SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TAL1
|
ENSG00000162367.7 | TAL bHLH transcription factor 1, erythroid differentiation factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TAL1 | hg19_v2_chr1_-_47697387_47697457 | 0.50 | 2.5e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_-_117695449 | 8.24 |
ENST00000292079.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr11_-_117698787 | 7.30 |
ENST00000260287.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr22_+_24577183 | 4.96 |
ENST00000358321.3
|
SUSD2
|
sushi domain containing 2 |
| chr11_-_117699413 | 4.60 |
ENST00000528014.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr12_-_52685312 | 4.54 |
ENST00000327741.5
|
KRT81
|
keratin 81 |
| chr6_-_32908792 | 4.30 |
ENST00000418107.2
|
HLA-DMB
|
major histocompatibility complex, class II, DM beta |
| chr11_-_117698765 | 4.26 |
ENST00000532119.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
| chr9_-_131940526 | 3.87 |
ENST00000372491.2
|
IER5L
|
immediate early response 5-like |
| chr7_-_134143841 | 3.77 |
ENST00000285930.4
|
AKR1B1
|
aldo-keto reductase family 1, member B1 (aldose reductase) |
| chr20_+_3776371 | 3.76 |
ENST00000245960.5
|
CDC25B
|
cell division cycle 25B |
| chr17_+_32582293 | 3.76 |
ENST00000580907.1
ENST00000225831.4 |
CCL2
|
chemokine (C-C motif) ligand 2 |
| chr16_+_770975 | 3.75 |
ENST00000569529.1
ENST00000564000.1 ENST00000219535.3 |
FAM173A
|
family with sequence similarity 173, member A |
| chr9_-_75567962 | 3.72 |
ENST00000297785.3
ENST00000376939.1 |
ALDH1A1
|
aldehyde dehydrogenase 1 family, member A1 |
| chr22_-_24641027 | 3.70 |
ENST00000398292.3
ENST00000263112.7 ENST00000418439.2 ENST00000424217.1 ENST00000327365.4 |
GGT5
|
gamma-glutamyltransferase 5 |
| chr8_-_27457494 | 3.67 |
ENST00000521770.1
|
CLU
|
clusterin |
| chrY_+_2709906 | 3.61 |
ENST00000430575.1
|
RPS4Y1
|
ribosomal protein S4, Y-linked 1 |
| chr2_+_74120094 | 3.53 |
ENST00000409731.3
ENST00000345517.3 ENST00000409918.1 ENST00000442912.1 ENST00000409624.1 |
ACTG2
|
actin, gamma 2, smooth muscle, enteric |
| chr8_-_95229531 | 3.37 |
ENST00000450165.2
|
CDH17
|
cadherin 17, LI cadherin (liver-intestine) |
| chr19_-_38743878 | 3.32 |
ENST00000587515.1
|
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr11_+_114168085 | 3.27 |
ENST00000541754.1
|
NNMT
|
nicotinamide N-methyltransferase |
| chr20_-_52790055 | 3.27 |
ENST00000395955.3
|
CYP24A1
|
cytochrome P450, family 24, subfamily A, polypeptide 1 |
| chr17_-_73761222 | 3.23 |
ENST00000437911.1
ENST00000225614.2 |
GALK1
|
galactokinase 1 |
| chr6_+_7727030 | 3.05 |
ENST00000283147.6
|
BMP6
|
bone morphogenetic protein 6 |
| chr20_-_23731893 | 3.03 |
ENST00000398402.1
|
CST1
|
cystatin SN |
| chr5_-_75919253 | 3.01 |
ENST00000296641.4
|
F2RL2
|
coagulation factor II (thrombin) receptor-like 2 |
| chr7_+_45927956 | 2.84 |
ENST00000275525.3
ENST00000457280.1 |
IGFBP1
|
insulin-like growth factor binding protein 1 |
| chr19_+_35521572 | 2.84 |
ENST00000262631.5
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
| chr2_+_238395879 | 2.77 |
ENST00000445024.2
ENST00000338530.4 ENST00000409373.1 |
MLPH
|
melanophilin |
| chr16_+_57844549 | 2.69 |
ENST00000564282.1
|
CTD-2600O9.1
|
uncharacterized protein LOC388282 |
| chr12_+_52445191 | 2.63 |
ENST00000243050.1
ENST00000394825.1 ENST00000550763.1 ENST00000394824.2 ENST00000548232.1 ENST00000562373.1 |
NR4A1
|
nuclear receptor subfamily 4, group A, member 1 |
| chr10_-_5046042 | 2.57 |
ENST00000421196.3
ENST00000455190.1 |
AKR1C2
|
aldo-keto reductase family 1, member C2 |
| chr17_-_26695013 | 2.56 |
ENST00000555059.2
|
CTB-96E2.2
|
Homeobox protein SEBOX |
| chr1_-_21995794 | 2.56 |
ENST00000542643.2
ENST00000374765.4 ENST00000317967.7 |
RAP1GAP
|
RAP1 GTPase activating protein |
| chr6_-_30080876 | 2.55 |
ENST00000376734.3
|
TRIM31
|
tripartite motif containing 31 |
| chr6_-_30080863 | 2.54 |
ENST00000540829.1
|
TRIM31
|
tripartite motif containing 31 |
| chr11_-_559377 | 2.52 |
ENST00000486629.1
|
C11orf35
|
chromosome 11 open reading frame 35 |
| chr7_-_108096822 | 2.51 |
ENST00000379028.3
ENST00000413765.2 ENST00000379022.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr11_+_114168773 | 2.46 |
ENST00000542647.1
ENST00000545255.1 |
NNMT
|
nicotinamide N-methyltransferase |
| chr4_-_155533787 | 2.46 |
ENST00000407946.1
ENST00000405164.1 ENST00000336098.3 ENST00000393846.2 ENST00000404648.3 ENST00000443553.1 |
FGG
|
fibrinogen gamma chain |
| chr7_-_95225768 | 2.44 |
ENST00000005178.5
|
PDK4
|
pyruvate dehydrogenase kinase, isozyme 4 |
| chr19_+_51153045 | 2.41 |
ENST00000458538.1
|
C19orf81
|
chromosome 19 open reading frame 81 |
| chr6_-_127780510 | 2.40 |
ENST00000487331.2
ENST00000483725.3 |
KIAA0408
|
KIAA0408 |
| chr9_+_139557360 | 2.39 |
ENST00000308874.7
ENST00000406555.3 ENST00000492862.2 |
EGFL7
|
EGF-like-domain, multiple 7 |
| chr17_+_39405939 | 2.37 |
ENST00000334109.2
|
KRTAP9-4
|
keratin associated protein 9-4 |
| chr4_+_88896819 | 2.36 |
ENST00000237623.7
ENST00000395080.3 ENST00000508233.1 ENST00000360804.4 |
SPP1
|
secreted phosphoprotein 1 |
| chr7_-_108096765 | 2.35 |
ENST00000379024.4
ENST00000351718.4 |
NRCAM
|
neuronal cell adhesion molecule |
| chr2_-_216946500 | 2.32 |
ENST00000265322.7
|
PECR
|
peroxisomal trans-2-enoyl-CoA reductase |
| chr17_-_26697304 | 2.31 |
ENST00000536498.1
|
VTN
|
vitronectin |
| chr11_-_2924720 | 2.30 |
ENST00000455942.2
|
SLC22A18AS
|
solute carrier family 22 (organic cation transporter), member 18 antisense |
| chr12_+_52450298 | 2.29 |
ENST00000550582.2
|
NR4A1
|
nuclear receptor subfamily 4, group A, member 1 |
| chr22_+_35776828 | 2.29 |
ENST00000216117.8
|
HMOX1
|
heme oxygenase (decycling) 1 |
| chr9_-_116840728 | 2.28 |
ENST00000265132.3
|
AMBP
|
alpha-1-microglobulin/bikunin precursor |
| chr7_-_95025661 | 2.27 |
ENST00000542556.1
ENST00000265627.5 ENST00000427422.1 ENST00000451904.1 |
PON1
PON3
|
paraoxonase 1 paraoxonase 3 |
| chr8_+_56014949 | 2.25 |
ENST00000327381.6
|
XKR4
|
XK, Kell blood group complex subunit-related family, member 4 |
| chr12_-_117537240 | 2.25 |
ENST00000392545.4
ENST00000541210.1 ENST00000335209.7 |
TESC
|
tescalcin |
| chr4_+_3768075 | 2.24 |
ENST00000509482.1
ENST00000330055.5 |
ADRA2C
|
adrenoceptor alpha 2C |
| chr19_+_859654 | 2.23 |
ENST00000592860.1
|
CFD
|
complement factor D (adipsin) |
| chr20_-_62493217 | 2.22 |
ENST00000601296.1
|
C20ORF135
|
C20ORF135 |
| chr11_-_117747327 | 2.22 |
ENST00000584230.1
ENST00000527429.1 ENST00000584394.1 ENST00000532984.1 |
FXYD6
FXYD6-FXYD2
|
FXYD domain containing ion transport regulator 6 FXYD6-FXYD2 readthrough |
| chr4_-_74864386 | 2.22 |
ENST00000296027.4
|
CXCL5
|
chemokine (C-X-C motif) ligand 5 |
| chr6_-_32908765 | 2.21 |
ENST00000416244.2
|
HLA-DMB
|
major histocompatibility complex, class II, DM beta |
| chr17_-_19648416 | 2.21 |
ENST00000426645.2
|
ALDH3A1
|
aldehyde dehydrogenase 3 family, member A1 |
| chr20_-_34542548 | 2.18 |
ENST00000305978.2
|
SCAND1
|
SCAN domain containing 1 |
| chr17_-_19648916 | 2.17 |
ENST00000444455.1
ENST00000439102.2 |
ALDH3A1
|
aldehyde dehydrogenase 3 family, member A1 |
| chr1_+_1217489 | 2.16 |
ENST00000325425.8
ENST00000400928.3 |
SCNN1D
|
sodium channel, non-voltage-gated 1, delta subunit |
| chr9_-_35815013 | 2.14 |
ENST00000259667.5
|
HINT2
|
histidine triad nucleotide binding protein 2 |
| chr2_+_238395803 | 2.14 |
ENST00000264605.3
|
MLPH
|
melanophilin |
| chr9_-_32573130 | 2.10 |
ENST00000350021.2
ENST00000379847.3 |
NDUFB6
|
NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 6, 17kDa |
| chr19_+_859425 | 2.10 |
ENST00000327726.6
|
CFD
|
complement factor D (adipsin) |
| chr14_+_21152706 | 2.09 |
ENST00000397995.2
ENST00000304704.4 ENST00000553909.1 |
RNASE4
AL163636.6
|
ribonuclease, RNase A family, 4 Homo sapiens ribonuclease, RNase A family, 4 (RNASE4), transcript variant 4, mRNA. |
| chr2_+_233734994 | 2.07 |
ENST00000331342.2
|
C2orf82
|
chromosome 2 open reading frame 82 |
| chr16_-_69760409 | 2.04 |
ENST00000561500.1
ENST00000439109.2 ENST00000564043.1 ENST00000379046.2 ENST00000379047.3 |
NQO1
|
NAD(P)H dehydrogenase, quinone 1 |
| chr3_+_149191723 | 2.03 |
ENST00000305354.4
|
TM4SF4
|
transmembrane 4 L six family member 4 |
| chr19_-_39402798 | 2.02 |
ENST00000571838.1
|
CTC-360G5.1
|
coiled-coil glutamate-rich protein 2 |
| chr15_-_31521567 | 2.01 |
ENST00000560812.1
ENST00000559853.1 ENST00000558109.1 |
RP11-16E12.2
|
RP11-16E12.2 |
| chr12_+_52643077 | 2.00 |
ENST00000553310.2
ENST00000544024.1 |
KRT86
|
keratin 86 |
| chr17_-_64225508 | 2.00 |
ENST00000205948.6
|
APOH
|
apolipoprotein H (beta-2-glycoprotein I) |
| chr11_+_67777751 | 1.97 |
ENST00000316367.6
ENST00000007633.8 ENST00000342456.6 |
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
| chr11_-_102401469 | 1.97 |
ENST00000260227.4
|
MMP7
|
matrix metallopeptidase 7 (matrilysin, uterine) |
| chr16_-_1821496 | 1.96 |
ENST00000564628.1
ENST00000563498.1 |
NME3
|
NME/NM23 nucleoside diphosphate kinase 3 |
| chr10_+_135204338 | 1.95 |
ENST00000468317.2
|
RP11-108K14.8
|
Mitochondrial GTPase 1 |
| chrX_-_15288154 | 1.94 |
ENST00000380483.3
ENST00000380485.3 ENST00000380488.4 |
ASB9
|
ankyrin repeat and SOCS box containing 9 |
| chr19_-_38746979 | 1.94 |
ENST00000591291.1
|
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr3_-_120365866 | 1.92 |
ENST00000475447.2
|
HGD
|
homogentisate 1,2-dioxygenase |
| chr16_-_88772761 | 1.91 |
ENST00000567844.1
ENST00000312838.4 |
RNF166
|
ring finger protein 166 |
| chr1_+_110453203 | 1.90 |
ENST00000357302.4
ENST00000344188.5 ENST00000329608.6 |
CSF1
|
colony stimulating factor 1 (macrophage) |
| chr19_-_38747172 | 1.88 |
ENST00000347262.4
ENST00000591585.1 ENST00000301242.4 |
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chrY_+_2709527 | 1.87 |
ENST00000250784.8
|
RPS4Y1
|
ribosomal protein S4, Y-linked 1 |
| chr1_-_238108575 | 1.87 |
ENST00000604646.1
|
MTRNR2L11
|
MT-RNR2-like 11 (pseudogene) |
| chr20_-_62129163 | 1.87 |
ENST00000298049.7
|
EEF1A2
|
eukaryotic translation elongation factor 1 alpha 2 |
| chr6_-_127840453 | 1.87 |
ENST00000556132.1
|
SOGA3
|
SOGA family member 3 |
| chr8_-_27468717 | 1.86 |
ENST00000520796.1
ENST00000520491.1 |
CLU
|
clusterin |
| chr21_+_47518011 | 1.85 |
ENST00000300527.4
ENST00000357838.4 ENST00000310645.5 |
COL6A2
|
collagen, type VI, alpha 2 |
| chr17_-_79623597 | 1.84 |
ENST00000574024.1
ENST00000331056.5 |
PDE6G
|
phosphodiesterase 6G, cGMP-specific, rod, gamma |
| chr3_-_196065248 | 1.84 |
ENST00000446879.1
ENST00000273695.3 |
TM4SF19
|
transmembrane 4 L six family member 19 |
| chr9_+_140445651 | 1.84 |
ENST00000371443.5
|
MRPL41
|
mitochondrial ribosomal protein L41 |
| chr11_-_77850629 | 1.84 |
ENST00000376156.3
ENST00000525870.1 ENST00000530454.1 ENST00000525755.1 ENST00000527099.1 ENST00000525761.1 ENST00000299626.5 |
ALG8
|
ALG8, alpha-1,3-glucosyltransferase |
| chr12_+_22778009 | 1.82 |
ENST00000266517.4
ENST00000335148.3 |
ETNK1
|
ethanolamine kinase 1 |
| chr17_-_26694979 | 1.82 |
ENST00000438614.1
|
VTN
|
vitronectin |
| chr11_-_45307817 | 1.81 |
ENST00000020926.3
|
SYT13
|
synaptotagmin XIII |
| chr16_+_2079637 | 1.81 |
ENST00000561844.1
|
SLC9A3R2
|
solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3 regulator 2 |
| chr6_+_1312675 | 1.79 |
ENST00000296839.2
|
FOXQ1
|
forkhead box Q1 |
| chr11_-_46142948 | 1.79 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr2_-_169769787 | 1.79 |
ENST00000451987.1
|
SPC25
|
SPC25, NDC80 kinetochore complex component |
| chr9_+_5231413 | 1.78 |
ENST00000239316.4
|
INSL4
|
insulin-like 4 (placenta) |
| chr17_+_39411636 | 1.77 |
ENST00000394008.1
|
KRTAP9-9
|
keratin associated protein 9-9 |
| chr22_+_24999114 | 1.77 |
ENST00000412658.1
ENST00000445029.1 ENST00000419133.1 ENST00000400382.1 ENST00000438643.2 ENST00000452551.1 ENST00000400383.1 ENST00000412898.1 ENST00000400380.1 ENST00000455483.1 ENST00000430289.1 |
GGT1
|
gamma-glutamyltransferase 1 |
| chr9_+_139553306 | 1.77 |
ENST00000371699.1
|
EGFL7
|
EGF-like-domain, multiple 7 |
| chr19_+_2249308 | 1.76 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
| chr3_+_186330712 | 1.76 |
ENST00000411641.2
ENST00000273784.5 |
AHSG
|
alpha-2-HS-glycoprotein |
| chrX_-_153775426 | 1.76 |
ENST00000393562.2
|
G6PD
|
glucose-6-phosphate dehydrogenase |
| chr11_-_74022658 | 1.76 |
ENST00000427714.2
ENST00000331597.4 |
P4HA3
|
prolyl 4-hydroxylase, alpha polypeptide III |
| chr1_-_110306526 | 1.75 |
ENST00000361965.4
ENST00000361852.4 |
EPS8L3
|
EPS8-like 3 |
| chr14_-_23822080 | 1.75 |
ENST00000397267.1
ENST00000354772.3 |
SLC22A17
|
solute carrier family 22, member 17 |
| chr5_-_59189545 | 1.74 |
ENST00000340635.6
|
PDE4D
|
phosphodiesterase 4D, cAMP-specific |
| chr16_-_67427389 | 1.73 |
ENST00000562206.1
ENST00000290942.5 ENST00000393957.2 |
TPPP3
|
tubulin polymerization-promoting protein family member 3 |
| chr6_+_160769399 | 1.73 |
ENST00000392145.1
|
SLC22A3
|
solute carrier family 22 (organic cation transporter), member 3 |
| chr9_+_43684902 | 1.73 |
ENST00000377564.3
ENST00000276974.6 |
CNTNAP3B
|
contactin associated protein-like 3B |
| chr19_-_39322497 | 1.73 |
ENST00000221418.4
|
ECH1
|
enoyl CoA hydratase 1, peroxisomal |
| chr18_-_56296182 | 1.73 |
ENST00000361673.3
|
ALPK2
|
alpha-kinase 2 |
| chr20_+_61867235 | 1.72 |
ENST00000342412.6
ENST00000217169.3 |
BIRC7
|
baculoviral IAP repeat containing 7 |
| chr15_+_89181974 | 1.72 |
ENST00000306072.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr20_+_3776936 | 1.71 |
ENST00000439880.2
|
CDC25B
|
cell division cycle 25B |
| chr19_+_18723660 | 1.71 |
ENST00000262817.3
|
TMEM59L
|
transmembrane protein 59-like |
| chr19_-_46272462 | 1.71 |
ENST00000317578.6
|
SIX5
|
SIX homeobox 5 |
| chr15_-_90294523 | 1.71 |
ENST00000300057.4
|
MESP1
|
mesoderm posterior 1 homolog (mouse) |
| chr2_+_120187465 | 1.70 |
ENST00000409826.1
ENST00000417645.1 |
TMEM37
|
transmembrane protein 37 |
| chr15_+_89182156 | 1.70 |
ENST00000379224.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr1_-_153518270 | 1.69 |
ENST00000354332.4
ENST00000368716.4 |
S100A4
|
S100 calcium binding protein A4 |
| chr17_+_43299241 | 1.68 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
| chr20_-_1165117 | 1.68 |
ENST00000381894.3
|
TMEM74B
|
transmembrane protein 74B |
| chr5_-_75919217 | 1.67 |
ENST00000504899.1
|
F2RL2
|
coagulation factor II (thrombin) receptor-like 2 |
| chr7_-_94953878 | 1.67 |
ENST00000222381.3
|
PON1
|
paraoxonase 1 |
| chr8_-_40200877 | 1.66 |
ENST00000521030.1
|
CTA-392C11.1
|
CTA-392C11.1 |
| chr2_+_120189422 | 1.66 |
ENST00000306406.4
|
TMEM37
|
transmembrane protein 37 |
| chr7_+_30960915 | 1.66 |
ENST00000441328.2
ENST00000409899.1 ENST00000409611.1 |
AQP1
|
aquaporin 1 (Colton blood group) |
| chr15_+_50474385 | 1.66 |
ENST00000267842.5
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
| chr3_-_196065374 | 1.65 |
ENST00000454715.1
|
TM4SF19
|
transmembrane 4 L six family member 19 |
| chr11_+_67776012 | 1.64 |
ENST00000539229.1
|
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
| chr20_-_52790512 | 1.62 |
ENST00000216862.3
|
CYP24A1
|
cytochrome P450, family 24, subfamily A, polypeptide 1 |
| chr15_+_78857870 | 1.62 |
ENST00000559554.1
|
CHRNA5
|
cholinergic receptor, nicotinic, alpha 5 (neuronal) |
| chr19_-_46285646 | 1.62 |
ENST00000458663.2
|
DMPK
|
dystrophia myotonica-protein kinase |
| chr19_-_55677920 | 1.61 |
ENST00000524407.2
ENST00000526003.1 ENST00000534170.1 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr12_-_8088871 | 1.61 |
ENST00000075120.7
|
SLC2A3
|
solute carrier family 2 (facilitated glucose transporter), member 3 |
| chr2_-_218808771 | 1.61 |
ENST00000449814.1
ENST00000171887.4 |
TNS1
|
tensin 1 |
| chr22_+_24990746 | 1.61 |
ENST00000456869.1
ENST00000411974.1 |
GGT1
|
gamma-glutamyltransferase 1 |
| chr1_+_22351977 | 1.60 |
ENST00000420503.1
ENST00000416769.1 ENST00000404210.2 |
LINC00339
|
long intergenic non-protein coding RNA 339 |
| chr5_+_75904918 | 1.60 |
ENST00000514001.1
ENST00000396234.3 ENST00000509074.1 |
IQGAP2
|
IQ motif containing GTPase activating protein 2 |
| chr6_-_127840336 | 1.60 |
ENST00000525778.1
|
SOGA3
|
SOGA family member 3 |
| chr9_-_140444814 | 1.59 |
ENST00000277531.4
|
PNPLA7
|
patatin-like phospholipase domain containing 7 |
| chr15_-_56757329 | 1.59 |
ENST00000260453.3
|
MNS1
|
meiosis-specific nuclear structural 1 |
| chr19_-_6502304 | 1.59 |
ENST00000540257.1
ENST00000594276.1 ENST00000594075.1 ENST00000600216.1 ENST00000596926.1 |
TUBB4A
|
tubulin, beta 4A class IVa |
| chr12_+_113344755 | 1.58 |
ENST00000550883.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr11_-_2924970 | 1.57 |
ENST00000533594.1
|
SLC22A18AS
|
solute carrier family 22 (organic cation transporter), member 18 antisense |
| chr16_+_89979826 | 1.56 |
ENST00000555427.1
|
MC1R
|
melanocortin 1 receptor (alpha melanocyte stimulating hormone receptor) |
| chr11_+_842928 | 1.56 |
ENST00000397408.1
|
TSPAN4
|
tetraspanin 4 |
| chr22_-_30960876 | 1.56 |
ENST00000401975.1
ENST00000428682.1 ENST00000423299.1 |
GAL3ST1
|
galactose-3-O-sulfotransferase 1 |
| chr19_-_36297348 | 1.55 |
ENST00000589835.1
|
PRODH2
|
proline dehydrogenase (oxidase) 2 |
| chrX_-_153744507 | 1.55 |
ENST00000442929.1
ENST00000426266.1 ENST00000359889.5 ENST00000369641.3 ENST00000447601.2 ENST00000434658.2 |
FAM3A
|
family with sequence similarity 3, member A |
| chr5_+_75699149 | 1.54 |
ENST00000379730.3
|
IQGAP2
|
IQ motif containing GTPase activating protein 2 |
| chr2_+_228029281 | 1.54 |
ENST00000396578.3
|
COL4A3
|
collagen, type IV, alpha 3 (Goodpasture antigen) |
| chr15_-_63448973 | 1.54 |
ENST00000462430.1
|
RPS27L
|
ribosomal protein S27-like |
| chr7_+_99971068 | 1.54 |
ENST00000198536.2
ENST00000453419.1 |
PILRA
|
paired immunoglobin-like type 2 receptor alpha |
| chr19_+_6887571 | 1.52 |
ENST00000250572.8
ENST00000381407.5 ENST00000312053.4 ENST00000450315.3 ENST00000381404.4 |
EMR1
|
egf-like module containing, mucin-like, hormone receptor-like 1 |
| chr14_+_77228532 | 1.52 |
ENST00000167106.4
ENST00000554237.1 |
VASH1
|
vasohibin 1 |
| chr10_-_95360983 | 1.52 |
ENST00000371464.3
|
RBP4
|
retinol binding protein 4, plasma |
| chr16_-_57880439 | 1.52 |
ENST00000565684.1
|
KIFC3
|
kinesin family member C3 |
| chr9_+_6645887 | 1.52 |
ENST00000413145.1
|
RP11-390F4.6
|
RP11-390F4.6 |
| chr11_+_1244288 | 1.52 |
ENST00000529681.1
ENST00000447027.1 |
MUC5B
|
mucin 5B, oligomeric mucus/gel-forming |
| chr19_+_2977444 | 1.51 |
ENST00000246112.4
ENST00000453329.1 ENST00000482627.1 ENST00000452088.1 |
TLE6
|
transducin-like enhancer of split 6 (E(sp1) homolog, Drosophila) |
| chr12_-_121477039 | 1.51 |
ENST00000257570.5
|
OASL
|
2'-5'-oligoadenylate synthetase-like |
| chr15_-_74495188 | 1.50 |
ENST00000563965.1
ENST00000395105.4 |
STRA6
|
stimulated by retinoic acid 6 |
| chr2_+_85981008 | 1.50 |
ENST00000306279.3
|
ATOH8
|
atonal homolog 8 (Drosophila) |
| chr4_+_2043689 | 1.50 |
ENST00000382878.3
ENST00000409248.4 |
C4orf48
|
chromosome 4 open reading frame 48 |
| chr2_-_45165994 | 1.50 |
ENST00000444871.2
|
RP11-89K21.1
|
RP11-89K21.1 |
| chr19_-_55677999 | 1.49 |
ENST00000532817.1
ENST00000527223.2 ENST00000391720.4 |
DNAAF3
|
dynein, axonemal, assembly factor 3 |
| chr11_-_62457371 | 1.49 |
ENST00000317449.4
|
LRRN4CL
|
LRRN4 C-terminal like |
| chr19_-_36297632 | 1.48 |
ENST00000588266.2
|
PRODH2
|
proline dehydrogenase (oxidase) 2 |
| chr1_-_153522562 | 1.48 |
ENST00000368714.1
|
S100A4
|
S100 calcium binding protein A4 |
| chr21_+_33784957 | 1.48 |
ENST00000401402.3
ENST00000382699.3 |
EVA1C
|
eva-1 homolog C (C. elegans) |
| chr12_-_121476959 | 1.47 |
ENST00000339275.5
|
OASL
|
2'-5'-oligoadenylate synthetase-like |
| chr3_+_167453493 | 1.47 |
ENST00000295777.5
ENST00000472747.2 |
SERPINI1
|
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr11_-_63933504 | 1.47 |
ENST00000255681.6
|
MACROD1
|
MACRO domain containing 1 |
| chr17_-_17480779 | 1.46 |
ENST00000395782.1
|
PEMT
|
phosphatidylethanolamine N-methyltransferase |
| chr15_+_89182178 | 1.46 |
ENST00000559876.1
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| chr12_+_72058130 | 1.45 |
ENST00000547843.1
|
THAP2
|
THAP domain containing, apoptosis associated protein 2 |
| chr16_-_2301563 | 1.45 |
ENST00000562238.1
ENST00000566379.1 ENST00000301729.4 |
ECI1
|
enoyl-CoA delta isomerase 1 |
| chr16_-_31076332 | 1.45 |
ENST00000539836.3
ENST00000535577.1 ENST00000442862.2 |
ZNF668
|
zinc finger protein 668 |
| chr19_-_16045619 | 1.45 |
ENST00000402119.4
|
CYP4F11
|
cytochrome P450, family 4, subfamily F, polypeptide 11 |
| chr14_-_23288930 | 1.45 |
ENST00000554517.1
ENST00000285850.7 ENST00000397529.2 ENST00000555702.1 |
SLC7A7
|
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
| chr3_+_49058444 | 1.44 |
ENST00000326925.6
ENST00000395458.2 |
NDUFAF3
|
NADH dehydrogenase (ubiquinone) complex I, assembly factor 3 |
| chrX_-_30326445 | 1.44 |
ENST00000378963.1
|
NR0B1
|
nuclear receptor subfamily 0, group B, member 1 |
| chr16_+_89642120 | 1.44 |
ENST00000268720.5
ENST00000319518.8 |
CPNE7
|
copine VII |
| chr16_+_2198604 | 1.43 |
ENST00000210187.6
|
RAB26
|
RAB26, member RAS oncogene family |
| chr15_-_88799384 | 1.43 |
ENST00000540489.2
ENST00000557856.1 ENST00000558676.1 |
NTRK3
|
neurotrophic tyrosine kinase, receptor, type 3 |
| chr11_-_842509 | 1.43 |
ENST00000322028.4
|
POLR2L
|
polymerase (RNA) II (DNA directed) polypeptide L, 7.6kDa |
| chr14_-_23822061 | 1.43 |
ENST00000397260.3
|
SLC22A17
|
solute carrier family 22, member 17 |
| chr16_-_2260834 | 1.43 |
ENST00000562360.1
ENST00000566018.1 |
BRICD5
|
BRICHOS domain containing 5 |
| chr19_-_58864848 | 1.42 |
ENST00000263100.3
|
A1BG
|
alpha-1-B glycoprotein |
| chr21_-_43786634 | 1.42 |
ENST00000291527.2
|
TFF1
|
trefoil factor 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 7.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 2.2 | 6.7 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 1.5 | 4.4 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 1.3 | 25.7 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 1.3 | 5.0 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 1.3 | 3.8 | GO:2000502 | negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 1.2 | 4.9 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 1.2 | 9.7 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 1.2 | 4.7 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 1.0 | 8.1 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 1.0 | 3.9 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 1.0 | 1.0 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.9 | 4.7 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.9 | 5.3 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.9 | 4.4 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.8 | 2.5 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.8 | 6.8 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.8 | 0.8 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.7 | 0.7 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.7 | 2.9 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.7 | 2.9 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.7 | 3.6 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.7 | 4.3 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.7 | 2.1 | GO:0035623 | renal glucose absorption(GO:0035623) |
| 0.7 | 2.8 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.7 | 2.0 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.7 | 2.0 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 0.7 | 2.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.7 | 2.7 | GO:0048242 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
| 0.7 | 3.3 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.6 | 0.6 | GO:0051775 | response to redox state(GO:0051775) cellular response to redox state(GO:0071461) |
| 0.6 | 2.5 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.6 | 3.7 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.6 | 2.5 | GO:2000863 | positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.6 | 1.2 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.6 | 3.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.6 | 2.4 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.6 | 1.8 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.6 | 4.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.6 | 2.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.6 | 1.7 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.6 | 2.3 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.6 | 1.1 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.6 | 2.8 | GO:1903971 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.6 | 4.0 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.6 | 1.7 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.6 | 1.7 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.6 | 2.2 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.6 | 7.8 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.6 | 1.7 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.5 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.5 | 1.1 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.5 | 9.7 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.5 | 1.6 | GO:1903465 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.5 | 2.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.5 | 2.1 | GO:0033076 | isoquinoline alkaloid metabolic process(GO:0033076) |
| 0.5 | 2.6 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.5 | 1.6 | GO:0034226 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.5 | 0.5 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.5 | 2.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.5 | 2.6 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.5 | 5.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.5 | 2.0 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 0.5 | 6.2 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.5 | 2.4 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 | 1.9 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.5 | 0.5 | GO:0009447 | putrescine catabolic process(GO:0009447) polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.5 | 0.5 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.5 | 1.4 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.5 | 5.9 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.4 | 2.2 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.4 | 0.4 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.4 | 2.6 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.4 | 0.9 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.4 | 1.3 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.4 | 2.6 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.4 | 2.1 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.4 | 1.7 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.4 | 1.2 | GO:2000775 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.4 | 2.5 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.4 | 2.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.4 | 2.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 | 1.6 | GO:0038185 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.4 | 0.4 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.4 | 0.4 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.4 | 2.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.4 | 0.4 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.4 | 1.2 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.4 | 0.4 | GO:0061227 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 | 0.8 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.4 | 1.6 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.4 | 5.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.4 | 2.7 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.4 | 1.9 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.4 | 1.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.4 | 1.5 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.4 | 0.7 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.4 | 3.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.4 | 6.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.4 | 1.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.4 | 1.5 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.4 | 2.9 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.4 | 1.1 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.4 | 1.4 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.4 | 1.1 | GO:0060827 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.3 | 1.4 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.3 | 0.3 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.3 | 1.0 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
| 0.3 | 1.0 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.3 | 2.1 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.3 | 5.7 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.3 | 0.7 | GO:0060458 | right lung development(GO:0060458) |
| 0.3 | 1.3 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.3 | 0.6 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.3 | 3.2 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.3 | 1.3 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.3 | 0.9 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.3 | 1.9 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.3 | 2.2 | GO:0060356 | leucine import(GO:0060356) |
| 0.3 | 0.9 | GO:0090345 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.3 | 2.8 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.3 | 0.3 | GO:0043132 | NAD transport(GO:0043132) |
| 0.3 | 1.2 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 | 0.9 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.3 | 2.1 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.3 | 2.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 6.3 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.3 | 0.3 | GO:0043366 | beta selection(GO:0043366) |
| 0.3 | 1.5 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.3 | 0.9 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.3 | 0.6 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.3 | 6.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 1.2 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.3 | 0.9 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.3 | 1.2 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.3 | 1.4 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.3 | 1.1 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.3 | 1.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 0.9 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 | 0.8 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.3 | 0.6 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.3 | 3.1 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.3 | 0.3 | GO:1902022 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.3 | 0.8 | GO:0060023 | soft palate development(GO:0060023) |
| 0.3 | 0.8 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.3 | 4.7 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.3 | 3.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.3 | 0.8 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.3 | 1.1 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.3 | 6.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.3 | 1.1 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.3 | 3.9 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.3 | 0.8 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.3 | 1.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 | 1.0 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.3 | 2.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.3 | 0.5 | GO:1904030 | negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.3 | 0.8 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.3 | 1.0 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.3 | 0.8 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 | 0.8 | GO:0015920 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) lipopolysaccharide transport(GO:0015920) |
| 0.3 | 0.8 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.3 | 1.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 | 1.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.3 | 1.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 1.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 | 1.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 1.0 | GO:0072278 | metanephric comma-shaped body morphogenesis(GO:0072278) |
| 0.2 | 1.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.2 | 3.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 | 1.5 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 | 1.5 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 | 1.2 | GO:0042363 | fat-soluble vitamin catabolic process(GO:0042363) |
| 0.2 | 1.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.2 | 0.7 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 1.2 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 | 1.6 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 0.7 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.2 | 0.7 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.2 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.2 | 1.4 | GO:0036100 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.2 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 0.9 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.2 | 0.2 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.2 | 3.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 | 0.7 | GO:0002877 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 | 0.9 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.2 | 1.6 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.2 | 1.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 0.4 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.2 | 0.9 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.2 | 7.0 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 | 0.7 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.2 | 7.2 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.2 | 1.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.2 | 0.6 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.2 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 0.6 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 | 1.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.2 | 0.9 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.2 | 0.8 | GO:0045354 | negative regulation of interferon-alpha production(GO:0032687) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.2 | 1.0 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.2 | 0.2 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.2 | 1.0 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.2 | 0.6 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 | 0.6 | GO:0032824 | negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.2 | 2.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.2 | 3.9 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.2 | 0.4 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.2 | 0.6 | GO:0060065 | uterus development(GO:0060065) |
| 0.2 | 0.2 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.2 | 0.6 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.2 | 0.2 | GO:0002544 | chronic inflammatory response(GO:0002544) |
| 0.2 | 1.8 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.2 | 0.8 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.2 | 0.2 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.2 | 0.6 | GO:1901145 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.2 | 1.0 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.2 | 0.2 | GO:1904640 | response to methionine(GO:1904640) |
| 0.2 | 1.2 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.2 | 0.6 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.2 | 0.6 | GO:1990086 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) lens fiber cell apoptotic process(GO:1990086) |
| 0.2 | 1.2 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.2 | 1.4 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.2 | 0.8 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.2 | 2.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.2 | 1.0 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.2 | 1.4 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 | 1.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 0.6 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.2 | 1.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.2 | 1.3 | GO:0019557 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.2 | 1.1 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 1.0 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.2 | 2.7 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.2 | 0.4 | GO:0010513 | positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.2 | 0.6 | GO:1903567 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.2 | 0.9 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.2 | 0.7 | GO:0032072 | plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) |
| 0.2 | 0.6 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.2 | 1.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.2 | 1.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 0.4 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.2 | 0.6 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.2 | 0.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 | 1.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.2 | 0.4 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 | 3.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 | 1.5 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.2 | 0.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 | 1.3 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 | 1.3 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.2 | 0.4 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 | 9.1 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.2 | 0.9 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.2 | 0.7 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.2 | 1.8 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.2 | 1.2 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.2 | 0.7 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.2 | 1.8 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.2 | 1.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.2 | 1.6 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.2 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.2 | 0.5 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.2 | 2.8 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.2 | 0.5 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.2 | 1.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 0.5 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.2 | 0.3 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.2 | 1.2 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.2 | 0.5 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.2 | 2.4 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.2 | 0.9 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.2 | 1.5 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.2 | 1.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.2 | 0.2 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.2 | 0.5 | GO:0018011 | N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.2 | 0.3 | GO:0061351 | neural precursor cell proliferation(GO:0061351) |
| 0.2 | 1.5 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.2 | 0.8 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 0.5 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 | 0.3 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.2 | 0.7 | GO:2001303 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.2 | 0.8 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.2 | 0.2 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.2 | 4.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 | 0.2 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.2 | 1.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.2 | 1.9 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.2 | 0.5 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.2 | 0.2 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.2 | 1.6 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.2 | 2.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.2 | 0.8 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.2 | 1.4 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.2 | 0.6 | GO:0060032 | notochord regression(GO:0060032) |
| 0.2 | 3.0 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.2 | 0.6 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 1.7 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 0.5 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.2 | 0.2 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.2 | 0.5 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.2 | 0.5 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.2 | 0.5 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 3.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.6 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.2 | 0.9 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.2 | 0.6 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.2 | 4.0 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 | 1.4 | GO:0015747 | urate transport(GO:0015747) |
| 0.2 | 1.8 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.2 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.9 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.1 | 0.4 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 0.1 | 0.9 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.4 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 2.3 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.3 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.1 | 3.4 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.4 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.1 | 0.7 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.4 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.1 | 0.7 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.4 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.7 | GO:0010522 | regulation of calcium ion transport into cytosol(GO:0010522) |
| 0.1 | 0.4 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 | 0.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 1.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.6 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.1 | 0.3 | GO:0035723 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.1 | 1.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 0.3 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 0.4 | GO:0045210 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.1 | 0.4 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 1.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.6 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 | 0.4 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.1 | 0.4 | GO:0021586 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 | 0.5 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 0.5 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.7 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 1.5 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 1.6 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.1 | 0.5 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 0.1 | 0.7 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.7 | GO:0060971 | intraciliary anterograde transport(GO:0035720) ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.3 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 | 2.9 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 0.8 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.3 | GO:0072248 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.7 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 0.5 | GO:0019860 | uracil metabolic process(GO:0019860) |
| 0.1 | 1.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.1 | 4.0 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.1 | 0.3 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.1 | 0.5 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.1 | 2.5 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 3.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.4 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.7 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.1 | 0.7 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
| 0.1 | 0.1 | GO:1990641 | response to iron ion starvation(GO:1990641) |
| 0.1 | 2.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 1.2 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.1 | 0.6 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 | 0.5 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.1 | 2.5 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.1 | 0.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.6 | GO:2000501 | regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.1 | 0.1 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.1 | 0.4 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 | 1.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.5 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.1 | 0.5 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.1 | 0.1 | GO:0044650 | adhesion of symbiont to host(GO:0044406) adhesion of symbiont to host cell(GO:0044650) receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 | 0.3 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.5 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.4 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 1.9 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.1 | 4.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 | 0.4 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.2 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 | 0.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.1 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.1 | 1.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 3.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.6 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.6 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.1 | 0.5 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 1.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 1.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 0.5 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.6 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.6 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.6 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 4.6 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.6 | GO:0044108 | cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.1 | 0.4 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.1 | 0.6 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.1 | 0.2 | GO:0060455 | positive regulation of norepinephrine secretion(GO:0010701) negative regulation of gastric acid secretion(GO:0060455) |
| 0.1 | 1.9 | GO:1901678 | heme transport(GO:0015886) iron coordination entity transport(GO:1901678) |
| 0.1 | 0.5 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 1.9 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.7 | GO:0052551 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.1 | 1.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 | 0.1 | GO:0060928 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.1 | 0.5 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 | 0.3 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.1 | 0.8 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.6 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.1 | 0.5 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.1 | 0.8 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 2.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 4.8 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 3.0 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 1.7 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 0.5 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.1 | 0.5 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.3 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 | 0.9 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.2 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 0.1 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.1 | 0.4 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.1 | 1.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 3.4 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.1 | 0.1 | GO:0055076 | transition metal ion homeostasis(GO:0055076) |
| 0.1 | 2.2 | GO:0034776 | response to histamine(GO:0034776) |
| 0.1 | 0.3 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.1 | 0.3 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.1 | 0.7 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 1.3 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.4 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.1 | 1.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.4 | GO:0060079 | excitatory postsynaptic potential(GO:0060079) |
| 0.1 | 0.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.9 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.9 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.1 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 1.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.1 | 0.6 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.1 | 0.3 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 | 1.0 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 1.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 11.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.2 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.1 | 0.4 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.1 | 1.7 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 0.2 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 0.4 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 1.3 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.1 | 0.9 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.2 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.1 | 0.6 | GO:0051304 | regulation of mitotic metaphase/anaphase transition(GO:0030071) chromosome separation(GO:0051304) mitotic sister chromatid separation(GO:0051306) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.4 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.1 | 1.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 1.0 | GO:0046479 | glycosphingolipid catabolic process(GO:0046479) |
| 0.1 | 1.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.9 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.2 | GO:0034165 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.1 | 0.1 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.1 | 0.5 | GO:0036512 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.1 | 0.4 | GO:0071462 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
| 0.1 | 0.7 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 | 0.5 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 | 0.3 | GO:1901571 | icosanoid secretion(GO:0032309) icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.1 | 0.2 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 3.7 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.1 | 0.3 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.5 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.5 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 0.1 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.1 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 | 1.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 0.7 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 0.8 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 | 1.3 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 1.8 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.5 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.1 | 0.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.4 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.6 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.1 | 13.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 0.6 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.1 | 0.4 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.1 | 1.4 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.3 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.1 | 0.5 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.1 | 0.5 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.1 | 0.5 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 1.5 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 0.3 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.1 | 0.5 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.2 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.1 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.1 | 0.6 | GO:0045959 | regulation of complement activation, classical pathway(GO:0030450) negative regulation of complement activation, classical pathway(GO:0045959) |
| 0.1 | 0.5 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.8 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.4 | GO:0005985 | sucrose metabolic process(GO:0005985) sucrose biosynthetic process(GO:0005986) |
| 0.1 | 0.2 | GO:1900744 | regulation of p38MAPK cascade(GO:1900744) |
| 0.1 | 0.5 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 3.6 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 0.3 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.5 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 0.4 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.1 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 0.8 | GO:0030969 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.1 | 2.0 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 1.6 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.6 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.9 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 3.5 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.6 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 | 0.3 | GO:0090194 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 0.1 | 0.5 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.3 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 0.9 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.3 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.1 | 0.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.5 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 0.2 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.1 | 0.7 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 1.2 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.1 | 1.7 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.2 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.1 | 0.1 | GO:1901624 | negative regulation of lymphocyte chemotaxis(GO:1901624) |
| 0.1 | 1.0 | GO:0015866 | ADP transport(GO:0015866) |
| 0.1 | 0.2 | GO:0071503 | response to heparin(GO:0071503) |
| 0.1 | 0.2 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
| 0.1 | 0.3 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.1 | 0.6 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.1 | 0.2 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) positive regulation of engulfment of apoptotic cell(GO:1901076) regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.1 | 0.2 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.1 | 6.9 | GO:0060337 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.8 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.2 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 2.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.5 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.4 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.1 | 2.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.1 | 0.4 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 2.8 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 1.3 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.2 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 1.0 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 1.4 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.9 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 1.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.8 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 | 0.2 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.1 | 0.2 | GO:1901159 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.1 | 1.2 | GO:0090656 | t-circle formation(GO:0090656) |
| 0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.4 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 2.1 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.1 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.1 | 0.2 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.1 | 1.3 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.1 | 1.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.2 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.1 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.1 | 0.2 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.1 | 0.4 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.1 | 0.2 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.1 | 0.3 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.2 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 | 0.3 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 1.9 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 | 6.3 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.8 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 0.4 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.3 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.1 | 0.6 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 | 0.3 | GO:0048736 | appendage development(GO:0048736) limb development(GO:0060173) |
| 0.1 | 0.5 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.2 | GO:0002818 | intracellular defense response(GO:0002818) |
| 0.1 | 0.6 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 2.9 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 | 0.3 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:0030187 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.1 | 0.1 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.1 | 0.3 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.9 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 1.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.1 | 0.5 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.5 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 | 0.1 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 1.3 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.1 | 0.1 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.1 | 0.4 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.1 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 1.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.5 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.1 | 1.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.4 | GO:0030282 | bone mineralization(GO:0030282) |
| 0.1 | 0.2 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 | 0.4 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.2 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.1 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 | 0.6 | GO:1903350 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.1 | 0.6 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.1 | 0.2 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.1 | 4.7 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.2 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.1 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 | 0.2 | GO:0006584 | catecholamine metabolic process(GO:0006584) catechol-containing compound metabolic process(GO:0009712) |
| 0.1 | 0.2 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 0.6 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.1 | 0.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.1 | 0.9 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.1 | 0.4 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.1 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.5 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.4 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.1 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 | 1.3 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
| 0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 2.5 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.1 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.1 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.1 | 0.5 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.1 | 0.4 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.1 | GO:0045425 | positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.1 | 0.5 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.1 | 0.3 | GO:0097374 | vestibulocochlear nerve structural organization(GO:0021649) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of cytokine activity(GO:0060301) renal artery morphogenesis(GO:0061441) ganglion morphogenesis(GO:0061552) endothelial tip cell fate specification(GO:0097102) sensory neuron axon guidance(GO:0097374) positive regulation of retinal ganglion cell axon guidance(GO:1902336) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.1 | 0.2 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.1 | 0.7 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.1 | 0.1 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 1.0 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 | 0.1 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 | 0.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.1 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.1 | 0.6 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 1.9 | GO:2000352 | negative regulation of endothelial cell apoptotic process(GO:2000352) |
| 0.1 | 0.3 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.1 | GO:0036294 | cellular response to decreased oxygen levels(GO:0036294) cellular response to hypoxia(GO:0071456) |
| 0.1 | 0.1 | GO:0001782 | B cell homeostasis(GO:0001782) |
| 0.1 | 0.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.7 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.1 | 0.2 | GO:0034130 | toll-like receptor 1 signaling pathway(GO:0034130) |
| 0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 0.7 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 1.0 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.3 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.7 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.1 | GO:2000977 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) regulation of forebrain neuron differentiation(GO:2000977) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.1 | 0.3 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.3 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.1 | 0.8 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 1.7 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.1 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.1 | 0.4 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.1 | 0.1 | GO:0071320 | cellular response to cAMP(GO:0071320) |
| 0.1 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.2 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.7 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.3 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 | 0.8 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.7 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.3 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.1 | 0.6 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 0.6 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 0.7 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.1 | 0.5 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.2 | GO:0060629 | regulation of homologous chromosome segregation(GO:0060629) |
| 0.1 | 0.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.4 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.1 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.4 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.4 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.1 | 0.4 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 1.1 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 0.3 | GO:0021884 | forebrain neuron development(GO:0021884) |
| 0.1 | 0.3 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.1 | 0.1 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.1 | 0.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 1.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.1 | 0.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 1.8 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 0.0 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 3.0 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.3 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.5 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 | 0.6 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.2 | GO:0002880 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 | 0.3 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.6 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.3 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.4 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.5 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.1 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 1.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.5 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
| 0.0 | 0.5 | GO:0042533 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.0 | 0.8 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.4 | GO:0072178 | nephric duct morphogenesis(GO:0072178) |
| 0.0 | 1.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.2 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.0 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 | 0.2 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.5 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.0 | 0.2 | GO:0001889 | liver development(GO:0001889) hepaticobiliary system development(GO:0061008) |
| 0.0 | 0.1 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.0 | 0.4 | GO:0007628 | adult walking behavior(GO:0007628) |
| 0.0 | 0.7 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.3 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.3 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 1.4 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 1.0 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.0 | 0.3 | GO:0021834 | chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.0 | 0.1 | GO:0016068 | regulation of type I hypersensitivity(GO:0001810) positive regulation of type I hypersensitivity(GO:0001812) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.4 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.2 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.3 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
| 0.0 | 0.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.2 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.0 | 0.3 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.0 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.0 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 1.1 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.1 | GO:0021551 | central nervous system morphogenesis(GO:0021551) cardiac muscle tissue regeneration(GO:0061026) regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 | 0.2 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.1 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.0 | 1.0 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.2 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0060788 | ectodermal placode formation(GO:0060788) hair follicle placode formation(GO:0060789) ectodermal placode development(GO:0071696) ectodermal placode morphogenesis(GO:0071697) |
| 0.0 | 0.1 | GO:1901383 | negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.0 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 0.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.0 | 0.0 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.0 | 0.4 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.1 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.0 | 0.4 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.1 | GO:0032966 | negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 | 0.3 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.0 | 0.2 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.0 | 0.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.0 | 0.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.2 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.0 | 0.6 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.6 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 1.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.2 | GO:0036371 | protein localization to T-tubule(GO:0036371) |
| 0.0 | 3.6 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.3 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.2 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.0 | 4.0 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) |
| 0.0 | 0.2 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.0 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 | 1.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.2 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
| 0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.5 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.1 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.0 | 0.8 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.9 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.1 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 | 0.4 | GO:2001259 | positive regulation of cation channel activity(GO:2001259) |
| 0.0 | 0.7 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.5 | GO:0051607 | defense response to virus(GO:0051607) |
| 0.0 | 0.4 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.1 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 | 0.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.2 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 | 0.1 | GO:0002863 | positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
| 0.0 | 0.1 | GO:0010842 | retina layer formation(GO:0010842) retina morphogenesis in camera-type eye(GO:0060042) |
| 0.0 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.2 | GO:0006458 | 'de novo' protein folding(GO:0006458) |
| 0.0 | 0.9 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
| 0.0 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.2 | GO:1901532 | regulation of megakaryocyte differentiation(GO:0045652) regulation of hematopoietic progenitor cell differentiation(GO:1901532) |
| 0.0 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.2 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 1.2 | GO:0050427 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.3 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.3 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.1 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.2 | GO:0098758 | interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 | 0.2 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.0 | 0.1 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.0 | 0.1 | GO:0006986 | response to unfolded protein(GO:0006986) response to topologically incorrect protein(GO:0035966) |
| 0.0 | 0.0 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) lateral mesodermal cell fate commitment(GO:0048372) lateral mesodermal cell fate specification(GO:0048377) regulation of lateral mesodermal cell fate specification(GO:0048378) |
| 0.0 | 0.4 | GO:0000732 | strand displacement(GO:0000732) |
| 0.0 | 0.2 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.6 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.1 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 | 0.3 | GO:0060021 | palate development(GO:0060021) |
| 0.0 | 0.1 | GO:0002304 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.3 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.0 | 0.1 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 0.1 | GO:0048840 | otolith morphogenesis(GO:0032474) otolith development(GO:0048840) |
| 0.0 | 0.1 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.0 | 0.4 | GO:1901072 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.3 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 0.1 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.0 | 0.1 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.0 | 0.2 | GO:0072698 | protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.0 | 0.3 | GO:0010827 | regulation of glucose transport(GO:0010827) |
| 0.0 | 0.3 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.2 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.0 | 0.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.0 | 0.1 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.0 | 0.0 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.4 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.0 | 1.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0051685 | endoplasmic reticulum localization(GO:0051643) maintenance of ER location(GO:0051685) |
| 0.0 | 0.1 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.3 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.2 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.2 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
| 0.0 | 0.2 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.0 | 0.2 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.1 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.0 | 0.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.3 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.2 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.0 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.0 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.0 | GO:0060298 | sarcomerogenesis(GO:0048769) positive regulation of sarcomere organization(GO:0060298) |
| 0.0 | 0.3 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.1 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.1 | GO:0009213 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.4 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.1 | GO:0019075 | virus maturation(GO:0019075) |
| 0.0 | 0.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.1 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.1 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 | 0.0 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.2 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.0 | 0.1 | GO:0042461 | photoreceptor cell development(GO:0042461) |
| 0.0 | 0.3 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.8 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
| 0.0 | 0.1 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.0 | 0.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
| 0.0 | 0.6 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.2 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.0 | 0.2 | GO:0019471 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 | 0.4 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.1 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.0 | GO:0051458 | corticotropin secretion(GO:0051458) |
| 0.0 | 0.0 | GO:0055094 | response to lipoprotein particle(GO:0055094) cellular response to lipoprotein particle stimulus(GO:0071402) |
| 0.0 | 0.4 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 1.0 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0009191 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 | 0.5 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.0 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 0.1 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.0 | 0.1 | GO:0061047 | regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 1.0 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 0.4 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.0 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.6 | GO:0090662 | ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.0 | 0.0 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.0 | 0.3 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.1 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.0 | 0.2 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) |
| 0.0 | 0.4 | GO:0043030 | regulation of macrophage activation(GO:0043030) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:2000106 | regulation of leukocyte apoptotic process(GO:2000106) |
| 0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.0 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.1 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 0.1 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.2 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.4 | GO:0007140 | male meiosis(GO:0007140) |
| 0.0 | 0.1 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.2 | GO:0007129 | synapsis(GO:0007129) |
| 0.0 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.1 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.3 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.1 | GO:0060591 | Sertoli cell fate commitment(GO:0060010) chondroblast differentiation(GO:0060591) |
| 0.0 | 0.1 | GO:0019477 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.0 | 0.8 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.1 | GO:0042303 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 | 0.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.1 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.1 | GO:0072033 | renal vesicle formation(GO:0072033) |
| 0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.0 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.0 | GO:0051145 | smooth muscle cell differentiation(GO:0051145) |
| 0.0 | 0.3 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.2 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.0 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.0 | 0.0 | GO:0072172 | mesonephric tubule formation(GO:0072172) |
| 0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.0 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 | 0.1 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0060135 | maternal placenta development(GO:0001893) maternal process involved in female pregnancy(GO:0060135) |
| 0.0 | 0.2 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.0 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.1 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 5.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 1.0 | 25.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.8 | 13.4 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.8 | 3.8 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.7 | 2.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.7 | 2.0 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.5 | 3.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.5 | 1.5 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.5 | 1.5 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.4 | 2.0 | GO:0070701 | mucus layer(GO:0070701) |
| 0.4 | 3.0 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.4 | 3.6 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.3 | 2.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.3 | 2.0 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.3 | 0.9 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.3 | 2.7 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.3 | 2.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.3 | 0.9 | GO:0035101 | FACT complex(GO:0035101) |
| 0.3 | 0.6 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 0.9 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.3 | 1.4 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.3 | 1.9 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.3 | 0.8 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.3 | 0.8 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.3 | 2.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.3 | 5.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 2.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.2 | 3.5 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 5.7 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 0.5 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.2 | 1.6 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.2 | 0.9 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.2 | 0.5 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.2 | 1.8 | GO:1990393 | 3M complex(GO:1990393) |
| 0.2 | 1.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.2 | 0.7 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.2 | 0.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 0.9 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.2 | 2.4 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.2 | 1.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 2.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 0.6 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.2 | 0.8 | GO:0097361 | CIA complex(GO:0097361) |
| 0.2 | 1.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.2 | 0.6 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.2 | 1.9 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.2 | 1.4 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.2 | 0.6 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.2 | 3.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 0.4 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.2 | 2.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.2 | 0.9 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.2 | 1.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.2 | 0.9 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 0.9 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.2 | 0.5 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 1.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 3.5 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.2 | 1.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 3.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 0.7 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.2 | 1.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.2 | 0.7 | GO:0070938 | contractile ring(GO:0070938) |
| 0.2 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.2 | 0.7 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.2 | 3.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.2 | 1.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.2 | 5.1 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.2 | 0.3 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.2 | 1.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.2 | 3.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.2 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.2 | 0.5 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 2.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 4.1 | GO:0032982 | myosin filament(GO:0032982) |
| 0.1 | 3.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 1.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 1.4 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 10.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 0.5 | GO:0000811 | GINS complex(GO:0000811) DNA replication preinitiation complex(GO:0031261) |
| 0.1 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 3.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 8.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 1.0 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.9 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.1 | 1.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.5 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.1 | 1.5 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 2.9 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.1 | 0.6 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 1.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 1.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.7 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 2.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.3 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.7 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.8 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.3 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.9 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 1.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.8 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.8 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.2 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.1 | 2.2 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.3 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 0.5 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 1.4 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 0.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.7 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 11.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 0.3 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.1 | 1.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 0.8 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.3 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 0.9 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.1 | 1.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 1.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 2.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 1.3 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 1.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 1.0 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.1 | 2.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 0.7 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.1 | 0.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.5 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 1.6 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 2.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.1 | 1.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 0.4 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 1.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 2.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.4 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.7 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.2 | GO:0035841 | new growing cell tip(GO:0035841) |
| 0.1 | 0.3 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 1.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.1 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 2.6 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.8 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.5 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.1 | 0.5 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 7.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 1.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.6 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 0.3 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.8 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.1 | 0.6 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.5 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.6 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 0.3 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 1.0 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 1.6 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 5.0 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 2.0 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.7 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.9 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.0 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 1.5 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.5 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.9 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 1.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) symmetric synapse(GO:0032280) |
| 0.0 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 1.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 1.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.6 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.2 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 1.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.7 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.4 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.6 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.7 | GO:0032059 | bleb(GO:0032059) |
| 0.0 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.2 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.0 | 0.6 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.4 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 2.3 | GO:0005657 | replication fork(GO:0005657) |
| 0.0 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 7.2 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.1 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 4.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 3.1 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.9 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.4 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 1.6 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.1 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 1.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.3 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.0 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 1.2 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.8 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.1 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 0.0 | 0.1 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 19.7 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.0 | 0.2 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 3.3 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 7.4 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 1.9 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.5 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.2 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.8 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.7 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 0.7 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.9 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 2.9 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.8 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 2.6 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.1 | GO:0042025 | host cell nucleus(GO:0042025) |
| 0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 2.7 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.7 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 1.3 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 6.2 | GO:0031966 | mitochondrial membrane(GO:0031966) |
| 0.0 | 0.7 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.1 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 0.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.8 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) |
| 0.0 | 0.7 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 0.1 | GO:0036024 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.0 | 1.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.0 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.0 | 5.6 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 1.2 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.2 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.8 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.0 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.0 | 0.2 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.5 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.0 | 0.0 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.9 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.5 | 4.6 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 1.4 | 5.7 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 1.3 | 4.0 | GO:0015322 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 1.3 | 5.1 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.2 | 25.4 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 1.1 | 4.3 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 1.1 | 4.3 | GO:0004335 | galactokinase activity(GO:0004335) |
| 1.0 | 7.3 | GO:0047086 | phenanthrene 9,10-monooxygenase activity(GO:0018636) ketosteroid monooxygenase activity(GO:0047086) |
| 1.0 | 9.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 1.0 | 3.0 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.9 | 2.7 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.9 | 3.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.8 | 2.5 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.8 | 0.8 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.8 | 2.3 | GO:0019862 | IgA binding(GO:0019862) |
| 0.7 | 2.2 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.7 | 3.7 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.7 | 0.7 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.7 | 2.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.7 | 2.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.7 | 4.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.7 | 2.0 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 0.7 | 3.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.7 | 4.7 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.7 | 4.6 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.6 | 3.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.6 | 2.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.6 | 1.8 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.6 | 2.3 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.6 | 6.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.6 | 2.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.6 | 1.7 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.5 | 9.7 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.5 | 1.6 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.5 | 6.4 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.5 | 2.6 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.5 | 2.6 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.5 | 2.0 | GO:0047860 | diiodophenylpyruvate reductase activity(GO:0047860) |
| 0.5 | 1.5 | GO:0032181 | double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.5 | 1.5 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.5 | 1.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 1.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.4 | 1.3 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.4 | 1.6 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.4 | 1.2 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.4 | 1.2 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.4 | 1.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.4 | 2.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.4 | 3.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.4 | 1.5 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 4.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.4 | 4.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.3 | 1.4 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.3 | 0.3 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 2.8 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.3 | 1.0 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.3 | 9.9 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.3 | 1.7 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.3 | 1.0 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 0.3 | 0.7 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.3 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.3 | 1.3 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.3 | 1.3 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.3 | 0.9 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.3 | 4.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.3 | 1.2 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.3 | 0.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.3 | 10.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.3 | 7.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.3 | 0.9 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.3 | 1.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.3 | 1.5 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.3 | 1.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.3 | 0.6 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.3 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.3 | 0.9 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.3 | 0.9 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.3 | 2.5 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.3 | 2.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.3 | 1.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.3 | 1.9 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.3 | 2.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.3 | 0.5 | GO:0070643 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.3 | 1.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.3 | 0.8 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.3 | 1.0 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.3 | 0.8 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 0.3 | 1.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.3 | 2.5 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.2 | 1.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.2 | 0.7 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.2 | 2.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.2 | 1.2 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.2 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.2 | 2.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 1.5 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.2 | 1.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 0.7 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.2 | 1.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.2 | 2.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.7 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.2 | 2.1 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.2 | 1.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.2 | 0.2 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 0.7 | GO:0051908 | double-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0051908) |
| 0.2 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 0.9 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.2 | 2.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.2 | 2.5 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.2 | 1.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 1.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.2 | 3.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 0.7 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.2 | 0.7 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.2 | 0.4 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.2 | 0.6 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.2 | 1.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.2 | 1.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.2 | 0.6 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.2 | 2.3 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.2 | 0.6 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
| 0.2 | 3.9 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.2 | 1.0 | GO:0070905 | serine binding(GO:0070905) |
| 0.2 | 1.6 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.2 | 0.4 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.2 | 0.6 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.2 | 1.6 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.2 | 2.0 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.2 | 1.2 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.2 | 1.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.2 | 1.0 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.2 | 0.6 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.2 | 6.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.2 | 1.9 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.2 | 0.6 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.2 | 1.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.2 | 0.8 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.2 | 0.6 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.2 | 1.5 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.2 | 3.0 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.2 | 0.8 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.2 | 0.9 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.2 | 2.4 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.2 | 0.7 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.2 | 1.9 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.2 | 1.5 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.2 | 2.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 0.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 0.5 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.2 | 1.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.2 | 0.9 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.2 | 0.5 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.2 | 5.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.2 | 0.5 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.2 | 0.7 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.2 | 0.9 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.2 | 0.4 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.2 | 2.1 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 0.7 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 4.0 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 0.7 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.2 | 0.9 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.2 | 2.0 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.2 | 6.3 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.2 | 1.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.2 | 0.7 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 1.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.2 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.2 | 0.3 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.2 | 0.5 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.2 | 2.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.2 | 0.5 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.2 | 1.0 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.2 | 0.5 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.2 | 5.0 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 0.5 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.2 | 5.3 | GO:0016675 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 3.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.2 | 2.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.2 | 0.6 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.2 | 1.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.2 | 1.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.2 | 1.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 0.3 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.2 | 2.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 0.5 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.4 | GO:0004397 | histidine ammonia-lyase activity(GO:0004397) |
| 0.1 | 0.6 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.1 | 1.5 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 1.6 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.4 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.4 | GO:0070361 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.1 | 0.7 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.6 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 1.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 1.4 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.1 | 0.4 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 1.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.9 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 3.1 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 2.8 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.4 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.1 | 0.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 1.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 3.1 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.4 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.1 | 0.8 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 2.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.4 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 1.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.1 | 2.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.9 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.1 | 1.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.5 | GO:0005019 | platelet-derived growth factor beta-receptor activity(GO:0005019) |
| 0.1 | 1.2 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 1.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.5 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.7 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 2.9 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.1 | 0.6 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 1.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.6 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.8 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.5 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 1.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 2.4 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 0.5 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.1 | 0.5 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 4.4 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.4 | GO:0051499 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.1 | 0.5 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.5 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 1.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 2.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 0.4 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
| 0.1 | 0.4 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 1.0 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.5 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 1.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 3.0 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 2.0 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.4 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 1.7 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 3.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 3.7 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 1.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.1 | 1.2 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 0.3 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.1 | 1.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 0.5 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.1 | 1.9 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.6 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 0.7 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 1.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.5 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 1.6 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
| 0.1 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.6 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 1.3 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 0.8 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.3 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
| 0.1 | 3.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.8 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 3.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 0.4 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.1 | 1.5 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.4 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.1 | 0.9 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.6 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 1.0 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.1 | 0.4 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.3 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.1 | 1.2 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 25.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.6 | GO:0052656 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 1.7 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.8 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 0.6 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.1 | 0.6 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.8 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 1.4 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.1 | 0.7 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.5 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 0.5 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 1.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 1.6 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.3 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.1 | 1.1 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.1 | 0.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.5 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 0.8 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.1 | 1.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.4 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 0.3 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.1 | 1.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 3.7 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 6.7 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.8 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.1 | 0.5 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.7 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.2 | GO:0030107 | HLA-A specific inhibitory MHC class I receptor activity(GO:0030107) HLA-B specific inhibitory MHC class I receptor activity(GO:0030109) inhibitory MHC class I receptor activity(GO:0032396) |
| 0.1 | 0.6 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.1 | 0.7 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.3 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 0.7 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.1 | 0.6 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 1.0 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.6 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 2.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.5 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 5.5 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 2.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 1.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.3 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.4 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 4.3 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.1 | 0.2 | GO:0090554 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylcholine-translocating ATPase activity(GO:0090554) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.1 | 3.1 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 1.6 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 1.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 2.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.5 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 1.3 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 1.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 2.4 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.7 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 1.0 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.4 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.4 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.1 | 0.6 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.4 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.1 | 0.5 | GO:0004519 | endonuclease activity(GO:0004519) |
| 0.1 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.1 | 0.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.6 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.8 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.2 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.1 | 0.5 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.3 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 1.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.0 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.1 | 1.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.7 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 0.2 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.1 | 0.8 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.2 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.1 | 1.0 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 0.6 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.2 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.1 | 0.3 | GO:0051800 | phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
| 0.1 | 0.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 0.2 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
| 0.1 | 0.2 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.1 | 0.8 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.5 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.3 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.1 | 2.1 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.1 | 0.4 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 1.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.4 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.1 | 0.6 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.4 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 2.3 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.2 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.1 | 0.2 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 0.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 6.4 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 0.2 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.6 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.4 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.1 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 1.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.1 | 0.2 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 0.4 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.1 | 0.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 1.4 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.1 | 0.2 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 0.5 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.1 | 0.3 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.1 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.1 | 2.0 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.1 | 0.4 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 1.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.4 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.1 | 0.4 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.2 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.6 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.2 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.1 | 5.7 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.1 | 0.3 | GO:0016917 | GABA receptor activity(GO:0016917) |
| 0.1 | 0.2 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.1 | 0.7 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 1.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 0.2 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.1 | 0.2 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.2 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 0.8 | GO:0034594 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.0 | 2.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 2.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.3 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.3 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.5 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.9 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.5 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.2 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.0 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.8 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 1.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 0.0 | 0.3 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.3 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.4 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.0 | 1.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.7 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 1.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0042020 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.0 | 0.2 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.4 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 1.3 | GO:0005231 | excitatory extracellular ligand-gated ion channel activity(GO:0005231) |
| 0.0 | 0.9 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 1.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 1.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.3 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 1.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.2 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.0 | 0.2 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.8 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.2 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 3.6 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.5 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.5 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 1.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0099589 | serotonin receptor activity(GO:0099589) |
| 0.0 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.0 | 0.4 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.1 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.0 | 0.6 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.0 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 0.2 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.8 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
| 0.0 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.4 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.5 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.1 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.0 | 1.8 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.0 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 1.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.2 | GO:0099528 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) dopamine neurotransmitter receptor activity(GO:0004952) G-protein coupled neurotransmitter receptor activity(GO:0099528) |
| 0.0 | 0.2 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.0 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.5 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 2.7 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 1.0 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.0 | 0.3 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.6 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.0 | 1.2 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.2 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.2 | GO:0004918 | interleukin-8 receptor activity(GO:0004918) |
| 0.0 | 0.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.0 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.7 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.5 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.2 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.1 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.0 | 0.3 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 2.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.1 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.7 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 1.2 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
| 0.0 | 0.1 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.2 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 2.0 | GO:0005267 | potassium channel activity(GO:0005267) |
| 0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.0 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.0 | 0.1 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.0 | 0.2 | GO:0052811 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.4 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) type II activin receptor binding(GO:0070699) |
| 0.0 | 0.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.8 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.2 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 1.2 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.8 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.0 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.4 | GO:0004950 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.2 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.0 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 2.5 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.2 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 4.9 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.0 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.0 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.0 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.7 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.4 | 5.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.2 | 1.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.2 | 5.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.2 | 10.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.2 | 10.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.9 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.1 | 12.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 1.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.5 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 2.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 2.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 7.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 0.4 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 5.6 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 1.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 1.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 1.0 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.4 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 3.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.7 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 2.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 2.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 1.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 2.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 1.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 1.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 2.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 3.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 2.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 2.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.8 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.9 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 1.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.9 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 6.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.3 | 21.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.3 | 6.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.3 | 5.6 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.3 | 8.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.3 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.3 | 1.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.2 | 9.9 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.2 | 4.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.2 | 10.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 3.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.2 | 5.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.2 | 6.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.2 | 4.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 5.0 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.2 | 1.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.2 | 1.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 4.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.2 | 8.9 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.2 | 18.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.2 | 0.7 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.2 | 3.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.2 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 0.2 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.2 | 7.9 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 2.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.8 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 0.3 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 1.8 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 1.9 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 4.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 4.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 2.6 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 2.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 8.1 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 3.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.1 | 2.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.1 | 0.7 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 9.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 8.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.1 | 21.6 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.1 | 1.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 8.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 3.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 5.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 0.9 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 2.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 1.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 1.0 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 2.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.6 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 1.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 4.1 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.7 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 2.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 4.4 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.5 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 1.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.1 | 1.6 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.4 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 3.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 1.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 5.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.2 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.1 | 1.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 1.0 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.1 | 3.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 2.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 2.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 5.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 4.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.1 | 1.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 1.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 4.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 3.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.1 | 0.6 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 0.9 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 5.9 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.6 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.1 | 1.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 1.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 1.0 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 1.1 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.5 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.8 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 5.0 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 3.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.4 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.4 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.7 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 1.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 4.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 1.6 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 0.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.2 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 1.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 1.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 3.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.5 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 1.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.5 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
| 0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 3.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.5 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.4 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.3 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 1.9 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 1.1 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 1.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.6 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.7 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 1.2 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |