| 2.1 |
8.6 |
GO:0021966 |
corticospinal neuron axon guidance(GO:0021966) |
| 1.7 |
8.4 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.6 |
4.9 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 1.5 |
4.5 |
GO:2000502 |
negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 1.4 |
4.3 |
GO:0017186 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 1.2 |
3.6 |
GO:0035623 |
renal glucose absorption(GO:0035623) |
| 1.1 |
5.5 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 1.1 |
3.2 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 1.0 |
4.0 |
GO:0045013 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.9 |
0.9 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.9 |
0.9 |
GO:0090116 |
C-5 methylation of cytosine(GO:0090116) |
| 0.8 |
2.3 |
GO:1903697 |
negative regulation of microvillus assembly(GO:1903697) |
| 0.7 |
3.0 |
GO:0090301 |
regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.7 |
3.7 |
GO:0015688 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.7 |
3.6 |
GO:0009440 |
cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.7 |
14.3 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.7 |
3.4 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.7 |
2.0 |
GO:0072428 |
signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.6 |
5.7 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.6 |
2.4 |
GO:0014859 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.6 |
4.5 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.6 |
2.3 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.6 |
2.3 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.5 |
1.6 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.5 |
2.1 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.5 |
1.5 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.5 |
1.5 |
GO:0060929 |
Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 0.5 |
1.5 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.5 |
1.9 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.5 |
3.2 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.5 |
1.8 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.5 |
1.4 |
GO:0019516 |
lactate oxidation(GO:0019516) |
| 0.5 |
1.4 |
GO:0070904 |
L-ascorbic acid transport(GO:0015882) molecular hydrogen transport(GO:0015993) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.4 |
1.3 |
GO:0014876 |
response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.4 |
6.2 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.4 |
2.6 |
GO:0070945 |
neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.4 |
2.6 |
GO:0072240 |
DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.4 |
1.7 |
GO:1901594 |
detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.4 |
1.3 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.4 |
0.8 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.4 |
2.4 |
GO:0048389 |
intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 |
1.6 |
GO:0006850 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.4 |
2.8 |
GO:0019322 |
pentose biosynthetic process(GO:0019322) |
| 0.4 |
1.6 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.4 |
1.2 |
GO:0038162 |
erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.4 |
1.9 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.4 |
1.1 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.4 |
1.4 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.4 |
1.1 |
GO:0021571 |
rhombomere 5 development(GO:0021571) |
| 0.3 |
5.8 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.3 |
1.0 |
GO:0043000 |
Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.3 |
0.7 |
GO:1900738 |
positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.3 |
2.3 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 |
1.0 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.3 |
1.0 |
GO:1904976 |
response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.3 |
0.3 |
GO:0032873 |
regulation of stress-activated MAPK cascade(GO:0032872) negative regulation of stress-activated MAPK cascade(GO:0032873) regulation of stress-activated protein kinase signaling cascade(GO:0070302) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.3 |
3.2 |
GO:0086024 |
adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.3 |
1.0 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.3 |
4.1 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.3 |
2.8 |
GO:0035747 |
natural killer cell chemotaxis(GO:0035747) |
| 0.3 |
1.6 |
GO:0031296 |
B cell costimulation(GO:0031296) |
| 0.3 |
1.2 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.3 |
2.4 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.3 |
0.9 |
GO:1904397 |
negative regulation of neuromuscular junction development(GO:1904397) |
| 0.3 |
1.2 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.3 |
0.9 |
GO:0060623 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) response to DDT(GO:0046680) regulation of chromosome condensation(GO:0060623) histone H3-S10 phosphorylation involved in chromosome condensation(GO:2000775) |
| 0.3 |
3.8 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.3 |
0.9 |
GO:2000611 |
positive regulation of thyroid hormone generation(GO:2000611) |
| 0.3 |
2.0 |
GO:0010133 |
proline catabolic process to glutamate(GO:0010133) |
| 0.3 |
1.1 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 |
0.9 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.3 |
1.1 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.3 |
1.4 |
GO:0070092 |
regulation of glucagon secretion(GO:0070092) |
| 0.3 |
1.1 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
0.8 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.3 |
0.8 |
GO:0042727 |
flavin-containing compound biosynthetic process(GO:0042727) |
| 0.3 |
1.3 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.3 |
1.3 |
GO:1904141 |
mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.3 |
1.0 |
GO:1904482 |
response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.3 |
1.3 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.3 |
1.3 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.3 |
1.5 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.2 |
0.5 |
GO:0032456 |
endocytic recycling(GO:0032456) |
| 0.2 |
0.7 |
GO:0002352 |
B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.2 |
1.2 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 0.2 |
0.7 |
GO:0006173 |
dADP biosynthetic process(GO:0006173) |
| 0.2 |
1.0 |
GO:0046882 |
negative regulation of B cell differentiation(GO:0045578) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.2 |
0.7 |
GO:2000627 |
regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.2 |
2.8 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.2 |
0.7 |
GO:1900369 |
transcription, RNA-templated(GO:0001172) negative regulation of RNA interference(GO:1900369) |
| 0.2 |
0.9 |
GO:0001808 |
negative regulation of type IV hypersensitivity(GO:0001808) |
| 0.2 |
2.1 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.2 |
0.9 |
GO:0036378 |
calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.2 |
0.7 |
GO:1990697 |
protein depalmitoleylation(GO:1990697) |
| 0.2 |
1.1 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.2 |
0.7 |
GO:0043602 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.2 |
0.9 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.2 |
0.2 |
GO:0002260 |
lymphocyte homeostasis(GO:0002260) |
| 0.2 |
2.8 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.2 |
0.6 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 |
0.6 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.2 |
1.1 |
GO:0090076 |
relaxation of skeletal muscle(GO:0090076) |
| 0.2 |
0.2 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.2 |
0.9 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.2 |
0.2 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.2 |
0.6 |
GO:1902303 |
regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.2 |
0.4 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.2 |
1.5 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 |
1.5 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
1.4 |
GO:0034036 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.2 |
0.4 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.2 |
0.6 |
GO:0060829 |
regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.2 |
0.2 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.2 |
3.5 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.2 |
1.8 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.2 |
0.2 |
GO:0051402 |
neuron apoptotic process(GO:0051402) |
| 0.2 |
1.6 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 |
1.4 |
GO:0060480 |
lung goblet cell differentiation(GO:0060480) |
| 0.2 |
1.0 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.2 |
5.0 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.2 |
0.6 |
GO:0009078 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.2 |
1.2 |
GO:0098746 |
fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.2 |
1.0 |
GO:1904636 |
response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.2 |
1.5 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) epidermis morphogenesis(GO:0048730) |
| 0.2 |
0.2 |
GO:0060823 |
canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.2 |
1.3 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.2 |
1.0 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 |
0.8 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.2 |
0.6 |
GO:1900075 |
regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.2 |
1.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
0.9 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 |
0.4 |
GO:0086014 |
atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
| 0.2 |
2.6 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
0.7 |
GO:0044537 |
regulation of circulating fibrinogen levels(GO:0044537) |
| 0.2 |
0.9 |
GO:0036115 |
fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.2 |
1.6 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.2 |
2.9 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 |
0.2 |
GO:0046939 |
nucleoside diphosphate phosphorylation(GO:0006165) nucleotide phosphorylation(GO:0046939) |
| 0.2 |
0.5 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.2 |
1.4 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.2 |
1.2 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.2 |
3.7 |
GO:0032988 |
ribonucleoprotein complex disassembly(GO:0032988) |
| 0.2 |
0.3 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.2 |
2.6 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.2 |
0.9 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 |
0.5 |
GO:1990637 |
response to prolactin(GO:1990637) |
| 0.2 |
0.5 |
GO:0060720 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.2 |
2.5 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.2 |
0.2 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) |
| 0.2 |
1.2 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 |
0.3 |
GO:0019442 |
tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 0.2 |
1.0 |
GO:0035407 |
histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 |
0.3 |
GO:0008347 |
glial cell migration(GO:0008347) |
| 0.2 |
1.0 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 |
0.5 |
GO:1902463 |
protein localization to cell leading edge(GO:1902463) |
| 0.2 |
1.4 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.2 |
0.8 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.2 |
2.5 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.2 |
1.9 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.2 |
0.3 |
GO:0043388 |
positive regulation of DNA binding(GO:0043388) |
| 0.2 |
0.9 |
GO:0051673 |
membrane disruption in other organism(GO:0051673) |
| 0.2 |
1.4 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.2 |
0.3 |
GO:0032481 |
positive regulation of type I interferon production(GO:0032481) |
| 0.2 |
0.6 |
GO:0045872 |
positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.2 |
0.8 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.2 |
0.6 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.2 |
0.9 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) positive regulation of centriole replication(GO:0046601) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 |
0.3 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 |
0.6 |
GO:0019918 |
peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 |
1.0 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 |
0.6 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.1 |
0.6 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
2.7 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
0.4 |
GO:1905069 |
allantois development(GO:1905069) |
| 0.1 |
2.6 |
GO:1901748 |
leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 |
0.7 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.1 |
0.7 |
GO:0042350 |
GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.1 |
0.7 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.1 |
0.7 |
GO:0090341 |
negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.1 |
0.4 |
GO:0070105 |
positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 |
0.7 |
GO:0032425 |
positive regulation of mismatch repair(GO:0032425) |
| 0.1 |
0.4 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.1 |
1.2 |
GO:0098989 |
NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.1 |
0.3 |
GO:1903831 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 |
1.4 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 |
0.3 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
1.9 |
GO:2000680 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
0.9 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 0.1 |
1.1 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
1.1 |
GO:0060371 |
regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.1 |
0.6 |
GO:0010767 |
regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 0.1 |
1.0 |
GO:0014057 |
positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 |
0.8 |
GO:0070295 |
renal water absorption(GO:0070295) |
| 0.1 |
0.4 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.1 |
0.1 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.1 |
1.0 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.1 |
0.4 |
GO:0002590 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.1 |
1.4 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.5 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 |
0.5 |
GO:0071348 |
cellular response to interleukin-11(GO:0071348) |
| 0.1 |
0.1 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.1 |
0.8 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 |
0.3 |
GO:1990051 |
activation of protein kinase C activity(GO:1990051) |
| 0.1 |
0.1 |
GO:0010609 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 |
0.3 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 |
0.7 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.5 |
GO:0033132 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
0.8 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.1 |
0.5 |
GO:0042374 |
phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 |
0.7 |
GO:0008588 |
release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 |
1.3 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.1 |
3.2 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.1 |
1.3 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.1 |
0.9 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.1 |
0.1 |
GO:2000196 |
positive regulation of female gonad development(GO:2000196) |
| 0.1 |
2.4 |
GO:0045008 |
depyrimidination(GO:0045008) |
| 0.1 |
0.5 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.1 |
0.9 |
GO:0097113 |
AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.1 |
1.6 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.1 |
GO:1904139 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.1 |
0.2 |
GO:0042098 |
T cell proliferation(GO:0042098) |
| 0.1 |
1.0 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 |
1.6 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
0.6 |
GO:0006540 |
glutamate decarboxylation to succinate(GO:0006540) |
| 0.1 |
1.5 |
GO:0071316 |
cellular response to nicotine(GO:0071316) |
| 0.1 |
0.5 |
GO:0032571 |
response to vitamin K(GO:0032571) |
| 0.1 |
0.2 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
0.7 |
GO:0051142 |
regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.1 |
1.9 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 |
0.4 |
GO:0046823 |
negative regulation of nucleocytoplasmic transport(GO:0046823) |
| 0.1 |
0.5 |
GO:0042421 |
noradrenergic neuron differentiation(GO:0003357) norepinephrine biosynthetic process(GO:0042421) |
| 0.1 |
2.0 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.1 |
0.2 |
GO:0010644 |
cell communication by electrical coupling(GO:0010644) |
| 0.1 |
0.6 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.1 |
0.1 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.1 |
0.5 |
GO:0003335 |
corneocyte development(GO:0003335) |
| 0.1 |
0.9 |
GO:0000066 |
mitochondrial ornithine transport(GO:0000066) |
| 0.1 |
0.3 |
GO:0002426 |
immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 |
0.3 |
GO:0021644 |
vagus nerve morphogenesis(GO:0021644) chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.1 |
1.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.6 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.1 |
0.3 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.1 |
1.2 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.1 |
1.0 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
0.3 |
GO:0097212 |
cadmium ion homeostasis(GO:0055073) lysosomal membrane organization(GO:0097212) regulation of hydrogen peroxide catabolic process(GO:2000295) negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 0.1 |
1.4 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.1 |
0.2 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 |
0.4 |
GO:0071503 |
response to heparin(GO:0071503) |
| 0.1 |
0.4 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.1 |
0.4 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.1 |
0.2 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.1 |
4.9 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.1 |
0.3 |
GO:0070676 |
intralumenal vesicle formation(GO:0070676) |
| 0.1 |
0.3 |
GO:0016242 |
negative regulation of macroautophagy(GO:0016242) |
| 0.1 |
1.5 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 |
0.8 |
GO:0071502 |
cellular response to temperature stimulus(GO:0071502) |
| 0.1 |
0.5 |
GO:0061364 |
apoptotic process involved in luteolysis(GO:0061364) |
| 0.1 |
0.5 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.1 |
4.0 |
GO:0007271 |
synaptic transmission, cholinergic(GO:0007271) |
| 0.1 |
0.1 |
GO:0003162 |
atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.1 |
0.8 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 |
9.9 |
GO:0010257 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.7 |
GO:0001709 |
cell fate determination(GO:0001709) |
| 0.1 |
0.6 |
GO:0042816 |
vitamin B6 metabolic process(GO:0042816) |
| 0.1 |
2.0 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.3 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.8 |
GO:0045667 |
regulation of osteoblast differentiation(GO:0045667) |
| 0.1 |
0.5 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.1 |
2.2 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.1 |
0.3 |
GO:0043932 |
ossification involved in bone remodeling(GO:0043932) |
| 0.1 |
0.6 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 |
0.3 |
GO:0060734 |
regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.1 |
0.5 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 |
0.4 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 |
0.4 |
GO:0070627 |
ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 |
0.5 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.1 |
0.6 |
GO:0090002 |
establishment of protein localization to plasma membrane(GO:0090002) |
| 0.1 |
0.6 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.3 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 |
0.7 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.1 |
0.1 |
GO:0031125 |
rRNA 3'-end processing(GO:0031125) |
| 0.1 |
0.1 |
GO:0002874 |
regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 |
2.3 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 |
0.5 |
GO:0000430 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 |
2.3 |
GO:0090023 |
positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 |
1.1 |
GO:0032364 |
oxygen homeostasis(GO:0032364) |
| 0.1 |
1.0 |
GO:0046149 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 |
0.3 |
GO:0021586 |
pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 |
0.2 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.1 |
0.3 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 |
1.3 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 0.1 |
0.3 |
GO:0072287 |
metanephric distal tubule morphogenesis(GO:0072287) |
| 0.1 |
0.3 |
GO:0002879 |
positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.1 |
0.8 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.3 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 |
0.5 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 |
2.2 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 |
0.6 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.1 |
0.1 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 |
0.5 |
GO:2001033 |
negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.1 |
0.5 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.1 |
0.2 |
GO:0002884 |
negative regulation of hypersensitivity(GO:0002884) |
| 0.1 |
0.1 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 |
0.7 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 |
0.2 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 |
0.4 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.4 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.1 |
0.2 |
GO:2000824 |
negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 |
0.2 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
0.6 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
0.1 |
GO:0072577 |
endothelial cell apoptotic process(GO:0072577) positive regulation of epithelial cell apoptotic process(GO:1904037) positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.6 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.1 |
1.0 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.1 |
0.2 |
GO:0051758 |
homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 |
0.3 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 |
1.9 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 |
0.2 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.1 |
0.4 |
GO:0006050 |
mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.1 |
0.4 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
1.7 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 |
0.3 |
GO:0032915 |
positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.1 |
0.4 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 |
0.3 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.3 |
GO:0072301 |
visceral serous pericardium development(GO:0061032) negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of metanephric glomerulus development(GO:0072299) regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) negative regulation of glomerulus development(GO:0090194) |
| 0.1 |
1.7 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
1.5 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.1 |
0.5 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.1 |
1.4 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.1 |
0.2 |
GO:0071377 |
cellular response to glucagon stimulus(GO:0071377) |
| 0.1 |
1.3 |
GO:0045779 |
negative regulation of bone resorption(GO:0045779) |
| 0.1 |
0.7 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 |
0.4 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
1.8 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.1 |
0.4 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.1 |
1.0 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.1 |
0.3 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) regulation of NADP metabolic process(GO:1902031) |
| 0.1 |
0.4 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.1 |
0.1 |
GO:0046010 |
positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.1 |
0.2 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
0.2 |
GO:0051037 |
regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.1 |
1.7 |
GO:0097696 |
JAK-STAT cascade(GO:0007259) STAT cascade(GO:0097696) |
| 0.1 |
0.6 |
GO:0035815 |
positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 |
0.7 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 |
1.6 |
GO:0007625 |
grooming behavior(GO:0007625) |
| 0.1 |
0.6 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 |
0.3 |
GO:1901387 |
positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.1 |
1.3 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.1 |
0.1 |
GO:0002023 |
reduction of food intake in response to dietary excess(GO:0002023) |
| 0.1 |
0.3 |
GO:0005985 |
sucrose metabolic process(GO:0005985) sucrose biosynthetic process(GO:0005986) |
| 0.1 |
1.4 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.1 |
0.9 |
GO:0000050 |
urea cycle(GO:0000050) |
| 0.1 |
3.9 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.1 |
0.2 |
GO:1901876 |
regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 |
0.2 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 |
0.2 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 |
0.3 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.1 |
0.9 |
GO:0061088 |
regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 |
0.2 |
GO:0019303 |
D-ribose metabolic process(GO:0006014) D-ribose catabolic process(GO:0019303) |
| 0.1 |
0.3 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.3 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 |
1.5 |
GO:0045717 |
negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 |
0.3 |
GO:0050771 |
negative regulation of axonogenesis(GO:0050771) |
| 0.1 |
0.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.1 |
0.5 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.7 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.3 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.1 |
0.6 |
GO:0071156 |
regulation of cell cycle arrest(GO:0071156) |
| 0.1 |
0.6 |
GO:0051552 |
flavone metabolic process(GO:0051552) |
| 0.1 |
0.1 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 |
0.4 |
GO:0051612 |
negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 |
0.2 |
GO:0045409 |
gastric motility(GO:0035482) gastric emptying(GO:0035483) positive regulation of growth rate(GO:0040010) negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) negative regulation of interleukin-6 biosynthetic process(GO:0045409) regulation of gastric mucosal blood circulation(GO:1904344) positive regulation of gastric mucosal blood circulation(GO:1904346) regulation of small intestine smooth muscle contraction(GO:1904347) positive regulation of small intestine smooth muscle contraction(GO:1904349) gastric mucosal blood circulation(GO:1990768) small intestine smooth muscle contraction(GO:1990770) |
| 0.1 |
5.0 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.1 |
1.0 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.6 |
GO:1901660 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.1 |
1.4 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.1 |
0.2 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.7 |
GO:0017187 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.3 |
GO:1904158 |
axonemal central apparatus assembly(GO:1904158) |
| 0.1 |
0.2 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 |
0.4 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.1 |
0.7 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.1 |
0.3 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.2 |
GO:0014904 |
myotube cell development(GO:0014904) skeletal muscle fiber development(GO:0048741) |
| 0.1 |
0.3 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.1 |
0.7 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 0.1 |
0.6 |
GO:0070543 |
response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 0.1 |
0.2 |
GO:1902161 |
positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 |
0.4 |
GO:0019060 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 |
0.4 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.1 |
0.1 |
GO:0035331 |
regulation of hippo signaling(GO:0035330) negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.2 |
GO:0070343 |
white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.1 |
0.1 |
GO:1901623 |
regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.1 |
2.5 |
GO:0031055 |
chromatin remodeling at centromere(GO:0031055) |
| 0.1 |
0.2 |
GO:0035038 |
female pronucleus assembly(GO:0035038) |
| 0.1 |
0.2 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.1 |
1.5 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.1 |
0.1 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 0.1 |
0.9 |
GO:0070257 |
positive regulation of mucus secretion(GO:0070257) |
| 0.1 |
1.9 |
GO:0050912 |
detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.1 |
0.2 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.2 |
GO:2000342 |
negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 |
0.3 |
GO:0090004 |
positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.1 |
1.0 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 |
0.2 |
GO:0036515 |
serotonergic neuron axon guidance(GO:0036515) |
| 0.1 |
0.3 |
GO:0033490 |
cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.1 |
0.5 |
GO:0046549 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 |
0.5 |
GO:0061525 |
hindgut development(GO:0061525) |
| 0.1 |
0.3 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.1 |
0.3 |
GO:0070309 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) lens fiber cell morphogenesis(GO:0070309) |
| 0.1 |
0.9 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.1 |
1.5 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 |
0.2 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 |
0.3 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 |
0.2 |
GO:0032824 |
negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) positive regulation of cytolysis in other organism(GO:0051714) |
| 0.1 |
0.5 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.2 |
GO:0048808 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 |
1.0 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 |
0.6 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.3 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.1 |
0.1 |
GO:0050955 |
thermoception(GO:0050955) |
| 0.1 |
2.0 |
GO:0002076 |
osteoblast development(GO:0002076) |
| 0.1 |
0.5 |
GO:0038171 |
cannabinoid signaling pathway(GO:0038171) |
| 0.1 |
1.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.1 |
0.5 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.2 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.1 |
0.2 |
GO:0021587 |
cerebellum morphogenesis(GO:0021587) |
| 0.1 |
0.2 |
GO:1900181 |
negative regulation of protein localization to nucleus(GO:1900181) |
| 0.1 |
0.1 |
GO:0002461 |
tolerance induction dependent upon immune response(GO:0002461) |
| 0.1 |
0.3 |
GO:0036371 |
protein localization to T-tubule(GO:0036371) |
| 0.1 |
1.3 |
GO:0035791 |
platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.1 |
0.3 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 |
0.2 |
GO:1904897 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 |
0.4 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.1 |
0.3 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 |
0.7 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.1 |
0.6 |
GO:0018211 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 |
0.7 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.0 |
0.1 |
GO:0070839 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) spleen trabecula formation(GO:0060345) divalent metal ion export(GO:0070839) iron cation export(GO:1903414) ferrous iron export(GO:1903988) |
| 0.0 |
0.2 |
GO:0003015 |
heart process(GO:0003015) heart contraction(GO:0060047) |
| 0.0 |
0.4 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.5 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.0 |
0.4 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 |
1.7 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 |
0.4 |
GO:2000637 |
positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 |
1.7 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 |
0.4 |
GO:0015698 |
inorganic anion transport(GO:0015698) |
| 0.0 |
0.1 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.0 |
1.1 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.0 |
2.1 |
GO:0007339 |
binding of sperm to zona pellucida(GO:0007339) |
| 0.0 |
0.2 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.0 |
0.4 |
GO:1900264 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 |
0.9 |
GO:0061577 |
calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.0 |
0.2 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 |
1.2 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.0 |
0.5 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.0 |
0.2 |
GO:0032091 |
negative regulation of protein binding(GO:0032091) |
| 0.0 |
0.4 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.0 |
5.2 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.0 |
0.0 |
GO:0051458 |
corticotropin secretion(GO:0051458) |
| 0.0 |
0.1 |
GO:0045720 |
negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.0 |
0.3 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 |
0.3 |
GO:0042494 |
detection of bacterial lipoprotein(GO:0042494) |
| 0.0 |
0.5 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 |
0.9 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
1.4 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.0 |
0.4 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.0 |
0.4 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 |
0.8 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 |
3.3 |
GO:0006081 |
cellular aldehyde metabolic process(GO:0006081) |
| 0.0 |
2.8 |
GO:0060395 |
SMAD protein signal transduction(GO:0060395) |
| 0.0 |
0.3 |
GO:0061162 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 |
0.5 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.0 |
0.9 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 |
0.1 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.0 |
0.4 |
GO:0097039 |
protein linear polyubiquitination(GO:0097039) |
| 0.0 |
0.2 |
GO:1901805 |
termination of signal transduction(GO:0023021) beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.0 |
0.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.0 |
0.6 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 0.0 |
0.2 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.0 |
0.4 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.0 |
0.1 |
GO:0010226 |
response to lithium ion(GO:0010226) |
| 0.0 |
0.1 |
GO:0045006 |
DNA deamination(GO:0045006) |
| 0.0 |
1.1 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 |
1.7 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 |
0.6 |
GO:0010663 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 |
0.2 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 |
0.2 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 |
0.2 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.3 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.0 |
0.1 |
GO:0048485 |
sympathetic nervous system development(GO:0048485) |
| 0.0 |
0.9 |
GO:0016075 |
rRNA catabolic process(GO:0016075) |
| 0.0 |
0.2 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.0 |
0.2 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
1.0 |
GO:0045124 |
regulation of bone resorption(GO:0045124) |
| 0.0 |
1.8 |
GO:0031112 |
positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
| 0.0 |
0.8 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.0 |
0.3 |
GO:1901142 |
insulin metabolic process(GO:1901142) |
| 0.0 |
2.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.1 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.0 |
0.1 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.4 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 0.0 |
0.4 |
GO:0048752 |
semicircular canal morphogenesis(GO:0048752) |
| 0.0 |
1.2 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
1.2 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.0 |
0.4 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.3 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 |
0.5 |
GO:1904837 |
beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 |
0.1 |
GO:0061056 |
sclerotome development(GO:0061056) |
| 0.0 |
0.3 |
GO:0009227 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.0 |
0.2 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
0.1 |
GO:0008630 |
intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.0 |
1.0 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.7 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.0 |
0.3 |
GO:0006216 |
cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 |
0.1 |
GO:0002864 |
hypersensitivity(GO:0002524) regulation of acute inflammatory response to antigenic stimulus(GO:0002864) regulation of hypersensitivity(GO:0002883) |
| 0.0 |
0.3 |
GO:0009113 |
purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 |
0.1 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 |
0.3 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 |
1.2 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.0 |
0.2 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 |
0.1 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 |
0.2 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.0 |
0.3 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 |
0.2 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.0 |
0.1 |
GO:0002677 |
negative regulation of chronic inflammatory response(GO:0002677) negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.0 |
0.5 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.0 |
0.1 |
GO:0014060 |
regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
| 0.0 |
0.8 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.0 |
GO:0098735 |
positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 |
0.1 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 |
0.2 |
GO:0043128 |
regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.0 |
0.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 |
0.2 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.4 |
GO:0051782 |
negative regulation of cell division(GO:0051782) |
| 0.0 |
1.8 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 |
0.3 |
GO:0097502 |
mannosylation(GO:0097502) |
| 0.0 |
0.0 |
GO:0072674 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 |
0.1 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.8 |
GO:0019722 |
calcium-mediated signaling(GO:0019722) |
| 0.0 |
0.2 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 |
0.9 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 |
0.2 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.2 |
GO:0045408 |
regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.0 |
0.5 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.4 |
GO:0018904 |
ether metabolic process(GO:0018904) |
| 0.0 |
0.3 |
GO:0016998 |
cell wall macromolecule catabolic process(GO:0016998) |
| 0.0 |
0.2 |
GO:0060332 |
positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 |
0.1 |
GO:2000523 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 |
0.5 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.3 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 |
0.5 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 |
0.1 |
GO:0007202 |
activation of phospholipase C activity(GO:0007202) |
| 0.0 |
0.3 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.2 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.0 |
0.1 |
GO:1904772 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 |
0.1 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.0 |
0.1 |
GO:0070301 |
cellular response to hydrogen peroxide(GO:0070301) |
| 0.0 |
0.4 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.0 |
0.4 |
GO:0015949 |
nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 |
0.2 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.3 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 |
0.8 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 |
0.1 |
GO:0002890 |
negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) |
| 0.0 |
1.0 |
GO:0015988 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 |
0.3 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.0 |
0.2 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 |
0.4 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.0 |
0.3 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 |
0.3 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 |
0.2 |
GO:0002098 |
tRNA wobble uridine modification(GO:0002098) |
| 0.0 |
0.3 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.2 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.0 |
0.6 |
GO:0030449 |
regulation of complement activation(GO:0030449) |
| 0.0 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 |
0.6 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.0 |
0.2 |
GO:0098773 |
skin epidermis development(GO:0098773) |
| 0.0 |
0.2 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 |
0.4 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 |
0.3 |
GO:0030433 |
ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 |
0.3 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.0 |
0.6 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 |
0.2 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.2 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 |
0.2 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 |
0.4 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 |
0.2 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.0 |
0.5 |
GO:0008207 |
C21-steroid hormone metabolic process(GO:0008207) |
| 0.0 |
0.1 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.0 |
0.2 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 0.0 |
3.2 |
GO:0043462 |
regulation of ATPase activity(GO:0043462) |
| 0.0 |
0.1 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.0 |
0.2 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.0 |
0.3 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 |
0.2 |
GO:0072672 |
neutrophil extravasation(GO:0072672) regulation of neutrophil extravasation(GO:2000389) |
| 0.0 |
0.1 |
GO:0045556 |
TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.0 |
0.2 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.0 |
0.3 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
0.7 |
GO:0000732 |
strand displacement(GO:0000732) |
| 0.0 |
1.3 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 |
0.6 |
GO:0007219 |
Notch signaling pathway(GO:0007219) |
| 0.0 |
0.1 |
GO:0097052 |
L-kynurenine metabolic process(GO:0097052) |
| 0.0 |
0.1 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.0 |
0.0 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 |
0.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.0 |
0.0 |
GO:2000974 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.0 |
0.2 |
GO:0021954 |
central nervous system neuron development(GO:0021954) |
| 0.0 |
0.4 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 |
0.3 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.6 |
GO:0042303 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 |
0.6 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
1.7 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.3 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 |
0.1 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.3 |
GO:0006782 |
protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 |
0.9 |
GO:0061098 |
positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.0 |
0.1 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.0 |
0.3 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.0 |
0.2 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
0.2 |
GO:1903147 |
negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
| 0.0 |
0.2 |
GO:0070296 |
sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.0 |
0.0 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.0 |
0.1 |
GO:0030888 |
regulation of B cell proliferation(GO:0030888) |
| 0.0 |
0.1 |
GO:0050650 |
chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 |
0.1 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.0 |
0.2 |
GO:0097056 |
selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.0 |
0.1 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 |
0.0 |
GO:0014717 |
regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) skeletal muscle satellite cell activation(GO:0014719) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.0 |
0.5 |
GO:0061036 |
positive regulation of cartilage development(GO:0061036) |
| 0.0 |
0.2 |
GO:0006893 |
Golgi to plasma membrane transport(GO:0006893) |
| 0.0 |
0.2 |
GO:0046855 |
inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 |
0.3 |
GO:0042773 |
ATP synthesis coupled electron transport(GO:0042773) mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 |
0.4 |
GO:0010586 |
miRNA metabolic process(GO:0010586) |
| 0.0 |
0.2 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.0 |
0.1 |
GO:0018057 |
peptidyl-lysine oxidation(GO:0018057) |
| 0.0 |
0.1 |
GO:0010830 |
regulation of myotube differentiation(GO:0010830) |
| 0.0 |
0.3 |
GO:0045636 |
positive regulation of melanocyte differentiation(GO:0045636) |
| 0.0 |
0.8 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.0 |
0.4 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.7 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.0 |
0.1 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.0 |
0.1 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.3 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.0 |
0.1 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 |
0.1 |
GO:2000671 |
regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 |
0.2 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.2 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.1 |
GO:1903275 |
protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 |
0.1 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.0 |
0.4 |
GO:0042438 |
melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
| 0.0 |
0.3 |
GO:0070098 |
chemokine-mediated signaling pathway(GO:0070098) |
| 0.0 |
0.1 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.0 |
0.1 |
GO:1903027 |
regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.0 |
1.1 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.5 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.0 |
0.8 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.0 |
0.0 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.0 |
0.0 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.0 |
0.3 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.1 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 |
0.6 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.2 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.3 |
GO:0006611 |
protein export from nucleus(GO:0006611) |
| 0.0 |
0.4 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 |
0.1 |
GO:0070829 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 |
0.1 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.1 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 |
0.2 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.0 |
0.2 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 |
1.1 |
GO:0032233 |
positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 |
0.2 |
GO:1901216 |
positive regulation of neuron death(GO:1901216) |
| 0.0 |
0.1 |
GO:0090156 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 |
0.6 |
GO:0030593 |
neutrophil chemotaxis(GO:0030593) |
| 0.0 |
0.3 |
GO:0034755 |
iron ion transmembrane transport(GO:0034755) |
| 0.0 |
0.1 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.0 |
0.3 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.0 |
0.5 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.1 |
GO:0052565 |
response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.0 |
0.1 |
GO:0015669 |
gas transport(GO:0015669) |
| 0.0 |
0.4 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.1 |
GO:0098758 |
interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 |
0.0 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.0 |
0.2 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.1 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.0 |
0.3 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 |
0.1 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 |
0.2 |
GO:0003310 |
pancreatic A cell differentiation(GO:0003310) |
| 0.0 |
0.1 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.0 |
0.0 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.0 |
0.3 |
GO:1901798 |
positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 |
0.1 |
GO:0060291 |
long-term synaptic potentiation(GO:0060291) |
| 0.0 |
0.8 |
GO:0021510 |
spinal cord development(GO:0021510) |
| 0.0 |
0.1 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.3 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.0 |
0.1 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.0 |
0.1 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) optic nerve structural organization(GO:0021633) |
| 0.0 |
0.0 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 |
0.2 |
GO:0010043 |
response to zinc ion(GO:0010043) |
| 0.0 |
0.2 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 |
0.1 |
GO:0015781 |
pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 |
0.0 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 |
0.0 |
GO:0006382 |
adenosine to inosine editing(GO:0006382) |
| 0.0 |
0.3 |
GO:0007205 |
protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 |
0.1 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 |
0.0 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 |
0.2 |
GO:0032201 |
telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 |
0.1 |
GO:0044211 |
CTP salvage(GO:0044211) |
| 0.0 |
0.1 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 |
0.2 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.1 |
GO:0021871 |
forebrain regionalization(GO:0021871) |
| 0.0 |
0.2 |
GO:0006032 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 |
0.1 |
GO:0002183 |
cytoplasmic translational initiation(GO:0002183) |
| 0.0 |
0.6 |
GO:0006040 |
amino sugar metabolic process(GO:0006040) |
| 0.0 |
0.2 |
GO:0098780 |
response to mitochondrial depolarisation(GO:0098780) |
| 0.0 |
0.0 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.0 |
0.1 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 |
0.2 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.0 |
0.1 |
GO:0009214 |
cyclic nucleotide catabolic process(GO:0009214) |
| 0.0 |
0.0 |
GO:0048644 |
muscle organ morphogenesis(GO:0048644) cardiac muscle tissue morphogenesis(GO:0055008) muscle tissue morphogenesis(GO:0060415) |
| 0.0 |
0.1 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 |
0.9 |
GO:0071804 |
cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
| 0.0 |
0.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 |
0.2 |
GO:1900102 |
negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.0 |
0.2 |
GO:0090218 |
positive regulation of lipid kinase activity(GO:0090218) |
| 0.0 |
0.1 |
GO:0030889 |
negative regulation of B cell proliferation(GO:0030889) |
| 0.0 |
0.1 |
GO:0030865 |
cortical cytoskeleton organization(GO:0030865) cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 |
0.1 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
