avrg: Epithelial-Mesenchymal Transition, human (Scheel, 2011)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
NRF1
|
ENSG00000106459.15 | nuclear respiratory factor 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
NRF1 | hg38_v1_chr7_+_129611680_129611760 | 0.49 | 2.2e-01 | Click! |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 7.6 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.8 | 5.0 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
0.8 | 3.8 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.7 | 3.7 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.7 | 4.1 | GO:0071874 | cellular response to norepinephrine stimulus(GO:0071874) |
0.7 | 4.7 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.6 | 2.6 | GO:0072183 | negative regulation of nephron tubule epithelial cell differentiation(GO:0072183) negative regulation of epithelial cell differentiation involved in kidney development(GO:2000697) |
0.6 | 3.8 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.6 | 3.5 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.6 | 1.7 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.5 | 2.7 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.5 | 2.7 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.5 | 1.6 | GO:0033869 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
0.5 | 1.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
0.5 | 0.5 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.4 | 1.3 | GO:1903722 | regulation of centriole elongation(GO:1903722) |
0.4 | 1.8 | GO:0018282 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
0.4 | 1.7 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.4 | 1.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.4 | 1.2 | GO:1902728 | mineralocorticoid receptor signaling pathway(GO:0031959) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
0.4 | 2.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.4 | 1.6 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
0.4 | 3.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.4 | 2.2 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
0.4 | 2.9 | GO:0016926 | protein desumoylation(GO:0016926) |
0.3 | 1.0 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) retinal cell apoptotic process(GO:1990009) |
0.3 | 1.4 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.3 | 1.4 | GO:0002159 | desmosome assembly(GO:0002159) |
0.3 | 1.3 | GO:0030806 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) |
0.3 | 1.2 | GO:0032954 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.3 | 3.4 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) |
0.3 | 1.2 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
0.3 | 3.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 0.9 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.3 | 1.7 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.3 | 0.8 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
0.3 | 0.3 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
0.3 | 3.3 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.3 | 0.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.3 | 1.9 | GO:0051511 | regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) positive regulation of barbed-end actin filament capping(GO:2000814) |
0.3 | 0.8 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.3 | 0.8 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.3 | 2.3 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.3 | 1.0 | GO:0006311 | meiotic gene conversion(GO:0006311) |
0.2 | 2.8 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
0.2 | 0.9 | GO:1990166 | protein localization to site of double-strand break(GO:1990166) |
0.2 | 1.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 1.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.2 | 0.9 | GO:0009183 | ADP biosynthetic process(GO:0006172) purine deoxyribonucleoside diphosphate biosynthetic process(GO:0009183) |
0.2 | 0.9 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.2 | 0.9 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.2 | 0.6 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
0.2 | 0.6 | GO:0036510 | trimming of terminal mannose on C branch(GO:0036510) |
0.2 | 1.3 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
0.2 | 1.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) positive regulation of interleukin-12 secretion(GO:2001184) |
0.2 | 0.6 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.2 | 0.6 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
0.2 | 0.6 | GO:0071335 | submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
0.2 | 1.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.2 | 0.8 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.2 | 0.8 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
0.2 | 0.4 | GO:0071284 | cellular response to lead ion(GO:0071284) |
0.2 | 1.3 | GO:1905068 | positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
0.2 | 0.6 | GO:0060913 | cardiac cell fate determination(GO:0060913) negative regulation of endodermal cell differentiation(GO:1903225) |
0.2 | 1.5 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.2 | 0.7 | GO:1903575 | cornified envelope assembly(GO:1903575) |
0.2 | 0.9 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.2 | 0.5 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.5 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.2 | 1.9 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) |
0.2 | 1.5 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.2 | 0.2 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.2 | 0.7 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 0.5 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
0.2 | 1.5 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 1.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.2 | 1.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 0.5 | GO:0051877 | pigment granule aggregation in cell center(GO:0051877) |
0.2 | 0.8 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.2 | 0.6 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.2 | 0.5 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
0.2 | 1.8 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.9 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 2.5 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 1.0 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 1.7 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 0.3 | GO:1903383 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.1 | 0.6 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.1 | 6.7 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.6 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
0.1 | 1.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.7 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.8 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 2.0 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 1.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 1.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.1 | 0.8 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
0.1 | 1.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.5 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.5 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 0.5 | GO:1904045 | cellular response to aldosterone(GO:1904045) |
0.1 | 0.4 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
0.1 | 0.5 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
0.1 | 0.4 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
0.1 | 0.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 1.1 | GO:0035986 | senescence-associated heterochromatin focus assembly(GO:0035986) |
0.1 | 0.4 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
0.1 | 1.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 3.5 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.3 | GO:1901073 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
0.1 | 0.5 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.1 | 1.5 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
0.1 | 1.5 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 1.0 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.3 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.1 | 2.0 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 1.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.3 | GO:0009189 | nucleoside diphosphate biosynthetic process(GO:0009133) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.1 | 0.3 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.1 | 0.5 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 1.9 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 1.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.4 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) positive regulation of lysosomal protein catabolic process(GO:1905167) |
0.1 | 0.4 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.4 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.1 | 1.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 0.3 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.5 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 1.4 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.4 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
0.1 | 0.5 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.4 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.2 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.1 | 0.6 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 1.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.3 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
0.1 | 1.2 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.1 | 0.5 | GO:0071105 | response to interleukin-11(GO:0071105) |
0.1 | 1.6 | GO:0035878 | nail development(GO:0035878) |
0.1 | 1.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 3.6 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
0.1 | 0.3 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
0.1 | 0.6 | GO:0006574 | valine catabolic process(GO:0006574) |
0.1 | 0.6 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.1 | 0.7 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.3 | GO:0022614 | membrane to membrane docking(GO:0022614) |
0.1 | 0.5 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 1.4 | GO:0051715 | cytolysis in other organism(GO:0051715) |
0.1 | 0.3 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.3 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.1 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 1.7 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.9 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.3 | GO:0090176 | microtubule cytoskeleton organization involved in establishment of planar polarity(GO:0090176) |
0.1 | 0.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.4 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.1 | 0.4 | GO:0015846 | polyamine transport(GO:0015846) |
0.1 | 1.0 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.3 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.1 | 0.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.3 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
0.1 | 3.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.1 | 0.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.4 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.5 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
0.1 | 0.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 2.0 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.7 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 1.3 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.1 | 0.4 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.5 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.1 | 1.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.3 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.1 | 0.8 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.1 | 0.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.3 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
0.1 | 0.6 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.1 | 1.7 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.8 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 1.0 | GO:0045008 | depyrimidination(GO:0045008) |
0.1 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
0.1 | 0.9 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.1 | 0.8 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.5 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
0.1 | 0.8 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.5 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 2.6 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
0.1 | 0.3 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
0.1 | 0.2 | GO:0052047 | interaction with other organism via secreted substance involved in symbiotic interaction(GO:0052047) |
0.1 | 0.3 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
0.1 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.2 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) negative regulation of myofibroblast differentiation(GO:1904761) |
0.1 | 0.4 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.1 | 0.3 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.1 | 0.6 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.3 | GO:0030961 | peptidyl-arginine hydroxylation(GO:0030961) |
0.1 | 0.2 | GO:1901377 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
0.1 | 0.5 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 0.4 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 1.0 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.1 | 0.4 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.9 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.9 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.2 | GO:0051311 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
0.1 | 2.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.2 | GO:1990637 | response to prolactin(GO:1990637) |
0.1 | 0.1 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
0.1 | 1.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.2 | GO:0031247 | actin rod assembly(GO:0031247) |
0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.1 | 0.2 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
0.1 | 0.5 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.4 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.1 | 0.3 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.4 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.1 | 0.2 | GO:0009956 | radial pattern formation(GO:0009956) |
0.1 | 0.2 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
0.1 | 0.4 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.2 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
0.1 | 1.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.8 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.6 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 3.0 | GO:0060976 | coronary vasculature development(GO:0060976) |
0.1 | 0.7 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
0.1 | 1.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.7 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.8 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.9 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 2.1 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 1.5 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.5 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.4 | GO:0061525 | hindgut development(GO:0061525) |
0.0 | 0.2 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 2.3 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.2 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
0.0 | 0.5 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.2 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
0.0 | 0.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.0 | 0.0 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.0 | 0.5 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) regulation of amacrine cell differentiation(GO:1902869) positive regulation of amacrine cell differentiation(GO:1902871) |
0.0 | 0.4 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.4 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 1.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.3 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.3 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.3 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
0.0 | 1.1 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
0.0 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 4.1 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.5 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.0 | 0.2 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.8 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.1 | GO:0030047 | actin modification(GO:0030047) |
0.0 | 0.1 | GO:0007308 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
0.0 | 2.5 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.5 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.4 | GO:0044598 | polyketide metabolic process(GO:0030638) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.2 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.0 | 0.2 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.0 | 0.5 | GO:0015684 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
0.0 | 0.5 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.0 | 0.6 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
0.0 | 1.4 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.0 | 0.9 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.4 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.4 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.7 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 1.0 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 1.6 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
0.0 | 0.2 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.0 | 0.1 | GO:0071422 | succinate transport(GO:0015744) sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) succinate transmembrane transport(GO:0071422) |
0.0 | 0.3 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.7 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.0 | 0.6 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.2 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.1 | GO:0000494 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.1 | GO:0043449 | olfactory learning(GO:0008355) cellular alkene metabolic process(GO:0043449) |
0.0 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.1 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 2.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.5 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.9 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.3 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.0 | 0.6 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 1.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.8 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
0.0 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 1.0 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.3 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 0.5 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
0.0 | 0.2 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.3 | GO:0044241 | lipid digestion(GO:0044241) |
0.0 | 0.4 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 4.9 | GO:0046546 | male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.3 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.6 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 0.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.4 | GO:0060117 | auditory receptor cell development(GO:0060117) |
0.0 | 3.6 | GO:0021987 | cerebral cortex development(GO:0021987) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.8 | GO:0048016 | inositol phosphate-mediated signaling(GO:0048016) |
0.0 | 0.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.5 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.1 | GO:2000439 | regulation of monocyte extravasation(GO:2000437) positive regulation of monocyte extravasation(GO:2000439) |
0.0 | 0.3 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.7 | GO:0002076 | osteoblast development(GO:0002076) |
0.0 | 0.1 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
0.0 | 0.8 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.2 | GO:0046103 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
0.0 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) negative regulation of translational initiation in response to stress(GO:0032057) |
0.0 | 0.0 | GO:0034699 | response to luteinizing hormone(GO:0034699) |
0.0 | 0.2 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.7 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.0 | 0.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 1.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 2.0 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 0.5 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
0.0 | 0.6 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.3 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.6 | GO:0043536 | positive regulation of blood vessel endothelial cell migration(GO:0043536) |
0.0 | 0.2 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
0.0 | 0.3 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) positive regulation of ATP biosynthetic process(GO:2001171) |
0.0 | 0.2 | GO:0040020 | regulation of meiotic nuclear division(GO:0040020) |
0.0 | 0.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.4 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.5 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.3 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.4 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) bone marrow development(GO:0048539) |
0.0 | 0.5 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.4 | GO:0052695 | cellular glucuronidation(GO:0052695) |
0.0 | 0.0 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 1.5 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.4 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 1.4 | GO:0032418 | lysosome localization(GO:0032418) |
0.0 | 0.5 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.0 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.0 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.1 | GO:0003266 | regulation of secondary heart field cardioblast proliferation(GO:0003266) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.7 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
0.0 | 0.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.3 | GO:0035635 | entry of bacterium into host cell(GO:0035635) |
0.0 | 0.8 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
0.0 | 0.1 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.7 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.1 | GO:0086047 | Purkinje myocyte action potential(GO:0086017) membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
0.0 | 1.6 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.5 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
0.0 | 0.1 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.2 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.4 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.0 | 0.1 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.0 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.5 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.9 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.1 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.4 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
0.0 | 0.0 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.0 | GO:0034184 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.0 | GO:0032328 | alanine transport(GO:0032328) |
0.0 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.6 | GO:0007520 | myoblast fusion(GO:0007520) |
0.0 | 0.3 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.5 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
0.0 | 0.1 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.3 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.3 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.1 | GO:0006189 | IMP biosynthetic process(GO:0006188) 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.2 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:0008347 | glial cell migration(GO:0008347) |
0.0 | 0.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.9 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.6 | GO:0048678 | response to axon injury(GO:0048678) |
0.0 | 1.4 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.3 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.5 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.2 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.9 | GO:0030838 | positive regulation of actin filament polymerization(GO:0030838) |
0.0 | 0.5 | GO:0021762 | substantia nigra development(GO:0021762) |
0.0 | 0.1 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.2 | GO:0014904 | myotube cell development(GO:0014904) |
0.0 | 0.8 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
0.0 | 0.2 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.7 | GO:0007422 | peripheral nervous system development(GO:0007422) |
0.0 | 0.6 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.0 | 0.2 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.7 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0060987 | lipid tube(GO:0060987) |
0.6 | 1.9 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.5 | 1.5 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.5 | 1.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
0.4 | 1.3 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
0.4 | 1.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.3 | 2.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.3 | 1.4 | GO:0044301 | climbing fiber(GO:0044301) |
0.3 | 0.8 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.2 | 3.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.2 | 0.7 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 3.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.2 | 1.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.2 | 2.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 3.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 0.6 | GO:0060187 | cell pole(GO:0060187) |
0.2 | 0.9 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.2 | 1.4 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.2 | 0.5 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.2 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 0.7 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 1.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 1.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 0.5 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.2 | 0.8 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
0.2 | 0.6 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.2 | 0.5 | GO:0005683 | U7 snRNP(GO:0005683) |
0.2 | 0.5 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
0.2 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 1.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 3.3 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 4.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 1.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 1.6 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 1.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 2.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.6 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.1 | 0.9 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 1.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 3.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.4 | GO:0072563 | endothelial microparticle(GO:0072563) |
0.1 | 0.6 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
0.1 | 0.9 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.1 | 0.4 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
0.1 | 0.9 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 1.0 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 1.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 1.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 2.6 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 2.7 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 1.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.6 | GO:0005713 | recombination nodule(GO:0005713) |
0.1 | 1.8 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.6 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.1 | 0.5 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.8 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.5 | GO:0045160 | myosin I complex(GO:0045160) |
0.1 | 0.4 | GO:0097196 | Shu complex(GO:0097196) |
0.1 | 0.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.1 | 0.9 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.4 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
0.1 | 1.8 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 1.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.7 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.4 | GO:1990879 | CST complex(GO:1990879) |
0.1 | 1.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.5 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 2.9 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.5 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
0.1 | 0.3 | GO:1990038 | glial cytoplasmic inclusion(GO:0097409) classical Lewy body(GO:0097414) Lewy neurite(GO:0097462) Lewy body corona(GO:1990038) |
0.1 | 1.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 5.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 1.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.4 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 1.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 2.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.9 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 5.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 6.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 12.2 | GO:0005814 | centriole(GO:0005814) |
0.1 | 0.5 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.9 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 1.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.3 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 1.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 4.9 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.4 | GO:1902560 | GMP reductase complex(GO:1902560) |
0.1 | 0.5 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.6 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.6 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 1.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 1.9 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.6 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 2.4 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 1.4 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.8 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 2.6 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 2.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.2 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
0.1 | 0.9 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.3 | GO:0043291 | RAVE complex(GO:0043291) |
0.1 | 0.7 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.7 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.1 | 0.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.8 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.2 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.1 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.3 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.4 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 1.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.5 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.0 | 1.2 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 1.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.1 | GO:0034271 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
0.0 | 0.8 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.9 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 2.9 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 1.4 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.2 | GO:0032301 | MutSalpha complex(GO:0032301) MutSbeta complex(GO:0032302) |
0.0 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.2 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 2.6 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 3.8 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) INO80-type complex(GO:0097346) |
0.0 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.4 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 3.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 2.5 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.8 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 2.0 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.3 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 1.2 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 4.1 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.8 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.8 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.1 | GO:0008623 | CHRAC(GO:0008623) |
0.0 | 4.3 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.0 | 1.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.8 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 1.4 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 1.6 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
0.0 | 2.6 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.0 | 3.6 | GO:0005819 | spindle(GO:0005819) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 1.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.5 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 1.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 1.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.8 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.7 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 1.5 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 1.1 | GO:0031904 | endosome lumen(GO:0031904) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 1.0 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 1.9 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.4 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 2.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.6 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 1.3 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 1.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.2 | GO:0016013 | syntrophin complex(GO:0016013) |
0.0 | 0.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.1 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.1 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.0 | 0.8 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 7.6 | GO:0016793 | dGTPase activity(GO:0008832) triphosphoric monoester hydrolase activity(GO:0016793) guanyl deoxyribonucleotide binding(GO:0032560) dGTP binding(GO:0032567) |
1.4 | 4.1 | GO:0031696 | alpha-2C adrenergic receptor binding(GO:0031696) |
1.2 | 5.0 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.9 | 4.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.7 | 2.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.6 | 1.8 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
0.6 | 2.8 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
0.5 | 2.1 | GO:0004773 | steryl-sulfatase activity(GO:0004773) |
0.5 | 1.4 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
0.4 | 1.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.4 | 1.7 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.4 | 1.2 | GO:0019777 | Atg12 transferase activity(GO:0019777) |
0.4 | 3.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.4 | 2.9 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.4 | 1.1 | GO:0032427 | GBD domain binding(GO:0032427) |
0.3 | 1.4 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.3 | 1.6 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.3 | 1.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 2.5 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.3 | 1.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.3 | 1.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.3 | 0.9 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.3 | 0.9 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.3 | 1.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.3 | 1.3 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.3 | 0.8 | GO:0036361 | L-serine ammonia-lyase activity(GO:0003941) racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.3 | 1.3 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.3 | 0.8 | GO:0043739 | G/U mismatch-specific uracil-DNA glycosylase activity(GO:0043739) |
0.3 | 1.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 1.0 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
0.2 | 1.0 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
0.2 | 3.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 1.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 0.9 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.2 | 0.6 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
0.2 | 1.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.2 | 0.8 | GO:0047708 | biotinidase activity(GO:0047708) |
0.2 | 0.8 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.2 | 0.7 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
0.2 | 0.7 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.2 | 1.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.2 | 0.5 | GO:0000248 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
0.2 | 3.9 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 1.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.2 | 0.5 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.2 | 0.9 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 0.8 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.2 | 0.5 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
0.2 | 2.4 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 1.3 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.2 | 0.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 0.5 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 1.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.4 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.1 | 0.7 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
0.1 | 0.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 0.7 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.4 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 1.3 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 1.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 3.4 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 1.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.8 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.4 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
0.1 | 2.7 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 1.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.1 | 1.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 3.6 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.1 | 3.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.1 | 0.3 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
0.1 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
0.1 | 0.3 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.3 | GO:0051717 | inositol-1,3,4,5-tetrakisphosphate 3-phosphatase activity(GO:0051717) phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
0.1 | 1.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.3 | GO:0004798 | thymidylate kinase activity(GO:0004798) |
0.1 | 1.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.3 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
0.1 | 2.0 | GO:0043295 | glutathione binding(GO:0043295) |
0.1 | 0.6 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.1 | 0.4 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
0.1 | 3.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.3 | GO:0005477 | pyruvate secondary active transmembrane transporter activity(GO:0005477) |
0.1 | 0.4 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) |
0.1 | 0.4 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.3 | GO:0090541 | MIT domain binding(GO:0090541) |
0.1 | 0.5 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
0.1 | 0.4 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.1 | 1.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.1 | 0.5 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.4 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.8 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.5 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.1 | 1.4 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.5 | GO:0039552 | RIG-I binding(GO:0039552) |
0.1 | 1.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.5 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 1.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 3.6 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.4 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
0.1 | 0.4 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.9 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.1 | 0.6 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.9 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 0.6 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.6 | GO:0003909 | DNA ligase activity(GO:0003909) |
0.1 | 0.4 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
0.1 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.3 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.3 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.1 | 1.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.1 | 0.7 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
0.1 | 0.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
0.1 | 0.5 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.1 | 0.5 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) thymidine kinase activity(GO:0004797) |
0.1 | 2.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.3 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
0.1 | 0.2 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.1 | 0.4 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 0.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.5 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.2 | GO:0043273 | CTPase activity(GO:0043273) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.5 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 1.3 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.3 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
0.1 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.1 | 1.9 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.1 | 0.2 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 1.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.9 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.2 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
0.1 | 1.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.2 | GO:0004639 | phosphoribosylaminoimidazole carboxylase activity(GO:0004638) phosphoribosylaminoimidazolesuccinocarboxamide synthase activity(GO:0004639) |
0.1 | 0.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.9 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.5 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.0 | 1.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 1.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 4.3 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 1.9 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.8 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.2 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.0 | 0.1 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
0.0 | 1.7 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.0 | 0.6 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
0.0 | 0.0 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 1.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 2.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 1.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.7 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.4 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.0 | 3.5 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 1.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.5 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 4.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.4 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 1.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.3 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 1.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 1.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 1.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 2.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.6 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
0.0 | 2.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 2.1 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.7 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.9 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
0.0 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.0 | 0.2 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.3 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.6 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.2 | GO:1902444 | riboflavin binding(GO:1902444) |
0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
0.0 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.0 | 0.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 1.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.7 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 2.0 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 1.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
0.0 | 0.0 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 1.1 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 1.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.3 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.2 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.8 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.5 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.0 | 1.2 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 1.1 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 1.3 | GO:0016209 | antioxidant activity(GO:0016209) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.8 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 1.1 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.3 | GO:1902936 | phosphatidylinositol bisphosphate binding(GO:1902936) |
0.0 | 0.4 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.1 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
0.0 | 0.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.4 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.0 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.0 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 1.0 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.0 | 1.7 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0004080 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.3 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 1.0 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
0.0 | 0.0 | GO:0008893 | guanosine-3',5'-bis(diphosphate) 3'-diphosphatase activity(GO:0008893) diphosphoric monoester hydrolase activity(GO:0016794) |
0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 5.5 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.7 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.0 | 0.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.3 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
0.0 | 0.2 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 1.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 2.8 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 2.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 2.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 1.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 2.7 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 1.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.6 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.5 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 3.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 3.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 2.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 3.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.7 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 5.0 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 1.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 8.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.1 | 0.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 8.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 1.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 2.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 1.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 3.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 2.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 1.1 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 2.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 1.3 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.8 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 1.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.8 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 1.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 1.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.7 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 1.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.3 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.7 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.2 | 0.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.2 | 0.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.2 | 2.9 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 2.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.9 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 2.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 1.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 1.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.3 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 3.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 1.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 1.9 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 2.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 3.5 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 1.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 1.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 3.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 0.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.4 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 1.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.0 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 1.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.5 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 1.6 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 1.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.9 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 2.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 1.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 4.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 1.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 1.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 1.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 1.4 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 1.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.9 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.4 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
0.0 | 1.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.6 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 1.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 1.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.5 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.5 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
0.0 | 1.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 3.8 | REACTOME SEMAPHORIN INTERACTIONS | Genes involved in Semaphorin interactions |
0.0 | 1.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 1.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 2.6 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 1.6 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.4 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.8 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 1.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.4 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 1.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 1.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.0 | 0.8 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.0 | 1.0 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 11.1 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 1.0 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.5 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 1.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 2.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.3 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 4.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 1.7 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.4 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.5 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 1.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 3.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.6 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 1.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.7 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.4 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 0.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |