Project
avrg: Epithelial-Mesenchymal Transition, human (Scheel, 2011)
Navigation
Downloads
Results for ZBTB6
Z-value: 2.65
Motif logo
Transcription factors associated with ZBTB6
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZBTB6
|
ENSG00000186130.5 | zinc finger and BTB domain containing 6 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZBTB6 | hg38_v1_chr9_-_122913299_122913333 | -0.37 | 3.6e-01 | Click! |
Activity profile of ZBTB6 motif
Sorted Z-values of ZBTB6 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of ZBTB6
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 4.8 | GO:0051710 | cytolysis by symbiont of host cells(GO:0001897) regulation of cytolysis in other organism(GO:0051710) |
| 1.0 | 3.1 | GO:1905006 | negative regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905006) |
| 0.8 | 2.4 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.7 | 2.7 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.6 | 0.6 | GO:0060066 | oviduct development(GO:0060066) |
| 0.5 | 2.0 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.5 | 1.4 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.4 | 1.8 | GO:0048627 | myoblast development(GO:0048627) |
| 0.4 | 3.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.4 | 1.2 | GO:0071284 | establishment of blood-nerve barrier(GO:0008065) cellular response to lead ion(GO:0071284) positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.3 | 0.9 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.3 | 0.8 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.3 | 1.6 | GO:0070778 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.2 | 0.7 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 | 0.8 | GO:0042335 | cuticle development(GO:0042335) |
| 0.2 | 1.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 | 0.7 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 | 0.5 | GO:0034148 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.2 | 6.3 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.2 | 0.5 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.2 | 1.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.2 | 0.5 | GO:0099538 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.1 | 0.7 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 0.4 | GO:0019542 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
| 0.1 | 0.8 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 2.0 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.5 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 3.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.5 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 | 0.6 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 0.1 | 0.4 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 | 0.4 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 1.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.6 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 1.4 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.4 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.7 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.6 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.1 | 0.5 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.3 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.1 | 0.3 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 1.1 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.1 | 0.6 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.6 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 0.4 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.2 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.1 | 4.9 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.3 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.6 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
| 0.1 | 1.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 1.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.2 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.1 | 0.2 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.3 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.1 | 0.3 | GO:0015692 | lead ion transport(GO:0015692) |
| 0.1 | 0.3 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.7 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.3 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.1 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.2 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.0 | 0.1 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.4 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.1 | GO:0035732 | nitric oxide storage(GO:0035732) |
| 0.0 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0006532 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
| 0.0 | 0.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.0 | 0.4 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.5 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.3 | GO:0035989 | tendon development(GO:0035989) |
| 0.0 | 0.1 | GO:0036048 | protein demalonylation(GO:0036046) peptidyl-lysine demalonylation(GO:0036047) protein desuccinylation(GO:0036048) peptidyl-lysine desuccinylation(GO:0036049) protein deglutarylation(GO:0061698) peptidyl-lysine deglutarylation(GO:0061699) |
| 0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.4 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.5 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.1 | GO:2000974 | auditory receptor cell fate determination(GO:0042668) negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.0 | 0.2 | GO:0032903 | viral protein processing(GO:0019082) negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.0 | 0.3 | GO:1903912 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.2 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.0 | 0.6 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.6 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.0 | 0.3 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
| 0.0 | 0.4 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.2 | GO:0050917 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.1 | GO:0048560 | establishment of anatomical structure orientation(GO:0048560) |
| 0.0 | 0.4 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.0 | 1.8 | GO:0045104 | intermediate filament cytoskeleton organization(GO:0045104) |
| 0.0 | 0.2 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 | 0.1 | GO:0035048 | splicing factor protein import into nucleus(GO:0035048) |
| 0.0 | 0.3 | GO:0009407 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.0 | 0.1 | GO:0032759 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.0 | 0.1 | GO:1903971 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.0 | 0.2 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.0 | 0.3 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.7 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.1 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.0 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.7 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.1 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.2 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.0 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.2 | GO:1900107 | embryonic hindgut morphogenesis(GO:0048619) regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.1 | GO:0042414 | phthalate metabolic process(GO:0018963) epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) phytoalexin metabolic process(GO:0052314) |
| 0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.6 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 | 0.1 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.0 | 0.5 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.0 | 0.1 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.0 | 0.4 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.1 | GO:0005999 | xylulose biosynthetic process(GO:0005999) |
| 0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.2 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.2 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.0 | 0.1 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.4 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.0 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0033967 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.1 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.0 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.0 | 0.1 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 1.9 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.3 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 1.8 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.4 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.1 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.9 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.0 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.0 | 0.2 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.0 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) histone H3-R2 methylation(GO:0034970) |
| 0.0 | 0.2 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.1 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.0 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) positive regulation of tooth mineralization(GO:0070172) |
| 0.0 | 0.5 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.8 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.0 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.4 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.6 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.3 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.0 | GO:1901388 | regulation of transforming growth factor beta activation(GO:1901388) negative regulation of transforming growth factor beta activation(GO:1901389) |
| 0.0 | 0.2 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 17.7 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.6 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.9 | GO:0098560 | cytoplasmic side of early endosome membrane(GO:0098559) cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 0.3 | GO:0005592 | collagen type XI trimer(GO:0005592) |
| 0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.1 | 0.3 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.3 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.7 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.3 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.2 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.0 | 0.1 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.0 | 0.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 1.1 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.6 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 1.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.0 | 0.3 | GO:0005816 | spindle pole body(GO:0005816) |
| 0.0 | 0.6 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 1.0 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.3 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 3.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.7 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 1.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.0 | 1.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.4 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 2.9 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.1 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.0 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.1 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.0 | GO:1990913 | sperm head plasma membrane(GO:1990913) ooplasm(GO:1990917) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.3 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.3 | 1.0 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.3 | 1.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.3 | 1.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 4.9 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.2 | 1.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 0.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.2 | 1.0 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.2 | 0.5 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.1 | 2.4 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 1.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.4 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 1.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.1 | 0.3 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.1 | 2.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 1.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.6 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.3 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.1 | 0.5 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.1 | 0.4 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 0.6 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.1 | 1.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.3 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 0.8 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.3 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 1.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 2.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 0.2 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 15.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.1 | 0.9 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 1.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.8 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 2.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.8 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 0.2 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 2.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.3 | GO:0015087 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.1 | 1.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.6 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.1 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.7 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.3 | GO:0045174 | glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.4 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.2 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.0 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.0 | 0.3 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.1 | GO:0035730 | S-nitrosoglutathione binding(GO:0035730) dinitrosyl-iron complex binding(GO:0035731) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.1 | GO:0061697 | protein-malonyllysine demalonylase activity(GO:0036054) protein-succinyllysine desuccinylase activity(GO:0036055) protein-glutaryllysine deglutarylase activity(GO:0061697) |
| 0.0 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 1.2 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.2 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.8 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.2 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 0.0 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.0 | 0.5 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 2.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 1.1 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.4 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.1 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.1 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.0 | 0.1 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 1.0 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.3 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.7 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.0 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.1 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 1.6 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.0 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.8 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 4.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 4.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 1.8 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 1.3 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.8 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 5.2 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 2.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.8 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.8 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.2 | ST GAQ PATHWAY | G alpha q Pathway |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.4 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 5.4 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 2.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 0.8 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 1.7 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 2.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.4 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 1.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 4.8 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.5 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 1.2 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.8 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.6 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 3.0 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |