| 2.3 |
7.0 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 2.2 |
6.7 |
GO:2001190 |
positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 1.5 |
4.4 |
GO:1903697 |
negative regulation of microvillus assembly(GO:1903697) |
| 1.3 |
25.7 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 1.3 |
5.0 |
GO:0021966 |
corticospinal neuron axon guidance(GO:0021966) |
| 1.3 |
3.8 |
GO:2000502 |
negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 1.2 |
4.9 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 1.2 |
9.7 |
GO:1902998 |
regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 1.2 |
4.7 |
GO:0042361 |
menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 1.0 |
8.1 |
GO:0071395 |
response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 1.0 |
3.9 |
GO:0034444 |
regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 1.0 |
1.0 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.9 |
4.7 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.9 |
5.3 |
GO:0061143 |
alveolar primary septum development(GO:0061143) |
| 0.9 |
4.4 |
GO:0002314 |
germinal center B cell differentiation(GO:0002314) |
| 0.8 |
2.5 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.8 |
6.8 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.8 |
0.8 |
GO:1901662 |
phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.7 |
0.7 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) |
| 0.7 |
2.9 |
GO:0014859 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.7 |
2.9 |
GO:0030185 |
nitric oxide transport(GO:0030185) |
| 0.7 |
3.6 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.7 |
4.3 |
GO:0090131 |
mesenchyme migration(GO:0090131) |
| 0.7 |
2.1 |
GO:0035623 |
renal glucose absorption(GO:0035623) |
| 0.7 |
2.8 |
GO:0048691 |
modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.7 |
2.0 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.7 |
2.0 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.7 |
2.0 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.7 |
2.7 |
GO:0048242 |
regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
| 0.7 |
3.3 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.6 |
0.6 |
GO:0051775 |
response to redox state(GO:0051775) cellular response to redox state(GO:0071461) |
| 0.6 |
2.5 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.6 |
3.7 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.6 |
2.5 |
GO:2000863 |
positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.6 |
1.2 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.6 |
3.0 |
GO:2000354 |
regulation of ovarian follicle development(GO:2000354) |
| 0.6 |
2.4 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 0.6 |
1.8 |
GO:0043181 |
vacuolar sequestering(GO:0043181) |
| 0.6 |
4.1 |
GO:0010133 |
proline catabolic process to glutamate(GO:0010133) |
| 0.6 |
2.3 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.6 |
1.7 |
GO:0072428 |
signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.6 |
2.3 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.6 |
1.1 |
GO:0031296 |
B cell costimulation(GO:0031296) |
| 0.6 |
2.8 |
GO:1903971 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.6 |
4.0 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.6 |
1.7 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.6 |
1.7 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.6 |
2.2 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.6 |
7.8 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.6 |
1.7 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.5 |
0.5 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.5 |
1.1 |
GO:0045605 |
negative regulation of epidermal cell differentiation(GO:0045605) negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.5 |
9.7 |
GO:1901750 |
leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.5 |
1.6 |
GO:1903465 |
vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.5 |
2.1 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.5 |
2.1 |
GO:0033076 |
isoquinoline alkaloid metabolic process(GO:0033076) |
| 0.5 |
2.6 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.5 |
1.6 |
GO:0034226 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.5 |
0.5 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.5 |
2.6 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.5 |
2.6 |
GO:0070945 |
neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.5 |
5.0 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
2.0 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.5 |
6.2 |
GO:0019375 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.5 |
2.4 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 |
1.9 |
GO:0044537 |
regulation of circulating fibrinogen levels(GO:0044537) |
| 0.5 |
0.5 |
GO:0009447 |
putrescine catabolic process(GO:0009447) polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.5 |
0.5 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.5 |
1.4 |
GO:0038162 |
erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.5 |
5.9 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.4 |
2.2 |
GO:0071051 |
polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.4 |
0.4 |
GO:0060913 |
cardiac cell fate determination(GO:0060913) |
| 0.4 |
2.6 |
GO:0098746 |
fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.4 |
0.9 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.4 |
1.3 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.4 |
2.6 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.4 |
2.1 |
GO:0003285 |
septum secundum development(GO:0003285) |
| 0.4 |
1.7 |
GO:1901079 |
positive regulation of relaxation of muscle(GO:1901079) |
| 0.4 |
1.2 |
GO:2000775 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.4 |
2.5 |
GO:0072069 |
DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.4 |
2.0 |
GO:0010520 |
regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.4 |
2.0 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 |
1.6 |
GO:0038185 |
nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.4 |
0.4 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.4 |
0.4 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.4 |
2.0 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.4 |
0.4 |
GO:0010644 |
cell communication by electrical coupling(GO:0010644) |
| 0.4 |
1.2 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.4 |
0.4 |
GO:0061227 |
intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 |
0.8 |
GO:1902563 |
regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.4 |
1.6 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 0.4 |
5.0 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.4 |
2.7 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.4 |
1.9 |
GO:0032411 |
positive regulation of transporter activity(GO:0032411) |
| 0.4 |
1.5 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.4 |
1.5 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.4 |
0.7 |
GO:0090119 |
vesicle-mediated cholesterol transport(GO:0090119) |
| 0.4 |
3.4 |
GO:0006572 |
tyrosine catabolic process(GO:0006572) |
| 0.4 |
6.3 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.4 |
1.1 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.4 |
1.5 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.4 |
2.9 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.4 |
1.1 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.4 |
1.4 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.4 |
1.1 |
GO:0060827 |
regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.3 |
1.4 |
GO:1903939 |
regulation of TORC2 signaling(GO:1903939) |
| 0.3 |
0.3 |
GO:0038183 |
bile acid signaling pathway(GO:0038183) |
| 0.3 |
1.0 |
GO:0006173 |
dADP biosynthetic process(GO:0006173) |
| 0.3 |
1.0 |
GO:0045062 |
extrathymic T cell selection(GO:0045062) |
| 0.3 |
2.1 |
GO:0032571 |
response to vitamin K(GO:0032571) |
| 0.3 |
5.7 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.3 |
0.7 |
GO:0060458 |
right lung development(GO:0060458) |
| 0.3 |
1.3 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.3 |
0.6 |
GO:0031585 |
regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.3 |
3.2 |
GO:0086024 |
adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.3 |
1.3 |
GO:0001188 |
RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.3 |
0.9 |
GO:2000437 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.3 |
1.9 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 0.3 |
2.2 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.3 |
0.9 |
GO:0090345 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.3 |
2.8 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.3 |
0.3 |
GO:0043132 |
NAD transport(GO:0043132) |
| 0.3 |
1.2 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 |
0.9 |
GO:2000611 |
positive regulation of thyroid hormone generation(GO:2000611) |
| 0.3 |
2.1 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.3 |
2.4 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.3 |
6.3 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.3 |
0.3 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.3 |
1.5 |
GO:2001183 |
negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.3 |
0.9 |
GO:2000118 |
regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.3 |
0.6 |
GO:0006550 |
isoleucine catabolic process(GO:0006550) |
| 0.3 |
6.7 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.3 |
1.2 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.3 |
0.9 |
GO:0071629 |
cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.3 |
1.2 |
GO:0051097 |
negative regulation of helicase activity(GO:0051097) |
| 0.3 |
1.4 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.3 |
1.1 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.3 |
1.1 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.3 |
0.9 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 |
0.8 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.3 |
0.6 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.3 |
3.1 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.3 |
0.3 |
GO:1902022 |
lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.3 |
0.8 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.3 |
0.8 |
GO:0006272 |
leading strand elongation(GO:0006272) |
| 0.3 |
4.7 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.3 |
3.6 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.3 |
0.8 |
GO:2000824 |
negative regulation of androgen receptor activity(GO:2000824) |
| 0.3 |
1.1 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.3 |
6.6 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.3 |
1.1 |
GO:0032690 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.3 |
3.9 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.3 |
0.8 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.3 |
1.6 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
1.0 |
GO:0006850 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.3 |
2.1 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.3 |
0.5 |
GO:1904030 |
negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.3 |
0.8 |
GO:0019516 |
lactate oxidation(GO:0019516) |
| 0.3 |
1.0 |
GO:1904482 |
response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.3 |
0.8 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 |
0.8 |
GO:0015920 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) lipopolysaccharide transport(GO:0015920) |
| 0.3 |
0.8 |
GO:1903461 |
Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.3 |
1.5 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 |
1.0 |
GO:0006391 |
transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.3 |
1.0 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.2 |
1.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 |
1.2 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 |
1.0 |
GO:0072278 |
metanephric comma-shaped body morphogenesis(GO:0072278) |
| 0.2 |
1.2 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.2 |
3.4 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
1.5 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 |
1.5 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
1.2 |
GO:0042363 |
fat-soluble vitamin catabolic process(GO:0042363) |
| 0.2 |
1.0 |
GO:0021524 |
visceral motor neuron differentiation(GO:0021524) |
| 0.2 |
0.7 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 |
1.2 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
1.6 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.2 |
0.7 |
GO:0045082 |
positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.2 |
0.7 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.2 |
0.2 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.2 |
1.4 |
GO:0036100 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.2 |
0.2 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 |
0.9 |
GO:0090214 |
spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.2 |
0.2 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.2 |
3.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 |
0.7 |
GO:0002877 |
acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 |
0.9 |
GO:0046452 |
dihydrofolate metabolic process(GO:0046452) |
| 0.2 |
1.6 |
GO:1903435 |
positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.2 |
1.3 |
GO:0035407 |
histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 |
0.4 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.2 |
0.9 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.2 |
7.0 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 |
0.7 |
GO:0032203 |
telomere formation via telomerase(GO:0032203) |
| 0.2 |
7.2 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.2 |
1.1 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.2 |
0.6 |
GO:0048210 |
Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.2 |
0.4 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 |
0.6 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 |
1.1 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.2 |
0.9 |
GO:0086097 |
phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.2 |
0.8 |
GO:0045354 |
negative regulation of interferon-alpha production(GO:0032687) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.2 |
1.0 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.2 |
0.2 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.2 |
1.0 |
GO:1901898 |
negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.2 |
0.6 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 |
0.6 |
GO:0032824 |
negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.2 |
2.5 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 0.2 |
3.9 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.2 |
0.4 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.2 |
0.6 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.2 |
0.2 |
GO:0002590 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.2 |
0.6 |
GO:1902303 |
regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.2 |
0.2 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
| 0.2 |
1.8 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.2 |
0.8 |
GO:1904106 |
protein localization to microvillus(GO:1904106) |
| 0.2 |
0.2 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.2 |
0.6 |
GO:1901145 |
regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.2 |
1.0 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.2 |
0.2 |
GO:1904640 |
response to methionine(GO:1904640) |
| 0.2 |
1.2 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.2 |
0.6 |
GO:0010621 |
negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.2 |
0.6 |
GO:1990086 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) lens fiber cell apoptotic process(GO:1990086) |
| 0.2 |
1.2 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.2 |
1.4 |
GO:2001293 |
malonyl-CoA metabolic process(GO:2001293) |
| 0.2 |
0.8 |
GO:0002118 |
aggressive behavior(GO:0002118) |
| 0.2 |
2.0 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.2 |
1.0 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.2 |
1.4 |
GO:0071926 |
endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 |
1.2 |
GO:0033132 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 |
0.6 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.2 |
1.2 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.2 |
1.3 |
GO:0019557 |
histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.2 |
1.1 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.2 |
1.0 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.2 |
2.7 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.2 |
0.4 |
GO:0010513 |
positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.2 |
0.6 |
GO:1903567 |
negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.2 |
0.9 |
GO:0009107 |
lipoate biosynthetic process(GO:0009107) |
| 0.2 |
0.7 |
GO:0032072 |
plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) |
| 0.2 |
0.6 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.2 |
1.1 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.2 |
1.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.2 |
0.4 |
GO:0098881 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.2 |
0.6 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.2 |
0.2 |
GO:1902990 |
mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 |
1.1 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.2 |
0.4 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 |
3.3 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 |
1.5 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.2 |
0.2 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 |
1.3 |
GO:0060332 |
positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 |
1.3 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.2 |
0.4 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
9.1 |
GO:0007271 |
synaptic transmission, cholinergic(GO:0007271) |
| 0.2 |
0.9 |
GO:0046984 |
regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.2 |
0.7 |
GO:0050912 |
detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.2 |
1.8 |
GO:2000344 |
positive regulation of acrosome reaction(GO:2000344) |
| 0.2 |
1.2 |
GO:0035815 |
positive regulation of renal sodium excretion(GO:0035815) |
| 0.2 |
0.7 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.2 |
1.8 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.2 |
1.2 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.2 |
1.6 |
GO:1902221 |
L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 |
0.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.2 |
0.5 |
GO:0036515 |
serotonergic neuron axon guidance(GO:0036515) |
| 0.2 |
2.8 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.2 |
0.5 |
GO:0018022 |
peptidyl-lysine methylation(GO:0018022) |
| 0.2 |
1.0 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 |
0.5 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.2 |
0.3 |
GO:0046222 |
mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.2 |
1.2 |
GO:0030885 |
regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.2 |
0.5 |
GO:0036060 |
filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.2 |
2.4 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.2 |
0.9 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.2 |
1.5 |
GO:0021840 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.2 |
1.2 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.2 |
0.2 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.2 |
0.5 |
GO:0018011 |
N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.2 |
0.3 |
GO:0061351 |
neural precursor cell proliferation(GO:0061351) |
| 0.2 |
1.5 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.2 |
0.8 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 |
0.5 |
GO:0097032 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 |
0.3 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
0.7 |
GO:2001303 |
lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.2 |
0.8 |
GO:0034224 |
cellular response to zinc ion starvation(GO:0034224) |
| 0.2 |
0.2 |
GO:0071469 |
cellular response to alkaline pH(GO:0071469) |
| 0.2 |
4.2 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 |
0.2 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.2 |
1.1 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.2 |
1.9 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.2 |
0.5 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.2 |
0.2 |
GO:0090210 |
regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.2 |
1.6 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.2 |
2.1 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
0.8 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.2 |
1.4 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.2 |
0.6 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.2 |
3.0 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.2 |
0.6 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 |
1.7 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 |
0.5 |
GO:0046356 |
acetyl-CoA catabolic process(GO:0046356) |
| 0.2 |
0.2 |
GO:1904124 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.2 |
0.5 |
GO:0014876 |
response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.2 |
0.5 |
GO:0015811 |
L-cystine transport(GO:0015811) |
| 0.2 |
0.5 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.2 |
3.9 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.2 |
0.6 |
GO:0003335 |
corneocyte development(GO:0003335) |
| 0.2 |
0.9 |
GO:1902462 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.2 |
0.6 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.2 |
4.0 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 |
1.4 |
GO:0015747 |
urate transport(GO:0015747) |
| 0.2 |
1.8 |
GO:0044387 |
negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.2 |
0.8 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.1 |
0.9 |
GO:0014827 |
intestine smooth muscle contraction(GO:0014827) |
| 0.1 |
0.4 |
GO:0006352 |
DNA-templated transcription, initiation(GO:0006352) |
| 0.1 |
0.9 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 |
0.4 |
GO:0006267 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 |
2.3 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.3 |
GO:0072300 |
positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.1 |
3.4 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 |
0.4 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
0.7 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.1 |
0.4 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.1 |
0.7 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 |
0.4 |
GO:0033058 |
directional locomotion(GO:0033058) |
| 0.1 |
0.7 |
GO:0010522 |
regulation of calcium ion transport into cytosol(GO:0010522) |
| 0.1 |
0.4 |
GO:0070105 |
positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 |
0.9 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 |
1.1 |
GO:1900264 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 |
0.6 |
GO:0035740 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.1 |
0.3 |
GO:0035723 |
interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.1 |
1.0 |
GO:0071502 |
cellular response to temperature stimulus(GO:0071502) |
| 0.1 |
0.3 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 |
0.4 |
GO:0045210 |
negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.1 |
0.4 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 |
0.1 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 |
1.8 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
0.6 |
GO:0019442 |
tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.1 |
0.4 |
GO:0014724 |
regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.1 |
0.4 |
GO:0021586 |
pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 |
0.5 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.5 |
GO:0033686 |
positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 |
0.7 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
1.5 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 |
1.6 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.1 |
0.5 |
GO:0070640 |
vitamin D3 metabolic process(GO:0070640) |
| 0.1 |
0.7 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.1 |
0.7 |
GO:0060971 |
intraciliary anterograde transport(GO:0035720) ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 |
0.3 |
GO:0044029 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
2.9 |
GO:0045199 |
maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 |
0.1 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 |
0.8 |
GO:0039689 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 |
0.3 |
GO:0072248 |
metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 |
0.7 |
GO:1904158 |
axonemal central apparatus assembly(GO:1904158) |
| 0.1 |
0.5 |
GO:0019860 |
uracil metabolic process(GO:0019860) |
| 0.1 |
1.1 |
GO:0000066 |
mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
| 0.1 |
4.0 |
GO:0060972 |
left/right pattern formation(GO:0060972) |
| 0.1 |
0.3 |
GO:0036146 |
cellular response to mycotoxin(GO:0036146) |
| 0.1 |
0.5 |
GO:0071348 |
cellular response to interleukin-11(GO:0071348) |
| 0.1 |
2.5 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
3.5 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.1 |
0.4 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.7 |
GO:0021936 |
regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.1 |
0.7 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.1 |
0.1 |
GO:1990641 |
response to iron ion starvation(GO:1990641) |
| 0.1 |
2.1 |
GO:0046951 |
ketone body biosynthetic process(GO:0046951) |
| 0.1 |
1.2 |
GO:0071498 |
cellular response to fluid shear stress(GO:0071498) |
| 0.1 |
0.6 |
GO:0038170 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 |
0.5 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 0.1 |
2.5 |
GO:0045008 |
depyrimidination(GO:0045008) |
| 0.1 |
0.5 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 |
0.6 |
GO:2000501 |
regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.1 |
0.1 |
GO:1900110 |
negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.1 |
0.4 |
GO:0021898 |
regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 |
1.0 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.5 |
GO:0046968 |
peptide antigen transport(GO:0046968) |
| 0.1 |
0.5 |
GO:0045023 |
G0 to G1 transition(GO:0045023) |
| 0.1 |
0.1 |
GO:0044650 |
adhesion of symbiont to host(GO:0044406) adhesion of symbiont to host cell(GO:0044650) receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 |
0.3 |
GO:1990051 |
activation of protein kinase C activity(GO:1990051) |
| 0.1 |
0.3 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.1 |
0.3 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 |
0.5 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 |
0.4 |
GO:0002426 |
immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 |
1.9 |
GO:0035641 |
locomotory exploration behavior(GO:0035641) |
| 0.1 |
4.1 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 |
0.4 |
GO:0042137 |
sequestering of neurotransmitter(GO:0042137) |
| 0.1 |
0.2 |
GO:0060573 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 |
0.5 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.1 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.1 |
1.5 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
3.3 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 |
0.6 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 |
0.2 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 |
0.6 |
GO:0090341 |
negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.1 |
0.5 |
GO:0097460 |
ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 |
0.4 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
1.1 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.1 |
1.3 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 |
0.5 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 |
0.6 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.1 |
0.6 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.6 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
4.6 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.1 |
0.7 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 |
0.6 |
GO:0044108 |
cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.1 |
0.4 |
GO:0044209 |
AMP salvage(GO:0044209) |
| 0.1 |
0.6 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 0.1 |
0.2 |
GO:0060455 |
positive regulation of norepinephrine secretion(GO:0010701) negative regulation of gastric acid secretion(GO:0060455) |
| 0.1 |
1.9 |
GO:1901678 |
heme transport(GO:0015886) iron coordination entity transport(GO:1901678) |
| 0.1 |
0.5 |
GO:2001176 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 |
1.9 |
GO:0098719 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 |
0.7 |
GO:0052551 |
response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.1 |
1.3 |
GO:0017187 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.1 |
GO:0060928 |
atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.1 |
0.5 |
GO:0000412 |
histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 |
0.3 |
GO:0034395 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.1 |
0.8 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.6 |
GO:0045919 |
positive regulation of cytolysis(GO:0045919) |
| 0.1 |
0.5 |
GO:0060969 |
negative regulation of gene silencing(GO:0060969) |
| 0.1 |
0.8 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
2.3 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.1 |
4.8 |
GO:0031055 |
chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 |
0.3 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 |
3.0 |
GO:0031163 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 |
1.7 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.1 |
0.5 |
GO:0070092 |
glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.1 |
0.5 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
0.3 |
GO:1904815 |
negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 |
0.9 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
0.2 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 0.1 |
0.1 |
GO:0072387 |
flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.1 |
0.4 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.1 |
1.4 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
3.4 |
GO:0015697 |
quaternary ammonium group transport(GO:0015697) |
| 0.1 |
0.1 |
GO:0055076 |
transition metal ion homeostasis(GO:0055076) |
| 0.1 |
2.2 |
GO:0034776 |
response to histamine(GO:0034776) |
| 0.1 |
0.3 |
GO:1902463 |
protein localization to cell leading edge(GO:1902463) |
| 0.1 |
0.3 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.1 |
0.7 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
1.3 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.4 |
GO:0045872 |
positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.1 |
1.2 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.4 |
GO:0060079 |
excitatory postsynaptic potential(GO:0060079) |
| 0.1 |
0.2 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.9 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 |
0.9 |
GO:0044211 |
CTP salvage(GO:0044211) |
| 0.1 |
0.2 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
1.1 |
GO:0045779 |
negative regulation of bone resorption(GO:0045779) |
| 0.1 |
0.6 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
0.3 |
GO:0051758 |
homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 |
1.0 |
GO:0070257 |
positive regulation of mucus secretion(GO:0070257) |
| 0.1 |
1.8 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 |
11.9 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.2 |
GO:0035038 |
female pronucleus assembly(GO:0035038) |
| 0.1 |
0.4 |
GO:0036071 |
N-glycan fucosylation(GO:0036071) |
| 0.1 |
1.7 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.1 |
GO:0031118 |
rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 |
0.2 |
GO:0007340 |
acrosome reaction(GO:0007340) |
| 0.1 |
0.4 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 |
1.3 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.1 |
0.9 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.2 |
GO:0060796 |
regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.1 |
0.6 |
GO:0051304 |
regulation of mitotic metaphase/anaphase transition(GO:0030071) chromosome separation(GO:0051304) mitotic sister chromatid separation(GO:0051306) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.1 |
0.2 |
GO:1904479 |
negative regulation of intestinal absorption(GO:1904479) |
| 0.1 |
0.4 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 |
0.2 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.4 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
1.1 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
1.0 |
GO:0046479 |
glycosphingolipid catabolic process(GO:0046479) |
| 0.1 |
1.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 |
0.5 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.9 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 |
0.2 |
GO:0034165 |
regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.1 |
0.1 |
GO:0002034 |
regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.1 |
0.5 |
GO:0036512 |
trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.1 |
0.4 |
GO:0071462 |
cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
| 0.1 |
0.7 |
GO:2000809 |
positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 |
0.5 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 |
0.3 |
GO:1901571 |
icosanoid secretion(GO:0032309) icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.1 |
0.2 |
GO:0036079 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 |
3.7 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.3 |
GO:0071418 |
cellular response to amine stimulus(GO:0071418) |
| 0.1 |
0.5 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 |
0.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 |
0.5 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 |
0.1 |
GO:0006829 |
zinc II ion transport(GO:0006829) |
| 0.1 |
0.2 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
1.3 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.7 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.1 |
0.8 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 |
1.3 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.1 |
0.3 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.1 |
0.2 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
1.8 |
GO:0006086 |
acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 |
0.5 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.1 |
0.6 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.4 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.1 |
0.6 |
GO:0034199 |
activation of protein kinase A activity(GO:0034199) |
| 0.1 |
13.4 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 |
0.6 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.1 |
0.4 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.1 |
1.4 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.1 |
0.3 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.1 |
0.5 |
GO:0031125 |
rRNA 3'-end processing(GO:0031125) |
| 0.1 |
0.5 |
GO:0097369 |
sodium ion import(GO:0097369) |
| 0.1 |
0.5 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 |
1.5 |
GO:0016075 |
rRNA catabolic process(GO:0016075) |
| 0.1 |
0.3 |
GO:1990697 |
protein depalmitoleylation(GO:1990697) |
| 0.1 |
0.5 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 |
0.2 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
0.1 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.1 |
0.6 |
GO:0045959 |
regulation of complement activation, classical pathway(GO:0030450) negative regulation of complement activation, classical pathway(GO:0045959) |
| 0.1 |
0.5 |
GO:0060632 |
regulation of microtubule-based movement(GO:0060632) |
| 0.1 |
0.5 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 |
0.8 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 |
0.4 |
GO:0005985 |
sucrose metabolic process(GO:0005985) sucrose biosynthetic process(GO:0005986) |
| 0.1 |
0.2 |
GO:1900744 |
regulation of p38MAPK cascade(GO:1900744) |
| 0.1 |
0.5 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 |
3.6 |
GO:0007339 |
binding of sperm to zona pellucida(GO:0007339) |
| 0.1 |
0.3 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 |
0.5 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.1 |
0.4 |
GO:0051712 |
positive regulation of killing of cells of other organism(GO:0051712) |
| 0.1 |
0.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
0.8 |
GO:0030969 |
mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.1 |
2.0 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
1.6 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
0.6 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 |
0.9 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 |
3.5 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 |
0.3 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 |
0.6 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 |
0.3 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 0.1 |
0.5 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.3 |
GO:0010918 |
positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 |
0.3 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.1 |
0.9 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 |
0.2 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 |
0.3 |
GO:1901873 |
regulation of post-translational protein modification(GO:1901873) |
| 0.1 |
0.3 |
GO:0048245 |
eosinophil chemotaxis(GO:0048245) |
| 0.1 |
0.2 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
0.5 |
GO:0052805 |
histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 |
0.2 |
GO:0001956 |
positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.1 |
0.7 |
GO:0046618 |
drug export(GO:0046618) |
| 0.1 |
1.2 |
GO:0033141 |
positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.1 |
1.7 |
GO:1990001 |
inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 |
0.2 |
GO:0051715 |
cytolysis in other organism(GO:0051715) |
| 0.1 |
0.1 |
GO:1901624 |
negative regulation of lymphocyte chemotaxis(GO:1901624) |
| 0.1 |
1.0 |
GO:0015866 |
ADP transport(GO:0015866) |
| 0.1 |
0.2 |
GO:0071503 |
response to heparin(GO:0071503) |
| 0.1 |
0.2 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.1 |
0.3 |
GO:2000698 |
positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.1 |
0.6 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.1 |
0.2 |
GO:1901074 |
regulation of engulfment of apoptotic cell(GO:1901074) positive regulation of engulfment of apoptotic cell(GO:1901076) regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.1 |
0.2 |
GO:0010002 |
cardioblast differentiation(GO:0010002) |
| 0.1 |
6.9 |
GO:0060337 |
type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 |
0.4 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 |
0.8 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
0.2 |
GO:0043388 |
positive regulation of DNA binding(GO:0043388) |
| 0.1 |
0.6 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.1 |
2.0 |
GO:0032201 |
telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 |
0.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.4 |
GO:0042350 |
GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.1 |
2.0 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 |
0.1 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.1 |
0.4 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.1 |
2.8 |
GO:0019228 |
neuronal action potential(GO:0019228) |
| 0.1 |
0.2 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 |
0.1 |
GO:0006382 |
adenosine to inosine editing(GO:0006382) |
| 0.1 |
1.3 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 |
0.2 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 |
0.4 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
1.0 |
GO:0070129 |
regulation of mitochondrial translation(GO:0070129) |
| 0.1 |
1.4 |
GO:0001964 |
startle response(GO:0001964) |
| 0.1 |
0.9 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 |
1.7 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.8 |
GO:0016998 |
cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 |
0.2 |
GO:0046603 |
negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.1 |
0.2 |
GO:1901159 |
glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.1 |
1.2 |
GO:0090656 |
t-circle formation(GO:0090656) |
| 0.1 |
0.2 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.1 |
0.4 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 |
2.1 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.1 |
0.2 |
GO:0038171 |
cannabinoid signaling pathway(GO:0038171) |
| 0.1 |
0.2 |
GO:0099525 |
presynaptic dense core granule exocytosis(GO:0099525) |
| 0.1 |
1.3 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.1 |
1.3 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 |
0.2 |
GO:0032581 |
ER-dependent peroxisome organization(GO:0032581) |
| 0.1 |
0.3 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.2 |
GO:0002416 |
IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.1 |
0.4 |
GO:0015878 |
biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.1 |
0.2 |
GO:0006710 |
androgen catabolic process(GO:0006710) |
| 0.1 |
0.3 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.1 |
0.2 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 |
0.3 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.1 |
0.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 |
1.9 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 |
6.3 |
GO:0010257 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.8 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.4 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) |
| 0.1 |
0.3 |
GO:0060620 |
regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.1 |
0.6 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 |
0.3 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.1 |
0.5 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 |
0.2 |
GO:0002818 |
intracellular defense response(GO:0002818) |
| 0.1 |
0.6 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 |
2.9 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 |
0.3 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
0.2 |
GO:0030187 |
melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.1 |
0.1 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.1 |
0.3 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.1 |
0.9 |
GO:0097286 |
iron ion import(GO:0097286) |
| 0.1 |
1.3 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.1 |
0.3 |
GO:0015742 |
alpha-ketoglutarate transport(GO:0015742) |
| 0.1 |
0.5 |
GO:0002026 |
regulation of the force of heart contraction(GO:0002026) |
| 0.1 |
0.1 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.1 |
0.5 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 |
0.1 |
GO:0090076 |
relaxation of skeletal muscle(GO:0090076) |
| 0.1 |
1.3 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 0.1 |
0.1 |
GO:0042450 |
arginine biosynthetic process via ornithine(GO:0042450) |
| 0.1 |
0.4 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.1 |
0.5 |
GO:0021555 |
midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 |
0.4 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 |
0.4 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 |
1.3 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.1 |
0.6 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.5 |
GO:0045047 |
protein targeting to ER(GO:0045047) |
| 0.1 |
1.1 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.1 |
0.4 |
GO:0030282 |
bone mineralization(GO:0030282) |
| 0.1 |
0.2 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 |
0.4 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.1 |
0.2 |
GO:0040040 |
thermosensory behavior(GO:0040040) |
| 0.1 |
0.1 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.1 |
0.6 |
GO:0042771 |
intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 |
0.1 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 |
0.6 |
GO:1903350 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.1 |
0.6 |
GO:1901660 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.1 |
0.2 |
GO:0031018 |
endocrine pancreas development(GO:0031018) |
| 0.1 |
4.7 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
0.5 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 |
0.2 |
GO:0051037 |
regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.1 |
0.1 |
GO:0021530 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 |
0.2 |
GO:0006584 |
catecholamine metabolic process(GO:0006584) catechol-containing compound metabolic process(GO:0009712) |
| 0.1 |
0.2 |
GO:1990168 |
protein K33-linked deubiquitination(GO:1990168) |
| 0.1 |
0.1 |
GO:0007468 |
regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 |
0.6 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 |
0.1 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.1 |
0.4 |
GO:0060480 |
lung goblet cell differentiation(GO:0060480) |
| 0.1 |
0.9 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.1 |
0.4 |
GO:0010756 |
positive regulation of plasminogen activation(GO:0010756) |
| 0.1 |
0.1 |
GO:0006751 |
glutathione catabolic process(GO:0006751) |
| 0.1 |
0.5 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.4 |
GO:0042483 |
negative regulation of odontogenesis(GO:0042483) |
| 0.1 |
0.2 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
1.3 |
GO:0019226 |
transmission of nerve impulse(GO:0019226) |
| 0.1 |
0.4 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
2.5 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.2 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.2 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.1 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.1 |
0.5 |
GO:0043116 |
negative regulation of vascular permeability(GO:0043116) |
| 0.1 |
0.4 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 |
0.1 |
GO:0045425 |
positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.1 |
0.5 |
GO:0006700 |
C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.1 |
0.3 |
GO:0097374 |
vestibulocochlear nerve structural organization(GO:0021649) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of cytokine activity(GO:0060301) renal artery morphogenesis(GO:0061441) ganglion morphogenesis(GO:0061552) endothelial tip cell fate specification(GO:0097102) sensory neuron axon guidance(GO:0097374) positive regulation of retinal ganglion cell axon guidance(GO:1902336) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.1 |
0.2 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.1 |
0.7 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 |
0.1 |
GO:0008078 |
mesodermal cell migration(GO:0008078) |
| 0.1 |
0.1 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.1 |
0.4 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.1 |
1.0 |
GO:0036148 |
phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 |
0.1 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 |
0.3 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 |
0.1 |
GO:0002584 |
negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.1 |
0.6 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 |
1.9 |
GO:2000352 |
negative regulation of endothelial cell apoptotic process(GO:2000352) |
| 0.1 |
0.3 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 |
0.1 |
GO:0036294 |
cellular response to decreased oxygen levels(GO:0036294) cellular response to hypoxia(GO:0071456) |
| 0.1 |
0.1 |
GO:0001782 |
B cell homeostasis(GO:0001782) |
| 0.1 |
0.3 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 |
0.7 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.1 |
0.2 |
GO:0034130 |
toll-like receptor 1 signaling pathway(GO:0034130) |
| 0.1 |
0.2 |
GO:0046532 |
regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 |
0.7 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.1 |
1.0 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 |
0.5 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.3 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.1 |
0.7 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.5 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 |
0.1 |
GO:2000977 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) regulation of forebrain neuron differentiation(GO:2000977) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.1 |
0.3 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 |
0.3 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.1 |
0.8 |
GO:0071830 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 |
1.7 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
0.1 |
GO:0002634 |
regulation of germinal center formation(GO:0002634) |
| 0.1 |
0.4 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.1 |
0.1 |
GO:0071320 |
cellular response to cAMP(GO:0071320) |
| 0.1 |
0.2 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 |
0.2 |
GO:0035624 |
receptor transactivation(GO:0035624) |
| 0.1 |
0.7 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 |
0.3 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 |
0.8 |
GO:1904152 |
regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 |
0.7 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.3 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.1 |
0.6 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.6 |
GO:0035437 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 |
0.7 |
GO:0036149 |
phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.1 |
0.5 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.1 |
0.2 |
GO:0060629 |
regulation of homologous chromosome segregation(GO:0060629) |
| 0.1 |
0.3 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.1 |
0.4 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.1 |
0.2 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.1 |
0.4 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.1 |
0.4 |
GO:0045071 |
negative regulation of viral genome replication(GO:0045071) |
| 0.1 |
0.4 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
1.1 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.1 |
0.3 |
GO:0021884 |
forebrain neuron development(GO:0021884) |
| 0.1 |
0.3 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.1 |
0.1 |
GO:0001970 |
positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.1 |
0.5 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
1.1 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.1 |
0.1 |
GO:0038195 |
urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 |
1.8 |
GO:0051602 |
response to electrical stimulus(GO:0051602) |
| 0.0 |
0.0 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 |
0.0 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.0 |
0.2 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.0 |
3.0 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.1 |
GO:0035902 |
response to immobilization stress(GO:0035902) |
| 0.0 |
0.3 |
GO:0052422 |
modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 |
0.5 |
GO:0043152 |
induction of bacterial agglutination(GO:0043152) |
| 0.0 |
0.2 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 |
0.1 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.1 |
GO:1904772 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 |
0.6 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.2 |
GO:0002880 |
chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 |
0.3 |
GO:0050919 |
negative chemotaxis(GO:0050919) |
| 0.0 |
0.6 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 |
0.3 |
GO:0051612 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 |
0.5 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.0 |
0.1 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 |
0.1 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 0.0 |
0.4 |
GO:0001915 |
negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 |
0.5 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.2 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 |
0.1 |
GO:0001777 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 |
0.1 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.0 |
1.2 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 |
0.1 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.0 |
0.5 |
GO:0045837 |
negative regulation of membrane potential(GO:0045837) |
| 0.0 |
0.5 |
GO:0042533 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.0 |
0.8 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.4 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 |
0.4 |
GO:0072178 |
nephric duct morphogenesis(GO:0072178) |
| 0.0 |
1.2 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 |
0.2 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 |
0.0 |
GO:0010609 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 |
0.2 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.0 |
0.5 |
GO:2001046 |
positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.0 |
0.2 |
GO:0001889 |
liver development(GO:0001889) hepaticobiliary system development(GO:0061008) |
| 0.0 |
0.1 |
GO:0002260 |
lymphocyte homeostasis(GO:0002260) |
| 0.0 |
0.4 |
GO:0007628 |
adult walking behavior(GO:0007628) |
| 0.0 |
0.7 |
GO:0030828 |
positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 |
0.3 |
GO:2000617 |
positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 |
0.5 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 |
0.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.0 |
0.1 |
GO:1902850 |
mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 |
0.3 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.0 |
1.4 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.0 |
0.2 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.0 |
1.0 |
GO:0030308 |
negative regulation of cell growth(GO:0030308) |
| 0.0 |
0.3 |
GO:0021834 |
chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.0 |
0.1 |
GO:0016068 |
regulation of type I hypersensitivity(GO:0001810) positive regulation of type I hypersensitivity(GO:0001812) type I hypersensitivity(GO:0016068) |
| 0.0 |
0.4 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
0.5 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.0 |
0.3 |
GO:0032481 |
positive regulation of type I interferon production(GO:0032481) |
| 0.0 |
0.4 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 |
0.2 |
GO:0018057 |
peptidyl-lysine oxidation(GO:0018057) |
| 0.0 |
0.3 |
GO:1901661 |
quinone metabolic process(GO:1901661) |
| 0.0 |
0.2 |
GO:0046104 |
thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 |
0.0 |
GO:1902159 |
regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.0 |
0.2 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
1.1 |
GO:0002717 |
positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 |
0.2 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.0 |
0.1 |
GO:0021551 |
central nervous system morphogenesis(GO:0021551) cardiac muscle tissue regeneration(GO:0061026) regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 |
0.2 |
GO:0090410 |
malonate catabolic process(GO:0090410) |
| 0.0 |
0.1 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.0 |
0.1 |
GO:1900226 |
negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.0 |
1.0 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 |
0.2 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.0 |
0.2 |
GO:0010988 |
regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 |
0.3 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.0 |
0.2 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.0 |
0.2 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 |
0.2 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 |
0.1 |
GO:0060788 |
ectodermal placode formation(GO:0060788) hair follicle placode formation(GO:0060789) ectodermal placode development(GO:0071696) ectodermal placode morphogenesis(GO:0071697) |
| 0.0 |
0.1 |
GO:1901383 |
negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.0 |
0.2 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.0 |
0.2 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 |
0.2 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.0 |
0.1 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 |
0.1 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.0 |
0.1 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.0 |
0.0 |
GO:0060482 |
lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 |
0.2 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 |
0.2 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.0 |
0.4 |
GO:1901409 |
positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 |
0.9 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 |
0.1 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.0 |
0.4 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 |
0.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.0 |
0.1 |
GO:0032966 |
negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 |
0.3 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.0 |
0.2 |
GO:0072711 |
cellular response to hydroxyurea(GO:0072711) |
| 0.0 |
0.2 |
GO:0007195 |
adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 |
0.1 |
GO:0071529 |
cementum mineralization(GO:0071529) |
| 0.0 |
0.6 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.0 |
0.2 |
GO:0070383 |
DNA cytosine deamination(GO:0070383) |
| 0.0 |
0.6 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.6 |
GO:0007625 |
grooming behavior(GO:0007625) |
| 0.0 |
1.1 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.1 |
GO:0007538 |
primary sex determination(GO:0007538) |
| 0.0 |
0.1 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.0 |
0.1 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.0 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.7 |
GO:0007158 |
neuron cell-cell adhesion(GO:0007158) |
| 0.0 |
0.2 |
GO:0036371 |
protein localization to T-tubule(GO:0036371) |
| 0.0 |
3.6 |
GO:0050911 |
detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 |
0.3 |
GO:0001696 |
gastric acid secretion(GO:0001696) |
| 0.0 |
0.2 |
GO:0002517 |
T cell tolerance induction(GO:0002517) |
| 0.0 |
4.0 |
GO:0051436 |
negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) |
| 0.0 |
0.2 |
GO:0015865 |
purine nucleotide transport(GO:0015865) |
| 0.0 |
0.1 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 |
0.0 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 |
1.2 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.0 |
0.2 |
GO:0048665 |
neuron fate specification(GO:0048665) |
| 0.0 |
0.1 |
GO:0048485 |
sympathetic nervous system development(GO:0048485) |
| 0.0 |
0.1 |
GO:0006425 |
glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 |
0.2 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 |
0.5 |
GO:0071625 |
vocalization behavior(GO:0071625) |
| 0.0 |
0.3 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 |
0.5 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.0 |
0.3 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 |
0.4 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 |
0.0 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 |
0.1 |
GO:1901143 |
insulin catabolic process(GO:1901143) |
| 0.0 |
0.8 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.9 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.1 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 |
0.4 |
GO:2001259 |
positive regulation of cation channel activity(GO:2001259) |
| 0.0 |
0.7 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.0 |
0.5 |
GO:0051607 |
defense response to virus(GO:0051607) |
| 0.0 |
0.4 |
GO:1904837 |
beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 |
0.1 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.0 |
0.1 |
GO:1904897 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 |
0.3 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 |
0.2 |
GO:0061318 |
renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 |
0.1 |
GO:0002863 |
positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
| 0.0 |
0.1 |
GO:0010842 |
retina layer formation(GO:0010842) retina morphogenesis in camera-type eye(GO:0060042) |
| 0.0 |
0.4 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.0 |
0.2 |
GO:0006458 |
'de novo' protein folding(GO:0006458) |
| 0.0 |
0.9 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) |
| 0.0 |
0.3 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 |
0.4 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.0 |
0.2 |
GO:1901532 |
regulation of megakaryocyte differentiation(GO:0045652) regulation of hematopoietic progenitor cell differentiation(GO:1901532) |
| 0.0 |
0.1 |
GO:1900019 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 |
0.1 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.0 |
0.2 |
GO:0035640 |
exploration behavior(GO:0035640) |
| 0.0 |
1.2 |
GO:0050427 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 |
0.1 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.0 |
0.3 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 |
0.2 |
GO:0090154 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 |
0.3 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.0 |
0.1 |
GO:1901018 |
positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 |
0.3 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 |
0.2 |
GO:0098758 |
interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 |
0.2 |
GO:0090646 |
mitochondrial tRNA processing(GO:0090646) |
| 0.0 |
0.1 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.0 |
0.1 |
GO:0006986 |
response to unfolded protein(GO:0006986) response to topologically incorrect protein(GO:0035966) |
| 0.0 |
0.0 |
GO:0048370 |
lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) lateral mesodermal cell fate commitment(GO:0048372) lateral mesodermal cell fate specification(GO:0048377) regulation of lateral mesodermal cell fate specification(GO:0048378) |
| 0.0 |
0.4 |
GO:0000732 |
strand displacement(GO:0000732) |
| 0.0 |
0.2 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 |
0.6 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.1 |
GO:0080120 |
CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.0 |
0.1 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 |
0.3 |
GO:0060021 |
palate development(GO:0060021) |
| 0.0 |
0.1 |
GO:0002304 |
gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.0 |
0.2 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.0 |
0.1 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 |
0.3 |
GO:0031054 |
pre-miRNA processing(GO:0031054) |
| 0.0 |
0.1 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 |
0.1 |
GO:0048840 |
otolith morphogenesis(GO:0032474) otolith development(GO:0048840) |
| 0.0 |
0.1 |
GO:0000436 |
carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.0 |
0.4 |
GO:1901072 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 |
0.3 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 |
0.1 |
GO:0060295 |
regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 |
0.0 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.0 |
0.1 |
GO:0071158 |
positive regulation of cell cycle arrest(GO:0071158) |
| 0.0 |
0.2 |
GO:0072698 |
protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.0 |
0.3 |
GO:0010827 |
regulation of glucose transport(GO:0010827) |
| 0.0 |
0.3 |
GO:0071380 |
cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 |
0.3 |
GO:0018231 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 |
0.2 |
GO:0018146 |
keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 |
0.2 |
GO:0006264 |
mitochondrial DNA replication(GO:0006264) |
| 0.0 |
0.1 |
GO:0043932 |
ossification involved in bone remodeling(GO:0043932) |
| 0.0 |
0.1 |
GO:0070255 |
regulation of mucus secretion(GO:0070255) |
| 0.0 |
0.0 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 |
0.2 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 |
0.4 |
GO:0048935 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 |
0.0 |
GO:0036155 |
acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.0 |
0.3 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.0 |
0.1 |
GO:0021826 |
substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.0 |
1.0 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.0 |
0.1 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.1 |
GO:0051685 |
endoplasmic reticulum localization(GO:0051643) maintenance of ER location(GO:0051685) |
| 0.0 |
0.1 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
0.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 |
0.3 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.0 |
0.2 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.0 |
0.2 |
GO:0002092 |
positive regulation of receptor internalization(GO:0002092) |
| 0.0 |
0.2 |
GO:0070987 |
error-free translesion synthesis(GO:0070987) |
| 0.0 |
0.2 |
GO:0001865 |
NK T cell differentiation(GO:0001865) |
| 0.0 |
0.1 |
GO:0043987 |
histone H3-S10 phosphorylation(GO:0043987) |
| 0.0 |
0.2 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.2 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.0 |
0.3 |
GO:0031640 |
killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 |
0.0 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 |
0.2 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 |
0.0 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 |
0.4 |
GO:1902236 |
negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 |
0.2 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.0 |
0.0 |
GO:0015870 |
acetylcholine transport(GO:0015870) |
| 0.0 |
0.1 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 |
0.1 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.0 |
0.0 |
GO:0060298 |
sarcomerogenesis(GO:0048769) positive regulation of sarcomere organization(GO:0060298) |
| 0.0 |
0.3 |
GO:1901642 |
nucleoside transmembrane transport(GO:1901642) |
| 0.0 |
0.1 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.1 |
GO:0009213 |
pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 |
0.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.0 |
0.3 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 |
0.4 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.0 |
0.1 |
GO:0019075 |
virus maturation(GO:0019075) |
| 0.0 |
0.4 |
GO:0035235 |
ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 |
0.7 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
0.0 |
GO:0098735 |
positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 |
0.1 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 |
0.2 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.1 |
GO:0006668 |
sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 |
0.0 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 |
0.5 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.0 |
0.2 |
GO:0042733 |
embryonic digit morphogenesis(GO:0042733) |
| 0.0 |
0.1 |
GO:0042461 |
photoreceptor cell development(GO:0042461) |
| 0.0 |
0.3 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.0 |
0.8 |
GO:0015909 |
long-chain fatty acid transport(GO:0015909) |
| 0.0 |
0.1 |
GO:0038155 |
interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.0 |
0.2 |
GO:0039694 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 |
0.1 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.0 |
0.1 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.0 |
0.2 |
GO:0032328 |
alanine transport(GO:0032328) |
| 0.0 |
0.6 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 |
0.2 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.0 |
0.2 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.2 |
GO:0003310 |
pancreatic A cell differentiation(GO:0003310) |
| 0.0 |
0.2 |
GO:0019471 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
0.4 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.0 |
0.1 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.0 |
0.1 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 |
0.1 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.1 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 |
0.0 |
GO:0051458 |
corticotropin secretion(GO:0051458) |
| 0.0 |
0.0 |
GO:0055094 |
response to lipoprotein particle(GO:0055094) cellular response to lipoprotein particle stimulus(GO:0071402) |
| 0.0 |
0.4 |
GO:0008211 |
glucocorticoid metabolic process(GO:0008211) |
| 0.0 |
1.0 |
GO:0000381 |
regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 |
0.1 |
GO:0009191 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 |
0.5 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.0 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 |
0.1 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.0 |
0.1 |
GO:0061047 |
regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 |
0.2 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 |
0.2 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.0 |
0.1 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.0 |
1.0 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 |
0.3 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.8 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.2 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.0 |
0.1 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.0 |
0.4 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.0 |
0.1 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 |
0.0 |
GO:0099640 |
axo-dendritic protein transport(GO:0099640) |
| 0.0 |
0.6 |
GO:0090662 |
ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 |
0.2 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 |
0.1 |
GO:0035934 |
corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 |
0.1 |
GO:1901098 |
positive regulation of autophagosome maturation(GO:1901098) |
| 0.0 |
0.0 |
GO:0035793 |
positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.0 |
0.3 |
GO:0046856 |
phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 |
0.1 |
GO:0061577 |
calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.0 |
0.2 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.0 |
0.1 |
GO:0072679 |
thymocyte migration(GO:0072679) |
| 0.0 |
0.4 |
GO:0043030 |
regulation of macrophage activation(GO:0043030) |
| 0.0 |
0.1 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.0 |
0.1 |
GO:2000106 |
regulation of leukocyte apoptotic process(GO:2000106) |
| 0.0 |
0.1 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.0 |
0.1 |
GO:0000730 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 |
0.0 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 |
0.1 |
GO:2000234 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 |
0.1 |
GO:0061622 |
glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 |
0.1 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 |
0.1 |
GO:0071313 |
cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 |
0.2 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
0.4 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.0 |
0.1 |
GO:0006777 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 |
0.1 |
GO:0006707 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 |
0.1 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.0 |
0.2 |
GO:0007129 |
synapsis(GO:0007129) |
| 0.0 |
0.1 |
GO:1902746 |
regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 |
0.1 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.0 |
0.1 |
GO:0060044 |
negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 |
0.1 |
GO:0051103 |
DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 |
0.1 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 |
0.3 |
GO:0007289 |
spermatid nucleus differentiation(GO:0007289) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.1 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 |
0.1 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.0 |
0.0 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.0 |
0.2 |
GO:0035810 |
positive regulation of urine volume(GO:0035810) |
| 0.0 |
0.1 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 |
0.1 |
GO:2000188 |
regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 |
0.1 |
GO:0060591 |
Sertoli cell fate commitment(GO:0060010) chondroblast differentiation(GO:0060591) |
| 0.0 |
0.1 |
GO:0019477 |
L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.0 |
0.8 |
GO:0071277 |
cellular response to calcium ion(GO:0071277) |
| 0.0 |
0.1 |
GO:0042303 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 |
0.1 |
GO:0006336 |
DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.0 |
0.2 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 |
0.3 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.0 |
0.1 |
GO:0034340 |
response to type I interferon(GO:0034340) |
| 0.0 |
0.1 |
GO:0072033 |
renal vesicle formation(GO:0072033) |
| 0.0 |
0.1 |
GO:1900454 |
positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 |
0.0 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 |
0.0 |
GO:0051145 |
smooth muscle cell differentiation(GO:0051145) |
| 0.0 |
0.3 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 |
0.1 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.0 |
0.1 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.2 |
GO:0035338 |
long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 |
0.0 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.0 |
0.0 |
GO:0072172 |
mesonephric tubule formation(GO:0072172) |
| 0.0 |
0.1 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 |
0.1 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 |
0.1 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 |
0.0 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 |
0.0 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 |
0.1 |
GO:0051703 |
social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 |
0.1 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 |
0.0 |
GO:0060135 |
maternal placenta development(GO:0001893) maternal process involved in female pregnancy(GO:0060135) |
| 0.0 |
0.2 |
GO:0007194 |
negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 |
0.1 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.0 |
0.6 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.0 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 |
0.1 |
GO:0050775 |
positive regulation of dendrite morphogenesis(GO:0050775) |
