Project
avrg: SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Navigation
Downloads
Results for MIXL1_GSX1_BSX_MEOX2_LHX4
Z-value: 0.82
Motif logo
Transcription factors associated with MIXL1_GSX1_BSX_MEOX2_LHX4
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MIXL1
|
ENSG00000185155.7 | Mix paired-like homeobox |
|
GSX1
|
ENSG00000169840.4 | GS homeobox 1 |
|
BSX
|
ENSG00000188909.4 | brain specific homeobox |
|
MEOX2
|
ENSG00000106511.5 | mesenchyme homeobox 2 |
|
LHX4
|
ENSG00000121454.4 | LIM homeobox 4 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| LHX4 | hg19_v2_chr1_+_180199393_180199426 | 0.56 | 9.6e-03 | Click! |
| MIXL1 | hg19_v2_chr1_+_226411319_226411366 | -0.02 | 9.4e-01 | Click! |
| MEOX2 | hg19_v2_chr7_-_15726296_15726437 | -0.01 | 9.6e-01 | Click! |
Activity profile of MIXL1_GSX1_BSX_MEOX2_LHX4 motif
Sorted Z-values of MIXL1_GSX1_BSX_MEOX2_LHX4 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of MIXL1_GSX1_BSX_MEOX2_LHX4
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0061010 | negative regulation of transcription by transcription factor localization(GO:0010621) gall bladder development(GO:0061010) |
| 0.4 | 0.4 | GO:0034759 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.4 | 3.3 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.4 | 1.6 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.3 | 0.9 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.3 | 0.8 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) response to iron ion starvation(GO:1990641) |
| 0.3 | 1.1 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.3 | 0.8 | GO:0051795 | positive regulation of catagen(GO:0051795) activation of meiosis(GO:0090427) |
| 0.2 | 2.6 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 0.7 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 | 2.8 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.2 | 0.6 | GO:2000863 | positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.2 | 1.0 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 | 0.9 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.2 | 1.1 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.1 | 1.9 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 1.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 1.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 1.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.4 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 1.6 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.1 | 0.4 | GO:1903414 | spleen trabecula formation(GO:0060345) iron cation export(GO:1903414) ferrous iron export(GO:1903988) |
| 0.1 | 0.3 | GO:0008217 | regulation of blood pressure(GO:0008217) |
| 0.1 | 0.4 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 | 0.8 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 0.7 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.8 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 | 0.2 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.6 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.1 | 0.5 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 0.4 | GO:0035711 | plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) T-helper 1 cell activation(GO:0035711) |
| 0.1 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
| 0.1 | 0.4 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.1 | 1.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.6 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.1 | 0.8 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.1 | 1.5 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.1 | 1.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.3 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 | 4.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.4 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.1 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.7 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.8 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.4 | GO:0072302 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.1 | 0.4 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 | 0.4 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.3 | GO:0051257 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.1 | 0.6 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.1 | 1.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.1 | 0.3 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 | 0.8 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.1 | 0.6 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.8 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.7 | GO:1902748 | positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.1 | 0.3 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 | 0.3 | GO:0033122 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.1 | 0.5 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.3 | GO:0051598 | meiotic recombination checkpoint(GO:0051598) |
| 0.1 | 0.7 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.2 | GO:0006173 | dADP biosynthetic process(GO:0006173) |
| 0.1 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.3 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.1 | 0.4 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 1.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.7 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.1 | 0.2 | GO:0033024 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.1 | 1.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.7 | GO:0014031 | mesenchymal cell development(GO:0014031) mesenchymal cell differentiation(GO:0048762) |
| 0.1 | 0.5 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.1 | 2.0 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.7 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.8 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.1 | 0.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.2 | GO:1902996 | regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 | 0.4 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 0.8 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.7 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.2 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 | 0.2 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.1 | 0.3 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.2 | GO:0072579 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.1 | 1.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.2 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 1.4 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 1.0 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.1 | 0.3 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.3 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 | 0.4 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.0 | 0.3 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.0 | 0.4 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.0 | 0.4 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.3 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.8 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.3 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 | 0.2 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.0 | 0.2 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.0 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.0 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.2 | GO:2000005 | apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 0.0 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.4 | GO:1904386 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.0 | 0.4 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.0 | 0.3 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.1 | GO:0061582 | colon epithelial cell migration(GO:0061580) intestinal epithelial cell migration(GO:0061582) |
| 0.0 | 1.4 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.0 | 0.5 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.0 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.0 | 1.4 | GO:0006625 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.2 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 | 0.1 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.3 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.2 | GO:0014011 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.0 | 0.3 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.2 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.0 | 0.5 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.4 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.5 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 1.2 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.1 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.0 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.2 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.0 | 0.1 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 | 0.1 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.0 | 0.4 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.3 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.0 | 0.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.3 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.0 | 0.1 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.1 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.0 | 0.2 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.7 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.4 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.2 | GO:0018032 | protein amidation(GO:0018032) |
| 0.0 | 0.8 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.4 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.6 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.1 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.0 | 0.1 | GO:0045208 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.0 | 0.2 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.0 | 0.1 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.0 | 0.7 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 1.5 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
| 0.0 | 0.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.2 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.0 | 1.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.3 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
| 0.0 | 0.2 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.0 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.0 | 0.1 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.0 | 0.2 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.0 | 0.2 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.0 | 0.1 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.0 | 0.2 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.3 | GO:0031053 | osteoblast fate commitment(GO:0002051) primary miRNA processing(GO:0031053) |
| 0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.3 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 1.0 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.2 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 | 0.1 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.1 | GO:0071306 | cellular response to vitamin E(GO:0071306) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.0 | 0.5 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
| 0.0 | 0.6 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.1 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.0 | 0.4 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.1 | GO:0003382 | epithelial cell morphogenesis(GO:0003382) |
| 0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.3 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.1 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.0 | 0.8 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 1.0 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.6 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.4 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.0 | 0.9 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.1 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.0 | 0.1 | GO:0052199 | negative regulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052199) |
| 0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0009099 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.0 | 0.4 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.0 | 0.1 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.0 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.2 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.0 | 1.1 | GO:0008347 | glial cell migration(GO:0008347) |
| 0.0 | 0.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.4 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.0 | GO:0060928 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 | 0.1 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.0 | 0.3 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.0 | 0.1 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.2 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.0 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.0 | 0.4 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 2.4 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.2 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.3 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 | 0.0 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.0 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.0 | 0.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.1 | GO:0006480 | N-terminal protein amino acid methylation(GO:0006480) |
| 0.0 | 0.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.1 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.0 | 0.9 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.4 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 | 0.1 | GO:0001935 | endothelial cell proliferation(GO:0001935) |
| 0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 1.1 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.1 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.1 | GO:0021997 | neural plate axis specification(GO:0021997) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.2 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.3 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.2 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.2 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.8 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.0 | 0.3 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.2 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.6 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.6 | GO:0070670 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.0 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 | 0.6 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.0 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.0 | 0.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.8 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0043614 | multi-eIF complex(GO:0043614) translation preinitiation complex(GO:0070993) glial limiting end-foot(GO:0097451) |
| 0.3 | 1.0 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.7 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.2 | 3.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.2 | 1.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.2 | 1.0 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.1 | 0.7 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 0.8 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.1 | 0.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.3 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 1.4 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 1.5 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 0.7 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 0.3 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.9 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.7 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.4 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 1.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 0.2 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 1.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 1.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.1 | 0.7 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.2 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.1 | 1.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.8 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.1 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 0.0 | 0.3 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.0 | 0.2 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.0 | 0.7 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0035841 | new growing cell tip(GO:0035841) |
| 0.0 | 0.3 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 1.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 1.1 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 3.0 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.6 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.2 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.1 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 1.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.9 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 2.0 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 1.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.6 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 1.3 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.2 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 1.4 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.4 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 2.8 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.5 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 1.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.3 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.6 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 3.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 1.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.0 | GO:0034657 | GID complex(GO:0034657) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.4 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 1.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 1.4 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.4 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
| 0.5 | 1.4 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 0.4 | 1.2 | GO:0036440 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.4 | 2.0 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.3 | 1.7 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.3 | 1.0 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.2 | 0.6 | GO:0070698 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) type I activin receptor binding(GO:0070698) |
| 0.2 | 0.6 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.2 | 1.2 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 1.2 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.2 | 0.5 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.2 | 0.5 | GO:0033961 | cis-stilbene-oxide hydrolase activity(GO:0033961) |
| 0.1 | 4.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.7 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 0.1 | 0.4 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.1 | 0.4 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.1 | 0.4 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.1 | 0.8 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) ketosteroid monooxygenase activity(GO:0047086) |
| 0.1 | 1.0 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 0.4 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.5 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.4 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 3.3 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.3 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.1 | 3.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.1 | 1.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 1.0 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.1 | 0.8 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.4 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.4 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 1.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 1.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.3 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.2 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 0.1 | 0.3 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.1 | 0.2 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.1 | 0.3 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.1 | 0.3 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.1 | 0.2 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.1 | 0.4 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.5 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.1 | 0.9 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.7 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.5 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.1 | 0.2 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 1.0 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.2 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.6 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.1 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.0 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.8 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.7 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.6 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.5 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 1.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.5 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 1.6 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 0.5 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.7 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.8 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.0 | 0.3 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.6 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.0 | 0.2 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.2 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.5 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.2 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.7 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.0 | 1.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 1.4 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.9 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 1.2 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 2.2 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.0 | 0.0 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 1.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 1.0 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.0 | 0.6 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.9 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.3 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 2.5 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
| 0.0 | 0.2 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
| 0.0 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.4 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.2 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.1 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.0 | 0.2 | GO:0019903 | protein phosphatase binding(GO:0019903) |
| 0.0 | 0.1 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.4 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.1 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.0 | 1.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.4 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 2.2 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.1 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.2 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.2 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 2.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 2.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 1.8 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 1.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 2.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 2.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.8 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 1.8 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.7 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 2.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.8 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.7 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.5 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 1.8 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 1.0 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 1.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 2.1 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 1.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 2.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 1.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 1.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 1.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 1.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 2.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 1.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 1.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 1.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 1.0 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 1.4 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 1.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 1.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 1.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 2.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.6 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 1.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 3.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 1.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 2.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.8 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.4 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 1.8 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 1.0 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |