 1.2 | 6.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 1.2 | 9.8 | GO:0006561 | proline biosynthetic process(GO:0006561) L-proline biosynthetic process(GO:0055129) |
| 1.2 | 3.7 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
| 1.2 | 2.4 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 1.2 | 3.6 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 1.2 | 26.2 | GO:0097503 | sialylation(GO:0097503) |
| 1.2 | 4.8 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 1.2 | 5.9 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 1.2 | 9.5 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 1.2 | 3.6 | GO:0002415 | immunoglobulin transcytosis in epithelial cells(GO:0002414) immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 1.2 | 4.7 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 1.2 | 2.4 | GO:0072014 | proximal tubule development(GO:0072014) |
| 1.2 | 17.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 1.2 | 3.5 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 1.2 | 7.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
| 1.2 | 9.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 1.2 | 10.4 | GO:0030822 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) |
| 1.1 | 2.3 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 1.1 | 19.5 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 1.1 | 3.4 | GO:0072300 | regulation of metanephric glomerulus development(GO:0072298) positive regulation of metanephric glomerulus development(GO:0072300) |
| 1.1 | 4.5 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 1.1 | 11.2 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 1.1 | 2.2 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 1.1 | 3.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 1.1 | 6.7 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 1.1 | 2.2 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 1.1 | 2.2 | GO:2000583 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 1.1 | 3.3 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 1.1 | 9.8 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 1.1 | 11.9 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 1.1 | 5.4 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 1.1 | 13.0 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 1.1 | 6.5 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 1.1 | 6.5 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 1.1 | 4.3 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 1.1 | 12.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 1.1 | 3.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 1.1 | 5.4 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 1.1 | 15.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 1.1 | 1.1 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.1 | 2.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 1.1 | 9.6 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 1.1 | 5.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 1.1 | 6.4 | GO:0097338 | response to clozapine(GO:0097338) |
| 1.1 | 4.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 1.1 | 11.6 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 1.1 | 8.4 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 1.1 | 15.8 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 1.0 | 2.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 1.0 | 17.6 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 1.0 | 3.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 1.0 | 38.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 1.0 | 15.3 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 1.0 | 3.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 1.0 | 3.0 | GO:0009386 | translational attenuation(GO:0009386) |
| 1.0 | 3.0 | GO:0035607 | vacuolar phosphate transport(GO:0007037) fibroblast growth factor receptor signaling pathway involved in orbitofrontal cortex development(GO:0035607) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 1.0 | 11.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 1.0 | 5.0 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 1.0 | 1.0 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 1.0 | 3.0 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 1.0 | 9.9 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 1.0 | 89.3 | GO:0032945 | negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) |
| 1.0 | 3.0 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.0 | 4.9 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 1.0 | 19.8 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 1.0 | 2.0 | GO:0019230 | proprioception(GO:0019230) |
| 1.0 | 2.9 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 1.0 | 43.1 | GO:0060119 | inner ear receptor cell development(GO:0060119) |
| 1.0 | 9.8 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 1.0 | 3.9 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 1.0 | 4.8 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 1.0 | 1.9 | GO:0090291 | negative regulation of osteoclast proliferation(GO:0090291) |
| 1.0 | 7.7 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 1.0 | 8.6 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 1.0 | 5.7 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.9 | 10.4 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.9 | 14.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.9 | 16.0 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.9 | 2.8 | GO:0001207 | histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.9 | 1.9 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.9 | 2.8 | GO:1900920 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.9 | 21.5 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.9 | 2.8 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.9 | 2.8 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.9 | 9.3 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.9 | 6.5 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.9 | 5.5 | GO:1902731 | negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.9 | 1.8 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.9 | 21.0 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.9 | 4.6 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.9 | 3.6 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.9 | 7.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.9 | 1.8 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.9 | 3.6 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) |
| 0.9 | 8.9 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.9 | 24.8 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.9 | 5.3 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.9 | 6.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.9 | 7.8 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.9 | 5.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.9 | 3.4 | GO:0043697 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.9 | 32.7 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.9 | 9.5 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.9 | 7.7 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.9 | 6.0 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.9 | 2.6 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.8 | 3.4 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
| 0.8 | 1.7 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.8 | 4.2 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.8 | 2.5 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) growth plate cartilage chondrocyte development(GO:0003431) |
| 0.8 | 1.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.8 | 10.9 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.8 | 5.0 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.8 | 10.9 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.8 | 7.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.8 | 3.3 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.8 | 5.0 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.8 | 24.1 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.8 | 3.3 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.8 | 4.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.8 | 3.3 | GO:0010650 | positive regulation of cell communication by electrical coupling(GO:0010650) maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.8 | 8.3 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.8 | 10.7 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.8 | 6.6 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.8 | 1.6 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.8 | 4.1 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.8 | 3.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.8 | 2.5 | GO:0006683 | galactosylceramide catabolic process(GO:0006683) |
| 0.8 | 4.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.8 | 2.5 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.8 | 5.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.8 | 8.9 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.8 | 4.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.8 | 5.7 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.8 | 4.8 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.8 | 1.6 | GO:0061582 | intestinal epithelial cell migration(GO:0061582) |
| 0.8 | 3.2 | GO:0010748 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.8 | 1.6 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.8 | 13.6 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.8 | 7.1 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.8 | 7.9 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.8 | 3.9 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.8 | 3.1 | GO:1903631 | regulation of calcium-dependent ATPase activity(GO:1903610) negative regulation of calcium-dependent ATPase activity(GO:1903611) regulation of dUTP diphosphatase activity(GO:1903627) positive regulation of dUTP diphosphatase activity(GO:1903629) negative regulation of aminoacyl-tRNA ligase activity(GO:1903631) regulation of leucine-tRNA ligase activity(GO:1903633) negative regulation of leucine-tRNA ligase activity(GO:1903634) |
| 0.8 | 3.9 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
| 0.8 | 1.6 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.8 | 9.4 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.8 | 10.1 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.8 | 27.3 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.8 | 0.8 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.8 | 2.3 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.8 | 15.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.8 | 1.5 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.8 | 2.3 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.8 | 1.5 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.8 | 17.7 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.8 | 6.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.8 | 6.9 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.8 | 5.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.8 | 2.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.8 | 9.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.8 | 3.8 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.8 | 0.8 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.8 | 3.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.8 | 3.8 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
| 0.7 | 6.7 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.7 | 2.2 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) regulation of melanosome transport(GO:1902908) |
| 0.7 | 2.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.7 | 3.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.7 | 4.5 | GO:0042436 | tryptophan catabolic process(GO:0006569) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.7 | 2.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.7 | 2.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.7 | 5.9 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.7 | 2.2 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.7 | 3.6 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.7 | 2.2 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.7 | 7.2 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.7 | 0.7 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.7 | 2.9 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.7 | 2.9 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.7 | 0.7 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.7 | 5.0 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.7 | 5.6 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.7 | 6.3 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 0.7 | 3.5 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.7 | 2.8 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.7 | 2.1 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.7 | 2.8 | GO:0048304 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.7 | 6.2 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.7 | 2.8 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.7 | 9.5 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.7 | 20.4 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.7 | 2.0 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
| 0.7 | 4.8 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
| 0.7 | 2.0 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.7 | 20.2 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.7 | 5.4 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.7 | 6.0 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.7 | 6.7 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.7 | 10.0 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.7 | 7.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.7 | 4.0 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.7 | 27.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.7 | 3.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) histone H2A phosphorylation(GO:1990164) |
| 0.7 | 5.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.7 | 8.5 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.7 | 8.5 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.7 | 2.0 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.6 | 4.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.6 | 3.9 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.6 | 2.6 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.6 | 4.5 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.6 | 2.5 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.6 | 11.4 | GO:0010518 | positive regulation of phospholipase activity(GO:0010518) |
| 0.6 | 2.5 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.6 | 3.8 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.6 | 5.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.6 | 3.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.6 | 4.4 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.6 | 2.5 | GO:1901838 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.6 | 7.4 | GO:0061756 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.6 | 6.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.6 | 42.0 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.6 | 4.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.6 | 2.4 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 0.6 | 2.4 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.6 | 1.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.6 | 4.2 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.6 | 4.7 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.6 | 1.8 | GO:0007343 | egg activation(GO:0007343) interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.6 | 5.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.6 | 7.0 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.6 | 4.6 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.6 | 3.4 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.6 | 6.8 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
| 0.6 | 1.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.6 | 3.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.6 | 2.2 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.6 | 1.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.6 | 1.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.6 | 4.4 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.6 | 6.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.5 | 11.5 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.5 | 4.4 | GO:0007135 | meiosis II(GO:0007135) |
| 0.5 | 1.1 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.5 | 7.5 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.5 | 7.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.5 | 1.6 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.5 | 2.1 | GO:1903038 | negative regulation of leukocyte cell-cell adhesion(GO:1903038) |
| 0.5 | 5.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.5 | 9.6 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.5 | 10.6 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.5 | 1.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.5 | 1.6 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.5 | 14.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.5 | 21.8 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.5 | 1.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.5 | 3.1 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.5 | 8.2 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.5 | 6.7 | GO:0051923 | sulfation(GO:0051923) |
| 0.5 | 1.0 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.5 | 1.5 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.5 | 10.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.5 | 4.6 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.5 | 11.3 | GO:0034204 | lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
| 0.5 | 3.5 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
| 0.5 | 8.5 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.5 | 5.0 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.5 | 2.0 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.5 | 2.0 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
| 0.5 | 5.0 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) |
| 0.5 | 13.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.5 | 6.9 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.5 | 3.5 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.5 | 6.4 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.5 | 9.8 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) glycosaminoglycan biosynthetic process(GO:0006024) |
| 0.5 | 4.9 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.5 | 3.4 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.5 | 9.3 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.5 | 2.9 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.5 | 4.4 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.5 | 1.5 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.5 | 1.9 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.5 | 2.9 | GO:0015840 | urea transport(GO:0015840) |
| 0.5 | 11.5 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.5 | 3.3 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.5 | 2.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.5 | 8.0 | GO:0051004 | regulation of lipoprotein lipase activity(GO:0051004) |
| 0.5 | 1.4 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.5 | 2.8 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.5 | 2.8 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) chondroitin sulfate proteoglycan metabolic process(GO:0050654) |
| 0.5 | 1.8 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
| 0.5 | 2.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.5 | 0.5 | GO:0021707 | cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.5 | 9.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.5 | 3.6 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.5 | 3.6 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
| 0.5 | 2.7 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.5 | 2.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.5 | 2.7 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.5 | 0.9 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.5 | 6.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.4 | 4.0 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.4 | 4.4 | GO:1902285 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
| 0.4 | 1.3 | GO:0030432 | peristalsis(GO:0030432) |
| 0.4 | 14.4 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.4 | 1.3 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.4 | 3.5 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.4 | 1.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.4 | 2.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.4 | 3.0 | GO:0032367 | intracellular sterol transport(GO:0032366) intracellular cholesterol transport(GO:0032367) |
| 0.4 | 6.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.4 | 17.9 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.4 | 1.3 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.4 | 0.8 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.4 | 3.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.4 | 1.6 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.4 | 3.7 | GO:0030903 | notochord development(GO:0030903) |
| 0.4 | 1.2 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.4 | 2.9 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.4 | 1.6 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.4 | 4.1 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.4 | 2.4 | GO:0098838 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.4 | 5.6 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.4 | 16.9 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.4 | 5.2 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.4 | 3.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.4 | 0.8 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
| 0.4 | 0.8 | GO:0033684 | regulation of luteinizing hormone secretion(GO:0033684) |
| 0.4 | 5.1 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.4 | 4.3 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.4 | 20.9 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.4 | 3.9 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.4 | 31.8 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.4 | 2.7 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.4 | 1.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.4 | 3.5 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.4 | 0.8 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.4 | 0.8 | GO:0002537 | nitric oxide production involved in inflammatory response(GO:0002537) |
| 0.4 | 1.5 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.4 | 11.7 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.4 | 4.9 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.4 | 3.0 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.4 | 22.4 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
| 0.4 | 2.6 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.4 | 5.9 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.4 | 13.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.4 | 2.2 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.4 | 4.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.4 | 4.7 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.4 | 3.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.4 | 1.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.4 | 2.5 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.4 | 3.3 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.4 | 1.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.4 | 0.7 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.4 | 6.8 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.4 | 1.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.4 | 9.6 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.4 | 2.8 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.4 | 1.4 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.4 | 4.6 | GO:0043217 | myelin maintenance(GO:0043217) |
| 0.4 | 5.6 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.3 | 29.0 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.3 | 1.4 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.3 | 7.7 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.3 | 1.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.3 | 1.7 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.3 | 1.0 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.3 | 3.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.3 | 16.6 | GO:0050709 | negative regulation of protein secretion(GO:0050709) |
| 0.3 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.3 | 3.0 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.3 | 12.0 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.3 | 5.6 | GO:0048278 | vesicle docking(GO:0048278) |
| 0.3 | 1.6 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.3 | 0.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.3 | 1.3 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.3 | 2.3 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.3 | 4.6 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.3 | 3.3 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.3 | 10.0 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
| 0.3 | 1.3 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.3 | 1.2 | GO:2000342 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.3 | 0.9 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.3 | 1.8 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.3 | 3.0 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.3 | 1.2 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.3 | 3.9 | GO:0021924 | cell proliferation in hindbrain(GO:0021534) cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.3 | 4.7 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.3 | 0.9 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.3 | 3.2 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.3 | 2.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 2.0 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.3 | 0.6 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.3 | 0.6 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.3 | 3.6 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.3 | 2.2 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.3 | 5.0 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.3 | 2.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 0.3 | 1.1 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.3 | 6.8 | GO:0003170 | heart valve development(GO:0003170) |
| 0.3 | 3.5 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.3 | 1.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.3 | 6.9 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.3 | 4.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.3 | 2.1 | GO:0002483 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.3 | 1.8 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.3 | 2.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.3 | 0.3 | GO:0048880 | sensory system development(GO:0048880) |
| 0.3 | 3.8 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.3 | 8.9 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.3 | 3.0 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.3 | 8.1 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.3 | 1.8 | GO:0030812 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.2 | 2.0 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.2 | 1.0 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 | 3.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 14.4 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.2 | 1.0 | GO:0032095 | regulation of response to food(GO:0032095) |
| 0.2 | 9.9 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.2 | 6.3 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.2 | 6.7 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
| 0.2 | 2.8 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.2 | 1.6 | GO:0015886 | heme transport(GO:0015886) |
| 0.2 | 3.7 | GO:0043030 | regulation of macrophage activation(GO:0043030) |
| 0.2 | 5.6 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.2 | 1.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.2 | 1.6 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.2 | 0.5 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.2 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.2 | 4.6 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.2 | 5.9 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.2 | 4.8 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 | 2.9 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.2 | 4.0 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.2 | 146.1 | GO:0043547 | positive regulation of GTPase activity(GO:0043547) |
| 0.2 | 1.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.2 | 0.7 | GO:0042427 | serotonin biosynthetic process(GO:0042427) |
| 0.2 | 2.6 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.2 | 0.6 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.2 | 3.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.2 | 3.9 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.2 | 2.0 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.2 | 1.2 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.2 | 1.2 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.2 | 9.9 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.2 | 2.5 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.2 | 7.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.2 | 2.8 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.2 | 1.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.2 | 4.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 | 2.8 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.2 | 2.2 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.2 | 2.9 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.2 | 0.7 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
| 0.2 | 2.4 | GO:0002718 | regulation of cytokine production involved in immune response(GO:0002718) |
| 0.2 | 1.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 0.6 | GO:0010922 | positive regulation of phosphatase activity(GO:0010922) |
| 0.2 | 0.5 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.2 | 5.6 | GO:0007041 | lysosomal transport(GO:0007041) |
| 0.2 | 0.6 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.2 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.2 | 2.4 | GO:2000828 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.9 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.1 | 3.4 | GO:0046473 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.1 | 2.7 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
| 0.1 | 0.7 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.9 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.1 | 1.6 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 0.1 | 1.1 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.4 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.1 | 1.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 1.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 15.6 | GO:0071805 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
| 0.1 | 0.7 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 0.7 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 1.7 | GO:0006751 | glutathione catabolic process(GO:0006751) leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 | 0.8 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 1.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 4.2 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.1 | 3.0 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.1 | 0.8 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 1.6 | GO:0046463 | triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 | 4.5 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.1 | 1.9 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.9 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 | 1.6 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 1.0 | GO:0071688 | myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 1.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.9 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.7 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 5.7 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.9 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 1.8 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.1 | 1.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 3.0 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.1 | 0.2 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) |
| 0.1 | 7.1 | GO:0006836 | neurotransmitter transport(GO:0006836) |
| 0.1 | 3.1 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.1 | 1.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 1.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 1.0 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 1.9 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.1 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 0.2 | GO:1901874 | negative regulation of post-translational protein modification(GO:1901874) |
| 0.1 | 0.5 | GO:0072393 | microtubule anchoring at centrosome(GO:0034454) microtubule anchoring at microtubule organizing center(GO:0072393) |
| 0.1 | 1.6 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 1.9 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.1 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 1.0 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.3 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.1 | 2.6 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.1 | 1.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 1.1 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.1 | 4.1 | GO:0005977 | glycogen metabolic process(GO:0005977) |
| 0.1 | 0.6 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.1 | 0.8 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.1 | 0.7 | GO:0097576 | vacuole fusion(GO:0097576) |
| 0.1 | 0.2 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.1 | 2.1 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.1 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.1 | GO:0000271 | polysaccharide biosynthetic process(GO:0000271) |
| 0.0 | 0.2 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.0 | 2.0 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.3 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.3 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.0 | 0.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.0 | 0.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.3 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.5 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.0 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.7 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.0 | 0.3 | GO:0009948 | anterior/posterior axis specification(GO:0009948) |
| 0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.2 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.0 | 0.4 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
| 0.0 | 0.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:0098937 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.0 | 0.6 | GO:0009583 | detection of light stimulus(GO:0009583) |
| 0.0 | 0.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.2 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 1.4 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.1 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.2 | 35.9 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 6.2 | 24.9 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 3.9 | 11.8 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 3.7 | 11.0 | GO:0071753 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 3.4 | 10.1 | GO:0060987 | lipid tube(GO:0060987) |
| 3.2 | 12.8 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 3.1 | 15.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 2.8 | 19.6 | GO:0032010 | phagolysosome(GO:0032010) |
| 2.7 | 16.4 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 2.6 | 7.9 | GO:0070701 | mucus layer(GO:0070701) |
| 2.5 | 9.8 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 2.4 | 46.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 2.4 | 7.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 2.4 | 19.0 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 2.3 | 11.4 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 2.2 | 13.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 2.1 | 8.4 | GO:0035363 | histone locus body(GO:0035363) |
| 2.1 | 71.0 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 2.1 | 54.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 2.0 | 6.0 | GO:0032116 | SMC loading complex(GO:0032116) |
| 2.0 | 14.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 2.0 | 11.7 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 2.0 | 9.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 1.9 | 11.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 1.9 | 7.7 | GO:0071942 | XPC complex(GO:0071942) |
| 1.8 | 5.5 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 1.8 | 9.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 1.7 | 19.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 1.6 | 3.2 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 1.6 | 11.2 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 1.5 | 6.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 1.5 | 22.6 | GO:0097433 | dense body(GO:0097433) |
| 1.5 | 1.5 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 1.4 | 4.3 | GO:0033010 | paranodal junction(GO:0033010) |
| 1.4 | 11.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 1.4 | 20.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 1.3 | 4.0 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 1.3 | 6.7 | GO:0097513 | myosin II filament(GO:0097513) |
| 1.3 | 14.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 1.3 | 17.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 1.3 | 7.8 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 1.3 | 7.8 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 1.3 | 10.4 | GO:0071565 | nBAF complex(GO:0071565) |
| 1.3 | 15.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 1.3 | 8.8 | GO:0033270 | paranode region of axon(GO:0033270) |
| 1.2 | 3.6 | GO:0043293 | apoptosome(GO:0043293) |
| 1.2 | 6.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 1.2 | 3.6 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 1.2 | 29.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 1.2 | 18.9 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 1.2 | 7.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 1.1 | 6.8 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 1.1 | 10.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 1.1 | 12.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 1.1 | 10.9 | GO:0032059 | bleb(GO:0032059) |
| 1.1 | 3.2 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 1.1 | 2.1 | GO:0044308 | axonal spine(GO:0044308) |
| 1.1 | 5.3 | GO:0072534 | perineuronal net(GO:0072534) |
| 1.1 | 5.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 1.0 | 4.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 1.0 | 2.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 1.0 | 9.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 1.0 | 10.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 1.0 | 24.5 | GO:0097386 | glial cell projection(GO:0097386) |
| 1.0 | 11.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 1.0 | 12.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 1.0 | 5.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 1.0 | 35.0 | GO:0030673 | axolemma(GO:0030673) |
| 1.0 | 4.8 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.9 | 2.8 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.9 | 13.6 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.9 | 21.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.9 | 30.4 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.9 | 11.6 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.9 | 3.5 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.8 | 5.0 | GO:0033063 | DNA recombinase mediator complex(GO:0033061) Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.8 | 14.0 | GO:0000145 | exocyst(GO:0000145) |
| 0.8 | 5.7 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.8 | 4.9 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.8 | 12.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.8 | 40.2 | GO:0042571 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 0.8 | 19.0 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.8 | 11.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.8 | 5.4 | GO:1990745 | EARP complex(GO:1990745) |
| 0.8 | 19.2 | GO:0042627 | chylomicron(GO:0042627) |
| 0.8 | 6.9 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.8 | 5.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.8 | 3.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.7 | 4.4 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.7 | 16.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.7 | 7.3 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.7 | 15.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.7 | 5.0 | GO:0031256 | leading edge membrane(GO:0031256) |
| 0.7 | 4.9 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.7 | 4.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.7 | 2.8 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.7 | 13.0 | GO:0036038 | MKS complex(GO:0036038) |
| 0.7 | 4.1 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.7 | 6.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.7 | 5.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.7 | 2.0 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.7 | 4.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.7 | 32.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.7 | 19.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.7 | 3.9 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.6 | 3.8 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.6 | 7.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.6 | 2.5 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.6 | 1.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.6 | 5.5 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.6 | 8.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.6 | 24.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.6 | 4.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.6 | 11.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.6 | 4.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.6 | 10.1 | GO:0043218 | compact myelin(GO:0043218) |
| 0.6 | 2.8 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.5 | 8.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.5 | 1.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.5 | 3.8 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.5 | 2.2 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.5 | 13.4 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.5 | 5.9 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.5 | 3.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.5 | 2.6 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.5 | 2.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.5 | 7.8 | GO:0030478 | actin cap(GO:0030478) |
| 0.5 | 3.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.5 | 5.7 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.5 | 3.6 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.5 | 4.6 | GO:0045180 | basal cortex(GO:0045180) |
| 0.5 | 22.4 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.5 | 2.0 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.5 | 0.5 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.5 | 1.5 | GO:0055087 | Ski complex(GO:0055087) |
| 0.5 | 35.9 | GO:0005902 | microvillus(GO:0005902) |
| 0.5 | 2.9 | GO:0060091 | kinocilium(GO:0060091) |
| 0.5 | 2.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.5 | 4.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.5 | 30.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.5 | 10.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.5 | 1.9 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.5 | 9.4 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.5 | 3.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.5 | 7.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.5 | 4.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.5 | 27.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.5 | 3.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.5 | 11.9 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.5 | 3.6 | GO:0031045 | dense core granule(GO:0031045) |
| 0.5 | 5.0 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.4 | 23.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.4 | 6.6 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.4 | 2.2 | GO:0032807 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
| 0.4 | 7.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.4 | 2.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.4 | 2.6 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.4 | 3.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.4 | 7.8 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.4 | 1.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.4 | 5.9 | GO:0005883 | neurofilament(GO:0005883) |
| 0.4 | 35.8 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.4 | 15.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.4 | 10.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.4 | 27.8 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.4 | 4.5 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.4 | 4.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.4 | 48.0 | GO:0034705 | voltage-gated potassium channel complex(GO:0008076) potassium channel complex(GO:0034705) |
| 0.4 | 3.3 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.4 | 8.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.4 | 2.8 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.4 | 7.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.4 | 9.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.4 | 5.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.4 | 4.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.4 | 5.8 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.4 | 3.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.4 | 51.1 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.4 | 1.4 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.4 | 25.3 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.4 | 3.2 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.3 | 1.0 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.3 | 1.4 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.3 | 7.2 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.3 | 1.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.3 | 1.0 | GO:0033167 | ARC complex(GO:0033167) |
| 0.3 | 3.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.3 | 16.7 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.3 | 2.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.3 | 14.7 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.3 | 16.0 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.3 | 3.6 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.3 | 19.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.3 | 13.0 | GO:0043235 | receptor complex(GO:0043235) |
| 0.3 | 1.8 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.3 | 3.9 | GO:0071437 | invadopodium(GO:0071437) |
| 0.3 | 42.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.3 | 0.8 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.3 | 13.0 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.3 | 15.0 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.3 | 2.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.3 | 13.0 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.3 | 18.1 | GO:0005776 | autophagosome(GO:0005776) |
| 0.2 | 27.8 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.2 | 37.9 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.2 | 0.7 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.2 | 2.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.2 | 2.6 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.2 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 148.1 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.2 | 6.1 | GO:0016459 | myosin complex(GO:0016459) |
| 0.2 | 4.5 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.2 | 2.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.2 | 11.5 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.2 | 12.9 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.2 | 25.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.2 | 2.8 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.2 | 3.7 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.2 | 8.5 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.2 | 3.8 | GO:0097546 | ciliary base(GO:0097546) |
| 0.2 | 10.3 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.2 | 1.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.2 | 2.6 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.2 | 1.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.2 | 56.2 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.2 | 22.7 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.2 | 29.5 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.2 | 3.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.2 | 2.6 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 3.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.2 | 0.5 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.2 | 2.9 | GO:0070461 | SAGA-type complex(GO:0070461) |
| 0.1 | 1.6 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.1 | GO:0032797 | SMN complex(GO:0032797) |
| 0.1 | 0.7 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.1 | 0.7 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.1 | 4.5 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 7.0 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.2 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.6 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 2.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.8 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 1.6 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 5.7 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.1 | 0.3 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 16.8 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.1 | 0.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 1.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.4 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 1.5 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 45.6 | GO:0031226 | intrinsic component of plasma membrane(GO:0031226) |
| 0.0 | 12.2 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 1.1 | GO:0005882 | intermediate filament(GO:0005882) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 16.8 | 67.3 | GO:0008832 | dGTPase activity(GO:0008832) triphosphoric monoester hydrolase activity(GO:0016793) guanyl deoxyribonucleotide binding(GO:0032560) dGTP binding(GO:0032567) |
| 7.4 | 29.7 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 7.1 | 21.2 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 6.3 | 25.3 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 5.7 | 22.9 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 5.1 | 35.9 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 5.0 | 15.1 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 5.0 | 15.0 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 4.9 | 14.6 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 4.8 | 28.8 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 4.6 | 13.8 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 4.2 | 25.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) beta-adrenergic receptor kinase activity(GO:0047696) |
| 3.9 | 15.7 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 3.9 | 15.5 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 3.5 | 10.5 | GO:0032093 | SAM domain binding(GO:0032093) |
| 3.4 | 17.2 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 3.4 | 20.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 3.3 | 9.9 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 3.3 | 9.8 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 3.2 | 16.0 | GO:0004803 | transposase activity(GO:0004803) |
| 3.1 | 18.8 | GO:0070728 | leucine binding(GO:0070728) |
| 3.1 | 34.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 2.8 | 17.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 2.8 | 11.2 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 2.8 | 11.1 | GO:1904492 | Ac-Asp-Glu binding(GO:1904492) tetrahydrofolyl-poly(glutamate) polymer binding(GO:1904493) |
| 2.7 | 8.2 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
| 2.7 | 16.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 2.7 | 24.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 2.6 | 31.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 2.6 | 7.8 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 2.6 | 54.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 2.6 | 18.0 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 2.6 | 10.3 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 2.5 | 7.6 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 2.5 | 7.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 2.5 | 2.5 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 2.5 | 7.4 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 2.5 | 19.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 2.4 | 19.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 2.4 | 7.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 2.4 | 26.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 2.4 | 11.8 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 2.4 | 11.8 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 2.3 | 9.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 2.3 | 11.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 2.3 | 16.3 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 2.3 | 44.3 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 2.3 | 11.6 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
| 2.3 | 11.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 2.3 | 9.2 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 2.3 | 11.4 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 2.3 | 13.6 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 2.2 | 20.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 2.2 | 33.6 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 2.2 | 8.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 2.2 | 2.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 2.2 | 4.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 2.1 | 8.5 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 2.1 | 6.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 2.1 | 14.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 2.0 | 6.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 2.0 | 28.4 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 2.0 | 14.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 2.0 | 22.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 2.0 | 8.0 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 2.0 | 9.8 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 1.9 | 7.8 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 1.9 | 3.9 | GO:0050473 | arachidonate 15-lipoxygenase activity(GO:0050473) |
| 1.9 | 17.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 1.9 | 7.6 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 1.9 | 7.5 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 1.9 | 9.3 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 1.8 | 12.9 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) thymidine kinase activity(GO:0004797) |
| 1.8 | 14.7 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 1.8 | 5.5 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 1.8 | 9.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 1.8 | 5.4 | GO:0017129 | triglyceride binding(GO:0017129) |
| 1.8 | 5.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 1.8 | 8.8 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 1.7 | 21.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 1.7 | 5.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 1.7 | 5.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 1.7 | 8.7 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 1.7 | 5.2 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 1.7 | 5.2 | GO:0036055 | protein-malonyllysine demalonylase activity(GO:0036054) protein-succinyllysine desuccinylase activity(GO:0036055) protein-glutaryllysine deglutarylase activity(GO:0061697) |
| 1.7 | 10.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 1.7 | 11.9 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 1.7 | 5.1 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
| 1.7 | 39.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 1.7 | 5.1 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 1.7 | 6.8 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 1.6 | 8.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 1.6 | 13.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 1.6 | 90.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 1.6 | 9.8 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 1.6 | 19.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 1.6 | 14.4 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 1.6 | 6.4 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 1.6 | 6.4 | GO:0004079 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 1.6 | 9.5 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 1.6 | 14.2 | GO:0045125 | sphingosine-1-phosphate receptor activity(GO:0038036) bioactive lipid receptor activity(GO:0045125) |
| 1.5 | 10.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 1.5 | 7.7 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 1.5 | 6.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 1.5 | 7.5 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 1.5 | 6.0 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 1.5 | 7.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 1.5 | 5.9 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 1.5 | 11.9 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 1.5 | 8.8 | GO:0052811 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
| 1.5 | 5.8 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 1.4 | 7.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 1.4 | 5.8 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 1.4 | 45.2 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 1.4 | 5.6 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 1.4 | 11.2 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 1.4 | 9.6 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 1.4 | 6.8 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 1.4 | 5.4 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 1.3 | 18.9 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 1.3 | 9.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 1.3 | 4.0 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 1.3 | 3.9 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 1.3 | 22.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 1.3 | 6.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 1.3 | 10.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 1.3 | 22.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 1.3 | 11.3 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 1.3 | 3.8 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 1.2 | 10.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 1.2 | 23.4 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 1.2 | 4.8 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 1.2 | 59.0 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 1.2 | 4.8 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 1.2 | 8.3 | GO:0043199 | sulfate binding(GO:0043199) |
| 1.2 | 7.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 1.2 | 18.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 1.2 | 3.5 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 1.1 | 9.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 1.1 | 7.8 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 1.1 | 5.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 1.1 | 14.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 1.1 | 3.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 1.1 | 5.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 1.1 | 5.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 1.1 | 5.3 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) azole transmembrane transporter activity(GO:1901474) |
| 1.1 | 10.6 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 1.1 | 4.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 1.1 | 7.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 1.1 | 54.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 1.0 | 2.1 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) |
| 1.0 | 16.7 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 1.0 | 5.2 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 1.0 | 5.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 1.0 | 14.1 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
| 1.0 | 14.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 1.0 | 4.0 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 1.0 | 14.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 1.0 | 9.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 1.0 | 3.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 1.0 | 3.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 1.0 | 18.9 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 1.0 | 5.9 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 1.0 | 3.9 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 1.0 | 8.8 | GO:0016595 | glutamate binding(GO:0016595) |
| 1.0 | 28.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 1.0 | 11.4 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.9 | 32.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.9 | 5.7 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.9 | 4.7 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.9 | 8.4 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.9 | 2.8 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.9 | 6.5 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.9 | 3.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.9 | 2.7 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.9 | 6.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.9 | 7.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.9 | 5.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.9 | 24.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.9 | 3.6 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.9 | 4.4 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.9 | 7.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.9 | 2.6 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.9 | 24.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.9 | 7.9 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.9 | 7.8 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.9 | 22.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.9 | 5.2 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.9 | 7.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.9 | 3.5 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.9 | 7.8 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.9 | 9.5 | GO:0008061 | chitinase activity(GO:0004568) chitin binding(GO:0008061) |
| 0.9 | 3.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.8 | 24.5 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.8 | 11.8 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.8 | 5.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.8 | 3.3 | GO:0034648 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.8 | 2.5 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.8 | 2.5 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.8 | 23.8 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.8 | 2.5 | GO:0004336 | galactosylceramidase activity(GO:0004336) |
| 0.8 | 2.5 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-5 receptor activity(GO:0004914) |
| 0.8 | 44.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.8 | 2.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.8 | 2.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.8 | 13.4 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.8 | 3.9 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.8 | 3.1 | GO:0004341 | gluconolactonase activity(GO:0004341) |
| 0.8 | 3.9 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.8 | 2.3 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.8 | 3.8 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.8 | 4.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.8 | 4.5 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.8 | 4.5 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.8 | 3.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.7 | 8.9 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.7 | 13.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.7 | 2.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.7 | 8.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.7 | 4.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.7 | 2.2 | GO:0004915 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) ciliary neurotrophic factor binding(GO:0070119) |
| 0.7 | 1.5 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.7 | 4.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.7 | 8.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.7 | 6.3 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.7 | 2.8 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.7 | 4.9 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.7 | 9.0 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.7 | 5.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.7 | 6.9 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
| 0.7 | 6.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.7 | 2.7 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.7 | 10.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.7 | 4.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.7 | 3.3 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.7 | 0.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.6 | 3.9 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.6 | 5.8 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.6 | 1.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.6 | 1.3 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.6 | 10.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.6 | 8.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.6 | 3.1 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.6 | 9.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.6 | 1.8 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.6 | 3.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.6 | 1.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.6 | 6.7 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.6 | 2.4 | GO:0005163 | nerve growth factor receptor binding(GO:0005163) |
| 0.6 | 4.8 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.6 | 4.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.6 | 3.6 | GO:0050780 | dopamine receptor binding(GO:0050780) |
| 0.6 | 1.8 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.6 | 32.4 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.6 | 12.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.6 | 2.9 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.6 | 8.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.6 | 2.3 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.6 | 3.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.6 | 3.4 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.6 | 5.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.6 | 9.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.6 | 2.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.6 | 6.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.6 | 60.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.6 | 6.1 | GO:0019864 | IgG binding(GO:0019864) |
| 0.6 | 1.7 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.5 | 8.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.5 | 2.7 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.5 | 1.6 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.5 | 12.9 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.5 | 1.6 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.5 | 1.6 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.5 | 3.7 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.5 | 40.8 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.5 | 9.0 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.5 | 2.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.5 | 14.7 | GO:0005521 | lamin binding(GO:0005521) |
| 0.5 | 10.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.5 | 2.6 | GO:0052828 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.5 | 8.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.5 | 17.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.5 | 3.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.5 | 1.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.5 | 12.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.5 | 4.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.5 | 15.7 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.5 | 5.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.5 | 5.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.5 | 6.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.5 | 3.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.5 | 2.0 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.5 | 5.0 | GO:0019841 | retinol binding(GO:0019841) |
| 0.5 | 2.0 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.5 | 1.9 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.5 | 5.7 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.5 | 3.8 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.5 | 2.8 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) |
| 0.5 | 6.5 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.5 | 2.8 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.5 | 5.1 | GO:0034595 | phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
| 0.5 | 3.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.5 | 3.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.5 | 10.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.5 | 11.9 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.5 | 5.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.5 | 6.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.5 | 4.5 | GO:0015250 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
| 0.4 | 4.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.4 | 6.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.4 | 19.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.4 | 1.8 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.4 | 1.3 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.4 | 3.9 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.4 | 3.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.4 | 1.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.4 | 6.9 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.4 | 1.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.4 | 1.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.4 | 14.1 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.4 | 8.7 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.4 | 14.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.4 | 2.5 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.4 | 1.6 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.4 | 7.8 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.4 | 1.6 | GO:0004031 | aldehyde oxidase activity(GO:0004031) |
| 0.4 | 2.4 | GO:0050051 | alkane 1-monooxygenase activity(GO:0018685) leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.4 | 4.9 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.4 | 2.4 | GO:0015350 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.4 | 3.2 | GO:0089720 | caspase binding(GO:0089720) |
| 0.4 | 6.0 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.4 | 5.5 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.4 | 3.2 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.4 | 19.6 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.4 | 5.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.4 | 0.8 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.4 | 4.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.4 | 4.6 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.4 | 6.4 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.4 | 1.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.4 | 11.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.4 | 8.0 | GO:0071949 | FAD binding(GO:0071949) |
| 0.4 | 106.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.4 | 23.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.4 | 16.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.4 | 1.1 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) 5S rDNA binding(GO:0080084) |
| 0.4 | 1.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.4 | 9.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.4 | 10.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.4 | 42.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.3 | 18.5 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.3 | 1.0 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.3 | 39.2 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.3 | 6.5 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.3 | 6.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.3 | 1.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.3 | 2.6 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.3 | 8.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.3 | 2.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.3 | 9.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.3 | 1.9 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.3 | 1.9 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.3 | 5.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.3 | 5.9 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.3 | 1.2 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.3 | 0.9 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.3 | 0.9 | GO:0032427 | GBD domain binding(GO:0032427) apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
| 0.3 | 0.9 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.3 | 1.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.3 | 7.9 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.3 | 1.5 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.3 | 1.2 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.3 | 5.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.3 | 3.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.3 | 1.2 | GO:0052591 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.3 | 0.6 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.3 | 5.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.3 | 1.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.3 | 8.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.3 | 2.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.3 | 2.9 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.3 | 1.7 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.3 | 2.0 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.3 | 4.8 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.3 | 5.1 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.3 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.3 | 7.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.3 | 5.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.3 | 12.0 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.3 | 2.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.3 | 3.2 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.3 | 9.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.3 | 3.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.3 | 3.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.3 | 1.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.3 | 4.0 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.3 | 2.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.3 | 1.6 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.3 | 8.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.3 | 3.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.3 | 2.8 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.3 | 2.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.3 | 6.1 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.3 | 0.8 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) arginine transmembrane transporter activity(GO:0015181) |
| 0.3 | 1.5 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.3 | 2.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 4.0 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.2 | 2.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 1.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 9.1 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.2 | 24.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.2 | 4.9 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.2 | 1.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.2 | 11.1 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.2 | 0.7 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 2.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.2 | 2.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.2 | 4.1 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.2 | 0.9 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.2 | 8.1 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.2 | 1.8 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.2 | 2.9 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.2 | 5.2 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.2 | 4.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.2 | 1.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 3.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.2 | 0.6 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.2 | 2.9 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.2 | 1.9 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 1.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.2 | 2.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.2 | 0.6 | GO:0046577 | long-chain-alcohol oxidase activity(GO:0046577) |
| 0.2 | 0.6 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 5.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 256.0 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.2 | 1.6 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 2.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.2 | 31.5 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.2 | 1.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.2 | 3.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) ATPase regulator activity(GO:0060590) |
| 0.2 | 6.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.2 | 1.6 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.2 | 1.3 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.2 | 2.3 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.2 | 7.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.2 | 4.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.2 | 2.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.2 | 21.4 | GO:0005516 | calmodulin binding(GO:0005516) |
| 0.2 | 27.3 | GO:0005261 | cation channel activity(GO:0005261) |
| 0.2 | 37.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.2 | 2.2 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 0.8 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.2 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 1.9 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.1 | 0.7 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 1.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 2.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.7 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 1.1 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 0.7 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.7 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 6.5 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 1.7 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 1.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 1.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 1.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 2.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 2.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 1.1 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.7 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.1 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 1.0 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.1 | 2.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.7 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.6 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 3.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 0.7 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 1.8 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 0.8 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 2.7 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
| 0.1 | 0.7 | GO:0019158 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.7 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.1 | 0.9 | GO:0052742 | phosphatidylinositol kinase activity(GO:0052742) |
| 0.1 | 1.1 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.1 | 1.8 | GO:0042805 | actinin binding(GO:0042805) |
| 0.1 | 0.5 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.7 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.1 | 0.9 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.7 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.4 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 1.8 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 2.8 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.4 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 1.1 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.3 | GO:0030883 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.0 | 1.2 | GO:0042626 | ATPase activity, coupled to transmembrane movement of substances(GO:0042626) |
| 0.0 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 1.4 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 1.4 | GO:0004984 | olfactory receptor activity(GO:0004984) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.7 | 7.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 1.6 | 20.6 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 1.5 | 164.0 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 1.5 | 52.6 | PID EPO PATHWAY | EPO signaling pathway |
| 1.4 | 5.7 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 1.4 | 2.8 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 1.2 | 6.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 1.1 | 6.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 1.1 | 8.8 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 1.0 | 5.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 1.0 | 23.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.9 | 28.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.9 | 43.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.9 | 7.9 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.8 | 8.5 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.8 | 44.2 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.8 | 12.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.8 | 26.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.7 | 8.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.7 | 5.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.7 | 4.9 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.6 | 10.9 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.6 | 11.8 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.6 | 40.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.6 | 6.8 | PID BMP PATHWAY | BMP receptor signaling |
| 0.6 | 6.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.6 | 7.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.6 | 22.8 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.5 | 2.2 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.5 | 7.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.5 | 5.5 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.5 | 18.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.5 | 23.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.5 | 5.8 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.5 | 34.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.5 | 29.4 | PID FGF PATHWAY | FGF signaling pathway |
| 0.5 | 13.0 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.5 | 13.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.5 | 8.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.5 | 8.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.4 | 3.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.4 | 15.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.4 | 17.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.4 | 6.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.4 | 16.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.4 | 27.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.4 | 3.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.4 | 6.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.4 | 8.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.4 | 1.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.4 | 2.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.3 | 2.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.3 | 5.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.3 | 10.8 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.3 | 6.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.3 | 10.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.3 | 3.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.3 | 9.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.3 | 8.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.3 | 2.8 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.3 | 6.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.3 | 7.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.3 | 11.9 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.3 | 3.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.3 | 3.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.2 | 14.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.2 | 9.0 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.2 | 5.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 1.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 6.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.2 | 5.8 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.2 | 2.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.2 | 6.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.2 | 3.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.2 | 6.3 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.2 | 2.8 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.2 | 1.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.2 | 8.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.2 | 14.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 1.8 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.1 | 6.9 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 2.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 13.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 21.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 2.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.1 | 1.3 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 1.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.1 | 1.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 2.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.1 | 1.6 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 2.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 2.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.7 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 1.0 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 5.4 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 1.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 3.0 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 1.0 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.6 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 4.0 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 4.0 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 2.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 2.1 | 41.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 1.9 | 46.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 1.7 | 32.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 1.5 | 7.7 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 1.5 | 2.9 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 1.4 | 18.1 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 1.3 | 3.9 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 1.3 | 18.0 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 1.3 | 1.3 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 1.2 | 17.0 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 1.2 | 2.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 1.2 | 18.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 1.2 | 1.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 1.2 | 13.0 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 1.1 | 20.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 1.1 | 19.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 1.1 | 2.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 1.1 | 26.0 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 1.1 | 8.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 1.0 | 59.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 1.0 | 3.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 1.0 | 21.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 1.0 | 12.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 1.0 | 13.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 1.0 | 3.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.9 | 10.4 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.9 | 19.6 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.9 | 20.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.9 | 2.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.9 | 14.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.9 | 13.8 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.9 | 2.7 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.9 | 34.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.9 | 23.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.9 | 4.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.9 | 15.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.8 | 13.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.8 | 1.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.8 | 17.5 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.8 | 26.7 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.8 | 17.6 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.8 | 18.9 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.8 | 34.4 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.8 | 24.9 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.8 | 12.2 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.7 | 28.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.7 | 33.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.7 | 24.0 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.7 | 8.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.6 | 15.4 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.6 | 57.7 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.6 | 6.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.6 | 12.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.6 | 21.4 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.6 | 29.5 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.6 | 11.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.6 | 6.4 | REACTOME OPSINS | Genes involved in Opsins |
| 0.6 | 5.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.6 | 24.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.6 | 38.5 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
| 0.6 | 7.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.6 | 76.7 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.6 | 7.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.5 | 5.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.5 | 8.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.5 | 9.0 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.5 | 15.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.5 | 18.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.5 | 8.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.5 | 22.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.4 | 6.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.4 | 3.4 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
| 0.4 | 0.8 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
| 0.4 | 9.1 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.4 | 9.0 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.4 | 25.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.4 | 4.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.4 | 4.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.4 | 4.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.4 | 11.0 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.4 | 4.0 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.4 | 5.8 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.4 | 5.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.4 | 7.2 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.4 | 7.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.3 | 2.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.3 | 10.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.3 | 10.0 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.3 | 3.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.3 | 9.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.3 | 15.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.3 | 9.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.3 | 5.3 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.3 | 6.7 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.3 | 14.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.3 | 7.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.3 | 15.7 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
| 0.3 | 2.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.3 | 8.6 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.3 | 7.0 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.3 | 1.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.3 | 1.6 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.2 | 7.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.2 | 5.5 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.2 | 6.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.2 | 1.7 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.2 | 2.7 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.2 | 2.4 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 2.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 2.6 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.2 | 5.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.2 | 6.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.2 | 0.9 | REACTOME PI 3K CASCADE | Genes involved in PI-3K cascade |
| 0.2 | 10.3 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.2 | 1.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 2.5 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 1.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.2 | 4.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 11.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.2 | 3.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.2 | 3.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 4.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.2 | 15.1 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.2 | 6.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.2 | 1.6 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.2 | 2.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.2 | 1.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.2 | 3.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.2 | 14.7 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.2 | 0.8 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 3.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 2.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 2.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 3.6 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 3.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 6.4 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 12.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 7.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 1.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.1 | 7.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 2.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.7 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 4.7 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.1 | 1.6 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 2.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 22.2 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.1 | 1.2 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 2.0 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 2.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 3.1 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 1.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 19.9 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.1 | 8.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 1.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 0.7 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.5 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 1.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 10.0 | REACTOME GPCR DOWNSTREAM SIGNALING | Genes involved in GPCR downstream signaling |
| 0.0 | 1.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 1.8 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.3 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
| 0.0 | 2.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.3 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.9 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |