Project
SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for ZNF711_TFAP2A_TFAP2D
Z-value: 6.50
Motif logo
Transcription factors associated with ZNF711_TFAP2A_TFAP2D
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZNF711
|
ENSG00000147180.12 | zinc finger protein 711 |
|
TFAP2A
|
ENSG00000137203.6 | transcription factor AP-2 alpha |
|
TFAP2D
|
ENSG00000008197.4 | transcription factor AP-2 delta |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZNF711 | hg19_v2_chrX_+_84499081_84499115 | 0.93 | 3.6e-09 | Click! |
| TFAP2A | hg19_v2_chr6_-_10415470_10415508 | -0.57 | 8.3e-03 | Click! |
Activity profile of ZNF711_TFAP2A_TFAP2D motif
Sorted Z-values of ZNF711_TFAP2A_TFAP2D motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr15_+_27112058 | 20.13 |
ENST00000355395.5
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr2_+_121493717 | 19.37 |
ENST00000418323.1
|
GLI2
|
GLI family zinc finger 2 |
| chr15_+_27112194 | 19.04 |
ENST00000555182.1
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr15_+_27112296 | 18.50 |
ENST00000554038.1
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr15_+_27112380 | 18.26 |
ENST00000554596.1
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr2_-_233792837 | 17.51 |
ENST00000373552.4
ENST00000409079.1 |
NGEF
|
neuronal guanine nucleotide exchange factor |
| chr7_-_131241361 | 17.32 |
ENST00000378555.3
ENST00000322985.9 ENST00000541194.1 ENST00000537928.1 |
PODXL
|
podocalyxin-like |
| chr15_+_27112251 | 16.34 |
ENST00000400081.3
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr1_-_226595648 | 15.50 |
ENST00000366790.3
|
PARP1
|
poly (ADP-ribose) polymerase 1 |
| chr3_-_5229982 | 15.40 |
ENST00000600805.1
|
AC026202.1
|
Uncharacterized protein |
| chr19_-_38747172 | 14.84 |
ENST00000347262.4
ENST00000591585.1 ENST00000301242.4 |
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr17_-_78450398 | 14.83 |
ENST00000306773.4
|
NPTX1
|
neuronal pentraxin I |
| chr15_+_99645277 | 14.18 |
ENST00000336292.6
ENST00000328642.7 |
SYNM
|
synemin, intermediate filament protein |
| chr20_+_42295745 | 13.88 |
ENST00000396863.4
ENST00000217026.4 |
MYBL2
|
v-myb avian myeloblastosis viral oncogene homolog-like 2 |
| chr14_+_105953204 | 13.45 |
ENST00000409393.2
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr2_+_30454390 | 13.41 |
ENST00000395323.3
ENST00000406087.1 ENST00000404397.1 |
LBH
|
limb bud and heart development |
| chr17_-_16256718 | 13.39 |
ENST00000476243.1
ENST00000299736.4 |
CENPV
|
centromere protein V |
| chr2_-_128145498 | 13.19 |
ENST00000409179.2
|
MAP3K2
|
mitogen-activated protein kinase kinase kinase 2 |
| chr18_-_3013307 | 12.87 |
ENST00000584294.1
|
LPIN2
|
lipin 2 |
| chr9_-_6645628 | 12.84 |
ENST00000321612.6
|
GLDC
|
glycine dehydrogenase (decarboxylating) |
| chr2_+_239067597 | 12.70 |
ENST00000546354.1
|
FAM132B
|
family with sequence similarity 132, member B |
| chr15_+_33010175 | 12.68 |
ENST00000300177.4
ENST00000560677.1 ENST00000560830.1 |
GREM1
|
gremlin 1, DAN family BMP antagonist |
| chr5_+_175298487 | 12.62 |
ENST00000393745.3
|
CPLX2
|
complexin 2 |
| chr2_+_30455016 | 12.46 |
ENST00000401506.1
ENST00000407930.2 |
LBH
|
limb bud and heart development |
| chr5_+_175298573 | 12.44 |
ENST00000512824.1
|
CPLX2
|
complexin 2 |
| chr2_-_44223089 | 12.39 |
ENST00000447246.1
ENST00000409946.1 ENST00000409659.1 |
LRPPRC
|
leucine-rich pentatricopeptide repeat containing |
| chr1_-_21948906 | 12.31 |
ENST00000374761.2
ENST00000599760.1 |
RAP1GAP
|
RAP1 GTPase activating protein |
| chr20_+_37554955 | 12.17 |
ENST00000217429.4
|
FAM83D
|
family with sequence similarity 83, member D |
| chr10_+_60272814 | 12.03 |
ENST00000373886.3
|
BICC1
|
bicaudal C homolog 1 (Drosophila) |
| chr16_-_54963026 | 11.82 |
ENST00000560208.1
ENST00000557792.1 |
CRNDE
|
colorectal neoplasia differentially expressed (non-protein coding) |
| chr2_-_225907150 | 11.81 |
ENST00000258390.7
|
DOCK10
|
dedicator of cytokinesis 10 |
| chr9_+_137533615 | 11.75 |
ENST00000371817.3
|
COL5A1
|
collagen, type V, alpha 1 |
| chr3_+_67705121 | 11.28 |
ENST00000464420.1
ENST00000482677.1 |
RP11-81N13.1
|
RP11-81N13.1 |
| chr14_+_105953246 | 11.14 |
ENST00000392531.3
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr8_-_120868078 | 11.11 |
ENST00000313655.4
|
DSCC1
|
DNA replication and sister chromatid cohesion 1 |
| chr20_-_43438912 | 11.08 |
ENST00000541604.2
ENST00000372851.3 |
RIMS4
|
regulating synaptic membrane exocytosis 4 |
| chr1_+_38259540 | 11.03 |
ENST00000397631.3
|
MANEAL
|
mannosidase, endo-alpha-like |
| chr10_+_48355024 | 10.97 |
ENST00000395702.2
ENST00000442001.1 ENST00000433077.1 ENST00000436850.1 ENST00000494156.1 ENST00000586537.1 |
ZNF488
|
zinc finger protein 488 |
| chr2_+_223725723 | 10.96 |
ENST00000535678.1
|
ACSL3
|
acyl-CoA synthetase long-chain family member 3 |
| chr16_-_85722530 | 10.94 |
ENST00000253462.3
|
GINS2
|
GINS complex subunit 2 (Psf2 homolog) |
| chr20_+_33814457 | 10.93 |
ENST00000246186.6
|
MMP24
|
matrix metallopeptidase 24 (membrane-inserted) |
| chr15_+_27111510 | 10.87 |
ENST00000335625.5
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr2_+_103236004 | 10.87 |
ENST00000233969.2
|
SLC9A2
|
solute carrier family 9, subfamily A (NHE2, cation proton antiporter 2), member 2 |
| chr16_+_81040794 | 10.81 |
ENST00000439957.3
ENST00000393335.3 ENST00000428963.2 ENST00000564669.1 |
CENPN
|
centromere protein N |
| chr3_-_13461807 | 10.61 |
ENST00000254508.5
|
NUP210
|
nucleoporin 210kDa |
| chr14_+_105992906 | 10.27 |
ENST00000392519.2
|
TMEM121
|
transmembrane protein 121 |
| chr17_-_56065540 | 10.27 |
ENST00000583932.1
|
VEZF1
|
vascular endothelial zinc finger 1 |
| chr2_+_121103706 | 10.26 |
ENST00000295228.3
|
INHBB
|
inhibin, beta B |
| chr11_+_1151573 | 10.26 |
ENST00000534821.1
ENST00000356191.2 |
MUC5AC
|
mucin 5AC, oligomeric mucus/gel-forming |
| chr7_-_134143841 | 10.24 |
ENST00000285930.4
|
AKR1B1
|
aldo-keto reductase family 1, member B1 (aldose reductase) |
| chr5_-_179780312 | 10.18 |
ENST00000253778.8
|
GFPT2
|
glutamine-fructose-6-phosphate transaminase 2 |
| chr9_+_139606983 | 10.11 |
ENST00000371692.4
|
FAM69B
|
family with sequence similarity 69, member B |
| chr20_+_2083540 | 10.10 |
ENST00000400064.3
|
STK35
|
serine/threonine kinase 35 |
| chr15_-_27018884 | 10.03 |
ENST00000299267.4
|
GABRB3
|
gamma-aminobutyric acid (GABA) A receptor, beta 3 |
| chr2_-_25142708 | 10.01 |
ENST00000260600.5
ENST00000435135.1 |
ADCY3
|
adenylate cyclase 3 |
| chr5_+_175298674 | 10.00 |
ENST00000514150.1
|
CPLX2
|
complexin 2 |
| chr8_-_145743164 | 10.00 |
ENST00000428558.2
|
RECQL4
|
RecQ protein-like 4 |
| chr12_+_49740700 | 9.98 |
ENST00000549441.2
ENST00000395069.3 |
DNAJC22
|
DnaJ (Hsp40) homolog, subfamily C, member 22 |
| chr1_+_38259459 | 9.96 |
ENST00000373045.6
|
MANEAL
|
mannosidase, endo-alpha-like |
| chr14_+_105957402 | 9.95 |
ENST00000421892.1
ENST00000334656.7 ENST00000451719.1 ENST00000392522.3 ENST00000392523.4 ENST00000354560.6 ENST00000450383.1 |
C14orf80
|
chromosome 14 open reading frame 80 |
| chr6_-_85473156 | 9.94 |
ENST00000606784.1
ENST00000606325.1 |
TBX18
|
T-box 18 |
| chr17_+_74864476 | 9.92 |
ENST00000301618.4
ENST00000569840.2 |
MGAT5B
|
mannosyl (alpha-1,6-)-glycoprotein beta-1,6-N-acetyl-glucosaminyltransferase, isozyme B |
| chr8_+_74888417 | 9.91 |
ENST00000517439.1
ENST00000312184.5 |
TMEM70
|
transmembrane protein 70 |
| chr2_+_234263120 | 9.87 |
ENST00000264057.2
ENST00000427930.1 |
DGKD
|
diacylglycerol kinase, delta 130kDa |
| chr14_+_100204027 | 9.83 |
ENST00000554479.1
ENST00000555145.1 |
EML1
|
echinoderm microtubule associated protein like 1 |
| chr4_+_1723512 | 9.82 |
ENST00000493975.1
|
TACC3
|
transforming, acidic coiled-coil containing protein 3 |
| chr1_+_95582881 | 9.79 |
ENST00000370203.4
ENST00000456991.1 |
TMEM56
|
transmembrane protein 56 |
| chr7_-_2883650 | 9.78 |
ENST00000544127.1
|
GNA12
|
guanine nucleotide binding protein (G protein) alpha 12 |
| chr15_+_65823092 | 9.77 |
ENST00000566074.1
|
PTPLAD1
|
protein tyrosine phosphatase-like A domain containing 1 |
| chr2_-_107503558 | 9.69 |
ENST00000361686.4
ENST00000409087.3 |
ST6GAL2
|
ST6 beta-galactosamide alpha-2,6-sialyltranferase 2 |
| chr17_+_1733251 | 9.69 |
ENST00000570451.1
|
RPA1
|
replication protein A1, 70kDa |
| chr18_+_11981427 | 9.67 |
ENST00000269159.3
|
IMPA2
|
inositol(myo)-1(or 4)-monophosphatase 2 |
| chr15_+_80351977 | 9.65 |
ENST00000559157.1
ENST00000561012.1 ENST00000564367.1 ENST00000558494.1 |
ZFAND6
|
zinc finger, AN1-type domain 6 |
| chr14_+_105952648 | 9.63 |
ENST00000330233.7
|
CRIP1
|
cysteine-rich protein 1 (intestinal) |
| chr11_-_61584233 | 9.62 |
ENST00000491310.1
|
FADS1
|
fatty acid desaturase 1 |
| chr11_+_66624527 | 9.61 |
ENST00000393952.3
|
LRFN4
|
leucine rich repeat and fibronectin type III domain containing 4 |
| chr9_-_138987115 | 9.56 |
ENST00000277554.2
|
NACC2
|
NACC family member 2, BEN and BTB (POZ) domain containing |
| chr15_-_41624685 | 9.49 |
ENST00000560640.1
ENST00000220514.3 |
OIP5
|
Opa interacting protein 5 |
| chr8_+_21906433 | 9.45 |
ENST00000522148.1
|
DMTN
|
dematin actin binding protein |
| chr9_-_139965000 | 9.43 |
ENST00000409687.3
|
SAPCD2
|
suppressor APC domain containing 2 |
| chr20_-_47444420 | 9.42 |
ENST00000371941.3
ENST00000396220.1 |
PREX1
|
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
| chr15_+_69591235 | 9.39 |
ENST00000395407.2
ENST00000558684.1 |
PAQR5
|
progestin and adipoQ receptor family member V |
| chr11_+_67777751 | 9.39 |
ENST00000316367.6
ENST00000007633.8 ENST00000342456.6 |
ALDH3B1
|
aldehyde dehydrogenase 3 family, member B1 |
| chr7_+_94536898 | 9.38 |
ENST00000433360.1
ENST00000340694.4 ENST00000424654.1 |
PPP1R9A
|
protein phosphatase 1, regulatory subunit 9A |
| chr19_+_33685490 | 9.37 |
ENST00000253193.7
|
LRP3
|
low density lipoprotein receptor-related protein 3 |
| chr10_+_47083454 | 9.35 |
ENST00000374312.1
|
NPY4R
|
neuropeptide Y receptor Y4 |
| chr19_-_38746979 | 9.35 |
ENST00000591291.1
|
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr11_-_74022658 | 9.33 |
ENST00000427714.2
ENST00000331597.4 |
P4HA3
|
prolyl 4-hydroxylase, alpha polypeptide III |
| chr12_-_58026451 | 9.29 |
ENST00000552350.1
ENST00000548888.1 |
B4GALNT1
|
beta-1,4-N-acetyl-galactosaminyl transferase 1 |
| chr17_-_20946710 | 9.26 |
ENST00000584538.1
|
USP22
|
ubiquitin specific peptidase 22 |
| chr5_-_168727713 | 9.20 |
ENST00000404867.3
|
SLIT3
|
slit homolog 3 (Drosophila) |
| chr16_-_19896832 | 9.19 |
ENST00000537135.1
ENST00000564449.1 |
GPRC5B
|
G protein-coupled receptor, family C, group 5, member B |
| chr9_+_137979506 | 9.19 |
ENST00000539529.1
ENST00000392991.4 ENST00000371793.3 |
OLFM1
|
olfactomedin 1 |
| chr1_+_64239657 | 9.17 |
ENST00000371080.1
ENST00000371079.1 |
ROR1
|
receptor tyrosine kinase-like orphan receptor 1 |
| chr19_+_2249308 | 9.17 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
| chr5_+_72112470 | 9.02 |
ENST00000447967.2
ENST00000523768.1 |
TNPO1
|
transportin 1 |
| chr8_-_19615435 | 8.95 |
ENST00000523262.1
|
CSGALNACT1
|
chondroitin sulfate N-acetylgalactosaminyltransferase 1 |
| chr19_+_13228917 | 8.89 |
ENST00000586171.1
|
NACC1
|
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
| chr3_-_138553779 | 8.88 |
ENST00000461451.1
|
PIK3CB
|
phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit beta |
| chr12_-_117537240 | 8.72 |
ENST00000392545.4
ENST00000541210.1 ENST00000335209.7 |
TESC
|
tescalcin |
| chr17_-_26926005 | 8.71 |
ENST00000536674.2
|
SPAG5
|
sperm associated antigen 5 |
| chr17_-_74236382 | 8.66 |
ENST00000592271.1
ENST00000319945.6 ENST00000269391.6 |
RNF157
|
ring finger protein 157 |
| chr2_+_25264933 | 8.64 |
ENST00000401432.3
ENST00000403714.3 |
EFR3B
|
EFR3 homolog B (S. cerevisiae) |
| chr1_-_201476220 | 8.62 |
ENST00000526723.1
ENST00000524951.1 |
CSRP1
|
cysteine and glycine-rich protein 1 |
| chr19_+_589893 | 8.59 |
ENST00000251287.2
|
HCN2
|
hyperpolarization activated cyclic nucleotide-gated potassium channel 2 |
| chr12_+_49658855 | 8.57 |
ENST00000549183.1
|
TUBA1C
|
tubulin, alpha 1c |
| chr6_-_74161977 | 8.56 |
ENST00000370318.1
ENST00000370315.3 |
MB21D1
|
Mab-21 domain containing 1 |
| chr8_-_27695552 | 8.56 |
ENST00000522944.1
ENST00000301905.4 |
PBK
|
PDZ binding kinase |
| chr1_-_38157877 | 8.50 |
ENST00000477060.1
ENST00000491981.1 ENST00000488137.1 |
C1orf109
|
chromosome 1 open reading frame 109 |
| chr2_+_10442993 | 8.49 |
ENST00000423674.1
ENST00000307845.3 |
HPCAL1
|
hippocalcin-like 1 |
| chr1_+_179051160 | 8.48 |
ENST00000367625.4
ENST00000352445.6 |
TOR3A
|
torsin family 3, member A |
| chr11_-_6440283 | 8.41 |
ENST00000299402.6
ENST00000609360.1 ENST00000389906.2 ENST00000532020.2 |
APBB1
|
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
| chr7_-_30029328 | 8.41 |
ENST00000425819.2
ENST00000409570.1 |
SCRN1
|
secernin 1 |
| chr14_+_31343747 | 8.38 |
ENST00000216361.4
ENST00000396618.3 ENST00000475087.1 |
COCH
|
cochlin |
| chr8_+_98881268 | 8.37 |
ENST00000254898.5
ENST00000524308.1 ENST00000522025.2 |
MATN2
|
matrilin 2 |
| chr9_+_129089088 | 8.35 |
ENST00000361171.3
ENST00000545391.1 |
MVB12B
|
multivesicular body subunit 12B |
| chr12_-_58026426 | 8.35 |
ENST00000418555.2
|
B4GALNT1
|
beta-1,4-N-acetyl-galactosaminyl transferase 1 |
| chr8_+_27491381 | 8.31 |
ENST00000337221.4
|
SCARA3
|
scavenger receptor class A, member 3 |
| chr2_-_239148599 | 8.30 |
ENST00000409182.1
ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6
|
hes family bHLH transcription factor 6 |
| chr11_-_64851496 | 8.30 |
ENST00000404147.3
ENST00000275517.3 |
CDCA5
|
cell division cycle associated 5 |
| chr3_+_32148106 | 8.29 |
ENST00000425459.1
ENST00000431009.1 |
GPD1L
|
glycerol-3-phosphate dehydrogenase 1-like |
| chr19_-_55919087 | 8.29 |
ENST00000587845.1
ENST00000589978.1 ENST00000264552.9 |
UBE2S
|
ubiquitin-conjugating enzyme E2S |
| chr2_-_234763147 | 8.28 |
ENST00000411486.2
ENST00000432087.1 ENST00000441687.1 ENST00000414924.1 |
HJURP
|
Holliday junction recognition protein |
| chr5_-_168727786 | 8.28 |
ENST00000332966.8
|
SLIT3
|
slit homolog 3 (Drosophila) |
| chr16_-_71757780 | 8.25 |
ENST00000567016.1
|
PHLPP2
|
PH domain and leucine rich repeat protein phosphatase 2 |
| chr3_-_149375783 | 8.20 |
ENST00000467467.1
ENST00000460517.1 ENST00000360632.3 |
WWTR1
|
WW domain containing transcription regulator 1 |
| chr2_-_228028829 | 8.19 |
ENST00000396625.3
ENST00000329662.7 |
COL4A4
|
collagen, type IV, alpha 4 |
| chr11_-_69294647 | 8.17 |
ENST00000542064.1
|
AP000439.3
|
AP000439.3 |
| chr6_-_85473073 | 8.17 |
ENST00000606621.1
|
TBX18
|
T-box 18 |
| chr2_-_72374948 | 8.11 |
ENST00000546307.1
ENST00000474509.1 |
CYP26B1
|
cytochrome P450, family 26, subfamily B, polypeptide 1 |
| chr1_-_226595741 | 8.09 |
ENST00000366794.5
ENST00000366792.1 ENST00000366791.5 |
PARP1
|
poly (ADP-ribose) polymerase 1 |
| chrX_-_153775760 | 8.06 |
ENST00000440967.1
ENST00000393564.2 ENST00000369620.2 |
G6PD
|
glucose-6-phosphate dehydrogenase |
| chr19_+_16435625 | 8.06 |
ENST00000248071.5
ENST00000592003.1 |
KLF2
|
Kruppel-like factor 2 |
| chr16_+_87636474 | 8.04 |
ENST00000284262.2
|
JPH3
|
junctophilin 3 |
| chr12_+_58013693 | 8.03 |
ENST00000320442.4
ENST00000379218.2 |
SLC26A10
|
solute carrier family 26, member 10 |
| chr3_-_134092561 | 8.03 |
ENST00000510560.1
ENST00000504234.1 ENST00000515172.1 |
AMOTL2
|
angiomotin like 2 |
| chr17_-_42276574 | 8.03 |
ENST00000589805.1
|
ATXN7L3
|
ataxin 7-like 3 |
| chr1_-_247095236 | 8.02 |
ENST00000478568.1
|
AHCTF1
|
AT hook containing transcription factor 1 |
| chr13_-_95953589 | 8.00 |
ENST00000538287.1
ENST00000376887.4 ENST00000412704.1 ENST00000536256.1 ENST00000431522.1 |
ABCC4
|
ATP-binding cassette, sub-family C (CFTR/MRP), member 4 |
| chr11_+_8102846 | 7.99 |
ENST00000299506.2
|
TUB
|
tubby bipartite transcription factor |
| chr10_+_31608054 | 7.98 |
ENST00000320985.10
ENST00000361642.5 ENST00000560721.2 ENST00000558440.1 ENST00000424869.1 ENST00000542815.3 |
ZEB1
|
zinc finger E-box binding homeobox 1 |
| chr5_+_76506706 | 7.98 |
ENST00000340978.3
ENST00000346042.3 ENST00000264917.5 ENST00000342343.4 ENST00000333194.4 |
PDE8B
|
phosphodiesterase 8B |
| chr17_-_15165854 | 7.98 |
ENST00000395936.1
ENST00000395938.2 |
PMP22
|
peripheral myelin protein 22 |
| chr7_+_36192758 | 7.97 |
ENST00000242108.4
|
EEPD1
|
endonuclease/exonuclease/phosphatase family domain containing 1 |
| chr21_+_38071430 | 7.91 |
ENST00000290399.6
|
SIM2
|
single-minded family bHLH transcription factor 2 |
| chr1_-_229694406 | 7.86 |
ENST00000344517.4
|
ABCB10
|
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
| chr14_+_104604916 | 7.85 |
ENST00000423312.2
|
KIF26A
|
kinesin family member 26A |
| chr15_+_50474385 | 7.85 |
ENST00000267842.5
|
SLC27A2
|
solute carrier family 27 (fatty acid transporter), member 2 |
| chr17_+_16945820 | 7.79 |
ENST00000577514.1
|
MPRIP
|
myosin phosphatase Rho interacting protein |
| chr12_+_3068957 | 7.78 |
ENST00000543035.1
|
TEAD4
|
TEA domain family member 4 |
| chr19_-_33555780 | 7.77 |
ENST00000254260.3
ENST00000400226.4 |
RHPN2
|
rhophilin, Rho GTPase binding protein 2 |
| chr19_+_55795493 | 7.77 |
ENST00000309383.1
|
BRSK1
|
BR serine/threonine kinase 1 |
| chr11_+_61560348 | 7.77 |
ENST00000535723.1
ENST00000574708.1 |
FEN1
FADS2
|
flap structure-specific endonuclease 1 fatty acid desaturase 2 |
| chr5_+_41925325 | 7.77 |
ENST00000296812.2
ENST00000281623.3 ENST00000509134.1 |
FBXO4
|
F-box protein 4 |
| chr11_+_48002279 | 7.73 |
ENST00000534219.1
ENST00000527952.1 |
PTPRJ
|
protein tyrosine phosphatase, receptor type, J |
| chr15_+_90118723 | 7.72 |
ENST00000560985.1
|
TICRR
|
TOPBP1-interacting checkpoint and replication regulator |
| chr2_-_215674374 | 7.69 |
ENST00000449967.2
ENST00000421162.1 ENST00000260947.4 |
BARD1
|
BRCA1 associated RING domain 1 |
| chr2_-_20212422 | 7.69 |
ENST00000421259.2
ENST00000407540.3 |
MATN3
|
matrilin 3 |
| chr1_+_233463507 | 7.68 |
ENST00000366623.3
ENST00000366624.3 |
MLK4
|
Mitogen-activated protein kinase kinase kinase MLK4 |
| chr2_+_198365122 | 7.67 |
ENST00000604458.1
|
HSPE1-MOB4
|
HSPE1-MOB4 readthrough |
| chr2_-_27434756 | 7.64 |
ENST00000426119.1
ENST00000412471.1 |
SLC5A6
|
solute carrier family 5 (sodium/multivitamin and iodide cotransporter), member 6 |
| chr3_-_108308241 | 7.64 |
ENST00000295746.8
|
KIAA1524
|
KIAA1524 |
| chr15_+_80351910 | 7.63 |
ENST00000261749.6
ENST00000561060.1 |
ZFAND6
|
zinc finger, AN1-type domain 6 |
| chr11_-_108369101 | 7.62 |
ENST00000323468.5
|
KDELC2
|
KDEL (Lys-Asp-Glu-Leu) containing 2 |
| chr2_-_11484710 | 7.62 |
ENST00000315872.6
|
ROCK2
|
Rho-associated, coiled-coil containing protein kinase 2 |
| chr2_+_200820494 | 7.60 |
ENST00000435773.2
|
C2orf47
|
chromosome 2 open reading frame 47 |
| chr7_-_108097144 | 7.59 |
ENST00000418239.1
|
NRCAM
|
neuronal cell adhesion molecule |
| chr15_-_26108355 | 7.59 |
ENST00000356865.6
|
ATP10A
|
ATPase, class V, type 10A |
| chr9_+_127539425 | 7.57 |
ENST00000331715.9
|
OLFML2A
|
olfactomedin-like 2A |
| chr14_-_105714771 | 7.57 |
ENST00000550375.1
|
BRF1
|
BRF1, RNA polymerase III transcription initiation factor 90 kDa subunit |
| chr2_+_46926326 | 7.55 |
ENST00000394861.2
|
SOCS5
|
suppressor of cytokine signaling 5 |
| chr14_+_100259666 | 7.55 |
ENST00000262233.6
ENST00000334192.4 |
EML1
|
echinoderm microtubule associated protein like 1 |
| chr10_-_118502070 | 7.54 |
ENST00000369209.3
|
HSPA12A
|
heat shock 70kDa protein 12A |
| chr9_+_6645887 | 7.54 |
ENST00000413145.1
|
RP11-390F4.6
|
RP11-390F4.6 |
| chr17_-_48785216 | 7.53 |
ENST00000285243.6
|
ANKRD40
|
ankyrin repeat domain 40 |
| chr8_+_101170134 | 7.51 |
ENST00000520643.1
|
SPAG1
|
sperm associated antigen 1 |
| chr2_-_175870085 | 7.50 |
ENST00000409156.3
|
CHN1
|
chimerin 1 |
| chr22_+_46692638 | 7.49 |
ENST00000454366.1
|
GTSE1
|
G-2 and S-phase expressed 1 |
| chr6_+_80714332 | 7.48 |
ENST00000502580.1
ENST00000511260.1 |
TTK
|
TTK protein kinase |
| chr2_-_202316169 | 7.48 |
ENST00000430254.1
|
TRAK2
|
trafficking protein, kinesin binding 2 |
| chr4_-_39529180 | 7.46 |
ENST00000515021.1
ENST00000510490.1 ENST00000316423.6 |
UGDH
|
UDP-glucose 6-dehydrogenase |
| chr11_+_45168182 | 7.46 |
ENST00000526442.1
|
PRDM11
|
PR domain containing 11 |
| chr7_+_94139105 | 7.44 |
ENST00000297273.4
|
CASD1
|
CAS1 domain containing 1 |
| chr16_-_28223229 | 7.40 |
ENST00000566073.1
|
XPO6
|
exportin 6 |
| chr2_+_172949468 | 7.39 |
ENST00000361609.4
ENST00000469444.2 |
DLX1
|
distal-less homeobox 1 |
| chr2_+_27070964 | 7.38 |
ENST00000288699.6
|
DPYSL5
|
dihydropyrimidinase-like 5 |
| chr17_+_78075324 | 7.37 |
ENST00000570803.1
|
GAA
|
glucosidase, alpha; acid |
| chr20_-_4804244 | 7.36 |
ENST00000379400.3
|
RASSF2
|
Ras association (RalGDS/AF-6) domain family member 2 |
| chr2_-_234763105 | 7.35 |
ENST00000454020.1
|
HJURP
|
Holliday junction recognition protein |
| chr14_-_53417732 | 7.34 |
ENST00000399304.3
ENST00000395631.2 ENST00000341590.3 ENST00000343279.4 |
FERMT2
|
fermitin family member 2 |
| chr11_+_74204883 | 7.34 |
ENST00000528481.1
|
POLD3
|
polymerase (DNA-directed), delta 3, accessory subunit |
| chr22_-_36902522 | 7.33 |
ENST00000397223.4
|
FOXRED2
|
FAD-dependent oxidoreductase domain containing 2 |
| chr2_+_74881432 | 7.28 |
ENST00000453930.1
|
SEMA4F
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4F |
| chr12_-_124456598 | 7.27 |
ENST00000539761.1
ENST00000539551.1 |
CCDC92
|
coiled-coil domain containing 92 |
| chr17_-_30186328 | 7.27 |
ENST00000302362.6
|
COPRS
|
coordinator of PRMT5, differentiation stimulator |
| chr9_-_134615326 | 7.26 |
ENST00000438647.1
|
RAPGEF1
|
Rap guanine nucleotide exchange factor (GEF) 1 |
| chr7_+_106685079 | 7.22 |
ENST00000265717.4
|
PRKAR2B
|
protein kinase, cAMP-dependent, regulatory, type II, beta |
| chr11_-_6440624 | 7.20 |
ENST00000311051.3
|
APBB1
|
amyloid beta (A4) precursor protein-binding, family B, member 1 (Fe65) |
| chr12_-_133263893 | 7.19 |
ENST00000535270.1
ENST00000320574.5 |
POLE
|
polymerase (DNA directed), epsilon, catalytic subunit |
| chr2_+_11295498 | 7.19 |
ENST00000295083.3
ENST00000441908.2 |
PQLC3
|
PQ loop repeat containing 3 |
Network of associatons between targets according to the STRING database.
First level regulatory network of ZNF711_TFAP2A_TFAP2D
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.3 | 21.8 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 6.5 | 26.1 | GO:0060032 | notochord regression(GO:0060032) |
| 6.4 | 19.3 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 6.4 | 19.3 | GO:0060829 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 6.1 | 6.1 | GO:0033598 | mammary gland epithelial cell proliferation(GO:0033598) |
| 6.0 | 23.9 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 5.8 | 17.4 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 5.7 | 28.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 5.6 | 16.9 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 5.6 | 16.7 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 5.6 | 5.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 5.3 | 15.8 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 4.9 | 14.8 | GO:0007387 | anterior compartment pattern formation(GO:0007387) posterior compartment specification(GO:0007388) |
| 4.7 | 28.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 4.7 | 14.2 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 4.7 | 14.0 | GO:0015729 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 4.6 | 27.7 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 4.6 | 18.3 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 4.6 | 22.8 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 4.5 | 17.9 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 4.4 | 17.4 | GO:1904481 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 4.3 | 25.9 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 4.3 | 17.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 4.2 | 12.5 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 4.1 | 20.7 | GO:0015862 | uridine transport(GO:0015862) |
| 4.1 | 12.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 4.1 | 12.2 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 4.1 | 20.3 | GO:1903613 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 4.1 | 16.2 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 4.0 | 11.9 | GO:0007037 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 3.9 | 11.8 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 3.8 | 3.8 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 3.8 | 23.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 3.8 | 11.4 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 3.8 | 11.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 3.8 | 11.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 3.7 | 29.7 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 3.7 | 33.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 3.6 | 43.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 3.6 | 3.6 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 3.5 | 21.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 3.5 | 10.6 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 3.5 | 10.6 | GO:0060929 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 3.5 | 17.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 3.5 | 14.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 3.5 | 20.9 | GO:0061441 | renal artery morphogenesis(GO:0061441) |
| 3.5 | 20.8 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 3.5 | 10.4 | GO:1902823 | negative regulation of late endosome to lysosome transport(GO:1902823) |
| 3.4 | 10.3 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 3.4 | 3.4 | GO:0048377 | lateral mesodermal cell fate commitment(GO:0048372) lateral mesodermal cell fate specification(GO:0048377) regulation of lateral mesodermal cell fate specification(GO:0048378) |
| 3.4 | 10.1 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 3.3 | 10.0 | GO:0060623 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) regulation of chromosome condensation(GO:0060623) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 3.3 | 9.9 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 3.3 | 9.8 | GO:0021893 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 3.2 | 13.0 | GO:0016598 | protein arginylation(GO:0016598) |
| 3.2 | 16.0 | GO:0006045 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 3.2 | 38.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 3.2 | 15.9 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 3.2 | 28.7 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 3.2 | 6.3 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 3.1 | 34.6 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 3.1 | 18.8 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
| 3.1 | 30.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 3.1 | 12.3 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 3.1 | 9.2 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 3.1 | 3.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 3.1 | 12.3 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 3.1 | 12.3 | GO:0006272 | leading strand elongation(GO:0006272) |
| 3.0 | 12.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 3.0 | 9.0 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 3.0 | 8.9 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 3.0 | 8.9 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 3.0 | 11.9 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 3.0 | 14.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 3.0 | 8.9 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 2.9 | 5.8 | GO:0019520 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 2.9 | 11.7 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 2.9 | 8.7 | GO:0000921 | septin ring assembly(GO:0000921) septin ring organization(GO:0031106) |
| 2.9 | 11.6 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 2.9 | 11.6 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 2.9 | 5.7 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 2.8 | 11.4 | GO:0008355 | olfactory learning(GO:0008355) |
| 2.8 | 8.5 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 2.8 | 36.8 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 2.8 | 2.8 | GO:0007521 | muscle cell fate determination(GO:0007521) |
| 2.8 | 17.0 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 2.8 | 14.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 2.8 | 114.7 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 2.8 | 16.8 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 2.8 | 11.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 2.8 | 8.4 | GO:0070632 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 2.8 | 8.4 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 2.8 | 11.1 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 2.7 | 8.2 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 2.7 | 2.7 | GO:0044346 | fibroblast apoptotic process(GO:0044346) regulation of fibroblast apoptotic process(GO:2000269) negative regulation of fibroblast apoptotic process(GO:2000270) |
| 2.7 | 2.7 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 2.7 | 8.2 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 2.7 | 8.2 | GO:0090427 | activation of meiosis(GO:0090427) |
| 2.7 | 24.5 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 2.7 | 51.5 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 2.7 | 13.5 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 2.7 | 16.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 2.7 | 8.1 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 2.7 | 8.1 | GO:0098939 | dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 2.6 | 10.6 | GO:0072299 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 2.6 | 10.4 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 2.6 | 10.3 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 2.6 | 7.8 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 2.6 | 12.9 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 2.6 | 10.3 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 2.6 | 23.1 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 2.6 | 15.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 2.6 | 7.7 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 2.5 | 17.8 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 2.5 | 5.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 2.5 | 12.4 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 2.5 | 19.8 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 2.5 | 9.9 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 2.5 | 2.5 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 2.4 | 19.5 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 2.4 | 4.9 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 2.4 | 9.7 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 2.4 | 4.8 | GO:0051958 | methotrexate transport(GO:0051958) |
| 2.4 | 12.0 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 2.4 | 14.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 2.4 | 7.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 2.4 | 7.1 | GO:0060931 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 2.3 | 9.4 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 2.3 | 2.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 2.3 | 16.4 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 2.3 | 2.3 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 2.3 | 7.0 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 2.3 | 2.3 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.3 | 4.7 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 2.3 | 7.0 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
| 2.3 | 2.3 | GO:0031081 | nuclear pore distribution(GO:0031081) nuclear pore localization(GO:0051664) |
| 2.3 | 9.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 2.3 | 4.6 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 2.3 | 9.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 2.3 | 43.4 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 2.3 | 4.6 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 2.3 | 11.3 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 2.3 | 4.5 | GO:0034766 | negative regulation of ion transmembrane transport(GO:0034766) |
| 2.3 | 6.8 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 2.2 | 26.4 | GO:0009304 | tRNA transcription(GO:0009304) |
| 2.2 | 8.8 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 2.2 | 6.6 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 2.2 | 6.6 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 2.2 | 8.8 | GO:1905044 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 2.2 | 2.2 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 2.2 | 8.7 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 2.2 | 6.5 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 2.2 | 10.8 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 2.2 | 10.8 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 2.2 | 6.5 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 2.2 | 8.6 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 2.2 | 10.8 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 2.1 | 10.7 | GO:0009111 | vitamin catabolic process(GO:0009111) |
| 2.1 | 8.6 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 2.1 | 85.6 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 2.1 | 4.3 | GO:0009149 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 2.1 | 8.5 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 2.1 | 6.4 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 2.1 | 8.5 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 2.1 | 8.5 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 2.1 | 16.9 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 2.1 | 8.4 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 2.1 | 25.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 2.1 | 29.5 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 2.1 | 10.5 | GO:1903971 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 2.1 | 14.6 | GO:0097473 | cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 2.1 | 6.2 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 2.1 | 2.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 2.1 | 12.4 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 2.1 | 18.7 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 2.1 | 16.5 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 2.1 | 8.2 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 2.1 | 14.4 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) dUMP metabolic process(GO:0046078) |
| 2.1 | 6.2 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 2.1 | 4.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 2.1 | 8.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 2.0 | 6.1 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 2.0 | 2.0 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 2.0 | 6.1 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 2.0 | 4.1 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) |
| 2.0 | 6.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 2.0 | 14.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 2.0 | 6.1 | GO:0060733 | regulation of eIF2 alpha phosphorylation by amino acid starvation(GO:0060733) regulation of translational initiation in response to starvation(GO:0071262) positive regulation of translational initiation in response to starvation(GO:0071264) |
| 2.0 | 6.0 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 2.0 | 28.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 2.0 | 12.1 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 2.0 | 14.1 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 2.0 | 8.0 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 2.0 | 6.0 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 2.0 | 20.0 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 2.0 | 17.9 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 2.0 | 7.9 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 2.0 | 13.9 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 2.0 | 17.7 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 2.0 | 7.9 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 2.0 | 11.7 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 2.0 | 3.9 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 2.0 | 3.9 | GO:0061110 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 2.0 | 3.9 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 1.9 | 5.8 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 1.9 | 5.8 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) |
| 1.9 | 3.9 | GO:0070166 | enamel mineralization(GO:0070166) |
| 1.9 | 13.5 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 1.9 | 3.8 | GO:1903826 | arginine transport(GO:0015809) arginine transmembrane transport(GO:1903826) |
| 1.9 | 1.9 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 1.9 | 11.4 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 1.9 | 15.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 1.9 | 13.3 | GO:0060356 | leucine import(GO:0060356) |
| 1.9 | 9.5 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.9 | 3.8 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 1.9 | 1.9 | GO:0072014 | proximal tubule development(GO:0072014) |
| 1.9 | 15.0 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 1.9 | 15.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 1.9 | 9.4 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 1.9 | 13.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 1.9 | 22.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 1.9 | 1.9 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 1.8 | 7.4 | GO:0061290 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 1.8 | 7.4 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 1.8 | 7.4 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 1.8 | 12.9 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 1.8 | 12.9 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 1.8 | 11.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.8 | 1.8 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 1.8 | 9.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 1.8 | 1.8 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 1.8 | 3.6 | GO:0051795 | positive regulation of catagen(GO:0051795) |
| 1.8 | 7.2 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 1.8 | 7.2 | GO:0006781 | succinyl-CoA pathway(GO:0006781) |
| 1.8 | 7.2 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 1.8 | 50.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 1.8 | 10.8 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.8 | 5.4 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
| 1.8 | 5.4 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 1.8 | 10.8 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.8 | 21.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 1.8 | 5.3 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 1.8 | 19.6 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 1.8 | 10.6 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 1.8 | 17.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 1.8 | 1.8 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 1.8 | 12.3 | GO:0019075 | virus maturation(GO:0019075) |
| 1.8 | 7.0 | GO:0097068 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 1.8 | 3.5 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 1.8 | 5.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 1.8 | 1.8 | GO:0007418 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 1.7 | 5.2 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 1.7 | 19.2 | GO:0007144 | female meiosis I(GO:0007144) |
| 1.7 | 15.7 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) |
| 1.7 | 47.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 1.7 | 1.7 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 1.7 | 5.2 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 1.7 | 6.9 | GO:0061582 | intestinal epithelial cell migration(GO:0061582) |
| 1.7 | 5.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 1.7 | 13.7 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 1.7 | 1.7 | GO:0007051 | spindle organization(GO:0007051) |
| 1.7 | 8.5 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 1.7 | 11.9 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.7 | 8.5 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 1.7 | 3.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 1.7 | 1.7 | GO:0031427 | response to methotrexate(GO:0031427) |
| 1.7 | 8.4 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 1.7 | 5.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 1.7 | 1.7 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 1.7 | 20.0 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 1.7 | 10.0 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 1.7 | 5.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 1.7 | 10.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 1.7 | 1.7 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
| 1.7 | 13.3 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 1.6 | 11.5 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 1.6 | 6.5 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 1.6 | 14.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 1.6 | 13.0 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 1.6 | 4.9 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 1.6 | 4.9 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 1.6 | 21.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 1.6 | 6.5 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 1.6 | 8.1 | GO:0046931 | pore complex assembly(GO:0046931) |
| 1.6 | 3.2 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 1.6 | 4.8 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 1.6 | 3.2 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 1.6 | 4.8 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 1.6 | 6.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 1.6 | 4.8 | GO:1901563 | response to camptothecin(GO:1901563) |
| 1.6 | 9.6 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 1.6 | 8.0 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 1.6 | 3.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 1.6 | 4.8 | GO:0019082 | viral protein processing(GO:0019082) nerve growth factor production(GO:0032902) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 1.6 | 33.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 1.6 | 11.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 1.6 | 50.7 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 1.6 | 3.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 1.6 | 4.7 | GO:1903567 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 1.6 | 1.6 | GO:0090212 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 1.6 | 3.1 | GO:0003285 | septum secundum development(GO:0003285) |
| 1.6 | 4.7 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 1.6 | 6.2 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 1.6 | 7.8 | GO:1902904 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 1.6 | 10.9 | GO:0070527 | platelet aggregation(GO:0070527) |
| 1.6 | 4.7 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 1.6 | 4.7 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
| 1.5 | 6.2 | GO:0060178 | regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 1.5 | 4.6 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 1.5 | 4.6 | GO:0052151 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 1.5 | 3.1 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 1.5 | 9.3 | GO:0035624 | receptor transactivation(GO:0035624) |
| 1.5 | 1.5 | GO:0061511 | centriole elongation(GO:0061511) |
| 1.5 | 9.2 | GO:1903412 | response to bile acid(GO:1903412) |
| 1.5 | 4.6 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 1.5 | 12.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 1.5 | 1.5 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 1.5 | 3.0 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 1.5 | 6.0 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 1.5 | 17.9 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 1.5 | 13.4 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 1.5 | 6.0 | GO:0015827 | tryptophan transport(GO:0015827) |
| 1.5 | 7.4 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
| 1.5 | 1.5 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 1.5 | 8.9 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 1.5 | 3.0 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
| 1.5 | 7.4 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 1.5 | 5.9 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 1.5 | 23.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 1.5 | 5.9 | GO:0072255 | metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 1.5 | 8.9 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.5 | 1.5 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 1.5 | 1.5 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) |
| 1.5 | 22.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 1.5 | 7.3 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
| 1.5 | 16.0 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 1.4 | 20.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 1.4 | 7.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 1.4 | 14.3 | GO:0046398 | UDP-glucuronate metabolic process(GO:0046398) |
| 1.4 | 4.3 | GO:0070666 | regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 1.4 | 5.7 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 1.4 | 8.6 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 1.4 | 4.3 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 1.4 | 5.7 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 1.4 | 8.5 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 1.4 | 11.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 1.4 | 4.2 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 1.4 | 4.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 1.4 | 4.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 1.4 | 1.4 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 1.4 | 7.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 1.4 | 5.6 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 1.4 | 19.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 1.4 | 2.8 | GO:0072144 | glomerular mesangial cell development(GO:0072144) |
| 1.4 | 8.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 1.4 | 4.2 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 1.4 | 1.4 | GO:0014855 | striated muscle cell proliferation(GO:0014855) |
| 1.4 | 4.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 1.4 | 2.8 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 1.4 | 6.9 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 1.4 | 1.4 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 1.4 | 11.0 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 1.4 | 12.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 1.4 | 8.2 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 1.4 | 5.5 | GO:0014002 | astrocyte development(GO:0014002) |
| 1.4 | 5.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 1.4 | 21.9 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 1.4 | 12.3 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 1.4 | 6.8 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 1.3 | 4.0 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 1.3 | 32.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 1.3 | 4.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 1.3 | 10.7 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 1.3 | 1.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 1.3 | 4.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 1.3 | 1.3 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 1.3 | 17.3 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 1.3 | 14.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 1.3 | 21.3 | GO:0044351 | macropinocytosis(GO:0044351) |
| 1.3 | 1.3 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 1.3 | 11.9 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 1.3 | 5.3 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 1.3 | 6.6 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 1.3 | 3.9 | GO:0003249 | cell proliferation involved in heart valve morphogenesis(GO:0003249) regulation of cell proliferation involved in heart valve morphogenesis(GO:0003250) |
| 1.3 | 14.4 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 1.3 | 3.9 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 1.3 | 5.2 | GO:0035669 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 1.3 | 1.3 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 1.3 | 17.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 1.3 | 1.3 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
| 1.3 | 11.8 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 1.3 | 13.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 1.3 | 14.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 1.3 | 2.6 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 1.3 | 28.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 1.3 | 2.6 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 1.3 | 14.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 1.3 | 1.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 1.3 | 6.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 1.3 | 5.1 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 1.3 | 1.3 | GO:0052150 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) modulation by symbiont of host apoptotic process(GO:0052150) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 1.3 | 7.7 | GO:0030047 | actin modification(GO:0030047) |
| 1.3 | 5.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 1.3 | 17.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 1.3 | 3.8 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 1.3 | 8.9 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 1.3 | 2.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 1.3 | 1.3 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 1.3 | 5.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 1.3 | 11.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 1.3 | 1.3 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 1.3 | 3.8 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 1.3 | 1.3 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
| 1.3 | 2.5 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 1.3 | 2.5 | GO:0010159 | specification of organ position(GO:0010159) |
| 1.3 | 21.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 1.2 | 2.5 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 1.2 | 6.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 1.2 | 8.7 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 1.2 | 5.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 1.2 | 13.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 1.2 | 2.5 | GO:1903516 | regulation of single strand break repair(GO:1903516) |
| 1.2 | 4.9 | GO:0018277 | protein deamination(GO:0018277) |
| 1.2 | 8.6 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 1.2 | 2.5 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 1.2 | 6.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 1.2 | 1.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 1.2 | 12.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 1.2 | 2.4 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 1.2 | 7.3 | GO:0070541 | response to platinum ion(GO:0070541) |
| 1.2 | 17.0 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 1.2 | 2.4 | GO:0043385 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 1.2 | 3.6 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 1.2 | 2.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 1.2 | 8.5 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 1.2 | 2.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 1.2 | 3.6 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 1.2 | 32.6 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 1.2 | 1.2 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 1.2 | 10.8 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 1.2 | 1.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 1.2 | 6.0 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 1.2 | 3.6 | GO:1903515 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 1.2 | 4.8 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 1.2 | 22.7 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 1.2 | 2.4 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 1.2 | 4.8 | GO:1990569 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 1.2 | 1.2 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 1.2 | 5.9 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 1.2 | 3.6 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 1.2 | 10.6 | GO:0030242 | pexophagy(GO:0030242) |
| 1.2 | 14.1 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 1.2 | 9.4 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) |
| 1.2 | 4.7 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 1.2 | 25.8 | GO:0032060 | bleb assembly(GO:0032060) |
| 1.2 | 10.5 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 1.2 | 3.5 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 1.2 | 1.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 1.2 | 4.7 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 1.2 | 7.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 1.2 | 7.0 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 1.2 | 4.6 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 1.2 | 9.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 1.2 | 5.8 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 1.1 | 37.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 1.1 | 5.7 | GO:0032218 | riboflavin transport(GO:0032218) |
| 1.1 | 1.1 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 1.1 | 3.4 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 1.1 | 1.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 1.1 | 3.4 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 1.1 | 7.9 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 1.1 | 2.3 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 1.1 | 4.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 1.1 | 6.8 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 1.1 | 14.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 1.1 | 4.5 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 1.1 | 2.2 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 1.1 | 2.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 1.1 | 7.8 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 1.1 | 5.6 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 1.1 | 1.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 1.1 | 5.6 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 1.1 | 4.4 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 1.1 | 1.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 1.1 | 12.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 1.1 | 14.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 1.1 | 9.9 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 1.1 | 1.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 1.1 | 4.4 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 1.1 | 7.7 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 1.1 | 5.5 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 1.1 | 4.4 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 1.1 | 1.1 | GO:0019563 | glycerol catabolic process(GO:0019563) |
| 1.1 | 2.2 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 1.1 | 17.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 1.1 | 1.1 | GO:0060956 | cardiac endothelial cell differentiation(GO:0003348) endocardial cell differentiation(GO:0060956) |
| 1.1 | 4.4 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 1.1 | 1.1 | GO:1901888 | regulation of cell junction assembly(GO:1901888) |
| 1.1 | 2.2 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 1.1 | 3.3 | GO:0061743 | motor learning(GO:0061743) |
| 1.1 | 1.1 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 1.1 | 3.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 1.1 | 1.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 1.1 | 172.5 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 1.1 | 1.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 1.1 | 3.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 1.1 | 5.4 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 1.1 | 17.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 1.1 | 2.1 | GO:0060488 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.1 | 1.1 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) |
| 1.1 | 2.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 1.1 | 2.1 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 1.1 | 10.7 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 1.1 | 3.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 1.1 | 3.2 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 1.1 | 15.9 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 1.1 | 52.0 | GO:0007077 | mitotic nuclear envelope disassembly(GO:0007077) |
| 1.1 | 5.3 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) peptidyl-glutamine modification(GO:0018199) isopeptide cross-linking(GO:0018262) |
| 1.1 | 22.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 1.1 | 21.1 | GO:0000338 | protein deneddylation(GO:0000338) |
| 1.1 | 3.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 1.1 | 21.1 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 1.1 | 1.1 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 1.0 | 6.3 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 1.0 | 3.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 1.0 | 7.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 1.0 | 2.1 | GO:1990641 | response to iron ion starvation(GO:1990641) |
| 1.0 | 3.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 1.0 | 28.1 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 1.0 | 2.1 | GO:0021699 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 1.0 | 25.0 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 1.0 | 9.3 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 1.0 | 10.4 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 1.0 | 9.3 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 1.0 | 17.6 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 1.0 | 8.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 1.0 | 3.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 1.0 | 2.1 | GO:1990180 | mitochondrial tRNA 3'-end processing(GO:1990180) |
| 1.0 | 6.2 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 1.0 | 4.1 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 1.0 | 7.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 1.0 | 27.5 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 1.0 | 3.0 | GO:0097187 | dentinogenesis(GO:0097187) |
| 1.0 | 4.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 1.0 | 1.0 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 1.0 | 2.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 1.0 | 10.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 1.0 | 2.0 | GO:0003165 | Purkinje myocyte development(GO:0003165) |
| 1.0 | 1.0 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 1.0 | 3.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 1.0 | 4.0 | GO:2001162 | regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 1.0 | 2.0 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 1.0 | 4.9 | GO:0001554 | luteolysis(GO:0001554) |
| 1.0 | 2.0 | GO:0009644 | response to high light intensity(GO:0009644) |
| 1.0 | 5.9 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 1.0 | 6.9 | GO:1902739 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 1.0 | 14.8 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 1.0 | 12.8 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 1.0 | 3.9 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 1.0 | 10.8 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 1.0 | 19.7 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 1.0 | 11.8 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 1.0 | 2.9 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 1.0 | 9.8 | GO:0043090 | amino acid import(GO:0043090) |
| 1.0 | 2.0 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 1.0 | 2.9 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 1.0 | 18.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 1.0 | 7.7 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 1.0 | 5.8 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 1.0 | 3.9 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 1.0 | 29.9 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 1.0 | 1.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 1.0 | 1.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
| 1.0 | 14.4 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 1.0 | 10.5 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 1.0 | 20.1 | GO:0014870 | response to muscle inactivity(GO:0014870) |
| 1.0 | 2.9 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 1.0 | 3.8 | GO:1903382 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.9 | 14.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.9 | 0.9 | GO:0032886 | regulation of microtubule-based process(GO:0032886) |
| 0.9 | 2.8 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.9 | 7.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.9 | 2.8 | GO:0070781 | response to biotin(GO:0070781) |
| 0.9 | 2.8 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.9 | 2.8 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.9 | 0.9 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.9 | 2.8 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.9 | 0.9 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.9 | 4.7 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.9 | 9.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.9 | 30.6 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.9 | 1.8 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.9 | 4.6 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.9 | 6.5 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.9 | 9.2 | GO:1904851 | regulation of establishment of protein localization to chromosome(GO:0070202) regulation of establishment of protein localization to telomere(GO:0070203) positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.9 | 10.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.9 | 2.8 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.9 | 19.3 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.9 | 20.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.9 | 2.7 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.9 | 3.6 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.9 | 10.0 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.9 | 8.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.9 | 0.9 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.9 | 15.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.9 | 0.9 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.9 | 13.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.9 | 2.7 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.9 | 4.5 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.9 | 2.7 | GO:0008589 | regulation of smoothened signaling pathway(GO:0008589) |
| 0.9 | 1.8 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.9 | 4.5 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.9 | 9.8 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.9 | 7.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.9 | 8.9 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.9 | 0.9 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
| 0.9 | 1.8 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.9 | 5.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.9 | 1.8 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.9 | 3.5 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.9 | 13.2 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.9 | 3.5 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
| 0.9 | 2.6 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.9 | 2.6 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.9 | 3.5 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.9 | 0.9 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.9 | 3.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.9 | 2.6 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.9 | 1.7 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.9 | 3.5 | GO:0050732 | negative regulation of peptidyl-tyrosine phosphorylation(GO:0050732) |
| 0.9 | 4.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.9 | 0.9 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.9 | 6.9 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.9 | 1.7 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.9 | 3.5 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.9 | 2.6 | GO:0015822 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.9 | 2.6 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.9 | 9.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.9 | 6.9 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.9 | 2.6 | GO:0035572 | N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.9 | 6.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.9 | 2.6 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.9 | 6.8 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.9 | 6.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.8 | 0.8 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.8 | 9.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.8 | 6.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.8 | 0.8 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.8 | 0.8 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.8 | 8.4 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.8 | 7.6 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.8 | 4.2 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.8 | 2.5 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.8 | 35.3 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.8 | 2.5 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.8 | 2.5 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
| 0.8 | 6.7 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.8 | 24.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.8 | 3.3 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.8 | 4.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.8 | 6.7 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.8 | 3.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.8 | 1.7 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.8 | 4.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.8 | 0.8 | GO:0072166 | posterior mesonephric tubule development(GO:0072166) |
| 0.8 | 15.7 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.8 | 5.8 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.8 | 1.7 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.8 | 0.8 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.8 | 2.5 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.8 | 8.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.8 | 23.8 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.8 | 4.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.8 | 2.5 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.8 | 11.4 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.8 | 4.1 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.8 | 3.3 | GO:0031455 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.8 | 2.4 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.8 | 8.9 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.8 | 7.3 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.8 | 4.9 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.8 | 8.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.8 | 2.4 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.8 | 3.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.8 | 2.4 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.8 | 8.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.8 | 39.3 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.8 | 3.2 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.8 | 13.5 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.8 | 10.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.8 | 8.0 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.8 | 3.2 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.8 | 2.4 | GO:0009744 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.8 | 0.8 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
| 0.8 | 3.2 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.8 | 4.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.8 | 15.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.8 | 6.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.8 | 0.8 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.8 | 0.8 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.8 | 0.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.8 | 2.4 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.8 | 3.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.8 | 0.8 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.8 | 5.5 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.8 | 1.6 | GO:0007135 | meiosis II(GO:0007135) |
| 0.8 | 1.6 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.8 | 3.9 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.8 | 11.7 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.8 | 11.7 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.8 | 13.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.8 | 4.7 | GO:2001295 | malonyl-CoA metabolic process(GO:2001293) malonyl-CoA biosynthetic process(GO:2001295) |
| 0.8 | 2.3 | GO:0001993 | regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) |
| 0.8 | 3.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.8 | 0.8 | GO:0010827 | regulation of glucose transport(GO:0010827) |
| 0.8 | 2.3 | GO:2001112 | negative regulation of hepatocyte growth factor receptor signaling pathway(GO:1902203) regulation of cellular response to hepatocyte growth factor stimulus(GO:2001112) negative regulation of cellular response to hepatocyte growth factor stimulus(GO:2001113) |
| 0.8 | 10.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.8 | 1.5 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.8 | 2.3 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.8 | 5.4 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.8 | 3.1 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.8 | 23.0 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.8 | 4.6 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.8 | 6.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.8 | 4.5 | GO:0050893 | sensory processing(GO:0050893) |
| 0.8 | 4.5 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.8 | 0.8 | GO:1902616 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.8 | 3.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) |
| 0.8 | 4.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.8 | 20.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.8 | 3.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.8 | 7.5 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.8 | 3.8 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.8 | 3.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.7 | 0.7 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
| 0.7 | 7.5 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.7 | 6.7 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.7 | 1.5 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.7 | 13.4 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.7 | 4.4 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.7 | 3.0 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.7 | 8.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.7 | 7.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.7 | 4.4 | GO:1901569 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.7 | 5.2 | GO:1902731 | negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.7 | 9.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.7 | 15.4 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.7 | 11.0 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.7 | 7.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.7 | 4.4 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.7 | 5.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.7 | 2.9 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.7 | 8.7 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.7 | 0.7 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.7 | 14.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.7 | 8.7 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.7 | 3.6 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.7 | 9.4 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.7 | 2.9 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.7 | 0.7 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) |
| 0.7 | 2.2 | GO:0033488 | cholesterol biosynthetic process via 24,25-dihydrolanosterol(GO:0033488) |
| 0.7 | 1.4 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.7 | 2.2 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.7 | 2.9 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.7 | 20.8 | GO:0072663 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.7 | 2.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.7 | 26.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.7 | 5.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.7 | 0.7 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.7 | 5.7 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.7 | 3.5 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.7 | 0.7 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.7 | 2.1 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.7 | 30.2 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.7 | 0.7 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.7 | 6.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.7 | 7.7 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.7 | 3.5 | GO:0003343 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.7 | 4.1 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.7 | 5.5 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.7 | 6.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.7 | 1.4 | GO:0015883 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.7 | 4.8 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.7 | 0.7 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.7 | 6.1 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.7 | 2.0 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.7 | 0.7 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.7 | 20.4 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.7 | 8.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.7 | 3.4 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.7 | 6.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.7 | 0.7 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.7 | 2.7 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.7 | 3.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.7 | 1.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.7 | 16.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.7 | 32.4 | GO:0051983 | regulation of chromosome segregation(GO:0051983) |
| 0.7 | 9.4 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.7 | 2.7 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.7 | 1.3 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.7 | 4.7 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.7 | 3.3 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.7 | 1.3 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.7 | 2.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.7 | 8.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.7 | 8.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.7 | 1.3 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.7 | 2.6 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.7 | 3.3 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
| 0.7 | 2.0 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.7 | 17.8 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.7 | 3.9 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.7 | 2.0 | GO:0060437 | lung growth(GO:0060437) |
| 0.7 | 3.3 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.7 | 0.7 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.7 | 10.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.7 | 7.2 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.7 | 7.8 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.6 | 1.9 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.6 | 1.9 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.6 | 22.0 | GO:0046710 | GDP metabolic process(GO:0046710) |
| 0.6 | 14.8 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.6 | 1.3 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.6 | 3.9 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.6 | 7.0 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.6 | 1.3 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.6 | 2.5 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.6 | 3.2 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.6 | 4.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.6 | 1.9 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.6 | 1.3 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.6 | 9.5 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.6 | 0.6 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.6 | 1.9 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.6 | 0.6 | GO:0035989 | tendon development(GO:0035989) |
| 0.6 | 5.6 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.6 | 5.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.6 | 7.5 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.6 | 4.3 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.6 | 0.6 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.6 | 3.1 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.6 | 1.8 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.6 | 1.8 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.6 | 0.6 | GO:0006983 | ER overload response(GO:0006983) |
| 0.6 | 1.2 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.6 | 7.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.6 | 2.5 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.6 | 0.6 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.6 | 1.2 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
| 0.6 | 2.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.6 | 2.4 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.6 | 1.8 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.6 | 1.8 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.6 | 3.6 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.6 | 3.0 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.6 | 4.8 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.6 | 3.0 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.6 | 12.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 0.6 | 2.4 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.6 | 9.0 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.6 | 1.2 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.6 | 2.4 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.6 | 0.6 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
| 0.6 | 1.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.6 | 1.2 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.6 | 1.2 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.6 | 9.4 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.6 | 0.6 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.6 | 5.9 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.6 | 6.5 | GO:0030091 | protein repair(GO:0030091) |
| 0.6 | 2.3 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.6 | 2.9 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.6 | 0.6 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.6 | 1.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.6 | 10.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.6 | 8.8 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.6 | 1.8 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
| 0.6 | 2.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.6 | 1.2 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.6 | 9.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.6 | 4.6 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.6 | 1.7 | GO:0061461 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.6 | 2.3 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.6 | 1.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.6 | 2.3 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.6 | 7.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.6 | 7.4 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.6 | 0.6 | GO:0051105 | regulation of DNA ligation(GO:0051105) |
| 0.6 | 1.7 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
| 0.6 | 1.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.6 | 1.1 | GO:0071484 | cellular response to light intensity(GO:0071484) |
| 0.6 | 2.3 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.6 | 1.7 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.6 | 1.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.6 | 1.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.6 | 1.7 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.6 | 8.4 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.6 | 1.7 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.6 | 3.3 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.6 | 1.7 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.6 | 6.7 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.6 | 9.4 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.6 | 0.6 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.5 | 2.7 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.5 | 3.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.5 | 2.2 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.5 | 17.5 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
| 0.5 | 1.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.5 | 4.9 | GO:0019049 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.5 | 3.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.5 | 2.7 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.5 | 2.7 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.5 | 6.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.5 | 1.6 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.5 | 22.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.5 | 1.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.5 | 5.9 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.5 | 6.4 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.5 | 2.7 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.5 | 11.7 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.5 | 1.6 | GO:0046022 | positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.5 | 8.0 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.5 | 2.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.5 | 1.6 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.5 | 3.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.5 | 12.1 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.5 | 3.7 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.5 | 2.6 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.5 | 0.5 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.5 | 12.1 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.5 | 1.6 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.5 | 4.2 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.5 | 2.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.5 | 20.9 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.5 | 1.6 | GO:0042058 | regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.5 | 4.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.5 | 1.6 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.5 | 1.0 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.5 | 2.6 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.5 | 2.6 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.5 | 16.5 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.5 | 3.1 | GO:0016246 | RNA interference(GO:0016246) |
| 0.5 | 2.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.5 | 1.0 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.5 | 9.6 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.5 | 5.0 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.5 | 1.5 | GO:0030806 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.5 | 2.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 0.5 | 8.0 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.5 | 4.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.5 | 7.5 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.5 | 6.5 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.5 | 1.5 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.5 | 1.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.5 | 3.0 | GO:2000234 | regulation of ribosome biogenesis(GO:0090069) positive regulation of ribosome biogenesis(GO:0090070) regulation of rRNA processing(GO:2000232) positive regulation of rRNA processing(GO:2000234) |
| 0.5 | 1.0 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.5 | 1.5 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.5 | 0.5 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.5 | 2.0 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.5 | 1.5 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.5 | 1.0 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.5 | 2.5 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.5 | 0.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.5 | 7.9 | GO:0006664 | glycolipid metabolic process(GO:0006664) liposaccharide metabolic process(GO:1903509) |
| 0.5 | 3.0 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.5 | 2.0 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.5 | 0.5 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.5 | 2.9 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.5 | 2.9 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.5 | 4.4 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.5 | 2.0 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.5 | 2.0 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.5 | 22.9 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.5 | 9.7 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.5 | 1.5 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.5 | 1.9 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.5 | 6.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.5 | 1.9 | GO:0050992 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.5 | 1.9 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.5 | 5.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.5 | 1.9 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.5 | 1.0 | GO:0022616 | DNA strand elongation(GO:0022616) |
| 0.5 | 1.4 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.5 | 1.4 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.5 | 6.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.5 | 0.5 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.5 | 0.5 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.5 | 2.4 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.5 | 4.7 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.5 | 1.4 | GO:0015820 | leucine transport(GO:0015820) |
| 0.5 | 1.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.5 | 1.9 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.5 | 9.4 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.5 | 1.4 | GO:1990874 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.5 | 0.9 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.5 | 1.9 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.5 | 0.9 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.5 | 0.5 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) |
| 0.5 | 0.5 | GO:1902186 | regulation of viral release from host cell(GO:1902186) negative regulation of viral release from host cell(GO:1902187) |
| 0.5 | 0.9 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.5 | 3.3 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.5 | 0.9 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.5 | 5.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.5 | 1.9 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.5 | 8.8 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.5 | 5.5 | GO:0015886 | heme transport(GO:0015886) |
| 0.5 | 5.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.5 | 1.8 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.5 | 0.9 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.5 | 1.4 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.5 | 0.9 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
| 0.5 | 1.4 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.5 | 9.6 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.5 | 4.6 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.5 | 4.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.5 | 2.7 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.5 | 31.4 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) |
| 0.5 | 0.5 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.5 | 31.8 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.5 | 8.2 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.5 | 0.5 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
| 0.5 | 5.9 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.5 | 1.8 | GO:0051145 | smooth muscle cell differentiation(GO:0051145) |
| 0.5 | 3.6 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.5 | 0.9 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.4 | 4.9 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.4 | 6.3 | GO:0071897 | DNA biosynthetic process(GO:0071897) |
| 0.4 | 11.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.4 | 0.4 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.4 | 1.8 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.4 | 6.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.4 | 4.4 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
| 0.4 | 1.8 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.4 | 4.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.4 | 1.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.4 | 1.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.4 | 5.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.4 | 1.3 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
| 0.4 | 2.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.4 | 0.9 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.4 | 0.9 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.4 | 1.8 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.4 | 11.8 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.4 | 2.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.4 | 3.1 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.4 | 1.7 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.4 | 8.3 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.4 | 40.5 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.4 | 1.7 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.4 | 0.9 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.4 | 1.3 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.4 | 12.5 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.4 | 1.3 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
| 0.4 | 0.9 | GO:0097466 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.4 | 2.6 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.4 | 0.4 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.4 | 13.7 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
| 0.4 | 3.0 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.4 | 7.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.4 | 2.5 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.4 | 6.7 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.4 | 1.3 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.4 | 0.4 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.4 | 2.9 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.4 | 0.8 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.4 | 7.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.4 | 1.2 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.4 | 0.4 | GO:0098905 | regulation of bundle of His cell action potential(GO:0098905) |
| 0.4 | 2.1 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.4 | 3.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.4 | 1.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.4 | 7.0 | GO:0036257 | multivesicular body organization(GO:0036257) |
| 0.4 | 4.1 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.4 | 1.6 | GO:0021953 | central nervous system neuron differentiation(GO:0021953) |
| 0.4 | 1.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.4 | 3.3 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.4 | 2.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.4 | 13.8 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.4 | 2.8 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
| 0.4 | 0.4 | GO:0043366 | beta selection(GO:0043366) |
| 0.4 | 2.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 | 2.8 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.4 | 4.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.4 | 3.2 | GO:0002369 | T cell cytokine production(GO:0002369) |
| 0.4 | 0.8 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.4 | 1.6 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.4 | 1.2 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) DNA demethylation of male pronucleus(GO:0044727) |
| 0.4 | 1.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.4 | 4.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.4 | 0.4 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.4 | 1.2 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.4 | 11.3 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.4 | 1.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.4 | 1.5 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.4 | 0.8 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.4 | 10.8 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.4 | 1.9 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.4 | 0.8 | GO:0002254 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.4 | 0.8 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.4 | 4.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.4 | 5.4 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.4 | 3.5 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.4 | 3.4 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.4 | 0.4 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.4 | 0.4 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.4 | 3.8 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.4 | 1.1 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.4 | 1.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.4 | 3.0 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.4 | 1.9 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.4 | 1.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.4 | 3.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.4 | 7.8 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.4 | 3.3 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.4 | 1.5 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.4 | 1.9 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.4 | 0.7 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.4 | 3.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.4 | 1.5 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.4 | 0.7 | GO:0007059 | chromosome segregation(GO:0007059) |
| 0.4 | 0.7 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.4 | 1.5 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 4.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.4 | 0.4 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
| 0.4 | 0.7 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
| 0.4 | 1.8 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.4 | 0.7 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.4 | 1.8 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.4 | 3.3 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.4 | 1.1 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.4 | 17.0 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.4 | 1.4 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.4 | 0.4 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.4 | 1.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.4 | 2.5 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.4 | 11.5 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.4 | 1.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.4 | 10.8 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.4 | 4.7 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.4 | 1.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.4 | 3.6 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.4 | 5.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.4 | 2.1 | GO:0009099 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.4 | 1.8 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.4 | 6.7 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.4 | 0.7 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.4 | 1.8 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 | 1.0 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.3 | 12.1 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.3 | 5.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.3 | 1.0 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.3 | 1.7 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.3 | 1.0 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.3 | 4.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.3 | 2.4 | GO:0055062 | phosphate ion homeostasis(GO:0055062) divalent inorganic anion homeostasis(GO:0072505) trivalent inorganic anion homeostasis(GO:0072506) |
| 0.3 | 2.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.3 | 9.9 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.3 | 1.7 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.3 | 4.4 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.3 | 2.0 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.3 | 1.0 | GO:0060318 | regulation of definitive erythrocyte differentiation(GO:0010724) definitive erythrocyte differentiation(GO:0060318) |
| 0.3 | 0.3 | GO:0061740 | protein targeting to lysosome involved in chaperone-mediated autophagy(GO:0061740) |
| 0.3 | 1.0 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.3 | 3.0 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.3 | 0.7 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.3 | 1.3 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.3 | 1.3 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.3 | 2.3 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.3 | 1.0 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.3 | 0.3 | GO:0010332 | response to gamma radiation(GO:0010332) |
| 0.3 | 11.3 | GO:0015949 | nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.3 | 0.7 | GO:0072665 | protein localization to vacuole(GO:0072665) |
| 0.3 | 4.0 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.3 | 2.0 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.3 | 1.0 | GO:0035844 | cloaca development(GO:0035844) |
| 0.3 | 1.6 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
| 0.3 | 1.0 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.3 | 17.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.3 | 1.0 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.3 | 2.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.3 | 1.6 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.3 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.3 | 0.6 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.3 | 0.6 | GO:0052314 | phytoalexin metabolic process(GO:0052314) |
| 0.3 | 34.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.3 | 0.3 | GO:0035886 | vascular smooth muscle cell differentiation(GO:0035886) |
| 0.3 | 1.9 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
| 0.3 | 2.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.3 | 0.3 | GO:0030852 | regulation of granulocyte differentiation(GO:0030852) |
| 0.3 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.3 | 0.9 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.3 | 1.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.3 | 3.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.3 | 3.1 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.3 | 1.9 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.3 | 2.2 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.3 | 28.4 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.3 | 0.6 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.3 | 8.6 | GO:0034204 | lipid translocation(GO:0034204) |
| 0.3 | 0.6 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.3 | 0.3 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.3 | 1.5 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.3 | 0.6 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.3 | 1.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.3 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.3 | 1.5 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.3 | 1.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.3 | 0.9 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.3 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.3 | 8.1 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.3 | 1.2 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.3 | 3.3 | GO:0060117 | auditory receptor cell development(GO:0060117) |
| 0.3 | 2.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.3 | 0.6 | GO:0042262 | DNA protection(GO:0042262) |
| 0.3 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 0.3 | GO:0090270 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.3 | 1.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.3 | 1.5 | GO:0006294 | nucleotide-excision repair, preincision complex assembly(GO:0006294) |
| 0.3 | 1.5 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.3 | 0.3 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.3 | 15.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.3 | 6.1 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.3 | 13.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.3 | 0.6 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.3 | 2.6 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.3 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.3 | 0.6 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.3 | 3.7 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.3 | 2.3 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.3 | 0.8 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.3 | 2.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.3 | 0.6 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.3 | 1.7 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.3 | 0.6 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.3 | 1.9 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.3 | 7.8 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.3 | 1.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.3 | 0.3 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.3 | 0.5 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
| 0.3 | 0.3 | GO:0006641 | triglyceride metabolic process(GO:0006641) |
| 0.3 | 1.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 0.5 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
| 0.3 | 5.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.3 | 2.7 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.3 | 6.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.3 | 8.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.3 | 0.3 | GO:0097502 | mannosylation(GO:0097502) |
| 0.3 | 1.1 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.3 | 3.0 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.3 | 0.3 | GO:0051132 | NK T cell activation(GO:0051132) |
| 0.3 | 0.8 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.3 | 0.3 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.3 | 1.9 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.3 | 1.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.3 | 19.2 | GO:0045814 | negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.3 | 6.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.3 | 5.6 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.3 | 1.1 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.3 | 0.3 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.3 | 23.7 | GO:0002433 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.3 | 1.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.3 | 2.1 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.3 | 10.8 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.3 | 1.0 | GO:0000422 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
| 0.3 | 1.6 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.3 | 3.9 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.3 | 2.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.3 | 1.0 | GO:0010212 | response to ionizing radiation(GO:0010212) |
| 0.3 | 3.9 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.3 | 29.4 | GO:1902749 | regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.3 | 0.8 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.3 | 0.3 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.3 | 0.5 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.3 | 0.5 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 | 1.0 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.3 | 1.0 | GO:0000732 | strand displacement(GO:0000732) |
| 0.3 | 0.5 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.3 | 0.5 | GO:0009080 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.3 | 0.5 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.2 | 0.7 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) |
| 0.2 | 2.5 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.2 | 0.7 | GO:0048087 | positive regulation of developmental pigmentation(GO:0048087) |
| 0.2 | 6.5 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 | 1.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.2 | 0.7 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.2 | 3.7 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.2 | 0.2 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.2 | 4.9 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.2 | 2.7 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 1.5 | GO:0018032 | protein amidation(GO:0018032) |
| 0.2 | 0.2 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.2 | 5.8 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 | 2.6 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.2 | 1.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.2 | 1.7 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 0.5 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.2 | 1.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 1.9 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.2 | 0.9 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 1.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.2 | 1.6 | GO:0019556 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.2 | 1.9 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.2 | 0.9 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.2 | 0.2 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.2 | 0.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.2 | 0.9 | GO:0017158 | regulation of calcium ion-dependent exocytosis(GO:0017158) |
| 0.2 | 5.8 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.2 | 0.9 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.2 | 3.2 | GO:0006363 | transcription initiation from RNA polymerase I promoter(GO:0006361) termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 | 0.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 0.7 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.2 | 0.7 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.2 | 0.5 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 | 0.7 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.2 | 1.1 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.2 | 1.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.2 | 2.1 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.2 | 0.2 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.2 | 2.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.2 | 14.4 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.2 | 2.0 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 13.0 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.2 | 0.4 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.2 | 2.4 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.2 | 0.4 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.2 | 0.4 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.2 | 0.4 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.2 | 4.2 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.2 | 1.5 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.2 | 1.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.2 | 6.3 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.2 | 7.3 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.2 | 1.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.2 | 5.4 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.2 | 1.7 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.2 | 0.4 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.2 | 2.8 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.2 | 2.6 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.2 | 0.4 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.2 | 2.7 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.2 | 2.9 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.2 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.2 | 1.9 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.2 | 1.3 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.2 | 1.0 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.2 | 2.9 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.2 | 2.5 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.2 | 2.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 | 6.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.2 | 1.6 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.2 | 0.8 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.2 | 2.0 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.2 | 1.8 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.2 | 2.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.2 | 4.9 | GO:0000819 | sister chromatid segregation(GO:0000819) |
| 0.2 | 0.2 | GO:0010907 | positive regulation of glucose metabolic process(GO:0010907) |
| 0.2 | 1.0 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.2 | 1.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.2 | 2.6 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.2 | 4.0 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.2 | 0.6 | GO:0046041 | ITP metabolic process(GO:0046041) |
| 0.2 | 1.6 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.2 | 0.2 | GO:0001519 | peptide amidation(GO:0001519) peptide modification(GO:0031179) |
| 0.2 | 1.6 | GO:0043536 | positive regulation of blood vessel endothelial cell migration(GO:0043536) |
| 0.2 | 1.2 | GO:0032905 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
| 0.2 | 0.6 | GO:1904181 | positive regulation of membrane depolarization(GO:1904181) |
| 0.2 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.2 | 3.3 | GO:1901018 | positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.2 | 2.5 | GO:0030183 | B cell differentiation(GO:0030183) |
| 0.2 | 2.9 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.2 | 3.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.2 | 1.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.2 | 0.2 | GO:0021831 | embryonic olfactory bulb interneuron precursor migration(GO:0021831) |
| 0.2 | 1.5 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
| 0.2 | 4.4 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.2 | 0.8 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 1.1 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.2 | 1.5 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.2 | 0.9 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.2 | 0.8 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.2 | 3.0 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.2 | 5.6 | GO:0032608 | interferon-beta production(GO:0032608) |
| 0.2 | 6.4 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.2 | 1.5 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.2 | 2.2 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.2 | 1.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.2 | 0.4 | GO:0030578 | PML body organization(GO:0030578) |
| 0.2 | 1.3 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.2 | 0.2 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.2 | 1.1 | GO:0032324 | molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.2 | 0.2 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.2 | 7.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.2 | 1.6 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.2 | 3.3 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.2 | 1.8 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.2 | 0.5 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 | 0.5 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.2 | 0.4 | GO:0032817 | regulation of natural killer cell proliferation(GO:0032817) |
| 0.2 | 1.6 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.2 | 0.5 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.2 | 0.7 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.2 | 2.0 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.2 | 0.9 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.2 | 2.8 | GO:0006739 | NADP metabolic process(GO:0006739) |
| 0.2 | 4.0 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.2 | 0.5 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.2 | 1.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.2 | 0.7 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.2 | 0.3 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.2 | 0.3 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.2 | 1.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.2 | 0.2 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.2 | 1.9 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.2 | 6.2 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.2 | 2.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.2 | 0.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.2 | 1.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.2 | 4.0 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.2 | 2.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.2 | 1.8 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.2 | 3.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.2 | 0.2 | GO:0071320 | cellular response to cAMP(GO:0071320) |
| 0.2 | 0.5 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.2 | 0.7 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.2 | 0.3 | GO:0051344 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.2 | 3.5 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.2 | 1.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 | 1.0 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.2 | 1.1 | GO:0070423 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.2 | 0.8 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.2 | 0.8 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 2.9 | GO:0033198 | response to ATP(GO:0033198) |
| 0.2 | 0.5 | GO:0014743 | regulation of muscle hypertrophy(GO:0014743) |
| 0.2 | 26.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.2 | 0.5 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.2 | 0.2 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.2 | 0.5 | GO:0043038 | amino acid activation(GO:0043038) |
| 0.2 | 9.1 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
| 0.2 | 1.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 0.8 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.2 | 2.2 | GO:0048278 | vesicle docking(GO:0048278) |
| 0.2 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.2 | 1.7 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.2 | 3.4 | GO:0048806 | genitalia development(GO:0048806) |
| 0.2 | 5.4 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.2 | 1.4 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.2 | 6.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.1 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.1 | 2.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.1 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.1 | 3.0 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 2.1 | GO:2000651 | positive regulation of sodium ion transmembrane transport(GO:1902307) positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.1 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
| 0.1 | 0.4 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.1 | 0.1 | GO:0009415 | response to water(GO:0009415) |
| 0.1 | 1.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.4 | GO:0001832 | blastocyst growth(GO:0001832) inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 2.7 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 0.1 | 1.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.4 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.1 | 2.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.8 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.6 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 | 1.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.8 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.8 | GO:0001736 | establishment of planar polarity(GO:0001736) establishment of tissue polarity(GO:0007164) |
| 0.1 | 1.2 | GO:0072348 | sulfur compound transport(GO:0072348) |
| 0.1 | 2.6 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.1 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.1 | 4.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.5 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.4 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.9 | GO:0070670 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.1 | 1.3 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.1 | 0.3 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
| 0.1 | 0.1 | GO:0051928 | positive regulation of calcium ion transport(GO:0051928) |
| 0.1 | 0.5 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 1.9 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.8 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.1 | 0.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 0.3 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.7 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.9 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.4 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.1 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.9 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 1.4 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.9 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.3 | GO:0007500 | mesodermal cell fate determination(GO:0007500) |
| 0.1 | 0.4 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.1 | 5.0 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.3 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.1 | 0.9 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 6.4 | GO:0006094 | gluconeogenesis(GO:0006094) |
| 0.1 | 0.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.1 | 0.7 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.5 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 | 0.4 | GO:0031929 | TOR signaling(GO:0031929) |
| 0.1 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.4 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.4 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.1 | 0.7 | GO:0045187 | regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.6 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.1 | 0.7 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.6 | GO:1904427 | positive regulation of calcium ion transmembrane transport(GO:1904427) |
| 0.1 | 2.6 | GO:0001885 | endothelial cell development(GO:0001885) |
| 0.1 | 1.1 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 3.0 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.9 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.1 | 1.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 2.0 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.7 | GO:0071711 | basement membrane organization(GO:0071711) |
| 0.1 | 2.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.1 | 0.3 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.1 | 1.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.1 | 1.1 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.1 | 1.4 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.1 | 0.2 | GO:0033077 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 | 0.4 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.2 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.6 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 0.9 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 6.5 | GO:1990830 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.1 | 0.2 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
| 0.1 | 0.4 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.3 | GO:0001694 | histamine biosynthetic process(GO:0001694) |
| 0.1 | 0.4 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 3.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.1 | 1.4 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.1 | 0.3 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 1.8 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.5 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.1 | 3.2 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.1 | 0.2 | GO:0018126 | protein hydroxylation(GO:0018126) |
| 0.1 | 0.3 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.2 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.1 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.5 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.1 | 0.9 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 3.9 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.7 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 3.0 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.1 | 0.4 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.9 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.1 | 1.8 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 | 0.5 | GO:0010714 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 | 1.6 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.1 | 3.9 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 | 2.4 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 0.4 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.1 | 0.7 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 0.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.1 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
| 0.1 | 0.4 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 1.3 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 | 1.4 | GO:0048536 | spleen development(GO:0048536) |
| 0.1 | 1.4 | GO:1903670 | regulation of sprouting angiogenesis(GO:1903670) |
| 0.1 | 1.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.1 | GO:0014061 | regulation of norepinephrine secretion(GO:0014061) |
| 0.1 | 3.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.2 | GO:1903980 | positive regulation of microglial cell activation(GO:1903980) |
| 0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 3.6 | GO:0046323 | glucose import(GO:0046323) |
| 0.1 | 0.6 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.5 | GO:0042426 | choline catabolic process(GO:0042426) |
| 0.1 | 0.5 | GO:1903027 | regulation of opsonization(GO:1903027) |
| 0.1 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.1 | 0.5 | GO:0003170 | heart valve development(GO:0003170) |
| 0.1 | 0.2 | GO:0045575 | basophil activation(GO:0045575) |
| 0.1 | 2.2 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 1.0 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.1 | 0.5 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
| 0.1 | 0.1 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.1 | 0.4 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.4 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.6 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.1 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 1.3 | GO:0051058 | negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.1 | 0.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.1 | 0.3 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.1 | 1.4 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.1 | 1.0 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.3 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.1 | 0.1 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 | 0.4 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.1 | 0.1 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.1 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.1 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.2 | GO:0051101 | regulation of DNA binding(GO:0051101) |
| 0.1 | 0.7 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
| 0.1 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.1 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.1 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
| 0.1 | 0.2 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 | 0.2 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
| 0.1 | 3.1 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.1 | 0.5 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 | 0.4 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.1 | 0.1 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.1 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 0.2 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.4 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.1 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.7 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 0.3 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.4 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.3 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
| 0.1 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.3 | GO:0046373 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.1 | 0.1 | GO:1902232 | regulation of positive thymic T cell selection(GO:1902232) |
| 0.1 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
| 0.1 | 1.0 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 | 0.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 | 2.5 | GO:0065004 | protein-DNA complex assembly(GO:0065004) |
| 0.1 | 0.3 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
| 0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.1 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
| 0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 2.9 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.0 | 0.1 | GO:0032530 | regulation of microvillus organization(GO:0032530) |
| 0.0 | 0.4 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.0 | 0.1 | GO:1901876 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 | 0.8 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.4 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.7 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.6 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.0 | GO:2000399 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 | 0.2 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.1 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 | 0.3 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.0 | 0.2 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.0 | 0.2 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.0 | 0.1 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 1.1 | GO:0043462 | regulation of ATPase activity(GO:0043462) |
| 0.0 | 0.1 | GO:0021793 | chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.3 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.0 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
| 0.0 | 0.9 | GO:0001570 | vasculogenesis(GO:0001570) |
| 0.0 | 0.7 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 0.3 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 | 0.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.0 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 1.1 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.1 | GO:0060964 | regulation of gene silencing by miRNA(GO:0060964) |
| 0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.0 | 0.2 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
| 0.0 | 4.4 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.4 | GO:0075733 | intracellular transport of virus(GO:0075733) |
| 0.0 | 0.5 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.3 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.1 | GO:0048864 | stem cell development(GO:0048864) |
| 0.0 | 0.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.1 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
| 0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.2 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:0038112 | interleukin-8-mediated signaling pathway(GO:0038112) |
| 0.0 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.0 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.0 | 0.0 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.1 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 4.3 | GO:0016567 | protein ubiquitination(GO:0016567) |
| 0.0 | 0.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.4 | 22.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 6.4 | 25.6 | GO:0031523 | Myb complex(GO:0031523) |
| 6.1 | 24.3 | GO:0000811 | GINS complex(GO:0000811) |
| 4.2 | 25.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 4.0 | 16.1 | GO:0044753 | amphisome(GO:0044753) |
| 4.0 | 19.9 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 4.0 | 11.9 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 4.0 | 39.7 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 3.9 | 11.7 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 3.8 | 49.1 | GO:0000796 | condensin complex(GO:0000796) |
| 3.8 | 15.0 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 3.7 | 114.3 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 3.7 | 18.3 | GO:0002133 | polycystin complex(GO:0002133) |
| 3.5 | 28.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 3.3 | 13.2 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 3.1 | 18.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 3.1 | 33.8 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 3.0 | 9.1 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 3.0 | 24.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 2.9 | 46.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 2.9 | 20.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 2.8 | 5.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 2.8 | 8.4 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 2.8 | 11.0 | GO:0045160 | myosin I complex(GO:0045160) |
| 2.8 | 2.8 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 2.7 | 54.5 | GO:0042555 | MCM complex(GO:0042555) |
| 2.7 | 24.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 2.7 | 8.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 2.6 | 7.9 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 2.6 | 7.7 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 2.6 | 7.7 | GO:0035061 | interchromatin granule(GO:0035061) |
| 2.5 | 2.5 | GO:0044301 | climbing fiber(GO:0044301) |
| 2.5 | 10.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 2.5 | 7.4 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 2.5 | 7.4 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 2.5 | 17.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 2.5 | 12.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 2.4 | 9.7 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 2.4 | 2.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 2.4 | 7.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 2.4 | 19.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 2.3 | 23.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 2.3 | 27.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 2.3 | 6.8 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 2.3 | 31.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 2.2 | 2.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 2.2 | 17.7 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 2.2 | 11.1 | GO:1990031 | pinceau fiber(GO:1990031) |
| 2.2 | 13.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 2.2 | 8.8 | GO:0043293 | apoptosome(GO:0043293) |
| 2.2 | 8.7 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 2.1 | 36.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 2.1 | 10.7 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 2.1 | 35.8 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 2.1 | 6.2 | GO:0097124 | cyclin A2-CDK2 complex(GO:0097124) |
| 2.1 | 24.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 2.0 | 8.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 2.0 | 8.1 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 2.0 | 2.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 2.0 | 4.0 | GO:0034657 | GID complex(GO:0034657) |
| 2.0 | 5.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 2.0 | 5.9 | GO:0070685 | macropinocytic cup(GO:0070685) |
| 1.9 | 9.7 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 1.9 | 5.8 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 1.9 | 3.8 | GO:0044094 | host cell nuclear part(GO:0044094) |
| 1.9 | 9.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 1.8 | 23.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 1.8 | 5.3 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 1.8 | 35.5 | GO:0070938 | contractile ring(GO:0070938) |
| 1.8 | 10.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 1.7 | 8.7 | GO:0097422 | tubular endosome(GO:0097422) |
| 1.7 | 1.7 | GO:1990246 | uniplex complex(GO:1990246) |
| 1.7 | 60.8 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 1.7 | 8.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 1.7 | 5.0 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 1.6 | 1.6 | GO:0060170 | ciliary membrane(GO:0060170) |
| 1.6 | 16.2 | GO:0005638 | lamin filament(GO:0005638) |
| 1.6 | 9.6 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 1.6 | 1.6 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 1.6 | 6.3 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 1.6 | 7.8 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 1.5 | 6.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 1.5 | 1.5 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 1.5 | 1.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 1.5 | 4.6 | GO:0034455 | t-UTP complex(GO:0034455) |
| 1.5 | 7.6 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 1.5 | 18.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 1.5 | 4.5 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 1.5 | 17.7 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 1.5 | 7.4 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 1.5 | 29.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 1.4 | 10.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 1.4 | 7.2 | GO:0070701 | mucus layer(GO:0070701) |
| 1.4 | 8.6 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 1.4 | 7.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 1.4 | 28.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 1.4 | 7.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 1.4 | 26.7 | GO:0000124 | SAGA complex(GO:0000124) |
| 1.4 | 5.6 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 1.4 | 11.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 1.4 | 22.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 1.4 | 4.2 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 1.4 | 2.8 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 1.3 | 6.7 | GO:0032449 | CBM complex(GO:0032449) |
| 1.3 | 18.7 | GO:0033269 | internode region of axon(GO:0033269) |
| 1.3 | 11.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 1.3 | 4.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 1.3 | 2.6 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 1.3 | 11.9 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 1.3 | 9.2 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 1.3 | 5.2 | GO:0097361 | CIA complex(GO:0097361) |
| 1.3 | 3.9 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 1.3 | 20.7 | GO:0031931 | TORC1 complex(GO:0031931) |
| 1.3 | 19.3 | GO:0005883 | neurofilament(GO:0005883) |
| 1.3 | 3.8 | GO:0033643 | host cell part(GO:0033643) |
| 1.3 | 18.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 1.3 | 6.3 | GO:0071942 | XPC complex(GO:0071942) |
| 1.3 | 8.8 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 1.3 | 8.8 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 1.2 | 31.0 | GO:0005915 | zonula adherens(GO:0005915) |
| 1.2 | 11.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 1.2 | 4.9 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 1.2 | 12.3 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 1.2 | 6.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 1.2 | 3.7 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 1.2 | 6.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 1.2 | 8.4 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 1.2 | 148.9 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 1.2 | 45.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 1.2 | 8.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 1.2 | 7.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 1.2 | 7.0 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 1.2 | 7.0 | GO:0071797 | LUBAC complex(GO:0071797) |
| 1.2 | 6.9 | GO:0001740 | Barr body(GO:0001740) |
| 1.1 | 3.4 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 1.1 | 10.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 1.1 | 13.5 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 1.1 | 4.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 1.1 | 29.9 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 1.1 | 7.7 | GO:0098536 | deuterosome(GO:0098536) |
| 1.1 | 8.7 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 1.1 | 6.5 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 1.1 | 11.9 | GO:0008278 | cohesin complex(GO:0008278) |
| 1.1 | 60.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 1.1 | 4.3 | GO:1990745 | EARP complex(GO:1990745) |
| 1.1 | 4.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 1.1 | 1.1 | GO:0045179 | apical cortex(GO:0045179) |
| 1.1 | 8.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 1.1 | 5.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 1.0 | 3.1 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 1.0 | 13.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 1.0 | 8.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 1.0 | 7.3 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 1.0 | 35.3 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 1.0 | 69.3 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 1.0 | 16.5 | GO:0008091 | spectrin(GO:0008091) |
| 1.0 | 5.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 1.0 | 10.3 | GO:0016600 | flotillin complex(GO:0016600) |
| 1.0 | 17.4 | GO:0032059 | bleb(GO:0032059) |
| 1.0 | 5.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 1.0 | 3.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 1.0 | 5.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 1.0 | 3.0 | GO:0031415 | NatA complex(GO:0031415) |
| 1.0 | 4.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 1.0 | 2.0 | GO:0070876 | SOSS complex(GO:0070876) |
| 1.0 | 3.9 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 1.0 | 32.3 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 1.0 | 2.9 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 1.0 | 10.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 1.0 | 16.6 | GO:0071564 | npBAF complex(GO:0071564) |
| 1.0 | 3.8 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 1.0 | 1.9 | GO:0032009 | early phagosome(GO:0032009) |
| 0.9 | 3.8 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.9 | 13.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.9 | 11.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.9 | 2.8 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.9 | 4.7 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
| 0.9 | 2.8 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.9 | 12.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.9 | 12.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.9 | 6.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.9 | 2.8 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.9 | 14.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.9 | 2.7 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.9 | 3.6 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.9 | 4.5 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.9 | 0.9 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.9 | 0.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.9 | 3.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.9 | 70.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.9 | 31.5 | GO:0000145 | exocyst(GO:0000145) |
| 0.9 | 19.2 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.9 | 22.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.9 | 34.7 | GO:0000776 | kinetochore(GO:0000776) |
| 0.9 | 18.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.9 | 0.9 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.9 | 12.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.9 | 3.4 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.9 | 0.9 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.8 | 8.5 | GO:0033503 | HULC complex(GO:0033503) |
| 0.8 | 9.3 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.8 | 4.2 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.8 | 5.0 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.8 | 5.0 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.8 | 1.7 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.8 | 22.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.8 | 14.6 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.8 | 2.4 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.8 | 27.5 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.8 | 64.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.8 | 31.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.8 | 10.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.8 | 3.2 | GO:0005712 | chiasma(GO:0005712) |
| 0.8 | 4.8 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.8 | 1.6 | GO:0032797 | SMN complex(GO:0032797) |
| 0.8 | 26.0 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.8 | 3.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.8 | 5.5 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.8 | 3.9 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.8 | 2.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.8 | 28.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.8 | 7.7 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.8 | 6.9 | GO:0051286 | cell tip(GO:0051286) |
| 0.8 | 5.4 | GO:0001652 | granular component(GO:0001652) |
| 0.8 | 35.8 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.7 | 0.7 | GO:0035101 | FACT complex(GO:0035101) |
| 0.7 | 8.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.7 | 12.7 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.7 | 17.8 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.7 | 71.2 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.7 | 2.2 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.7 | 2.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.7 | 8.0 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.7 | 2.2 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.7 | 11.6 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.7 | 43.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.7 | 1.4 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.7 | 2.9 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.7 | 18.6 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.7 | 12.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.7 | 3.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.7 | 5.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.7 | 6.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.7 | 22.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.7 | 1.4 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.7 | 12.6 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.7 | 7.7 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.7 | 4.8 | GO:0043679 | axon terminus(GO:0043679) |
| 0.7 | 32.0 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.7 | 5.4 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.7 | 4.7 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.7 | 14.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.7 | 22.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.7 | 3.9 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.6 | 5.8 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.6 | 90.6 | GO:0000922 | spindle pole(GO:0000922) |
| 0.6 | 4.5 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.6 | 14.7 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.6 | 12.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.6 | 3.8 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.6 | 7.6 | GO:0090543 | Flemming body(GO:0090543) |
| 0.6 | 2.5 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.6 | 16.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.6 | 11.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.6 | 9.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.6 | 20.7 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.6 | 16.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.6 | 7.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.6 | 2.4 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.6 | 6.6 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.6 | 16.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.6 | 3.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.6 | 2.9 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.6 | 0.6 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.6 | 3.5 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.6 | 5.8 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.6 | 61.6 | GO:0005901 | caveola(GO:0005901) |
| 0.6 | 35.6 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.6 | 1.1 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.6 | 8.0 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.6 | 39.4 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.6 | 3.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.5 | 1.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.5 | 0.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.5 | 10.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.5 | 23.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.5 | 2.7 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.5 | 14.4 | GO:0043218 | compact myelin(GO:0043218) |
| 0.5 | 5.8 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.5 | 2.7 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.5 | 8.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.5 | 19.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.5 | 2.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.5 | 3.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.5 | 51.0 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.5 | 4.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.5 | 1.5 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.5 | 2.5 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.5 | 2.0 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.5 | 12.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.5 | 1.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.5 | 2.4 | GO:0018995 | host(GO:0018995) host cell(GO:0043657) |
| 0.5 | 3.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.5 | 3.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.5 | 2.8 | GO:0032021 | NELF complex(GO:0032021) |
| 0.5 | 39.8 | GO:0005814 | centriole(GO:0005814) |
| 0.5 | 1.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.5 | 1.9 | GO:0031251 | PAN complex(GO:0031251) |
| 0.5 | 3.7 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.5 | 0.9 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.5 | 28.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.5 | 1.4 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.5 | 7.8 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.5 | 4.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.5 | 1.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.5 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.5 | 42.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.5 | 3.6 | GO:1990234 | transferase complex(GO:1990234) |
| 0.4 | 0.9 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.4 | 1.8 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.4 | 59.0 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.4 | 6.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.4 | 44.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.4 | 17.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.4 | 2.2 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.4 | 1.7 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.4 | 1.7 | GO:0060187 | cell pole(GO:0060187) |
| 0.4 | 13.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.4 | 5.0 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.4 | 29.0 | GO:0032153 | cell division site(GO:0032153) cell division site part(GO:0032155) |
| 0.4 | 4.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.4 | 2.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.4 | 9.6 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.4 | 3.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.4 | 1.6 | GO:1990357 | terminal web(GO:1990357) |
| 0.4 | 1.2 | GO:0070993 | translation preinitiation complex(GO:0070993) |
| 0.4 | 6.9 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.4 | 2.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.4 | 6.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.4 | 2.8 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.4 | 1.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.4 | 4.0 | GO:0034464 | BBSome(GO:0034464) |
| 0.4 | 1.6 | GO:0016342 | catenin complex(GO:0016342) |
| 0.4 | 3.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.4 | 16.7 | GO:0043034 | costamere(GO:0043034) |
| 0.4 | 8.8 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.4 | 13.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.4 | 8.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.4 | 10.9 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.4 | 2.7 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.4 | 0.4 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.4 | 12.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.4 | 4.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.4 | 55.6 | GO:0005819 | spindle(GO:0005819) |
| 0.4 | 4.9 | GO:0031300 | intrinsic component of organelle membrane(GO:0031300) |
| 0.4 | 8.7 | GO:0030904 | retromer complex(GO:0030904) |
| 0.4 | 6.7 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.4 | 3.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.4 | 10.8 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.4 | 4.5 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.4 | 29.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.4 | 1.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.4 | 0.7 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.4 | 3.6 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.4 | 6.9 | GO:0016459 | myosin complex(GO:0016459) |
| 0.4 | 10.1 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.4 | 3.6 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.4 | 1.8 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.3 | 2.1 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.3 | 10.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.3 | 2.8 | GO:0038201 | TOR complex(GO:0038201) |
| 0.3 | 17.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.3 | 1.7 | GO:1990393 | 3M complex(GO:1990393) |
| 0.3 | 0.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.3 | 0.3 | GO:0097637 | intrinsic component of autophagosome membrane(GO:0097636) integral component of autophagosome membrane(GO:0097637) |
| 0.3 | 9.1 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.3 | 24.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.3 | 2.0 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 3.0 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.3 | 23.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.3 | 3.0 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 1.0 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.3 | 47.4 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.3 | 1.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.3 | 9.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.3 | 1.9 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.3 | 14.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.3 | 0.9 | GO:0005840 | ribosome(GO:0005840) |
| 0.3 | 2.8 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.3 | 5.7 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.3 | 25.6 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.3 | 1.5 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.3 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
| 0.3 | 5.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.3 | 142.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.3 | 1.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.3 | 3.4 | GO:0072487 | MSL complex(GO:0072487) |
| 0.3 | 5.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.3 | 20.0 | GO:0030496 | midbody(GO:0030496) |
| 0.3 | 18.8 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.3 | 1.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.3 | 1.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.3 | 3.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.3 | 1.2 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.3 | 8.8 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.3 | 2.3 | GO:0045180 | basal cortex(GO:0045180) |
| 0.3 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.3 | 4.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.3 | 1.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.3 | 25.3 | GO:0030880 | DNA-directed RNA polymerase complex(GO:0000428) RNA polymerase complex(GO:0030880) |
| 0.3 | 10.0 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.3 | 0.3 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.3 | 5.9 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.3 | 21.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.3 | 11.5 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.3 | 1.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.3 | 1.0 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.3 | 1.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.3 | 4.6 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.3 | 1.0 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.3 | 2.0 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 1.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 0.7 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.2 | 5.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.2 | 42.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.2 | 0.7 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.2 | 5.7 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.2 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.2 | 1.4 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.2 | 1.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 23.0 | GO:0031975 | organelle envelope(GO:0031967) envelope(GO:0031975) |
| 0.2 | 3.9 | GO:0032982 | myosin filament(GO:0032982) |
| 0.2 | 4.8 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.2 | 2.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 12.5 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.2 | 7.0 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.2 | 2.2 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.2 | 7.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 2.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.2 | 15.1 | GO:0030529 | intracellular ribonucleoprotein complex(GO:0030529) |
| 0.2 | 5.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.2 | 2.8 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 18.6 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.2 | 0.4 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.2 | 1.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 2.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.2 | 22.7 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.2 | 31.7 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.2 | 4.8 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.2 | 2.7 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.2 | 0.6 | GO:0005776 | autophagosome(GO:0005776) |
| 0.2 | 28.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.2 | 0.9 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.2 | 1.5 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 0.8 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.2 | 0.4 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.2 | 0.6 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.2 | 11.7 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.2 | 4.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 0.3 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.2 | 1.0 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.2 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 0.3 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.2 | 0.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.2 | 1.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.2 | 5.4 | GO:0042641 | actomyosin(GO:0042641) |
| 0.2 | 4.6 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.2 | 12.2 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.2 | 0.5 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.2 | 6.7 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.2 | 3.6 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 1.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 8.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.1 | 28.2 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.1 | 2.3 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.1 | 35.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.1 | 42.2 | GO:0005874 | microtubule(GO:0005874) |
| 0.1 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.4 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.1 | 26.9 | GO:0030133 | transport vesicle(GO:0030133) |
| 0.1 | 1.8 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 1.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.3 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 12.9 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.1 | 24.7 | GO:0005813 | centrosome(GO:0005813) |
| 0.1 | 1.8 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 15.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 1.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 5.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.2 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.2 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 159.3 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.1 | 4.7 | GO:0030016 | myofibril(GO:0030016) |
| 0.1 | 2.6 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 49.2 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.1 | 1.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 14.6 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 11.6 | GO:0005884 | actin filament(GO:0005884) |
| 0.1 | 37.9 | GO:0098791 | Golgi subcompartment(GO:0098791) |
| 0.1 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 15.8 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
| 0.1 | 0.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 25.8 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 51.1 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.1 | 0.4 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.1 | 1.3 | GO:0036477 | somatodendritic compartment(GO:0036477) |
| 0.1 | 0.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.9 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 0.9 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 5.8 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.1 | 0.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 0.7 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 16.1 | GO:0044456 | synapse part(GO:0044456) |
| 0.1 | 0.3 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 1.9 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 4.0 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.1 | 0.9 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.1 | 0.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 43.6 | GO:0005730 | nucleolus(GO:0005730) |
| 0.1 | 0.1 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.1 | 48.4 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 0.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.9 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.3 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 1.8 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.3 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.0 | 0.3 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 1.6 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 1.2 | GO:0022627 | small ribosomal subunit(GO:0015935) cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.1 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 3.6 | GO:0044432 | endoplasmic reticulum part(GO:0044432) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.5 | GO:0005796 | Golgi lumen(GO:0005796) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 6.9 | 34.5 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 6.7 | 20.0 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 6.0 | 23.9 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 4.8 | 4.8 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 4.7 | 4.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 4.7 | 14.0 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 4.2 | 12.6 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 4.2 | 29.3 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 4.2 | 12.5 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 4.1 | 12.3 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 4.0 | 11.9 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 4.0 | 19.8 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 3.9 | 116.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 3.8 | 15.4 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 3.8 | 11.4 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 3.8 | 11.4 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 3.8 | 15.0 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 3.7 | 14.8 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 3.6 | 10.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 3.5 | 28.3 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 3.5 | 28.3 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 3.5 | 21.1 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 3.5 | 3.5 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 3.4 | 13.6 | GO:0003896 | DNA primase activity(GO:0003896) |
| 3.4 | 10.2 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 3.4 | 10.1 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 3.4 | 10.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 3.3 | 9.8 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 3.2 | 13.0 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 3.2 | 9.6 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 3.2 | 16.0 | GO:0098626 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 3.2 | 12.7 | GO:0009384 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) N-acylmannosamine kinase activity(GO:0009384) |
| 3.2 | 9.5 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 3.1 | 28.3 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 3.1 | 25.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 3.1 | 9.4 | GO:0043337 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 3.1 | 12.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 3.0 | 3.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 3.0 | 9.0 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 2.9 | 23.6 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 2.9 | 26.4 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 2.9 | 8.8 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 2.9 | 8.6 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 2.9 | 34.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 2.8 | 8.5 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
| 2.8 | 22.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 2.8 | 8.3 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 2.8 | 8.3 | GO:0051908 | double-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0051908) |
| 2.7 | 8.2 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 2.7 | 2.7 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) platelet-derived growth factor beta-receptor activity(GO:0005019) |
| 2.7 | 8.2 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 2.7 | 16.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 2.6 | 13.1 | GO:0070905 | serine binding(GO:0070905) |
| 2.6 | 10.4 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 2.6 | 7.7 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 2.6 | 7.7 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 2.5 | 7.6 | GO:0043274 | phospholipase binding(GO:0043274) |
| 2.5 | 7.5 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 2.5 | 17.4 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 2.5 | 5.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 2.5 | 7.4 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 2.5 | 12.4 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 2.5 | 9.9 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 2.5 | 7.4 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 2.4 | 12.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 2.4 | 9.7 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 2.4 | 16.9 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 2.4 | 4.8 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 2.4 | 9.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 2.4 | 24.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 2.4 | 14.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 2.4 | 9.5 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 2.4 | 14.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 2.4 | 7.1 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 2.4 | 9.4 | GO:0016662 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 2.4 | 14.1 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 2.4 | 7.1 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 2.3 | 23.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 2.3 | 16.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 2.3 | 7.0 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 2.3 | 7.0 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 2.3 | 6.9 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 2.3 | 6.8 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
| 2.2 | 13.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 2.2 | 8.8 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 2.2 | 10.9 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 2.2 | 10.8 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 2.2 | 12.9 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 2.1 | 8.6 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 2.1 | 44.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 2.1 | 6.4 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 2.1 | 4.3 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 2.1 | 16.9 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 2.1 | 12.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 2.1 | 6.2 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 2.1 | 6.2 | GO:0036328 | VEGF-C-activated receptor activity(GO:0036328) |
| 2.0 | 6.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 2.0 | 6.1 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 2.0 | 10.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 2.0 | 10.1 | GO:0010736 | serum response element binding(GO:0010736) |
| 2.0 | 20.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 2.0 | 7.9 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 2.0 | 9.9 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 2.0 | 5.9 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 2.0 | 11.8 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 2.0 | 2.0 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 2.0 | 13.7 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 1.9 | 5.8 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 1.9 | 3.9 | GO:0002134 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 1.9 | 1.9 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 1.9 | 5.7 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 1.9 | 15.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 1.9 | 28.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 1.9 | 5.6 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 1.9 | 16.8 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 1.9 | 13.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 1.9 | 5.6 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 1.8 | 9.2 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 1.8 | 23.8 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 1.8 | 5.4 | GO:0031403 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 1.8 | 12.5 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 1.8 | 7.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 1.8 | 5.3 | GO:0090541 | MIT domain binding(GO:0090541) |
| 1.8 | 10.5 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 1.7 | 8.7 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 1.7 | 20.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 1.7 | 13.9 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 1.7 | 10.4 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 1.7 | 20.9 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 1.7 | 19.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 1.7 | 5.1 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 1.7 | 8.6 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 1.7 | 35.9 | GO:0003680 | AT DNA binding(GO:0003680) |
| 1.7 | 12.0 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 1.7 | 10.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 1.7 | 6.8 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 1.7 | 15.3 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 1.7 | 8.5 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 1.7 | 6.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 1.7 | 11.7 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 1.7 | 5.0 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.7 | 6.6 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 1.6 | 11.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 1.6 | 4.9 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 1.6 | 6.5 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 1.6 | 11.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 1.6 | 6.4 | GO:0004325 | ferrochelatase activity(GO:0004325) |
| 1.6 | 4.8 | GO:0036033 | mediator complex binding(GO:0036033) |
| 1.6 | 4.8 | GO:0051499 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 1.6 | 6.3 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 1.6 | 7.8 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 1.6 | 4.7 | GO:0000224 | peptide-N4-(N-acetyl-beta-glucosaminyl)asparagine amidase activity(GO:0000224) |
| 1.6 | 7.8 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 1.6 | 24.9 | GO:0015232 | heme transporter activity(GO:0015232) |
| 1.6 | 9.3 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 1.6 | 4.7 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
| 1.5 | 4.6 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 1.5 | 3.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 1.5 | 16.9 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 1.5 | 9.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 1.5 | 6.1 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 1.5 | 7.6 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 1.5 | 13.7 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 1.5 | 8.9 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 1.5 | 17.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 1.5 | 4.4 | GO:0019862 | IgA binding(GO:0019862) |
| 1.5 | 7.4 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 1.5 | 10.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 1.5 | 2.9 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 1.5 | 4.4 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 1.5 | 5.8 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 1.5 | 4.4 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 1.5 | 4.4 | GO:0097258 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 1.4 | 7.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 1.4 | 5.7 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 1.4 | 7.1 | GO:0002046 | opsin binding(GO:0002046) |
| 1.4 | 8.5 | GO:0030957 | Tat protein binding(GO:0030957) |
| 1.4 | 1.4 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 1.4 | 2.8 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 1.4 | 4.2 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 1.4 | 5.6 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 1.4 | 5.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 1.4 | 1.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 1.4 | 12.6 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 1.4 | 2.8 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 1.4 | 11.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 1.4 | 8.2 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 1.4 | 11.0 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 1.4 | 6.8 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 1.4 | 6.8 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 1.4 | 5.5 | GO:0004335 | galactokinase activity(GO:0004335) |
| 1.4 | 4.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 1.4 | 6.8 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 1.4 | 10.8 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 1.4 | 10.8 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 1.3 | 9.4 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 1.3 | 5.4 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 1.3 | 39.0 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 1.3 | 9.4 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 1.3 | 20.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 1.3 | 11.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 1.3 | 4.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 1.3 | 3.9 | GO:0033961 | cis-stilbene-oxide hydrolase activity(GO:0033961) |
| 1.3 | 34.0 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 1.3 | 6.5 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 1.3 | 10.4 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 1.3 | 45.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 1.3 | 2.6 | GO:0032427 | GBD domain binding(GO:0032427) |
| 1.3 | 1.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 1.3 | 3.9 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 1.3 | 11.6 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 1.3 | 9.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 1.3 | 5.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 1.3 | 3.8 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 1.3 | 6.4 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 1.3 | 3.8 | GO:0050405 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 1.3 | 3.8 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 1.3 | 6.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 1.3 | 17.6 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 1.3 | 3.8 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 1.2 | 4.9 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 1.2 | 3.7 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 1.2 | 7.4 | GO:0030911 | TPR domain binding(GO:0030911) |
| 1.2 | 2.5 | GO:0032356 | oxidized DNA binding(GO:0032356) |
| 1.2 | 14.7 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 1.2 | 3.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 1.2 | 2.4 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 1.2 | 4.9 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) |
| 1.2 | 9.7 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 1.2 | 8.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 1.2 | 6.0 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 1.2 | 4.8 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 1.2 | 4.8 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 1.2 | 3.6 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 1.2 | 2.4 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 1.2 | 6.0 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 1.2 | 3.6 | GO:0031775 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 1.2 | 4.8 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 1.2 | 29.9 | GO:0003924 | GTPase activity(GO:0003924) |
| 1.2 | 2.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 1.2 | 4.7 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 1.2 | 13.0 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 1.2 | 8.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 1.2 | 7.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 1.2 | 12.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 1.2 | 10.4 | GO:0032810 | sterol response element binding(GO:0032810) |
| 1.2 | 9.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 1.2 | 3.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 1.2 | 8.1 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 1.2 | 3.5 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 1.2 | 4.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 1.2 | 4.6 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 1.1 | 1.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 1.1 | 3.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 1.1 | 5.7 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 1.1 | 5.7 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 1.1 | 4.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 1.1 | 3.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 1.1 | 3.4 | GO:0047676 | arachidonate-CoA ligase activity(GO:0047676) |
| 1.1 | 10.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 1.1 | 19.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 1.1 | 21.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 1.1 | 4.5 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 1.1 | 4.5 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 1.1 | 7.8 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 1.1 | 4.4 | GO:0004803 | transposase activity(GO:0004803) |
| 1.1 | 1.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 1.1 | 9.9 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 1.1 | 2.2 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 1.1 | 11.0 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 1.1 | 6.5 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 1.1 | 14.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 1.1 | 9.8 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 1.1 | 3.2 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 1.1 | 11.9 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 1.1 | 11.9 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 1.1 | 5.4 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 1.1 | 12.9 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 1.1 | 2.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 1.1 | 40.8 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 1.1 | 5.4 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 1.1 | 5.4 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 1.1 | 8.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 1.1 | 6.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 1.1 | 11.7 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 1.1 | 57.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 1.1 | 3.2 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
| 1.1 | 6.3 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 1.1 | 5.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 1.1 | 1.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 1.0 | 25.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 1.0 | 2.1 | GO:0030343 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 1.0 | 12.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.0 | 10.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 1.0 | 1.0 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 1.0 | 1.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 1.0 | 1.0 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 1.0 | 6.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 1.0 | 6.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 1.0 | 10.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 1.0 | 10.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 1.0 | 5.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 1.0 | 10.0 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 1.0 | 7.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 1.0 | 12.9 | GO:0035173 | histone kinase activity(GO:0035173) |
| 1.0 | 4.0 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 1.0 | 8.9 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 1.0 | 27.7 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 1.0 | 3.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 1.0 | 33.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 1.0 | 3.9 | GO:0072590 | N-acetyl-L-aspartate-L-glutamate ligase activity(GO:0072590) |
| 1.0 | 21.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 1.0 | 29.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 1.0 | 13.6 | GO:0031014 | troponin T binding(GO:0031014) |
| 1.0 | 11.6 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 1.0 | 17.3 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
| 1.0 | 39.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 1.0 | 23.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 1.0 | 11.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 1.0 | 1.9 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.9 | 6.6 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.9 | 19.8 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.9 | 2.8 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.9 | 17.8 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.9 | 2.8 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.9 | 4.7 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.9 | 2.8 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.9 | 9.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.9 | 2.8 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.9 | 1.9 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.9 | 8.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.9 | 10.2 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 0.9 | 12.0 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.9 | 23.0 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.9 | 2.8 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.9 | 3.7 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.9 | 42.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.9 | 2.7 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.9 | 6.4 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.9 | 3.6 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.9 | 39.0 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.9 | 0.9 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
| 0.9 | 4.5 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.9 | 17.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.9 | 1.8 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.9 | 35.5 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.9 | 0.9 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.9 | 10.6 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.9 | 7.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.9 | 4.4 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.9 | 14.9 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.9 | 11.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.9 | 6.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.9 | 2.6 | GO:0036317 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.9 | 13.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.9 | 7.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.9 | 2.6 | GO:0001031 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) 5S rDNA binding(GO:0080084) |
| 0.9 | 3.5 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.9 | 0.9 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.9 | 2.6 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.9 | 8.7 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.9 | 2.6 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.9 | 6.8 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.9 | 4.3 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.9 | 6.8 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.9 | 11.9 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.8 | 37.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.8 | 5.0 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.8 | 5.0 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.8 | 0.8 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.8 | 4.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.8 | 9.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.8 | 3.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.8 | 26.5 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.8 | 2.5 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.8 | 8.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.8 | 9.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.8 | 9.0 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.8 | 23.7 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.8 | 18.5 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.8 | 0.8 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.8 | 3.2 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.8 | 12.7 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.8 | 4.8 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.8 | 6.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.8 | 4.7 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.8 | 17.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.8 | 3.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.8 | 6.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.8 | 1.6 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.8 | 6.3 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.8 | 25.0 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.8 | 9.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.8 | 4.7 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.8 | 34.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.8 | 3.1 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.8 | 3.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.8 | 29.1 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.8 | 3.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.8 | 3.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.8 | 6.9 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.8 | 5.3 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.8 | 2.3 | GO:0015039 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.8 | 1.5 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.8 | 0.8 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.8 | 2.3 | GO:0036440 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.8 | 0.8 | GO:0016801 | hydrolase activity, acting on ether bonds(GO:0016801) ether hydrolase activity(GO:0016803) |
| 0.8 | 3.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.8 | 9.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.8 | 5.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.8 | 11.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.8 | 15.0 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.8 | 10.5 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.7 | 2.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.7 | 19.4 | GO:0071617 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
| 0.7 | 7.5 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.7 | 14.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.7 | 0.7 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.7 | 16.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.7 | 0.7 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.7 | 5.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.7 | 7.3 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.7 | 5.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.7 | 5.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.7 | 7.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.7 | 2.2 | GO:0008398 | sterol 14-demethylase activity(GO:0008398) |
| 0.7 | 38.1 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.7 | 19.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.7 | 6.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.7 | 6.4 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.7 | 2.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.7 | 72.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.7 | 6.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.7 | 2.1 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.7 | 2.1 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.7 | 24.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.7 | 2.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.7 | 26.8 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.7 | 4.8 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.7 | 1.4 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.7 | 7.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.7 | 0.7 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.7 | 14.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.7 | 6.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.7 | 50.0 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.7 | 2.7 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.7 | 24.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.7 | 2.6 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.7 | 9.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.7 | 7.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.7 | 24.3 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.7 | 3.9 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.7 | 5.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.6 | 3.9 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.6 | 9.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.6 | 2.6 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.6 | 1.9 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.6 | 10.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.6 | 5.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.6 | 3.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.6 | 8.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.6 | 37.7 | GO:0016796 | exonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016796) |
| 0.6 | 17.8 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.6 | 1.9 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.6 | 17.7 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.6 | 3.8 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.6 | 1.3 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.6 | 1.9 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.6 | 1.9 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.6 | 14.9 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.6 | 2.5 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.6 | 8.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.6 | 15.4 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.6 | 0.6 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.6 | 4.9 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.6 | 3.6 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.6 | 1.8 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.6 | 5.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.6 | 3.0 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.6 | 19.9 | GO:0043531 | ADP binding(GO:0043531) |
| 0.6 | 1.8 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.6 | 13.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.6 | 3.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.6 | 9.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.6 | 2.4 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.6 | 1.8 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.6 | 2.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.6 | 1.8 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.6 | 1.8 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.6 | 2.3 | GO:0070404 | NADH binding(GO:0070404) |
| 0.6 | 4.7 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.6 | 1.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.6 | 8.2 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.6 | 1.7 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.6 | 9.9 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.6 | 1.2 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.6 | 1.7 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.6 | 2.9 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.6 | 0.6 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.6 | 8.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.6 | 0.6 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.6 | 8.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.6 | 8.6 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.6 | 0.6 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.6 | 0.6 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.6 | 4.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.6 | 3.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.6 | 7.3 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.6 | 2.8 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.6 | 1.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.6 | 0.6 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.6 | 3.9 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.6 | 6.6 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.5 | 2.2 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.5 | 8.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.5 | 3.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.5 | 3.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.5 | 4.9 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.5 | 0.5 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.5 | 20.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.5 | 7.0 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.5 | 5.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.5 | 1.1 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.5 | 28.4 | GO:0005048 | signal sequence binding(GO:0005048) |
| 0.5 | 4.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.5 | 3.2 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.5 | 2.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.5 | 4.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.5 | 12.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.5 | 1.6 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.5 | 3.1 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.5 | 2.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.5 | 10.4 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.5 | 55.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.5 | 9.8 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.5 | 0.5 | GO:0052827 | inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 0.5 | 2.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.5 | 18.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.5 | 1.5 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.5 | 12.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.5 | 6.1 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.5 | 10.2 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.5 | 2.5 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.5 | 1.5 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.5 | 9.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.5 | 1.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.5 | 13.5 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.5 | 4.5 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.5 | 4.0 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.5 | 6.5 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
| 0.5 | 2.0 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.5 | 1.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.5 | 1.0 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.5 | 5.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.5 | 5.9 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.5 | 2.0 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.5 | 12.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.5 | 1.9 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.5 | 22.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.5 | 7.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.5 | 1.5 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.5 | 2.4 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.5 | 1.9 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.5 | 1.4 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 0.5 | 4.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.5 | 8.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.5 | 1.9 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.5 | 5.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.5 | 9.0 | GO:0005522 | profilin binding(GO:0005522) |
| 0.5 | 4.7 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.5 | 2.4 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.5 | 11.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.5 | 1.4 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.5 | 7.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.5 | 3.3 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.5 | 6.0 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.5 | 2.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.5 | 1.4 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.5 | 1.8 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.5 | 3.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.5 | 6.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.5 | 4.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.5 | 2.7 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.5 | 0.9 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.5 | 26.4 | GO:0034062 | RNA polymerase activity(GO:0034062) |
| 0.5 | 11.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.5 | 10.8 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.4 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.4 | 1.8 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.4 | 7.6 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.4 | 3.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.4 | 1.3 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.4 | 3.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.4 | 1.3 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
| 0.4 | 0.9 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.4 | 14.4 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.4 | 35.4 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.4 | 3.1 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.4 | 3.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.4 | 6.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.4 | 2.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.4 | 0.4 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.4 | 7.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.4 | 0.9 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.4 | 0.9 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.4 | 14.9 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.4 | 1.3 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) 2-aminoadipate transaminase activity(GO:0047536) |
| 0.4 | 2.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.4 | 61.0 | GO:0004386 | helicase activity(GO:0004386) |
| 0.4 | 1.3 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.4 | 25.6 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.4 | 1.7 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.4 | 2.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.4 | 1.2 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
| 0.4 | 7.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.4 | 8.6 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.4 | 1.2 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
| 0.4 | 12.6 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.4 | 0.8 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.4 | 2.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.4 | 2.4 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.4 | 1.2 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 0.4 | 1.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.4 | 1.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.4 | 0.4 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.4 | 3.9 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.4 | 1.6 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.4 | 12.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.4 | 21.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.4 | 1.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.4 | 1.9 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.4 | 4.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.4 | 1.2 | GO:0004794 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
| 0.4 | 1.5 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.4 | 7.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.4 | 5.0 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.4 | 0.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.4 | 3.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.4 | 6.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.4 | 1.5 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.4 | 90.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.4 | 14.0 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.4 | 1.1 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.4 | 7.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.4 | 1.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.4 | 13.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.4 | 1.1 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.4 | 2.6 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.4 | 2.9 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.4 | 1.5 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.4 | 1.1 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.4 | 19.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.4 | 4.0 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.4 | 56.7 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.4 | 16.2 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.4 | 1.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.4 | 3.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.4 | 3.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.4 | 95.4 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.4 | 1.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.4 | 2.1 | GO:0052656 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.4 | 3.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.4 | 4.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.4 | 2.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.4 | 2.8 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.4 | 1.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.3 | 1.7 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.3 | 2.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.3 | 14.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.3 | 9.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.3 | 11.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.3 | 6.5 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.3 | 2.7 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.3 | 0.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.3 | 0.7 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.3 | 1.4 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.3 | 34.2 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.3 | 10.8 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.3 | 1.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.3 | 4.0 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.3 | 1.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.3 | 7.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.3 | 3.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.3 | 0.3 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.3 | 1.6 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.3 | 13.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.3 | 0.6 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.3 | 0.6 | GO:0031432 | titin binding(GO:0031432) |
| 0.3 | 1.6 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.3 | 1.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.3 | 7.0 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.3 | 6.0 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.3 | 0.9 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.3 | 3.8 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.3 | 0.9 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.3 | 1.9 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.3 | 1.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.3 | 1.5 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.3 | 3.7 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.3 | 3.7 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.3 | 1.8 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 2.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.3 | 0.9 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.3 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.3 | 0.9 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.3 | 1.8 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.3 | 25.0 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.3 | 5.0 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.3 | 2.9 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.3 | 10.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.3 | 0.9 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.3 | 2.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.3 | 1.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.3 | 2.6 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.3 | 4.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 2.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.3 | 11.9 | GO:0051287 | NAD binding(GO:0051287) |
| 0.3 | 3.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.3 | 0.3 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.3 | 1.6 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.3 | 1.9 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.3 | 6.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.3 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.3 | 2.4 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.3 | 1.1 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.3 | 5.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.3 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
| 0.3 | 4.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.3 | 2.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 12.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.3 | 0.8 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.3 | 1.8 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.3 | 0.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.3 | 2.9 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.3 | 2.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.3 | 4.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.3 | 1.0 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.3 | 1.0 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.3 | 2.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.3 | 3.6 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.3 | 19.1 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.3 | 0.8 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.3 | 4.4 | GO:0070513 | death domain binding(GO:0070513) |
| 0.3 | 0.3 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.3 | 9.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.3 | 3.8 | GO:0015662 | ATPase activity, coupled to transmembrane movement of ions, phosphorylative mechanism(GO:0015662) |
| 0.3 | 1.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 0.8 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.3 | 37.9 | GO:0005178 | integrin binding(GO:0005178) |
| 0.3 | 4.0 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.3 | 3.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.2 | 0.7 | GO:0004139 | deoxyribose-phosphate aldolase activity(GO:0004139) |
| 0.2 | 1.0 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.2 | 3.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.2 | 1.0 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
| 0.2 | 0.2 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.2 | 13.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.2 | 0.2 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.2 | 53.3 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.2 | 41.5 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.2 | 1.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.2 | 9.4 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.2 | 1.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.2 | 5.7 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.2 | 0.7 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.2 | 12.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.2 | 5.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.2 | 1.9 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.2 | 5.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.2 | 1.7 | GO:0005112 | Notch binding(GO:0005112) |
| 0.2 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.2 | 14.0 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.2 | 2.1 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.2 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.2 | 10.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.2 | 10.6 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.2 | 135.1 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.2 | 34.1 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.2 | 1.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.2 | 11.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 1.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.2 | 3.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.2 | 0.9 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.2 | 0.4 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.2 | 0.8 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.2 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.2 | 1.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 0.4 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.2 | 6.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 3.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 98.4 | GO:0005525 | GTP binding(GO:0005525) |
| 0.2 | 2.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.2 | 17.2 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.2 | 5.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.2 | 10.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.2 | 1.4 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
| 0.2 | 1.0 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.2 | 7.1 | GO:0017022 | myosin binding(GO:0017022) |
| 0.2 | 1.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.2 | 1.6 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.2 | 7.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.2 | 3.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.2 | 1.1 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.2 | 5.9 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.2 | 4.2 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.2 | 0.2 | GO:0060229 | lipase activator activity(GO:0060229) |
| 0.2 | 1.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.2 | 0.9 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.2 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.2 | 3.5 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.2 | 2.6 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.2 | 0.9 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.2 | 1.3 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.2 | 17.7 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.2 | 1.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.2 | 0.4 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.2 | 1.4 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.2 | 2.5 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.2 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.2 | 3.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.2 | 0.5 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.2 | 10.7 | GO:0005518 | collagen binding(GO:0005518) |
| 0.2 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.2 | 0.2 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.2 | 1.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 0.5 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.2 | 0.9 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.2 | 1.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.4 | GO:0030395 | lactose binding(GO:0030395) |
| 0.1 | 1.3 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.1 | 1.9 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 2.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 2.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.4 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.3 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.6 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 8.3 | GO:0005230 | extracellular ligand-gated ion channel activity(GO:0005230) |
| 0.1 | 0.5 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.1 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 0.7 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 1.7 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.1 | 2.1 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 1.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 1.4 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 4.1 | GO:0016675 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.3 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 8.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 0.4 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 1.3 | GO:0002039 | p53 binding(GO:0002039) |
| 0.1 | 0.6 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.1 | 0.2 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.1 | 0.4 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.4 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.5 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 3.2 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 4.9 | GO:0005516 | calmodulin binding(GO:0005516) |
| 0.1 | 0.9 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 1.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.4 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 1.3 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.1 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 1.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 4.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.1 | 0.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.5 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.9 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 3.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 1.7 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.3 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.1 | 1.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 0.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.7 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 3.8 | GO:0015631 | tubulin binding(GO:0015631) |
| 0.1 | 1.5 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 1.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.5 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 1.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.3 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 0.4 | GO:0052836 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 7.7 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.1 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.1 | 0.4 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.5 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.7 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 2.4 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.1 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.1 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.1 | 0.7 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
| 0.1 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 0.8 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.1 | 0.6 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.1 | 0.8 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.1 | 0.1 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.1 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.2 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.1 | 4.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.2 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.1 | 0.3 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.1 | 2.1 | GO:0035257 | nuclear hormone receptor binding(GO:0035257) |
| 0.1 | 0.2 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.1 | 22.2 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.1 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.3 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
| 0.1 | 0.3 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.1 | 0.8 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 10.6 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 18.6 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
| 0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.0 | 3.4 | GO:0017016 | Ras GTPase binding(GO:0017016) |
| 0.0 | 0.1 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.0 | 0.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 4.4 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 2.5 | GO:0004497 | monooxygenase activity(GO:0004497) |
| 0.0 | 0.1 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.1 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.0 | 1.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.5 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.4 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.1 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.1 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 receptor activity(GO:0004918) interleukin-8 binding(GO:0019959) |
| 0.0 | 0.1 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.7 | GO:0016614 | oxidoreductase activity, acting on CH-OH group of donors(GO:0016614) |
| 0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.2 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.1 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 0.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.0 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.7 | 8.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 2.2 | 34.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 1.8 | 135.4 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 1.8 | 149.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 1.6 | 115.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 1.4 | 1.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 1.4 | 2.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 1.3 | 53.9 | PID ATR PATHWAY | ATR signaling pathway |
| 1.2 | 48.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 1.1 | 8.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 1.0 | 6.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 1.0 | 14.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.9 | 0.9 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.9 | 23.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.9 | 5.4 | PID EPO PATHWAY | EPO signaling pathway |
| 0.9 | 100.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.9 | 42.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.9 | 72.5 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.9 | 10.6 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.9 | 0.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.9 | 55.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.9 | 16.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.9 | 14.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.8 | 22.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.8 | 24.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.8 | 67.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.8 | 17.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.8 | 27.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.7 | 1.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.7 | 9.9 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.7 | 33.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.7 | 38.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.7 | 87.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.7 | 30.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.7 | 28.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.6 | 23.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.6 | 10.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.6 | 0.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.6 | 9.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.6 | 31.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.6 | 41.6 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.6 | 79.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.6 | 40.8 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.6 | 32.6 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.6 | 20.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.5 | 37.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.5 | 20.5 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.5 | 26.7 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.5 | 13.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.5 | 18.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.5 | 10.0 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.5 | 17.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.5 | 2.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.5 | 43.7 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.5 | 33.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.4 | 5.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.4 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.4 | 6.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.4 | 23.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.4 | 5.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.4 | 39.4 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.4 | 8.0 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.4 | 8.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.4 | 5.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.4 | 2.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.4 | 2.8 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.4 | 1.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.3 | 1.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.3 | 18.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.3 | 9.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.3 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.3 | 3.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.3 | 9.7 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.3 | 16.6 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.3 | 7.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.3 | 12.4 | PID ATM PATHWAY | ATM pathway |
| 0.3 | 0.8 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.3 | 6.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.2 | 20.2 | PID E2F PATHWAY | E2F transcription factor network |
| 0.2 | 3.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.2 | 3.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.2 | 12.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.2 | 5.6 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.2 | 1.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 11.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 16.9 | PID P73PATHWAY | p73 transcription factor network |
| 0.2 | 11.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.2 | 7.9 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.2 | 8.9 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.2 | 7.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.2 | 5.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.2 | 5.4 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.2 | 3.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 4.4 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.2 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 7.1 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 3.5 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.1 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 3.1 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 2.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 1.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 4.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 1.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 0.5 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 4.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 1.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.8 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 0.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 0.8 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 2.8 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.1 | 118.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 3.6 | 71.7 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 3.1 | 49.9 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 3.0 | 11.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 2.6 | 42.2 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 2.5 | 43.2 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 2.4 | 36.7 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 2.1 | 46.8 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 1.9 | 13.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 1.9 | 9.5 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 1.8 | 29.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 1.7 | 41.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 1.7 | 40.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 1.7 | 28.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 1.6 | 26.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 1.6 | 26.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 1.5 | 230.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 1.5 | 61.0 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 1.4 | 5.7 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 1.4 | 32.3 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 1.4 | 12.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 1.3 | 47.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 1.3 | 7.8 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 1.3 | 6.4 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 1.3 | 50.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 1.3 | 74.9 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 1.3 | 17.8 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 1.2 | 18.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 1.2 | 46.4 | REACTOME KINESINS | Genes involved in Kinesins |
| 1.2 | 12.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 1.2 | 50.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 1.1 | 32.6 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 1.1 | 60.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 1.1 | 9.8 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 1.1 | 17.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 1.1 | 41.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 1.1 | 5.3 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 1.0 | 6.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 1.0 | 30.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 1.0 | 33.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 1.0 | 22.6 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 1.0 | 11.3 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 1.0 | 7.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 1.0 | 1.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 1.0 | 19.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 1.0 | 77.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 1.0 | 42.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 1.0 | 26.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.9 | 39.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.9 | 22.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.9 | 33.1 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.9 | 33.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.9 | 0.9 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.9 | 5.4 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.9 | 42.8 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.9 | 54.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.9 | 19.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.9 | 14.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.9 | 36.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.9 | 16.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.8 | 11.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.8 | 13.3 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.8 | 12.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.8 | 13.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.8 | 13.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.8 | 10.6 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.8 | 2.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.8 | 15.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.8 | 33.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.8 | 18.7 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.8 | 30.1 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.8 | 15.9 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.7 | 39.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.7 | 8.9 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.7 | 11.0 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.7 | 20.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.7 | 37.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.7 | 29.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.7 | 2.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.7 | 47.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.7 | 33.9 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.7 | 2.7 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.7 | 53.0 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.7 | 3.9 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.6 | 14.3 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.6 | 14.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.6 | 3.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.6 | 13.9 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.6 | 17.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.6 | 3.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.6 | 29.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.6 | 14.6 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.6 | 9.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.6 | 8.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.6 | 34.8 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.6 | 12.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.6 | 11.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.6 | 14.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.6 | 5.8 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.6 | 9.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.6 | 11.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.6 | 1.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.6 | 2.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.6 | 2.9 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.6 | 41.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.6 | 24.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.6 | 32.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.6 | 0.6 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.6 | 35.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.6 | 4.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.6 | 8.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.5 | 21.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.5 | 10.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.5 | 14.0 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.5 | 16.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.5 | 35.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.5 | 40.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.5 | 2.6 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.5 | 12.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.5 | 11.0 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.5 | 6.8 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.5 | 0.5 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.5 | 2.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.5 | 8.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.5 | 5.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.5 | 11.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.5 | 12.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.5 | 16.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.5 | 14.1 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.5 | 14.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.5 | 13.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.5 | 4.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.5 | 12.5 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.5 | 2.8 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.5 | 5.5 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.5 | 14.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.4 | 1.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.4 | 4.5 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.4 | 23.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.4 | 2.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.4 | 46.9 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.4 | 12.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.4 | 40.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.4 | 12.7 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.4 | 6.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.4 | 5.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.4 | 10.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.4 | 11.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.4 | 5.2 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.4 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.4 | 16.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.4 | 10.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.4 | 21.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.4 | 9.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.4 | 82.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.4 | 51.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.4 | 7.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.4 | 36.7 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.4 | 4.6 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.4 | 1.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.4 | 15.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.4 | 16.8 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.3 | 9.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.3 | 10.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.3 | 7.4 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.3 | 5.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.3 | 7.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.3 | 9.0 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.3 | 11.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.3 | 2.8 | REACTOME OPSINS | Genes involved in Opsins |
| 0.3 | 15.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.3 | 8.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.3 | 8.7 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.3 | 21.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.3 | 17.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.3 | 12.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.3 | 13.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 9.8 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.2 | 3.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.2 | 3.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.2 | 4.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 4.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.2 | 1.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.2 | 5.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 2.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.2 | 1.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.2 | 4.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.2 | 1.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.2 | 6.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.2 | 2.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.2 | 12.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.2 | 7.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 1.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.2 | 2.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 26.3 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 4.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 0.5 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.1 | 11.6 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 6.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 14.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 0.9 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 1.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 2.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 3.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.1 | 19.4 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
| 0.1 | 8.1 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 2.7 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 6.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 1.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 6.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 1.6 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 1.9 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.1 | 0.6 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.5 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 1.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.8 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |