Project
SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for ID4_TCF4_SNAI2
Z-value: 1.69
Motif logo
Transcription factors associated with ID4_TCF4_SNAI2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ID4
|
ENSG00000172201.6 | inhibitor of DNA binding 4, HLH protein |
|
TCF4
|
ENSG00000196628.9 | transcription factor 4 |
|
SNAI2
|
ENSG00000019549.4 | snail family transcriptional repressor 2 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ID4 | hg19_v2_chr6_+_19837592_19837621 | 0.83 | 7.0e-06 | Click! |
| TCF4 | hg19_v2_chr18_-_53257027_53257052 | -0.72 | 3.6e-04 | Click! |
| SNAI2 | hg19_v2_chr8_-_49834299_49834446 | -0.52 | 1.8e-02 | Click! |
Activity profile of ID4_TCF4_SNAI2 motif
Sorted Z-values of ID4_TCF4_SNAI2 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr9_-_131940526 | 6.22 |
ENST00000372491.2
|
IER5L
|
immediate early response 5-like |
| chrX_-_153775426 | 5.70 |
ENST00000393562.2
|
G6PD
|
glucose-6-phosphate dehydrogenase |
| chr9_-_75567962 | 5.43 |
ENST00000297785.3
ENST00000376939.1 |
ALDH1A1
|
aldehyde dehydrogenase 1 family, member A1 |
| chr16_+_771663 | 5.42 |
ENST00000568916.1
|
FAM173A
|
family with sequence similarity 173, member A |
| chr12_+_52450298 | 4.92 |
ENST00000550582.2
|
NR4A1
|
nuclear receptor subfamily 4, group A, member 1 |
| chr17_+_43299241 | 4.65 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
| chr17_+_43299156 | 4.58 |
ENST00000331495.3
|
FMNL1
|
formin-like 1 |
| chr11_-_117698787 | 4.53 |
ENST00000260287.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr11_-_560703 | 4.50 |
ENST00000441853.1
ENST00000329451.3 |
C11orf35
|
chromosome 11 open reading frame 35 |
| chr14_+_75746781 | 4.45 |
ENST00000555347.1
|
FOS
|
FBJ murine osteosarcoma viral oncogene homolog |
| chr7_-_73184588 | 4.17 |
ENST00000395145.2
|
CLDN3
|
claudin 3 |
| chr14_+_75746340 | 4.14 |
ENST00000555686.1
ENST00000555672.1 |
FOS
|
FBJ murine osteosarcoma viral oncogene homolog |
| chr11_-_615570 | 4.10 |
ENST00000525445.1
ENST00000348655.6 ENST00000397566.1 |
IRF7
|
interferon regulatory factor 7 |
| chr1_+_8378140 | 4.09 |
ENST00000377479.2
|
SLC45A1
|
solute carrier family 45, member 1 |
| chr16_-_74808710 | 3.93 |
ENST00000219368.3
ENST00000544337.1 |
FA2H
|
fatty acid 2-hydroxylase |
| chr11_-_117698765 | 3.91 |
ENST00000532119.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr11_+_67776012 | 3.75 |
ENST00000539229.1
|
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
| chr17_-_72968809 | 3.75 |
ENST00000530857.1
ENST00000425042.2 |
HID1
|
HID1 domain containing |
| chr4_-_2420357 | 3.71 |
ENST00000511071.1
ENST00000509171.1 ENST00000290974.2 |
ZFYVE28
|
zinc finger, FYVE domain containing 28 |
| chr9_-_139940608 | 3.54 |
ENST00000371601.4
|
NPDC1
|
neural proliferation, differentiation and control, 1 |
| chr14_-_23288930 | 3.47 |
ENST00000554517.1
ENST00000285850.7 ENST00000397529.2 ENST00000555702.1 |
SLC7A7
|
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
| chr4_-_155533787 | 3.39 |
ENST00000407946.1
ENST00000405164.1 ENST00000336098.3 ENST00000393846.2 ENST00000404648.3 ENST00000443553.1 |
FGG
|
fibrinogen gamma chain |
| chr11_+_64879317 | 3.31 |
ENST00000526809.1
ENST00000279263.7 ENST00000524986.1 ENST00000534371.1 ENST00000540748.1 ENST00000525385.1 ENST00000345348.5 ENST00000531321.1 ENST00000529414.1 ENST00000526085.1 ENST00000530750.1 |
TM7SF2
|
transmembrane 7 superfamily member 2 |
| chr11_-_67275542 | 3.19 |
ENST00000531506.1
|
CDK2AP2
|
cyclin-dependent kinase 2 associated protein 2 |
| chr22_-_50970506 | 3.19 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr12_-_117537240 | 3.14 |
ENST00000392545.4
ENST00000541210.1 ENST00000335209.7 |
TESC
|
tescalcin |
| chr19_-_47735918 | 3.13 |
ENST00000449228.1
ENST00000300880.7 ENST00000341983.4 |
BBC3
|
BCL2 binding component 3 |
| chr6_-_31550192 | 3.08 |
ENST00000429299.2
ENST00000446745.2 |
LTB
|
lymphotoxin beta (TNF superfamily, member 3) |
| chr19_-_18391708 | 3.08 |
ENST00000600972.1
|
JUND
|
jun D proto-oncogene |
| chr17_+_73521763 | 3.05 |
ENST00000167462.5
ENST00000375227.4 ENST00000392550.3 ENST00000578363.1 ENST00000579392.1 |
LLGL2
|
lethal giant larvae homolog 2 (Drosophila) |
| chr7_+_29603394 | 3.05 |
ENST00000319694.2
|
PRR15
|
proline rich 15 |
| chr11_-_17410869 | 3.04 |
ENST00000528731.1
|
KCNJ11
|
potassium inwardly-rectifying channel, subfamily J, member 11 |
| chr17_+_77021702 | 3.01 |
ENST00000392445.2
ENST00000354124.3 |
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr11_-_417308 | 2.96 |
ENST00000397632.3
ENST00000382520.2 |
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chr22_-_30960876 | 2.95 |
ENST00000401975.1
ENST00000428682.1 ENST00000423299.1 |
GAL3ST1
|
galactose-3-O-sulfotransferase 1 |
| chr16_-_1968231 | 2.93 |
ENST00000443547.1
ENST00000293937.3 ENST00000454677.2 |
HS3ST6
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 6 |
| chr16_-_30022293 | 2.90 |
ENST00000565273.1
ENST00000567332.2 ENST00000350119.4 |
DOC2A
|
double C2-like domains, alpha |
| chr22_-_50970566 | 2.89 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr15_+_50474385 | 2.87 |
ENST00000267842.5
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
| chr19_-_10047219 | 2.86 |
ENST00000264833.4
|
OLFM2
|
olfactomedin 2 |
| chr2_-_133427767 | 2.85 |
ENST00000397463.2
|
LYPD1
|
LY6/PLAUR domain containing 1 |
| chr17_-_46703826 | 2.83 |
ENST00000550387.1
ENST00000311177.5 |
HOXB9
|
homeobox B9 |
| chr17_-_16256718 | 2.75 |
ENST00000476243.1
ENST00000299736.4 |
CENPV
|
centromere protein V |
| chr9_+_139847347 | 2.72 |
ENST00000371632.3
|
LCN12
|
lipocalin 12 |
| chr16_-_30394143 | 2.70 |
ENST00000321367.3
ENST00000571393.1 |
SEPT1
|
septin 1 |
| chr5_+_175223313 | 2.68 |
ENST00000359546.4
|
CPLX2
|
complexin 2 |
| chr7_+_150065278 | 2.66 |
ENST00000519397.1
ENST00000479668.1 ENST00000540729.1 |
REPIN1
|
replication initiator 1 |
| chr3_+_49059038 | 2.66 |
ENST00000451378.2
|
NDUFAF3
|
NADH dehydrogenase (ubiquinone) complex I, assembly factor 3 |
| chr15_+_50474412 | 2.62 |
ENST00000380902.4
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
| chr19_+_49055332 | 2.58 |
ENST00000201586.2
|
SULT2B1
|
sulfotransferase family, cytosolic, 2B, member 1 |
| chr19_+_38755042 | 2.57 |
ENST00000301244.7
|
SPINT2
|
serine peptidase inhibitor, Kunitz type, 2 |
| chr14_+_31343747 | 2.57 |
ENST00000216361.4
ENST00000396618.3 ENST00000475087.1 |
COCH
|
cochlin |
| chr20_-_4982132 | 2.56 |
ENST00000338244.1
ENST00000424750.2 |
SLC23A2
|
solute carrier family 23 (ascorbic acid transporter), member 2 |
| chr9_+_140317802 | 2.54 |
ENST00000341349.2
ENST00000392815.2 |
NOXA1
|
NADPH oxidase activator 1 |
| chr14_+_75746664 | 2.51 |
ENST00000557139.1
|
FOS
|
FBJ murine osteosarcoma viral oncogene homolog |
| chr2_-_165477971 | 2.50 |
ENST00000446413.2
|
GRB14
|
growth factor receptor-bound protein 14 |
| chr19_+_18794470 | 2.49 |
ENST00000321949.8
ENST00000338797.6 |
CRTC1
|
CREB regulated transcription coactivator 1 |
| chr3_-_13461807 | 2.48 |
ENST00000254508.5
|
NUP210
|
nucleoporin 210kDa |
| chr19_-_7939319 | 2.43 |
ENST00000539422.1
|
CTD-3193O13.9
|
Protein FLJ22184 |
| chr19_+_54385439 | 2.40 |
ENST00000536044.1
ENST00000540413.1 ENST00000263431.3 ENST00000419486.1 |
PRKCG
|
protein kinase C, gamma |
| chr19_+_38755203 | 2.40 |
ENST00000587090.1
ENST00000454580.3 |
SPINT2
|
serine peptidase inhibitor, Kunitz type, 2 |
| chr11_-_417388 | 2.39 |
ENST00000332725.3
|
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chr7_+_44788430 | 2.38 |
ENST00000457123.1
ENST00000309315.4 |
ZMIZ2
|
zinc finger, MIZ-type containing 2 |
| chr19_+_38755237 | 2.36 |
ENST00000587516.1
|
SPINT2
|
serine peptidase inhibitor, Kunitz type, 2 |
| chr11_-_64885111 | 2.35 |
ENST00000528598.1
ENST00000310597.4 |
ZNHIT2
|
zinc finger, HIT-type containing 2 |
| chr22_-_36018569 | 2.34 |
ENST00000419229.1
ENST00000406324.1 |
MB
|
myoglobin |
| chr3_-_49055991 | 2.33 |
ENST00000441576.2
ENST00000420952.2 ENST00000341949.4 ENST00000395462.4 |
DALRD3
|
DALR anticodon binding domain containing 3 |
| chr14_-_37051798 | 2.31 |
ENST00000258829.5
|
NKX2-8
|
NK2 homeobox 8 |
| chr13_-_79177673 | 2.28 |
ENST00000377208.5
|
POU4F1
|
POU class 4 homeobox 1 |
| chr12_+_7282795 | 2.27 |
ENST00000266546.6
|
CLSTN3
|
calsyntenin 3 |
| chr1_-_3566590 | 2.25 |
ENST00000424367.1
ENST00000378322.3 |
WRAP73
|
WD repeat containing, antisense to TP73 |
| chr12_+_58148842 | 2.25 |
ENST00000266643.5
|
MARCH9
|
membrane-associated ring finger (C3HC4) 9 |
| chr3_+_149191723 | 2.23 |
ENST00000305354.4
|
TM4SF4
|
transmembrane 4 L six family member 4 |
| chr5_+_139027877 | 2.22 |
ENST00000302517.3
|
CXXC5
|
CXXC finger protein 5 |
| chrX_+_70443050 | 2.18 |
ENST00000361726.6
|
GJB1
|
gap junction protein, beta 1, 32kDa |
| chr2_-_157189180 | 2.18 |
ENST00000539077.1
ENST00000424077.1 ENST00000426264.1 ENST00000339562.4 ENST00000421709.1 |
NR4A2
|
nuclear receptor subfamily 4, group A, member 2 |
| chr20_-_22565101 | 2.17 |
ENST00000419308.2
|
FOXA2
|
forkhead box A2 |
| chr20_+_48599506 | 2.17 |
ENST00000244050.2
|
SNAI1
|
snail family zinc finger 1 |
| chr16_-_776431 | 2.16 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
| chr17_-_40346477 | 2.16 |
ENST00000593209.1
ENST00000587427.1 ENST00000588352.1 ENST00000414034.3 ENST00000590249.1 |
GHDC
|
GH3 domain containing |
| chr22_-_37415475 | 2.15 |
ENST00000403892.3
ENST00000249042.3 ENST00000438203.1 |
TST
|
thiosulfate sulfurtransferase (rhodanese) |
| chr8_-_17270809 | 2.14 |
ENST00000180173.5
ENST00000521857.1 |
MTMR7
|
myotubularin related protein 7 |
| chr19_-_46272106 | 2.14 |
ENST00000560168.1
|
SIX5
|
SIX homeobox 5 |
| chr11_+_68080077 | 2.14 |
ENST00000294304.7
|
LRP5
|
low density lipoprotein receptor-related protein 5 |
| chr2_-_45165994 | 2.13 |
ENST00000444871.2
|
RP11-89K21.1
|
RP11-89K21.1 |
| chr16_+_770975 | 2.13 |
ENST00000569529.1
ENST00000564000.1 ENST00000219535.3 |
FAM173A
|
family with sequence similarity 173, member A |
| chr5_-_138718973 | 2.13 |
ENST00000353963.3
ENST00000348729.3 |
SLC23A1
|
solute carrier family 23 (ascorbic acid transporter), member 1 |
| chr19_-_42894420 | 2.12 |
ENST00000597255.1
ENST00000222032.5 |
CNFN
|
cornifelin |
| chr19_-_37178284 | 2.10 |
ENST00000425254.2
ENST00000590952.1 ENST00000433232.1 |
AC074138.3
|
AC074138.3 |
| chr3_-_158450475 | 2.10 |
ENST00000237696.5
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr22_-_18923655 | 2.09 |
ENST00000438924.1
ENST00000457083.1 ENST00000420436.1 ENST00000334029.2 ENST00000357068.6 |
PRODH
|
proline dehydrogenase (oxidase) 1 |
| chr16_+_30205754 | 2.09 |
ENST00000354723.6
ENST00000355544.5 |
SULT1A3
|
sulfotransferase family, cytosolic, 1A, phenol-preferring, member 3 |
| chr1_+_186265399 | 2.08 |
ENST00000367486.3
ENST00000367484.3 ENST00000533951.1 ENST00000367482.4 ENST00000367483.4 ENST00000367485.4 ENST00000445192.2 |
PRG4
|
proteoglycan 4 |
| chr10_+_94608245 | 2.07 |
ENST00000443748.2
ENST00000260762.6 |
EXOC6
|
exocyst complex component 6 |
| chr14_-_100625932 | 2.06 |
ENST00000553834.1
|
DEGS2
|
delta(4)-desaturase, sphingolipid 2 |
| chr20_+_43029911 | 2.06 |
ENST00000443598.2
ENST00000316099.4 ENST00000415691.2 |
HNF4A
|
hepatocyte nuclear factor 4, alpha |
| chr15_+_69591235 | 2.04 |
ENST00000395407.2
ENST00000558684.1 |
PAQR5
|
progestin and adipoQ receptor family member V |
| chr16_+_2039946 | 2.03 |
ENST00000248121.2
ENST00000568896.1 |
SYNGR3
|
synaptogyrin 3 |
| chr19_+_56111680 | 2.03 |
ENST00000301073.3
|
ZNF524
|
zinc finger protein 524 |
| chr19_-_36342739 | 2.03 |
ENST00000378910.5
ENST00000353632.6 |
NPHS1
|
nephrosis 1, congenital, Finnish type (nephrin) |
| chr3_+_32280159 | 2.01 |
ENST00000458535.2
ENST00000307526.3 |
CMTM8
|
CKLF-like MARVEL transmembrane domain containing 8 |
| chr17_-_79519403 | 2.01 |
ENST00000327787.8
ENST00000537152.1 |
C17orf70
|
chromosome 17 open reading frame 70 |
| chr20_-_60942361 | 1.98 |
ENST00000252999.3
|
LAMA5
|
laminin, alpha 5 |
| chr7_-_156803329 | 1.97 |
ENST00000252971.6
|
MNX1
|
motor neuron and pancreas homeobox 1 |
| chr19_+_34895289 | 1.96 |
ENST00000246535.3
|
PDCD2L
|
programmed cell death 2-like |
| chr20_+_42574317 | 1.96 |
ENST00000358131.5
|
TOX2
|
TOX high mobility group box family member 2 |
| chr1_-_223537475 | 1.96 |
ENST00000344029.6
ENST00000494793.2 ENST00000366878.4 ENST00000366877.3 |
SUSD4
|
sushi domain containing 4 |
| chr2_-_239148599 | 1.96 |
ENST00000409182.1
ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6
|
hes family bHLH transcription factor 6 |
| chr9_+_35673853 | 1.95 |
ENST00000378357.4
|
CA9
|
carbonic anhydrase IX |
| chr11_+_560956 | 1.95 |
ENST00000397582.3
ENST00000344375.4 ENST00000397583.3 |
RASSF7
|
Ras association (RalGDS/AF-6) domain family (N-terminal) member 7 |
| chr19_+_14544099 | 1.93 |
ENST00000242783.6
ENST00000586557.1 ENST00000590097.1 |
PKN1
|
protein kinase N1 |
| chr14_-_20929624 | 1.93 |
ENST00000398020.4
ENST00000250489.4 |
TMEM55B
|
transmembrane protein 55B |
| chr20_-_23731893 | 1.92 |
ENST00000398402.1
|
CST1
|
cystatin SN |
| chr11_-_559377 | 1.92 |
ENST00000486629.1
|
C11orf35
|
chromosome 11 open reading frame 35 |
| chr14_+_31343951 | 1.91 |
ENST00000556908.1
ENST00000555881.1 ENST00000460581.2 |
COCH
|
cochlin |
| chr16_-_4784128 | 1.90 |
ENST00000592711.1
ENST00000590147.1 ENST00000304283.4 ENST00000592190.1 ENST00000589065.1 ENST00000585773.1 ENST00000450067.2 ENST00000592698.1 ENST00000586166.1 ENST00000586605.1 ENST00000592421.1 |
ANKS3
|
ankyrin repeat and sterile alpha motif domain containing 3 |
| chr17_+_41158742 | 1.89 |
ENST00000415816.2
ENST00000438323.2 |
IFI35
|
interferon-induced protein 35 |
| chr22_-_30783075 | 1.88 |
ENST00000215798.6
|
RNF215
|
ring finger protein 215 |
| chr11_+_842808 | 1.88 |
ENST00000397397.2
ENST00000397411.2 ENST00000397396.1 |
TSPAN4
|
tetraspanin 4 |
| chr16_-_8962853 | 1.84 |
ENST00000565287.1
ENST00000311052.5 |
CARHSP1
|
calcium regulated heat stable protein 1, 24kDa |
| chr11_-_615942 | 1.82 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr19_+_36347787 | 1.81 |
ENST00000347900.6
ENST00000360202.5 |
KIRREL2
|
kin of IRRE like 2 (Drosophila) |
| chr6_-_31697255 | 1.81 |
ENST00000436437.1
|
DDAH2
|
dimethylarginine dimethylaminohydrolase 2 |
| chr19_-_55660561 | 1.80 |
ENST00000587758.1
ENST00000356783.5 ENST00000291901.8 ENST00000588426.1 ENST00000588147.1 ENST00000536926.1 ENST00000588981.1 |
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr17_-_36105009 | 1.80 |
ENST00000560016.1
ENST00000427275.2 ENST00000561193.1 |
HNF1B
|
HNF1 homeobox B |
| chr3_-_49459878 | 1.80 |
ENST00000546031.1
ENST00000458307.2 ENST00000430521.1 |
AMT
|
aminomethyltransferase |
| chr7_+_66800928 | 1.80 |
ENST00000430244.1
|
RP11-166O4.5
|
RP11-166O4.5 |
| chr2_+_121103706 | 1.79 |
ENST00000295228.3
|
INHBB
|
inhibin, beta B |
| chr22_+_24577183 | 1.78 |
ENST00000358321.3
|
SUSD2
|
sushi domain containing 2 |
| chr20_-_23731569 | 1.78 |
ENST00000304749.2
|
CST1
|
cystatin SN |
| chr16_-_2390704 | 1.78 |
ENST00000301732.5
ENST00000382381.3 |
ABCA3
|
ATP-binding cassette, sub-family A (ABC1), member 3 |
| chr3_-_124653579 | 1.78 |
ENST00000478191.1
ENST00000311075.3 |
MUC13
|
mucin 13, cell surface associated |
| chr19_-_40324767 | 1.78 |
ENST00000601972.1
ENST00000430012.2 ENST00000323039.5 ENST00000348817.3 |
DYRK1B
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
| chr5_-_172662303 | 1.78 |
ENST00000517440.1
ENST00000329198.4 |
NKX2-5
|
NK2 homeobox 5 |
| chr19_+_3721719 | 1.77 |
ENST00000589378.1
ENST00000382008.3 |
TJP3
|
tight junction protein 3 |
| chr1_-_167906020 | 1.76 |
ENST00000458574.1
|
MPC2
|
mitochondrial pyruvate carrier 2 |
| chr8_+_145438870 | 1.76 |
ENST00000527931.1
|
FAM203B
|
family with sequence similarity 203, member B |
| chr12_-_49259643 | 1.76 |
ENST00000309739.5
|
RND1
|
Rho family GTPase 1 |
| chr16_+_691792 | 1.75 |
ENST00000307650.4
|
FAM195A
|
family with sequence similarity 195, member A |
| chr19_-_47734448 | 1.75 |
ENST00000439096.2
|
BBC3
|
BCL2 binding component 3 |
| chr16_+_30996502 | 1.75 |
ENST00000353250.5
ENST00000262520.6 ENST00000297679.5 ENST00000562932.1 ENST00000574447.1 |
HSD3B7
|
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 7 |
| chr19_+_55996565 | 1.75 |
ENST00000587400.1
|
NAT14
|
N-acetyltransferase 14 (GCN5-related, putative) |
| chr17_-_81009636 | 1.75 |
ENST00000320865.3
|
B3GNTL1
|
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase-like 1 |
| chr7_+_192969 | 1.74 |
ENST00000313766.5
|
FAM20C
|
family with sequence similarity 20, member C |
| chr17_-_72968837 | 1.73 |
ENST00000581676.1
|
HID1
|
HID1 domain containing |
| chr19_+_2249308 | 1.73 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
| chr9_-_75653627 | 1.73 |
ENST00000446946.1
|
ALDH1A1
|
aldehyde dehydrogenase 1 family, member A1 |
| chr20_+_61867235 | 1.72 |
ENST00000342412.6
ENST00000217169.3 |
BIRC7
|
baculoviral IAP repeat containing 7 |
| chr1_-_222721434 | 1.71 |
ENST00000343410.6
|
HHIPL2
|
HHIP-like 2 |
| chr3_+_167453493 | 1.69 |
ENST00000295777.5
ENST00000472747.2 |
SERPINI1
|
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr8_-_27462822 | 1.66 |
ENST00000522098.1
|
CLU
|
clusterin |
| chr19_-_40324255 | 1.66 |
ENST00000593685.1
ENST00000600611.1 |
DYRK1B
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
| chr11_+_64107663 | 1.66 |
ENST00000356786.5
|
CCDC88B
|
coiled-coil domain containing 88B |
| chr11_-_117699413 | 1.66 |
ENST00000528014.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr19_+_51153045 | 1.66 |
ENST00000458538.1
|
C19orf81
|
chromosome 19 open reading frame 81 |
| chr19_-_40730820 | 1.65 |
ENST00000513948.1
|
CNTD2
|
cyclin N-terminal domain containing 2 |
| chr9_-_35815013 | 1.65 |
ENST00000259667.5
|
HINT2
|
histidine triad nucleotide binding protein 2 |
| chr11_-_66115032 | 1.64 |
ENST00000311181.4
|
B3GNT1
|
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 1 |
| chr1_+_37940153 | 1.63 |
ENST00000373087.6
|
ZC3H12A
|
zinc finger CCCH-type containing 12A |
| chr11_-_2924720 | 1.63 |
ENST00000455942.2
|
SLC22A18AS
|
solute carrier family 22 (organic cation transporter), member 18 antisense |
| chr22_-_50970919 | 1.63 |
ENST00000329363.4
ENST00000437588.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr7_+_148982396 | 1.62 |
ENST00000418158.2
|
ZNF783
|
zinc finger family member 783 |
| chr16_+_2286726 | 1.62 |
ENST00000382437.4
ENST00000569184.1 |
DNASE1L2
|
deoxyribonuclease I-like 2 |
| chr19_+_51152702 | 1.60 |
ENST00000425202.1
|
C19orf81
|
chromosome 19 open reading frame 81 |
| chr2_-_42160486 | 1.60 |
ENST00000427054.1
|
AC104654.2
|
AC104654.2 |
| chr8_+_145726472 | 1.60 |
ENST00000528430.1
|
PPP1R16A
|
protein phosphatase 1, regulatory subunit 16A |
| chr19_-_8373173 | 1.59 |
ENST00000537716.2
ENST00000301458.5 |
CD320
|
CD320 molecule |
| chr8_+_145490549 | 1.59 |
ENST00000340695.2
|
SCXA
|
scleraxis homolog A (mouse) |
| chr16_-_30393752 | 1.59 |
ENST00000566517.1
ENST00000605106.1 |
SEPT1
SEPT1
|
septin 1 Uncharacterized protein |
| chr19_-_42806723 | 1.58 |
ENST00000262890.3
|
PAFAH1B3
|
platelet-activating factor acetylhydrolase 1b, catalytic subunit 3 (29kDa) |
| chr1_-_27998689 | 1.58 |
ENST00000339145.4
ENST00000362020.4 ENST00000361157.6 |
IFI6
|
interferon, alpha-inducible protein 6 |
| chr20_+_306221 | 1.57 |
ENST00000342665.2
|
SOX12
|
SRY (sex determining region Y)-box 12 |
| chr14_-_24685246 | 1.57 |
ENST00000396833.2
ENST00000288087.7 |
MDP1
|
magnesium-dependent phosphatase 1 |
| chr1_+_110026544 | 1.56 |
ENST00000369870.3
|
ATXN7L2
|
ataxin 7-like 2 |
| chr1_-_156217829 | 1.56 |
ENST00000356983.2
ENST00000335852.1 ENST00000340183.5 ENST00000540423.1 |
PAQR6
|
progestin and adipoQ receptor family member VI |
| chr13_+_113760098 | 1.56 |
ENST00000346342.3
ENST00000541084.1 ENST00000375581.3 |
F7
|
coagulation factor VII (serum prothrombin conversion accelerator) |
| chr2_-_74726710 | 1.56 |
ENST00000377566.4
|
LBX2
|
ladybird homeobox 2 |
| chr20_-_22566089 | 1.56 |
ENST00000377115.4
|
FOXA2
|
forkhead box A2 |
| chr17_-_19648683 | 1.55 |
ENST00000573368.1
ENST00000457500.2 |
ALDH3A1
|
aldehyde dehydrogenase 3 family, member A1 |
| chr19_-_42721819 | 1.55 |
ENST00000336034.4
ENST00000598200.1 ENST00000598727.1 ENST00000596251.1 |
DEDD2
|
death effector domain containing 2 |
| chr3_+_53528659 | 1.55 |
ENST00000350061.5
|
CACNA1D
|
calcium channel, voltage-dependent, L type, alpha 1D subunit |
| chr7_+_140774032 | 1.55 |
ENST00000565468.1
|
TMEM178B
|
transmembrane protein 178B |
| chr12_-_53320245 | 1.55 |
ENST00000552150.1
|
KRT8
|
keratin 8 |
| chr16_-_89268070 | 1.55 |
ENST00000562855.2
|
SLC22A31
|
solute carrier family 22, member 31 |
| chr16_-_29466285 | 1.54 |
ENST00000330978.3
|
BOLA2
|
bolA family member 2 |
| chr4_-_74964904 | 1.54 |
ENST00000508487.2
|
CXCL2
|
chemokine (C-X-C motif) ligand 2 |
| chr22_+_35776354 | 1.53 |
ENST00000412893.1
|
HMOX1
|
heme oxygenase (decycling) 1 |
| chr15_-_88799661 | 1.53 |
ENST00000360948.2
ENST00000357724.2 ENST00000355254.2 ENST00000317501.3 |
NTRK3
|
neurotrophic tyrosine kinase, receptor, type 3 |
| chr16_-_4395905 | 1.53 |
ENST00000571941.1
|
PAM16
|
presequence translocase-associated motor 16 homolog (S. cerevisiae) |
| chr12_-_118406777 | 1.52 |
ENST00000339824.5
|
KSR2
|
kinase suppressor of ras 2 |
| chr8_-_144654918 | 1.52 |
ENST00000529971.1
|
MROH6
|
maestro heat-like repeat family member 6 |
| chr3_-_120400960 | 1.51 |
ENST00000476082.2
|
HGD
|
homogentisate 1,2-dioxygenase |
| chr22_-_25801333 | 1.50 |
ENST00000444995.3
|
LRP5L
|
low density lipoprotein receptor-related protein 5-like |
| chr15_+_41786065 | 1.50 |
ENST00000260386.5
|
ITPKA
|
inositol-trisphosphate 3-kinase A |
| chr22_+_37415676 | 1.50 |
ENST00000401419.3
|
MPST
|
mercaptopyruvate sulfurtransferase |
| chr14_+_70346125 | 1.49 |
ENST00000361956.3
ENST00000381280.4 |
SMOC1
|
SPARC related modular calcium binding 1 |
| chr17_-_43045439 | 1.49 |
ENST00000253407.3
|
C1QL1
|
complement component 1, q subcomponent-like 1 |
| chr22_+_37415700 | 1.49 |
ENST00000397129.1
|
MPST
|
mercaptopyruvate sulfurtransferase |
| chr22_+_23412479 | 1.48 |
ENST00000248996.4
|
GNAZ
|
guanine nucleotide binding protein (G protein), alpha z polypeptide |
| chr2_-_27486951 | 1.48 |
ENST00000432351.1
|
SLC30A3
|
solute carrier family 30 (zinc transporter), member 3 |
Network of associatons between targets according to the STRING database.
First level regulatory network of ID4_TCF4_SNAI2
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.7 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 1.5 | 7.4 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 1.3 | 12.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 1.3 | 7.6 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 1.3 | 7.6 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 1.2 | 5.9 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 1.1 | 7.9 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 1.1 | 1.1 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 1.1 | 4.5 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 1.1 | 5.5 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.1 | 8.7 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 1.1 | 4.4 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 1.0 | 3.9 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.9 | 1.9 | GO:0034340 | response to type I interferon(GO:0034340) type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.9 | 3.7 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.8 | 2.5 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.8 | 2.3 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.8 | 6.9 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.7 | 2.2 | GO:0003168 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 0.7 | 5.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.7 | 1.5 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
| 0.7 | 3.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.7 | 8.4 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.7 | 2.8 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.7 | 1.3 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.7 | 2.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.6 | 2.6 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.6 | 1.9 | GO:2000627 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.6 | 0.6 | GO:0071426 | ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.6 | 6.0 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.6 | 1.8 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.6 | 2.3 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.6 | 2.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.6 | 2.9 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.6 | 1.7 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.5 | 1.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.5 | 2.1 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.5 | 2.6 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.5 | 4.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.5 | 1.6 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.5 | 2.0 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.5 | 1.5 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.5 | 1.5 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.5 | 2.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.5 | 2.0 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.5 | 2.5 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.5 | 2.5 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.5 | 1.5 | GO:0061743 | motor learning(GO:0061743) |
| 0.5 | 1.5 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.5 | 3.0 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.5 | 2.9 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.5 | 0.5 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.5 | 6.2 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.5 | 0.5 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.5 | 1.4 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.5 | 2.3 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.5 | 2.8 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.5 | 1.8 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.5 | 1.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.5 | 3.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.5 | 2.3 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.5 | 1.4 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.5 | 1.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.5 | 9.0 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.4 | 1.8 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.4 | 1.3 | GO:0045362 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.4 | 3.6 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.4 | 1.3 | GO:0048597 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.4 | 1.3 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.4 | 1.8 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.4 | 1.7 | GO:0060032 | notochord regression(GO:0060032) |
| 0.4 | 1.3 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.4 | 1.3 | GO:0072034 | renal vesicle induction(GO:0072034) |
| 0.4 | 3.0 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.4 | 1.7 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.4 | 0.8 | GO:0019520 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.4 | 1.3 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.4 | 3.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 | 0.4 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.4 | 1.2 | GO:0009078 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.4 | 1.2 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.4 | 2.4 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.4 | 2.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.4 | 1.2 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.4 | 2.3 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.4 | 1.9 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.4 | 4.5 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.4 | 1.1 | GO:0033076 | isoquinoline alkaloid metabolic process(GO:0033076) |
| 0.4 | 0.4 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.4 | 2.9 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.4 | 1.8 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
| 0.4 | 1.4 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.3 | 2.8 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.3 | 1.0 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.3 | 1.0 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.3 | 1.4 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.3 | 0.3 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.3 | 5.7 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.3 | 8.0 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.3 | 3.7 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.3 | 1.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.3 | 0.6 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.3 | 1.0 | GO:0021793 | chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.3 | 0.3 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
| 0.3 | 1.3 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.3 | 1.3 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.3 | 4.4 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.3 | 2.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.3 | 1.5 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.3 | 1.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 | 1.2 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.3 | 3.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.3 | 1.2 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.3 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.3 | 0.9 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.3 | 1.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.3 | 1.8 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.3 | 1.1 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.3 | 1.4 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.3 | 0.9 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.3 | 1.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.3 | 1.1 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.3 | 1.7 | GO:0052565 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.3 | 1.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.3 | 0.6 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.3 | 1.1 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.3 | 0.5 | GO:0043153 | photoperiodism(GO:0009648) entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.3 | 1.4 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.3 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.3 | 0.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.3 | 1.9 | GO:0060356 | leucine import(GO:0060356) |
| 0.3 | 0.8 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.3 | 1.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.3 | 0.3 | GO:0003292 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.3 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.3 | 1.3 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.3 | 0.8 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.3 | 1.0 | GO:2000866 | positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.3 | 1.5 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.3 | 1.8 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.3 | 0.8 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.3 | 0.8 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.3 | 1.5 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.2 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.2 | 0.5 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 1.2 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.2 | 0.7 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.2 | 0.7 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.2 | 0.7 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 | 0.7 | GO:1900369 | transcription, RNA-templated(GO:0001172) negative regulation of RNA interference(GO:1900369) |
| 0.2 | 1.9 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 1.0 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.2 | 0.7 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.2 | 3.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.2 | 2.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.2 | 0.2 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.2 | 0.5 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.2 | 0.7 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.2 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 | 0.2 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.2 | 0.7 | GO:0033967 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.2 | 0.5 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 | 0.5 | GO:1902991 | regulation of beta-amyloid formation(GO:1902003) regulation of amyloid precursor protein catabolic process(GO:1902991) |
| 0.2 | 2.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.2 | 0.9 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 0.7 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.2 | 0.2 | GO:0060599 | lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 0.2 | 2.5 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.2 | 3.1 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.9 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.2 | 4.9 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.2 | 1.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.2 | 0.9 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.2 | 2.9 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.2 | 3.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 2.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.2 | 4.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.2 | 1.3 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.2 | 1.3 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 | 0.6 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.2 | 0.9 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.2 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.2 | 0.6 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 0.6 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.2 | 0.6 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.2 | 0.6 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.2 | 0.6 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.2 | 0.4 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
| 0.2 | 0.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.2 | 4.1 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.2 | 0.4 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.2 | 0.4 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 | 0.6 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.2 | 5.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.2 | 1.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 | 0.6 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.2 | 0.6 | GO:1904640 | response to methionine(GO:1904640) |
| 0.2 | 1.6 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.2 | 0.2 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.2 | 2.8 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 0.4 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.2 | 0.4 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 | 0.8 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 1.0 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.2 | 0.8 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 0.4 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.2 | 2.3 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.2 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.2 | 2.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.2 | 0.8 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 | 0.6 | GO:0030070 | insulin processing(GO:0030070) |
| 0.2 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.2 | 1.9 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 | 0.2 | GO:2000426 | negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.2 | 0.6 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.2 | 0.6 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.2 | 0.4 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.2 | 2.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.2 | 1.1 | GO:0086015 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.2 | 0.6 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.2 | 0.9 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.2 | 0.9 | GO:0036511 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.2 | 0.6 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.2 | 0.4 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.2 | 0.7 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.2 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.2 | 0.4 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 | 3.6 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.2 | 0.2 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.2 | 1.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.2 | 0.5 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.2 | 0.9 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.2 | 0.9 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.2 | 0.5 | GO:2000830 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.2 | 0.5 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.2 | 0.5 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.2 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.2 | 0.9 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.2 | 0.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 | 0.2 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.2 | 0.5 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.2 | 1.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.2 | 0.5 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.2 | 0.7 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 0.2 | 1.0 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.2 | 1.4 | GO:0046618 | drug export(GO:0046618) |
| 0.2 | 0.9 | GO:2000768 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.2 | 0.3 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.2 | 1.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.2 | 1.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.2 | 0.8 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.2 | 0.5 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.2 | 0.3 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 0.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 0.2 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.2 | 2.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.2 | 0.7 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.2 | 0.7 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.2 | 1.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 0.3 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 0.5 | GO:1903530 | regulation of secretion by cell(GO:1903530) |
| 0.2 | 0.6 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.2 | 2.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 | 0.3 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.2 | 1.5 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.2 | 0.5 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 | 0.5 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.2 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.2 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 4.9 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 | 0.6 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 0.6 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 0.4 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.1 | 0.4 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 | 0.4 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.1 | 0.9 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 1.0 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.1 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.1 | 0.1 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.1 | 1.0 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.1 | 0.9 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.9 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.7 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.3 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.1 | 2.0 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.1 | 0.3 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 1.0 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.1 | 0.8 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.1 | 0.4 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 0.4 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.5 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 | 0.6 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 | 2.3 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 | 0.4 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.1 | 0.4 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.1 | 0.7 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 1.1 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.1 | 0.3 | GO:0090194 | negative regulation of prostatic bud formation(GO:0060686) negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 0.1 | 3.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 1.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.7 | GO:0042631 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
| 0.1 | 0.3 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| 0.1 | 0.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.8 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.5 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 0.3 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.1 | 0.1 | GO:0030168 | platelet activation(GO:0030168) |
| 0.1 | 1.7 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 1.3 | GO:0009111 | vitamin catabolic process(GO:0009111) |
| 0.1 | 0.9 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 1.8 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.5 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.5 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.1 | 0.3 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.1 | 0.5 | GO:1901805 | beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.1 | 1.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 | 0.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 2.9 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 4.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.2 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.1 | 0.4 | GO:1904530 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.1 | 0.7 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.6 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.1 | 0.5 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.7 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.5 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.1 | 1.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.7 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.1 | 0.9 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.2 | GO:0052501 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.1 | 0.2 | GO:0001836 | release of cytochrome c from mitochondria(GO:0001836) |
| 0.1 | 0.8 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.4 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.1 | 0.5 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.1 | 1.0 | GO:0007041 | lysosomal transport(GO:0007041) |
| 0.1 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 1.3 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.2 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
| 0.1 | 0.5 | GO:0031455 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.1 | 1.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.2 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.1 | 0.7 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.6 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 0.4 | GO:0060623 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) regulation of chromosome condensation(GO:0060623) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.1 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 0.5 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.5 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.1 | 2.2 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.3 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 0.6 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.1 | 0.6 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.1 | 0.3 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.3 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
| 0.1 | 0.5 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.1 | GO:1902573 | positive regulation of serine-type endopeptidase activity(GO:1900005) positive regulation of serine-type peptidase activity(GO:1902573) |
| 0.1 | 2.6 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 3.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.2 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.1 | 0.4 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.6 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.1 | 1.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.8 | GO:0021884 | forebrain neuron development(GO:0021884) |
| 0.1 | 0.7 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.2 | GO:0034112 | positive regulation of homotypic cell-cell adhesion(GO:0034112) |
| 0.1 | 0.4 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.1 | 0.8 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 1.0 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.1 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 1.6 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.1 | 0.3 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.1 | 1.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 1.7 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.3 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.1 | 0.5 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 | 0.5 | GO:0015791 | polyol transport(GO:0015791) glycerol transport(GO:0015793) |
| 0.1 | 0.3 | GO:0032827 | negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.1 | 0.5 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.3 | GO:0032606 | regulation of type I interferon production(GO:0032479) type I interferon production(GO:0032606) |
| 0.1 | 2.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.4 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.1 | 0.5 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 1.7 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.1 | 0.4 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.1 | 0.5 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 0.7 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 3.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 2.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.7 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.6 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.1 | 0.4 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.5 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 0.7 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 1.0 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.4 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 | 0.5 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.1 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.1 | 2.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 1.8 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 0.6 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 0.5 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.5 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.4 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.6 | GO:1901569 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 | 0.7 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.1 | 0.3 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 0.7 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 | 0.2 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.1 | 1.9 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 1.1 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 | 2.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.1 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.6 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 0.4 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 0.3 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.1 | 1.8 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.5 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.1 | 0.2 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.1 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.6 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 2.5 | GO:1901663 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 2.0 | GO:0098926 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 2.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.4 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.4 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.6 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 1.4 | GO:0000050 | urea cycle(GO:0000050) |
| 0.1 | 1.4 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.1 | 2.0 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 1.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.4 | GO:0006480 | N-terminal protein amino acid methylation(GO:0006480) |
| 0.1 | 0.4 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.1 | 0.2 | GO:0071910 | determination of pancreatic left/right asymmetry(GO:0035469) determination of digestive tract left/right asymmetry(GO:0071907) determination of liver left/right asymmetry(GO:0071910) |
| 0.1 | 0.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.4 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.1 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.1 | 0.4 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 1.9 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.9 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.1 | 0.2 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.1 | 1.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.5 | GO:0043126 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 0.3 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 0.3 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 0.3 | GO:2000342 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 1.0 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.1 | 0.3 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.1 | 0.3 | GO:1904073 | trophectodermal cell proliferation(GO:0001834) regulation of trophectodermal cell proliferation(GO:1904073) positive regulation of trophectodermal cell proliferation(GO:1904075) |
| 0.1 | 2.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 1.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.2 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.1 | 5.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.4 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.1 | 0.9 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.6 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 0.3 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
| 0.1 | 0.7 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.1 | 0.2 | GO:0051659 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) maintenance of mitochondrion location(GO:0051659) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.1 | 0.2 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.1 | 0.5 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 1.3 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 1.4 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0035377 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.1 | 0.2 | GO:0051262 | protein tetramerization(GO:0051262) |
| 0.1 | 0.8 | GO:0043266 | regulation of potassium ion transport(GO:0043266) regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.1 | 1.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.1 | 0.7 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.1 | 0.4 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.1 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 | 0.5 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 | 0.4 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
| 0.1 | 0.9 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.7 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.9 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 1.0 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.1 | 0.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 | 0.2 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
| 0.1 | 2.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.1 | 1.6 | GO:0034776 | response to histamine(GO:0034776) |
| 0.1 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.1 | 0.3 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 | 0.2 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
| 0.1 | 2.5 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 1.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 1.6 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 1.3 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.3 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.1 | 0.2 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 | 0.2 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.1 | 0.4 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.9 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.4 | GO:0045337 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.1 | 0.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.8 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 | 0.4 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.1 | 1.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 1.5 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.9 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.6 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 0.5 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.1 | 0.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.6 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.2 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.1 | 0.8 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.1 | 1.0 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.4 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.4 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.1 | 1.0 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 | 2.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.4 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 1.6 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.3 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.1 | 1.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 | 0.2 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.1 | 0.2 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 | 0.1 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.1 | 0.2 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 0.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.1 | 0.3 | GO:0045807 | positive regulation of endocytosis(GO:0045807) |
| 0.1 | 0.6 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 0.4 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 0.2 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 | 0.5 | GO:0043271 | negative regulation of ion transport(GO:0043271) |
| 0.1 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.1 | 0.2 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.2 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.1 | 0.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.7 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.1 | 0.4 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.1 | 1.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.7 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.2 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 0.1 | 0.9 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
| 0.1 | 0.2 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.6 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) establishment of meiotic spindle localization(GO:0051295) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.2 | GO:0050807 | regulation of synapse organization(GO:0050807) |
| 0.1 | 0.3 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 | 9.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.2 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.1 | 0.4 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.1 | 0.7 | GO:0043379 | memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) |
| 0.1 | 0.1 | GO:0042345 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
| 0.1 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.6 | GO:0014048 | regulation of glutamate secretion(GO:0014048) |
| 0.1 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.3 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.3 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 0.2 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 | 0.6 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.2 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.1 | 0.9 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.8 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.7 | GO:0048477 | oogenesis(GO:0048477) |
| 0.1 | 0.9 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.3 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.1 | 0.8 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.1 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
| 0.1 | 0.3 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.2 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.3 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.3 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.5 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.1 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.1 | 0.9 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 0.3 | GO:2001303 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.1 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.1 | GO:0097477 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.2 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 | 0.4 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.3 | GO:0060460 | subthalamic nucleus development(GO:0021763) deltoid tuberosity development(GO:0035993) prolactin secreting cell differentiation(GO:0060127) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) superior vena cava morphogenesis(GO:0060578) |
| 0.1 | 1.0 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 1.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.3 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.3 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.7 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 1.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 2.0 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.1 | 0.2 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.1 | 0.7 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.1 | 0.2 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 | 0.1 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.1 | 4.9 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 | 0.2 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.1 | 2.4 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.1 | 0.2 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 1.5 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.1 | 0.1 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.1 | 0.7 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.1 | 0.9 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.1 | 0.2 | GO:0006147 | guanine catabolic process(GO:0006147) |
| 0.1 | 0.1 | GO:0071503 | response to heparin(GO:0071503) |
| 0.1 | 0.4 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.4 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 1.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.1 | 0.2 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.5 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.1 | 1.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.4 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.6 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 3.0 | GO:0006735 | NADH regeneration(GO:0006735) glycolytic process through fructose-6-phosphate(GO:0061615) glycolytic process through glucose-6-phosphate(GO:0061620) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 | 2.0 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 1.0 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.6 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.1 | 0.7 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.1 | 0.2 | GO:1902227 | negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) |
| 0.1 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.3 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
| 0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.1 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
| 0.1 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.1 | 0.4 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.6 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 | 0.2 | GO:0030730 | regulation of sequestering of triglyceride(GO:0010889) positive regulation of sequestering of triglyceride(GO:0010890) sequestering of triglyceride(GO:0030730) |
| 0.1 | 0.2 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) lysine catabolic process(GO:0006554) |
| 0.1 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.1 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.1 | 0.2 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.1 | 0.3 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.1 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.1 | 0.3 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 0.5 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.1 | 0.2 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 1.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.1 | 0.4 | GO:0002526 | acute inflammatory response(GO:0002526) |
| 0.1 | 1.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.7 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 0.8 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 2.6 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 2.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 0.7 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 | 0.7 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 | 0.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.4 | GO:0043525 | positive regulation of neuron apoptotic process(GO:0043525) |
| 0.1 | 0.4 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 0.2 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.1 | 0.6 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 1.4 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.1 | 0.2 | GO:0090034 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.3 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.7 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 1.0 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 | 0.4 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.4 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.5 | GO:0051023 | regulation of immunoglobulin secretion(GO:0051023) |
| 0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.0 | 0.8 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.3 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.1 | GO:0010458 | exit from mitosis(GO:0010458) |
| 0.0 | 0.2 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.0 | 0.2 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.0 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.0 | GO:0055083 | monovalent inorganic anion homeostasis(GO:0055083) |
| 0.0 | 0.6 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.4 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.0 | 0.8 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.0 | GO:1902616 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.9 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 7.8 | GO:0072599 | establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.0 | 0.4 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 2.2 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.2 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.2 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 2.0 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.1 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 | 5.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 1.8 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.6 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.4 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.3 | GO:0043606 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.0 | 0.4 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.2 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.5 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.2 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.2 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.2 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 | 0.9 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 2.9 | GO:0030449 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
| 0.0 | 0.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 | 0.3 | GO:0043931 | ossification involved in bone maturation(GO:0043931) |
| 0.0 | 1.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.0 | 1.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 1.0 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.0 | 0.5 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.4 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.7 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.0 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.7 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 1.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.5 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.0 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.8 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.0 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
| 0.0 | 0.1 | GO:0014824 | artery smooth muscle contraction(GO:0014824) negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 | 0.1 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.0 | 0.6 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 0.5 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.4 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.0 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 2.2 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
| 0.0 | 0.2 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.4 | GO:0071600 | otic vesicle morphogenesis(GO:0071600) |
| 0.0 | 0.2 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.4 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.0 | 0.0 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.0 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.4 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0006816 | calcium ion transport(GO:0006816) |
| 0.0 | 1.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0044108 | calcitriol biosynthetic process from calciol(GO:0036378) cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.0 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.2 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.0 | 0.3 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.2 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.0 | 1.6 | GO:0006505 | GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.5 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 2.0 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.0 | 1.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0045414 | regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.0 | 0.2 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.0 | 0.9 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.0 | 0.1 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.0 | 0.5 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.1 | GO:0060168 | regulation of adenosine receptor signaling pathway(GO:0060167) positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.0 | 0.2 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.1 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.0 | 0.3 | GO:0042534 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.0 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 1.9 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
| 0.0 | 0.3 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.3 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.3 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.8 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.8 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.6 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.0 | GO:1901988 | negative regulation of cell cycle phase transition(GO:1901988) |
| 0.0 | 0.1 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.7 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.0 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:0035383 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 | 0.1 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.0 | 0.1 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 | 0.1 | GO:0015881 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.0 | 0.3 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.0 | 0.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.1 | GO:0009127 | purine nucleoside monophosphate biosynthetic process(GO:0009127) purine ribonucleoside monophosphate biosynthetic process(GO:0009168) |
| 0.0 | 2.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.7 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.5 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) optic nerve structural organization(GO:0021633) |
| 0.0 | 0.2 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.4 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 | 0.1 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.0 | 1.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.3 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0048806 | genitalia development(GO:0048806) |
| 0.0 | 0.2 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.3 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.1 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.0 | 1.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.1 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.3 | GO:0010324 | membrane invagination(GO:0010324) |
| 0.0 | 0.6 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.2 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
| 0.0 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.2 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.4 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.8 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.3 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.1 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
| 0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.0 | 0.2 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.1 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.5 | GO:1901687 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.0 | 0.8 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.1 | GO:1900073 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.0 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.0 | GO:1903430 | negative regulation of neuron maturation(GO:0014043) negative regulation of cell maturation(GO:1903430) |
| 0.0 | 0.8 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.3 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.1 | GO:0002372 | myeloid dendritic cell cytokine production(GO:0002372) |
| 0.0 | 0.1 | GO:0003309 | type B pancreatic cell differentiation(GO:0003309) |
| 0.0 | 0.1 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.2 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.0 | 0.5 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.8 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.5 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.1 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.0 | 0.2 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.4 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.0 | 0.2 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.0 | 0.1 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.4 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 1.5 | GO:0021510 | spinal cord development(GO:0021510) |
| 0.0 | 0.3 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.0 | 0.1 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0051708 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.2 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.8 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.1 | GO:0009069 | serine family amino acid metabolic process(GO:0009069) |
| 0.0 | 0.2 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.0 | 0.3 | GO:0010043 | response to zinc ion(GO:0010043) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.2 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.1 | GO:0072308 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.0 | 0.1 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.0 | 0.5 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.1 | GO:0034104 | negative regulation of tissue remodeling(GO:0034104) |
| 0.0 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.8 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.0 | 0.3 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.0 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
| 0.0 | 0.6 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.1 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.0 | 0.2 | GO:0016446 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.2 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.0 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.0 | 0.0 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.0 | 0.4 | GO:0007077 | mitotic nuclear envelope disassembly(GO:0007077) |
| 0.0 | 0.1 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.0 | 0.3 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.2 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.0 | 0.1 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.0 | 0.0 | GO:0001694 | histamine biosynthetic process(GO:0001694) |
| 0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.0 | 0.8 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.0 | GO:0002767 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.1 | GO:0043368 | positive T cell selection(GO:0043368) |
| 0.0 | 0.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.1 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) regulation of bile acid metabolic process(GO:1904251) |
| 0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.3 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.1 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.0 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.0 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.2 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.2 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.0 | 0.3 | GO:0021549 | cerebellum development(GO:0021549) |
| 0.0 | 0.0 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.2 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.7 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.5 | GO:0006536 | glutamate metabolic process(GO:0006536) |
| 0.0 | 0.2 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.0 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 0.0 | 0.2 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.1 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.0 | 0.4 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 | 0.3 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.3 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.0 | GO:0001756 | somitogenesis(GO:0001756) |
| 0.0 | 0.2 | GO:0007620 | copulation(GO:0007620) |
| 0.0 | 0.1 | GO:0060369 | positive regulation of natural killer cell cytokine production(GO:0002729) positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
| 0.0 | 0.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.0 | GO:0042214 | terpene metabolic process(GO:0042214) |
| 0.0 | 0.1 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.0 | 0.1 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.0 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.0 | 0.1 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.0 | 0.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.1 | GO:0060563 | neuroepithelial cell differentiation(GO:0060563) |
| 0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.0 | 0.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.2 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.2 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.1 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
| 0.0 | 0.2 | GO:0060039 | pericardium development(GO:0060039) |
| 0.0 | 0.0 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
| 0.0 | 0.1 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 | 0.0 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.1 | GO:0006064 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.0 | 0.0 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
| 0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:1902099 | regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.0 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) |
| 0.0 | 0.3 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.1 | GO:0007249 | I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.0 | 0.1 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 | 0.1 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.0 | 0.0 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.0 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.0 | 0.1 | GO:0042797 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.0 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 0.0 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.0 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.0 | 0.0 | GO:2000296 | regulation of hydrogen peroxide catabolic process(GO:2000295) negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 0.0 | 0.1 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.2 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.1 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.1 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.0 | 0.0 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.0 | 0.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.1 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.0 | GO:1903568 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.0 | 0.1 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 | 0.1 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:0002396 | MHC protein complex assembly(GO:0002396) MHC class II protein complex assembly(GO:0002399) |
| 0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.0 | 0.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 15.8 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.9 | 5.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.6 | 4.8 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.5 | 5.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.5 | 2.0 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.5 | 9.2 | GO:0032059 | bleb(GO:0032059) |
| 0.5 | 1.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.4 | 3.6 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.4 | 2.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.4 | 1.2 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.4 | 1.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.4 | 3.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 8.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.3 | 1.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.3 | 1.9 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.3 | 1.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.3 | 2.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.3 | 2.4 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.3 | 0.9 | GO:0020005 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.3 | 0.3 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.3 | 1.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.3 | 2.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.3 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 4.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.3 | 3.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.3 | 2.8 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.2 | 0.7 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.2 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.2 | 1.2 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.2 | 4.9 | GO:0042627 | chylomicron(GO:0042627) |
| 0.2 | 1.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 2.2 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 4.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 7.6 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.2 | 1.9 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.2 | 0.4 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 0.8 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 1.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.2 | 2.0 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 1.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 2.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 1.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 0.5 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.2 | 1.8 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 0.5 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.2 | 3.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 1.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.2 | 0.5 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.2 | 1.5 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 0.3 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.2 | 0.5 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.2 | 0.9 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.2 | 1.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.2 | 1.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.2 | 3.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 2.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.4 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 1.4 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.8 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.7 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.1 | 1.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 1.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 1.9 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 0.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.4 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.1 | 1.4 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 0.4 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 6.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 1.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.5 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.5 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 0.1 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 4.2 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 1.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.8 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 0.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 1.6 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 2.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.9 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 14.0 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.7 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 1.0 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.1 | 3.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.3 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.3 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.1 | 0.8 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.8 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 0.1 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.1 | 0.7 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 11.4 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 1.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.9 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 1.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 1.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.8 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.4 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.1 | GO:0071159 | NF-kappaB complex(GO:0071159) |
| 0.1 | 0.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.3 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 1.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.2 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.1 | 0.2 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 1.8 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 1.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 2.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 2.2 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.1 | 0.9 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 2.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.1 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.1 | 0.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.0 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 1.4 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.4 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 5.3 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 1.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 1.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.4 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 1.4 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 1.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 3.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 0.2 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.7 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 0.4 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.1 | 0.2 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.1 | 1.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 0.4 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.6 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 0.2 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.1 | 0.7 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 2.8 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.8 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 2.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 1.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.1 | 0.3 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.5 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.1 | GO:0036457 | keratohyalin granule(GO:0036457) |
| 0.1 | 0.4 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.1 | 0.4 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 1.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.8 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 1.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.5 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.9 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.6 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.8 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 1.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.3 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.0 | 1.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.4 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.4 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 1.2 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.5 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.7 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.4 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 1.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.0 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 2.7 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 2.7 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.4 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.2 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.7 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.0 | 0.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 1.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.9 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 1.1 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 15.6 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 4.9 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 1.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.2 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 1.0 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 1.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 4.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.6 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.8 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.9 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.5 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.0 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 1.0 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 1.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.3 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 1.1 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.1 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.0 | 2.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 1.8 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 2.9 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.5 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 1.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.1 | GO:0001740 | X chromosome(GO:0000805) Barr body(GO:0001740) |
| 0.0 | 3.4 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.0 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 3.6 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 1.0 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.2 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.5 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 4.9 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.1 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 7.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.3 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 1.0 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 1.7 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.2 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.6 | GO:0032421 | stereocilium bundle(GO:0032421) |
| 0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.0 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.7 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 1.5 | 7.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 1.3 | 5.3 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 1.1 | 10.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 1.1 | 3.3 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 1.1 | 2.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.8 | 2.5 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.8 | 3.2 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.8 | 3.1 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.7 | 2.9 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.7 | 2.0 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.7 | 3.9 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.6 | 1.8 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.6 | 3.6 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.6 | 1.7 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.6 | 1.7 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.6 | 0.6 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.6 | 5.0 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.5 | 6.6 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.5 | 4.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.5 | 1.6 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.5 | 1.6 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.5 | 1.6 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.5 | 1.5 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.5 | 2.0 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.5 | 0.5 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.5 | 2.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.5 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.5 | 2.8 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.5 | 9.9 | GO:0005522 | profilin binding(GO:0005522) |
| 0.4 | 1.3 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.4 | 2.2 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.4 | 4.0 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.4 | 1.8 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.4 | 1.3 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.4 | 1.3 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.4 | 1.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 1.2 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.4 | 8.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.4 | 2.4 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.4 | 2.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.4 | 4.4 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.4 | 1.5 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.4 | 1.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.4 | 2.7 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.4 | 1.1 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.4 | 2.6 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.4 | 1.1 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 0.4 | 1.5 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.4 | 1.4 | GO:0005019 | platelet-derived growth factor beta-receptor activity(GO:0005019) |
| 0.4 | 3.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.4 | 1.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.3 | 1.0 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.3 | 1.0 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.3 | 1.4 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.3 | 1.0 | GO:0019862 | IgA binding(GO:0019862) |
| 0.3 | 1.0 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.3 | 1.0 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.3 | 1.0 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.3 | 1.3 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.3 | 6.6 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.3 | 0.9 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.3 | 1.2 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.3 | 2.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.3 | 1.8 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.3 | 0.9 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.3 | 1.8 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.3 | 0.9 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.3 | 1.4 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.3 | 1.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.3 | 3.0 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.3 | 1.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.3 | 1.3 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.3 | 2.4 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.3 | 1.3 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.3 | 1.3 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.3 | 2.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.2 | 0.7 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.2 | 0.7 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.2 | 1.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.2 | 1.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.2 | 1.5 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.2 | 0.7 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.2 | 4.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.2 | 0.7 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.2 | 2.8 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.2 | 2.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 0.7 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 0.2 | 0.7 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.2 | 1.6 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.2 | 0.7 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.2 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 3.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 0.7 | GO:0033961 | cis-stilbene-oxide hydrolase activity(GO:0033961) |
| 0.2 | 0.9 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.2 | 4.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.2 | 3.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.2 | 0.6 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.2 | 0.6 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.2 | 0.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.2 | 2.9 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 1.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.2 | 0.8 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.2 | 0.8 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.2 | 2.6 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.2 | 0.6 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.2 | 0.8 | GO:0015563 | thiamine uptake transmembrane transporter activity(GO:0015403) uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 2.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.2 | 4.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.2 | 1.2 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.2 | 1.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.2 | 1.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.2 | 1.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.2 | 0.9 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.2 | 0.9 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 1.1 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.2 | 0.6 | GO:0097258 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.2 | 0.5 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.2 | 1.8 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.2 | 1.6 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.2 | 3.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.2 | 0.5 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.2 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.2 | 2.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 2.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.2 | 1.9 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.2 | 2.8 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.2 | 0.5 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 1.5 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.2 | 2.0 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 1.3 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.2 | 1.7 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.2 | 0.7 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.2 | 0.5 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.2 | 0.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 0.5 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.2 | 2.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.2 | 0.5 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.2 | 5.0 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 1.6 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 1.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.2 | 4.6 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.2 | 2.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 0.6 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.2 | 0.6 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.2 | 1.7 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.2 | 1.4 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.1 | 1.8 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 8.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.4 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 2.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.6 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.4 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 0.4 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 1.5 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 1.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 2.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.7 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.1 | 0.4 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.4 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.1 | 1.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 1.4 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.7 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.1 | 10.0 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.1 | 0.7 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 1.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.5 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.7 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 2.9 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.5 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.1 | 1.3 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.4 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.1 | 1.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 0.6 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 0.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 4.1 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 0.4 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 1.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.4 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.1 | 0.4 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 0.1 | 0.4 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.1 | 0.4 | GO:0004397 | histidine ammonia-lyase activity(GO:0004397) |
| 0.1 | 1.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 1.6 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 1.5 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.1 | 0.7 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.7 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.8 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 1.2 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 1.7 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.8 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.1 | 0.3 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.3 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.1 | 0.7 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 1.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.3 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
| 0.1 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 2.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.6 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.1 | 4.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.1 | 0.7 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.1 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.9 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.1 | 0.2 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.1 | 0.3 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.1 | 0.6 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 1.9 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 1.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.5 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 0.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 0.5 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.3 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.1 | 1.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.6 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.7 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 3.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 0.5 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.1 | 0.4 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.7 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.1 | 7.1 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.6 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.1 | 0.7 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.1 | 0.8 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.1 | 0.4 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.1 | 1.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 1.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.7 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.3 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.1 | 0.8 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.5 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.8 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.3 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.7 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 1.8 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 1.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 2.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.4 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.1 | 1.8 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.4 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.1 | 12.7 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 1.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 1.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 2.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 1.3 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.8 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.1 | 1.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 0.3 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.1 | 0.3 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.3 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) secondary active organic cation transmembrane transporter activity(GO:0008513) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.3 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 1.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.2 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 2.0 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 3.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.3 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.1 | 0.2 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.4 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 0.9 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.4 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.8 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.4 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.1 | 0.4 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.5 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.1 | 1.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.9 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 1.5 | GO:0008483 | transaminase activity(GO:0008483) transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.1 | 0.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 1.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.7 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.9 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.1 | GO:1901474 | thiamine transmembrane transporter activity(GO:0015234) azole transmembrane transporter activity(GO:1901474) |
| 0.1 | 0.7 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 3.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.9 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.2 | GO:0034188 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.1 | 1.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.1 | 1.7 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
| 0.1 | 0.4 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 3.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 1.0 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.7 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 0.3 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.1 | 0.6 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.1 | 0.3 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.2 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.1 | 0.5 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 1.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.1 | 0.4 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.1 | 9.9 | GO:0020037 | heme binding(GO:0020037) |
| 0.1 | 0.3 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.4 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 2.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.3 | GO:0051800 | phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
| 0.1 | 0.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.4 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.7 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 0.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.2 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.3 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.1 | 0.5 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 1.7 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.9 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.4 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 2.7 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.1 | 0.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.1 | 0.2 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.1 | 1.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.7 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.2 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.2 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.1 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.2 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.1 | 0.3 | GO:0034979 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 0.5 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 0.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.8 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.1 | 0.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 1.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.2 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 0.1 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.1 | 1.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.7 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.2 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.1 | 1.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 4.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.5 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.1 | 0.2 | GO:0052595 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.1 | 0.2 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
| 0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.1 | 0.3 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 0.4 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.1 | 1.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.3 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 6.4 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 1.2 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.1 | 1.9 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.1 | 0.4 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 1.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.3 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 0.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.7 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 3.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.2 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.1 | 2.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 0.5 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 0.2 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.1 | 1.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.4 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.1 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.3 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 1.5 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.6 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.3 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.5 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 11.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.3 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 1.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.4 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 1.0 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.3 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 1.3 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.2 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 2.8 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.8 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.3 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.7 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.4 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.0 | 0.3 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 1.2 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 1.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 1.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.3 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.4 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.4 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 1.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 1.2 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 1.1 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.7 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.0 | 0.1 | GO:0031768 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
| 0.0 | 0.1 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
| 0.0 | 0.7 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.2 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.0 | 0.1 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.0 | 0.1 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0015350 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.2 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.9 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.1 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 3.2 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.2 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.0 | 0.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.1 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.2 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.0 | 0.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 2.2 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0016160 | amylase activity(GO:0016160) |
| 0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.8 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.1 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.0 | 0.2 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.0 | 0.6 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.8 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.1 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.0 | 0.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.2 | GO:0030171 | hydrogen ion channel activity(GO:0015252) voltage-gated proton channel activity(GO:0030171) |
| 0.0 | 0.2 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.0 | 0.6 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0001159 | core promoter proximal region DNA binding(GO:0001159) |
| 0.0 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.1 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.5 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.1 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.4 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 1.7 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.0 | 1.3 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.6 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.2 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.1 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.0 | 0.3 | GO:0090484 | drug transporter activity(GO:0090484) |
| 0.0 | 0.3 | GO:0001164 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0047946 | glutamine N-acyltransferase activity(GO:0047946) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.1 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.0 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 0.1 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
| 0.0 | 0.0 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.0 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.0 | 0.5 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.1 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.0 | 0.2 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.4 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 0.1 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.0 | 0.2 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.2 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.4 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.5 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.1 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.5 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 2.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.3 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.0 | 0.3 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.1 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.8 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.0 | GO:0030395 | lactose binding(GO:0030395) |
| 0.0 | 14.4 | GO:0000976 | transcription regulatory region sequence-specific DNA binding(GO:0000976) |
| 0.0 | 0.2 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.0 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.0 | 0.2 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.0 | 0.1 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.0 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
| 0.0 | 1.5 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.3 | GO:0004950 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.1 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.0 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.0 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.3 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.1 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.0 | GO:0016296 | oleoyl-[acyl-carrier-protein] hydrolase activity(GO:0004320) myristoyl-[acyl-carrier-protein] hydrolase activity(GO:0016295) palmitoyl-[acyl-carrier-protein] hydrolase activity(GO:0016296) acyl-[acyl-carrier-protein] hydrolase activity(GO:0016297) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 1.0 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.1 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.3 | 3.1 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.3 | 9.7 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 1.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.2 | 0.9 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.2 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 2.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.2 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.2 | 14.3 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 3.7 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 3.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 1.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.5 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 2.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 4.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 1.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 3.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 2.5 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 2.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 2.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.1 | 1.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 4.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 1.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 1.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 2.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 3.4 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.3 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 2.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 2.7 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 1.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 1.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.8 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 3.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 1.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 1.8 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 7.8 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 1.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 1.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 1.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 1.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.4 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 3.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 8.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.5 | 6.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.3 | 6.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.3 | 1.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.3 | 8.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.3 | 0.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 4.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.2 | 1.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.2 | 2.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.2 | 5.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.2 | 0.9 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.2 | 4.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.2 | 0.5 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 6.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 1.0 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 3.8 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 2.2 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 1.6 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 7.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 1.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.1 | 0.6 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 1.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 1.7 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 6.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 2.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.1 | 2.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 2.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 7.3 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 3.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 3.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 10.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 2.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 1.9 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.4 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 2.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 6.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.1 | 3.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.7 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 2.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.6 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.1 | 8.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 2.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 5.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 2.0 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 4.7 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.1 | 4.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 5.2 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 2.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 0.7 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 4.3 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.1 | 2.0 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 0.7 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 1.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 1.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 0.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 1.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 2.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 1.7 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 3.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 1.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.1 | 0.4 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 0.6 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 0.6 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 0.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 7.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.1 | 4.1 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.0 | 9.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 2.0 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 1.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 4.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 2.4 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 3.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.8 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.6 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 1.8 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.8 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 2.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 1.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 1.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 1.7 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 1.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 3.3 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.0 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 1.9 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.6 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 1.4 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 1.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.5 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.9 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 3.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.4 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.3 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.8 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.5 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.0 | 3.6 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
| 0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |