Project
avrg: SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for MBD2
Z-value: 1.57
Motif logo
Transcription factors associated with MBD2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MBD2
|
ENSG00000134046.7 | methyl-CpG binding domain protein 2 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MBD2 | hg19_v2_chr18_-_51750948_51751059 | -0.60 | 4.7e-03 | Click! |
Activity profile of MBD2 motif
Sorted Z-values of MBD2 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of MBD2
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.6 | 1.8 | GO:0060915 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.4 | 1.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.4 | 1.1 | GO:0061184 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) positive regulation of dermatome development(GO:0061184) renal vesicle induction(GO:0072034) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.3 | 1.0 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.3 | 0.9 | GO:0015881 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.3 | 0.8 | GO:1902256 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.2 | 1.4 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 | 0.8 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.2 | 1.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 | 0.6 | GO:0035283 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.2 | 0.6 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.2 | 1.2 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 0.5 | GO:2000276 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.2 | 1.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.1 | 1.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 0.7 | GO:2000051 | Wnt receptor catabolic process(GO:0038018) negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 1.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.7 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 1.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.4 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.1 | 0.4 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.3 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 1.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.7 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.5 | GO:0021623 | optic cup structural organization(GO:0003409) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 1.4 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.2 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.5 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.4 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 0.5 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.1 | 0.6 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.1 | 1.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.5 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 0.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.5 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 | 0.5 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.4 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.3 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.7 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.4 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.2 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 1.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.1 | 0.2 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.1 | 0.4 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.2 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.1 | 0.3 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.3 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 0.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.4 | GO:0061458 | reproductive system development(GO:0061458) |
| 0.1 | 0.3 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.3 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.1 | 0.3 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 | 0.3 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 1.0 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.5 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 | 0.2 | GO:0035854 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.0 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 1.5 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.0 | 0.6 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.8 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 1.2 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.3 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.8 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.2 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.0 | 1.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.1 | GO:0002519 | natural killer cell tolerance induction(GO:0002519) regulation of tolerance induction dependent upon immune response(GO:0002652) negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 0.0 | 0.1 | GO:0006091 | generation of precursor metabolites and energy(GO:0006091) |
| 0.0 | 0.1 | GO:0048007 | synaptic vesicle recycling via endosome(GO:0036466) antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.2 | GO:0072560 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.0 | 0.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 | 1.2 | GO:0008285 | negative regulation of cell proliferation(GO:0008285) |
| 0.0 | 0.7 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
| 0.0 | 0.4 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.1 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.1 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.0 | 0.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.6 | GO:0008284 | positive regulation of cell proliferation(GO:0008284) |
| 0.0 | 0.1 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.0 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.0 | 0.7 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.6 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.1 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.0 | 0.7 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.6 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 1.4 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.0 | 0.1 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 1.0 | GO:0042554 | superoxide anion generation(GO:0042554) |
| 0.0 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.2 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.7 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 1.8 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.2 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 1.4 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.0 | 0.4 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.5 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.6 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.5 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 2.1 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.2 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.4 | GO:0001505 | regulation of neurotransmitter levels(GO:0001505) |
| 0.0 | 0.2 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.5 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.7 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.0 | 0.9 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.2 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.0 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.3 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.0 | 0.9 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.1 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 0.3 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.7 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.3 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.5 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.2 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.3 | 1.1 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 1.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.4 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 0.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 1.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 1.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.5 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.3 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.2 | GO:1990742 | microvesicle(GO:1990742) |
| 0.1 | 0.5 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.3 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.0 | 0.1 | GO:0008623 | CHRAC(GO:0008623) |
| 0.0 | 0.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.0 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 1.5 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.0 | 0.7 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 2.4 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.3 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.6 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 0.5 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 1.9 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.9 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.7 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 1.4 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.4 | GO:0005921 | gap junction(GO:0005921) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.2 | 1.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 0.8 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.2 | 1.9 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 1.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 1.2 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 1.0 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 0.3 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 1.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.6 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.3 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 1.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.4 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.1 | 1.0 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 0.3 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.1 | 0.9 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 1.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 0.9 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 0.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.5 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.1 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.5 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 0.4 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.0 | 1.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 2.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.4 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.3 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.1 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.0 | 0.8 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.5 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.2 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 1.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.4 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 2.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0031775 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 2.6 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.9 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 1.0 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.9 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 1.9 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.7 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.7 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.3 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.3 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 1.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 1.6 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 1.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 2.3 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.8 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.8 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.5 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.9 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 1.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 1.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 0.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.3 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 1.1 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.5 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |