Project
avrg: Epithelial-Mesenchymal Transition, human (Scheel, 2011)
Navigation
Downloads
Results for MIXL1_GSX1_BSX_MEOX2_LHX4
Z-value: 2.48
Motif logo
Transcription factors associated with MIXL1_GSX1_BSX_MEOX2_LHX4
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MIXL1
|
ENSG00000185155.12 | Mix paired-like homeobox |
|
GSX1
|
ENSG00000169840.5 | GS homeobox 1 |
|
BSX
|
ENSG00000188909.5 | brain specific homeobox |
|
MEOX2
|
ENSG00000106511.6 | mesenchyme homeobox 2 |
|
LHX4
|
ENSG00000121454.6 | LIM homeobox 4 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| LHX4 | hg38_v1_chr1_+_180230257_180230291 | 0.38 | 3.5e-01 | Click! |
| MIXL1 | hg38_v1_chr1_+_226223618_226223670 | 0.37 | 3.7e-01 | Click! |
| GSX1 | hg38_v1_chr13_+_27792479_27792485 | 0.24 | 5.6e-01 | Click! |
| MEOX2 | hg38_v1_chr7_-_15686671_15686689 | 0.16 | 7.1e-01 | Click! |
Activity profile of MIXL1_GSX1_BSX_MEOX2_LHX4 motif
Sorted Z-values of MIXL1_GSX1_BSX_MEOX2_LHX4 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of MIXL1_GSX1_BSX_MEOX2_LHX4
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.3 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.7 | 2.1 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.4 | 8.0 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.4 | 1.2 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.4 | 0.8 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.3 | 1.3 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.3 | 7.6 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.3 | 1.2 | GO:0010652 | regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.3 | 1.5 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 0.3 | 2.7 | GO:2000620 | innate vocalization behavior(GO:0098582) positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.3 | 0.9 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.3 | 1.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.3 | 0.8 | GO:0034769 | basement membrane disassembly(GO:0034769) |
| 0.3 | 0.8 | GO:0048560 | establishment of anatomical structure orientation(GO:0048560) |
| 0.3 | 1.3 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.3 | 1.0 | GO:0032597 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.2 | 1.0 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.2 | 2.5 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.2 | 0.7 | GO:1902960 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.2 | 8.7 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.2 | 2.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.2 | 0.9 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.2 | 0.6 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.2 | 0.8 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.2 | 0.6 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 | 0.8 | GO:0007499 | ectoderm and mesoderm interaction(GO:0007499) |
| 0.2 | 2.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| 0.2 | 2.3 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.2 | 1.0 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.2 | 1.7 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.2 | 0.5 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.2 | 0.5 | GO:0043016 | negative regulation of T cell tolerance induction(GO:0002665) negative regulation of T cell anergy(GO:0002668) negative regulation of lymphocyte anergy(GO:0002912) regulation of lymphotoxin A production(GO:0032681) positive regulation of lymphotoxin A production(GO:0032761) regulation of lymphotoxin A biosynthetic process(GO:0043016) positive regulation of lymphotoxin A biosynthetic process(GO:0043017) |
| 0.2 | 0.2 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.2 | 0.7 | GO:0042335 | cuticle development(GO:0042335) |
| 0.2 | 0.9 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.7 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.1 | 1.7 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.1 | 2.3 | GO:1902224 | ketone body metabolic process(GO:1902224) |
| 0.1 | 1.7 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.4 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.1 | 0.4 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 2.0 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.4 | GO:1901994 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 0.4 | GO:1990451 | cellular stress response to acidic pH(GO:1990451) |
| 0.1 | 1.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.4 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.1 | 8.3 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.1 | 0.6 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 0.3 | GO:0090149 | synaptic vesicle recycling via endosome(GO:0036466) mitochondrial membrane fission(GO:0090149) |
| 0.1 | 0.4 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 | 0.3 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.3 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 0.3 | GO:1902594 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.1 | 0.3 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 | 1.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.9 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.1 | 0.4 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 1.2 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 1.1 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.7 | GO:0048840 | otolith development(GO:0048840) |
| 0.1 | 0.1 | GO:0002396 | MHC protein complex assembly(GO:0002396) |
| 0.1 | 0.6 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.1 | 0.2 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.4 | GO:0015692 | lead ion transport(GO:0015692) |
| 0.1 | 0.4 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 | 0.3 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.2 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 0.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.4 | GO:0070778 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.1 | 1.6 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.1 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.4 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.1 | 1.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.4 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 1.9 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.1 | 0.2 | GO:0061027 | umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.1 | 0.2 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.6 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.1 | GO:0051884 | regulation of anagen(GO:0051884) positive regulation of anagen(GO:0051885) |
| 0.1 | 1.7 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.1 | 0.2 | GO:1901876 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 | 7.5 | GO:0070268 | cornification(GO:0070268) |
| 0.1 | 2.4 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.1 | 0.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.1 | 0.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.4 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
| 0.1 | 0.2 | GO:0003218 | cardiac left ventricle formation(GO:0003218) cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.2 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.1 | 0.2 | GO:0015722 | canalicular bile acid transport(GO:0015722) pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.6 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.1 | 0.2 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.0 | 0.3 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.7 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.2 | GO:2000863 | positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.0 | 0.1 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.0 | 0.8 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 3.6 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
| 0.0 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.8 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.3 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.0 | 0.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 2.8 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.4 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.1 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.3 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.0 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.0 | 0.2 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.1 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.0 | 0.2 | GO:0051620 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) regulation of peroxidase activity(GO:2000468) positive regulation of peroxidase activity(GO:2000470) |
| 0.0 | 0.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.0 | 0.3 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) |
| 0.0 | 0.1 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 | 1.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.7 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 2.3 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.4 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.2 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.0 | 1.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 1.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:0060739 | mesenchymal-epithelial cell signaling involved in prostate gland development(GO:0060739) |
| 0.0 | 0.3 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.1 | GO:0002769 | natural killer cell inhibitory signaling pathway(GO:0002769) |
| 0.0 | 1.2 | GO:0015695 | organic cation transport(GO:0015695) |
| 0.0 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 | 0.1 | GO:0010650 | positive regulation of cell communication by electrical coupling(GO:0010650) |
| 0.0 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.3 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.3 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.3 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) |
| 0.0 | 0.3 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.0 | 0.1 | GO:1902688 | regulation of NAD metabolic process(GO:1902688) |
| 0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.3 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 | 0.2 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.4 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
| 0.0 | 0.2 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.1 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.0 | 0.1 | GO:0046878 | regulation of saliva secretion(GO:0046877) positive regulation of saliva secretion(GO:0046878) |
| 0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
| 0.0 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.0 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.1 | GO:0050928 | negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 | 0.4 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.2 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.0 | 0.4 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.0 | 1.0 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.2 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.0 | 0.1 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.0 | 0.5 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0043305 | negative regulation of mast cell degranulation(GO:0043305) |
| 0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.2 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.0 | 0.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.1 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
| 0.0 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) |
| 0.0 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.6 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 | 0.1 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 | 0.9 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 | 0.1 | GO:0061075 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) regulation of amacrine cell differentiation(GO:1902869) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.0 | 0.5 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 | 0.5 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
| 0.0 | 0.7 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.1 | GO:0099551 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 | 0.1 | GO:0035989 | tendon development(GO:0035989) |
| 0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.1 | GO:1903301 | fructose 2,6-bisphosphate metabolic process(GO:0006003) positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.5 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.0 | 0.1 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.0 | 0.9 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.3 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.1 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.2 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.2 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.1 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.4 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) regulation of mRNA export from nucleus(GO:0010793) |
| 0.0 | 2.9 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.1 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.0 | GO:0036233 | glycine import(GO:0036233) |
| 0.0 | 0.1 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.0 | 0.1 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.0 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0009441 | glycolate metabolic process(GO:0009441) |
| 0.0 | 0.2 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.2 | GO:0023058 | adaptation of signaling pathway(GO:0023058) |
| 0.0 | 0.3 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 0.0 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 1.3 | GO:0043647 | inositol phosphate metabolic process(GO:0043647) |
| 0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.0 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 1.3 | GO:0030819 | positive regulation of cAMP biosynthetic process(GO:0030819) |
| 0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.0 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.2 | GO:1903764 | hard palate development(GO:0060022) regulation of potassium ion import(GO:1903286) regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 | 0.2 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.0 | 0.0 | GO:0010513 | positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 | 0.4 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.1 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.0 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 | 0.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) cellular response to sodium arsenite(GO:1903936) |
| 0.0 | 0.3 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.0 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.3 | GO:0060187 | cell pole(GO:0060187) |
| 0.4 | 1.3 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.3 | 1.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.2 | 2.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.2 | 5.7 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 2.2 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.2 | 0.5 | GO:0043512 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.1 | 0.8 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.1 | 0.5 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.1 | 8.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.5 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 7.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.3 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.1 | 0.4 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.2 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.1 | 0.3 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 1.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 1.4 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 1.5 | GO:0032982 | myosin filament(GO:0032982) |
| 0.1 | 1.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.6 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.2 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 1.3 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.9 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.3 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.0 | 1.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.4 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.1 | GO:0071752 | dimeric IgA immunoglobulin complex(GO:0071750) secretory dimeric IgA immunoglobulin complex(GO:0071752) |
| 0.0 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 1.8 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.2 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 0.3 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) GID complex(GO:0034657) |
| 0.0 | 0.1 | GO:0005592 | collagen type XI trimer(GO:0005592) |
| 0.0 | 0.8 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 1.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.9 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 1.0 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 2.2 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.1 | GO:0060342 | photoreceptor inner segment membrane(GO:0060342) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.7 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.1 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.0 | 0.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 1.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0045259 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.0 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.4 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 1.1 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.1 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.0 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 3.0 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.1 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.0 | 0.2 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.0 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 1.4 | GO:0035578 | azurophil granule lumen(GO:0035578) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 2.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.3 | 7.6 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.3 | 3.9 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 8.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.3 | 2.9 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.3 | 1.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 1.5 | GO:0017161 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.2 | 4.8 | GO:0005549 | odorant binding(GO:0005549) |
| 0.2 | 2.5 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.2 | 0.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.2 | 0.6 | GO:0016524 | latrotoxin receptor activity(GO:0016524) |
| 0.2 | 7.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.2 | 1.2 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.1 | 0.7 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.6 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.1 | 2.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 7.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.3 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 0.1 | 0.3 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.1 | 0.5 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.1 | 2.2 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.1 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 0.7 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 1.4 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.3 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.1 | 1.9 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 0.4 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.3 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.1 | 1.2 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.3 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.1 | 2.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 1.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.4 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.6 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 0.4 | GO:0015639 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.1 | 0.3 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 0.9 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 1.0 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.5 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 0.4 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 2.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.2 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.1 | 0.1 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.3 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.9 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.8 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 1.8 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 4.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.2 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.1 | 0.2 | GO:0090555 | phosphatidylethanolamine-translocating ATPase activity(GO:0090555) |
| 0.1 | 0.8 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.2 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.1 | 0.8 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.1 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.2 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.0 | 1.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.0 | 1.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.2 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 0.0 | 0.8 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 1.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.2 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.0 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 1.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.6 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.4 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 0.2 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.0 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 1.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.5 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.6 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.4 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0052816 | medium-chain acyl-CoA hydrolase activity(GO:0052815) long-chain acyl-CoA hydrolase activity(GO:0052816) |
| 0.0 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.0 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 9.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.0 | 0.2 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 1.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.1 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 0.0 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 2.0 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 1.7 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.5 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.0 | GO:0016623 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.1 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.0 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.0 | 0.4 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.6 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.3 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
| 0.0 | 0.1 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.3 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.5 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.5 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.5 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.9 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.0 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.0 | 0.0 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.0 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.0 | 0.1 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
| 0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.0 | GO:0061599 | nitrate reductase activity(GO:0008940) molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 10.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.2 | 6.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 3.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 2.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 3.0 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 3.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 1.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 1.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 2.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.8 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.9 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 1.9 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 6.2 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.9 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.9 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 1.1 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.1 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.2 | 2.9 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 1.6 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 0.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.8 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 2.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 8.0 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 1.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 4.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.5 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 8.6 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 1.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.7 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.4 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 1.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.4 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.4 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.8 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 1.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.4 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 2.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.4 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.3 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.1 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |