| 1.9 |
7.6 |
GO:1903575 |
cornified envelope assembly(GO:1903575) |
| 1.4 |
8.2 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 1.1 |
3.3 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 1.0 |
4.0 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.9 |
1.7 |
GO:2000309 |
positive regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000309) |
| 0.8 |
3.3 |
GO:0050712 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.8 |
0.8 |
GO:0048817 |
negative regulation of hair follicle maturation(GO:0048817) |
| 0.8 |
2.3 |
GO:0002582 |
positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.7 |
2.7 |
GO:0032600 |
B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.6 |
2.6 |
GO:0042361 |
menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.6 |
2.5 |
GO:0060448 |
dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.6 |
5.4 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.6 |
9.0 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.6 |
5.2 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 0.6 |
1.2 |
GO:0060557 |
positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 0.6 |
0.6 |
GO:0045976 |
negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.5 |
2.5 |
GO:0097021 |
lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.5 |
4.5 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.5 |
2.4 |
GO:0071109 |
superior temporal gyrus development(GO:0071109) |
| 0.5 |
1.4 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.5 |
1.9 |
GO:0033693 |
neurofilament bundle assembly(GO:0033693) |
| 0.5 |
2.4 |
GO:2001181 |
positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.5 |
1.4 |
GO:0042231 |
interleukin-13 biosynthetic process(GO:0042231) |
| 0.5 |
1.4 |
GO:0051695 |
actin filament uncapping(GO:0051695) |
| 0.4 |
1.7 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.4 |
2.5 |
GO:0035602 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.4 |
1.7 |
GO:0048627 |
myoblast development(GO:0048627) |
| 0.4 |
0.8 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.4 |
1.2 |
GO:0002892 |
type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) |
| 0.4 |
1.1 |
GO:0098905 |
regulation of bundle of His cell action potential(GO:0098905) |
| 0.4 |
1.5 |
GO:0010982 |
regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.4 |
1.9 |
GO:1902943 |
regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) |
| 0.4 |
2.3 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.4 |
5.2 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.4 |
1.1 |
GO:0072192 |
apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 0.4 |
2.2 |
GO:1903285 |
negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) positive regulation of peroxidase activity(GO:2000470) |
| 0.4 |
1.1 |
GO:1901899 |
positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.4 |
1.5 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.4 |
1.5 |
GO:0051710 |
regulation of cytolysis in other organism(GO:0051710) |
| 0.4 |
1.4 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.4 |
2.8 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.3 |
1.0 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.3 |
9.0 |
GO:0090026 |
positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.3 |
4.5 |
GO:0038129 |
ERBB3 signaling pathway(GO:0038129) |
| 0.3 |
4.8 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.3 |
1.3 |
GO:0007499 |
ectoderm and mesoderm interaction(GO:0007499) |
| 0.3 |
3.0 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.3 |
1.3 |
GO:0030037 |
actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 |
1.3 |
GO:0090096 |
regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.3 |
1.0 |
GO:2001287 |
negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.3 |
0.6 |
GO:0086042 |
cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.3 |
1.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.3 |
0.9 |
GO:0018057 |
peptidyl-lysine oxidation(GO:0018057) |
| 0.3 |
0.6 |
GO:1903937 |
response to acrylamide(GO:1903937) |
| 0.3 |
0.9 |
GO:0061589 |
calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.3 |
0.9 |
GO:0043000 |
Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.3 |
1.2 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.3 |
1.8 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.3 |
0.9 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.3 |
8.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.3 |
1.2 |
GO:1990834 |
response to odorant(GO:1990834) |
| 0.3 |
2.0 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.3 |
0.9 |
GO:0061573 |
endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.3 |
2.8 |
GO:0098881 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.3 |
1.1 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.3 |
0.8 |
GO:0045608 |
negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.3 |
3.0 |
GO:0021853 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.3 |
1.6 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.3 |
1.1 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.3 |
1.6 |
GO:0003011 |
involuntary skeletal muscle contraction(GO:0003011) |
| 0.3 |
0.8 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.3 |
4.7 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.3 |
1.0 |
GO:0034164 |
negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.3 |
2.1 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.3 |
0.8 |
GO:0071676 |
negative regulation of mononuclear cell migration(GO:0071676) |
| 0.3 |
1.5 |
GO:0070778 |
L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.3 |
0.8 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) |
| 0.3 |
1.0 |
GO:1903860 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.3 |
1.0 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.3 |
1.3 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.2 |
1.0 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.2 |
0.7 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 |
1.5 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.2 |
0.7 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.2 |
1.5 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.2 |
1.7 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
0.7 |
GO:0051040 |
regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 0.2 |
0.7 |
GO:0033037 |
polysaccharide localization(GO:0033037) |
| 0.2 |
0.7 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.2 |
0.7 |
GO:0060086 |
circadian temperature homeostasis(GO:0060086) |
| 0.2 |
0.7 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.2 |
2.5 |
GO:0034626 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 |
0.9 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.2 |
0.7 |
GO:0048560 |
establishment of anatomical structure orientation(GO:0048560) |
| 0.2 |
0.7 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.2 |
2.9 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.2 |
0.9 |
GO:1902164 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.2 |
0.4 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
1.1 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 |
0.4 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.2 |
1.3 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.2 |
1.1 |
GO:0090362 |
positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.2 |
1.7 |
GO:1902959 |
regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) regulation of aspartic-type peptidase activity(GO:1905245) |
| 0.2 |
0.6 |
GO:1900163 |
regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 0.2 |
0.8 |
GO:0003104 |
positive regulation of glomerular filtration(GO:0003104) |
| 0.2 |
0.6 |
GO:0045013 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.2 |
0.6 |
GO:1905064 |
negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.2 |
0.6 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 0.2 |
1.9 |
GO:0051121 |
hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.2 |
2.5 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.2 |
0.8 |
GO:0002238 |
response to molecule of fungal origin(GO:0002238) cellular response to molecule of fungal origin(GO:0071226) |
| 0.2 |
0.2 |
GO:0070256 |
negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.2 |
0.6 |
GO:0007538 |
primary sex determination(GO:0007538) |
| 0.2 |
1.6 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.2 |
1.2 |
GO:0060214 |
endocardium formation(GO:0060214) |
| 0.2 |
0.6 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.2 |
1.0 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.2 |
1.0 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.2 |
0.4 |
GO:0001743 |
optic placode formation(GO:0001743) |
| 0.2 |
0.6 |
GO:0010481 |
epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.2 |
0.8 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.2 |
0.6 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.2 |
0.9 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.2 |
2.2 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.2 |
0.2 |
GO:0002325 |
natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.2 |
2.0 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.2 |
0.6 |
GO:0005988 |
lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 0.2 |
1.1 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.2 |
1.6 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.2 |
0.5 |
GO:0043006 |
activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.2 |
0.2 |
GO:0060197 |
cloacal septation(GO:0060197) |
| 0.2 |
0.5 |
GO:0048865 |
stem cell fate commitment(GO:0048865) |
| 0.2 |
0.9 |
GO:0009137 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.2 |
0.7 |
GO:0018879 |
biphenyl metabolic process(GO:0018879) |
| 0.2 |
0.5 |
GO:0038195 |
urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.2 |
0.7 |
GO:2000660 |
negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.2 |
0.4 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 |
0.2 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 |
1.2 |
GO:0071639 |
positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
| 0.2 |
0.5 |
GO:0050976 |
detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
| 0.2 |
0.7 |
GO:0015770 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 |
1.2 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.2 |
0.9 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.2 |
0.3 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.2 |
0.5 |
GO:0060309 |
elastin catabolic process(GO:0060309) |
| 0.2 |
0.5 |
GO:0030221 |
basophil differentiation(GO:0030221) |
| 0.2 |
1.0 |
GO:0038172 |
interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.2 |
1.8 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.2 |
0.5 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.2 |
2.7 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.2 |
0.3 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.2 |
2.3 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.2 |
0.5 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 |
0.5 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 0.2 |
0.3 |
GO:0060128 |
corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.2 |
1.9 |
GO:0090360 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 |
0.6 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.2 |
0.5 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.2 |
1.0 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.2 |
0.2 |
GO:0010615 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.2 |
0.8 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 |
1.8 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.2 |
0.8 |
GO:2000721 |
positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.2 |
1.3 |
GO:0002329 |
pre-B cell differentiation(GO:0002329) |
| 0.2 |
1.1 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.2 |
0.8 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 |
0.3 |
GO:1903233 |
regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.2 |
0.2 |
GO:1900673 |
olefin metabolic process(GO:1900673) |
| 0.2 |
0.9 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.2 |
0.5 |
GO:1904845 |
response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.2 |
1.5 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 |
1.0 |
GO:0033029 |
neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.1 |
0.7 |
GO:0032185 |
septin cytoskeleton organization(GO:0032185) |
| 0.1 |
1.6 |
GO:0048003 |
antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 |
0.7 |
GO:0044332 |
Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.1 |
0.3 |
GO:0018894 |
dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.1 |
0.7 |
GO:1904219 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 |
0.3 |
GO:1990569 |
UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.1 |
0.7 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.1 |
0.3 |
GO:0036466 |
synaptic vesicle recycling via endosome(GO:0036466) |
| 0.1 |
16.8 |
GO:0070268 |
cornification(GO:0070268) |
| 0.1 |
0.4 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.1 |
1.2 |
GO:0061709 |
reticulophagy(GO:0061709) |
| 0.1 |
0.1 |
GO:0034395 |
regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.1 |
0.3 |
GO:0089709 |
histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.1 |
1.4 |
GO:0051918 |
negative regulation of fibrinolysis(GO:0051918) |
| 0.1 |
0.7 |
GO:0010956 |
negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.1 |
0.4 |
GO:0043396 |
corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.1 |
0.6 |
GO:0021773 |
striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 |
0.4 |
GO:0035732 |
nitric oxide storage(GO:0035732) |
| 0.1 |
0.6 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.1 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 |
0.7 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.1 |
0.5 |
GO:0010900 |
negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.1 |
0.4 |
GO:1902219 |
negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 |
0.5 |
GO:0032489 |
regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.1 |
0.4 |
GO:0042369 |
vitamin D catabolic process(GO:0042369) |
| 0.1 |
0.7 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.1 |
0.1 |
GO:2000777 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.1 |
3.1 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.1 |
0.5 |
GO:1903371 |
regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 |
0.7 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 |
2.1 |
GO:0002138 |
retinoic acid biosynthetic process(GO:0002138) |
| 0.1 |
1.2 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
0.5 |
GO:0071727 |
toll-like receptor TLR1:TLR2 signaling pathway(GO:0038123) response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.1 |
0.4 |
GO:0002884 |
negative regulation of type IV hypersensitivity(GO:0001808) negative regulation of hypersensitivity(GO:0002884) |
| 0.1 |
0.5 |
GO:0060585 |
regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 |
0.8 |
GO:0036324 |
vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 |
0.8 |
GO:0006196 |
AMP catabolic process(GO:0006196) |
| 0.1 |
0.6 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.1 |
0.5 |
GO:0045226 |
extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 |
1.0 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 |
0.4 |
GO:1900738 |
positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 |
1.0 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
2.9 |
GO:0014733 |
regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 |
0.1 |
GO:0032765 |
positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 |
1.5 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.1 |
0.5 |
GO:0009436 |
glyoxylate catabolic process(GO:0009436) |
| 0.1 |
0.5 |
GO:1903750 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 |
0.9 |
GO:0097461 |
ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.1 |
0.2 |
GO:0021827 |
cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.1 |
0.4 |
GO:0034351 |
regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.1 |
0.1 |
GO:1903949 |
positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 |
0.4 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 |
0.5 |
GO:2001268 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 |
2.2 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.1 |
3.9 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 |
0.5 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 |
1.7 |
GO:0032119 |
sequestering of zinc ion(GO:0032119) |
| 0.1 |
0.4 |
GO:0060458 |
right lung development(GO:0060458) |
| 0.1 |
0.5 |
GO:0015783 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 |
0.5 |
GO:0086048 |
membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.1 |
0.3 |
GO:0042137 |
sequestering of neurotransmitter(GO:0042137) |
| 0.1 |
0.8 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 |
0.8 |
GO:0030917 |
midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 |
0.5 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 |
0.3 |
GO:0035634 |
response to stilbenoid(GO:0035634) |
| 0.1 |
0.5 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.1 |
0.3 |
GO:0098759 |
response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.1 |
0.6 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.1 |
0.6 |
GO:0093001 |
glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.1 |
0.3 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.1 |
0.3 |
GO:0071286 |
cellular response to magnesium ion(GO:0071286) |
| 0.1 |
0.1 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.1 |
1.0 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 |
1.3 |
GO:0098734 |
macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.4 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.1 |
0.6 |
GO:0002396 |
MHC protein complex assembly(GO:0002396) |
| 0.1 |
0.2 |
GO:0097107 |
postsynaptic density assembly(GO:0097107) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.1 |
0.3 |
GO:0036005 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 |
0.3 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.1 |
0.9 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.1 |
0.3 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 |
0.3 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.1 |
0.5 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.1 |
0.4 |
GO:0090611 |
ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 |
0.1 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 |
0.8 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.1 |
1.3 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 |
0.3 |
GO:0046521 |
sphingoid catabolic process(GO:0046521) |
| 0.1 |
0.4 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.1 |
1.3 |
GO:0046940 |
nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.1 |
0.7 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 |
0.1 |
GO:2000981 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.1 |
0.8 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.1 |
0.6 |
GO:1900825 |
regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.1 |
0.3 |
GO:0002625 |
regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.1 |
0.2 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 |
0.4 |
GO:0002913 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 |
0.2 |
GO:0061027 |
umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.1 |
0.3 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.1 |
1.6 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
2.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.1 |
GO:0014744 |
positive regulation of muscle adaptation(GO:0014744) |
| 0.1 |
0.3 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) |
| 0.1 |
0.4 |
GO:2000490 |
negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.1 |
0.1 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.1 |
0.1 |
GO:0072003 |
kidney rudiment formation(GO:0072003) |
| 0.1 |
0.3 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 |
1.0 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 |
2.5 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 |
0.1 |
GO:0045763 |
negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.1 |
1.3 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 |
0.1 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 |
0.5 |
GO:2000503 |
positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 |
0.4 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 |
0.4 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.1 |
0.4 |
GO:1901318 |
negative regulation of sperm motility(GO:1901318) |
| 0.1 |
0.3 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) mesenchymal-epithelial cell signaling involved in prostate gland development(GO:0060739) |
| 0.1 |
1.5 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
0.4 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 |
0.4 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.1 |
0.2 |
GO:0010979 |
regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 |
0.5 |
GO:1901091 |
regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 |
0.2 |
GO:0052510 |
induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 |
0.7 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.1 |
0.2 |
GO:0045082 |
positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.1 |
1.2 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 |
0.1 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.1 |
0.6 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.1 |
0.5 |
GO:0038016 |
insulin receptor internalization(GO:0038016) |
| 0.1 |
0.3 |
GO:0033082 |
regulation of extrathymic T cell differentiation(GO:0033082) sebum secreting cell proliferation(GO:1990654) |
| 0.1 |
0.3 |
GO:0071460 |
cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 |
0.2 |
GO:0002266 |
follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.1 |
0.5 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.1 |
GO:1904220 |
regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 |
0.6 |
GO:0015760 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.1 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.1 |
0.3 |
GO:0000967 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 |
0.2 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 0.1 |
0.2 |
GO:0015842 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 |
1.7 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.4 |
GO:1904744 |
positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 |
0.4 |
GO:0043987 |
histone H3-S10 phosphorylation(GO:0043987) |
| 0.1 |
0.2 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
0.3 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.1 |
0.4 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.1 |
0.7 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 |
0.1 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.1 |
0.3 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 |
0.2 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.1 |
0.4 |
GO:0032485 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 |
0.3 |
GO:0098957 |
anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.1 |
0.5 |
GO:0043697 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.1 |
0.8 |
GO:1902714 |
negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 |
0.3 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.1 |
0.3 |
GO:0006524 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.1 |
0.1 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.1 |
0.3 |
GO:1903288 |
positive regulation of potassium ion import(GO:1903288) |
| 0.1 |
0.4 |
GO:0002679 |
respiratory burst involved in defense response(GO:0002679) |
| 0.1 |
0.6 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 |
0.2 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 |
0.5 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 |
1.1 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 |
0.4 |
GO:0015742 |
alpha-ketoglutarate transport(GO:0015742) |
| 0.1 |
0.3 |
GO:0048505 |
regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.1 |
0.1 |
GO:0030185 |
nitric oxide transport(GO:0030185) |
| 0.1 |
0.7 |
GO:1901339 |
regulation of store-operated calcium channel activity(GO:1901339) |
| 0.1 |
0.5 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.3 |
GO:2000687 |
negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.1 |
0.2 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.1 |
0.1 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 0.1 |
0.6 |
GO:0002074 |
extraocular skeletal muscle development(GO:0002074) |
| 0.1 |
0.2 |
GO:1903899 |
positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 |
0.5 |
GO:0036493 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.1 |
0.6 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 |
0.3 |
GO:2000612 |
thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.1 |
2.5 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 |
0.2 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 |
0.5 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.4 |
GO:0006537 |
glutamate biosynthetic process(GO:0006537) |
| 0.1 |
0.1 |
GO:0072300 |
regulation of metanephros size(GO:0035566) positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.1 |
0.2 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 |
0.2 |
GO:0010875 |
positive regulation of cholesterol efflux(GO:0010875) |
| 0.1 |
0.1 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.1 |
0.2 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 |
0.1 |
GO:0009111 |
vitamin catabolic process(GO:0009111) |
| 0.1 |
0.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.5 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 |
0.4 |
GO:1904502 |
regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.1 |
0.1 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 |
0.3 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 |
0.7 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.1 |
GO:1902938 |
regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.1 |
0.2 |
GO:0060720 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 |
0.3 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 |
0.3 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 |
0.3 |
GO:0009624 |
response to nematode(GO:0009624) |
| 0.1 |
2.5 |
GO:0015695 |
organic cation transport(GO:0015695) |
| 0.1 |
0.4 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
0.5 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.1 |
0.1 |
GO:0048320 |
axial mesoderm formation(GO:0048320) |
| 0.1 |
0.8 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
0.6 |
GO:0002070 |
epithelial cell maturation(GO:0002070) |
| 0.1 |
1.8 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 |
0.5 |
GO:0001705 |
ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.1 |
0.3 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.1 |
0.5 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.1 |
0.2 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.1 |
0.2 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.1 |
0.4 |
GO:0032468 |
Golgi calcium ion homeostasis(GO:0032468) |
| 0.1 |
0.2 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.8 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.6 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
0.3 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
0.4 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.1 |
0.3 |
GO:0033076 |
isoquinoline alkaloid metabolic process(GO:0033076) |
| 0.1 |
0.8 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.5 |
GO:0001915 |
negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 |
0.6 |
GO:2000321 |
positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.1 |
0.2 |
GO:0035962 |
response to interleukin-13(GO:0035962) |
| 0.1 |
0.3 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.1 |
0.2 |
GO:0007174 |
epidermal growth factor catabolic process(GO:0007174) |
| 0.1 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 |
1.0 |
GO:1901642 |
nucleoside transmembrane transport(GO:1901642) |
| 0.1 |
0.1 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.1 |
0.2 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 |
0.8 |
GO:0031126 |
snoRNA 3'-end processing(GO:0031126) |
| 0.1 |
0.3 |
GO:0035585 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.1 |
0.8 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 |
0.4 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 |
0.3 |
GO:1900108 |
negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 |
0.5 |
GO:0098814 |
spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.1 |
0.5 |
GO:0051673 |
membrane disruption in other organism(GO:0051673) |
| 0.1 |
0.2 |
GO:0061727 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 |
0.1 |
GO:0045080 |
positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.1 |
0.7 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 |
0.3 |
GO:2000851 |
positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.1 |
0.4 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 |
0.3 |
GO:0034224 |
cellular response to zinc ion starvation(GO:0034224) |
| 0.1 |
0.1 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 |
0.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.3 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.1 |
1.3 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 |
0.2 |
GO:0046586 |
regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.1 |
0.3 |
GO:0071422 |
succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.1 |
0.2 |
GO:0003343 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.1 |
0.1 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 |
0.5 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
2.5 |
GO:0051602 |
response to electrical stimulus(GO:0051602) |
| 0.1 |
4.5 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.3 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.1 |
GO:0006714 |
sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) terpenoid catabolic process(GO:0016115) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) |
| 0.1 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.1 |
0.5 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 |
0.1 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.1 |
0.2 |
GO:1900107 |
regulation of nodal signaling pathway(GO:1900107) |
| 0.1 |
0.1 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 |
0.6 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.1 |
0.1 |
GO:0002865 |
negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.1 |
0.2 |
GO:0038043 |
interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.1 |
2.3 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.1 |
0.2 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.1 |
0.4 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 0.1 |
0.3 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 |
0.3 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.1 |
0.6 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.1 |
1.1 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.1 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 0.1 |
0.4 |
GO:0061368 |
behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 |
0.1 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
0.1 |
GO:0050902 |
leukocyte adhesive activation(GO:0050902) |
| 0.1 |
0.2 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 |
0.9 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.1 |
0.1 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.1 |
0.3 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.1 |
0.4 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
0.4 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 |
0.1 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.1 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 |
0.2 |
GO:0046035 |
CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 |
0.1 |
GO:1901876 |
regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.1 |
0.1 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.1 |
0.8 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.1 |
0.1 |
GO:2000863 |
positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.1 |
0.1 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 |
0.2 |
GO:0060003 |
copper ion export(GO:0060003) |
| 0.1 |
0.2 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 |
0.3 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) |
| 0.1 |
0.1 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.1 |
0.6 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.2 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.1 |
0.2 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 0.1 |
0.1 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 |
0.2 |
GO:1901993 |
meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 |
0.2 |
GO:0002774 |
Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 0.1 |
0.2 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.1 |
0.6 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.1 |
0.1 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.1 |
0.8 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 |
0.2 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.1 |
0.1 |
GO:0046643 |
regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 |
1.2 |
GO:0001573 |
ganglioside metabolic process(GO:0001573) |
| 0.1 |
0.2 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.1 |
0.1 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 |
0.1 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.1 |
0.2 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.1 |
0.3 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) |
| 0.1 |
0.5 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 |
0.1 |
GO:0000466 |
maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.1 |
0.1 |
GO:0035992 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 |
0.2 |
GO:1902081 |
regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.1 |
0.1 |
GO:0097106 |
postsynaptic density organization(GO:0097106) |
| 0.1 |
0.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
0.7 |
GO:0010248 |
establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 |
0.1 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.1 |
0.2 |
GO:0030920 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.4 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 |
0.1 |
GO:0072720 |
response to dithiothreitol(GO:0072720) |
| 0.1 |
0.1 |
GO:2000722 |
regulation of cardiac vascular smooth muscle cell differentiation(GO:2000722) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.1 |
0.3 |
GO:2000741 |
positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 |
0.6 |
GO:0042355 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.1 |
0.1 |
GO:0061198 |
fungiform papilla formation(GO:0061198) |
| 0.1 |
0.2 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.1 |
GO:0019240 |
citrulline biosynthetic process(GO:0019240) |
| 0.1 |
3.7 |
GO:0045576 |
mast cell activation(GO:0045576) |
| 0.1 |
0.1 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.1 |
0.1 |
GO:0002579 |
positive regulation of antigen processing and presentation(GO:0002579) |
| 0.1 |
0.1 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.1 |
0.4 |
GO:0048712 |
negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 |
0.2 |
GO:0031635 |
adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
| 0.1 |
0.1 |
GO:0002232 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 |
0.5 |
GO:0015691 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.6 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 |
0.1 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.1 |
0.5 |
GO:1900623 |
regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.1 |
0.2 |
GO:0019046 |
release from viral latency(GO:0019046) |
| 0.1 |
0.1 |
GO:0032425 |
positive regulation of mismatch repair(GO:0032425) |
| 0.1 |
0.7 |
GO:0045072 |
regulation of interferon-gamma biosynthetic process(GO:0045072) |
| 0.1 |
0.2 |
GO:1904732 |
regulation of electron carrier activity(GO:1904732) |
| 0.1 |
0.2 |
GO:0071962 |
mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.1 |
0.1 |
GO:0021779 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 |
0.5 |
GO:0019344 |
cysteine biosynthetic process(GO:0019344) |
| 0.1 |
1.3 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.1 |
0.3 |
GO:0032364 |
oxygen homeostasis(GO:0032364) |
| 0.1 |
0.2 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.1 |
0.4 |
GO:0016199 |
axon midline choice point recognition(GO:0016199) |
| 0.1 |
0.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
1.0 |
GO:2000251 |
positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 |
0.6 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
0.0 |
GO:0060462 |
lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 |
0.2 |
GO:0044210 |
'de novo' CTP biosynthetic process(GO:0044210) |
| 0.0 |
0.0 |
GO:1902823 |
negative regulation of late endosome to lysosome transport(GO:1902823) |
| 0.0 |
0.2 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.0 |
0.4 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.0 |
0.1 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.0 |
0.8 |
GO:2000821 |
regulation of grooming behavior(GO:2000821) |
| 0.0 |
0.3 |
GO:0046075 |
dTTP metabolic process(GO:0046075) |
| 0.0 |
0.1 |
GO:0060556 |
regulation of vitamin D biosynthetic process(GO:0060556) |
| 0.0 |
0.2 |
GO:0072093 |
metanephric renal vesicle formation(GO:0072093) |
| 0.0 |
0.1 |
GO:0030969 |
mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.0 |
0.6 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.0 |
0.2 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 0.0 |
0.1 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 0.0 |
0.2 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.0 |
0.0 |
GO:1900019 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 |
0.1 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 |
0.0 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 0.0 |
0.3 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.0 |
0.8 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.9 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.0 |
0.8 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.1 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 |
0.2 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 |
0.2 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 |
0.0 |
GO:0072108 |
positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 |
0.1 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 |
0.8 |
GO:2000052 |
positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 |
0.3 |
GO:1903659 |
regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 |
0.1 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.0 |
0.6 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 |
0.1 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 |
2.9 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.3 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.1 |
GO:0014813 |
skeletal muscle satellite cell commitment(GO:0014813) |
| 0.0 |
0.9 |
GO:1904778 |
regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 |
0.2 |
GO:0009098 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.0 |
0.1 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.0 |
0.5 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.0 |
2.6 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.0 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
0.1 |
GO:0051552 |
flavone metabolic process(GO:0051552) |
| 0.0 |
0.1 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 |
0.0 |
GO:0033861 |
negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 |
0.7 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 |
0.3 |
GO:0014859 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 |
0.1 |
GO:0001994 |
norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 |
0.3 |
GO:0044789 |
modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 |
0.3 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.0 |
0.1 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.0 |
0.6 |
GO:0086027 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
| 0.0 |
0.3 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 0.0 |
0.1 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.0 |
0.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.1 |
GO:0033133 |
positive regulation of glucokinase activity(GO:0033133) |
| 0.0 |
0.1 |
GO:0018160 |
peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 0.0 |
0.9 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 |
0.2 |
GO:0033058 |
directional locomotion(GO:0033058) |
| 0.0 |
1.1 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 |
0.2 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.0 |
0.7 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.0 |
0.7 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.0 |
0.1 |
GO:0050928 |
negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 |
0.2 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 |
0.2 |
GO:0010387 |
COP9 signalosome assembly(GO:0010387) |
| 0.0 |
0.1 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.0 |
0.1 |
GO:0099551 |
synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 |
0.2 |
GO:0036229 |
glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.0 |
0.1 |
GO:0075732 |
viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.0 |
0.4 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) |
| 0.0 |
0.3 |
GO:0048165 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 |
0.3 |
GO:0009912 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 |
0.0 |
GO:0010621 |
negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.0 |
0.0 |
GO:1904378 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 |
0.6 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.0 |
0.1 |
GO:0002827 |
positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.0 |
0.3 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.0 |
0.1 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 |
0.2 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 |
0.8 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.0 |
0.5 |
GO:0002097 |
tRNA wobble base modification(GO:0002097) |
| 0.0 |
0.4 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 |
0.7 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.0 |
0.2 |
GO:0060363 |
cranial suture morphogenesis(GO:0060363) |
| 0.0 |
0.3 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 0.0 |
0.3 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.3 |
GO:0021633 |
optic nerve structural organization(GO:0021633) |
| 0.0 |
0.0 |
GO:1903625 |
negative regulation of DNA catabolic process(GO:1903625) |
| 0.0 |
0.1 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.0 |
2.0 |
GO:0046710 |
GDP metabolic process(GO:0046710) |
| 0.0 |
0.1 |
GO:0002818 |
intracellular defense response(GO:0002818) |
| 0.0 |
0.1 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.0 |
0.6 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 0.0 |
0.2 |
GO:0002357 |
defense response to tumor cell(GO:0002357) |
| 0.0 |
0.1 |
GO:0048880 |
sensory system development(GO:0048880) |
| 0.0 |
0.3 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.0 |
0.1 |
GO:0070124 |
mitochondrial translational initiation(GO:0070124) |
| 0.0 |
0.3 |
GO:1902915 |
negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 |
0.2 |
GO:0016098 |
monoterpenoid metabolic process(GO:0016098) |
| 0.0 |
0.2 |
GO:0035376 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 |
1.0 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 |
0.1 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.0 |
0.2 |
GO:1903385 |
regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 |
0.3 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.0 |
0.1 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.0 |
0.3 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.0 |
0.2 |
GO:1900112 |
regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 |
0.0 |
GO:0009822 |
alkaloid catabolic process(GO:0009822) |
| 0.0 |
0.2 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.2 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.3 |
GO:0010968 |
regulation of microtubule nucleation(GO:0010968) |
| 0.0 |
1.2 |
GO:0021680 |
cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 |
0.1 |
GO:0018315 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 |
0.6 |
GO:1904869 |
regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.0 |
0.4 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.0 |
0.5 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 |
0.2 |
GO:1904379 |
protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 |
0.1 |
GO:0072156 |
distal tubule morphogenesis(GO:0072156) |
| 0.0 |
0.4 |
GO:0006670 |
sphingosine metabolic process(GO:0006670) |
| 0.0 |
0.1 |
GO:0035281 |
pre-miRNA export from nucleus(GO:0035281) |
| 0.0 |
0.2 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.0 |
GO:0040038 |
polar body extrusion after meiotic divisions(GO:0040038) |
| 0.0 |
0.0 |
GO:1900110 |
negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.0 |
0.6 |
GO:0031284 |
positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 |
0.1 |
GO:1903382 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 |
0.1 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.0 |
0.1 |
GO:1904158 |
axonemal central apparatus assembly(GO:1904158) |
| 0.0 |
0.1 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.0 |
0.1 |
GO:1902530 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 |
0.2 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 |
0.3 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.0 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 |
0.3 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 |
0.2 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.0 |
0.2 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 |
0.1 |
GO:0061591 |
calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 |
1.4 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.0 |
0.1 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 |
0.4 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.0 |
0.1 |
GO:2000434 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.0 |
0.7 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.2 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.0 |
0.2 |
GO:0045161 |
neuronal ion channel clustering(GO:0045161) |
| 0.0 |
0.2 |
GO:0001923 |
B-1 B cell differentiation(GO:0001923) |
| 0.0 |
0.3 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 |
0.1 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 0.0 |
0.1 |
GO:0072674 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 |
0.1 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.0 |
0.3 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.1 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.0 |
0.2 |
GO:2001295 |
malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 |
0.1 |
GO:0070305 |
response to cGMP(GO:0070305) |
| 0.0 |
0.3 |
GO:0071233 |
cellular response to leucine(GO:0071233) |
| 0.0 |
0.1 |
GO:0072719 |
cellular response to cisplatin(GO:0072719) |
| 0.0 |
0.1 |
GO:0001188 |
RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 |
0.1 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.0 |
0.2 |
GO:0043457 |
regulation of cellular respiration(GO:0043457) |
| 0.0 |
0.0 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 |
0.1 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.0 |
0.1 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.0 |
0.2 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.1 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 |
0.3 |
GO:1902661 |
positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.0 |
0.4 |
GO:0002230 |
positive regulation of defense response to virus by host(GO:0002230) |
| 0.0 |
0.1 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 |
0.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.0 |
0.0 |
GO:0050703 |
interleukin-1 alpha secretion(GO:0050703) |
| 0.0 |
0.4 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 |
0.1 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 |
0.1 |
GO:1903781 |
positive regulation of cell communication by electrical coupling(GO:0010650) positive regulation of cardiac conduction(GO:1903781) |
| 0.0 |
0.5 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.0 |
0.1 |
GO:0036049 |
protein demalonylation(GO:0036046) peptidyl-lysine demalonylation(GO:0036047) protein desuccinylation(GO:0036048) peptidyl-lysine desuccinylation(GO:0036049) protein deglutarylation(GO:0061698) peptidyl-lysine deglutarylation(GO:0061699) |
| 0.0 |
0.1 |
GO:1902304 |
positive regulation of potassium ion export(GO:1902304) |
| 0.0 |
0.1 |
GO:0046015 |
carbon catabolite regulation of transcription(GO:0045990) regulation of transcription by glucose(GO:0046015) |
| 0.0 |
0.5 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.0 |
0.9 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.0 |
GO:0014043 |
negative regulation of neuron maturation(GO:0014043) |
| 0.0 |
0.2 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.0 |
0.3 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 |
0.2 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.1 |
GO:0045041 |
protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.3 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 |
0.5 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.0 |
0.3 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 |
0.0 |
GO:0072387 |
flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 |
0.1 |
GO:0030573 |
bile acid catabolic process(GO:0030573) |
| 0.0 |
0.2 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 |
0.3 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.0 |
0.2 |
GO:0070417 |
cellular response to cold(GO:0070417) |
| 0.0 |
0.1 |
GO:0051891 |
positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 |
0.1 |
GO:0010513 |
regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.0 |
0.5 |
GO:0018146 |
keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 |
0.2 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 |
0.6 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.4 |
GO:1902571 |
regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 |
0.3 |
GO:0010917 |
negative regulation of mitochondrial membrane potential(GO:0010917) negative regulation of membrane potential(GO:0045837) |
| 0.0 |
0.1 |
GO:1900864 |
mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 |
0.5 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.0 |
0.1 |
GO:0009216 |
adenosine salvage(GO:0006169) dATP biosynthetic process(GO:0006175) deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) adenosine biosynthetic process(GO:0046086) |
| 0.0 |
0.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.0 |
0.3 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 |
0.7 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 |
0.2 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 0.0 |
0.1 |
GO:0061763 |
multivesicular body-lysosome fusion(GO:0061763) |
| 0.0 |
0.0 |
GO:0060435 |
bronchiole development(GO:0060435) |
| 0.0 |
0.2 |
GO:0035507 |
regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 |
0.4 |
GO:0048298 |
positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 |
0.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 |
0.0 |
GO:2001293 |
malonyl-CoA metabolic process(GO:2001293) |
| 0.0 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.1 |
GO:1905224 |
clathrin-coated pit assembly(GO:1905224) |
| 0.0 |
0.2 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 |
0.2 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.0 |
0.1 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.0 |
0.1 |
GO:0044205 |
'de novo' UMP biosynthetic process(GO:0044205) |
| 0.0 |
0.2 |
GO:0036302 |
atrioventricular canal development(GO:0036302) |
| 0.0 |
0.1 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.0 |
0.2 |
GO:0015780 |
nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 |
0.3 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.0 |
0.1 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 |
0.3 |
GO:0007207 |
phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 |
0.6 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.0 |
0.1 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 |
0.4 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.1 |
GO:0032972 |
regulation of muscle filament sliding speed(GO:0032972) |
| 0.0 |
0.1 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 |
0.1 |
GO:0051039 |
histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.0 |
0.1 |
GO:0032071 |
regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.0 |
0.1 |
GO:0001180 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.0 |
0.1 |
GO:1903526 |
negative regulation of membrane tubulation(GO:1903526) |
| 0.0 |
0.0 |
GO:0044209 |
AMP salvage(GO:0044209) |
| 0.0 |
0.2 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.0 |
0.1 |
GO:1904751 |
positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 |
0.1 |
GO:0000393 |
spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 |
0.1 |
GO:0019427 |
acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
| 0.0 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 |
0.1 |
GO:1901838 |
regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 |
0.1 |
GO:0048205 |
COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 |
0.1 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 |
0.3 |
GO:0032925 |
regulation of activin receptor signaling pathway(GO:0032925) |
| 0.0 |
0.3 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.0 |
0.1 |
GO:0060151 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.0 |
0.1 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.2 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 |
0.6 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 |
0.6 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.9 |
GO:0015012 |
heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 |
0.1 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.0 |
0.0 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 |
0.1 |
GO:0090219 |
negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 |
0.4 |
GO:0042554 |
superoxide anion generation(GO:0042554) |
| 0.0 |
0.4 |
GO:0000050 |
urea cycle(GO:0000050) |
| 0.0 |
0.1 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 |
0.4 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.0 |
0.9 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.0 |
0.1 |
GO:0061668 |
mitochondrial ribosome assembly(GO:0061668) |
| 0.0 |
0.1 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
0.2 |
GO:0007619 |
courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
| 0.0 |
0.1 |
GO:0033123 |
positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.0 |
0.4 |
GO:1902369 |
negative regulation of RNA catabolic process(GO:1902369) |
| 0.0 |
5.2 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.0 |
0.6 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 0.0 |
0.4 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.0 |
0.2 |
GO:0021527 |
spinal cord association neuron differentiation(GO:0021527) |
| 0.0 |
0.0 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 |
1.2 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 |
0.0 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.0 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.0 |
0.5 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 |
0.2 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.0 |
0.1 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 |
0.1 |
GO:0070352 |
positive regulation of white fat cell proliferation(GO:0070352) |
| 0.0 |
0.3 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.0 |
0.2 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.0 |
0.1 |
GO:0001555 |
oocyte growth(GO:0001555) |
| 0.0 |
0.1 |
GO:0052697 |
flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.0 |
0.1 |
GO:0060482 |
lobar bronchus development(GO:0060482) |
| 0.0 |
0.1 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.0 |
0.0 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 |
0.3 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.0 |
0.1 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.0 |
0.2 |
GO:0051969 |
regulation of transmission of nerve impulse(GO:0051969) |
| 0.0 |
0.0 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.0 |
0.1 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 |
0.0 |
GO:0042727 |
flavin-containing compound biosynthetic process(GO:0042727) |
| 0.0 |
0.5 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.0 |
GO:0090091 |
positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 |
0.2 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 |
0.0 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 |
0.7 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.0 |
0.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.1 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.0 |
1.0 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
0.0 |
GO:0002580 |
regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) |
| 0.0 |
0.2 |
GO:0090168 |
Golgi reassembly(GO:0090168) |
| 0.0 |
0.1 |
GO:0035627 |
ceramide transport(GO:0035627) |
| 0.0 |
0.1 |
GO:0010133 |
proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.0 |
0.1 |
GO:0048194 |
Golgi vesicle budding(GO:0048194) |
| 0.0 |
0.2 |
GO:0018377 |
protein myristoylation(GO:0018377) |
| 0.0 |
0.0 |
GO:0097695 |
establishment of RNA localization to telomere(GO:0097694) establishment of macromolecular complex localization to telomere(GO:0097695) |
| 0.0 |
0.1 |
GO:0090009 |
primitive streak formation(GO:0090009) |
| 0.0 |
0.3 |
GO:0090154 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 |
0.5 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 |
0.1 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 |
0.2 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 |
0.1 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.4 |
GO:0048935 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 |
0.1 |
GO:2000516 |
positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
| 0.0 |
0.0 |
GO:0097114 |
NMDA glutamate receptor clustering(GO:0097114) |
| 0.0 |
0.1 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.0 |
0.1 |
GO:0038110 |
interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 |
0.0 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) |
| 0.0 |
0.1 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 |
0.1 |
GO:0006781 |
succinyl-CoA pathway(GO:0006781) |
| 0.0 |
0.5 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.0 |
0.1 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 |
0.8 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.7 |
GO:0007340 |
acrosome reaction(GO:0007340) |
| 0.0 |
0.1 |
GO:0007097 |
nuclear migration(GO:0007097) |
| 0.0 |
0.3 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.0 |
0.1 |
GO:1905146 |
lysosomal protein catabolic process(GO:1905146) |
| 0.0 |
0.0 |
GO:0070676 |
intralumenal vesicle formation(GO:0070676) |
| 0.0 |
0.0 |
GO:0042362 |
fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.0 |
0.5 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 |
1.8 |
GO:1902476 |
chloride transmembrane transport(GO:1902476) |
| 0.0 |
0.1 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 |
0.4 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.0 |
0.2 |
GO:2001204 |
regulation of osteoclast development(GO:2001204) |
| 0.0 |
0.2 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 |
0.1 |
GO:1901656 |
glucoside transport(GO:0042946) glycoside transport(GO:1901656) |
| 0.0 |
0.3 |
GO:1904380 |
endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 |
0.2 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 |
0.3 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 |
0.1 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.0 |
0.1 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.0 |
0.2 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 |
0.3 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.1 |
GO:0040030 |
regulation of molecular function, epigenetic(GO:0040030) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0060454 |
positive regulation of gastric acid secretion(GO:0060454) |
| 0.0 |
0.2 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.0 |
0.1 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.0 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.0 |
0.1 |
GO:0090487 |
toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.0 |
0.1 |
GO:0021626 |
hindbrain maturation(GO:0021578) pons maturation(GO:0021586) central nervous system maturation(GO:0021626) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 |
0.1 |
GO:1900272 |
negative regulation of long-term synaptic potentiation(GO:1900272) |
| 0.0 |
0.1 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 |
0.1 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.0 |
0.1 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.0 |
0.7 |
GO:0006099 |
tricarboxylic acid cycle(GO:0006099) |
| 0.0 |
0.9 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
0.2 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.0 |
0.1 |
GO:0006045 |
N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.0 |
0.1 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 |
0.2 |
GO:0000479 |
endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 |
0.1 |
GO:0030472 |
mitotic spindle organization in nucleus(GO:0030472) |
| 0.0 |
0.1 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.0 |
0.0 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 |
0.7 |
GO:0008347 |
glial cell migration(GO:0008347) |
| 0.0 |
0.1 |
GO:0035246 |
peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 |
0.0 |
GO:0070245 |
positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 |
0.1 |
GO:0002681 |
somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.0 |
0.1 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 |
0.0 |
GO:0072757 |
cellular response to camptothecin(GO:0072757) |
| 0.0 |
0.1 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.0 |
0.1 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.0 |
0.2 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.0 |
1.3 |
GO:0031295 |
T cell costimulation(GO:0031295) |
| 0.0 |
0.1 |
GO:1990167 |
protein K27-linked deubiquitination(GO:1990167) |
| 0.0 |
0.1 |
GO:0099640 |
axo-dendritic protein transport(GO:0099640) |
| 0.0 |
0.2 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.2 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.0 |
0.0 |
GO:0043474 |
eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.0 |
0.1 |
GO:1900264 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 |
0.1 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.0 |
0.1 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 |
0.3 |
GO:0097034 |
mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.0 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.0 |
0.1 |
GO:0042986 |
positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.0 |
0.2 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.0 |
0.0 |
GO:0010609 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 |
0.1 |
GO:0034398 |
telomere tethering at nuclear periphery(GO:0034398) |
| 0.0 |
0.1 |
GO:0006064 |
glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.0 |
0.0 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 |
0.0 |
GO:0003064 |
regulation of heart rate by hormone(GO:0003064) |
| 0.0 |
0.1 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.0 |
0.1 |
GO:0090494 |
dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.0 |
0.0 |
GO:0000117 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 |
0.1 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 |
0.1 |
GO:0043031 |
negative regulation of macrophage activation(GO:0043031) |
| 0.0 |
0.1 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.0 |
0.0 |
GO:1900239 |
phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 |
0.4 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.0 |
0.0 |
GO:0006710 |
androgen catabolic process(GO:0006710) |
| 0.0 |
0.0 |
GO:0031247 |
actin rod assembly(GO:0031247) |
| 0.0 |
0.2 |
GO:0040023 |
establishment of nucleus localization(GO:0040023) |
| 0.0 |
0.0 |
GO:2000437 |
regulation of monocyte extravasation(GO:2000437) positive regulation of monocyte extravasation(GO:2000439) |
| 0.0 |
0.1 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 |
0.0 |
GO:0001820 |
serotonin secretion(GO:0001820) |
| 0.0 |
0.0 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 |
0.1 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 |
0.0 |
GO:1990164 |
histone H2A phosphorylation(GO:1990164) |
| 0.0 |
0.1 |
GO:0018243 |
protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 |
0.1 |
GO:0002675 |
positive regulation of acute inflammatory response(GO:0002675) |
| 0.0 |
0.0 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.0 |
0.0 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 |
0.0 |
GO:0097051 |
establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 |
0.1 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.0 |
0.1 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.0 |
0.1 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.0 |
GO:0051142 |
regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 |
0.4 |
GO:0042417 |
dopamine metabolic process(GO:0042417) |
| 0.0 |
0.0 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 |
0.1 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 |
0.1 |
GO:0050711 |
negative regulation of interleukin-1 secretion(GO:0050711) negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.0 |
0.0 |
GO:0021557 |
oculomotor nerve development(GO:0021557) |
| 0.0 |
0.0 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.0 |
0.4 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.2 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.0 |
0.0 |
GO:1905063 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) |
| 0.0 |
0.1 |
GO:0038169 |
somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 |
0.0 |
GO:0043634 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.0 |
0.0 |
GO:0086036 |
regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.0 |
0.0 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.0 |
0.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.0 |
0.1 |
GO:1901621 |
negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 |
0.0 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.0 |
0.0 |
GO:0003228 |
atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 |
0.4 |
GO:0006656 |
phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 |
0.1 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.0 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.0 |
0.1 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 |
0.0 |
GO:0018874 |
benzoate metabolic process(GO:0018874) |
| 0.0 |
0.2 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.1 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 |
0.0 |
GO:1904044 |
response to aldosterone(GO:1904044) |
| 0.0 |
0.0 |
GO:0045715 |
negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.0 |
0.1 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 |
0.2 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.0 |
0.0 |
GO:0021830 |
interneuron migration from the subpallium to the cortex(GO:0021830) |
| 0.0 |
0.0 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 |
0.0 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 |
0.1 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 |
0.0 |
GO:0072114 |
regulation of pronephros size(GO:0035565) pronephros morphogenesis(GO:0072114) |
| 0.0 |
0.0 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.0 |
0.0 |
GO:0018201 |
N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) peptidyl-glycine modification(GO:0018201) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 |
0.0 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.0 |
0.1 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.0 |
0.1 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.0 |
GO:0002911 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 |
0.1 |
GO:1902224 |
ketone body metabolic process(GO:1902224) |
| 0.0 |
0.0 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.0 |
0.1 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 |
0.0 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.0 |
0.0 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.0 |
0.1 |
GO:2000291 |
regulation of myoblast proliferation(GO:2000291) |
| 0.0 |
0.0 |
GO:0009441 |
glycolate metabolic process(GO:0009441) |
| 0.0 |
0.1 |
GO:0002091 |
negative regulation of receptor internalization(GO:0002091) |
| 0.0 |
0.1 |
GO:0019805 |
quinolinate biosynthetic process(GO:0019805) |
| 0.0 |
0.0 |
GO:1900226 |
negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.0 |
0.0 |
GO:0002118 |
aggressive behavior(GO:0002118) |
| 0.0 |
0.1 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 |
0.0 |
GO:0070681 |
glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 |
0.0 |
GO:0010874 |
regulation of cholesterol efflux(GO:0010874) |
| 0.0 |
0.1 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 |
0.1 |
GO:0060669 |
embryonic placenta morphogenesis(GO:0060669) |
| 0.0 |
0.0 |
GO:1903587 |
regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 |
0.0 |
GO:0048148 |
behavioral response to cocaine(GO:0048148) |
| 0.0 |
0.1 |
GO:0009304 |
tRNA transcription(GO:0009304) |
