Project
SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for ZBTB6
Z-value: 1.63
Motif logo
Transcription factors associated with ZBTB6
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZBTB6
|
ENSG00000186130.4 | zinc finger and BTB domain containing 6 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZBTB6 | hg19_v2_chr9_-_125675576_125675612 | -0.89 | 1.3e-07 | Click! |
Activity profile of ZBTB6 motif
Sorted Z-values of ZBTB6 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of ZBTB6
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 5.5 | GO:0051710 | cytolysis by symbiont of host cells(GO:0001897) regulation of cytolysis in other organism(GO:0051710) |
| 0.8 | 2.4 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.6 | 2.5 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.6 | 2.5 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.5 | 3.8 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.5 | 2.4 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.5 | 0.9 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.4 | 1.8 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.4 | 1.9 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.4 | 2.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.4 | 1.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.4 | 1.1 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.3 | 1.0 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.3 | 1.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.3 | 3.2 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.3 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
| 0.3 | 0.9 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.3 | 1.5 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.3 | 1.2 | GO:0018282 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.3 | 0.9 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.3 | 2.3 | GO:0048880 | sensory system development(GO:0048880) |
| 0.3 | 0.9 | GO:0061193 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.3 | 0.8 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.3 | 1.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.3 | 0.5 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.2 | 1.9 | GO:0043585 | nose morphogenesis(GO:0043585) |
| 0.2 | 0.7 | GO:1902568 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.2 | 1.8 | GO:1902613 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.2 | 0.8 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.2 | 0.8 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.2 | 0.8 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.2 | 1.0 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.2 | 2.1 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.2 | 0.8 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.2 | 0.9 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 | 1.3 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.2 | 0.5 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.2 | 0.9 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.2 | 1.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.2 | 0.7 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.2 | 0.7 | GO:0033076 | alkaloid catabolic process(GO:0009822) isoquinoline alkaloid metabolic process(GO:0033076) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.2 | 0.8 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.2 | 0.3 | GO:0030866 | cortical cytoskeleton organization(GO:0030865) cortical actin cytoskeleton organization(GO:0030866) |
| 0.2 | 0.6 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.2 | 0.5 | GO:0048627 | myoblast development(GO:0048627) |
| 0.1 | 0.9 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.9 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.7 | GO:2000051 | Wnt receptor catabolic process(GO:0038018) negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 1.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.7 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 0.7 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.4 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.1 | 1.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 5.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 3.5 | GO:0070977 | bone maturation(GO:0070977) |
| 0.1 | 1.1 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.1 | 0.7 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 1.0 | GO:0036018 | cellular response to erythropoietin(GO:0036018) |
| 0.1 | 0.6 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.7 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.8 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 1.9 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.7 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 0.3 | GO:0032904 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 | 1.4 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 | 0.3 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 | 0.9 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.8 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.4 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.1 | 0.3 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.3 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.1 | 2.9 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 0.9 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.7 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.7 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.4 | GO:0072248 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.4 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.7 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.8 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.5 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 0.3 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 0.3 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.1 | 0.4 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 | 0.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.5 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 1.7 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.8 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.1 | 0.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.5 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.2 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 | 4.9 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 1.5 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.4 | GO:0061364 | negative regulation of negative chemotaxis(GO:0050925) apoptotic process involved in luteolysis(GO:0061364) |
| 0.1 | 1.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 1.5 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 1.6 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.1 | 0.7 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.1 | 0.9 | GO:0009407 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.1 | 0.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.5 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.5 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.3 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.3 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 2.2 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.1 | 0.2 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.1 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.1 | 0.3 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.1 | 0.6 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 1.6 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 | 1.1 | GO:0014894 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.9 | GO:0035860 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 1.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 1.2 | GO:0016577 | histone demethylation(GO:0016577) |
| 0.1 | 0.7 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.5 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 0.7 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.3 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 | 0.3 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 3.0 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.1 | 1.0 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.1 | 0.3 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 0.3 | GO:0099542 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
| 0.0 | 0.8 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.2 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 0.7 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.4 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 | 0.3 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.0 | 0.8 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.8 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 1.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.4 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.3 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.0 | 0.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.7 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.0 | 0.5 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.6 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 1.2 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.5 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 1.6 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.2 | GO:0032811 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) epinephrine secretion(GO:0048242) |
| 0.0 | 0.3 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.4 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 3.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.6 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.9 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 1.1 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 1.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 2.4 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.6 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 | 0.9 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.2 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 1.9 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.2 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.0 | 0.1 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.0 | 0.7 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.7 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.7 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.3 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.6 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.6 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.7 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.6 | GO:0005977 | glycogen metabolic process(GO:0005977) |
| 0.0 | 0.6 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.1 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.4 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 | 0.1 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.0 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.6 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.0 | 0.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.2 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.3 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.0 | 0.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 2.0 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.3 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 | 0.2 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 0.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.1 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.6 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 1.0 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
| 0.0 | 0.5 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.0 | 0.1 | GO:2001302 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.0 | 0.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.5 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 1.0 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.2 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.4 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 2.0 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) |
| 0.0 | 0.6 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 | 0.5 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.4 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 1.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.0 | 0.4 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.2 | GO:0098856 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 1.0 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.3 | GO:0014044 | Schwann cell development(GO:0014044) |
| 0.0 | 3.0 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.0 | 0.3 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 1.0 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
| 0.0 | 1.2 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 0.6 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.4 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.2 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.0 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.0 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.4 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.1 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.7 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.2 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.4 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.6 | GO:0003299 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.3 | GO:0050796 | regulation of insulin secretion(GO:0050796) |
| 0.0 | 0.6 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.2 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.0 | 0.6 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.2 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
| 0.0 | 0.4 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.6 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.7 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.3 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 | 0.5 | GO:0030323 | respiratory tube development(GO:0030323) |
| 0.0 | 0.4 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.9 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.5 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.0 | 0.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.5 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
| 0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 | 0.6 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 | 0.3 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.2 | GO:0033028 | myeloid cell apoptotic process(GO:0033028) protein localization to endosome(GO:0036010) |
| 0.0 | 0.0 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.1 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.3 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.4 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.0 | 0.4 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.4 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 | 0.2 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.1 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.5 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.5 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium assembly(GO:0010593) negative regulation of lamellipodium organization(GO:1902744) |
| 0.0 | 0.3 | GO:0016236 | macroautophagy(GO:0016236) |
| 0.0 | 0.1 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.5 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.5 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.3 | 3.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.2 | 0.7 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.2 | 1.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.2 | 2.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.2 | 1.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 13.5 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 1.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.9 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 2.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 1.0 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.1 | 0.4 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.1 | 0.8 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.7 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 1.1 | GO:0098642 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 0.1 | 0.5 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 0.7 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 6.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.9 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.9 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 1.0 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 1.3 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 1.8 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 0.6 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 1.9 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 1.0 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.4 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 1.8 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.3 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.1 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.4 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 0.6 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.2 | GO:0044094 | viral replication complex(GO:0019034) host cell nuclear part(GO:0044094) |
| 0.0 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 1.7 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.6 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 2.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.5 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.5 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.5 | GO:0061202 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.0 | 0.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 3.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.7 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.6 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.6 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 1.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.3 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.4 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 2.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.3 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 1.2 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.6 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.9 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 1.2 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 1.4 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.2 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.9 | GO:0070160 | occluding junction(GO:0070160) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.9 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.9 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.3 | GO:0001533 | cornified envelope(GO:0001533) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.5 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.5 | 1.5 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.5 | 2.0 | GO:1990175 | EH domain binding(GO:1990175) |
| 0.4 | 1.2 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.3 | 1.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.3 | 2.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.3 | 6.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.3 | 1.1 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.3 | 0.3 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.2 | 2.0 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.2 | 0.7 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.2 | 1.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.2 | 0.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.2 | 1.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 0.7 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.2 | 1.5 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.2 | 1.3 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.2 | 2.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.2 | 0.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.2 | 1.2 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.2 | 1.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.2 | 0.5 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.2 | 1.5 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.2 | 0.6 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 0.9 | GO:0050610 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.1 | 3.4 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.8 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 1.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 1.3 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.1 | 0.7 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.3 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.1 | 0.9 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.1 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.1 | 1.0 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 3.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.9 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.1 | 0.5 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.1 | 2.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.5 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.1 | 0.5 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 1.8 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.7 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.8 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.1 | 0.7 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.4 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.8 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.1 | 1.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.9 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 1.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 1.0 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 1.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.4 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.4 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.1 | 0.6 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.6 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.1 | 0.3 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 1.5 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 1.4 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.4 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 1.9 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.4 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.5 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 0.6 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 0.7 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.9 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.4 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 1.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 1.8 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 11.0 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 1.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 1.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.4 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.0 | 0.7 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.8 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.6 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.7 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 1.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.7 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.1 | GO:0031177 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) phosphopantetheine binding(GO:0031177) |
| 0.0 | 0.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.9 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 1.1 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 1.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 1.0 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.8 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.4 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.7 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.9 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.6 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.7 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.7 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.6 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.8 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.5 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.5 | GO:0017162 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) hepoxilin-epoxide hydrolase activity(GO:0047977) |
| 0.0 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.0 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.9 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.8 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.0 | 0.1 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.0 | 0.7 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.5 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 0.5 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 1.4 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.6 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 3.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.2 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
| 0.0 | 0.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.1 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
| 0.0 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.6 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 1.8 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.4 | GO:0016757 | transferase activity, transferring glycosyl groups(GO:0016757) |
| 0.0 | 1.1 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 3.3 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.0 | 0.3 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.6 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.1 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 6.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.4 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 3.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 1.6 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.0 | 0.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.1 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 5.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 2.8 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 3.0 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.4 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 1.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 2.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.9 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.3 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 1.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 1.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.9 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 1.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 1.6 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 4.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.5 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 1.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.4 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 1.3 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.5 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 1.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 2.1 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.6 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 1.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 1.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 3.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.2 | 3.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.2 | 2.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 0.9 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 3.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 1.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 1.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.6 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 2.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.4 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 2.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 3.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 1.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 1.0 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.9 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 1.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.7 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 1.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 1.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 3.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.6 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.5 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.9 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 1.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.7 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.8 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 1.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |