Project
SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for MLXIPL
Z-value: 0.93
Motif logo
Transcription factors associated with MLXIPL
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MLXIPL
|
ENSG00000009950.11 | MLX interacting protein like |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MLXIPL | hg19_v2_chr7_-_73038867_73038878 | 0.84 | 4.0e-06 | Click! |
Activity profile of MLXIPL motif
Sorted Z-values of MLXIPL motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_+_2249308 | 3.53 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
| chr11_-_117695449 | 3.05 |
ENST00000292079.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr7_+_93551011 | 2.70 |
ENST00000248564.5
|
GNG11
|
guanine nucleotide binding protein (G protein), gamma 11 |
| chr19_-_38747172 | 2.49 |
ENST00000347262.4
ENST00000591585.1 ENST00000301242.4 |
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr20_+_61867235 | 2.07 |
ENST00000342412.6
ENST00000217169.3 |
BIRC7
|
baculoviral IAP repeat containing 7 |
| chr6_-_24358264 | 2.03 |
ENST00000378454.3
|
DCDC2
|
doublecortin domain containing 2 |
| chr19_-_55677920 | 2.00 |
ENST00000524407.2
ENST00000526003.1 ENST00000534170.1 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr7_-_155437075 | 1.94 |
ENST00000401694.1
|
AC009403.2
|
Protein LOC100506302 |
| chr2_+_8822113 | 1.91 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr20_-_62203808 | 1.74 |
ENST00000467148.1
|
HELZ2
|
helicase with zinc finger 2, transcriptional coactivator |
| chr11_+_67776012 | 1.73 |
ENST00000539229.1
|
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
| chr5_-_90610200 | 1.68 |
ENST00000511918.1
ENST00000513626.1 ENST00000607854.1 |
LUCAT1
RP11-213H15.4
|
lung cancer associated transcript 1 (non-protein coding) RP11-213H15.4 |
| chr8_-_27469196 | 1.66 |
ENST00000546343.1
ENST00000560566.1 |
CLU
|
clusterin |
| chr8_-_27468945 | 1.61 |
ENST00000405140.3
|
CLU
|
clusterin |
| chr15_+_69591235 | 1.59 |
ENST00000395407.2
ENST00000558684.1 |
PAQR5
|
progestin and adipoQ receptor family member V |
| chr22_-_22901636 | 1.58 |
ENST00000406503.1
ENST00000439106.1 ENST00000402697.1 ENST00000543184.1 ENST00000398743.2 |
PRAME
|
preferentially expressed antigen in melanoma |
| chr8_+_142402089 | 1.56 |
ENST00000521578.1
ENST00000520105.1 ENST00000523147.1 |
PTP4A3
|
protein tyrosine phosphatase type IVA, member 3 |
| chr6_+_32821924 | 1.56 |
ENST00000374859.2
ENST00000453265.2 |
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr11_+_114128522 | 1.54 |
ENST00000535401.1
|
NNMT
|
nicotinamide N-methyltransferase |
| chr9_+_5231413 | 1.53 |
ENST00000239316.4
|
INSL4
|
insulin-like 4 (placenta) |
| chr22_+_29279552 | 1.52 |
ENST00000544604.2
|
ZNRF3
|
zinc and ring finger 3 |
| chr19_+_45417921 | 1.51 |
ENST00000252491.4
ENST00000592885.1 ENST00000589781.1 |
APOC1
|
apolipoprotein C-I |
| chr19_+_507299 | 1.50 |
ENST00000359315.5
|
TPGS1
|
tubulin polyglutamylase complex subunit 1 |
| chr19_+_49956426 | 1.49 |
ENST00000293350.4
ENST00000540132.1 ENST00000455361.2 ENST00000433981.2 |
ALDH16A1
|
aldehyde dehydrogenase 16 family, member A1 |
| chr20_-_34542548 | 1.49 |
ENST00000305978.2
|
SCAND1
|
SCAN domain containing 1 |
| chr14_+_103573853 | 1.48 |
ENST00000560304.1
|
EXOC3L4
|
exocyst complex component 3-like 4 |
| chr7_-_73038867 | 1.47 |
ENST00000313375.3
ENST00000354613.1 ENST00000395189.1 ENST00000453275.1 |
MLXIPL
|
MLX interacting protein-like |
| chr19_-_55677999 | 1.46 |
ENST00000532817.1
ENST00000527223.2 ENST00000391720.4 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr16_+_29466426 | 1.45 |
ENST00000567248.1
|
SLX1B
|
SLX1 structure-specific endonuclease subunit homolog B (S. cerevisiae) |
| chr17_+_77030267 | 1.41 |
ENST00000581774.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr17_+_32582293 | 1.40 |
ENST00000580907.1
ENST00000225831.4 |
CCL2
|
chemokine (C-C motif) ligand 2 |
| chr19_+_55996316 | 1.38 |
ENST00000205194.4
|
NAT14
|
N-acetyltransferase 14 (GCN5-related, putative) |
| chr19_+_39759154 | 1.37 |
ENST00000331982.5
|
IFNL2
|
interferon, lambda 2 |
| chr15_-_88799384 | 1.36 |
ENST00000540489.2
ENST00000557856.1 ENST00000558676.1 |
NTRK3
|
neurotrophic tyrosine kinase, receptor, type 3 |
| chrX_-_52260355 | 1.36 |
ENST00000375602.1
ENST00000399800.3 |
XAGE1A
|
X antigen family, member 1A |
| chr7_-_73038822 | 1.34 |
ENST00000414749.2
ENST00000429400.2 ENST00000434326.1 |
MLXIPL
|
MLX interacting protein-like |
| chr8_-_27457494 | 1.34 |
ENST00000521770.1
|
CLU
|
clusterin |
| chr19_-_47922750 | 1.33 |
ENST00000331559.5
|
MEIS3
|
Meis homeobox 3 |
| chr19_+_2977444 | 1.32 |
ENST00000246112.4
ENST00000453329.1 ENST00000482627.1 ENST00000452088.1 |
TLE6
|
transducin-like enhancer of split 6 (E(sp1) homolog, Drosophila) |
| chr2_+_46844290 | 1.32 |
ENST00000238892.3
|
CRIPT
|
cysteine-rich PDZ-binding protein |
| chr4_-_74864386 | 1.31 |
ENST00000296027.4
|
CXCL5
|
chemokine (C-X-C motif) ligand 5 |
| chr17_-_17480779 | 1.31 |
ENST00000395782.1
|
PEMT
|
phosphatidylethanolamine N-methyltransferase |
| chr16_-_30023615 | 1.30 |
ENST00000564979.1
ENST00000563378.1 |
DOC2A
|
double C2-like domains, alpha |
| chr2_+_37571717 | 1.28 |
ENST00000338415.3
ENST00000404976.1 |
QPCT
|
glutaminyl-peptide cyclotransferase |
| chr5_+_142149955 | 1.28 |
ENST00000378004.3
|
ARHGAP26
|
Rho GTPase activating protein 26 |
| chr20_+_4129426 | 1.26 |
ENST00000339123.6
ENST00000305958.4 ENST00000278795.3 |
SMOX
|
spermine oxidase |
| chr19_+_16435625 | 1.22 |
ENST00000248071.5
ENST00000592003.1 |
KLF2
|
Kruppel-like factor 2 |
| chr9_+_137979506 | 1.22 |
ENST00000539529.1
ENST00000392991.4 ENST00000371793.3 |
OLFM1
|
olfactomedin 1 |
| chrX_+_106163626 | 1.22 |
ENST00000336803.1
|
CLDN2
|
claudin 2 |
| chr22_-_30956746 | 1.22 |
ENST00000437282.1
ENST00000447224.1 ENST00000427899.1 ENST00000406955.1 ENST00000452827.1 |
GAL3ST1
|
galactose-3-O-sulfotransferase 1 |
| chr2_+_130939235 | 1.20 |
ENST00000425361.1
ENST00000457492.1 |
MZT2B
|
mitotic spindle organizing protein 2B |
| chr20_-_52790055 | 1.20 |
ENST00000395955.3
|
CYP24A1
|
cytochrome P450, family 24, subfamily A, polypeptide 1 |
| chr6_+_29691056 | 1.19 |
ENST00000414333.1
ENST00000334668.4 ENST00000259951.7 |
HLA-F
|
major histocompatibility complex, class I, F |
| chr12_+_58013693 | 1.19 |
ENST00000320442.4
ENST00000379218.2 |
SLC26A10
|
solute carrier family 26, member 10 |
| chr19_+_45418067 | 1.18 |
ENST00000589078.1
ENST00000586638.1 |
APOC1
|
apolipoprotein C-I |
| chr8_-_27468842 | 1.17 |
ENST00000523500.1
|
CLU
|
clusterin |
| chr5_-_179780312 | 1.16 |
ENST00000253778.8
|
GFPT2
|
glutamine-fructose-6-phosphate transaminase 2 |
| chr12_+_56661033 | 1.15 |
ENST00000433805.2
|
COQ10A
|
coenzyme Q10 homolog A (S. cerevisiae) |
| chr11_+_61522844 | 1.15 |
ENST00000265460.5
|
MYRF
|
myelin regulatory factor |
| chr6_-_41909191 | 1.14 |
ENST00000512426.1
ENST00000372987.4 |
CCND3
|
cyclin D3 |
| chr20_+_3026591 | 1.13 |
ENST00000380325.3
|
MRPS26
|
mitochondrial ribosomal protein S26 |
| chr1_+_948803 | 1.12 |
ENST00000379389.4
|
ISG15
|
ISG15 ubiquitin-like modifier |
| chr14_+_75745477 | 1.10 |
ENST00000303562.4
ENST00000554617.1 ENST00000554212.1 ENST00000535987.1 ENST00000555242.1 |
FOS
|
FBJ murine osteosarcoma viral oncogene homolog |
| chr4_-_123843597 | 1.10 |
ENST00000510735.1
ENST00000304430.5 |
NUDT6
|
nudix (nucleoside diphosphate linked moiety X)-type motif 6 |
| chr19_+_4304585 | 1.09 |
ENST00000221856.6
|
FSD1
|
fibronectin type III and SPRY domain containing 1 |
| chr19_+_4304632 | 1.08 |
ENST00000597590.1
|
FSD1
|
fibronectin type III and SPRY domain containing 1 |
| chr19_+_45417812 | 1.08 |
ENST00000592535.1
|
APOC1
|
apolipoprotein C-I |
| chr17_-_46894576 | 1.08 |
ENST00000393382.3
|
TTLL6
|
tubulin tyrosine ligase-like family, member 6 |
| chr2_+_37571845 | 1.07 |
ENST00000537448.1
|
QPCT
|
glutaminyl-peptide cyclotransferase |
| chr8_-_27468717 | 1.07 |
ENST00000520796.1
ENST00000520491.1 |
CLU
|
clusterin |
| chr16_-_2205352 | 1.07 |
ENST00000563192.1
|
RP11-304L19.5
|
RP11-304L19.5 |
| chr11_-_114271139 | 1.07 |
ENST00000325636.4
|
C11orf71
|
chromosome 11 open reading frame 71 |
| chr14_+_105957402 | 1.06 |
ENST00000421892.1
ENST00000334656.7 ENST00000451719.1 ENST00000392522.3 ENST00000392523.4 ENST00000354560.6 ENST00000450383.1 |
C14orf80
|
chromosome 14 open reading frame 80 |
| chr8_-_1922789 | 1.06 |
ENST00000521498.1
|
RP11-439C15.4
|
RP11-439C15.4 |
| chr9_-_74980113 | 1.04 |
ENST00000376962.5
ENST00000376960.4 ENST00000237937.3 |
ZFAND5
|
zinc finger, AN1-type domain 5 |
| chr9_+_80912059 | 1.04 |
ENST00000347159.2
ENST00000376588.3 |
PSAT1
|
phosphoserine aminotransferase 1 |
| chr1_-_212004090 | 1.04 |
ENST00000366997.4
|
LPGAT1
|
lysophosphatidylglycerol acyltransferase 1 |
| chr14_-_23288930 | 1.04 |
ENST00000554517.1
ENST00000285850.7 ENST00000397529.2 ENST00000555702.1 |
SLC7A7
|
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
| chr19_-_39402798 | 1.03 |
ENST00000571838.1
|
CTC-360G5.1
|
coiled-coil glutamate-rich protein 2 |
| chr21_+_33784670 | 1.03 |
ENST00000300255.2
|
EVA1C
|
eva-1 homolog C (C. elegans) |
| chr9_+_90112117 | 1.02 |
ENST00000358077.5
|
DAPK1
|
death-associated protein kinase 1 |
| chr19_+_54495542 | 1.00 |
ENST00000252729.2
ENST00000352529.1 |
CACNG6
|
calcium channel, voltage-dependent, gamma subunit 6 |
| chr2_+_71162995 | 0.99 |
ENST00000234396.4
|
ATP6V1B1
|
ATPase, H+ transporting, lysosomal 56/58kDa, V1 subunit B1 |
| chr7_-_23145288 | 0.99 |
ENST00000419813.1
|
KLHL7-AS1
|
KLHL7 antisense RNA 1 (head to head) |
| chr2_+_71163051 | 0.99 |
ENST00000412314.1
|
ATP6V1B1
|
ATPase, H+ transporting, lysosomal 56/58kDa, V1 subunit B1 |
| chr15_-_57025675 | 0.99 |
ENST00000558320.1
|
ZNF280D
|
zinc finger protein 280D |
| chr19_-_49956728 | 0.98 |
ENST00000601825.1
ENST00000596049.1 ENST00000599366.1 ENST00000597415.1 |
PIH1D1
|
PIH1 domain containing 1 |
| chr19_+_54496132 | 0.98 |
ENST00000346968.2
|
CACNG6
|
calcium channel, voltage-dependent, gamma subunit 6 |
| chr20_-_3748363 | 0.98 |
ENST00000217195.8
|
C20orf27
|
chromosome 20 open reading frame 27 |
| chr7_-_2595337 | 0.98 |
ENST00000340611.4
|
BRAT1
|
BRCA1-associated ATM activator 1 |
| chr11_+_22214708 | 0.98 |
ENST00000324559.8
|
ANO5
|
anoctamin 5 |
| chr19_-_40931891 | 0.97 |
ENST00000357949.4
|
SERTAD1
|
SERTA domain containing 1 |
| chr20_+_43029911 | 0.97 |
ENST00000443598.2
ENST00000316099.4 ENST00000415691.2 |
HNF4A
|
hepatocyte nuclear factor 4, alpha |
| chr14_+_103592636 | 0.96 |
ENST00000333007.1
|
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr12_+_112451222 | 0.96 |
ENST00000552052.1
|
ERP29
|
endoplasmic reticulum protein 29 |
| chr19_+_840963 | 0.96 |
ENST00000234347.5
|
PRTN3
|
proteinase 3 |
| chr5_-_156390230 | 0.96 |
ENST00000407087.3
ENST00000274532.2 |
TIMD4
|
T-cell immunoglobulin and mucin domain containing 4 |
| chr16_+_57023406 | 0.95 |
ENST00000262510.6
ENST00000308149.7 ENST00000436936.1 |
NLRC5
|
NLR family, CARD domain containing 5 |
| chr20_-_23731893 | 0.95 |
ENST00000398402.1
|
CST1
|
cystatin SN |
| chr1_-_40254482 | 0.94 |
ENST00000397360.2
ENST00000372827.3 |
BMP8B
|
bone morphogenetic protein 8b |
| chr19_+_54466179 | 0.94 |
ENST00000270458.2
|
CACNG8
|
calcium channel, voltage-dependent, gamma subunit 8 |
| chr1_-_27998689 | 0.93 |
ENST00000339145.4
ENST00000362020.4 ENST00000361157.6 |
IFI6
|
interferon, alpha-inducible protein 6 |
| chr15_-_55489097 | 0.93 |
ENST00000260443.4
|
RSL24D1
|
ribosomal L24 domain containing 1 |
| chrX_-_15511438 | 0.93 |
ENST00000380420.5
|
PIR
|
pirin (iron-binding nuclear protein) |
| chr8_-_27469383 | 0.93 |
ENST00000519742.1
|
CLU
|
clusterin |
| chr19_+_49055332 | 0.93 |
ENST00000201586.2
|
SULT2B1
|
sulfotransferase family, cytosolic, 2B, member 1 |
| chr16_-_4664860 | 0.93 |
ENST00000587615.1
ENST00000587649.1 ENST00000590965.1 ENST00000591401.1 ENST00000283474.7 |
UBALD1
|
UBA-like domain containing 1 |
| chr20_-_61885826 | 0.93 |
ENST00000370316.3
|
NKAIN4
|
Na+/K+ transporting ATPase interacting 4 |
| chr20_+_361890 | 0.92 |
ENST00000449710.1
ENST00000422053.2 |
TRIB3
|
tribbles pseudokinase 3 |
| chr19_+_58898627 | 0.92 |
ENST00000598098.1
ENST00000598495.1 ENST00000196551.3 ENST00000596046.1 |
RPS5
|
ribosomal protein S5 |
| chr19_+_54705025 | 0.92 |
ENST00000441429.1
|
RPS9
|
ribosomal protein S9 |
| chr1_-_238108575 | 0.91 |
ENST00000604646.1
|
MTRNR2L11
|
MT-RNR2-like 11 (pseudogene) |
| chr19_-_55919087 | 0.91 |
ENST00000587845.1
ENST00000589978.1 ENST00000264552.9 |
UBE2S
|
ubiquitin-conjugating enzyme E2S |
| chr19_-_4559814 | 0.91 |
ENST00000586582.1
|
SEMA6B
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6B |
| chr5_+_175298674 | 0.91 |
ENST00000514150.1
|
CPLX2
|
complexin 2 |
| chr11_+_842808 | 0.91 |
ENST00000397397.2
ENST00000397411.2 ENST00000397396.1 |
TSPAN4
|
tetraspanin 4 |
| chr11_-_64889649 | 0.90 |
ENST00000434372.2
|
FAU
|
Finkel-Biskis-Reilly murine sarcoma virus (FBR-MuSV) ubiquitously expressed |
| chr16_-_88717482 | 0.90 |
ENST00000261623.3
|
CYBA
|
cytochrome b-245, alpha polypeptide |
| chr7_+_101928380 | 0.90 |
ENST00000536178.1
|
SH2B2
|
SH2B adaptor protein 2 |
| chr19_-_39735646 | 0.89 |
ENST00000413851.2
|
IFNL3
|
interferon, lambda 3 |
| chr17_+_36886478 | 0.89 |
ENST00000439660.2
|
CISD3
|
CDGSH iron sulfur domain 3 |
| chr7_+_150065278 | 0.89 |
ENST00000519397.1
ENST00000479668.1 ENST00000540729.1 |
REPIN1
|
replication initiator 1 |
| chr19_-_55660561 | 0.89 |
ENST00000587758.1
ENST00000356783.5 ENST00000291901.8 ENST00000588426.1 ENST00000588147.1 ENST00000536926.1 ENST00000588981.1 |
TNNT1
|
troponin T type 1 (skeletal, slow) |
| chr17_+_48712206 | 0.89 |
ENST00000427699.1
ENST00000285238.8 |
ABCC3
|
ATP-binding cassette, sub-family C (CFTR/MRP), member 3 |
| chr14_-_24685246 | 0.89 |
ENST00000396833.2
ENST00000288087.7 |
MDP1
|
magnesium-dependent phosphatase 1 |
| chr1_+_246887349 | 0.88 |
ENST00000366510.3
|
SCCPDH
|
saccharopine dehydrogenase (putative) |
| chr3_+_49027308 | 0.88 |
ENST00000383729.4
ENST00000343546.4 |
P4HTM
|
prolyl 4-hydroxylase, transmembrane (endoplasmic reticulum) |
| chr11_-_63381925 | 0.88 |
ENST00000415826.1
|
PLA2G16
|
phospholipase A2, group XVI |
| chr11_-_2924720 | 0.88 |
ENST00000455942.2
|
SLC22A18AS
|
solute carrier family 22 (organic cation transporter), member 18 antisense |
| chr1_-_23521222 | 0.87 |
ENST00000374619.1
|
HTR1D
|
5-hydroxytryptamine (serotonin) receptor 1D, G protein-coupled |
| chr10_-_72142345 | 0.86 |
ENST00000373224.1
ENST00000446961.1 ENST00000358141.2 ENST00000357631.2 |
LRRC20
|
leucine rich repeat containing 20 |
| chr11_+_60699222 | 0.86 |
ENST00000536409.1
|
TMEM132A
|
transmembrane protein 132A |
| chr21_+_46875395 | 0.86 |
ENST00000355480.5
|
COL18A1
|
collagen, type XVIII, alpha 1 |
| chrX_-_153775047 | 0.86 |
ENST00000433845.1
ENST00000439227.1 |
G6PD
|
glucose-6-phosphate dehydrogenase |
| chr10_-_69597915 | 0.86 |
ENST00000225171.2
|
DNAJC12
|
DnaJ (Hsp40) homolog, subfamily C, member 12 |
| chr22_-_20255212 | 0.85 |
ENST00000416372.1
|
RTN4R
|
reticulon 4 receptor |
| chr20_-_3748416 | 0.85 |
ENST00000399672.1
|
C20orf27
|
chromosome 20 open reading frame 27 |
| chr12_+_49740700 | 0.84 |
ENST00000549441.2
ENST00000395069.3 |
DNAJC22
|
DnaJ (Hsp40) homolog, subfamily C, member 22 |
| chr21_+_46875424 | 0.84 |
ENST00000359759.4
|
COL18A1
|
collagen, type XVIII, alpha 1 |
| chr17_+_59489112 | 0.83 |
ENST00000335108.2
|
C17orf82
|
chromosome 17 open reading frame 82 |
| chr11_+_62538775 | 0.82 |
ENST00000294168.3
ENST00000526261.1 |
TAF6L
|
TAF6-like RNA polymerase II, p300/CBP-associated factor (PCAF)-associated factor, 65kDa |
| chr3_-_149095652 | 0.82 |
ENST00000305366.3
|
TM4SF1
|
transmembrane 4 L six family member 1 |
| chr7_-_99869799 | 0.82 |
ENST00000436886.2
|
GATS
|
GATS, stromal antigen 3 opposite strand |
| chr17_-_19062187 | 0.82 |
ENST00000399087.1
ENST00000436381.1 |
AC007952.6
|
Uncharacterized protein |
| chr1_-_23520755 | 0.81 |
ENST00000314113.3
|
HTR1D
|
5-hydroxytryptamine (serotonin) receptor 1D, G protein-coupled |
| chr8_-_48651648 | 0.80 |
ENST00000408965.3
|
CEBPD
|
CCAAT/enhancer binding protein (C/EBP), delta |
| chrX_-_30326445 | 0.80 |
ENST00000378963.1
|
NR0B1
|
nuclear receptor subfamily 0, group B, member 1 |
| chr19_+_48876300 | 0.79 |
ENST00000600863.1
ENST00000601610.1 ENST00000595322.1 |
SYNGR4
|
synaptogyrin 4 |
| chr17_-_16256718 | 0.79 |
ENST00000476243.1
ENST00000299736.4 |
CENPV
|
centromere protein V |
| chrX_-_153095945 | 0.79 |
ENST00000164640.4
|
PDZD4
|
PDZ domain containing 4 |
| chr20_+_43343517 | 0.79 |
ENST00000372865.4
|
WISP2
|
WNT1 inducible signaling pathway protein 2 |
| chr20_+_5986727 | 0.79 |
ENST00000378863.4
|
CRLS1
|
cardiolipin synthase 1 |
| chr8_-_145115584 | 0.79 |
ENST00000426825.1
|
OPLAH
|
5-oxoprolinase (ATP-hydrolysing) |
| chr16_-_81040719 | 0.79 |
ENST00000219400.3
|
CMC2
|
C-x(9)-C motif containing 2 |
| chr5_-_54529415 | 0.78 |
ENST00000282572.4
|
CCNO
|
cyclin O |
| chr11_-_65150103 | 0.77 |
ENST00000294187.6
ENST00000398802.1 ENST00000360662.3 ENST00000377152.2 ENST00000530936.1 |
SLC25A45
|
solute carrier family 25, member 45 |
| chr3_-_129035120 | 0.77 |
ENST00000333762.4
|
H1FX
|
H1 histone family, member X |
| chr12_+_52643077 | 0.77 |
ENST00000553310.2
ENST00000544024.1 |
KRT86
|
keratin 86 |
| chr20_+_3776936 | 0.77 |
ENST00000439880.2
|
CDC25B
|
cell division cycle 25B |
| chr5_+_142149932 | 0.77 |
ENST00000274498.4
|
ARHGAP26
|
Rho GTPase activating protein 26 |
| chr11_+_71934962 | 0.77 |
ENST00000543234.1
|
INPPL1
|
inositol polyphosphate phosphatase-like 1 |
| chr7_+_134832808 | 0.77 |
ENST00000275767.3
|
TMEM140
|
transmembrane protein 140 |
| chr19_-_16045665 | 0.77 |
ENST00000248041.8
|
CYP4F11
|
cytochrome P450, family 4, subfamily F, polypeptide 11 |
| chr22_-_30970560 | 0.76 |
ENST00000402369.1
ENST00000406361.1 |
GAL3ST1
|
galactose-3-O-sulfotransferase 1 |
| chr2_+_176994408 | 0.76 |
ENST00000429017.1
ENST00000313173.4 ENST00000544999.1 |
HOXD8
|
homeobox D8 |
| chr21_+_37507210 | 0.76 |
ENST00000290354.5
|
CBR3
|
carbonyl reductase 3 |
| chr1_+_95582881 | 0.76 |
ENST00000370203.4
ENST00000456991.1 |
TMEM56
|
transmembrane protein 56 |
| chr10_-_14590644 | 0.76 |
ENST00000378470.1
|
FAM107B
|
family with sequence similarity 107, member B |
| chr1_+_196788887 | 0.75 |
ENST00000320493.5
ENST00000367424.4 ENST00000367421.3 |
CFHR1
CFHR2
|
complement factor H-related 1 complement factor H-related 2 |
| chr17_-_14140166 | 0.75 |
ENST00000420162.2
ENST00000431716.2 |
CDRT15
|
CMT1A duplicated region transcript 15 |
| chr16_-_30022293 | 0.75 |
ENST00000565273.1
ENST00000567332.2 ENST00000350119.4 |
DOC2A
|
double C2-like domains, alpha |
| chr3_-_186857267 | 0.75 |
ENST00000455270.1
ENST00000296277.4 |
RPL39L
|
ribosomal protein L39-like |
| chr6_-_85473156 | 0.75 |
ENST00000606784.1
ENST00000606325.1 |
TBX18
|
T-box 18 |
| chr20_+_36012051 | 0.74 |
ENST00000373567.2
|
SRC
|
v-src avian sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog |
| chr14_-_21566731 | 0.74 |
ENST00000360947.3
|
ZNF219
|
zinc finger protein 219 |
| chr15_-_45670924 | 0.74 |
ENST00000396659.3
|
GATM
|
glycine amidinotransferase (L-arginine:glycine amidinotransferase) |
| chr4_+_103790120 | 0.74 |
ENST00000273986.4
|
CISD2
|
CDGSH iron sulfur domain 2 |
| chr2_-_220083671 | 0.74 |
ENST00000439002.2
|
ABCB6
|
ATP-binding cassette, sub-family B (MDR/TAP), member 6 |
| chr19_+_45542295 | 0.73 |
ENST00000221455.3
ENST00000391953.4 ENST00000588936.1 |
CLASRP
|
CLK4-associating serine/arginine rich protein |
| chr20_-_33460621 | 0.73 |
ENST00000427420.1
ENST00000336431.5 |
GGT7
|
gamma-glutamyltransferase 7 |
| chr6_+_32812568 | 0.73 |
ENST00000414474.1
|
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr10_+_133918175 | 0.73 |
ENST00000298622.4
|
JAKMIP3
|
Janus kinase and microtubule interacting protein 3 |
| chr22_+_49089016 | 0.73 |
ENST00000406880.1
|
FAM19A5
|
family with sequence similarity 19 (chemokine (C-C motif)-like), member A5 |
| chr16_-_2260834 | 0.72 |
ENST00000562360.1
ENST00000566018.1 |
BRICD5
|
BRICHOS domain containing 5 |
| chr17_+_7982800 | 0.72 |
ENST00000399413.3
|
AC129492.6
|
AC129492.6 |
| chr17_+_77020325 | 0.72 |
ENST00000311661.4
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr10_+_5135981 | 0.72 |
ENST00000380554.3
|
AKR1C3
|
aldo-keto reductase family 1, member C3 |
| chr12_+_21679220 | 0.72 |
ENST00000256969.2
|
C12orf39
|
chromosome 12 open reading frame 39 |
| chr19_-_17799008 | 0.72 |
ENST00000519716.2
|
UNC13A
|
unc-13 homolog A (C. elegans) |
| chr9_-_116840728 | 0.71 |
ENST00000265132.3
|
AMBP
|
alpha-1-microglobulin/bikunin precursor |
| chr2_+_3622893 | 0.71 |
ENST00000407445.3
ENST00000403564.1 |
RPS7
|
ribosomal protein S7 |
| chr1_-_17216143 | 0.71 |
ENST00000457075.1
|
RP11-108M9.4
|
RP11-108M9.4 |
| chr14_+_103566481 | 0.71 |
ENST00000380069.3
|
EXOC3L4
|
exocyst complex component 3-like 4 |
| chr17_-_64216748 | 0.71 |
ENST00000585162.1
|
APOH
|
apolipoprotein H (beta-2-glycoprotein I) |
| chr22_+_45072925 | 0.71 |
ENST00000006251.7
|
PRR5
|
proline rich 5 (renal) |
| chr16_-_4784128 | 0.70 |
ENST00000592711.1
ENST00000590147.1 ENST00000304283.4 ENST00000592190.1 ENST00000589065.1 ENST00000585773.1 ENST00000450067.2 ENST00000592698.1 ENST00000586166.1 ENST00000586605.1 ENST00000592421.1 |
ANKS3
|
ankyrin repeat and sterile alpha motif domain containing 3 |
| chr15_-_27018884 | 0.70 |
ENST00000299267.4
|
GABRB3
|
gamma-aminobutyric acid (GABA) A receptor, beta 3 |
| chr7_+_149571045 | 0.70 |
ENST00000479613.1
ENST00000606024.1 ENST00000464662.1 ENST00000425642.2 |
ATP6V0E2
|
ATPase, H+ transporting V0 subunit e2 |
| chr17_+_48046538 | 0.70 |
ENST00000240306.3
|
DLX4
|
distal-less homeobox 4 |
| chr16_-_66968265 | 0.70 |
ENST00000567511.1
ENST00000422424.2 |
FAM96B
|
family with sequence similarity 96, member B |
Network of associatons between targets according to the STRING database.
First level regulatory network of MLXIPL
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.5 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 1.0 | 7.8 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.9 | 3.8 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.8 | 2.4 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.5 | 2.6 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.5 | 0.5 | GO:0071359 | cellular response to dsRNA(GO:0071359) |
| 0.5 | 1.9 | GO:0048687 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.5 | 1.4 | GO:2000502 | negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 0.4 | 2.2 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.4 | 2.6 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.4 | 1.9 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.3 | 1.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.3 | 1.3 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.3 | 1.5 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.3 | 1.5 | GO:2000051 | Wnt receptor catabolic process(GO:0038018) negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.3 | 1.2 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 0.3 | 0.9 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.3 | 1.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.3 | 1.4 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 0.3 | 0.8 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.3 | 0.8 | GO:0100009 | circadian temperature homeostasis(GO:0060086) regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.3 | 2.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.3 | 1.3 | GO:1904141 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.3 | 0.8 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.3 | 0.8 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.2 | 1.2 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.2 | 0.7 | GO:0060827 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.2 | 1.0 | GO:0019520 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.2 | 1.0 | GO:1903939 | negative regulation of histone H3-K9 dimethylation(GO:1900110) regulation of TORC2 signaling(GO:1903939) |
| 0.2 | 1.2 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.2 | 0.7 | GO:2000224 | sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 | 0.7 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.2 | 0.9 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.2 | 2.1 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.2 | 1.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.2 | 0.9 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.2 | 2.6 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.2 | 0.6 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.2 | 0.6 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.2 | 0.4 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.2 | 0.6 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.2 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.2 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.2 | 2.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.2 | 0.6 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.2 | 0.6 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.2 | 0.8 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.2 | 0.8 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.2 | 2.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.2 | 0.9 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.2 | 0.7 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.2 | 0.6 | GO:0035623 | renal glucose absorption(GO:0035623) |
| 0.2 | 0.7 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.2 | 0.6 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.2 | 1.1 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.2 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 | 0.5 | GO:0018016 | N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.2 | 0.9 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.2 | 2.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 3.6 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 1.8 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.2 | 2.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 | 1.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 1.0 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.2 | 0.5 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.2 | 1.2 | GO:0060356 | leucine import(GO:0060356) |
| 0.2 | 1.0 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 0.7 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 | 0.8 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.2 | 1.5 | GO:1904386 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.2 | 0.6 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 1.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.2 | 1.6 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.2 | 0.8 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 | 1.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.2 | 0.3 | GO:2000625 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.2 | 0.9 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.2 | 1.1 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 | 2.0 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 | 0.5 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.2 | 0.2 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.1 | 1.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.4 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.1 | 0.4 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.6 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.1 | 0.6 | GO:0032811 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) epinephrine secretion(GO:0048242) |
| 0.1 | 0.4 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.1 | 1.0 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 3.1 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.1 | 0.4 | GO:0060123 | regulation of growth hormone secretion(GO:0060123) positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 0.3 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.1 | 0.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 1.6 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 1.3 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 1.3 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 | 1.3 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 2.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.1 | 4.5 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 1.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.5 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.4 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.1 | 0.4 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.1 | 0.5 | GO:0060995 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.1 | 0.4 | GO:0045210 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.1 | 0.4 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.1 | 0.6 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.1 | 1.7 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 | 0.6 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 | 0.8 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 | 0.7 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.9 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.1 | 0.9 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 2.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 2.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.1 | 0.5 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.1 | 0.5 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.1 | 0.9 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.1 | 0.3 | GO:0055073 | cadmium ion homeostasis(GO:0055073) |
| 0.1 | 0.3 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 | 0.4 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 | 0.6 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.4 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 0.3 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 | 0.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 2.0 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.8 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.1 | 0.3 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.1 | 1.7 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.2 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.1 | 1.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.3 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.4 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.1 | 0.3 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.1 | 1.6 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 1.0 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.1 | 2.9 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 | 0.3 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.1 | 0.8 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.4 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.1 | 1.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.3 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.7 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.3 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.2 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 0.1 | 0.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.1 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.1 | 0.2 | GO:2000282 | detoxification of mercury ion(GO:0050787) regulation of cellular amino acid biosynthetic process(GO:2000282) |
| 0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.4 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.1 | 0.5 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 1.2 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.2 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 1.3 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.1 | 1.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.9 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.1 | 0.9 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.1 | 0.4 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.7 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 1.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 0.3 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.1 | 0.3 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.1 | 1.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 0.3 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.1 | 1.6 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.1 | 0.6 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.5 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.1 | 0.7 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 0.9 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.1 | 0.5 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 | 0.9 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 0.4 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.1 | 1.5 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 | 0.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.1 | 2.2 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.2 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) regulation of DNA ligase activity(GO:1904875) |
| 0.1 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.5 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 | 0.2 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.1 | GO:2000410 | regulation of thymocyte migration(GO:2000410) |
| 0.1 | 0.2 | GO:1900168 | glial cell-derived neurotrophic factor secretion(GO:0044467) regulation of glial cell-derived neurotrophic factor secretion(GO:1900166) positive regulation of glial cell-derived neurotrophic factor secretion(GO:1900168) |
| 0.1 | 0.8 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.4 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 | 0.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.4 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.1 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.1 | 1.8 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.5 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.1 | 0.3 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.7 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.3 | GO:0034343 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.1 | 0.5 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.1 | 0.3 | GO:2001178 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 0.4 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.2 | GO:1900073 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.1 | 0.4 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 0.8 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.2 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.1 | 0.1 | GO:0051781 | positive regulation of cell division(GO:0051781) |
| 0.1 | 0.1 | GO:0070256 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.1 | 0.6 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 | 0.4 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.2 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.2 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 | 0.4 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.1 | 0.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 1.4 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.5 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 2.7 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.3 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.1 | 0.3 | GO:0072299 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.1 | 0.3 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.5 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.1 | 1.2 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.1 | 0.3 | GO:0032641 | lymphotoxin A production(GO:0032641) lymphotoxin A biosynthetic process(GO:0042109) |
| 0.1 | 0.4 | GO:0071038 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
| 0.1 | 1.0 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.1 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 1.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.1 | 0.5 | GO:0044565 | dendritic cell proliferation(GO:0044565) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 0.3 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 | 0.7 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.2 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.1 | 0.3 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 0.3 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.5 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 | 0.1 | GO:0071661 | granzyme B production(GO:0071613) regulation of granzyme B production(GO:0071661) positive regulation of granzyme B production(GO:0071663) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.1 | 0.2 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.1 | 0.1 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.5 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.6 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.2 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 | 0.4 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
| 0.1 | 1.3 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 1.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 2.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.2 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.1 | 0.9 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.3 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 | 0.5 | GO:0000050 | urea cycle(GO:0000050) |
| 0.1 | 0.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.7 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.9 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.1 | 0.2 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.1 | 0.5 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.1 | 0.1 | GO:0050870 | positive regulation of T cell activation(GO:0050870) |
| 0.1 | 1.1 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.6 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.1 | 0.2 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.1 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 0.8 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.6 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.1 | 1.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.5 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.1 | 0.5 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.1 | 0.2 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.1 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.1 | 0.5 | GO:1903524 | positive regulation of vasoconstriction(GO:0045907) positive regulation of blood circulation(GO:1903524) |
| 0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.9 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.1 | 0.1 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.1 | 0.2 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.1 | 0.1 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 | 1.0 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.8 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.2 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.1 | 0.3 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.3 | GO:1901090 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 | 0.2 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.9 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.4 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.4 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.0 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.0 | 0.3 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.9 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.0 | 0.2 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.9 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.4 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.0 | 0.1 | GO:1901253 | negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.0 | 1.6 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 | 0.1 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.0 | 1.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.6 | GO:0035268 | protein mannosylation(GO:0035268) protein O-linked mannosylation(GO:0035269) |
| 0.0 | 1.1 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 0.1 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.0 | 0.2 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.0 | 0.3 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.2 | GO:0035711 | plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) T-helper 1 cell activation(GO:0035711) |
| 0.0 | 0.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.2 | GO:0051958 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 1.5 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.5 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.1 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.0 | 0.8 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 5.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 2.9 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.0 | 0.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.2 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.0 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.5 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.5 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.2 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.5 | GO:0021795 | cerebral cortex cell migration(GO:0021795) |
| 0.0 | 0.1 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.0 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.3 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.0 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.3 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.4 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.0 | 0.5 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.2 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.4 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.0 | 0.1 | GO:0097359 | UDP-glucosylation(GO:0097359) |
| 0.0 | 0.1 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.0 | 0.3 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.9 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.5 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.0 | 0.1 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.0 | 1.1 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) otolith development(GO:0048840) |
| 0.0 | 0.2 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 0.1 | GO:0036378 | calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.0 | 4.1 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) |
| 0.0 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.1 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
| 0.0 | 0.2 | GO:0060754 | regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.0 | 3.1 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.2 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 | 0.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 3.8 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 1.2 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.6 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.0 | 0.2 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.0 | 0.5 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.3 | GO:2000373 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.0 | 0.1 | GO:0051311 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.0 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.1 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.0 | 0.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.5 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.1 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.4 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.1 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.5 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:0009080 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.0 | 0.2 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 | 0.8 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.6 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.1 | GO:0015853 | adenine transport(GO:0015853) |
| 0.0 | 1.1 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 1.2 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.0 | 0.5 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.1 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.0 | 0.6 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.5 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 1.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0045076 | interleukin-2 biosynthetic process(GO:0042094) regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.0 | 0.3 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.0 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.1 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.5 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.2 | GO:2001240 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.1 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) negative regulation of muscle hyperplasia(GO:0014740) |
| 0.0 | 0.2 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.3 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.2 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.8 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.2 | GO:1901731 | positive regulation of platelet aggregation(GO:1901731) |
| 0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.1 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.2 | GO:0031645 | negative regulation of neurological system process(GO:0031645) |
| 0.0 | 0.6 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.3 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.3 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) |
| 0.0 | 0.0 | GO:0072229 | proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.0 | 0.5 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 | 0.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.2 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.0 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.0 | 0.5 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.0 | 0.4 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.1 | GO:0032414 | positive regulation of ion transmembrane transporter activity(GO:0032414) |
| 0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.3 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 | 0.1 | GO:1903568 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.0 | 0.3 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.1 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.0 | 0.1 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.0 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.4 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 | 0.6 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 | 0.1 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.0 | 0.0 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.2 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.0 | 0.3 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.1 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 | 0.7 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.4 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 | 0.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.2 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.1 | GO:0007176 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:1901185 | regulation of epidermal growth factor receptor signaling pathway(GO:0042058) negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.1 | GO:0001694 | histamine biosynthetic process(GO:0001694) |
| 0.0 | 0.0 | GO:2000506 | negative regulation of energy homeostasis(GO:2000506) |
| 0.0 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.0 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.0 | 0.1 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.2 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.1 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.0 | 0.2 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.0 | 0.1 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 | 0.1 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.1 | GO:0097107 | postsynaptic density assembly(GO:0097107) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.1 | GO:0007530 | sex determination(GO:0007530) |
| 0.0 | 0.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.1 | GO:0035509 | positive regulation of centrosome duplication(GO:0010825) negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.0 | 0.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.5 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.1 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.0 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0018277 | protein deamination(GO:0018277) |
| 0.0 | 0.0 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.1 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.0 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.0 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.0 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.6 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.0 | 1.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0038042 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) |
| 0.0 | 0.0 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.3 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.0 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.1 | GO:0032606 | regulation of type I interferon production(GO:0032479) type I interferon production(GO:0032606) |
| 0.0 | 0.3 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.0 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.0 | 0.0 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.2 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.2 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.2 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.0 | 1.0 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.1 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.0 | 0.2 | GO:0006505 | GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.0 | 0.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.0 | 0.1 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.0 | 0.1 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.0 | 0.2 | GO:0046323 | glucose import(GO:0046323) |
| 0.0 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.3 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 1.0 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.3 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.0 | 0.2 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.1 | GO:1903543 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.0 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.0 | 0.1 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.0 | 0.4 | GO:0007099 | centriole replication(GO:0007099) |
| 0.0 | 0.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.0 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.0 | GO:0071872 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) |
| 0.0 | 0.7 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.2 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.0 | 0.1 | GO:0045837 | negative regulation of mitochondrial membrane potential(GO:0010917) negative regulation of membrane potential(GO:0045837) |
| 0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.0 | 0.2 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 7.8 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.3 | 2.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 0.2 | GO:0000776 | kinetochore(GO:0000776) |
| 0.2 | 0.6 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.2 | 4.1 | GO:0042627 | chylomicron(GO:0042627) |
| 0.2 | 0.5 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.2 | 1.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.2 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.2 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.2 | 2.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 2.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.2 | 0.3 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.2 | 0.6 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.2 | 2.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.4 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 1.3 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.3 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 1.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.7 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.6 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 2.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 0.7 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 1.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 1.5 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.1 | 0.4 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.1 | 1.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 3.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.4 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 0.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 1.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 1.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.8 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.3 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 1.7 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 11.4 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.1 | 0.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.3 | GO:0070685 | macropinocytic cup(GO:0070685) |
| 0.1 | 0.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 1.2 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.1 | 0.3 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.1 | 1.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.7 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.8 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.5 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.1 | 1.9 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.4 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.6 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.1 | 0.5 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.1 | 1.5 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.4 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.1 | 0.7 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.3 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.7 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.1 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 2.4 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.5 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.2 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.0 | 2.0 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 6.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.6 | GO:0030424 | axon(GO:0030424) |
| 0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.7 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.3 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.0 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.1 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.0 | 0.2 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.0 | 1.3 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.6 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.5 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 3.1 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 1.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.3 | GO:0005874 | microtubule(GO:0005874) |
| 0.0 | 0.1 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.0 | 1.0 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.9 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 1.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.4 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 1.3 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.4 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.8 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.6 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.2 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.0 | 0.1 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.0 | 3.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 2.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.5 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 2.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.7 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.8 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.4 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.2 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.3 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.0 | 0.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 3.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.2 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 2.0 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.5 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.2 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 2.0 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.5 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 2.4 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.6 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.2 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.7 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.2 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.4 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 1.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 2.3 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.3 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.2 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.5 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 1.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 1.5 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.3 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 2.8 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.1 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.1 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:1902495 | transmembrane transporter complex(GO:1902495) transporter complex(GO:1990351) |
| 0.0 | 0.6 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.0 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.3 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 1.0 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.8 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.8 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.0 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.4 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.6 | 1.7 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.6 | 2.2 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.5 | 4.0 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.5 | 0.5 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.5 | 1.5 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.5 | 1.4 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 0.4 | 1.3 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.4 | 1.3 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.4 | 1.2 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.4 | 1.6 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.4 | 1.5 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.4 | 3.8 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.4 | 1.1 | GO:0015067 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.4 | 1.1 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.4 | 1.1 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.3 | 0.9 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.3 | 1.5 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.3 | 1.4 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.3 | 1.9 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.3 | 2.5 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.3 | 1.1 | GO:0047860 | diiodophenylpyruvate reductase activity(GO:0047860) |
| 0.3 | 0.8 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.3 | 1.8 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.2 | 1.2 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.2 | 0.7 | GO:0047017 | geranylgeranyl reductase activity(GO:0045550) prostaglandin-F synthase activity(GO:0047017) |
| 0.2 | 0.7 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.2 | 0.7 | GO:0019862 | IgA binding(GO:0019862) |
| 0.2 | 0.7 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.2 | 0.7 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.2 | 7.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.2 | 1.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.2 | 0.4 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 0.6 | GO:0032181 | double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.2 | 0.4 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.2 | 1.7 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.2 | 0.6 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.2 | 1.2 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.2 | 1.7 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 0.9 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 0.5 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.2 | 1.3 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.2 | 1.1 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.2 | 0.5 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.1 | 3.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 1.0 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.3 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 2.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.7 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 1.3 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 0.6 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 1.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.5 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.1 | 1.4 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 1.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.5 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.1 | 0.6 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 0.4 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.1 | 1.9 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.4 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.4 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 0.4 | GO:0031783 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.1 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.8 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.4 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.1 | 1.5 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 1.5 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.4 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.1 | 0.6 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.1 | 0.4 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.1 | 0.7 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.5 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 1.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.8 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.7 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.3 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.1 | 1.1 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 3.2 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.3 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.5 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.1 | 0.3 | GO:0016826 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.1 | 0.6 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.3 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
| 0.1 | 0.8 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.4 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.3 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.1 | 1.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.8 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.6 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.6 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.3 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.1 | 0.9 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 1.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 1.0 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 1.6 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 1.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.5 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.1 | 0.7 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.4 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.1 | 0.2 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.1 | 1.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.6 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 0.6 | GO:0016679 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.5 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.1 | 0.1 | GO:0070643 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.1 | 0.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.1 | 0.7 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.1 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.5 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 1.9 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.1 | 1.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.4 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.6 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.4 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.1 | 1.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.8 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.1 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 0.2 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.1 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.4 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 0.7 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.7 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.5 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.1 | 0.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.2 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.1 | 0.7 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
| 0.1 | 0.6 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.2 | GO:0005287 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 0.1 | 0.1 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.7 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.1 | 0.5 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 3.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.2 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
| 0.1 | 1.0 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.2 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 0.3 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.3 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.1 | 0.5 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 2.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 1.4 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.3 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 11.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.4 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.2 | GO:0032356 | oxidized DNA binding(GO:0032356) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.7 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 2.8 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.6 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.3 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.0 | 1.0 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.0 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.0 | 2.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.8 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.0 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.2 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.0 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.4 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.9 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.3 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.8 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.2 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.0 | 0.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.5 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.7 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 1.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0003980 | UDP-glucose:glycoprotein glucosyltransferase activity(GO:0003980) |
| 0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 1.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.8 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 2.4 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.2 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.8 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.3 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 1.0 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.5 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.5 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.2 | GO:0036435 | IkappaB kinase activity(GO:0008384) K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 1.2 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.0 | 1.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 3.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.8 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.9 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.3 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.2 | GO:0004904 | interferon receptor activity(GO:0004904) |
| 0.0 | 1.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.1 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.0 | 0.8 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.3 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 1.6 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.3 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.0 | 0.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.6 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 1.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.1 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.0 | 0.4 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.0 | 0.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 1.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.0 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.4 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.6 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.0 | 0.6 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.2 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.9 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 0.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 1.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.3 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.1 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.1 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.0 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.0 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.0 | 0.1 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.0 | 1.1 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.7 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.0 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 2.2 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.2 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.5 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.1 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.0 | 0.1 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.0 | 0.1 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.0 | 0.1 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.3 | GO:0008200 | ion channel inhibitor activity(GO:0008200) channel inhibitor activity(GO:0016248) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.1 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.0 | 0.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 1.3 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.0 | 0.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.5 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.8 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.9 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.8 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.4 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 1.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.3 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.0 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.1 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.0 | GO:0005477 | pyruvate secondary active transmembrane transporter activity(GO:0005477) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 1.6 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.0 | GO:0005365 | myo-inositol transmembrane transporter activity(GO:0005365) |
| 0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.0 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.2 | 3.5 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.7 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 1.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 10.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 1.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 1.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.6 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 2.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 4.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 2.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 1.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 1.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 1.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 1.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.6 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 1.0 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 1.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.5 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.2 | 1.7 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 2.7 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 1.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 8.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 2.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 1.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 2.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 1.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 3.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 0.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 1.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 1.3 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.1 | 2.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 5.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 1.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 1.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 1.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.9 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 1.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 3.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 1.6 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 1.5 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.3 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 1.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.6 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 3.5 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 2.3 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 2.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 2.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.6 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.8 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.9 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 1.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 4.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 1.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 3.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 5.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 2.0 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.8 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 1.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.8 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 1.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.7 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.0 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.0 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.3 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 1.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 1.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.8 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.6 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 1.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.8 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |