avrg: SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
KLF16
|
ENSG00000129911.4 | Kruppel like factor 16 |
|
SP2
|
ENSG00000167182.11 | Sp2 transcription factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SP2 | hg19_v2_chr17_+_45973516_45973618 | -0.91 | 2.5e-08 | Click! |
| KLF16 | hg19_v2_chr19_-_1863567_1863586 | 0.08 | 7.5e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 10.4 | 41.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 10.3 | 62.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 10.2 | 40.8 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 9.2 | 27.5 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 8.5 | 33.8 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 8.3 | 49.5 | GO:1903412 | response to bile acid(GO:1903412) |
| 7.8 | 39.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 7.4 | 29.7 | GO:0061743 | motor learning(GO:0061743) |
| 7.3 | 21.8 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 7.1 | 64.0 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 6.2 | 24.7 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 5.9 | 5.9 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 5.7 | 17.1 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 5.5 | 16.5 | GO:0060927 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 5.2 | 15.5 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 5.2 | 36.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 5.0 | 29.7 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 4.9 | 39.2 | GO:0046618 | drug export(GO:0046618) |
| 4.7 | 4.7 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 4.5 | 17.9 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 4.3 | 17.3 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 4.3 | 4.3 | GO:0060599 | lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) |
| 4.3 | 17.2 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 4.3 | 12.8 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 4.2 | 8.4 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 4.2 | 4.2 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 4.1 | 20.3 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 4.0 | 16.1 | GO:0060032 | notochord regression(GO:0060032) |
| 4.0 | 12.0 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 4.0 | 11.9 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 3.7 | 22.4 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 3.7 | 11.1 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 3.7 | 32.9 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 3.6 | 18.2 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 3.6 | 3.6 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 3.6 | 10.9 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 3.6 | 7.2 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 3.6 | 10.8 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 3.6 | 21.5 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 3.6 | 10.7 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 3.5 | 17.6 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 3.5 | 13.9 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 3.5 | 3.5 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 3.5 | 13.8 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 3.4 | 27.1 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 3.4 | 10.1 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 3.4 | 20.2 | GO:0072218 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) |
| 3.3 | 13.4 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 3.3 | 6.7 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 3.3 | 9.8 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 3.2 | 9.7 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 3.2 | 12.9 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 3.2 | 12.9 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 3.2 | 9.6 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 3.2 | 9.6 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 3.1 | 9.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 3.1 | 15.5 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 3.1 | 12.3 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 3.1 | 3.1 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 3.1 | 30.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 3.0 | 42.4 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 3.0 | 36.2 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 3.0 | 42.2 | GO:0007144 | female meiosis I(GO:0007144) |
| 3.0 | 9.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 3.0 | 12.0 | GO:0002432 | granuloma formation(GO:0002432) |
| 3.0 | 18.0 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 3.0 | 6.0 | GO:0007412 | axon target recognition(GO:0007412) |
| 3.0 | 9.0 | GO:0015729 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 2.9 | 8.8 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 2.9 | 23.3 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 2.9 | 8.7 | GO:0043311 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 2.8 | 25.6 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 2.8 | 37.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 2.8 | 8.5 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 2.8 | 11.2 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 2.8 | 11.2 | GO:0003335 | corneocyte development(GO:0003335) |
| 2.8 | 8.4 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 2.8 | 16.5 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 2.7 | 11.0 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 2.7 | 8.2 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 2.7 | 8.2 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 2.7 | 2.7 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 2.7 | 5.4 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 2.7 | 10.6 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 2.6 | 13.2 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 2.6 | 10.4 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 2.5 | 7.6 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 2.5 | 10.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 2.5 | 20.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 2.5 | 10.1 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 2.5 | 15.1 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 2.5 | 7.5 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 2.5 | 12.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 2.5 | 7.4 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 2.5 | 7.4 | GO:1903465 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 2.5 | 9.8 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 2.4 | 14.5 | GO:0019427 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 2.4 | 4.8 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 2.4 | 4.8 | GO:0003285 | septum secundum development(GO:0003285) |
| 2.4 | 7.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 2.4 | 7.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 2.4 | 7.1 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 2.4 | 2.4 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 2.3 | 14.0 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 2.3 | 7.0 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 2.3 | 16.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 2.3 | 9.2 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 2.3 | 25.2 | GO:0070269 | pyroptosis(GO:0070269) |
| 2.3 | 6.8 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 2.3 | 9.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 2.2 | 6.7 | GO:1903410 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 2.2 | 11.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 2.2 | 15.5 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 2.2 | 13.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 2.2 | 10.9 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 2.2 | 6.5 | GO:0090427 | activation of meiosis(GO:0090427) |
| 2.2 | 8.7 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 2.2 | 4.3 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 2.2 | 39.0 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 2.2 | 4.3 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 2.2 | 2.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 2.2 | 4.3 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 2.1 | 4.2 | GO:0072125 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 2.1 | 8.4 | GO:2000230 | response to metformin(GO:1901558) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 2.1 | 4.2 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 2.1 | 12.6 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 2.1 | 25.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
| 2.1 | 10.5 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 2.1 | 6.2 | GO:0035623 | renal glucose absorption(GO:0035623) |
| 2.1 | 4.2 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 2.1 | 6.2 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 2.1 | 6.2 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 2.1 | 2.1 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 2.1 | 4.1 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
| 2.0 | 8.2 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 2.0 | 4.1 | GO:1902214 | regulation of interleukin-4-mediated signaling pathway(GO:1902214) |
| 2.0 | 8.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 2.0 | 4.0 | GO:0034205 | beta-amyloid formation(GO:0034205) |
| 2.0 | 8.0 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 2.0 | 10.0 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 2.0 | 6.0 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 2.0 | 14.0 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 2.0 | 6.0 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 2.0 | 25.8 | GO:0030091 | protein repair(GO:0030091) |
| 2.0 | 5.9 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 2.0 | 11.8 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 2.0 | 7.8 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 1.9 | 25.3 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 1.9 | 1.9 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 1.9 | 1.9 | GO:1901420 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
| 1.9 | 3.9 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 1.9 | 11.5 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 1.9 | 9.6 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 1.9 | 7.7 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 1.9 | 11.4 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 1.9 | 7.6 | GO:0032811 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
| 1.9 | 36.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 1.9 | 5.7 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 1.9 | 5.7 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 1.9 | 18.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 1.9 | 7.5 | GO:0006272 | leading strand elongation(GO:0006272) |
| 1.9 | 13.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 1.9 | 7.5 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 1.9 | 31.8 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 1.9 | 26.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 1.9 | 20.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 1.9 | 9.3 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 1.9 | 50.0 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 1.8 | 14.8 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.8 | 12.9 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 1.8 | 9.2 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 1.8 | 7.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 1.8 | 5.4 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 1.8 | 7.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 1.8 | 7.1 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 1.8 | 39.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 1.8 | 5.3 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 1.8 | 15.8 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 1.7 | 8.7 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 1.7 | 8.7 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 1.7 | 8.7 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 1.7 | 5.2 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 1.7 | 3.5 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 1.7 | 25.9 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.7 | 13.7 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 1.7 | 5.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 1.7 | 8.5 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 1.7 | 1.7 | GO:0090381 | regulation of heart induction(GO:0090381) regulation of heart induction by canonical Wnt signaling pathway(GO:0100012) |
| 1.7 | 5.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 1.7 | 10.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 1.7 | 5.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 1.7 | 3.3 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 1.7 | 1.7 | GO:0021772 | olfactory bulb development(GO:0021772) |
| 1.7 | 8.3 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 1.7 | 5.0 | GO:2001113 | negative regulation of hepatocyte growth factor receptor signaling pathway(GO:1902203) regulation of cellular response to hepatocyte growth factor stimulus(GO:2001112) negative regulation of cellular response to hepatocyte growth factor stimulus(GO:2001113) |
| 1.7 | 5.0 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 1.7 | 11.6 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 1.7 | 5.0 | GO:1901207 | regulation of heart looping(GO:1901207) |
| 1.7 | 6.6 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 1.6 | 37.7 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 1.6 | 13.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 1.6 | 8.2 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 1.6 | 21.0 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 1.6 | 4.8 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 1.6 | 3.2 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 1.6 | 3.2 | GO:0060023 | soft palate development(GO:0060023) |
| 1.6 | 9.5 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 1.6 | 4.7 | GO:1904530 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 1.6 | 12.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 1.6 | 6.3 | GO:1904481 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 1.6 | 7.8 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 1.6 | 12.4 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 1.5 | 6.2 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 1.5 | 12.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 1.5 | 23.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 1.5 | 10.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 1.5 | 6.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 1.5 | 19.8 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 1.5 | 4.6 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 1.5 | 4.5 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 1.5 | 4.5 | GO:1903925 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 1.5 | 6.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 1.5 | 3.0 | GO:0072014 | proximal tubule development(GO:0072014) |
| 1.5 | 3.0 | GO:0014038 | regulation of Schwann cell differentiation(GO:0014038) |
| 1.5 | 4.5 | GO:0010159 | specification of organ position(GO:0010159) |
| 1.5 | 1.5 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 1.5 | 1.5 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 1.5 | 4.5 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 1.5 | 5.9 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 1.5 | 11.9 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 1.5 | 1.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 1.5 | 5.9 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 1.5 | 4.4 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 1.4 | 2.9 | GO:0017158 | regulation of calcium ion-dependent exocytosis(GO:0017158) |
| 1.4 | 8.6 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 1.4 | 4.3 | GO:0072236 | metanephric loop of Henle development(GO:0072236) |
| 1.4 | 1.4 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 1.4 | 22.8 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 1.4 | 7.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 1.4 | 9.9 | GO:0019075 | virus maturation(GO:0019075) |
| 1.4 | 19.9 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 1.4 | 4.3 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 1.4 | 12.7 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 1.4 | 1.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 1.4 | 8.5 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 1.4 | 2.8 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 1.4 | 5.6 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 1.4 | 9.8 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 1.4 | 18.0 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 1.4 | 5.5 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 1.4 | 15.0 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 1.4 | 4.1 | GO:0018012 | N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 1.4 | 15.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 1.4 | 4.1 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 1.4 | 5.4 | GO:0071462 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
| 1.3 | 4.0 | GO:0034963 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 1.3 | 5.4 | GO:0015819 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 1.3 | 2.7 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 1.3 | 1.3 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 1.3 | 1.3 | GO:0033058 | directional locomotion(GO:0033058) |
| 1.3 | 8.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 1.3 | 15.9 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 1.3 | 1.3 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 1.3 | 4.0 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 1.3 | 19.7 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 1.3 | 6.6 | GO:0045007 | depurination(GO:0045007) |
| 1.3 | 18.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 1.3 | 26.2 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 1.3 | 15.7 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 1.3 | 19.3 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 1.3 | 9.0 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 1.3 | 1.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 1.3 | 11.6 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 1.3 | 28.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 1.3 | 2.6 | GO:0035989 | tendon development(GO:0035989) |
| 1.3 | 3.8 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
| 1.3 | 6.4 | GO:0031296 | B cell costimulation(GO:0031296) |
| 1.3 | 11.4 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 1.3 | 13.9 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 1.3 | 2.5 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 1.3 | 15.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 1.3 | 12.6 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 1.3 | 6.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 1.3 | 17.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 1.3 | 1.3 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 1.2 | 2.5 | GO:0072197 | ureter morphogenesis(GO:0072197) |
| 1.2 | 5.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 1.2 | 6.2 | GO:0050893 | sensory processing(GO:0050893) |
| 1.2 | 3.7 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 1.2 | 12.5 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 1.2 | 5.0 | GO:0072179 | nephric duct formation(GO:0072179) |
| 1.2 | 2.5 | GO:0042323 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 1.2 | 3.7 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 1.2 | 1.2 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 1.2 | 6.2 | GO:0090042 | tubulin deacetylation(GO:0090042) |
| 1.2 | 2.5 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 1.2 | 2.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 1.2 | 3.7 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 1.2 | 4.8 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 1.2 | 4.8 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 1.2 | 4.8 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 1.2 | 3.6 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 1.2 | 4.8 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 1.2 | 18.0 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 1.2 | 6.0 | GO:0032218 | riboflavin transport(GO:0032218) |
| 1.2 | 11.9 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 1.2 | 7.1 | GO:0051958 | methotrexate transport(GO:0051958) |
| 1.2 | 7.1 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 1.2 | 23.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 1.2 | 4.7 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 1.2 | 2.4 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 1.2 | 1.2 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 1.2 | 8.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 1.2 | 3.5 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 1.2 | 7.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 1.2 | 1.2 | GO:0040020 | regulation of meiotic nuclear division(GO:0040020) |
| 1.2 | 7.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 1.2 | 4.7 | GO:2000672 | regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
| 1.2 | 4.7 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
| 1.2 | 4.7 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 1.2 | 10.4 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 1.2 | 4.6 | GO:1990523 | bone regeneration(GO:1990523) |
| 1.2 | 30.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 1.2 | 5.8 | GO:0003352 | regulation of cilium movement(GO:0003352) |
| 1.1 | 3.4 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 1.1 | 2.3 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 1.1 | 3.4 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 1.1 | 1.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 1.1 | 3.4 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 1.1 | 1.1 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 1.1 | 6.8 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 1.1 | 2.3 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 1.1 | 6.8 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 1.1 | 2.3 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 1.1 | 3.4 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 1.1 | 13.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 1.1 | 1.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 1.1 | 12.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 1.1 | 24.5 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 1.1 | 3.3 | GO:0019516 | lactate oxidation(GO:0019516) |
| 1.1 | 8.9 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 1.1 | 6.6 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 1.1 | 4.4 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 1.1 | 4.4 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 1.1 | 2.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 1.1 | 5.5 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 1.1 | 7.6 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 1.1 | 13.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 1.1 | 3.3 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 1.1 | 7.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 1.1 | 26.9 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 1.1 | 9.7 | GO:0038129 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 1.1 | 18.3 | GO:0015886 | heme transport(GO:0015886) |
| 1.1 | 5.4 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 1.1 | 3.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 1.1 | 3.2 | GO:0035425 | autocrine signaling(GO:0035425) |
| 1.1 | 2.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 1.1 | 5.3 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
| 1.1 | 11.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 1.1 | 5.3 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 1.1 | 2.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 1.1 | 5.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 1.1 | 3.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 1.1 | 4.3 | GO:0009111 | vitamin catabolic process(GO:0009111) |
| 1.1 | 2.1 | GO:0051963 | regulation of synapse assembly(GO:0051963) |
| 1.1 | 2.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 1.1 | 1.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 1.1 | 2.1 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 1.1 | 7.4 | GO:1901523 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 1.1 | 18.9 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 1.0 | 3.1 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 1.0 | 3.1 | GO:1904875 | regulation of DNA ligase activity(GO:1904875) |
| 1.0 | 8.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 1.0 | 4.1 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 1.0 | 4.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 1.0 | 4.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 1.0 | 3.1 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 1.0 | 12.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 1.0 | 4.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 1.0 | 1.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 1.0 | 12.2 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 1.0 | 2.0 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 1.0 | 3.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 1.0 | 3.0 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 1.0 | 3.0 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 1.0 | 8.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 1.0 | 3.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 1.0 | 2.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 1.0 | 5.0 | GO:0051344 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 1.0 | 1.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 1.0 | 7.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 1.0 | 2.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 1.0 | 31.8 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 1.0 | 20.7 | GO:0022038 | corpus callosum development(GO:0022038) |
| 1.0 | 2.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 1.0 | 13.8 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 1.0 | 4.9 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 1.0 | 40.1 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 1.0 | 2.9 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.0 | 3.9 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 1.0 | 4.8 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 1.0 | 1.0 | GO:0006534 | cysteine metabolic process(GO:0006534) |
| 1.0 | 1.9 | GO:0045360 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 1.0 | 3.8 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.9 | 15.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.9 | 3.8 | GO:0042262 | DNA protection(GO:0042262) |
| 0.9 | 0.9 | GO:0060922 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.9 | 10.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.9 | 2.8 | GO:0009078 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.9 | 3.8 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.9 | 2.8 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.9 | 0.9 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.9 | 7.5 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.9 | 2.8 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.9 | 3.7 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.9 | 1.8 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.9 | 2.7 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.9 | 2.7 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.9 | 2.7 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.9 | 2.7 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.9 | 7.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.9 | 11.7 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.9 | 9.9 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.9 | 4.5 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.9 | 2.7 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.9 | 12.6 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.9 | 2.7 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.9 | 4.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.9 | 5.4 | GO:0060581 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.9 | 0.9 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.9 | 4.5 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.9 | 16.9 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.9 | 2.7 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.9 | 7.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.9 | 2.7 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.9 | 16.8 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.9 | 6.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.9 | 10.6 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.9 | 16.7 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.9 | 2.6 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.9 | 3.5 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.9 | 6.1 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.9 | 0.9 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.9 | 2.6 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.9 | 1.7 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.9 | 2.6 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.9 | 0.9 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.9 | 2.6 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.9 | 1.7 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.9 | 6.8 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.8 | 3.4 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.8 | 5.9 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.8 | 5.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.8 | 5.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.8 | 15.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.8 | 2.5 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.8 | 3.4 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.8 | 19.2 | GO:0051412 | response to corticosterone(GO:0051412) |
| 0.8 | 4.2 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.8 | 3.3 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.8 | 3.3 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.8 | 0.8 | GO:0002514 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.8 | 6.6 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.8 | 5.8 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.8 | 5.8 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.8 | 9.9 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.8 | 16.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.8 | 9.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.8 | 22.1 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.8 | 4.1 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.8 | 5.7 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.8 | 9.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.8 | 3.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.8 | 8.1 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.8 | 0.8 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.8 | 5.6 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.8 | 1.6 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.8 | 2.4 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.8 | 4.7 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.8 | 10.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.8 | 4.7 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.8 | 14.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.8 | 2.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.8 | 3.8 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.8 | 1.5 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.8 | 2.3 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
| 0.8 | 5.3 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.8 | 4.5 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.8 | 0.8 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.8 | 7.6 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.8 | 2.3 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.8 | 2.3 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.8 | 0.8 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.8 | 157.6 | GO:0006414 | translational elongation(GO:0006414) |
| 0.7 | 6.7 | GO:0007135 | meiosis II(GO:0007135) |
| 0.7 | 1.5 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.7 | 2.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.7 | 2.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.7 | 0.7 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.7 | 35.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.7 | 0.7 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.7 | 0.7 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.7 | 0.7 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.7 | 15.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.7 | 4.4 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.7 | 0.7 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.7 | 4.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.7 | 3.0 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.7 | 2.9 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.7 | 1.5 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
| 0.7 | 2.2 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.7 | 5.1 | GO:0060356 | leucine import(GO:0060356) |
| 0.7 | 5.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.7 | 16.8 | GO:0001964 | startle response(GO:0001964) |
| 0.7 | 10.2 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.7 | 5.8 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.7 | 3.6 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.7 | 1.4 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.7 | 3.6 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.7 | 3.6 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.7 | 1.4 | GO:0090186 | regulation of pancreatic juice secretion(GO:0090186) |
| 0.7 | 1.4 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.7 | 1.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.7 | 2.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.7 | 2.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.7 | 3.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.7 | 0.7 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.7 | 3.5 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.7 | 14.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.7 | 5.6 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.7 | 3.5 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.7 | 1.4 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.7 | 4.9 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.7 | 2.1 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.7 | 4.9 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.7 | 2.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.7 | 11.1 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.7 | 0.7 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.7 | 1.4 | GO:0021884 | forebrain neuron development(GO:0021884) |
| 0.7 | 1.4 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.7 | 6.9 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.7 | 9.7 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.7 | 4.8 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.7 | 1.4 | GO:0052501 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.7 | 13.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.7 | 4.8 | GO:0050955 | thermoception(GO:0050955) |
| 0.7 | 0.7 | GO:1902603 | carnitine transmembrane transport(GO:1902603) |
| 0.7 | 2.7 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.7 | 4.1 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.7 | 2.0 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.7 | 1.4 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.7 | 2.7 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.7 | 16.3 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.7 | 11.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.7 | 2.0 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.7 | 1.4 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.7 | 3.4 | GO:0051610 | serotonin uptake(GO:0051610) |
| 0.7 | 3.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.7 | 2.0 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.7 | 4.7 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.7 | 7.3 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.7 | 11.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.7 | 3.3 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.7 | 5.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.7 | 17.8 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.7 | 11.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.7 | 5.2 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.7 | 5.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.7 | 1.3 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.6 | 1.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.6 | 7.1 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.6 | 1.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.6 | 7.8 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.6 | 0.6 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.6 | 5.8 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.6 | 5.8 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.6 | 27.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.6 | 3.2 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.6 | 1.3 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.6 | 5.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.6 | 1.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.6 | 2.6 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.6 | 2.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.6 | 14.7 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.6 | 1.9 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.6 | 3.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.6 | 17.2 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.6 | 1.3 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.6 | 2.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.6 | 2.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.6 | 5.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.6 | 5.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.6 | 0.6 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.6 | 3.1 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.6 | 1.3 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.6 | 2.5 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.6 | 3.1 | GO:2000255 | regulation of male germ cell proliferation(GO:2000254) negative regulation of male germ cell proliferation(GO:2000255) |
| 0.6 | 1.9 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.6 | 4.4 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.6 | 17.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.6 | 4.9 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.6 | 1.2 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.6 | 2.5 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.6 | 5.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.6 | 1.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.6 | 12.2 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.6 | 4.9 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.6 | 3.6 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.6 | 3.0 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.6 | 13.9 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.6 | 0.6 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.6 | 1.8 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.6 | 1.2 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.6 | 2.4 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.6 | 7.8 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.6 | 1.8 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.6 | 9.0 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.6 | 4.2 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.6 | 3.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.6 | 13.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.6 | 23.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.6 | 12.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.6 | 1.2 | GO:1990927 | negative regulation of membrane invagination(GO:1905154) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.6 | 4.1 | GO:0007442 | hindgut morphogenesis(GO:0007442) embryonic hindgut morphogenesis(GO:0048619) |
| 0.6 | 4.7 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.6 | 1.8 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.6 | 2.3 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.6 | 17.6 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.6 | 10.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.6 | 5.8 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.6 | 1.2 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.6 | 0.6 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 0.6 | 2.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.6 | 4.6 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.6 | 2.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.6 | 2.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.6 | 0.6 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.6 | 5.1 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.6 | 2.8 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.6 | 3.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.6 | 8.5 | GO:0006547 | histidine metabolic process(GO:0006547) |
| 0.6 | 1.7 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.6 | 2.8 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.6 | 4.5 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.6 | 1.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.6 | 1.1 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.6 | 3.4 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.6 | 1.7 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.6 | 0.6 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.6 | 3.9 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.6 | 5.0 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.6 | 1.7 | GO:1904586 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) hepatocyte dedifferentiation(GO:1990828) |
| 0.6 | 1.7 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.6 | 1.7 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.6 | 12.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.6 | 10.0 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.6 | 1.7 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.6 | 3.9 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.6 | 1.1 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) positive regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000340) |
| 0.6 | 1.7 | GO:0009410 | response to xenobiotic stimulus(GO:0009410) |
| 0.5 | 4.9 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.5 | 1.6 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.5 | 1.1 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.5 | 54.5 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.5 | 9.3 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.5 | 0.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.5 | 2.2 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.5 | 8.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.5 | 4.3 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.5 | 2.2 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.5 | 3.2 | GO:0045837 | negative regulation of mitochondrial membrane potential(GO:0010917) negative regulation of membrane potential(GO:0045837) |
| 0.5 | 1.6 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.5 | 18.8 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.5 | 5.4 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.5 | 2.7 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.5 | 0.5 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.5 | 1.1 | GO:0071389 | cellular response to mineralocorticoid stimulus(GO:0071389) |
| 0.5 | 3.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.5 | 0.5 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.5 | 14.9 | GO:0048566 | embryonic digestive tract development(GO:0048566) |
| 0.5 | 3.7 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.5 | 4.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.5 | 1.6 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.5 | 4.7 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.5 | 5.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.5 | 2.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.5 | 4.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.5 | 3.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.5 | 2.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.5 | 3.6 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) |
| 0.5 | 7.3 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.5 | 3.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.5 | 2.6 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.5 | 1.0 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.5 | 2.1 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.5 | 3.6 | GO:0032305 | positive regulation of icosanoid secretion(GO:0032305) positive regulation of fatty acid transport(GO:2000193) |
| 0.5 | 3.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.5 | 3.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.5 | 8.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.5 | 0.5 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.5 | 2.0 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.5 | 0.5 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.5 | 1.5 | GO:0015820 | leucine transport(GO:0015820) |
| 0.5 | 4.6 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.5 | 11.2 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.5 | 1.0 | GO:0035696 | monocyte extravasation(GO:0035696) positive regulation of smooth muscle cell chemotaxis(GO:0071673) regulation of monocyte extravasation(GO:2000437) |
| 0.5 | 14.7 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.5 | 19.7 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.5 | 5.0 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.5 | 9.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.5 | 0.5 | GO:0051133 | regulation of NK T cell activation(GO:0051133) |
| 0.5 | 1.0 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.5 | 1.5 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.5 | 2.5 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.5 | 2.0 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.5 | 2.5 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.5 | 2.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.5 | 2.5 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.5 | 1.5 | GO:0045359 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.5 | 39.1 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.5 | 37.6 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.5 | 3.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.5 | 2.5 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.5 | 2.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.5 | 2.5 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.5 | 2.9 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.5 | 5.9 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.5 | 2.0 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.5 | 11.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.5 | 5.3 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.5 | 1.9 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.5 | 1.5 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.5 | 1.0 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.5 | 1.9 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.5 | 1.9 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.5 | 2.9 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.5 | 2.4 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.5 | 4.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.5 | 1.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.5 | 9.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.5 | 1.0 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
| 0.5 | 2.8 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.5 | 1.4 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.5 | 0.5 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.5 | 41.4 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.5 | 13.2 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.5 | 16.9 | GO:0061641 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.5 | 1.4 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.5 | 6.1 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.5 | 1.4 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.5 | 2.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 14.9 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.5 | 9.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.5 | 1.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.5 | 1.9 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.5 | 2.8 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.5 | 0.9 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.5 | 6.5 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.5 | 2.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.5 | 0.5 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.5 | 2.7 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.5 | 0.9 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.5 | 10.5 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.5 | 5.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.5 | 0.9 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.5 | 7.7 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.5 | 7.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.5 | 1.8 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.5 | 1.8 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.5 | 1.8 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.5 | 2.7 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.4 | 3.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.4 | 4.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.4 | 0.4 | GO:0043092 | L-amino acid import(GO:0043092) |
| 0.4 | 2.2 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.4 | 3.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.4 | 0.9 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.4 | 2.2 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.4 | 2.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.4 | 1.8 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.4 | 2.2 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.4 | 1.8 | GO:1902932 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) positive regulation of alcohol biosynthetic process(GO:1902932) |
| 0.4 | 1.8 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.4 | 1.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.4 | 1.3 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.4 | 0.9 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.4 | 3.0 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.4 | 0.9 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.4 | 2.6 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.4 | 1.3 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.4 | 0.4 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.4 | 2.6 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.4 | 1.3 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.4 | 1.3 | GO:0009151 | purine deoxyribonucleotide metabolic process(GO:0009151) purine deoxyribonucleoside triphosphate metabolic process(GO:0009215) |
| 0.4 | 2.6 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.4 | 3.4 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.4 | 4.3 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.4 | 2.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.4 | 8.1 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.4 | 1.7 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.4 | 23.7 | GO:0061621 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.4 | 14.8 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.4 | 0.4 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.4 | 3.4 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.4 | 0.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.4 | 1.7 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.4 | 0.8 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.4 | 2.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.4 | 2.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.4 | 19.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.4 | 16.6 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.4 | 1.2 | GO:0048749 | compound eye development(GO:0048749) |
| 0.4 | 24.8 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.4 | 1.7 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.4 | 4.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.4 | 1.2 | GO:0003183 | mitral valve morphogenesis(GO:0003183) |
| 0.4 | 2.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.4 | 9.4 | GO:0015893 | drug transport(GO:0015893) |
| 0.4 | 2.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.4 | 1.2 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.4 | 16.4 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.4 | 1.2 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.4 | 4.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.4 | 0.4 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.4 | 4.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.4 | 1.6 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.4 | 1.2 | GO:0042311 | vasodilation(GO:0042311) |
| 0.4 | 21.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.4 | 6.5 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.4 | 1.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.4 | 4.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.4 | 11.0 | GO:0072663 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.4 | 0.8 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| 0.4 | 2.8 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.4 | 1.2 | GO:0090208 | positive regulation of triglyceride metabolic process(GO:0090208) |
| 0.4 | 0.4 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.4 | 2.8 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.4 | 0.4 | GO:1901723 | negative regulation of cell proliferation involved in kidney development(GO:1901723) |
| 0.4 | 1.6 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 | 0.4 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
| 0.4 | 1.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.4 | 1.6 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.4 | 1.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.4 | 1.6 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.4 | 1.9 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.4 | 1.9 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.4 | 9.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.4 | 5.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.4 | 4.6 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.4 | 1.9 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.4 | 32.8 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.4 | 1.5 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.4 | 1.9 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.4 | 0.8 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.4 | 1.9 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.4 | 2.3 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.4 | 1.9 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.4 | 4.5 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.4 | 3.4 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.4 | 1.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.4 | 1.9 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.4 | 2.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.4 | 0.7 | GO:0015827 | tryptophan transport(GO:0015827) |
| 0.4 | 1.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.4 | 8.9 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.4 | 1.5 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.4 | 3.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.4 | 4.1 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.4 | 0.7 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.4 | 2.6 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.4 | 4.1 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.4 | 6.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.4 | 2.2 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.4 | 51.4 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.4 | 2.9 | GO:0090307 | mitotic spindle assembly(GO:0090307) |
| 0.4 | 2.2 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.4 | 0.7 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.4 | 0.7 | GO:0033384 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.4 | 2.2 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.4 | 5.4 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.4 | 0.4 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.4 | 2.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.4 | 0.7 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.4 | 2.5 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.4 | 1.8 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) |
| 0.4 | 3.2 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.4 | 13.7 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.4 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 0.7 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.3 | 0.3 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.3 | 0.7 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.3 | 0.7 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.3 | 43.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.3 | 0.7 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.3 | 1.4 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.3 | 1.7 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.3 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.3 | 1.0 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.3 | 0.7 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.3 | 6.8 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.3 | 3.0 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 | 0.7 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.3 | 1.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.3 | 0.7 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.3 | 1.7 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.3 | 1.7 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 | 2.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.3 | 1.3 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.3 | 1.7 | GO:0006983 | ER overload response(GO:0006983) |
| 0.3 | 1.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 | 0.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.3 | 4.9 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.3 | 4.6 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.3 | 2.3 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.3 | 1.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.3 | 3.6 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.3 | 6.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.3 | 1.0 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.3 | 0.6 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.3 | 1.0 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.3 | 3.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.3 | 1.6 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.3 | 2.8 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.3 | 1.9 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.3 | 5.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.3 | 3.7 | GO:0009304 | tRNA transcription(GO:0009304) |
| 0.3 | 3.7 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.3 | 2.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.3 | 5.8 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.3 | 0.3 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.3 | 8.5 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.3 | 2.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.3 | 5.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.3 | 0.6 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.3 | 1.2 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.3 | 1.2 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.3 | 0.6 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.3 | 0.6 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.3 | 5.3 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.3 | 3.8 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.3 | 1.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.3 | 0.9 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.3 | 1.4 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.3 | 0.6 | GO:0007494 | midgut development(GO:0007494) |
| 0.3 | 1.2 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.3 | 4.9 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.3 | 1.4 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.3 | 0.3 | GO:1902232 | regulation of positive thymic T cell selection(GO:1902232) |
| 0.3 | 1.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.3 | 2.6 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.3 | 0.3 | GO:0044254 | angiotensin catabolic process in blood(GO:0002005) multicellular organismal protein catabolic process(GO:0044254) protein digestion(GO:0044256) multicellular organismal macromolecule catabolic process(GO:0044266) |
| 0.3 | 0.3 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.3 | 1.1 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.3 | 7.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.3 | 2.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.3 | 2.5 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.3 | 2.8 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.3 | 0.8 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.3 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 | 4.1 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.3 | 1.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.3 | 2.2 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.3 | 0.3 | GO:1904238 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
| 0.3 | 3.5 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.3 | 0.3 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.3 | 2.4 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.3 | 0.3 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.3 | 0.3 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.3 | 1.6 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.3 | 2.1 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.3 | 1.9 | GO:0003159 | morphogenesis of an endothelium(GO:0003159) |
| 0.3 | 1.3 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.3 | 1.6 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.3 | 0.8 | GO:0030070 | insulin processing(GO:0030070) |
| 0.3 | 0.3 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.3 | 1.3 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.3 | 2.9 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.3 | 9.5 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.3 | 2.1 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.3 | 1.0 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.3 | 0.8 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.3 | 4.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 1.0 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.2 | 1.5 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.2 | 1.0 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.2 | 2.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.2 | 0.5 | GO:0021589 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 0.2 | 1.7 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 0.7 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.2 | 0.5 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 | 1.9 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.2 | 0.7 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.2 | 0.5 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.2 | 4.8 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.2 | 7.3 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.2 | 1.5 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.2 | 0.5 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.2 | 0.5 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.2 | 0.5 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.2 | 1.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.2 | 2.4 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.2 | 1.7 | GO:0010133 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.2 | 3.3 | GO:0086070 | SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
| 0.2 | 0.9 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.2 | 1.9 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.2 | 1.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 | 3.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.2 | 8.1 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.2 | 8.1 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.2 | 1.2 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.2 | 0.5 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.2 | 2.3 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.2 | 0.7 | GO:0048663 | neuron fate commitment(GO:0048663) |
| 0.2 | 1.6 | GO:0016129 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.2 | 4.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 | 0.2 | GO:0060740 | prostate gland epithelium morphogenesis(GO:0060740) |
| 0.2 | 1.8 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 0.4 | GO:1902598 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.2 | 0.2 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.2 | 0.9 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.2 | 8.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.2 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.2 | 0.2 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.2 | 0.9 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.2 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 | 9.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.2 | 2.2 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.2 | 1.3 | GO:0072178 | nephric duct morphogenesis(GO:0072178) |
| 0.2 | 0.9 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.2 | 4.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.2 | 1.3 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.2 | 1.5 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 | 0.4 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.2 | 0.4 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.2 | 0.6 | GO:0050822 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.2 | 2.3 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.2 | 2.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.2 | 0.6 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.2 | 0.8 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.2 | 1.3 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.8 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.2 | 0.4 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.2 | 1.7 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.2 | 1.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 1.0 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.2 | 0.8 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 | 1.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.2 | 1.9 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.2 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.2 | 2.0 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.2 | 8.2 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.2 | 0.2 | GO:2000380 | regulation of mesoderm development(GO:2000380) |
| 0.2 | 0.6 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.2 | 1.0 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.2 | 0.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.2 | 0.8 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.2 | 1.2 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.2 | 0.8 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.2 | 1.2 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.2 | 2.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 | 1.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.2 | 1.0 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.2 | 4.1 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.2 | 3.9 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.2 | 1.0 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.2 | 3.1 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.2 | 1.3 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.2 | 1.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.2 | 2.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.6 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 0.2 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.2 | 6.8 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.2 | 0.9 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.2 | 1.9 | GO:0048806 | genitalia development(GO:0048806) |
| 0.2 | 0.6 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.2 | 2.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 | 0.7 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.2 | 0.7 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.2 | 0.4 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.2 | 2.4 | GO:0050999 | regulation of nitric-oxide synthase activity(GO:0050999) |
| 0.2 | 1.1 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.2 | 0.4 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.2 | 0.9 | GO:0022029 | telencephalon cell migration(GO:0022029) |
| 0.2 | 2.2 | GO:0019835 | cytolysis(GO:0019835) |
| 0.2 | 1.4 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) |
| 0.2 | 0.5 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.2 | 3.0 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.2 | 1.8 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 | 0.4 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.2 | 0.7 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.2 | 0.5 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 | 0.3 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.2 | 0.3 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.2 | 1.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.2 | 1.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.2 | 1.6 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.2 | 1.0 | GO:0043584 | nose development(GO:0043584) |
| 0.2 | 0.5 | GO:0046606 | negative regulation of centrosome cycle(GO:0046606) |
| 0.2 | 0.3 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) |
| 0.2 | 0.5 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.2 | 2.0 | GO:0072112 | renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) |
| 0.2 | 2.0 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.2 | 2.0 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.2 | 0.5 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.2 | 0.7 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.2 | 1.7 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.2 | 0.5 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.2 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 | 2.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.2 | 1.6 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.2 | 0.3 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.2 | 1.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 1.3 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.2 | 0.5 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.2 | 6.7 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.2 | 1.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 1.6 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 | 0.8 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.2 | 0.8 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.2 | 5.0 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.2 | 1.6 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 | 0.5 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.2 | 0.8 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.2 | 10.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.2 | 0.3 | GO:2001302 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.2 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.2 | 2.7 | GO:0000732 | strand displacement(GO:0000732) |
| 0.2 | 0.3 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
| 0.1 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 | 0.3 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.1 | 1.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 1.5 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 | 0.3 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 0.4 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 0.9 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.4 | GO:2000366 | cardiac muscle tissue regeneration(GO:0061026) regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 | 0.3 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 2.0 | GO:0072698 | protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.1 | 0.1 | GO:0008356 | asymmetric cell division(GO:0008356) |
| 0.1 | 0.9 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.1 | 0.4 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.1 | 0.6 | GO:2000176 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.1 | 2.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 3.8 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 3.9 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.6 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.1 | 0.1 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 | 1.7 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 1.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 0.3 | GO:0072720 | cellular response to mycotoxin(GO:0036146) response to dithiothreitol(GO:0072720) |
| 0.1 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.4 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
| 0.1 | 0.1 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 4.3 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.1 | 3.1 | GO:0043030 | regulation of macrophage activation(GO:0043030) |
| 0.1 | 0.8 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.1 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 0.8 | GO:1900120 | regulation of receptor binding(GO:1900120) |
| 0.1 | 0.3 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
| 0.1 | 0.7 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.1 | 2.0 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.1 | 1.5 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.1 | 1.1 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 0.3 | GO:0042414 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 | 0.8 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.1 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.1 | 0.4 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 2.8 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.1 | 1.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 2.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.1 | 2.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.1 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.1 | 0.6 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.1 | 1.4 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.1 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.1 | 0.7 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 2.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.4 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.1 | 0.6 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.5 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.1 | 0.5 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.5 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.2 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 | 6.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.2 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.1 | 1.1 | GO:0019043 | establishment of viral latency(GO:0019043) establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 1.4 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 | 0.4 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 1.4 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 3.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 1.2 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.1 | 0.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 2.0 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
| 0.1 | 4.3 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
| 0.1 | 0.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 0.2 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 1.0 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.1 | 0.1 | GO:0001708 | cell fate specification(GO:0001708) |
| 0.1 | 3.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.1 | 2.4 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.1 | 0.4 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
| 0.1 | 0.5 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 0.8 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 2.5 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.4 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.2 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
| 0.1 | 0.5 | GO:0034372 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 2.3 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.1 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.4 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.1 | 0.2 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.1 | 1.0 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.4 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.1 | 0.5 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.5 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 2.0 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 1.3 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.1 | 1.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.1 | 0.5 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 | 0.3 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 | 0.8 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.1 | 0.3 | GO:0060437 | lung growth(GO:0060437) |
| 0.1 | 1.8 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 1.0 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 1.2 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 1.9 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.5 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.9 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 | 0.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.3 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.3 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.1 | 0.5 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 0.4 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.1 | 0.9 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.2 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.1 | 2.4 | GO:0006836 | neurotransmitter transport(GO:0006836) |
| 0.1 | 1.3 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.5 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
| 0.1 | 6.1 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.2 | GO:0009310 | amine catabolic process(GO:0009310) |
| 0.1 | 0.6 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 0.2 | GO:0015851 | nucleobase transport(GO:0015851) |
| 0.1 | 5.3 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.1 | 0.6 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 1.7 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.5 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
| 0.1 | 0.5 | GO:0051231 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) |
| 0.1 | 0.2 | GO:0045553 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.1 | 0.9 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.1 | 0.6 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.5 | GO:0051149 | positive regulation of muscle cell differentiation(GO:0051149) |
| 0.1 | 0.3 | GO:0045924 | negative regulation of female receptivity(GO:0007621) regulation of female receptivity(GO:0045924) |
| 0.1 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.4 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.1 | GO:0042214 | terpene metabolic process(GO:0042214) |
| 0.1 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.1 | 0.9 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 0.2 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.1 | 0.6 | GO:0033198 | response to ATP(GO:0033198) |
| 0.1 | 0.1 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.2 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.1 | 0.1 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) protein localization to nucleoplasm(GO:1990173) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.1 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.1 | 0.2 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.1 | 0.6 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.3 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 0.4 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.2 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.1 | 0.5 | GO:0048265 | response to pain(GO:0048265) |
| 0.1 | 0.1 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.3 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.1 | 0.2 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.1 | 0.4 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.7 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.1 | 0.9 | GO:0006073 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 | 1.1 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.1 | 0.1 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.1 | 2.6 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.1 | 0.5 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) |
| 0.1 | 0.4 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 0.8 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
| 0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.3 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.6 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 1.1 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.1 | 0.4 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.1 | 0.1 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 0.4 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.1 | 0.1 | GO:0007500 | mesodermal cell fate determination(GO:0007500) |
| 0.1 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.8 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.2 | GO:2000825 | regulation of androgen receptor activity(GO:2000823) positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.8 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.2 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.1 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.3 | GO:0046373 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.1 | 0.2 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.5 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 1.5 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.6 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.4 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.1 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.0 | 0.1 | GO:2000845 | androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.0 | 0.1 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.0 | 0.4 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.2 | GO:0045333 | cellular respiration(GO:0045333) |
| 0.0 | 0.2 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.6 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.2 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.0 | 0.2 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 3.4 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.1 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.3 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.0 | 0.4 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.2 | GO:0003170 | heart valve development(GO:0003170) |
| 0.0 | 0.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.3 | GO:0071265 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.2 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.0 | 0.6 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.0 | 0.3 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.3 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.3 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.0 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.0 | 0.2 | GO:0007281 | germ cell development(GO:0007281) |
| 0.0 | 0.0 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.1 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.0 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:0031179 | peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.0 | 0.1 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 | 0.1 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.1 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 | 0.1 | GO:0038194 | thyroid-stimulating hormone signaling pathway(GO:0038194) cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.0 | 0.1 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.1 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.0 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 8.4 | 42.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 8.3 | 24.8 | GO:0098855 | HCN channel complex(GO:0098855) |
| 5.2 | 31.4 | GO:0071797 | LUBAC complex(GO:0071797) |
| 4.3 | 17.2 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 4.3 | 4.3 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 4.1 | 12.3 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 4.1 | 32.8 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 3.9 | 23.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 3.7 | 22.0 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 3.5 | 24.5 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 3.4 | 13.6 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 3.3 | 10.0 | GO:0035101 | FACT complex(GO:0035101) |
| 3.2 | 16.0 | GO:0002133 | polycystin complex(GO:0002133) |
| 3.1 | 74.9 | GO:0005861 | troponin complex(GO:0005861) |
| 3.0 | 9.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 2.9 | 38.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 2.8 | 13.8 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 2.7 | 10.8 | GO:1990742 | microvesicle(GO:1990742) |
| 2.6 | 10.5 | GO:0044301 | climbing fiber(GO:0044301) |
| 2.5 | 7.5 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 2.5 | 9.9 | GO:0097635 | extrinsic component of autophagosome membrane(GO:0097635) |
| 2.5 | 19.7 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 2.4 | 16.9 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 2.4 | 12.0 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 2.4 | 21.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 2.3 | 11.6 | GO:0070701 | mucus layer(GO:0070701) |
| 2.2 | 6.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 2.2 | 17.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 2.1 | 16.8 | GO:0035976 | AP1 complex(GO:0035976) |
| 2.1 | 14.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 2.0 | 8.1 | GO:0043293 | apoptosome(GO:0043293) |
| 2.0 | 7.9 | GO:0097196 | Shu complex(GO:0097196) |
| 2.0 | 11.9 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 2.0 | 33.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 1.9 | 38.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 1.9 | 7.5 | GO:0031523 | Myb complex(GO:0031523) |
| 1.9 | 5.6 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
| 1.8 | 25.9 | GO:0070652 | HAUS complex(GO:0070652) |
| 1.8 | 1.8 | GO:0005652 | nuclear lamina(GO:0005652) |
| 1.8 | 1.8 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 1.8 | 5.4 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 1.8 | 10.7 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 1.8 | 10.6 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 1.7 | 5.2 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 1.7 | 7.0 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 1.7 | 10.4 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 1.7 | 6.9 | GO:0000811 | GINS complex(GO:0000811) |
| 1.7 | 36.7 | GO:0035102 | PRC1 complex(GO:0035102) |
| 1.7 | 26.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 1.6 | 74.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 1.6 | 19.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 1.6 | 9.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 1.6 | 1.6 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 1.6 | 3.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 1.6 | 14.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 1.6 | 3.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 1.5 | 23.0 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 1.5 | 6.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 1.5 | 6.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 1.5 | 4.5 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 1.5 | 13.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 1.5 | 12.1 | GO:0032009 | early phagosome(GO:0032009) |
| 1.5 | 10.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 1.5 | 10.5 | GO:0098536 | deuterosome(GO:0098536) |
| 1.5 | 1.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 1.4 | 15.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 1.4 | 7.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 1.4 | 8.5 | GO:0071817 | MMXD complex(GO:0071817) |
| 1.4 | 17.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 1.4 | 32.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 1.4 | 20.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 1.4 | 9.5 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 1.4 | 2.7 | GO:0044753 | amphisome(GO:0044753) |
| 1.3 | 23.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 1.3 | 13.1 | GO:0005638 | lamin filament(GO:0005638) |
| 1.3 | 2.6 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 1.3 | 10.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 1.3 | 2.6 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 1.3 | 12.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 1.3 | 1.3 | GO:0016342 | catenin complex(GO:0016342) |
| 1.2 | 5.0 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 1.2 | 13.6 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 1.2 | 4.9 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 1.2 | 4.9 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 1.2 | 3.7 | GO:0070938 | contractile ring(GO:0070938) |
| 1.2 | 8.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 1.2 | 2.3 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 1.2 | 3.5 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 1.2 | 12.7 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 1.1 | 24.0 | GO:0042627 | chylomicron(GO:0042627) |
| 1.1 | 3.4 | GO:0043083 | synaptic cleft(GO:0043083) |
| 1.1 | 10.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 1.1 | 19.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 1.1 | 13.6 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 1.1 | 5.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 1.1 | 3.4 | GO:0008623 | CHRAC(GO:0008623) |
| 1.1 | 7.7 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 1.1 | 4.3 | GO:0014802 | terminal cisterna(GO:0014802) |
| 1.1 | 2.1 | GO:0032982 | myosin filament(GO:0032982) |
| 1.1 | 37.9 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 1.0 | 1.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 1.0 | 7.3 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 1.0 | 17.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 1.0 | 15.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 1.0 | 4.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 1.0 | 36.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 1.0 | 20.9 | GO:0036038 | MKS complex(GO:0036038) |
| 1.0 | 54.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 1.0 | 4.9 | GO:1990031 | pinceau fiber(GO:1990031) |
| 1.0 | 8.8 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 1.0 | 10.7 | GO:0044327 | dendritic spine head(GO:0044327) |
| 1.0 | 38.8 | GO:0034451 | centriolar satellite(GO:0034451) |
| 1.0 | 5.8 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 1.0 | 5.8 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 1.0 | 3.8 | GO:0097361 | CIA complex(GO:0097361) |
| 0.9 | 0.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.9 | 12.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.9 | 2.8 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.9 | 2.8 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.9 | 12.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.9 | 5.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.9 | 2.7 | GO:0070685 | macropinocytic cup(GO:0070685) |
| 0.9 | 9.9 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.9 | 6.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.9 | 1.7 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.9 | 8.7 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.9 | 4.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.9 | 16.4 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.8 | 4.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.8 | 3.3 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.8 | 2.5 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.8 | 12.3 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.8 | 2.4 | GO:0070695 | FHF complex(GO:0070695) |
| 0.8 | 3.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.8 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.8 | 2.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.8 | 4.0 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.8 | 1.6 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.8 | 16.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.8 | 7.2 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.8 | 3.9 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.8 | 2.3 | GO:0020003 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
| 0.8 | 1.6 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.8 | 2.3 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.8 | 61.0 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.8 | 5.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.8 | 8.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.8 | 2.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.7 | 2.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.7 | 96.4 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.7 | 8.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.7 | 3.6 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.7 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.7 | 3.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.7 | 1.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.7 | 2.8 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.7 | 5.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.7 | 3.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.7 | 2.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.7 | 0.7 | GO:0044393 | microspike(GO:0044393) |
| 0.7 | 8.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.7 | 9.9 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.7 | 11.8 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.7 | 3.3 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.6 | 1.9 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.6 | 5.2 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.6 | 1.9 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.6 | 10.9 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.6 | 49.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.6 | 2.5 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.6 | 18.3 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.6 | 3.1 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.6 | 2.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.6 | 1.8 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.6 | 2.4 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.6 | 1.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.6 | 9.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.6 | 10.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.6 | 1.8 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.6 | 4.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.6 | 7.6 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.6 | 11.6 | GO:0034709 | methylosome(GO:0034709) |
| 0.6 | 4.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.6 | 2.3 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.6 | 17.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.6 | 3.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.6 | 32.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.6 | 6.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.5 | 4.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.5 | 2.7 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.5 | 10.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.5 | 3.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.5 | 5.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.5 | 9.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.5 | 2.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.5 | 4.0 | GO:0001740 | Barr body(GO:0001740) |
| 0.5 | 4.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.5 | 7.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.5 | 5.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.5 | 62.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.5 | 1.9 | GO:0055087 | Ski complex(GO:0055087) |
| 0.5 | 11.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.5 | 5.2 | GO:0031513 | nonmotile primary cilium(GO:0031513) primary cilium(GO:0072372) |
| 0.5 | 2.8 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.5 | 1.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.5 | 10.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.5 | 2.8 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.5 | 1.9 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.5 | 2.3 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.5 | 3.7 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.5 | 2.3 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.5 | 18.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.5 | 1.4 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.5 | 5.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.5 | 0.9 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.5 | 3.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.4 | 18.8 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.4 | 12.0 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.4 | 11.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.4 | 52.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.4 | 1.3 | GO:0034657 | GID complex(GO:0034657) |
| 0.4 | 15.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.4 | 1.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.4 | 5.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.4 | 3.4 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.4 | 2.6 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.4 | 9.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.4 | 2.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.4 | 1.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.4 | 0.4 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.4 | 1.2 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.4 | 1.2 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.4 | 10.7 | GO:0000145 | exocyst(GO:0000145) |
| 0.4 | 6.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.4 | 14.6 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.4 | 4.7 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
| 0.4 | 3.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.4 | 1.5 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.4 | 5.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.4 | 2.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.4 | 1.9 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.4 | 5.7 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.4 | 1.5 | GO:0060171 | myosin I complex(GO:0045160) stereocilium membrane(GO:0060171) |
| 0.4 | 3.0 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.4 | 6.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.4 | 2.9 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.4 | 4.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.4 | 15.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.4 | 0.7 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.4 | 2.9 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 2.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 12.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.3 | 4.4 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.3 | 1.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.3 | 2.3 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.3 | 2.3 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.3 | 2.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.3 | 6.6 | GO:0001741 | XY body(GO:0001741) |
| 0.3 | 7.8 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.3 | 23.1 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.3 | 1.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.3 | 0.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.3 | 3.2 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.3 | 44.6 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.3 | 5.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.3 | 39.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.3 | 0.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 8.0 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.3 | 0.9 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.3 | 2.3 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.3 | 1.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 1.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.3 | 0.8 | GO:0030689 | Noc complex(GO:0030689) |
| 0.3 | 2.7 | GO:0034464 | BBSome(GO:0034464) |
| 0.3 | 0.8 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.3 | 0.8 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 22.1 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.3 | 1.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.3 | 0.8 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 3.5 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.3 | 2.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.3 | 2.9 | GO:0005883 | neurofilament(GO:0005883) |
| 0.3 | 4.2 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.3 | 5.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.3 | 3.9 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.3 | 19.9 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.3 | 8.9 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.2 | 1.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 1.5 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.2 | 2.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 3.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 5.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.2 | 3.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 4.2 | GO:0032059 | bleb(GO:0032059) |
| 0.2 | 3.9 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.2 | 2.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 6.0 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.2 | 1.8 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 7.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 2.5 | GO:0046930 | pore complex(GO:0046930) |
| 0.2 | 20.3 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.2 | 2.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.2 | 1.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 9.2 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.2 | 4.9 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.2 | 4.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 10.1 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.2 | 1.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.2 | 2.6 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 0.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.2 | 1.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.2 | 0.8 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.2 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.2 | 0.6 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.2 | 1.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.2 | 12.2 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.2 | 1.0 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.2 | 0.6 | GO:0001534 | radial spoke(GO:0001534) |
| 0.2 | 2.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 17.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.2 | 4.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.2 | 1.7 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 25.7 | GO:0043204 | perikaryon(GO:0043204) |
| 0.2 | 45.2 | GO:0019866 | organelle inner membrane(GO:0019866) |
| 0.2 | 1.8 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.2 | 9.1 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.2 | 45.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.2 | 6.2 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.2 | 4.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.2 | 2.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.2 | 5.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.2 | 1.0 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.2 | 20.2 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.2 | 0.7 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.8 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.2 | 2.8 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.2 | 2.8 | GO:0005901 | caveola(GO:0005901) |
| 0.2 | 11.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.2 | 0.8 | GO:0000938 | GARP complex(GO:0000938) |
| 0.2 | 2.9 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 12.6 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.2 | 4.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.2 | 2.5 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.2 | 2.7 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 2.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.2 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 1.1 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.2 | 0.5 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 9.4 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.2 | 1.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 4.4 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.4 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 1.6 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.4 | GO:0044853 | plasma membrane raft(GO:0044853) |
| 0.1 | 3.5 | GO:0031095 | platelet dense tubular network(GO:0031094) platelet dense tubular network membrane(GO:0031095) |
| 0.1 | 894.0 | GO:0016021 | integral component of membrane(GO:0016021) |
| 0.1 | 1.7 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 5.9 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 1.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 1.0 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.6 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.6 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 47.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 14.5 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 2.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 1.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 5.7 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 26.2 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 10.4 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.1 | 0.6 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.1 | 0.9 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 0.8 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.9 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 1.8 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.1 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.3 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 3.3 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.7 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.9 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 19.7 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 1.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.7 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 3.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.7 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 2.6 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 11.0 | 55.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 10.9 | 32.8 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 9.4 | 9.4 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 9.1 | 27.2 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 7.5 | 37.3 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 7.3 | 43.9 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 6.8 | 27.0 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 6.5 | 39.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 6.4 | 25.6 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 6.0 | 30.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 5.5 | 22.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 5.4 | 75.5 | GO:0031014 | troponin T binding(GO:0031014) |
| 5.0 | 24.8 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 5.0 | 24.8 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 4.4 | 30.6 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 4.4 | 13.1 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 4.3 | 17.3 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 4.3 | 12.8 | GO:0048156 | tau protein binding(GO:0048156) |
| 4.0 | 47.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 3.9 | 19.3 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 3.9 | 11.6 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 3.9 | 15.4 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 3.8 | 11.3 | GO:0000773 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 3.7 | 11.1 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 3.7 | 11.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 3.6 | 10.7 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 3.5 | 17.6 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 3.4 | 20.4 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 3.3 | 16.4 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 3.2 | 29.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 3.2 | 9.6 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 3.2 | 9.6 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 3.2 | 22.3 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 3.1 | 15.5 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 3.0 | 3.0 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 3.0 | 3.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 3.0 | 9.0 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 2.9 | 8.8 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 2.9 | 26.4 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 2.9 | 23.4 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 2.9 | 8.6 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 2.8 | 2.8 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 2.8 | 8.5 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 2.8 | 28.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 2.8 | 8.4 | GO:0031896 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) V2 vasopressin receptor binding(GO:0031896) |
| 2.8 | 13.8 | GO:0010736 | serum response element binding(GO:0010736) |
| 2.8 | 8.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 2.7 | 13.7 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) ketosteroid monooxygenase activity(GO:0047086) |
| 2.7 | 40.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 2.6 | 15.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 2.6 | 10.3 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 2.6 | 2.6 | GO:0047115 | trans-1,2-dihydrobenzene-1,2-diol dehydrogenase activity(GO:0047115) |
| 2.6 | 7.7 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 2.5 | 10.2 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 2.5 | 30.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 2.4 | 7.3 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
| 2.4 | 4.9 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 2.4 | 14.4 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 2.4 | 7.2 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 2.4 | 21.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 2.4 | 21.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 2.3 | 30.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 2.3 | 20.7 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 2.3 | 6.8 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 2.3 | 6.8 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 2.2 | 4.5 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 2.2 | 6.7 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 2.2 | 6.7 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 2.2 | 11.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 2.2 | 6.6 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 2.2 | 8.8 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 2.2 | 8.7 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 2.2 | 6.5 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 2.1 | 6.4 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 2.1 | 10.7 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 2.1 | 6.3 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 2.1 | 16.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 2.0 | 18.2 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 2.0 | 8.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 2.0 | 8.0 | GO:0004335 | galactokinase activity(GO:0004335) |
| 2.0 | 6.0 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 2.0 | 39.8 | GO:0039706 | co-receptor binding(GO:0039706) |
| 2.0 | 11.8 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 2.0 | 5.9 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 2.0 | 5.9 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 1.9 | 5.8 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 1.9 | 3.8 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 1.9 | 9.6 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 1.9 | 13.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 1.9 | 9.6 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 1.9 | 5.7 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 1.9 | 5.7 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 1.9 | 3.8 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 1.9 | 5.6 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 1.8 | 7.3 | GO:0047708 | biotinidase activity(GO:0047708) |
| 1.8 | 14.5 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 1.8 | 5.4 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 1.8 | 5.4 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 1.8 | 12.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 1.8 | 5.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 1.8 | 3.5 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 1.8 | 8.9 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 1.8 | 5.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 1.8 | 7.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 1.8 | 5.3 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 1.7 | 8.7 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 1.7 | 5.2 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 1.7 | 15.3 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 1.7 | 5.0 | GO:0051499 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 1.7 | 5.0 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 1.7 | 11.7 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 1.7 | 3.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 1.7 | 6.6 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 1.6 | 4.9 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 1.6 | 4.9 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 1.6 | 30.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 1.6 | 8.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 1.6 | 12.9 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 1.6 | 4.8 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 1.6 | 4.8 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 1.6 | 12.8 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 1.6 | 9.4 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 1.6 | 6.3 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 1.6 | 6.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 1.6 | 18.7 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 1.6 | 4.7 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 1.5 | 9.3 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
| 1.5 | 6.2 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 1.5 | 4.6 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 1.5 | 39.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 1.5 | 4.5 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 1.5 | 6.0 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 1.5 | 13.6 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 1.5 | 1.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 1.5 | 12.0 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 1.5 | 6.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 1.5 | 4.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
| 1.5 | 22.2 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 1.5 | 8.9 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 1.5 | 31.0 | GO:0003680 | AT DNA binding(GO:0003680) |
| 1.5 | 4.4 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 1.4 | 11.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 1.4 | 11.6 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 1.4 | 18.7 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 1.4 | 12.9 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 1.4 | 1.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 1.4 | 4.3 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 1.4 | 5.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 1.4 | 1.4 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 1.4 | 8.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 1.4 | 6.9 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 1.4 | 16.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.4 | 8.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 1.4 | 4.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 1.3 | 4.0 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 1.3 | 4.0 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 1.3 | 14.8 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 1.3 | 5.4 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 1.3 | 8.0 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 1.3 | 6.5 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 1.3 | 1.3 | GO:0052827 | inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 1.3 | 5.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 1.3 | 37.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 1.3 | 7.7 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 1.3 | 15.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 1.3 | 1.3 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 1.2 | 6.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 1.2 | 5.0 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 1.2 | 3.7 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 1.2 | 1.2 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 1.2 | 22.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 1.2 | 4.9 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 1.2 | 15.8 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 1.2 | 4.8 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 1.2 | 8.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 1.2 | 6.0 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 1.2 | 2.4 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 1.2 | 4.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 1.2 | 1.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 1.2 | 4.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 1.2 | 15.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 1.2 | 4.6 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 1.2 | 59.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 1.1 | 6.9 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 1.1 | 3.4 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 1.1 | 5.7 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 1.1 | 4.6 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 1.1 | 6.8 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 1.1 | 9.0 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 1.1 | 14.6 | GO:0097016 | L27 domain binding(GO:0097016) |
| 1.1 | 5.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 1.1 | 2.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 1.1 | 3.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 1.1 | 4.5 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 1.1 | 8.9 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 1.1 | 7.8 | GO:0005497 | androgen binding(GO:0005497) |
| 1.1 | 13.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 1.1 | 8.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 1.1 | 6.6 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 1.1 | 3.3 | GO:0004103 | choline kinase activity(GO:0004103) |
| 1.1 | 7.7 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 1.1 | 39.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 1.1 | 10.7 | GO:0045545 | syndecan binding(GO:0045545) |
| 1.1 | 36.5 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 1.1 | 6.4 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 1.1 | 4.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 1.1 | 4.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 1.1 | 12.6 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 1.0 | 4.2 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 1.0 | 9.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 1.0 | 7.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 1.0 | 7.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 1.0 | 18.6 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 1.0 | 3.1 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 1.0 | 4.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 1.0 | 2.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 1.0 | 8.2 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 1.0 | 4.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 1.0 | 5.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 1.0 | 6.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 1.0 | 3.0 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 1.0 | 4.0 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 1.0 | 6.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 1.0 | 4.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 1.0 | 6.0 | GO:0034711 | inhibin binding(GO:0034711) |
| 1.0 | 3.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 1.0 | 3.0 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 1.0 | 8.9 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 1.0 | 3.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 1.0 | 4.9 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 1.0 | 19.6 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 1.0 | 2.9 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 1.0 | 3.9 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 1.0 | 6.8 | GO:1990254 | keratin filament binding(GO:1990254) |
| 1.0 | 3.9 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 1.0 | 3.9 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 1.0 | 5.8 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 1.0 | 2.9 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 1.0 | 2.9 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 1.0 | 6.7 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 1.0 | 9.5 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 1.0 | 10.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.9 | 2.8 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.9 | 0.9 | GO:0001159 | core promoter proximal region DNA binding(GO:0001159) |
| 0.9 | 4.7 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.9 | 5.6 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.9 | 8.4 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.9 | 5.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.9 | 8.4 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.9 | 2.8 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.9 | 3.7 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.9 | 2.8 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.9 | 9.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.9 | 5.5 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.9 | 14.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.9 | 2.7 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.9 | 8.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.9 | 5.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.9 | 3.6 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.9 | 20.4 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.9 | 8.8 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.9 | 16.7 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.9 | 3.5 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.9 | 0.9 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) |
| 0.9 | 18.9 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.8 | 2.5 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.8 | 37.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.8 | 3.4 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.8 | 3.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.8 | 5.9 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.8 | 3.3 | GO:0004803 | transposase activity(GO:0004803) |
| 0.8 | 3.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.8 | 4.1 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.8 | 17.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.8 | 6.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.8 | 10.6 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.8 | 3.3 | GO:0005019 | platelet-derived growth factor beta-receptor activity(GO:0005019) |
| 0.8 | 4.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.8 | 2.4 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.8 | 14.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.8 | 10.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.8 | 8.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.8 | 12.0 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.8 | 2.4 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.8 | 0.8 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.8 | 2.4 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.8 | 7.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.8 | 7.1 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.8 | 11.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.8 | 16.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.8 | 2.4 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.8 | 5.5 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.8 | 2.3 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.8 | 7.7 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.8 | 2.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.8 | 2.3 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.8 | 3.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.8 | 5.4 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.8 | 4.6 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.8 | 3.1 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.8 | 1.5 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.8 | 24.4 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.8 | 9.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.8 | 3.8 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.8 | 14.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.8 | 3.8 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.8 | 2.3 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.8 | 3.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.8 | 9.8 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.7 | 9.7 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.7 | 2.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.7 | 0.7 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.7 | 0.7 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.7 | 2.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.7 | 10.4 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.7 | 9.6 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.7 | 5.8 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.7 | 8.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.7 | 4.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.7 | 7.2 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.7 | 5.0 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.7 | 27.2 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.7 | 7.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.7 | 26.9 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.7 | 2.8 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.7 | 2.8 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.7 | 8.4 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.7 | 4.9 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.7 | 4.9 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.7 | 6.3 | GO:0090484 | drug transporter activity(GO:0090484) |
| 0.7 | 8.4 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.7 | 3.5 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.7 | 2.8 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.7 | 0.7 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.7 | 2.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.7 | 2.0 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.7 | 2.0 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.7 | 6.8 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.7 | 6.7 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.7 | 16.1 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.7 | 12.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.7 | 0.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.7 | 10.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.7 | 2.0 | GO:0036328 | VEGF-C-activated receptor activity(GO:0036328) |
| 0.7 | 2.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.7 | 1.3 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.7 | 6.0 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.7 | 14.0 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.7 | 8.0 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.7 | 3.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.7 | 6.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.7 | 21.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.7 | 2.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.7 | 0.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.7 | 6.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.6 | 2.6 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.6 | 11.4 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.6 | 16.5 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.6 | 8.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.6 | 3.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.6 | 7.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.6 | 6.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.6 | 8.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.6 | 154.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.6 | 1.8 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.6 | 7.4 | GO:0016594 | glycine binding(GO:0016594) |
| 0.6 | 4.9 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.6 | 1.2 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.6 | 18.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.6 | 6.1 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.6 | 7.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.6 | 4.8 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.6 | 6.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.6 | 14.3 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.6 | 3.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.6 | 22.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.6 | 5.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.6 | 4.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.6 | 13.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.6 | 2.9 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.6 | 12.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.6 | 5.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.6 | 0.6 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.6 | 2.9 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.6 | 3.4 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.6 | 5.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.6 | 4.5 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.6 | 1.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.6 | 11.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.6 | 1.7 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.6 | 1.7 | GO:0034188 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.6 | 7.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.6 | 16.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.5 | 18.7 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.5 | 9.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.5 | 19.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.5 | 1.6 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.5 | 16.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.5 | 10.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.5 | 1.1 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.5 | 2.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.5 | 2.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.5 | 2.6 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.5 | 1.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.5 | 11.4 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.5 | 1.5 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.5 | 2.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.5 | 6.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.5 | 14.8 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.5 | 3.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.5 | 3.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.5 | 2.5 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.5 | 38.3 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.5 | 2.5 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.5 | 0.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.5 | 1.5 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.5 | 1.0 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.5 | 5.9 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.5 | 5.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.5 | 1.5 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.5 | 4.9 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.5 | 2.9 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.5 | 1.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.5 | 2.0 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.5 | 8.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.5 | 17.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.5 | 1.4 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.5 | 2.9 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.5 | 1.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.5 | 4.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.5 | 5.3 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.5 | 21.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.5 | 4.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.5 | 1.9 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.5 | 3.8 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.5 | 4.7 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.5 | 1.4 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.5 | 77.3 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.5 | 31.6 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.5 | 1.4 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.5 | 6.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.5 | 17.2 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.5 | 1.4 | GO:0050577 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.5 | 13.0 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.5 | 2.8 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.5 | 2.8 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.5 | 6.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.5 | 10.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.5 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.5 | 2.3 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.4 | 3.6 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.4 | 4.9 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.4 | 3.6 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.4 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.4 | 4.0 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.4 | 4.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.4 | 1.8 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.4 | 2.2 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.4 | 2.6 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.4 | 0.9 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.4 | 3.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.4 | 1.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.4 | 3.0 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.4 | 2.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.4 | 6.1 | GO:0071949 | FAD binding(GO:0071949) |
| 0.4 | 3.9 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.4 | 32.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.4 | 1.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.4 | 4.7 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.4 | 3.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.4 | 3.0 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.4 | 1.3 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.4 | 3.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.4 | 4.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.4 | 8.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.4 | 2.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.4 | 2.5 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.4 | 2.1 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.4 | 2.9 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.4 | 0.8 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
| 0.4 | 6.7 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.4 | 2.9 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.4 | 1.7 | GO:0016662 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.4 | 2.1 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.4 | 1.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.4 | 4.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.4 | 1.6 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.4 | 11.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.4 | 4.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.4 | 1.6 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.4 | 3.9 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.4 | 4.7 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.4 | 3.9 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.4 | 1.2 | GO:0004397 | histidine ammonia-lyase activity(GO:0004397) |
| 0.4 | 1.9 | GO:0098626 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.4 | 7.7 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.4 | 0.8 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.4 | 4.5 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.4 | 1.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.4 | 3.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.4 | 10.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.4 | 1.5 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.4 | 1.1 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 0.4 | 0.7 | GO:0005534 | galactose binding(GO:0005534) |
| 0.4 | 5.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.4 | 3.0 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 0.4 | 6.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.4 | 0.7 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.4 | 2.6 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.4 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.4 | 2.2 | GO:0099583 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.4 | 1.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.4 | 8.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.4 | 1.8 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.4 | 1.4 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.4 | 6.0 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.4 | 3.9 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.4 | 6.7 | GO:0070513 | death domain binding(GO:0070513) |
| 0.4 | 4.9 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.4 | 2.1 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.3 | 1.7 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.3 | 1.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 1.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.3 | 1.0 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.3 | 1.0 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
| 0.3 | 9.1 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.3 | 4.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.3 | 5.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.3 | 3.0 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.3 | 1.7 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.3 | 2.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.3 | 0.7 | GO:0002134 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.3 | 1.3 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.3 | 3.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.3 | 2.9 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.3 | 1.6 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.3 | 0.6 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.3 | 3.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.3 | 4.2 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.3 | 12.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.3 | 7.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.3 | 159.2 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.3 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.3 | 1.6 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.3 | 0.6 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.3 | 1.6 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.3 | 0.6 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.3 | 1.2 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.3 | 1.5 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.3 | 5.5 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.3 | 10.7 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.3 | 5.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.3 | 1.8 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.3 | 7.6 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.3 | 1.5 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.3 | 1.2 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.3 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.3 | 3.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.3 | 0.9 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.3 | 13.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.3 | 0.9 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.3 | 9.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.3 | 4.4 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.3 | 0.6 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.3 | 0.9 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.3 | 11.3 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.3 | 1.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.3 | 0.9 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.3 | 1.7 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.3 | 4.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.3 | 2.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.3 | 1.1 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.3 | 1.1 | GO:0016615 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) malate dehydrogenase activity(GO:0016615) |
| 0.3 | 2.8 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.3 | 1.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.3 | 4.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.3 | 3.9 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.3 | 3.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.3 | 2.8 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.3 | 1.1 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
| 0.3 | 7.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.3 | 1.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.3 | 17.5 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.3 | 1.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.3 | 2.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.3 | 4.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.3 | 3.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.3 | 1.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.3 | 2.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.3 | 2.8 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.3 | 0.5 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.3 | 1.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.3 | 3.8 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.3 | 2.3 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.3 | 4.5 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.2 | 1.0 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.2 | 4.9 | GO:0008061 | chitin binding(GO:0008061) |
| 0.2 | 2.0 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.2 | 10.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.2 | 0.5 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 0.5 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.2 | 5.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.2 | 1.0 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) |
| 0.2 | 1.9 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.2 | 3.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.2 | 2.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.2 | 0.9 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.2 | 5.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.2 | 1.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.2 | 0.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 4.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 5.9 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.2 | 0.9 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 3.8 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.2 | 11.5 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.2 | 1.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.2 | 9.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.2 | 2.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.2 | 2.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.2 | 4.8 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.2 | 0.9 | GO:0009384 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) N-acylmannosamine kinase activity(GO:0009384) |
| 0.2 | 7.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 0.6 | GO:0000224 | peptide-N4-(N-acetyl-beta-glucosaminyl)asparagine amidase activity(GO:0000224) |
| 0.2 | 1.5 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.2 | 1.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 4.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.2 | 8.2 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.2 | 1.0 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.2 | 0.2 | GO:0019959 | C-X-C chemokine binding(GO:0019958) interleukin-8 binding(GO:0019959) |
| 0.2 | 1.7 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.2 | 0.2 | GO:0072545 | tyrosine binding(GO:0072545) |
| 0.2 | 0.8 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.2 | 6.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.2 | 1.6 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.2 | 13.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.2 | 1.4 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.2 | 2.0 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.2 | 1.8 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.6 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.2 | 3.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.2 | 0.8 | GO:0002060 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
| 0.2 | 3.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.2 | 0.6 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.2 | 3.5 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.2 | 1.9 | GO:0089720 | caspase binding(GO:0089720) |
| 0.2 | 1.7 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 0.7 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.2 | 0.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.2 | 1.3 | GO:0004904 | interferon receptor activity(GO:0004904) |
| 0.2 | 1.8 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.2 | 1.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.2 | 1.8 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.2 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 1.6 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.2 | 0.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 2.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 0.5 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.2 | 4.8 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.2 | 5.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.2 | 1.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 0.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.2 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.2 | 2.8 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.2 | 0.5 | GO:0001595 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.2 | 3.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.2 | 0.8 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.2 | 1.0 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.2 | 0.5 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.2 | 4.1 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.2 | 0.2 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.2 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.2 | 17.7 | GO:0005267 | potassium channel activity(GO:0005267) |
| 0.2 | 4.8 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 0.5 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 1.8 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.2 | 10.9 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.2 | 0.8 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.2 | 0.9 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 4.9 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.1 | 1.2 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.1 | 2.7 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 1.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 1.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.6 | GO:0052594 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.1 | 0.6 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.1 | 7.1 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 2.0 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.1 | 1.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.1 | 0.4 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.3 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.1 | 1.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.3 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
| 0.1 | 4.7 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.1 | 1.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 4.8 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.1 | 0.4 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 0.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.4 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 1.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.6 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 1.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.7 | GO:0099528 | G-protein coupled neurotransmitter receptor activity(GO:0099528) |
| 0.1 | 2.9 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.7 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 3.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.4 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.1 | 3.9 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 1.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.7 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 4.4 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 16.4 | GO:0003823 | antigen binding(GO:0003823) |
| 0.1 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 3.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 1.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 2.4 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.1 | 0.4 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.1 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 1.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.1 | 5.3 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.1 | 0.7 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 1.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 0.6 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 2.8 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.9 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 14.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.5 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 11.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.1 | 3.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.1 | 0.2 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.1 | 1.2 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.1 | 0.9 | GO:0005230 | extracellular ligand-gated ion channel activity(GO:0005230) |
| 0.1 | 0.3 | GO:0003980 | UDP-glucose:glycoprotein glucosyltransferase activity(GO:0003980) |
| 0.1 | 5.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.1 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 7.2 | GO:0051213 | dioxygenase activity(GO:0051213) |
| 0.1 | 5.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 0.3 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.1 | 0.2 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.1 | 0.2 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.1 | 0.5 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.2 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
| 0.1 | 0.3 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 0.3 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 0.1 | 0.3 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 0.2 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.1 | 0.5 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.2 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.1 | 0.3 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 1.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.1 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.1 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.4 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 0.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.3 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.1 | 0.8 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.2 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.1 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.4 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.2 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.1 | 0.4 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.4 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 1.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 2.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 1.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.4 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 0.3 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
| 0.1 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 1.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 1.0 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 0.1 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 0.7 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.1 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.0 | 1.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.2 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.3 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.0 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.9 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 2.5 | GO:0008528 | G-protein coupled peptide receptor activity(GO:0008528) |
| 0.0 | 0.1 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.0 | 1.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.8 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.2 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.2 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
| 0.0 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.7 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.0 | 7.4 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.0 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.1 | GO:0047946 | glutamine N-acyltransferase activity(GO:0047946) |
| 0.0 | 0.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.0 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.2 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.0 | 0.1 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 4.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 1.3 | 21.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 1.2 | 7.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 1.0 | 5.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.9 | 23.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.8 | 20.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.8 | 2.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.8 | 9.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.7 | 3.5 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.7 | 44.3 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.7 | 18.9 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.6 | 6.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.6 | 11.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.6 | 2.4 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.6 | 10.4 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.6 | 38.8 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.5 | 6.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.5 | 11.3 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.5 | 10.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.5 | 20.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.5 | 20.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.5 | 5.6 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.5 | 9.3 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.4 | 4.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.4 | 10.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.4 | 10.0 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.4 | 9.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.4 | 9.9 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.4 | 37.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.4 | 5.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.4 | 29.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.4 | 4.4 | PID MYC PATHWAY | C-MYC pathway |
| 0.4 | 20.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.4 | 20.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.4 | 21.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.4 | 1.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.4 | 15.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.3 | 1.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.3 | 10.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.3 | 3.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.3 | 12.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.3 | 24.6 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.3 | 3.4 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.3 | 1.9 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.3 | 8.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.3 | 13.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.3 | 24.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.3 | 23.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.3 | 9.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.3 | 4.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.3 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.3 | 12.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.3 | 3.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.3 | 2.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.3 | 3.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.3 | 32.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.2 | 8.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.2 | 22.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.2 | 14.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.2 | 2.8 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.2 | 4.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.2 | 11.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 16.0 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.2 | 25.5 | PID E2F PATHWAY | E2F transcription factor network |
| 0.2 | 18.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.2 | 2.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.2 | 19.9 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.2 | 20.7 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.2 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.2 | 14.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.2 | 1.5 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.2 | 6.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 5.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.2 | 11.7 | PID FGF PATHWAY | FGF signaling pathway |
| 0.2 | 0.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 3.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 3.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 2.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.1 | 9.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 1.7 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 1.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 5.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 2.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 4.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 3.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 3.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 2.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 5.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 2.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 2.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.1 | 0.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 4.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 1.5 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 2.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.5 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 7.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 1.2 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.7 | 4.7 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 3.3 | 56.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 1.9 | 7.7 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 1.9 | 13.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 1.8 | 44.3 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 1.8 | 38.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 1.7 | 29.4 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 1.7 | 50.5 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 1.6 | 1.6 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 1.6 | 26.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 1.6 | 26.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 1.5 | 6.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 1.4 | 13.7 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 1.2 | 29.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 1.2 | 22.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 1.1 | 16.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 1.1 | 17.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 1.1 | 18.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 1.1 | 68.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 1.0 | 19.9 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 1.0 | 73.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 1.0 | 18.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 1.0 | 4.9 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 1.0 | 21.4 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 1.0 | 6.7 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.9 | 4.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.9 | 26.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.9 | 70.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.9 | 2.7 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.9 | 17.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.9 | 13.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.9 | 12.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.8 | 17.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.8 | 6.8 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.8 | 33.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.8 | 8.2 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.8 | 25.0 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.8 | 10.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.8 | 16.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.8 | 21.6 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.8 | 6.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.8 | 58.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.7 | 6.7 | REACTOME OPSINS | Genes involved in Opsins |
| 0.7 | 20.7 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.7 | 13.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.7 | 2.9 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.7 | 22.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.7 | 16.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.7 | 3.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.7 | 110.8 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.7 | 6.3 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.7 | 15.1 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.7 | 21.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.7 | 54.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.7 | 19.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.7 | 5.9 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.7 | 7.2 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.6 | 5.8 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.6 | 1.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.6 | 1.3 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.6 | 6.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.6 | 96.4 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.6 | 34.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.6 | 24.9 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.6 | 22.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.5 | 15.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.5 | 0.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.5 | 16.7 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.5 | 25.8 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.5 | 14.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.5 | 24.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.5 | 9.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.5 | 3.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.5 | 5.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.5 | 15.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.5 | 6.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.5 | 9.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.5 | 42.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.5 | 6.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.5 | 11.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.5 | 14.0 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.5 | 15.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.5 | 10.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.5 | 14.3 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.5 | 7.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.5 | 33.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.4 | 3.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.4 | 8.7 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.4 | 4.8 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
| 0.4 | 13.0 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
| 0.4 | 4.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.4 | 0.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.4 | 5.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.4 | 15.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.4 | 19.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.4 | 8.5 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.4 | 18.6 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.4 | 8.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.4 | 26.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.4 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.3 | 12.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.3 | 19.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.3 | 5.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.3 | 3.7 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.3 | 15.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.3 | 8.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.3 | 4.8 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.3 | 8.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.3 | 2.2 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.3 | 2.2 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.3 | 16.0 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.3 | 0.6 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.3 | 0.6 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.3 | 10.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.3 | 4.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.3 | 10.9 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.3 | 4.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.3 | 3.4 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.3 | 4.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.3 | 10.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.3 | 1.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.3 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.3 | 23.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.3 | 0.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.3 | 3.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.3 | 4.6 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 9.4 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.2 | 0.5 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 6.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.2 | 6.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.2 | 2.0 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 6.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.2 | 6.9 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.2 | 4.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.2 | 7.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.2 | 8.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.2 | 2.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.2 | 3.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.2 | 0.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.2 | 10.8 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.2 | 2.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.2 | 0.4 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.2 | 4.8 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.2 | 9.0 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.2 | 3.0 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.2 | 3.4 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 6.0 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.2 | 4.8 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.2 | 8.2 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.2 | 0.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.2 | 3.9 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.2 | 3.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 2.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 3.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 2.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 0.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 13.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 23.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.1 | 6.9 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 1.1 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.1 | 3.0 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 2.8 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.1 | 1.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 24.1 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
| 0.1 | 4.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 0.7 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 1.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 2.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.1 | 1.9 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 2.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 0.7 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.1 | 1.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 2.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.1 | 0.7 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 0.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.1 | 1.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 9.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 0.8 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 0.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 3.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 3.8 | REACTOME DNA REPLICATION | Genes involved in DNA Replication |
| 0.0 | 3.5 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 1.0 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.5 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 2.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.2 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |