| 0.8 |
2.5 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 0.5 |
3.2 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
0.3 |
GO:0061341 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.2 |
0.7 |
GO:0042231 |
interleukin-13 biosynthetic process(GO:0042231) |
| 0.2 |
1.3 |
GO:0070384 |
Harderian gland development(GO:0070384) |
| 0.2 |
0.6 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.2 |
1.2 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 |
0.7 |
GO:1903575 |
cornified envelope assembly(GO:1903575) |
| 0.1 |
0.4 |
GO:1903572 |
regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.1 |
0.4 |
GO:0060128 |
corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.1 |
0.1 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 |
1.2 |
GO:0061669 |
spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 |
0.5 |
GO:1902162 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) platelet alpha granule organization(GO:0070889) regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.1 |
0.4 |
GO:0003130 |
BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.1 |
0.6 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) maintenance of chromatin silencing(GO:0006344) |
| 0.1 |
0.8 |
GO:0010482 |
epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 |
0.3 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.1 |
1.0 |
GO:2000620 |
innate vocalization behavior(GO:0098582) positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.1 |
0.5 |
GO:2000721 |
pilomotor reflex(GO:0097195) positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 |
0.3 |
GO:0036166 |
phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 |
0.3 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.1 |
0.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.1 |
0.3 |
GO:0035922 |
pulmonary valve formation(GO:0003193) foramen ovale closure(GO:0035922) regulation of bundle of His cell action potential(GO:0098905) |
| 0.1 |
0.4 |
GO:1904636 |
response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.1 |
0.4 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 0.1 |
0.3 |
GO:0018057 |
peptidyl-lysine oxidation(GO:0018057) |
| 0.1 |
0.3 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.1 |
0.1 |
GO:0060738 |
epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.1 |
0.3 |
GO:0030221 |
basophil differentiation(GO:0030221) |
| 0.1 |
0.1 |
GO:0003169 |
coronary vein morphogenesis(GO:0003169) |
| 0.1 |
0.3 |
GO:0060374 |
mast cell differentiation(GO:0060374) |
| 0.1 |
0.3 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
0.4 |
GO:1903860 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 |
0.3 |
GO:0003358 |
noradrenergic neuron development(GO:0003358) |
| 0.1 |
1.4 |
GO:0070444 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 |
0.2 |
GO:0051885 |
positive regulation of anagen(GO:0051885) |
| 0.1 |
0.4 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.1 |
0.3 |
GO:0036304 |
umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.1 |
0.3 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.1 |
1.1 |
GO:0038129 |
ERBB3 signaling pathway(GO:0038129) |
| 0.1 |
0.2 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 |
1.0 |
GO:0006707 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.2 |
GO:1902232 |
regulation of positive thymic T cell selection(GO:1902232) |
| 0.1 |
0.3 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 |
0.4 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 |
1.1 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.1 |
0.2 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
1.1 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
0.5 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.1 |
0.9 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 |
0.4 |
GO:0010166 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 |
0.7 |
GO:0030917 |
midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 |
1.5 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.2 |
GO:1904328 |
regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.1 |
1.8 |
GO:0071481 |
cellular response to X-ray(GO:0071481) |
| 0.1 |
0.3 |
GO:0071109 |
superior temporal gyrus development(GO:0071109) |
| 0.1 |
0.4 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.1 |
0.2 |
GO:0043006 |
activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.1 |
0.5 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.1 |
0.2 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 |
0.2 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.1 |
0.2 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.1 |
0.4 |
GO:1901314 |
negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 |
0.2 |
GO:0002585 |
positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.1 |
0.4 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.2 |
GO:1904897 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 |
0.2 |
GO:0032765 |
positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 |
0.2 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 |
0.2 |
GO:1901994 |
meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 |
0.3 |
GO:0060982 |
coronary artery morphogenesis(GO:0060982) |
| 0.1 |
0.2 |
GO:0048627 |
myoblast development(GO:0048627) |
| 0.1 |
0.3 |
GO:0093001 |
glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.1 |
0.5 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 |
0.4 |
GO:2001268 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 |
0.3 |
GO:0070778 |
L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.1 |
0.1 |
GO:0060458 |
right lung development(GO:0060458) |
| 0.0 |
0.5 |
GO:0098795 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 |
0.3 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 |
0.7 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.2 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 |
0.4 |
GO:0002074 |
extraocular skeletal muscle development(GO:0002074) |
| 0.0 |
0.5 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 |
0.2 |
GO:0021571 |
rhombomere 5 development(GO:0021571) |
| 0.0 |
0.2 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.0 |
0.5 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.0 |
0.1 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.0 |
0.5 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.0 |
0.5 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 |
0.3 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.0 |
0.1 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.0 |
0.3 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.0 |
0.4 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.0 |
0.2 |
GO:0021823 |
cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.0 |
0.2 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.0 |
0.2 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.0 |
0.2 |
GO:2000611 |
thyroid-stimulating hormone secretion(GO:0070460) positive regulation of thyroid hormone generation(GO:2000611) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.0 |
0.3 |
GO:0015760 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.2 |
GO:0061056 |
sclerotome development(GO:0061056) |
| 0.0 |
0.4 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.0 |
0.1 |
GO:0036493 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 |
0.2 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.2 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 |
0.1 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 |
0.4 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 |
0.3 |
GO:0045905 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.3 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.0 |
0.1 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 |
0.9 |
GO:2000821 |
regulation of grooming behavior(GO:2000821) |
| 0.0 |
0.1 |
GO:1903233 |
regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.0 |
0.1 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.0 |
0.5 |
GO:0021800 |
cerebral cortex tangential migration(GO:0021800) |
| 0.0 |
0.3 |
GO:0060005 |
vestibular reflex(GO:0060005) |
| 0.0 |
0.6 |
GO:1904776 |
regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 |
0.8 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 |
0.1 |
GO:1902809 |
regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 |
0.1 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.0 |
0.1 |
GO:0099540 |
synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 |
0.1 |
GO:1903659 |
regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 |
0.1 |
GO:0007538 |
primary sex determination(GO:0007538) |
| 0.0 |
0.2 |
GO:0090116 |
C-5 methylation of cytosine(GO:0090116) |
| 0.0 |
0.1 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 |
0.2 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.0 |
0.2 |
GO:2000503 |
positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 |
0.1 |
GO:0002368 |
B cell cytokine production(GO:0002368) protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 |
0.1 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 |
0.2 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 |
0.1 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.0 |
0.1 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 |
0.1 |
GO:1990834 |
response to odorant(GO:1990834) |
| 0.0 |
0.1 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 |
0.1 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 |
0.3 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 |
0.2 |
GO:0014859 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 |
0.4 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.0 |
0.2 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 0.0 |
0.2 |
GO:0033029 |
regulation of neutrophil apoptotic process(GO:0033029) |
| 0.0 |
0.4 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 |
0.1 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.0 |
0.1 |
GO:1902462 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 |
0.3 |
GO:0015691 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 |
0.2 |
GO:0045586 |
regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.0 |
0.1 |
GO:0044725 |
chromatin reprogramming in the zygote(GO:0044725) |
| 0.0 |
0.1 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 0.0 |
0.2 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.0 |
0.1 |
GO:1903691 |
positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 |
0.1 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.0 |
0.1 |
GO:1900020 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 |
0.5 |
GO:1903286 |
regulation of potassium ion import(GO:1903286) |
| 0.0 |
0.5 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
0.1 |
GO:1901535 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 |
0.2 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.1 |
GO:1901350 |
cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.0 |
0.2 |
GO:0051621 |
negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) regulation of peroxidase activity(GO:2000468) positive regulation of peroxidase activity(GO:2000470) |
| 0.0 |
0.2 |
GO:2000490 |
negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 |
0.2 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.2 |
GO:0007068 |
negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.0 |
0.1 |
GO:0002329 |
pre-B cell differentiation(GO:0002329) |
| 0.0 |
0.1 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.0 |
0.1 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.0 |
0.1 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.0 |
0.0 |
GO:0035281 |
pre-miRNA export from nucleus(GO:0035281) |
| 0.0 |
0.0 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.0 |
0.1 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.0 |
0.4 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.1 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.0 |
0.2 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 |
0.0 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 |
0.1 |
GO:1900425 |
negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 |
0.3 |
GO:0001766 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 |
0.2 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 0.0 |
0.2 |
GO:2000807 |
regulation of synaptic vesicle clustering(GO:2000807) |
| 0.0 |
0.2 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.1 |
GO:0060535 |
trachea cartilage morphogenesis(GO:0060535) |
| 0.0 |
0.5 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.0 |
0.2 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.0 |
0.0 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 |
0.1 |
GO:0031291 |
Ran protein signal transduction(GO:0031291) |
| 0.0 |
0.1 |
GO:0061358 |
negative regulation of Wnt protein secretion(GO:0061358) |
| 0.0 |
0.1 |
GO:0030886 |
negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 |
0.1 |
GO:1903595 |
positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 |
0.1 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.0 |
0.0 |
GO:2000617 |
positive regulation of histone H3-K9 acetylation(GO:2000617) |
| 0.0 |
0.1 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 |
0.5 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.0 |
0.1 |
GO:0071931 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) |
| 0.0 |
0.1 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.0 |
0.5 |
GO:0043555 |
regulation of translation in response to stress(GO:0043555) |
| 0.0 |
0.1 |
GO:1904861 |
excitatory synapse assembly(GO:1904861) |
| 0.0 |
0.1 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 |
0.1 |
GO:1901899 |
positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.0 |
0.3 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.0 |
0.1 |
GO:0002501 |
peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.0 |
0.0 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.0 |
0.0 |
GO:0003064 |
regulation of heart rate by hormone(GO:0003064) |
| 0.0 |
0.0 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.0 |
0.3 |
GO:0048298 |
positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 |
0.1 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.0 |
0.4 |
GO:0015732 |
prostaglandin transport(GO:0015732) |
| 0.0 |
0.2 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.0 |
0.1 |
GO:0097498 |
endothelial tube lumen extension(GO:0097498) |
| 0.0 |
0.2 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 |
0.2 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 |
0.0 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.0 |
0.2 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.0 |
0.7 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.1 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 |
0.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 |
0.1 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 0.0 |
0.1 |
GO:0000432 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 |
0.1 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 |
0.1 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 0.0 |
0.1 |
GO:0001712 |
ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 |
0.1 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.0 |
0.3 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 |
0.1 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 |
0.0 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.0 |
0.1 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.2 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 |
0.2 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 |
0.2 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.0 |
0.0 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 |
0.2 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.0 |
0.1 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 |
0.1 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.0 |
0.1 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 |
0.2 |
GO:0042428 |
serotonin metabolic process(GO:0042428) |
| 0.0 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.0 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 0.0 |
0.2 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 |
0.1 |
GO:0045542 |
positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.0 |
0.1 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 |
0.1 |
GO:0090009 |
primitive streak formation(GO:0090009) |
| 0.0 |
0.0 |
GO:0021569 |
rhombomere 3 development(GO:0021569) |
| 0.0 |
0.0 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.0 |
0.7 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
0.1 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.0 |
0.6 |
GO:0046839 |
phospholipid dephosphorylation(GO:0046839) |
| 0.0 |
0.1 |
GO:0014894 |
response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 |
0.0 |
GO:1900155 |
regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 |
0.1 |
GO:0010801 |
negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 |
0.1 |
GO:0060482 |
lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 |
0.0 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 0.0 |
0.2 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.0 |
0.1 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.0 |
0.1 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.0 |
0.2 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 |
0.1 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.0 |
0.2 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.1 |
GO:0048541 |
mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.0 |
0.1 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.0 |
0.0 |
GO:1900114 |
positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.0 |
0.1 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 |
0.1 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.3 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.0 |
0.2 |
GO:0021527 |
spinal cord association neuron differentiation(GO:0021527) |
| 0.0 |
0.2 |
GO:0042354 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 |
0.1 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.0 |
0.1 |
GO:0060125 |
negative regulation of growth hormone secretion(GO:0060125) |
| 0.0 |
0.1 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.0 |
0.3 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.0 |
0.9 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.1 |
GO:2000741 |
positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.0 |
0.6 |
GO:0003009 |
skeletal muscle contraction(GO:0003009) |
| 0.0 |
0.1 |
GO:0044791 |
modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 |
0.0 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.0 |
0.1 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.0 |
0.1 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.1 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 |
0.1 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.0 |
0.0 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 0.0 |
0.0 |
GO:0006045 |
N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.0 |
0.1 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.0 |
0.0 |
GO:0050925 |
negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 |
0.5 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 |
0.2 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.0 |
0.0 |
GO:0060684 |
epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 |
0.1 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 |
0.1 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 |
0.0 |
GO:0050928 |
negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 |
0.1 |
GO:1990441 |
negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.0 |
0.0 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 |
0.1 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.0 |
0.1 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
