SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
TCF12
|
ENSG00000140262.13 | transcription factor 12 |
ASCL2
|
ENSG00000183734.4 | achaete-scute family bHLH transcription factor 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
TCF12 | hg19_v2_chr15_+_57540213_57540218 | -0.79 | 3.1e-05 | Click! |
ASCL2 | hg19_v2_chr11_-_2292182_2292212 | 0.32 | 1.7e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr11_-_117695449 | 7.90 |
ENST00000292079.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
chr17_-_73761222 | 4.95 |
ENST00000437911.1
ENST00000225614.2 |
GALK1
|
galactokinase 1 |
chr17_+_32582293 | 4.47 |
ENST00000580907.1
ENST00000225831.4 |
CCL2
|
chemokine (C-C motif) ligand 2 |
chr19_+_35521572 | 4.30 |
ENST00000262631.5
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
chr5_+_175223313 | 4.12 |
ENST00000359546.4
|
CPLX2
|
complexin 2 |
chr12_+_52450298 | 3.92 |
ENST00000550582.2
|
NR4A1
|
nuclear receptor subfamily 4, group A, member 1 |
chr20_+_62367989 | 3.66 |
ENST00000309546.3
|
LIME1
|
Lck interacting transmembrane adaptor 1 |
chr22_-_30960876 | 3.57 |
ENST00000401975.1
ENST00000428682.1 ENST00000423299.1 |
GAL3ST1
|
galactose-3-O-sulfotransferase 1 |
chr17_+_39411636 | 3.56 |
ENST00000394008.1
|
KRTAP9-9
|
keratin associated protein 9-9 |
chr9_+_140445651 | 3.34 |
ENST00000371443.5
|
MRPL41
|
mitochondrial ribosomal protein L41 |
chr22_-_50970506 | 3.17 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
chr15_+_89182156 | 3.16 |
ENST00000379224.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
chr6_+_1312675 | 3.13 |
ENST00000296839.2
|
FOXQ1
|
forkhead box Q1 |
chr22_-_50970566 | 2.88 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
chr9_-_140444867 | 2.83 |
ENST00000406427.1
|
PNPLA7
|
patatin-like phospholipase domain containing 7 |
chr19_+_35485682 | 2.83 |
ENST00000599564.1
|
GRAMD1A
|
GRAM domain containing 1A |
chr22_-_36013368 | 2.81 |
ENST00000442617.1
ENST00000397326.2 ENST00000397328.1 ENST00000451685.1 |
MB
|
myoglobin |
chr15_+_50474385 | 2.79 |
ENST00000267842.5
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
chr15_+_89182178 | 2.77 |
ENST00000559876.1
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
chr17_-_19648683 | 2.76 |
ENST00000573368.1
ENST00000457500.2 |
ALDH3A1
|
aldehyde dehydrogenase 3 family, member A1 |
chr20_-_22565101 | 2.75 |
ENST00000419308.2
|
FOXA2
|
forkhead box A2 |
chr16_-_31076332 | 2.67 |
ENST00000539836.3
ENST00000535577.1 ENST00000442862.2 |
ZNF668
|
zinc finger protein 668 |
chr20_+_3776936 | 2.62 |
ENST00000439880.2
|
CDC25B
|
cell division cycle 25B |
chr7_-_73184588 | 2.61 |
ENST00000395145.2
|
CLDN3
|
claudin 3 |
chr9_-_131940526 | 2.57 |
ENST00000372491.2
|
IER5L
|
immediate early response 5-like |
chr19_+_35521616 | 2.53 |
ENST00000595652.1
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
chr4_+_102268904 | 2.52 |
ENST00000527564.1
ENST00000529296.1 |
AP001816.1
|
Uncharacterized protein |
chr22_-_21905120 | 2.52 |
ENST00000331505.5
|
RIMBP3C
|
RIMS binding protein 3C |
chr6_-_127780510 | 2.48 |
ENST00000487331.2
ENST00000483725.3 |
KIAA0408
|
KIAA0408 |
chr15_+_89181974 | 2.48 |
ENST00000306072.5
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
chr14_-_37051798 | 2.45 |
ENST00000258829.5
|
NKX2-8
|
NK2 homeobox 8 |
chr17_+_39405939 | 2.45 |
ENST00000334109.2
|
KRTAP9-4
|
keratin associated protein 9-4 |
chr2_-_133427767 | 2.45 |
ENST00000397463.2
|
LYPD1
|
LY6/PLAUR domain containing 1 |
chr11_-_63933504 | 2.38 |
ENST00000255681.6
|
MACROD1
|
MACRO domain containing 1 |
chr15_+_50474412 | 2.35 |
ENST00000380902.4
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
chr11_+_67777751 | 2.32 |
ENST00000316367.6
ENST00000007633.8 ENST00000342456.6 |
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
chr11_-_117698787 | 2.26 |
ENST00000260287.2
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
chr19_-_39402798 | 2.26 |
ENST00000571838.1
|
CTC-360G5.1
|
coiled-coil glutamate-rich protein 2 |
chr19_+_39989535 | 2.25 |
ENST00000356433.5
|
DLL3
|
delta-like 3 (Drosophila) |
chr11_-_117699413 | 2.23 |
ENST00000528014.1
|
FXYD2
|
FXYD domain containing ion transport regulator 2 |
chr14_-_23288930 | 2.23 |
ENST00000554517.1
ENST00000285850.7 ENST00000397529.2 ENST00000555702.1 |
SLC7A7
|
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
chr6_+_136172820 | 2.22 |
ENST00000308191.6
|
PDE7B
|
phosphodiesterase 7B |
chr11_-_17410869 | 2.17 |
ENST00000528731.1
|
KCNJ11
|
potassium inwardly-rectifying channel, subfamily J, member 11 |
chr1_-_153522562 | 2.15 |
ENST00000368714.1
|
S100A4
|
S100 calcium binding protein A4 |
chr2_+_37571717 | 2.15 |
ENST00000338415.3
ENST00000404976.1 |
QPCT
|
glutaminyl-peptide cyclotransferase |
chr2_+_37571845 | 2.14 |
ENST00000537448.1
|
QPCT
|
glutaminyl-peptide cyclotransferase |
chr16_-_2390704 | 2.13 |
ENST00000301732.5
ENST00000382381.3 |
ABCA3
|
ATP-binding cassette, sub-family A (ABC1), member 3 |
chr12_+_56075330 | 2.10 |
ENST00000394252.3
|
METTL7B
|
methyltransferase like 7B |
chr6_-_168720382 | 2.10 |
ENST00000610183.1
ENST00000607983.1 ENST00000366795.3 |
DACT2
|
dishevelled-binding antagonist of beta-catenin 2 |
chr5_+_139027877 | 2.09 |
ENST00000302517.3
|
CXXC5
|
CXXC finger protein 5 |
chrX_-_47004437 | 2.06 |
ENST00000276062.8
|
NDUFB11
|
NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 11, 17.3kDa |
chr16_+_30996502 | 2.06 |
ENST00000353250.5
ENST00000262520.6 ENST00000297679.5 ENST00000562932.1 ENST00000574447.1 |
HSD3B7
|
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 7 |
chr22_-_42342692 | 2.05 |
ENST00000404067.1
ENST00000402338.1 |
CENPM
|
centromere protein M |
chr6_+_31895480 | 2.01 |
ENST00000418949.2
ENST00000383177.3 ENST00000477310.1 |
C2
CFB
|
complement component 2 Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
chr6_+_31895467 | 2.00 |
ENST00000556679.1
ENST00000456570.1 |
CFB
CFB
|
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
chr20_-_33460621 | 1.99 |
ENST00000427420.1
ENST00000336431.5 |
GGT7
|
gamma-glutamyltransferase 7 |
chr16_+_83986827 | 1.98 |
ENST00000393306.1
ENST00000565123.1 |
OSGIN1
|
oxidative stress induced growth inhibitor 1 |
chr5_-_75919253 | 1.98 |
ENST00000296641.4
|
F2RL2
|
coagulation factor II (thrombin) receptor-like 2 |
chr22_-_29107919 | 1.97 |
ENST00000434810.1
ENST00000456369.1 |
CHEK2
|
checkpoint kinase 2 |
chr17_+_43299241 | 1.94 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
chr14_+_31343747 | 1.92 |
ENST00000216361.4
ENST00000396618.3 ENST00000475087.1 |
COCH
|
cochlin |
chr19_+_850985 | 1.92 |
ENST00000590230.1
|
ELANE
|
elastase, neutrophil expressed |
chr15_-_75660919 | 1.90 |
ENST00000569482.1
ENST00000565683.1 ENST00000561615.1 ENST00000563622.1 ENST00000568374.1 ENST00000566256.1 ENST00000267978.5 |
MAN2C1
|
mannosidase, alpha, class 2C, member 1 |
chr20_+_3776371 | 1.89 |
ENST00000245960.5
|
CDC25B
|
cell division cycle 25B |
chr19_+_49055332 | 1.88 |
ENST00000201586.2
|
SULT2B1
|
sulfotransferase family, cytosolic, 2B, member 1 |
chr19_+_39989580 | 1.87 |
ENST00000596614.1
ENST00000205143.4 |
DLL3
|
delta-like 3 (Drosophila) |
chrX_+_106163626 | 1.83 |
ENST00000336803.1
|
CLDN2
|
claudin 2 |
chr7_+_128784712 | 1.81 |
ENST00000289407.4
|
TSPAN33
|
tetraspanin 33 |
chr2_-_7005785 | 1.81 |
ENST00000256722.5
ENST00000404168.1 ENST00000458098.1 |
CMPK2
|
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
chr17_+_7123207 | 1.81 |
ENST00000584103.1
ENST00000579886.2 |
ACADVL
|
acyl-CoA dehydrogenase, very long chain |
chr17_-_19648416 | 1.81 |
ENST00000426645.2
|
ALDH3A1
|
aldehyde dehydrogenase 3 family, member A1 |
chr1_+_169075554 | 1.81 |
ENST00000367815.4
|
ATP1B1
|
ATPase, Na+/K+ transporting, beta 1 polypeptide |
chr20_+_48599506 | 1.80 |
ENST00000244050.2
|
SNAI1
|
snail family zinc finger 1 |
chr1_-_110306526 | 1.77 |
ENST00000361965.4
ENST00000361852.4 |
EPS8L3
|
EPS8-like 3 |
chr12_+_132628963 | 1.77 |
ENST00000330579.1
|
NOC4L
|
nucleolar complex associated 4 homolog (S. cerevisiae) |
chr14_-_69263043 | 1.77 |
ENST00000408913.2
|
ZFP36L1
|
ZFP36 ring finger protein-like 1 |
chr19_+_35521699 | 1.74 |
ENST00000415950.3
|
SCN1B
|
sodium channel, voltage-gated, type I, beta subunit |
chr12_-_52685312 | 1.73 |
ENST00000327741.5
|
KRT81
|
keratin 81 |
chr17_-_72968809 | 1.73 |
ENST00000530857.1
ENST00000425042.2 |
HID1
|
HID1 domain containing |
chr19_+_18111927 | 1.73 |
ENST00000379656.3
|
ARRDC2
|
arrestin domain containing 2 |
chr20_-_61885826 | 1.72 |
ENST00000370316.3
|
NKAIN4
|
Na+/K+ transporting ATPase interacting 4 |
chr3_+_49058444 | 1.70 |
ENST00000326925.6
ENST00000395458.2 |
NDUFAF3
|
NADH dehydrogenase (ubiquinone) complex I, assembly factor 3 |
chr3_+_49059038 | 1.69 |
ENST00000451378.2
|
NDUFAF3
|
NADH dehydrogenase (ubiquinone) complex I, assembly factor 3 |
chr2_-_42160486 | 1.68 |
ENST00000427054.1
|
AC104654.2
|
AC104654.2 |
chr9_-_139940608 | 1.65 |
ENST00000371601.4
|
NPDC1
|
neural proliferation, differentiation and control, 1 |
chr19_-_18391708 | 1.64 |
ENST00000600972.1
|
JUND
|
jun D proto-oncogene |
chr20_+_10199468 | 1.63 |
ENST00000254976.2
ENST00000304886.2 |
SNAP25
|
synaptosomal-associated protein, 25kDa |
chr16_+_771663 | 1.63 |
ENST00000568916.1
|
FAM173A
|
family with sequence similarity 173, member A |
chr22_-_30783075 | 1.63 |
ENST00000215798.6
|
RNF215
|
ring finger protein 215 |
chr2_-_220436248 | 1.63 |
ENST00000265318.4
|
OBSL1
|
obscurin-like 1 |
chr9_-_140444814 | 1.63 |
ENST00000277531.4
|
PNPLA7
|
patatin-like phospholipase domain containing 7 |
chr17_+_77030267 | 1.62 |
ENST00000581774.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
chr11_-_615570 | 1.62 |
ENST00000525445.1
ENST00000348655.6 ENST00000397566.1 |
IRF7
|
interferon regulatory factor 7 |
chr7_-_11871815 | 1.61 |
ENST00000423059.4
|
THSD7A
|
thrombospondin, type I, domain containing 7A |
chr12_+_121416489 | 1.60 |
ENST00000541395.1
ENST00000544413.1 |
HNF1A
|
HNF1 homeobox A |
chrX_-_153775426 | 1.60 |
ENST00000393562.2
|
G6PD
|
glucose-6-phosphate dehydrogenase |
chr14_-_27066636 | 1.58 |
ENST00000267422.7
ENST00000344429.5 ENST00000574031.1 ENST00000465357.2 ENST00000547619.1 |
NOVA1
|
neuro-oncological ventral antigen 1 |
chr17_-_16256718 | 1.57 |
ENST00000476243.1
ENST00000299736.4 |
CENPV
|
centromere protein V |
chr16_-_74808710 | 1.57 |
ENST00000219368.3
ENST00000544337.1 |
FA2H
|
fatty acid 2-hydroxylase |
chr11_+_66742742 | 1.57 |
ENST00000308963.4
|
C11orf86
|
chromosome 11 open reading frame 86 |
chr16_-_88772761 | 1.57 |
ENST00000567844.1
ENST00000312838.4 |
RNF166
|
ring finger protein 166 |
chr1_+_162760513 | 1.55 |
ENST00000367915.1
ENST00000367917.3 ENST00000254521.3 ENST00000367913.1 |
HSD17B7
|
hydroxysteroid (17-beta) dehydrogenase 7 |
chr12_+_122150646 | 1.54 |
ENST00000449592.2
|
TMEM120B
|
transmembrane protein 120B |
chr22_+_24999114 | 1.54 |
ENST00000412658.1
ENST00000445029.1 ENST00000419133.1 ENST00000400382.1 ENST00000438643.2 ENST00000452551.1 ENST00000400383.1 ENST00000412898.1 ENST00000400380.1 ENST00000455483.1 ENST00000430289.1 |
GGT1
|
gamma-glutamyltransferase 1 |
chr12_+_121416340 | 1.54 |
ENST00000257555.6
ENST00000400024.2 |
HNF1A
|
HNF1 homeobox A |
chr9_-_35689900 | 1.53 |
ENST00000378300.5
ENST00000329305.2 ENST00000360958.2 |
TPM2
|
tropomyosin 2 (beta) |
chr1_-_110306562 | 1.52 |
ENST00000369805.3
|
EPS8L3
|
EPS8-like 3 |
chr16_-_1821496 | 1.52 |
ENST00000564628.1
ENST00000563498.1 |
NME3
|
NME/NM23 nucleoside diphosphate kinase 3 |
chr16_-_31076273 | 1.51 |
ENST00000426488.2
|
ZNF668
|
zinc finger protein 668 |
chr11_-_66115032 | 1.50 |
ENST00000311181.4
|
B3GNT1
|
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 1 |
chr10_-_103347883 | 1.50 |
ENST00000339310.3
ENST00000370158.3 ENST00000299206.4 ENST00000456836.2 ENST00000413344.1 ENST00000429502.1 ENST00000430045.1 ENST00000370172.1 ENST00000436284.2 ENST00000370162.3 |
POLL
|
polymerase (DNA directed), lambda |
chr17_-_3500392 | 1.50 |
ENST00000571088.1
ENST00000174621.6 |
TRPV1
|
transient receptor potential cation channel, subfamily V, member 1 |
chr7_-_95225768 | 1.50 |
ENST00000005178.5
|
PDK4
|
pyruvate dehydrogenase kinase, isozyme 4 |
chr2_+_85981008 | 1.50 |
ENST00000306279.3
|
ATOH8
|
atonal homolog 8 (Drosophila) |
chr12_-_53298841 | 1.49 |
ENST00000293308.6
|
KRT8
|
keratin 8 |
chr5_-_172662303 | 1.49 |
ENST00000517440.1
ENST00000329198.4 |
NKX2-5
|
NK2 homeobox 5 |
chr2_-_239148599 | 1.49 |
ENST00000409182.1
ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6
|
hes family bHLH transcription factor 6 |
chr20_-_60942361 | 1.48 |
ENST00000252999.3
|
LAMA5
|
laminin, alpha 5 |
chr5_+_176873789 | 1.47 |
ENST00000323249.3
ENST00000502922.1 |
PRR7
|
proline rich 7 (synaptic) |
chr11_-_31531121 | 1.46 |
ENST00000532287.1
ENST00000526776.1 ENST00000534812.1 ENST00000529749.1 ENST00000278200.1 ENST00000530023.1 ENST00000533642.1 |
IMMP1L
|
IMP1 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
chr19_-_7939319 | 1.44 |
ENST00000539422.1
|
CTD-3193O13.9
|
Protein FLJ22184 |
chr14_+_77228532 | 1.42 |
ENST00000167106.4
ENST00000554237.1 |
VASH1
|
vasohibin 1 |
chr9_-_35619539 | 1.42 |
ENST00000396757.1
|
CD72
|
CD72 molecule |
chr20_+_3777078 | 1.41 |
ENST00000340833.4
|
CDC25B
|
cell division cycle 25B |
chr16_-_776431 | 1.41 |
ENST00000293889.6
|
CCDC78
|
coiled-coil domain containing 78 |
chr4_-_140223670 | 1.40 |
ENST00000394228.1
ENST00000539387.1 |
NDUFC1
|
NADH dehydrogenase (ubiquinone) 1, subcomplex unknown, 1, 6kDa |
chr2_+_43864387 | 1.39 |
ENST00000282406.4
|
PLEKHH2
|
pleckstrin homology domain containing, family H (with MyTH4 domain) member 2 |
chr14_-_23822080 | 1.38 |
ENST00000397267.1
ENST00000354772.3 |
SLC22A17
|
solute carrier family 22, member 17 |
chr16_+_67193834 | 1.38 |
ENST00000258200.3
ENST00000518148.1 ENST00000519917.1 ENST00000517382.1 ENST00000521920.1 |
FBXL8
|
F-box and leucine-rich repeat protein 8 |
chr5_-_58571935 | 1.38 |
ENST00000503258.1
|
PDE4D
|
phosphodiesterase 4D, cAMP-specific |
chr7_+_148982396 | 1.38 |
ENST00000418158.2
|
ZNF783
|
zinc finger family member 783 |
chr10_+_47083454 | 1.37 |
ENST00000374312.1
|
NPY4R
|
neuropeptide Y receptor Y4 |
chr17_-_47045949 | 1.37 |
ENST00000357424.2
|
GIP
|
gastric inhibitory polypeptide |
chr22_+_24577183 | 1.37 |
ENST00000358321.3
|
SUSD2
|
sushi domain containing 2 |
chr20_+_2673383 | 1.37 |
ENST00000380648.4
ENST00000342725.5 |
EBF4
|
early B-cell factor 4 |
chr2_+_242673994 | 1.35 |
ENST00000321264.4
ENST00000537090.1 ENST00000403782.1 ENST00000342518.6 |
D2HGDH
|
D-2-hydroxyglutarate dehydrogenase |
chr20_-_4982132 | 1.35 |
ENST00000338244.1
ENST00000424750.2 |
SLC23A2
|
solute carrier family 23 (ascorbic acid transporter), member 2 |
chr17_-_15168624 | 1.35 |
ENST00000312280.3
ENST00000494511.1 ENST00000580584.1 |
PMP22
|
peripheral myelin protein 22 |
chr19_+_15751689 | 1.35 |
ENST00000586182.2
ENST00000591058.1 ENST00000221307.8 |
CYP4F3
|
cytochrome P450, family 4, subfamily F, polypeptide 3 |
chr19_+_2977444 | 1.34 |
ENST00000246112.4
ENST00000453329.1 ENST00000482627.1 ENST00000452088.1 |
TLE6
|
transducin-like enhancer of split 6 (E(sp1) homolog, Drosophila) |
chr14_-_54423529 | 1.34 |
ENST00000245451.4
ENST00000559087.1 |
BMP4
|
bone morphogenetic protein 4 |
chr5_-_179285785 | 1.34 |
ENST00000520698.1
ENST00000518235.1 ENST00000376931.2 ENST00000518219.1 ENST00000521333.1 ENST00000523084.1 |
C5orf45
|
chromosome 5 open reading frame 45 |
chr19_+_2249308 | 1.33 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
chr16_+_67204400 | 1.33 |
ENST00000563439.1
ENST00000432069.2 ENST00000564992.1 ENST00000564053.1 |
NOL3
|
nucleolar protein 3 (apoptosis repressor with CARD domain) |
chr8_+_17434689 | 1.33 |
ENST00000398074.3
|
PDGFRL
|
platelet-derived growth factor receptor-like |
chr12_+_122064673 | 1.33 |
ENST00000537188.1
|
ORAI1
|
ORAI calcium release-activated calcium modulator 1 |
chr16_-_1821721 | 1.33 |
ENST00000219302.3
|
NME3
|
NME/NM23 nucleoside diphosphate kinase 3 |
chr12_-_7245125 | 1.33 |
ENST00000542285.1
ENST00000540610.1 |
C1R
|
complement component 1, r subcomponent |
chr1_+_8378140 | 1.32 |
ENST00000377479.2
|
SLC45A1
|
solute carrier family 45, member 1 |
chr19_-_55628927 | 1.32 |
ENST00000263433.3
ENST00000376393.2 |
PPP1R12C
|
protein phosphatase 1, regulatory subunit 12C |
chr17_-_79519403 | 1.29 |
ENST00000327787.8
ENST00000537152.1 |
C17orf70
|
chromosome 17 open reading frame 70 |
chr12_+_54393880 | 1.29 |
ENST00000303450.4
|
HOXC9
|
homeobox C9 |
chr15_+_75660431 | 1.29 |
ENST00000563278.1
|
RP11-817O13.8
|
RP11-817O13.8 |
chr10_+_92980517 | 1.29 |
ENST00000336126.5
|
PCGF5
|
polycomb group ring finger 5 |
chr9_-_35815013 | 1.29 |
ENST00000259667.5
|
HINT2
|
histidine triad nucleotide binding protein 2 |
chr3_-_155524049 | 1.28 |
ENST00000534941.1
ENST00000340171.2 |
C3orf33
|
chromosome 3 open reading frame 33 |
chr17_+_73512594 | 1.28 |
ENST00000333213.6
|
TSEN54
|
TSEN54 tRNA splicing endonuclease subunit |
chr19_+_4304585 | 1.28 |
ENST00000221856.6
|
FSD1
|
fibronectin type III and SPRY domain containing 1 |
chr20_-_22566089 | 1.28 |
ENST00000377115.4
|
FOXA2
|
forkhead box A2 |
chr19_-_46272106 | 1.28 |
ENST00000560168.1
|
SIX5
|
SIX homeobox 5 |
chr17_-_3867585 | 1.28 |
ENST00000359983.3
ENST00000352011.3 ENST00000397043.3 ENST00000397041.3 ENST00000397035.3 ENST00000397039.1 ENST00000309890.7 |
ATP2A3
|
ATPase, Ca++ transporting, ubiquitous |
chr16_+_2083265 | 1.28 |
ENST00000565855.1
ENST00000566198.1 |
SLC9A3R2
|
solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3 regulator 2 |
chr1_-_156217822 | 1.27 |
ENST00000368270.1
|
PAQR6
|
progestin and adipoQ receptor family member VI |
chr19_+_35491174 | 1.27 |
ENST00000317991.5
ENST00000504615.2 |
GRAMD1A
|
GRAM domain containing 1A |
chr4_-_2420357 | 1.26 |
ENST00000511071.1
ENST00000509171.1 ENST00000290974.2 |
ZFYVE28
|
zinc finger, FYVE domain containing 28 |
chr2_-_220435963 | 1.26 |
ENST00000373876.1
ENST00000404537.1 ENST00000603926.1 ENST00000373873.4 ENST00000289656.3 |
OBSL1
|
obscurin-like 1 |
chr8_-_144654918 | 1.26 |
ENST00000529971.1
|
MROH6
|
maestro heat-like repeat family member 6 |
chr17_+_80693427 | 1.26 |
ENST00000300784.7
|
FN3K
|
fructosamine 3 kinase |
chr2_+_228029281 | 1.26 |
ENST00000396578.3
|
COL4A3
|
collagen, type IV, alpha 3 (Goodpasture antigen) |
chr15_+_69591235 | 1.25 |
ENST00000395407.2
ENST00000558684.1 |
PAQR5
|
progestin and adipoQ receptor family member V |
chr10_-_22292675 | 1.25 |
ENST00000376946.1
|
DNAJC1
|
DnaJ (Hsp40) homolog, subfamily C, member 1 |
chr17_-_55162360 | 1.24 |
ENST00000576871.1
ENST00000576313.1 |
RP11-166P13.3
|
RP11-166P13.3 |
chr7_+_150065879 | 1.23 |
ENST00000397281.2
ENST00000444957.1 ENST00000466559.1 ENST00000489432.2 ENST00000475514.1 ENST00000482680.1 ENST00000488943.1 ENST00000518514.1 ENST00000478789.1 |
REPIN1
ZNF775
|
replication initiator 1 zinc finger protein 775 |
chr11_-_67120974 | 1.23 |
ENST00000539074.1
ENST00000312419.3 |
POLD4
|
polymerase (DNA-directed), delta 4, accessory subunit |
chr3_-_13461807 | 1.23 |
ENST00000254508.5
|
NUP210
|
nucleoporin 210kDa |
chr19_-_3547305 | 1.23 |
ENST00000589063.1
|
MFSD12
|
major facilitator superfamily domain containing 12 |
chr4_+_15779901 | 1.23 |
ENST00000226279.3
|
CD38
|
CD38 molecule |
chr2_+_105471969 | 1.22 |
ENST00000361360.2
|
POU3F3
|
POU class 3 homeobox 3 |
chr8_-_27457494 | 1.22 |
ENST00000521770.1
|
CLU
|
clusterin |
chr19_-_55628700 | 1.22 |
ENST00000592993.1
|
PPP1R12C
|
protein phosphatase 1, regulatory subunit 12C |
chr11_-_65374430 | 1.22 |
ENST00000532507.1
|
MAP3K11
|
mitogen-activated protein kinase kinase kinase 11 |
chr11_+_842928 | 1.22 |
ENST00000397408.1
|
TSPAN4
|
tetraspanin 4 |
chr21_+_38071430 | 1.22 |
ENST00000290399.6
|
SIM2
|
single-minded family bHLH transcription factor 2 |
chr11_+_842808 | 1.21 |
ENST00000397397.2
ENST00000397411.2 ENST00000397396.1 |
TSPAN4
|
tetraspanin 4 |
chr17_-_26695013 | 1.21 |
ENST00000555059.2
|
CTB-96E2.2
|
Homeobox protein SEBOX |
chr19_-_6591113 | 1.21 |
ENST00000423145.3
ENST00000245903.3 |
CD70
|
CD70 molecule |
chr19_-_46285736 | 1.21 |
ENST00000291270.4
ENST00000447742.2 ENST00000354227.5 |
DMPK
|
dystrophia myotonica-protein kinase |
chr7_+_150748288 | 1.21 |
ENST00000490540.1
|
ASIC3
|
acid-sensing (proton-gated) ion channel 3 |
chr17_+_43299156 | 1.20 |
ENST00000331495.3
|
FMNL1
|
formin-like 1 |
chr16_-_8962853 | 1.20 |
ENST00000565287.1
ENST00000311052.5 |
CARHSP1
|
calcium regulated heat stable protein 1, 24kDa |
chr12_+_56661033 | 1.19 |
ENST00000433805.2
|
COQ10A
|
coenzyme Q10 homolog A (S. cerevisiae) |
chr17_-_15469590 | 1.19 |
ENST00000312127.2
|
CDRT1
|
CMT duplicated region transcript 1; Uncharacterized protein |
chr12_+_122064398 | 1.19 |
ENST00000330079.7
|
ORAI1
|
ORAI calcium release-activated calcium modulator 1 |
chr10_-_135150367 | 1.19 |
ENST00000368555.3
ENST00000252939.4 ENST00000368558.1 ENST00000368556.2 |
CALY
|
calcyon neuron-specific vesicular protein |
chr1_-_11751665 | 1.19 |
ENST00000376667.3
ENST00000235310.3 |
MAD2L2
|
MAD2 mitotic arrest deficient-like 2 (yeast) |
chrX_+_70521584 | 1.19 |
ENST00000373829.3
ENST00000538820.1 |
ITGB1BP2
|
integrin beta 1 binding protein (melusin) 2 |
chr7_-_99869799 | 1.18 |
ENST00000436886.2
|
GATS
|
GATS, stromal antigen 3 opposite strand |
chr19_-_46285646 | 1.18 |
ENST00000458663.2
|
DMPK
|
dystrophia myotonica-protein kinase |
chr1_-_21978312 | 1.18 |
ENST00000359708.4
ENST00000290101.4 |
RAP1GAP
|
RAP1 GTPase activating protein |
chr5_+_176873446 | 1.17 |
ENST00000507881.1
|
PRR7
|
proline rich 7 (synaptic) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.1 | 8.6 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
1.7 | 8.4 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
1.6 | 4.9 | GO:0006059 | hexitol metabolic process(GO:0006059) |
1.5 | 4.5 | GO:2000502 | negative regulation of natural killer cell chemotaxis(GO:2000502) |
1.4 | 4.3 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
1.2 | 3.6 | GO:0035623 | renal glucose absorption(GO:0035623) |
1.1 | 5.5 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
1.1 | 3.2 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
1.0 | 4.0 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.9 | 0.9 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
0.9 | 0.9 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
0.8 | 2.3 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
0.7 | 3.0 | GO:0090301 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.7 | 3.7 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
0.7 | 3.6 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
0.7 | 14.3 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.7 | 3.4 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.7 | 2.0 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
0.6 | 5.7 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
0.6 | 2.4 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.6 | 4.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.6 | 2.3 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
0.6 | 2.3 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
0.5 | 1.6 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.5 | 2.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.5 | 1.5 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
0.5 | 1.5 | GO:0060929 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
0.5 | 1.5 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.5 | 1.9 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.5 | 3.2 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
0.5 | 1.8 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.5 | 1.4 | GO:0019516 | lactate oxidation(GO:0019516) |
0.5 | 1.4 | GO:0070904 | L-ascorbic acid transport(GO:0015882) molecular hydrogen transport(GO:0015993) transepithelial L-ascorbic acid transport(GO:0070904) |
0.4 | 1.3 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
0.4 | 6.2 | GO:0007144 | female meiosis I(GO:0007144) |
0.4 | 2.6 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.4 | 2.6 | GO:0072240 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
0.4 | 1.7 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
0.4 | 1.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.4 | 0.8 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.4 | 2.4 | GO:0048389 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
0.4 | 1.6 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.4 | 2.8 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
0.4 | 1.6 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.4 | 1.2 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
0.4 | 1.9 | GO:0032218 | riboflavin transport(GO:0032218) |
0.4 | 1.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.4 | 1.4 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.4 | 1.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.3 | 5.8 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.3 | 1.0 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
0.3 | 0.7 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.3 | 2.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.3 | 1.0 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
0.3 | 1.0 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.3 | 0.3 | GO:0032873 | regulation of stress-activated MAPK cascade(GO:0032872) negative regulation of stress-activated MAPK cascade(GO:0032873) regulation of stress-activated protein kinase signaling cascade(GO:0070302) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.3 | 3.2 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
0.3 | 1.0 | GO:0097187 | dentinogenesis(GO:0097187) |
0.3 | 4.1 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.3 | 2.8 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) |
0.3 | 1.6 | GO:0031296 | B cell costimulation(GO:0031296) |
0.3 | 1.2 | GO:0060032 | notochord regression(GO:0060032) |
0.3 | 2.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.3 | 0.9 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
0.3 | 1.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.3 | 0.9 | GO:0060623 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) regulation of chromosome condensation(GO:0060623) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
0.3 | 3.8 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.3 | 0.9 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.3 | 2.0 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
0.3 | 1.1 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.3 | 0.9 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
0.3 | 1.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.3 | 1.4 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.3 | 1.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.3 | 0.8 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.3 | 0.8 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
0.3 | 1.3 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.3 | 1.3 | GO:1904141 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
0.3 | 1.0 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
0.3 | 1.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.3 | 1.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.3 | 1.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.2 | 0.5 | GO:0032456 | endocytic recycling(GO:0032456) |
0.2 | 0.7 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.2 | 1.2 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.2 | 0.7 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
0.2 | 1.0 | GO:0046882 | negative regulation of B cell differentiation(GO:0045578) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.2 | 0.7 | GO:2000627 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
0.2 | 2.8 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.2 | 0.7 | GO:1900369 | transcription, RNA-templated(GO:0001172) negative regulation of RNA interference(GO:1900369) |
0.2 | 0.9 | GO:0001808 | negative regulation of type IV hypersensitivity(GO:0001808) |
0.2 | 2.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.2 | 0.9 | GO:0036378 | calcitriol biosynthetic process from calciol(GO:0036378) |
0.2 | 0.7 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
0.2 | 1.1 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
0.2 | 0.7 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
0.2 | 0.9 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.2 | 0.2 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
0.2 | 2.8 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 0.6 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.2 | 0.6 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 1.1 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
0.2 | 0.2 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.2 | 0.9 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.2 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.2 | 0.6 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
0.2 | 0.4 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.2 | 1.5 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.2 | 1.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 1.4 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
0.2 | 0.4 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 0.6 | GO:0060829 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
0.2 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.2 | 3.5 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.2 | 1.8 | GO:0070560 | protein secretion by platelet(GO:0070560) |
0.2 | 0.2 | GO:0051402 | neuron apoptotic process(GO:0051402) |
0.2 | 1.6 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.2 | 1.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.2 | 1.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.2 | 5.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.6 | GO:0009078 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
0.2 | 1.2 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
0.2 | 1.0 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
0.2 | 1.5 | GO:0031069 | hair follicle morphogenesis(GO:0031069) epidermis morphogenesis(GO:0048730) |
0.2 | 0.2 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
0.2 | 1.3 | GO:1901569 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
0.2 | 1.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.2 | 0.8 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
0.2 | 0.6 | GO:1900075 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
0.2 | 1.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.2 | 0.9 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.4 | GO:0086014 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
0.2 | 2.6 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.2 | 0.7 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.2 | 0.9 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
0.2 | 1.6 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.2 | 2.9 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.2 | 0.2 | GO:0046939 | nucleoside diphosphate phosphorylation(GO:0006165) nucleotide phosphorylation(GO:0046939) |
0.2 | 0.5 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.2 | 1.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.2 | 1.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 3.7 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.2 | 0.3 | GO:0035106 | operant conditioning(GO:0035106) |
0.2 | 2.6 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.2 | 0.9 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.2 | 0.5 | GO:1990637 | response to prolactin(GO:1990637) |
0.2 | 0.5 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
0.2 | 2.5 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.2 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.2 | 1.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.3 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
0.2 | 1.0 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.2 | 0.3 | GO:0008347 | glial cell migration(GO:0008347) |
0.2 | 1.0 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
0.2 | 0.5 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.2 | 1.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.2 | 0.8 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
0.2 | 2.5 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 1.9 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.2 | 0.3 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.2 | 0.9 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
0.2 | 1.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.2 | 0.3 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
0.2 | 0.6 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
0.2 | 0.8 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.2 | 0.6 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
0.2 | 0.9 | GO:1903490 | regulation of cytokinetic process(GO:0032954) positive regulation of centriole replication(GO:0046601) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.2 | 0.3 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
0.1 | 0.6 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
0.1 | 1.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.6 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.6 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 2.7 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.4 | GO:1905069 | allantois development(GO:1905069) |
0.1 | 2.6 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.1 | 0.7 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
0.1 | 0.7 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
0.1 | 0.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.7 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.1 | 0.4 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
0.1 | 0.7 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
0.1 | 0.4 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
0.1 | 1.2 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
0.1 | 0.3 | GO:1903831 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 1.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.1 | 0.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.1 | 1.9 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
0.1 | 0.9 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.1 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.1 | 1.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.1 | 0.6 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
0.1 | 1.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.1 | 0.8 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.4 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.1 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.1 | 1.0 | GO:0015798 | myo-inositol transport(GO:0015798) |
0.1 | 0.4 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
0.1 | 1.4 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.1 | 0.5 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
0.1 | 0.5 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.1 | 0.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.1 | 0.8 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.3 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
0.1 | 0.1 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.1 | 0.3 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
0.1 | 0.7 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.5 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.8 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.1 | 0.5 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.7 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 1.3 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.1 | 3.2 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 1.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.1 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.1 | 2.4 | GO:0045008 | depyrimidination(GO:0045008) |
0.1 | 0.5 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.1 | 0.9 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 1.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.1 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.2 | GO:0042098 | T cell proliferation(GO:0042098) |
0.1 | 1.0 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.1 | 1.6 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.6 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
0.1 | 1.5 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.1 | 0.5 | GO:0032571 | response to vitamin K(GO:0032571) |
0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.7 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.1 | 1.9 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.1 | 0.4 | GO:0046823 | negative regulation of nucleocytoplasmic transport(GO:0046823) |
0.1 | 0.5 | GO:0042421 | noradrenergic neuron differentiation(GO:0003357) norepinephrine biosynthetic process(GO:0042421) |
0.1 | 2.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.2 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
0.1 | 0.6 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.1 | 0.1 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.1 | 0.5 | GO:0003335 | corneocyte development(GO:0003335) |
0.1 | 0.9 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
0.1 | 0.3 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.3 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) chemorepulsion of branchiomotor axon(GO:0021793) |
0.1 | 1.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.6 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.3 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 1.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 1.0 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.3 | GO:0097212 | cadmium ion homeostasis(GO:0055073) lysosomal membrane organization(GO:0097212) regulation of hydrogen peroxide catabolic process(GO:2000295) negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
0.1 | 1.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.1 | 0.4 | GO:0071503 | response to heparin(GO:0071503) |
0.1 | 0.4 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.1 | 0.4 | GO:0009386 | translational attenuation(GO:0009386) |
0.1 | 0.2 | GO:0001893 | maternal placenta development(GO:0001893) |
0.1 | 4.9 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.1 | 0.3 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.3 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.1 | 1.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.8 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.1 | 0.5 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
0.1 | 0.5 | GO:1990523 | bone regeneration(GO:1990523) |
0.1 | 4.0 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
0.1 | 0.8 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.1 | 9.9 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.7 | GO:0001709 | cell fate determination(GO:0001709) |
0.1 | 0.6 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
0.1 | 2.0 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.8 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
0.1 | 0.5 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 2.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.1 | 0.3 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
0.1 | 0.6 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
0.1 | 0.3 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
0.1 | 0.5 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.4 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.4 | GO:0070627 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
0.1 | 0.5 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.1 | 0.6 | GO:0090002 | establishment of protein localization to plasma membrane(GO:0090002) |
0.1 | 0.6 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.7 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.1 | 2.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.5 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 2.3 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.1 | 1.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 1.0 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.3 | GO:0021586 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.1 | 0.2 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.1 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 1.3 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
0.1 | 0.3 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
0.1 | 0.3 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
0.1 | 0.8 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.5 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 2.2 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.6 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.1 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.1 | 0.5 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.1 | 0.5 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.1 | 0.2 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.1 | 0.1 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
0.1 | 0.7 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.1 | 0.4 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.4 | GO:2000768 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
0.1 | 0.2 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
0.1 | 0.2 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
0.1 | 0.6 | GO:0042756 | drinking behavior(GO:0042756) |
0.1 | 0.1 | GO:0072577 | endothelial cell apoptotic process(GO:0072577) positive regulation of epithelial cell apoptotic process(GO:1904037) positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.1 | 0.6 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 1.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.2 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
0.1 | 0.3 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
0.1 | 1.9 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
0.1 | 0.4 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
0.1 | 0.4 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.1 | 1.7 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.3 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
0.1 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.3 | GO:0072301 | visceral serous pericardium development(GO:0061032) negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of metanephric glomerulus development(GO:0072299) regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) negative regulation of glomerulus development(GO:0090194) |
0.1 | 1.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 1.5 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.5 | GO:0060356 | leucine import(GO:0060356) |
0.1 | 1.4 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.2 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
0.1 | 1.3 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.1 | 0.7 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.4 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
0.1 | 1.8 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.1 | 0.4 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 1.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.4 | GO:0015853 | adenine transport(GO:0015853) |
0.1 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
0.1 | 1.7 | GO:0097696 | JAK-STAT cascade(GO:0007259) STAT cascade(GO:0097696) |
0.1 | 0.6 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.1 | 0.7 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 1.6 | GO:0007625 | grooming behavior(GO:0007625) |
0.1 | 0.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.3 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 1.3 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.1 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.3 | GO:0005985 | sucrose metabolic process(GO:0005985) sucrose biosynthetic process(GO:0005986) |
0.1 | 1.4 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.1 | 0.9 | GO:0000050 | urea cycle(GO:0000050) |
0.1 | 3.9 | GO:0006298 | mismatch repair(GO:0006298) |
0.1 | 0.2 | GO:1901876 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.1 | 0.9 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.2 | GO:0019303 | D-ribose metabolic process(GO:0006014) D-ribose catabolic process(GO:0019303) |
0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 1.5 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.3 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
0.1 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.7 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.3 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.6 | GO:0071156 | regulation of cell cycle arrest(GO:0071156) |
0.1 | 0.6 | GO:0051552 | flavone metabolic process(GO:0051552) |
0.1 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.1 | 0.4 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.2 | GO:0045409 | gastric motility(GO:0035482) gastric emptying(GO:0035483) positive regulation of growth rate(GO:0040010) negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) negative regulation of interleukin-6 biosynthetic process(GO:0045409) regulation of gastric mucosal blood circulation(GO:1904344) positive regulation of gastric mucosal blood circulation(GO:1904346) regulation of small intestine smooth muscle contraction(GO:1904347) positive regulation of small intestine smooth muscle contraction(GO:1904349) gastric mucosal blood circulation(GO:1990768) small intestine smooth muscle contraction(GO:1990770) |
0.1 | 5.0 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.1 | 1.0 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.6 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
0.1 | 1.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.7 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.1 | 0.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.7 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.2 | GO:0014904 | myotube cell development(GO:0014904) skeletal muscle fiber development(GO:0048741) |
0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.7 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.6 | GO:0070543 | response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
0.1 | 0.2 | GO:1902161 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
0.1 | 0.4 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
0.1 | 0.4 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.1 | 0.1 | GO:0035331 | regulation of hippo signaling(GO:0035330) negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.2 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.1 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
0.1 | 2.5 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.1 | 0.2 | GO:0035038 | female pronucleus assembly(GO:0035038) |
0.1 | 0.2 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.1 | 1.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.9 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 1.9 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
0.1 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.1 | 0.2 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
0.1 | 0.3 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.1 | 1.0 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.3 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.1 | 0.5 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.1 | 0.5 | GO:0061525 | hindgut development(GO:0061525) |
0.1 | 0.3 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.3 | GO:0070309 | positive regulation by virus of viral protein levels in host cell(GO:0046726) lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.1 | 1.5 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.2 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.2 | GO:0032824 | negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) positive regulation of cytolysis in other organism(GO:0051714) |
0.1 | 0.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 1.0 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.1 | 0.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.3 | GO:0051958 | methotrexate transport(GO:0051958) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 2.0 | GO:0002076 | osteoblast development(GO:0002076) |
0.1 | 0.5 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
0.1 | 1.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.1 | 0.5 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.2 | GO:0021587 | cerebellum morphogenesis(GO:0021587) |
0.1 | 0.2 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
0.1 | 0.1 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.1 | 0.3 | GO:0036371 | protein localization to T-tubule(GO:0036371) |
0.1 | 1.3 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.1 | 0.3 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.2 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
0.1 | 0.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.1 | 0.3 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.7 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.6 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0070839 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) spleen trabecula formation(GO:0060345) divalent metal ion export(GO:0070839) iron cation export(GO:1903414) ferrous iron export(GO:1903988) |
0.0 | 0.2 | GO:0003015 | heart process(GO:0003015) heart contraction(GO:0060047) |
0.0 | 0.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.5 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.4 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 1.7 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.4 | GO:2000637 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 1.7 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.4 | GO:0015698 | inorganic anion transport(GO:0015698) |
0.0 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.0 | 1.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 2.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.9 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 1.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.5 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.2 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.0 | 0.4 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
0.0 | 5.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.0 | GO:0051458 | corticotropin secretion(GO:0051458) |
0.0 | 0.1 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
0.0 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.3 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.5 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 1.4 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.0 | 0.4 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.0 | 0.4 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.8 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 3.3 | GO:0006081 | cellular aldehyde metabolic process(GO:0006081) |
0.0 | 2.8 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
0.0 | 0.3 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.5 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.9 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.2 | GO:1901805 | termination of signal transduction(GO:0023021) beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
0.0 | 0.6 | GO:0060242 | contact inhibition(GO:0060242) |
0.0 | 0.6 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.0 | 0.4 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.0 | 0.1 | GO:0010226 | response to lithium ion(GO:0010226) |
0.0 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) |
0.0 | 1.1 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 1.7 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.6 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.0 | 0.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.9 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.0 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 1.0 | GO:0045124 | regulation of bone resorption(GO:0045124) |
0.0 | 1.8 | GO:0031112 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
0.0 | 0.8 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.3 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.0 | 2.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 1.2 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 1.2 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.3 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.5 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
0.0 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
0.0 | 0.3 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
0.0 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0008630 | intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
0.0 | 1.0 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.7 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.3 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.1 | GO:0002864 | hypersensitivity(GO:0002524) regulation of acute inflammatory response to antigenic stimulus(GO:0002864) regulation of hypersensitivity(GO:0002883) |
0.0 | 0.3 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 1.2 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.2 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.2 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.0 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
0.0 | 0.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0014060 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
0.0 | 0.8 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.2 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.2 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.0 | 0.4 | GO:0051782 | negative regulation of cell division(GO:0051782) |
0.0 | 1.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.3 | GO:0097502 | mannosylation(GO:0097502) |
0.0 | 0.0 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.8 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
0.0 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.0 | 0.9 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.2 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.2 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.0 | 0.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.4 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.3 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
0.0 | 0.2 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.5 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.3 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.5 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.2 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.0 | 0.1 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
0.0 | 0.1 | GO:0036292 | DNA rewinding(GO:0036292) |
0.0 | 0.1 | GO:0070301 | cellular response to hydrogen peroxide(GO:0070301) |
0.0 | 0.4 | GO:0090263 | positive regulation of canonical Wnt signaling pathway(GO:0090263) |
0.0 | 0.4 | GO:0015949 | nucleobase-containing small molecule interconversion(GO:0015949) |
0.0 | 0.2 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:0002890 | negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
0.0 | 1.0 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.4 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.3 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.2 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.3 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.6 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.6 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.2 | GO:0098773 | skin epidermis development(GO:0098773) |
0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.4 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.3 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.0 | 0.6 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.0 | 0.2 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
0.0 | 0.2 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.4 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
0.0 | 0.5 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.2 | GO:0045806 | negative regulation of endocytosis(GO:0045806) |
0.0 | 3.2 | GO:0043462 | regulation of ATPase activity(GO:0043462) |
0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.2 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
0.0 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.2 | GO:0072672 | neutrophil extravasation(GO:0072672) regulation of neutrophil extravasation(GO:2000389) |
0.0 | 0.1 | GO:0045556 | TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
0.0 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.3 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.7 | GO:0000732 | strand displacement(GO:0000732) |
0.0 | 1.3 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.0 | 0.6 | GO:0007219 | Notch signaling pathway(GO:0007219) |
0.0 | 0.1 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
0.0 | 0.1 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.0 | 0.0 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.0 | GO:2000974 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.0 | 0.2 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.4 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.6 | GO:0042303 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
0.0 | 0.6 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 1.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.3 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.3 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
0.0 | 0.9 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) |
0.0 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.2 | GO:1903147 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
0.0 | 0.2 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.1 | GO:0030888 | regulation of B cell proliferation(GO:0030888) |
0.0 | 0.1 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.2 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.0 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) skeletal muscle satellite cell activation(GO:0014719) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.5 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.2 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
0.0 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.0 | 0.4 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.1 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
0.0 | 0.1 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.0 | 0.3 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.0 | 0.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.4 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.1 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.3 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.1 | GO:1905247 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
0.0 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.2 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.1 | GO:1903275 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:0003360 | brainstem development(GO:0003360) |
0.0 | 0.4 | GO:0042438 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
0.0 | 0.3 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.1 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
0.0 | 0.1 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
0.0 | 1.1 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.5 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.8 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.0 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
0.0 | 0.3 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.0 | 0.6 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.3 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.4 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
0.0 | 0.1 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 1.1 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.2 | GO:1901216 | positive regulation of neuron death(GO:1901216) |
0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.6 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
0.0 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
0.0 | 0.3 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0052565 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
0.0 | 0.1 | GO:0015669 | gas transport(GO:0015669) |
0.0 | 0.4 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.1 | GO:0098758 | interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
0.0 | 0.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.2 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.1 | GO:0038061 | NIK/NF-kappaB signaling(GO:0038061) regulation of NIK/NF-kappaB signaling(GO:1901222) |
0.0 | 0.0 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.0 | 0.3 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.0 | 0.1 | GO:0060291 | long-term synaptic potentiation(GO:0060291) |
0.0 | 0.8 | GO:0021510 | spinal cord development(GO:0021510) |
0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) optic nerve structural organization(GO:0021633) |
0.0 | 0.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.2 | GO:0010043 | response to zinc ion(GO:0010043) |
0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.1 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.0 | 0.6 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
0.0 | 0.2 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
0.0 | 0.0 | GO:0048644 | muscle organ morphogenesis(GO:0048644) cardiac muscle tissue morphogenesis(GO:0055008) muscle tissue morphogenesis(GO:0060415) |
0.0 | 0.1 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.0 | 0.9 | GO:0071804 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.2 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.0 | 0.2 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
0.0 | 0.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.1 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 2.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.7 | 3.7 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.6 | 15.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.6 | 1.7 | GO:0030689 | Noc complex(GO:0030689) |
0.6 | 0.6 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.5 | 2.1 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.5 | 2.9 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.5 | 1.5 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.5 | 2.8 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.4 | 3.7 | GO:0035976 | AP1 complex(GO:0035976) |
0.4 | 2.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.4 | 4.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
0.4 | 9.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.4 | 0.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.4 | 2.9 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.3 | 2.6 | GO:1990393 | 3M complex(GO:1990393) |
0.3 | 1.0 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
0.3 | 1.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.3 | 1.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.3 | 1.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 1.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.2 | 0.7 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
0.2 | 0.7 | GO:0020005 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
0.2 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
0.2 | 0.4 | GO:0019034 | viral replication complex(GO:0019034) |
0.2 | 2.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 1.4 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 0.6 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.2 | 0.6 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
0.2 | 3.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.2 | 1.0 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.2 | 1.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 1.1 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.2 | 0.6 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.2 | 1.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.2 | 0.9 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
0.2 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.2 | 0.5 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
0.2 | 0.7 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.2 | 1.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.2 | 0.5 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
0.2 | 0.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 3.4 | GO:0035579 | specific granule membrane(GO:0035579) |
0.1 | 0.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 5.2 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 1.1 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 2.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.6 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 1.5 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 1.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.1 | 3.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 1.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.4 | GO:0005960 | glycine cleavage complex(GO:0005960) |
0.1 | 1.4 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
0.1 | 1.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.6 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.1 | 1.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 1.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 1.1 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.1 | 1.4 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
0.1 | 0.5 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 9.0 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.7 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 1.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 2.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.4 | GO:0031226 | intrinsic component of plasma membrane(GO:0031226) |
0.1 | 2.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 1.0 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.5 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 6.4 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.3 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 1.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.9 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.2 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
0.1 | 1.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 1.7 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.4 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.2 | GO:0005602 | complement component C1 complex(GO:0005602) |
0.1 | 1.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.1 | 0.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.3 | GO:0002133 | polycystin complex(GO:0002133) |
0.1 | 0.9 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 2.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 6.3 | GO:0035580 | specific granule lumen(GO:0035580) |
0.1 | 0.4 | GO:0036021 | endolysosome lumen(GO:0036021) |
0.1 | 1.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.6 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 1.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.1 | 0.2 | GO:0014802 | terminal cisterna(GO:0014802) |
0.1 | 2.0 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 0.5 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 1.9 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.7 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 1.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 4.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.2 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.1 | 0.9 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 1.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 1.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 1.2 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 1.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.1 | 1.0 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.0 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.4 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
0.0 | 2.0 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 2.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.6 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 9.6 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 4.4 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
0.0 | 1.0 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 2.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.9 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 1.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 1.3 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.7 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 1.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.2 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.0 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 1.6 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.7 | GO:0032059 | bleb(GO:0032059) |
0.0 | 0.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 1.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.0 | 0.4 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 1.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.6 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.5 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 17.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.6 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 2.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 3.2 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 1.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.5 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 2.3 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 1.5 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.6 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
0.0 | 0.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 2.7 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 2.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) new growing cell tip(GO:0035841) |
0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.2 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.5 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 1.2 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 2.8 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0001534 | radial spoke(GO:0001534) |
0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.2 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.1 | GO:0070701 | mucus layer(GO:0070701) |
0.0 | 0.1 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.3 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 1.1 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.5 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:0097486 | multivesicular body lumen(GO:0097486) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
0.0 | 0.4 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.3 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 1.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.8 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.8 | 8.4 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
2.1 | 8.6 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
1.4 | 4.3 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
1.2 | 4.9 | GO:0004335 | galactokinase activity(GO:0004335) |
0.7 | 2.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.7 | 2.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.7 | 14.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.7 | 2.7 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
0.6 | 2.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.6 | 2.8 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.5 | 4.6 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.5 | 2.0 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
0.5 | 3.5 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.5 | 1.0 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.5 | 0.9 | GO:0010857 | calcium-dependent protein kinase C activity(GO:0004698) calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.5 | 1.8 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.5 | 1.4 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
0.5 | 1.4 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.4 | 1.3 | GO:0097258 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
0.4 | 1.3 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
0.4 | 1.2 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.4 | 2.0 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.4 | 1.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.4 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.4 | 2.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.4 | 1.9 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.4 | 1.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.4 | 2.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.3 | 2.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.3 | 1.0 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
0.3 | 1.3 | GO:0005019 | platelet-derived growth factor beta-receptor activity(GO:0005019) |
0.3 | 1.0 | GO:0019862 | IgA binding(GO:0019862) |
0.3 | 1.0 | GO:0045142 | triplex DNA binding(GO:0045142) |
0.3 | 2.9 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.3 | 0.9 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.3 | 3.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.3 | 1.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.3 | 0.9 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.3 | 2.4 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.3 | 1.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.3 | 1.5 | GO:0010736 | serum response element binding(GO:0010736) |
0.3 | 1.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 0.9 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
0.3 | 0.9 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
0.3 | 0.9 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
0.3 | 1.2 | GO:0047860 | diiodophenylpyruvate reductase activity(GO:0047860) |
0.3 | 1.7 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.3 | 3.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.3 | 0.8 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
0.3 | 0.8 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
0.3 | 1.9 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.3 | 3.2 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
0.3 | 2.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.3 | 0.8 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
0.3 | 0.8 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
0.3 | 6.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.3 | 1.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.2 | 1.5 | GO:0032089 | NACHT domain binding(GO:0032089) |
0.2 | 1.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 0.7 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
0.2 | 1.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
0.2 | 2.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.2 | 0.9 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
0.2 | 0.7 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.2 | 0.9 | GO:0070643 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
0.2 | 0.9 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.2 | 0.7 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
0.2 | 0.7 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
0.2 | 0.7 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
0.2 | 1.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.2 | 0.9 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.2 | 0.9 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
0.2 | 0.7 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 0.6 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
0.2 | 1.9 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.2 | 0.9 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.2 | 0.6 | GO:0033961 | cis-stilbene-oxide hydrolase activity(GO:0033961) |
0.2 | 1.5 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.2 | 3.6 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.2 | 1.0 | GO:0070905 | serine binding(GO:0070905) |
0.2 | 1.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.2 | 1.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 0.6 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.2 | 0.8 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
0.2 | 0.6 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
0.2 | 1.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
0.2 | 0.8 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
0.2 | 0.6 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 1.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.2 | 5.3 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.2 | 0.7 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
0.2 | 8.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.2 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.2 | 1.0 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.2 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.2 | 1.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.2 | 2.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.2 | 0.5 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
0.2 | 0.5 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
0.2 | 0.5 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
0.2 | 0.5 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
0.2 | 2.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.2 | 1.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 0.6 | GO:0005046 | KDEL sequence binding(GO:0005046) |
0.1 | 1.5 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 1.6 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.4 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.1 | 1.6 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 2.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.1 | 4.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.4 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
0.1 | 2.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 1.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 2.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.4 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
0.1 | 0.6 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.4 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
0.1 | 0.4 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
0.1 | 0.8 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.1 | 0.7 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.5 | GO:0047708 | biotinidase activity(GO:0047708) |
0.1 | 0.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 2.9 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 2.7 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 0.9 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.1 | 4.2 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.9 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 7.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.4 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
0.1 | 0.9 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.1 | 1.1 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.1 | 0.6 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.1 | 2.8 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 1.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 3.0 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 1.3 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 5.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.7 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 3.7 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.1 | 0.9 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 1.4 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.1 | 2.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 2.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.1 | 0.3 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
0.1 | 0.3 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.1 | 0.7 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.1 | 0.4 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
0.1 | 1.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.5 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.9 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.4 | GO:0052594 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.1 | 0.4 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.5 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.7 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.4 | GO:0004998 | transferrin receptor activity(GO:0004998) |
0.1 | 0.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.7 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
0.1 | 3.4 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 2.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.4 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.1 | 2.6 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 1.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.8 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.8 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 0.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 1.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 1.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.9 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.5 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.1 | 0.3 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.1 | 1.7 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.3 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 2.0 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 2.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 3.7 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.7 | GO:0032357 | oxidized purine DNA binding(GO:0032357) |
0.1 | 1.6 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.8 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.7 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
0.1 | 0.7 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 1.8 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.5 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 1.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 1.7 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 2.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 2.5 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.3 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 1.7 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.3 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
0.1 | 0.7 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.3 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
0.1 | 1.5 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.5 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.1 | 4.6 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 1.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.6 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.3 | GO:0033906 | protein tyrosine kinase inhibitor activity(GO:0030292) hyaluronoglucuronidase activity(GO:0033906) |
0.1 | 0.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 1.0 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.9 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.2 | GO:0031768 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
0.1 | 0.2 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
0.1 | 0.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.4 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.3 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.7 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 1.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.2 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 2.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.1 | 0.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.2 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
0.1 | 7.7 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.1 | 0.5 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.7 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.4 | GO:0016403 | dimethylargininase activity(GO:0016403) |
0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.7 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 1.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.3 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.1 | 1.8 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 2.0 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.0 | 2.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0097689 | iron channel activity(GO:0097689) |
0.0 | 1.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.0 | 0.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 1.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 1.0 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 1.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.0 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
0.0 | 0.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.2 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
0.0 | 0.7 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 1.7 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
0.0 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.5 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0042007 | interleukin-18 binding(GO:0042007) |
0.0 | 1.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.3 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.2 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
0.0 | 0.4 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
0.0 | 0.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
0.0 | 0.2 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.8 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 2.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.3 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 1.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 1.4 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.0 | 0.9 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.9 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
0.0 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.9 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.4 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.0 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
0.0 | 1.0 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.8 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.3 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.0 | 4.5 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.8 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 2.1 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 3.4 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 1.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.3 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
0.0 | 0.2 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 1.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 7.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.4 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 1.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.2 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
0.0 | 0.1 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
0.0 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
0.0 | 0.1 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
0.0 | 1.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.4 | GO:0034594 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 1.0 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.4 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.1 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.0 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0052811 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) |
0.0 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.6 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.4 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.1 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 1.0 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.4 | GO:0001637 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.5 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 1.6 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.0 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.7 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.0 | 1.7 | GO:0005267 | potassium channel activity(GO:0005267) |
0.0 | 0.3 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 1.8 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.0 | 1.2 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.2 | GO:0015926 | glucosidase activity(GO:0015926) |
0.0 | 0.5 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.0 | 0.0 | GO:0047946 | glutamine N-acyltransferase activity(GO:0047946) |
0.0 | 0.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
0.0 | 0.1 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
0.0 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.0 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.7 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 2.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.0 | GO:0016409 | palmitoyltransferase activity(GO:0016409) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.8 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 9.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.2 | 15.3 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 0.8 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.8 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.7 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 3.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 4.0 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.1 | 2.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 3.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.6 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 3.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.7 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 1.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 3.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.9 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.7 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 1.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 1.0 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 1.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 1.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 1.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 1.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 2.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 1.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 2.0 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 1.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.5 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 1.0 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 1.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.5 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 7.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.3 | 1.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.3 | 0.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.2 | 7.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.2 | 3.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 5.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.2 | 2.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.2 | 8.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.2 | 9.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 10.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.2 | 3.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 1.8 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 8.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 0.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 2.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.7 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 1.8 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 1.8 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.1 | 1.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 2.7 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.1 | 1.6 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.2 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 3.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 2.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 8.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 1.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 0.4 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 2.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 2.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 1.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.1 | 1.4 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 2.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 1.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 2.0 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 1.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 6.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 10.1 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.1 | 3.7 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.1 | 4.2 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 1.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 2.7 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.5 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 3.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 1.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 2.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 2.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 3.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 1.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 1.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 1.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.6 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 1.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 4.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.6 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
0.0 | 0.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 2.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 1.8 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.2 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 1.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.7 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 1.8 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.9 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 3.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 2.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 2.0 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.4 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 1.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.5 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.6 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 1.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.9 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 2.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.9 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 1.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.4 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.0 | 0.8 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |