Project
Epithelial-Mesenchymal Transition, human (Scheel, 2011)
Navigation
Downloads
Results for WT1_MTF1_ZBTB7B
Z-value: 1.07
Motif logo
Transcription factors associated with WT1_MTF1_ZBTB7B
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
WT1
|
ENSG00000184937.16 | WT1 transcription factor |
|
MTF1
|
ENSG00000188786.10 | metal regulatory transcription factor 1 |
|
ZBTB7B
|
ENSG00000160685.13 | zinc finger and BTB domain containing 7B |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| WT1 | hg38_v1_chr11_-_32430811_32430817, hg38_v1_chr11_-_32435557_32435578 | 0.66 | 7.7e-02 | Click! |
| MTF1 | hg38_v1_chr1_-_37859583_37859609 | -0.23 | 5.8e-01 | Click! |
| ZBTB7B | hg38_v1_chr1_+_155002630_155002689 | 0.08 | 8.5e-01 | Click! |
Activity profile of WT1_MTF1_ZBTB7B motif
Sorted Z-values of WT1_MTF1_ZBTB7B motif
Network of associatons between targets according to the STRING database.
First level regulatory network of WT1_MTF1_ZBTB7B
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 5.7 | GO:0032597 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.8 | 3.9 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.6 | 1.7 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 0.5 | 1.6 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.5 | 3.1 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.5 | 1.5 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.5 | 2.5 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.5 | 10.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.4 | 1.3 | GO:2000309 | positive regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000309) positive regulation of thymocyte migration(GO:2000412) |
| 0.4 | 1.7 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.4 | 1.3 | GO:0036304 | umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.4 | 3.5 | GO:2000620 | innate vocalization behavior(GO:0098582) positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.4 | 1.9 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.4 | 1.5 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.4 | 2.1 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.3 | 1.3 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.3 | 1.0 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.3 | 1.9 | GO:0089712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.3 | 0.9 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.3 | 0.9 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.3 | 0.9 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.3 | 0.9 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.3 | 0.6 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.3 | 1.7 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.3 | 0.8 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.3 | 1.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.3 | 1.6 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.3 | 1.4 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.3 | 1.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.3 | 1.8 | GO:0060066 | oviduct development(GO:0060066) |
| 0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.3 | 1.0 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.2 | 0.7 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.2 | 0.2 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 | 1.2 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.2 | 2.4 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.2 | 0.7 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.2 | 0.7 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.2 | 2.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.2 | 3.0 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.2 | 0.7 | GO:0048560 | establishment of anatomical structure orientation(GO:0048560) |
| 0.2 | 2.0 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.2 | 0.7 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.2 | 2.7 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.2 | 2.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.2 | 3.6 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 0.9 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.9 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 0.7 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.2 | 0.7 | GO:1905064 | negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.2 | 1.1 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 1.3 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.2 | 0.6 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.2 | 0.6 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 2.7 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.2 | 0.6 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 | 0.6 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.2 | 0.6 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.2 | 0.2 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.2 | 0.8 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.2 | 0.6 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.2 | 0.6 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.2 | 0.6 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.2 | 1.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.2 | 0.4 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.2 | 0.7 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 0.7 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.2 | 1.6 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.2 | 0.9 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.2 | 0.5 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.2 | 1.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.2 | 0.5 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.2 | 0.7 | GO:0048627 | myoblast development(GO:0048627) |
| 0.2 | 0.9 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 0.2 | 0.5 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.2 | 0.5 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.2 | 0.5 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.2 | 2.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.2 | 0.7 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 0.7 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.2 | 0.8 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.2 | 0.5 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.2 | 0.6 | GO:0035625 | epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.2 | 0.2 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
| 0.2 | 1.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.2 | 1.0 | GO:2000468 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) regulation of peroxidase activity(GO:2000468) positive regulation of peroxidase activity(GO:2000470) |
| 0.2 | 0.5 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.2 | 0.8 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 1.5 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 | 0.5 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.2 | 0.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.2 | 0.5 | GO:0001796 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) |
| 0.2 | 0.6 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.1 | 0.6 | GO:0060197 | cloacal septation(GO:0060197) |
| 0.1 | 1.3 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 0.6 | GO:0090095 | regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.1 | 3.3 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.1 | 1.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 3.4 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 0.6 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.1 | 1.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.1 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.1 | 0.4 | GO:0051463 | negative regulation of cortisol secretion(GO:0051463) |
| 0.1 | 0.3 | GO:1903973 | negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) |
| 0.1 | 0.3 | GO:0071812 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 | 0.1 | GO:0070256 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.1 | 0.5 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 1.8 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.1 | 0.9 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.3 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 | 0.9 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 1.6 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.5 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.1 | 2.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.8 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.3 | GO:1903937 | response to acrylamide(GO:1903937) |
| 0.1 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.1 | 0.9 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 | 0.5 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.1 | 0.4 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.4 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.1 | 4.8 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.4 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.1 | 1.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.2 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 | 0.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 1.1 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 0.6 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 1.3 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.7 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.1 | 0.2 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.1 | 1.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.4 | GO:0061573 | endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.1 | 0.6 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 | 0.8 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.5 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.1 | 0.2 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.6 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.1 | 1.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.2 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.1 | 0.5 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.1 | 0.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 0.3 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.1 | 0.5 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.4 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.1 | 0.9 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 1.2 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 1.4 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.8 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 0.4 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 0.2 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 | 0.5 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 0.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.3 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.1 | 0.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.1 | 0.3 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.3 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 2.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.3 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.7 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.4 | GO:0002268 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.1 | 0.7 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 0.5 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 2.2 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.1 | 0.6 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 1.7 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) |
| 0.1 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.1 | GO:1903243 | negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.1 | 2.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.9 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 1.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.5 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 1.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.3 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 0.3 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.1 | 0.3 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.6 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.1 | 0.1 | GO:0060723 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 | 0.3 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 0.4 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.4 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.1 | 0.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.7 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.4 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.8 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.4 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 1.8 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.1 | 0.7 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.7 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.1 | 0.2 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 0.6 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.2 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.1 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.1 | 0.4 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.1 | 1.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.1 | 0.4 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.2 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.3 | GO:0008615 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.1 | 0.3 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.1 | 0.4 | GO:0042853 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 | 0.2 | GO:0097274 | urea homeostasis(GO:0097274) |
| 0.1 | 0.7 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 1.0 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 | 0.2 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.1 | 0.4 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.1 | 0.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.2 | GO:2000078 | positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.1 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.2 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 0.6 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.3 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.1 | 0.3 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 0.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.5 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.1 | 0.2 | GO:1903576 | response to L-arginine(GO:1903576) |
| 0.1 | 0.2 | GO:2001287 | regulation of caveolin-mediated endocytosis(GO:2001286) negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.1 | 1.0 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.7 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.2 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 0.2 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.1 | 0.2 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.1 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.1 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.1 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.4 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 1.8 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.1 | 0.7 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 0.4 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 0.6 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.8 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 | 0.1 | GO:0060458 | right lung development(GO:0060458) |
| 0.1 | 1.2 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.1 | 1.3 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 0.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 | 0.7 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 0.2 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.1 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.4 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.1 | 0.5 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 | 0.3 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.6 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.2 | GO:0018963 | phthalate metabolic process(GO:0018963) |
| 0.1 | 0.3 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.1 | 0.3 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.1 | 0.2 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 | 0.2 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.1 | 0.2 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.1 | 1.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.2 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.1 | 0.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.1 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
| 0.1 | 0.5 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) |
| 0.1 | 0.1 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) |
| 0.1 | 0.3 | GO:0097646 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 | 0.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.1 | 0.7 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.1 | 0.1 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.2 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 0.2 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) |
| 0.1 | 0.3 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.1 | 0.1 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 | 0.5 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.2 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.1 | 0.6 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.2 | GO:0060058 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 | 0.1 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
| 0.1 | 0.3 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 | 0.2 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.2 | GO:0061699 | protein demalonylation(GO:0036046) peptidyl-lysine demalonylation(GO:0036047) protein desuccinylation(GO:0036048) peptidyl-lysine desuccinylation(GO:0036049) protein deglutarylation(GO:0061698) peptidyl-lysine deglutarylation(GO:0061699) |
| 0.1 | 0.1 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 0.3 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 0.2 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 0.4 | GO:1905245 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) regulation of aspartic-type peptidase activity(GO:1905245) |
| 0.1 | 0.2 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.3 | GO:2000984 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 | 0.3 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.1 | 0.6 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.3 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 0.4 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 0.8 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 0.3 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.7 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.1 | 0.1 | GO:1902823 | neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) negative regulation of late endosome to lysosome transport(GO:1902823) |
| 0.1 | 0.2 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.1 | 0.4 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.2 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.1 | 0.3 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.2 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 0.2 | GO:2000797 | amniotic stem cell differentiation(GO:0097086) negative regulation of dense core granule biogenesis(GO:2000706) negative regulation of mesenchymal stem cell differentiation(GO:2000740) regulation of amniotic stem cell differentiation(GO:2000797) negative regulation of amniotic stem cell differentiation(GO:2000798) |
| 0.1 | 0.2 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.2 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.1 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 0.2 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 0.2 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.1 | 0.1 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.1 | 0.2 | GO:0051714 | positive regulation of cytolysis in other organism(GO:0051714) |
| 0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.1 | 0.7 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 | 0.4 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.2 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.1 | GO:0060003 | copper ion export(GO:0060003) |
| 0.1 | 1.5 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.2 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 | 0.2 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 1.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.2 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
| 0.1 | 0.2 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.2 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 | 0.1 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 | 0.2 | GO:1904732 | regulation of electron carrier activity(GO:1904732) |
| 0.1 | 0.3 | GO:1901731 | positive regulation of platelet aggregation(GO:1901731) |
| 0.1 | 0.7 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.5 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.2 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 0.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.1 | 1.0 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.1 | 0.3 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.1 | 0.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.2 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.2 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 | 0.8 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 1.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 1.7 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.1 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.1 | 0.5 | GO:0009415 | response to water(GO:0009415) |
| 0.1 | 1.8 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.1 | 2.2 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.1 | 0.8 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 0.2 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.1 | 0.3 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.1 | 2.2 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.1 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.9 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.1 | 0.6 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.1 | 0.3 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 | 0.2 | GO:1901656 | glucoside transport(GO:0042946) glycoside transport(GO:1901656) |
| 0.1 | 0.2 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.5 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.0 | 0.5 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 1.0 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 1.3 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 | 0.1 | GO:0034148 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.0 | 0.0 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.0 | 0.7 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.3 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.1 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 | 1.0 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.1 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.6 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.1 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) |
| 0.0 | 0.7 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.5 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.7 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.3 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.3 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.0 | 0.0 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.0 | 0.9 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.4 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 | 0.2 | GO:0034343 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.2 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.0 | 0.5 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.0 | GO:1902164 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.0 | 0.5 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.2 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.4 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.0 | 0.1 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.0 | 0.7 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.6 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.2 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.4 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 0.0 | 0.1 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 | 4.9 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.7 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.0 | 1.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.3 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.3 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 0.3 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.4 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.0 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.7 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.2 | GO:0018106 | peptidyl-histidine phosphorylation(GO:0018106) |
| 0.0 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.2 | GO:0052510 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.0 | 0.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.0 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
| 0.0 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.9 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.3 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.5 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.2 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.1 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.0 | 0.5 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.1 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.0 | 1.7 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.9 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.1 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.0 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.0 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.0 | 0.7 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.0 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.1 | GO:0000494 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.6 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.4 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.0 | 0.8 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.1 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.0 | 0.1 | GO:0002428 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) |
| 0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 2.6 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
| 0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.5 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.4 | GO:1900004 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.0 | 0.1 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.0 | GO:0016488 | sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) |
| 0.0 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.0 | 0.6 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.6 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 1.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.1 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.0 | 0.1 | GO:1903464 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.0 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.5 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.2 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.0 | 0.0 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.0 | 0.1 | GO:0072205 | collecting duct development(GO:0072044) metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.0 | GO:0072530 | purine-containing compound transmembrane transport(GO:0072530) |
| 0.0 | 0.1 | GO:0035419 | activation of MAPK activity involved in innate immune response(GO:0035419) |
| 0.0 | 0.3 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 | 0.4 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.0 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.3 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
| 0.0 | 0.3 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.0 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.1 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.0 | 0.1 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.2 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.4 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.3 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.4 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.1 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.2 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.1 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.1 | GO:0071110 | protein biotinylation(GO:0009305) histone biotinylation(GO:0071110) |
| 0.0 | 0.7 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.1 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.0 | 0.4 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.6 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.1 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.1 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.0 | 0.2 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.2 | GO:0009635 | response to herbicide(GO:0009635) |
| 0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.2 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.0 | 0.1 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.0 | 0.1 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.0 | 0.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.2 | GO:1903301 | positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.2 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.2 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.4 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.0 | 0.1 | GO:0071315 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) negative regulation of Wnt protein secretion(GO:0061358) cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 1.5 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
| 0.0 | 0.3 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.2 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.0 | 0.3 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.8 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 1.0 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 1.0 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0046080 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.0 | 0.6 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.0 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.0 | 0.2 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.2 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.3 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.0 | 0.2 | GO:0072757 | cellular response to camptothecin(GO:0072757) |
| 0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.7 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.2 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.1 | GO:2000366 | cardiac muscle tissue regeneration(GO:0061026) regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.5 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 0.3 | GO:0032261 | purine nucleotide salvage(GO:0032261) |
| 0.0 | 1.7 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.5 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.4 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.7 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.1 | GO:2000755 | regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 0.0 | 0.1 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.3 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.4 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 | 0.1 | GO:0018012 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 1.2 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.4 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.0 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.0 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.0 | 0.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.3 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.0 | 0.0 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.1 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.0 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.0 | 0.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.0 | 0.1 | GO:0014813 | skeletal muscle satellite cell commitment(GO:0014813) |
| 0.0 | 0.0 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.0 | 0.3 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.0 | 0.0 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 0.1 | GO:0038169 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.0 | GO:0035552 | oxidative single-stranded DNA demethylation(GO:0035552) |
| 0.0 | 0.6 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.5 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.0 | 0.0 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.1 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.3 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.2 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.3 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.9 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:0060459 | left lung development(GO:0060459) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.2 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.0 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.2 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.0 | 0.0 | GO:0098877 | neurotransmitter receptor transport to plasma membrane(GO:0098877) |
| 0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:0036483 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.3 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 1.0 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.2 | GO:0007207 | phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.3 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.1 | GO:0035712 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 | 0.8 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.3 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.2 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.0 | 0.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.1 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) T cell extravasation(GO:0072683) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.0 | GO:0070054 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.1 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.0 | 0.1 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.0 | 0.5 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:1903259 | exon-exon junction complex disassembly(GO:1903259) |
| 0.0 | 0.0 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.0 | 0.0 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.0 | 0.5 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.0 | GO:2000439 | positive regulation of monocyte extravasation(GO:2000439) |
| 0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.5 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 | 0.5 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.1 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.0 | 2.4 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.1 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 1.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.0 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.1 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
| 0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.7 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.3 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.2 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 0.5 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.0 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.0 | 0.1 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
| 0.0 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.0 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.0 | 0.5 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.0 | 0.0 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.1 | GO:0099540 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 | 0.1 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.0 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.0 | 0.1 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
| 0.0 | 0.1 | GO:0042976 | activation of Janus kinase activity(GO:0042976) |
| 0.0 | 0.1 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.0 | 0.1 | GO:1902905 | positive regulation of fibril organization(GO:1902905) |
| 0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.2 | GO:0042749 | regulation of circadian sleep/wake cycle(GO:0042749) |
| 0.0 | 0.0 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.0 | 0.1 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.0 | 0.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.2 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
| 0.0 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) metanephric S-shaped body morphogenesis(GO:0072284) |
| 0.0 | 1.4 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.3 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.0 | 0.2 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 | 0.1 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.0 | 0.2 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.1 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.3 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.0 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.0 | 0.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0043217 | myelin maintenance(GO:0043217) |
| 0.0 | 0.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.3 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.1 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.0 | 0.4 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.3 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.2 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.2 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.3 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 | 0.1 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.0 | 0.1 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.0 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 2.6 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.0 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 | 0.1 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.0 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.0 | 0.3 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
| 0.0 | 0.0 | GO:1990654 | regulation of extrathymic T cell differentiation(GO:0033082) sebum secreting cell proliferation(GO:1990654) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:0093001 | glycolytic process through glucose-1-phosphate(GO:0061622) glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.0 | GO:0006545 | glycine biosynthetic process(GO:0006545) glycine biosynthetic process from serine(GO:0019264) |
| 0.0 | 0.7 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.0 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.0 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.0 | 0.0 | GO:1904628 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.0 | 0.6 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.2 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.0 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.0 | 0.1 | GO:0060482 | lobar bronchus development(GO:0060482) |
| 0.0 | 0.2 | GO:0043574 | peroxisomal transport(GO:0043574) |
| 0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.1 | GO:0051030 | snRNA transport(GO:0051030) |
| 0.0 | 0.0 | GO:0010044 | response to aluminum ion(GO:0010044) |
| 0.0 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.0 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
| 0.0 | 0.0 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.0 | 0.0 | GO:0070920 | regulation of production of small RNA involved in gene silencing by RNA(GO:0070920) |
| 0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.0 | 0.2 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.0 | 0.4 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.0 | GO:0055095 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.4 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:1901838 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.1 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.2 | GO:0051788 | response to misfolded protein(GO:0051788) |
| 0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.1 | GO:0071051 | snoRNA 3'-end processing(GO:0031126) polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.1 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.0 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 0.0 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.0 | 0.6 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.3 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 | 0.0 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.0 | 0.1 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 1.0 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.0 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.0 | 0.0 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.0 | 0.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0003352 | regulation of cilium movement(GO:0003352) |
| 0.0 | 0.1 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.0 | 0.0 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.0 | 0.1 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.1 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.1 | GO:0048007 | antigen processing and presentation via MHC class Ib(GO:0002475) antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.0 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.0 | 0.0 | GO:0071878 | negative regulation of adrenergic receptor signaling pathway(GO:0071878) retrograde trans-synaptic signaling(GO:0098917) |
| 0.0 | 0.6 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.6 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.0 | 0.2 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.0 | GO:1904528 | positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.4 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.0 | 0.2 | GO:1902253 | regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902253) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.2 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) |
| 0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.0 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.4 | 0.4 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.3 | 1.0 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 1.1 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.3 | 1.6 | GO:0070695 | FHF complex(GO:0070695) |
| 0.2 | 1.7 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.2 | 0.7 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 2.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.2 | 1.4 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.2 | 0.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 5.4 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.2 | 1.0 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.2 | 0.9 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.2 | 0.9 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.2 | 0.5 | GO:0019031 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.2 | 1.9 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 1.3 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.2 | 5.5 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 2.6 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.2 | 3.8 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 3.9 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 0.6 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.1 | 1.6 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 2.9 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 1.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.4 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 3.5 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.9 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.1 | 0.4 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.1 | 0.9 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.6 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 0.4 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.1 | 1.0 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.5 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 8.8 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 0.6 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.1 | 0.6 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.6 | GO:0032449 | CBM complex(GO:0032449) |
| 0.1 | 0.4 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 1.9 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 0.4 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.1 | 0.3 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 3.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.4 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.8 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.3 | GO:0045259 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.1 | 1.7 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.1 | 0.4 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.3 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 0.4 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.7 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.2 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 0.9 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.3 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.5 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 0.3 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 1.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 1.6 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 0.2 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.1 | 0.5 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 3.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.2 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.5 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.2 | GO:1990879 | CST complex(GO:1990879) |
| 0.1 | 1.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.2 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 0.2 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.5 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 0.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.3 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
| 0.0 | 0.1 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.0 | 2.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.1 | GO:0030849 | autosome(GO:0030849) |
| 0.0 | 0.6 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.0 | 0.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 2.0 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.3 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 1.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.3 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 1.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 1.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 1.0 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.4 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.3 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.0 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.0 | 0.1 | GO:0001534 | radial spoke(GO:0001534) |
| 0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.4 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.4 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.4 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.2 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 2.4 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.8 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0097462 | glial cytoplasmic inclusion(GO:0097409) classical Lewy body(GO:0097414) Lewy neurite(GO:0097462) Lewy body corona(GO:1990038) |
| 0.0 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.1 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.1 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.0 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 1.7 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 1.2 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 1.5 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 1.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 11.8 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.0 | GO:0034448 | EGO complex(GO:0034448) |
| 0.0 | 0.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 0.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.6 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 1.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.0 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.0 | 0.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.5 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 2.9 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.0 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 2.0 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 2.7 | GO:0070160 | occluding junction(GO:0070160) |
| 0.0 | 0.1 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 0.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.1 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 2.3 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.1 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 2.7 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.0 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.4 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 1.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.0 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.9 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 0.5 | 3.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.4 | 2.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.4 | 1.2 | GO:0052835 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.4 | 1.8 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.3 | 1.4 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.3 | 1.9 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.3 | 3.5 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.3 | 1.3 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.3 | 0.9 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.3 | 2.4 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.3 | 0.9 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 0.3 | 1.7 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.3 | 1.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.3 | 0.8 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
| 0.3 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.3 | 0.8 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.2 | 0.7 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.2 | 0.2 | GO:0050473 | arachidonate 15-lipoxygenase activity(GO:0050473) |
| 0.2 | 0.7 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.2 | 0.7 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 0.9 | GO:0016524 | latrotoxin receptor activity(GO:0016524) |
| 0.2 | 0.7 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.2 | 0.9 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.2 | 0.9 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.2 | 1.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 2.7 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 0.6 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 0.6 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.2 | 2.3 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.2 | 2.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.2 | 1.8 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.2 | 0.5 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.2 | 1.4 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.2 | 0.5 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.2 | 1.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 1.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.2 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.2 | 0.8 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.2 | 1.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 1.0 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.2 | 0.6 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.2 | 3.5 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.2 | 0.9 | GO:0004096 | catalase activity(GO:0004096) |
| 0.2 | 0.6 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 2.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.6 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.7 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.1 | 0.4 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.1 | 0.8 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.1 | 0.4 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 0.1 | 0.8 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.4 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.5 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.4 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.5 | GO:0031716 | calcitonin receptor binding(GO:0031716) |
| 0.1 | 1.6 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 0.4 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.1 | 0.9 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.1 | 3.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 1.3 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 0.4 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.1 | 0.5 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 1.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 1.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 1.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 3.6 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 0.3 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.1 | 0.8 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.3 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 0.6 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.1 | 3.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.1 | 0.6 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 0.3 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.8 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.3 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.1 | 2.1 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 6.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 1.5 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.6 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.1 | 0.4 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.4 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.1 | GO:0050405 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.5 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 1.9 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 0.3 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 6.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.1 | 1.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.5 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 0.7 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.5 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.1 | 0.3 | GO:0016497 | substance K receptor activity(GO:0016497) |
| 0.1 | 0.6 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.1 | 0.5 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 3.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.7 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.4 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.2 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 1.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.4 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.3 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.1 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 1.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.3 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.1 | 1.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.2 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.1 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 1.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.5 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 1.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 0.6 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.3 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 0.2 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.4 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 0.5 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.2 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.1 | 0.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 1.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.7 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 1.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 0.5 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 0.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.3 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.2 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.7 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.3 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.6 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.5 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.3 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.3 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.3 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 0.1 | 0.3 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.1 | 0.6 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.2 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.2 | GO:0061697 | protein-malonyllysine demalonylase activity(GO:0036054) protein-succinyllysine desuccinylase activity(GO:0036055) protein-glutaryllysine deglutarylase activity(GO:0061697) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 1.5 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.1 | 1.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 0.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.2 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 1.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.5 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.1 | 0.2 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 1.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.7 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 1.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.8 | GO:0004691 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 1.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.1 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.8 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.9 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 1.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.3 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.3 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.2 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.1 | 0.6 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.1 | 0.5 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 1.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.2 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.1 | 0.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.2 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.1 | 0.2 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.7 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 0.2 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 1.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 1.0 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.2 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.1 | 0.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 2.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 1.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.1 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.1 | 1.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.1 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.6 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 0.1 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.1 | 0.2 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 0.2 | GO:0042947 | glucoside transmembrane transporter activity(GO:0042947) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.3 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.0 | 1.0 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.2 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.0 | 1.1 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 0.1 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.0 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 3.2 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.5 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.1 | GO:0008940 | nitrate reductase activity(GO:0008940) molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.0 | 0.3 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.0 | 0.1 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.0 | 0.5 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.2 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.0 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 2.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0090422 | thiamine pyrophosphate transporter activity(GO:0090422) |
| 0.0 | 0.3 | GO:0052847 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 1.2 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.2 | GO:0042979 | ornithine decarboxylase inhibitor activity(GO:0008073) ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.3 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 1.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.9 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.0 | 0.2 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.2 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.0 | 0.5 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.7 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.2 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.3 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.0 | 0.1 | GO:0090555 | phosphatidylethanolamine-translocating ATPase activity(GO:0090555) |
| 0.0 | 0.5 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 1.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0034512 | box C/D snoRNA binding(GO:0034512) |
| 0.0 | 0.4 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.0 | 0.1 | GO:0016154 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.1 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.0 | 0.4 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.0 | GO:0045550 | geranylgeranyl reductase activity(GO:0045550) |
| 0.0 | 2.9 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.1 | GO:0030290 | sphingolipid activator protein activity(GO:0030290) beta-N-acetylgalactosaminidase activity(GO:0032428) |
| 0.0 | 0.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.7 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.7 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 2.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.0 | 0.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 1.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.1 | GO:0004080 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 0.0 | 0.4 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.3 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.1 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.0 | 0.5 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.6 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.2 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.0 | 0.1 | GO:0038047 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.0 | 0.6 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 2.2 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.2 | GO:0052828 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.0 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.2 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.0 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.0 | 0.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.3 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 0.0 | 0.3 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 1.3 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.0 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 3.1 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.3 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 1.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.2 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.0 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.3 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.0 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.0 | 0.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 1.3 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0004750 | ribulose-phosphate 3-epimerase activity(GO:0004750) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0047115 | trans-1,2-dihydrobenzene-1,2-diol dehydrogenase activity(GO:0047115) |
| 0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.0 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.0 | 0.0 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.2 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.4 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.8 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.2 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.0 | 0.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.9 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.1 | GO:0001626 | nociceptin receptor activity(GO:0001626) |
| 0.0 | 1.7 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.0 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.7 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.5 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.0 | 0.4 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) inositol trisphosphate kinase activity(GO:0051766) |
| 0.0 | 0.7 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.0 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.0 | 0.1 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.0 | 1.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.2 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.0 | 0.1 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.0 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.0 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:1901338 | catecholamine binding(GO:1901338) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.7 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.2 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.0 | 1.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 1.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.6 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.0 | GO:0035586 | purinergic receptor activity(GO:0035586) |
| 0.0 | 0.7 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.0 | 0.3 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 1.1 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.4 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.1 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.0 | 0.0 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.0 | 0.0 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.1 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.1 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.0 | 0.1 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.1 | GO:0004775 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.0 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) CoA-ligase activity(GO:0016405) |
| 0.0 | 0.1 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.0 | GO:0004040 | amidase activity(GO:0004040) |
| 0.0 | 0.1 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.1 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.0 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.3 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.4 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 4.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.7 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.2 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.0 | GO:0033699 | DNA 5'-adenosine monophosphate hydrolase activity(GO:0033699) |
| 0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.0 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.0 | GO:0036505 | prosaposin receptor activity(GO:0036505) |
| 0.0 | 0.0 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.0 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.0 | 0.0 | GO:0099528 | G-protein coupled neurotransmitter receptor activity(GO:0099528) |
| 0.0 | 0.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.2 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.4 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.0 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.0 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.0 | 0.0 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.0 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.1 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.0 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 1.3 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.1 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.1 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 0.1 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.1 | GO:0030883 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.0 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.0 | 0.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.0 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.0 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.0 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.3 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 3.2 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.1 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 2.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 2.0 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.2 | 9.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 4.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 3.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 1.6 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 4.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 1.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 5.4 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 1.6 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 1.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 2.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 1.8 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 2.7 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.8 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.9 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 1.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 1.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 1.7 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 1.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.9 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 1.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 2.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 1.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 4.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 1.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 1.0 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 1.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 2.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.8 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 2.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.6 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 1.3 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 2.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.4 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.8 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.5 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.5 | SIG CHEMOTAXIS | Genes related to chemotaxis |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.2 | 9.6 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.2 | 3.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 3.9 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 2.8 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 3.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 3.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 1.7 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 1.8 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 3.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 2.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 2.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.3 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.1 | 1.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.1 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.2 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
| 0.1 | 2.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 2.8 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 1.2 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 1.6 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.1 | 1.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 2.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 1.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 1.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 0.8 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 1.8 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 0.5 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 2.7 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 1.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 0.4 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.1 | 1.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 0.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 2.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.2 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 2.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 1.5 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 1.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 2.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.6 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.8 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 1.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 1.3 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.8 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 1.0 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 1.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 3.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.7 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 2.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 1.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
| 0.0 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 2.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 1.0 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.9 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.6 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.3 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 2.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.1 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.8 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF NFKB AND MAP KINASES UPON TLR7 8 OR 9 ACTIVATION | Genes involved in TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation |
| 0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.5 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.1 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.0 | REACTOME M G1 TRANSITION | Genes involved in M/G1 Transition |
| 0.0 | 0.8 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.1 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.4 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 2.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.4 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 2.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.1 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.9 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.4 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.6 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |