Project
avrg: SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for CUGGCUG
Z-value: 0.87
Motif logo
miRNA associated with seed CUGGCUG
| Name | miRBASE accession |
|---|---|
|
hsa-miR-3064-5p
|
MIMAT0019864 |
|
hsa-miR-6504-5p
|
MIMAT0025464 |
Activity profile of CUGGCUG motif
Sorted Z-values of CUGGCUG motif
Network of associatons between targets according to the STRING database.
First level regulatory network of CUGGCUG
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.3 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.3 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.1 | 0.3 | GO:1904204 | regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.1 | 0.3 | GO:1902228 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.2 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.1 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.0 | 0.2 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.2 | GO:0001808 | negative regulation of type IV hypersensitivity(GO:0001808) |
| 0.0 | 0.1 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.0 | 0.1 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.0 | 0.1 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 | 0.2 | GO:0072069 | ascending thin limb development(GO:0072021) DCT cell differentiation(GO:0072069) metanephric ascending thin limb development(GO:0072218) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.1 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.0 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.1 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.0 | 0.3 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.2 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.0 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.0 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.1 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.0 | 0.1 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.0 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.1 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
| 0.0 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:1901805 | beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.0 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.0 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.0 | 0.2 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.0 | 0.1 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.3 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 0.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.2 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.0 | 0.2 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.0 | 0.3 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.0 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |