Project
avrg: Epithelial-Mesenchymal Transition, human (Scheel, 2011)
Navigation
Downloads
Results for EBF1
Z-value: 2.52
Motif logo
Transcription factors associated with EBF1
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
EBF1
|
ENSG00000164330.17 | EBF transcription factor 1 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| EBF1 | hg38_v1_chr5_-_159099684_159099698, hg38_v1_chr5_-_159099745_159099789 | -0.20 | 6.3e-01 | Click! |
Activity profile of EBF1 motif
Sorted Z-values of EBF1 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of EBF1
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 10.9 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 1.7 | 9.9 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.7 | 2.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.6 | 3.8 | GO:1903284 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) positive regulation of peroxidase activity(GO:2000470) |
| 0.6 | 5.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.5 | 1.6 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.5 | 1.6 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) negative regulation of hair follicle maturation(GO:0048817) regulation of melanosome transport(GO:1902908) |
| 0.5 | 2.0 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.5 | 1.8 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.4 | 1.7 | GO:0032752 | response to molecule of fungal origin(GO:0002238) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) cellular response to molecule of fungal origin(GO:0071226) |
| 0.4 | 1.7 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.4 | 1.2 | GO:0002582 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.4 | 1.6 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.4 | 1.6 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.4 | 2.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.4 | 1.6 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.4 | 1.1 | GO:1902769 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.4 | 1.1 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) |
| 0.4 | 1.5 | GO:0050904 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) diapedesis(GO:0050904) |
| 0.4 | 1.1 | GO:0036304 | umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.4 | 1.5 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.3 | 1.7 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.3 | 0.7 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.3 | 1.0 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.3 | 1.6 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.3 | 0.9 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.3 | 0.9 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.3 | 2.8 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.3 | 0.9 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.3 | 1.2 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.3 | 0.9 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.3 | 0.9 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.3 | 1.9 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.3 | 0.8 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.3 | 1.3 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.3 | 1.0 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.2 | 0.7 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.2 | 1.4 | GO:0089712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.2 | 0.9 | GO:1902164 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) platelet alpha granule organization(GO:0070889) regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.2 | 0.6 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.2 | 1.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.2 | 0.6 | GO:1904604 | regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904596) negative regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904597) regulation of advanced glycation end-product receptor activity(GO:1904603) negative regulation of advanced glycation end-product receptor activity(GO:1904604) negative regulation of connective tissue replacement(GO:1905204) |
| 0.2 | 0.6 | GO:0030221 | basophil differentiation(GO:0030221) |
| 0.2 | 1.0 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 1.4 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.2 | 2.4 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.2 | 0.6 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.2 | 1.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 0.2 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.2 | 1.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.7 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.2 | 0.9 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.2 | 0.3 | GO:1902232 | regulation of positive thymic T cell selection(GO:1902232) |
| 0.2 | 0.5 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 0.5 | GO:0098905 | regulation of bundle of His cell action potential(GO:0098905) |
| 0.2 | 0.8 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.2 | 4.0 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.2 | 0.8 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.2 | 0.5 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.2 | 0.8 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 0.9 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.2 | 0.6 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.2 | 1.8 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.2 | 0.5 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.1 | 0.9 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 0.4 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.1 | 0.4 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.4 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 0.7 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 1.1 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 0.4 | GO:0071676 | negative regulation of mononuclear cell migration(GO:0071676) |
| 0.1 | 2.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.4 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.1 | 1.2 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 | 0.6 | GO:1990834 | response to odorant(GO:1990834) |
| 0.1 | 0.4 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) |
| 0.1 | 2.3 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.5 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 | 0.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.9 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 2.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.6 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 1.4 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.1 | 0.8 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.6 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.1 | 0.2 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.1 | 1.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 0.4 | GO:0060003 | copper ion export(GO:0060003) |
| 0.1 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.1 | 1.8 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.5 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.5 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 | 0.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.1 | 1.3 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.2 | GO:0060032 | notochord regression(GO:0060032) |
| 0.1 | 1.7 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.1 | 0.4 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.3 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.3 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 0.3 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.1 | 0.4 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.1 | 0.5 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 | 1.4 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 0.2 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.1 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.1 | 0.6 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.7 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.8 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 | 0.4 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 1.0 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.3 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.1 | 0.5 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.1 | 0.4 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.1 | 0.3 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.1 | 0.4 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.3 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.1 | 0.6 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 | 7.5 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
| 0.1 | 0.6 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.3 | GO:0043465 | fermentation(GO:0006113) regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) |
| 0.1 | 0.5 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 1.4 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
| 0.1 | 0.3 | GO:0061184 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
| 0.1 | 0.6 | GO:1902731 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.1 | 0.8 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 1.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.3 | GO:0009624 | response to nematode(GO:0009624) |
| 0.1 | 0.3 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.1 | 0.3 | GO:0038156 | interleukin-5-mediated signaling pathway(GO:0038043) interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.1 | 0.3 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.1 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 1.5 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 | 0.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 1.8 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.9 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.6 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.6 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 1.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.2 | GO:0099557 | trans-synaptic signaling by trans-synaptic complex, modulating synaptic transmission(GO:0099557) |
| 0.1 | 0.6 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 | 0.2 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.1 | 0.4 | GO:0060677 | ureteric bud elongation(GO:0060677) |
| 0.1 | 0.4 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.5 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.2 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.1 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.1 | 0.7 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.2 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.1 | 0.7 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 0.4 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.3 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 | 0.1 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 | 3.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.1 | 0.3 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 | 0.8 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.1 | 0.1 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.1 | 0.3 | GO:0072615 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.1 | 0.5 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 | 0.3 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.1 | 0.2 | GO:0097274 | urea homeostasis(GO:0097274) |
| 0.1 | 0.2 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.1 | 0.1 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.1 | 0.9 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.6 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 | 0.3 | GO:0036229 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.1 | 0.9 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.1 | 0.3 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 2.7 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.1 | 0.5 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 0.3 | GO:0086068 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.1 | 0.1 | GO:0014740 | negative regulation of muscle hyperplasia(GO:0014740) |
| 0.1 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) |
| 0.1 | 1.3 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.5 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.1 | 1.4 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 2.2 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 | 0.9 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.4 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.6 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.1 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.1 | 0.5 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.6 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 1.7 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.3 | GO:0044027 | hypermethylation of CpG island(GO:0044027) negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.4 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.1 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 0.2 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.1 | 0.6 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.2 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 0.2 | GO:0018106 | peptidyl-histidine phosphorylation(GO:0018106) |
| 0.1 | 0.5 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.5 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.1 | 2.9 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.7 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.2 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
| 0.1 | 0.4 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 1.6 | GO:0097503 | sialylation(GO:0097503) |
| 0.1 | 0.3 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.1 | 1.2 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.1 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.1 | 0.3 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.6 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 0.3 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.1 | 0.2 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.1 | 0.4 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.7 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.2 | GO:0008614 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.1 | 1.0 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.6 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.2 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.1 | 0.5 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 0.9 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.2 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.0 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 | 0.2 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.2 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.0 | 0.1 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.0 | 2.8 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.7 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.2 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.2 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.4 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.5 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.4 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.2 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.0 | 0.3 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.0 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.0 | 0.2 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.0 | 0.5 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 | 0.4 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.1 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.0 | 3.4 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.0 | 0.3 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.0 | 0.0 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.0 | 5.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.9 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 1.4 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.1 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 | 1.7 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.7 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.0 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.2 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.0 | 0.5 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.0 | 0.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.2 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.7 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.1 | GO:0071626 | mastication(GO:0071626) learned vocalization behavior(GO:0098583) |
| 0.0 | 0.8 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.0 | 0.2 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.2 | GO:0003068 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.9 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.3 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.3 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 1.8 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.2 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
| 0.0 | 0.1 | GO:0036101 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 | 0.4 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 1.2 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.5 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.0 | 0.4 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.3 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.1 | GO:2000863 | negative regulation of macrophage chemotaxis(GO:0010760) positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.0 | 0.2 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.0 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.2 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 | 0.5 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.2 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 0.0 | 0.2 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
| 0.0 | 0.2 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.0 | 2.3 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 1.6 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.6 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.0 | 0.2 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 1.5 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.0 | 0.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.2 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) female meiosis chromosome segregation(GO:0016321) |
| 0.0 | 0.1 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) |
| 0.0 | 0.5 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.4 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.1 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.0 | 0.5 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.3 | GO:1900625 | monocyte aggregation(GO:0070487) regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.6 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.0 | 0.1 | GO:0099640 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.0 | 0.1 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.2 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.0 | 0.1 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 | 0.1 | GO:0018963 | phthalate metabolic process(GO:0018963) |
| 0.0 | 0.1 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.1 | GO:1904823 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 2.5 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 | 0.6 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.9 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 0.1 | GO:0006169 | adenosine salvage(GO:0006169) dATP biosynthetic process(GO:0006175) adenosine biosynthetic process(GO:0046086) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.4 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.2 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.2 | GO:0003352 | regulation of cilium movement(GO:0003352) |
| 0.0 | 0.4 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.3 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.1 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 | 0.1 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.0 | 0.2 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 | 0.1 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.3 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.2 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.3 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.5 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0010513 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.0 | 0.2 | GO:0008212 | mineralocorticoid biosynthetic process(GO:0006705) mineralocorticoid metabolic process(GO:0008212) |
| 0.0 | 0.1 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.4 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.0 | GO:0097501 | stress response to metal ion(GO:0097501) |
| 0.0 | 1.1 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.8 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
| 0.0 | 0.2 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.0 | 1.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.0 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.0 | 0.5 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.7 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.0 | GO:0071442 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.2 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
| 0.0 | 0.5 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:1903352 | L-ornithine transmembrane transport(GO:1903352) |
| 0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 0.1 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.1 | GO:0035698 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 1.6 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.1 | GO:2000576 | positive regulation of microtubule motor activity(GO:2000576) |
| 0.0 | 0.1 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.0 | 0.2 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.2 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.5 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.6 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 1.5 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.1 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.0 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) optic cup structural organization(GO:0003409) |
| 0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.0 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.0 | 0.1 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.1 | GO:0042634 | regulation of hair cycle(GO:0042634) |
| 0.0 | 0.1 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.2 | GO:0032228 | regulation of synaptic transmission, GABAergic(GO:0032228) |
| 0.0 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.3 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.0 | 0.2 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.0 | 0.0 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.0 | 0.1 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.0 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.1 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.5 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 1.4 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
| 0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.0 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.0 | 0.0 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.5 | GO:0050854 | regulation of antigen receptor-mediated signaling pathway(GO:0050854) |
| 0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.0 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 | 0.3 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.2 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.4 | GO:0008347 | glial cell migration(GO:0008347) |
| 0.0 | 0.8 | GO:0009301 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 12.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 1.0 | 9.9 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.4 | 1.5 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.3 | 1.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.3 | 6.8 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 1.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 0.7 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.2 | 1.9 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.2 | 0.7 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 1.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.2 | 1.7 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.2 | 2.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.2 | 2.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 0.6 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.2 | 3.7 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 1.2 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 2.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.5 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.1 | 0.5 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 4.0 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 0.4 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.5 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.1 | 0.6 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.1 | 1.7 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.4 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 3.7 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 1.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 1.4 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 1.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 1.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.9 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 1.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.3 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.1 | 3.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 0.9 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 1.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 0.8 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.8 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 1.0 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 6.5 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 1.6 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 1.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.3 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.1 | 0.2 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 3.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.2 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.2 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.0 | 0.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 1.0 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 1.3 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.3 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.5 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.5 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.1 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.0 | 1.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 1.8 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.6 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.3 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 6.6 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.6 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 1.6 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.1 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 1.4 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.5 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.1 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.6 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 1.7 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 6.3 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.5 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 1.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.7 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.1 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 1.6 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.1 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 2.2 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.8 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.1 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 2.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.8 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.0 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 0.0 | GO:0071753 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.0 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.8 | 5.0 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.6 | 3.8 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.5 | 6.8 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.4 | 1.2 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.4 | 1.6 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.4 | 1.1 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.3 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.3 | 1.8 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.3 | 1.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.3 | 1.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.3 | 1.4 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.3 | 2.2 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.3 | 1.9 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.3 | 1.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.3 | 1.8 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.3 | 3.0 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.2 | 1.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 0.6 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
| 0.2 | 1.6 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 1.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.2 | 1.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 1.0 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.2 | 0.6 | GO:0033265 | choline binding(GO:0033265) |
| 0.2 | 0.5 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.2 | 0.9 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.2 | 0.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.2 | 1.9 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 0.5 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 0.4 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.6 | GO:0002046 | opsin binding(GO:0002046) |
| 0.1 | 0.4 | GO:0045550 | geranylgeranyl reductase activity(GO:0045550) |
| 0.1 | 9.8 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.8 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.1 | 0.9 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.6 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.6 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.1 | 0.4 | GO:0004008 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 0.5 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.1 | 1.3 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 1.9 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.1 | 2.1 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 1.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 2.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.7 | GO:0015198 | oligopeptide transporter activity(GO:0015198) peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.9 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.8 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.6 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.1 | 0.4 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.6 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 0.5 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 2.7 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.4 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 1.8 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 2.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 1.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.7 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 4.0 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 1.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.8 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.3 | GO:0004914 | interleukin-3 receptor activity(GO:0004912) interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 2.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.3 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 1.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.3 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 0.1 | 3.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.1 | 0.2 | GO:0008988 | rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) |
| 0.1 | 3.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.4 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) |
| 0.1 | 0.4 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.5 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 0.3 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.2 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.1 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.8 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 1.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 1.3 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.1 | 0.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.2 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.7 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.6 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.2 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 0.1 | 2.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 1.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.3 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.1 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.1 | 4.4 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.1 | 0.4 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.3 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.1 | 1.0 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.2 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.1 | 1.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.2 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.1 | 1.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.1 | 0.2 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.0 | 0.9 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.6 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.7 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.2 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 1.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.8 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 14.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.0 | 0.4 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 2.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.5 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) glycoprotein transporter activity(GO:0034437) |
| 0.0 | 0.6 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) |
| 0.0 | 0.1 | GO:0061598 | nitrate reductase activity(GO:0008940) molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.0 | 0.5 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.2 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.2 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.4 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.6 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.6 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 1.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.3 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.5 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.0 | GO:0031692 | alpha-1B adrenergic receptor binding(GO:0031692) |
| 0.0 | 1.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 1.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.0 | 0.4 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.3 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.0 | 0.2 | GO:0045174 | glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 2.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.9 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 1.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 1.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.2 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.0 | 0.1 | GO:0005350 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.1 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.1 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.0 | 0.5 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 1.6 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.1 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.0 | 0.4 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 4.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.7 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 1.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.3 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.7 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.7 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.2 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.0 | 0.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.1 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 2.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.3 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) D4 dopamine receptor binding(GO:0031751) |
| 0.0 | 1.2 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.0 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.1 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.0 | 0.7 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.0 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.1 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 2.1 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.9 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.0 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.0 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.6 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.4 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.5 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:0033765 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.0 | 0.1 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.8 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.1 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.2 | GO:0015645 | long-chain fatty acid-CoA ligase activity(GO:0004467) fatty acid ligase activity(GO:0015645) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.0 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 3.9 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 4.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 3.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 2.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 1.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 2.6 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 3.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 1.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.6 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.8 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.7 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 1.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 1.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 2.7 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.5 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 1.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 1.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 4.3 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.9 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.8 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.8 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.9 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 1.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.8 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 5.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.8 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 2.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 2.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 2.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 3.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 2.0 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.9 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 1.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 5.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 0.2 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 1.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 3.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.1 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 2.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 3.1 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 0.2 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.1 | 2.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 1.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 1.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 1.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 1.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 1.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 1.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.6 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 1.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 1.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 1.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.7 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 1.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 1.9 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.2 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.7 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.4 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.4 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 0.6 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 1.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.5 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.7 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.8 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.5 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.6 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.0 | 0.5 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 1.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |