| 3.7 |
18.3 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 3.7 |
3.7 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 2.2 |
8.8 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 2.2 |
2.2 |
GO:0010039 |
response to iron ion(GO:0010039) |
| 2.1 |
68.8 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 2.0 |
6.0 |
GO:1903410 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 1.8 |
7.3 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 1.8 |
9.1 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.8 |
5.4 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 1.8 |
1.8 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.8 |
5.3 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.7 |
18.8 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 1.7 |
3.3 |
GO:0035407 |
histone H3-T11 phosphorylation(GO:0035407) |
| 1.6 |
6.4 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 1.6 |
8.0 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.6 |
4.8 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 1.5 |
3.1 |
GO:0034144 |
negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 1.5 |
7.6 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.4 |
4.2 |
GO:0035283 |
rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.4 |
5.4 |
GO:2000820 |
negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 1.3 |
4.0 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.3 |
9.4 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 1.3 |
1.3 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 1.3 |
3.9 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 1.3 |
3.8 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.3 |
3.8 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 1.2 |
3.7 |
GO:1905072 |
apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 1.2 |
4.9 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 1.2 |
6.0 |
GO:1901090 |
regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 1.2 |
11.9 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 1.2 |
1.2 |
GO:2000017 |
positive regulation of determination of dorsal identity(GO:2000017) |
| 1.2 |
9.3 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 1.2 |
4.7 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.2 |
4.7 |
GO:0009447 |
putrescine catabolic process(GO:0009447) |
| 1.2 |
9.3 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 1.2 |
3.5 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 1.2 |
4.6 |
GO:0021502 |
neural fold elevation formation(GO:0021502) nephrogenic mesenchyme morphogenesis(GO:0072134) allantois development(GO:1905069) |
| 1.1 |
10.3 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 1.1 |
3.4 |
GO:0021919 |
BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 1.1 |
2.3 |
GO:0007227 |
signal transduction downstream of smoothened(GO:0007227) |
| 1.1 |
3.3 |
GO:0006174 |
dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 1.1 |
51.9 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 1.0 |
3.1 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 1.0 |
4.1 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 1.0 |
3.0 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 1.0 |
3.0 |
GO:0042351 |
'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 1.0 |
3.0 |
GO:0070602 |
regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 1.0 |
3.0 |
GO:0003147 |
neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 1.0 |
2.9 |
GO:0002023 |
reduction of food intake in response to dietary excess(GO:0002023) |
| 1.0 |
2.9 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 1.0 |
12.4 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.9 |
2.8 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.9 |
2.8 |
GO:0072229 |
proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.9 |
2.7 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.9 |
6.2 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.9 |
3.5 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.9 |
2.7 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.9 |
2.6 |
GO:1903568 |
negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.9 |
7.9 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.9 |
0.9 |
GO:0046640 |
regulation of alpha-beta T cell proliferation(GO:0046640) |
| 0.9 |
6.0 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.9 |
7.8 |
GO:0002414 |
immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.9 |
3.4 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.9 |
2.6 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.9 |
3.4 |
GO:1901074 |
regulation of engulfment of apoptotic cell(GO:1901074) |
| 0.9 |
4.3 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.9 |
2.6 |
GO:0015729 |
thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.8 |
7.5 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.8 |
3.3 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.8 |
0.8 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.8 |
2.5 |
GO:1903860 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.8 |
7.4 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.8 |
4.0 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.8 |
12.0 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.8 |
2.4 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.8 |
3.2 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.8 |
3.2 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.8 |
2.4 |
GO:0061188 |
negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.8 |
3.9 |
GO:0090202 |
transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.8 |
3.1 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.8 |
6.1 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.8 |
2.3 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.8 |
14.3 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.8 |
12.1 |
GO:0060452 |
positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.8 |
10.5 |
GO:0060180 |
female mating behavior(GO:0060180) |
| 0.7 |
0.7 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.7 |
1.5 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.7 |
4.4 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.7 |
2.9 |
GO:0035521 |
monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.7 |
9.4 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.7 |
2.2 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.7 |
2.2 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.7 |
2.1 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 0.7 |
5.0 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.7 |
8.4 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.7 |
4.9 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.7 |
2.1 |
GO:0006864 |
pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.7 |
2.8 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.7 |
2.1 |
GO:1902303 |
negative regulation of potassium ion export(GO:1902303) |
| 0.7 |
2.7 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.7 |
0.7 |
GO:2000118 |
regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.7 |
0.7 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.7 |
2.0 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.7 |
2.0 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.7 |
2.6 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.7 |
2.0 |
GO:0043602 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.7 |
2.6 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.6 |
1.9 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.6 |
2.6 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.6 |
5.1 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.6 |
1.9 |
GO:0048505 |
regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.6 |
8.3 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.6 |
1.9 |
GO:1904882 |
telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.6 |
3.2 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 0.6 |
1.9 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.6 |
0.6 |
GO:0034163 |
regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.6 |
2.5 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.6 |
5.6 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.6 |
1.9 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.6 |
1.9 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.6 |
3.1 |
GO:0071500 |
cellular response to nitrosative stress(GO:0071500) |
| 0.6 |
0.6 |
GO:0032570 |
response to progesterone(GO:0032570) |
| 0.6 |
6.7 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.6 |
3.0 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.6 |
1.2 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.6 |
2.4 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.6 |
3.6 |
GO:1902998 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.6 |
2.4 |
GO:0043324 |
eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.6 |
8.3 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.6 |
3.0 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.6 |
1.8 |
GO:0018312 |
peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.6 |
1.2 |
GO:0060152 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.6 |
2.4 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.6 |
5.3 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.6 |
0.6 |
GO:0071106 |
coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.6 |
2.8 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.6 |
3.4 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.6 |
0.6 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.6 |
2.8 |
GO:2001076 |
regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.5 |
2.2 |
GO:0046452 |
dihydrofolate metabolic process(GO:0046452) |
| 0.5 |
0.5 |
GO:0006325 |
chromatin organization(GO:0006325) |
| 0.5 |
1.6 |
GO:1904048 |
regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.5 |
0.5 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.5 |
3.8 |
GO:0045629 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.5 |
2.2 |
GO:0002503 |
peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.5 |
2.7 |
GO:0033685 |
negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.5 |
3.2 |
GO:1990822 |
basic amino acid transmembrane transport(GO:1990822) |
| 0.5 |
1.6 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.5 |
3.2 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.5 |
5.8 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.5 |
3.1 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.5 |
1.6 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.5 |
1.6 |
GO:0090310 |
negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.5 |
4.1 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.5 |
4.6 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.5 |
1.0 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.5 |
1.0 |
GO:1903052 |
positive regulation of proteolysis involved in cellular protein catabolic process(GO:1903052) |
| 0.5 |
3.0 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.5 |
2.0 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.5 |
1.5 |
GO:2001160 |
histone H3-K79 methylation(GO:0034729) regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.5 |
5.0 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.5 |
0.5 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.5 |
3.0 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.5 |
3.0 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.5 |
1.5 |
GO:0019056 |
modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.5 |
4.9 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.5 |
0.5 |
GO:2000078 |
positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.5 |
1.0 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.5 |
4.3 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.5 |
0.5 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.5 |
1.9 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.5 |
1.4 |
GO:0045082 |
positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.5 |
1.9 |
GO:0070426 |
positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.5 |
1.4 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.5 |
1.4 |
GO:0010641 |
positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.5 |
0.9 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.5 |
1.4 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.5 |
1.4 |
GO:0021966 |
corticospinal neuron axon guidance(GO:0021966) |
| 0.5 |
1.9 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.5 |
1.4 |
GO:0003095 |
pressure natriuresis(GO:0003095) |
| 0.5 |
1.4 |
GO:0032203 |
telomere formation via telomerase(GO:0032203) |
| 0.5 |
0.9 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.5 |
0.5 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.5 |
9.1 |
GO:0019614 |
catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.5 |
1.8 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.5 |
0.5 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.5 |
3.6 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.5 |
0.9 |
GO:1990164 |
histone H2A phosphorylation(GO:1990164) |
| 0.4 |
2.7 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.4 |
0.9 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 |
1.3 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.4 |
1.8 |
GO:0021781 |
glial cell fate commitment(GO:0021781) |
| 0.4 |
1.8 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.4 |
3.1 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.4 |
1.3 |
GO:0046056 |
dADP metabolic process(GO:0046056) |
| 0.4 |
2.7 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 |
2.7 |
GO:1904381 |
Golgi apparatus mannose trimming(GO:1904381) |
| 0.4 |
5.3 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.4 |
2.2 |
GO:1900920 |
regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.4 |
6.6 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.4 |
3.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.4 |
10.5 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.4 |
2.2 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.4 |
1.7 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.4 |
2.6 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.4 |
18.1 |
GO:0042073 |
intraciliary transport(GO:0042073) |
| 0.4 |
1.3 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.4 |
1.7 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.4 |
1.3 |
GO:0006844 |
acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.4 |
4.2 |
GO:0045054 |
constitutive secretory pathway(GO:0045054) |
| 0.4 |
3.4 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 |
1.3 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.4 |
1.7 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.4 |
0.8 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.4 |
3.3 |
GO:0090240 |
positive regulation of histone H4 acetylation(GO:0090240) |
| 0.4 |
0.8 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 |
0.4 |
GO:0038183 |
bile acid signaling pathway(GO:0038183) |
| 0.4 |
5.8 |
GO:0035864 |
response to potassium ion(GO:0035864) |
| 0.4 |
4.5 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.4 |
0.4 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.4 |
5.7 |
GO:0006054 |
N-acetylneuraminate metabolic process(GO:0006054) |
| 0.4 |
0.4 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.4 |
0.8 |
GO:1902725 |
negative regulation of satellite cell differentiation(GO:1902725) |
| 0.4 |
4.5 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.4 |
1.6 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.4 |
0.4 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.4 |
3.2 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.4 |
0.8 |
GO:0060406 |
positive regulation of penile erection(GO:0060406) |
| 0.4 |
1.6 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.4 |
9.2 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.4 |
1.6 |
GO:0090299 |
regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.4 |
2.0 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.4 |
1.2 |
GO:1900114 |
positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.4 |
0.4 |
GO:0040020 |
regulation of meiotic nuclear division(GO:0040020) |
| 0.4 |
0.8 |
GO:1902047 |
polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.4 |
1.6 |
GO:0006391 |
transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.4 |
2.8 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.4 |
0.8 |
GO:0045074 |
interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.4 |
1.2 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.4 |
1.2 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.4 |
1.2 |
GO:0007057 |
spindle assembly involved in female meiosis I(GO:0007057) |
| 0.4 |
4.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.4 |
2.7 |
GO:0030917 |
midbrain-hindbrain boundary development(GO:0030917) |
| 0.4 |
5.8 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.4 |
1.5 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.4 |
0.4 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.4 |
3.4 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.4 |
5.3 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.4 |
1.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.4 |
1.1 |
GO:0097195 |
pilomotor reflex(GO:0097195) |
| 0.4 |
1.1 |
GO:1904617 |
negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.4 |
0.7 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.4 |
1.9 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.4 |
1.1 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.4 |
3.0 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.4 |
1.8 |
GO:0019075 |
virus maturation(GO:0019075) |
| 0.4 |
2.2 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.4 |
2.2 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.4 |
0.7 |
GO:2000364 |
regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.4 |
4.4 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.4 |
1.1 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.4 |
0.7 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.4 |
1.1 |
GO:0097156 |
fasciculation of motor neuron axon(GO:0097156) |
| 0.4 |
0.4 |
GO:0071874 |
response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.4 |
1.1 |
GO:1900039 |
positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.4 |
0.7 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.4 |
2.5 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.4 |
0.7 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.4 |
1.8 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.4 |
1.4 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.4 |
6.0 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
2.5 |
GO:0045007 |
depurination(GO:0045007) |
| 0.4 |
1.8 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.4 |
1.1 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.4 |
4.2 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.3 |
2.4 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.3 |
1.7 |
GO:0051167 |
glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.3 |
1.4 |
GO:0002691 |
regulation of cellular extravasation(GO:0002691) |
| 0.3 |
2.1 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 |
1.4 |
GO:0033591 |
response to L-ascorbic acid(GO:0033591) |
| 0.3 |
2.7 |
GO:0048477 |
oogenesis(GO:0048477) |
| 0.3 |
7.5 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.3 |
1.4 |
GO:0030037 |
actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 |
1.0 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.3 |
0.3 |
GO:0071421 |
manganese ion transmembrane transport(GO:0071421) |
| 0.3 |
0.3 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.3 |
2.0 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.3 |
3.4 |
GO:1904779 |
regulation of protein localization to centrosome(GO:1904779) |
| 0.3 |
1.4 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) |
| 0.3 |
5.7 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.3 |
10.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.3 |
1.0 |
GO:0060449 |
bud elongation involved in lung branching(GO:0060449) |
| 0.3 |
1.7 |
GO:0090669 |
telomerase RNA stabilization(GO:0090669) |
| 0.3 |
1.0 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.3 |
3.4 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.3 |
0.7 |
GO:1900369 |
negative regulation of RNA interference(GO:1900369) |
| 0.3 |
1.3 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.3 |
2.3 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.3 |
1.7 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.3 |
1.0 |
GO:0070103 |
regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.3 |
1.0 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.3 |
2.0 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.3 |
2.3 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.3 |
0.3 |
GO:1903939 |
regulation of TORC2 signaling(GO:1903939) |
| 0.3 |
0.7 |
GO:0014063 |
regulation of serotonin secretion(GO:0014062) negative regulation of serotonin secretion(GO:0014063) |
| 0.3 |
1.3 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.3 |
1.3 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.3 |
6.5 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.3 |
1.0 |
GO:0042727 |
flavin-containing compound biosynthetic process(GO:0042727) |
| 0.3 |
5.2 |
GO:0090360 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.3 |
0.6 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.3 |
2.6 |
GO:1903441 |
protein localization to ciliary membrane(GO:1903441) |
| 0.3 |
3.8 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.3 |
1.0 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.3 |
0.3 |
GO:0060769 |
positive regulation of epithelial cell proliferation involved in prostate gland development(GO:0060769) |
| 0.3 |
0.3 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.3 |
0.3 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.3 |
6.6 |
GO:0010248 |
establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.3 |
1.6 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 |
0.3 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.3 |
0.9 |
GO:0051097 |
negative regulation of helicase activity(GO:0051097) |
| 0.3 |
1.9 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.3 |
1.9 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.3 |
0.6 |
GO:0003011 |
involuntary skeletal muscle contraction(GO:0003011) |
| 0.3 |
0.3 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.3 |
0.9 |
GO:0014858 |
positive regulation of skeletal muscle cell proliferation(GO:0014858) |
| 0.3 |
0.3 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.3 |
1.5 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.3 |
0.3 |
GO:0070839 |
divalent metal ion export(GO:0070839) |
| 0.3 |
0.9 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.3 |
0.3 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.3 |
2.8 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.3 |
4.3 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.3 |
6.7 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.3 |
1.8 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.3 |
0.3 |
GO:0072156 |
distal tubule morphogenesis(GO:0072156) |
| 0.3 |
0.3 |
GO:0021896 |
forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.3 |
0.9 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.3 |
1.2 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
2.1 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.3 |
0.3 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.3 |
0.9 |
GO:0046167 |
glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.3 |
6.5 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.3 |
0.6 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.3 |
0.9 |
GO:2000564 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.3 |
0.9 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.3 |
5.9 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.3 |
0.6 |
GO:0003186 |
tricuspid valve morphogenesis(GO:0003186) |
| 0.3 |
0.6 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.3 |
0.3 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.3 |
16.1 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.3 |
0.9 |
GO:0007497 |
posterior midgut development(GO:0007497) |
| 0.3 |
1.7 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.3 |
0.6 |
GO:0032304 |
negative regulation of icosanoid secretion(GO:0032304) negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.3 |
1.2 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.3 |
0.3 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.3 |
0.9 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.3 |
0.6 |
GO:0035902 |
response to immobilization stress(GO:0035902) |
| 0.3 |
0.6 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.3 |
1.7 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.3 |
1.4 |
GO:0010918 |
positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.3 |
0.9 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.3 |
2.6 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 |
0.8 |
GO:0097178 |
ruffle assembly(GO:0097178) |
| 0.3 |
0.3 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.3 |
0.6 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.3 |
1.1 |
GO:0051970 |
negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 |
0.6 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.3 |
1.7 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.3 |
0.8 |
GO:0015870 |
acetylcholine transport(GO:0015870) |
| 0.3 |
0.3 |
GO:0003192 |
mitral valve formation(GO:0003192) |
| 0.3 |
0.3 |
GO:0019046 |
release from viral latency(GO:0019046) |
| 0.3 |
1.7 |
GO:0070944 |
neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.3 |
2.5 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.3 |
0.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.3 |
1.1 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.3 |
2.2 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.3 |
0.8 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.3 |
4.4 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.3 |
0.8 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 |
0.5 |
GO:0098937 |
dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.3 |
0.5 |
GO:0030505 |
inorganic diphosphate transport(GO:0030505) |
| 0.3 |
15.7 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.3 |
3.8 |
GO:0021694 |
cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.3 |
0.8 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.3 |
0.8 |
GO:0070902 |
mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.3 |
6.7 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.3 |
1.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 |
0.5 |
GO:0003402 |
planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.3 |
0.3 |
GO:0018894 |
dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.3 |
2.9 |
GO:0052805 |
histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.3 |
1.3 |
GO:0045955 |
negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.3 |
0.3 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.3 |
5.3 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.3 |
0.3 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) regulation by virus of viral protein levels in host cell(GO:0046719) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.3 |
0.8 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.3 |
0.5 |
GO:0006678 |
glucosylceramide metabolic process(GO:0006678) |
| 0.3 |
0.8 |
GO:0045829 |
negative regulation of isotype switching(GO:0045829) |
| 0.3 |
0.5 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.3 |
0.8 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 0.3 |
3.1 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.3 |
0.3 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.3 |
8.0 |
GO:0032007 |
negative regulation of TOR signaling(GO:0032007) |
| 0.3 |
1.0 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.3 |
1.8 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.3 |
5.9 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.3 |
1.3 |
GO:0072396 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.3 |
11.8 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.3 |
2.3 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.3 |
0.8 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.3 |
0.8 |
GO:0006188 |
IMP biosynthetic process(GO:0006188) |
| 0.3 |
0.5 |
GO:1902723 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.3 |
0.5 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.3 |
2.0 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.3 |
0.5 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.3 |
1.8 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.3 |
2.3 |
GO:0003374 |
dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.2 |
4.0 |
GO:2000757 |
negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.2 |
0.7 |
GO:0033214 |
iron assimilation(GO:0033212) iron assimilation by chelation and transport(GO:0033214) positive regulation of bone mineralization involved in bone maturation(GO:1900159) negative regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000308) |
| 0.2 |
0.7 |
GO:0038193 |
thromboxane A2 signaling pathway(GO:0038193) |
| 0.2 |
0.5 |
GO:2000374 |
regulation of oxygen metabolic process(GO:2000374) |
| 0.2 |
1.7 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.2 |
1.0 |
GO:2000143 |
negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.2 |
2.7 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.2 |
1.7 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.2 |
7.4 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.2 |
0.7 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 |
2.7 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.2 |
1.0 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.2 |
1.9 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.2 |
2.7 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.2 |
0.2 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.2 |
1.0 |
GO:1901836 |
regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.2 |
1.0 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.2 |
0.7 |
GO:0051311 |
meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.2 |
0.7 |
GO:1904106 |
protein localization to microvillus(GO:1904106) |
| 0.2 |
0.9 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.2 |
2.1 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.2 |
0.5 |
GO:0070781 |
response to biotin(GO:0070781) |
| 0.2 |
1.4 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
0.5 |
GO:1902617 |
response to fluoride(GO:1902617) |
| 0.2 |
0.7 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 |
9.7 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 |
0.9 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.2 |
1.1 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
0.7 |
GO:0093001 |
glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.2 |
0.5 |
GO:0010956 |
negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.2 |
1.6 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.2 |
0.2 |
GO:0034059 |
response to anoxia(GO:0034059) |
| 0.2 |
0.7 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.2 |
1.6 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 |
2.0 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 |
0.5 |
GO:0034728 |
nucleosome organization(GO:0034728) |
| 0.2 |
0.5 |
GO:0090080 |
positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.2 |
2.3 |
GO:0031054 |
pre-miRNA processing(GO:0031054) |
| 0.2 |
0.5 |
GO:1903413 |
cellular response to bile acid(GO:1903413) |
| 0.2 |
0.4 |
GO:0018216 |
peptidyl-arginine methylation(GO:0018216) |
| 0.2 |
0.2 |
GO:0035912 |
dorsal aorta morphogenesis(GO:0035912) |
| 0.2 |
0.2 |
GO:0021650 |
vestibulocochlear nerve formation(GO:0021650) |
| 0.2 |
0.2 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.2 |
3.6 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.2 |
0.4 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.2 |
1.3 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.2 |
0.2 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.2 |
0.2 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.2 |
1.8 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.2 |
0.7 |
GO:0044691 |
tooth eruption(GO:0044691) |
| 0.2 |
1.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.2 |
1.5 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 |
5.3 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.2 |
0.7 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.2 |
8.0 |
GO:0060271 |
cilium morphogenesis(GO:0060271) |
| 0.2 |
3.5 |
GO:1900046 |
regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.2 |
3.2 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.2 |
1.3 |
GO:2000568 |
memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.2 |
3.2 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.2 |
0.4 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.2 |
1.9 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.2 |
0.8 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
2.5 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.2 |
0.2 |
GO:0072038 |
mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.2 |
2.5 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 |
0.4 |
GO:0038162 |
erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.2 |
0.4 |
GO:0002215 |
defense response to nematode(GO:0002215) |
| 0.2 |
1.3 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 |
1.9 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.2 |
3.1 |
GO:0045008 |
depyrimidination(GO:0045008) |
| 0.2 |
0.2 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.2 |
1.2 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.2 |
1.0 |
GO:0019377 |
glycolipid catabolic process(GO:0019377) |
| 0.2 |
0.6 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 0.2 |
0.6 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.2 |
2.3 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.2 |
4.7 |
GO:0050655 |
dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.2 |
0.4 |
GO:1900113 |
negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 |
0.8 |
GO:0019042 |
viral latency(GO:0019042) |
| 0.2 |
0.6 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.2 |
0.4 |
GO:0060931 |
sinoatrial node cell development(GO:0060931) |
| 0.2 |
1.0 |
GO:1904977 |
lymphatic endothelial cell migration(GO:1904977) |
| 0.2 |
0.4 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.2 |
1.4 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 |
0.8 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.2 |
0.4 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 |
1.8 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 |
0.8 |
GO:0007569 |
cell aging(GO:0007569) |
| 0.2 |
1.0 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
| 0.2 |
0.4 |
GO:0090034 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.2 |
0.4 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.2 |
0.6 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.2 |
0.8 |
GO:0015891 |
iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.2 |
0.6 |
GO:0046839 |
phospholipid dephosphorylation(GO:0046839) |
| 0.2 |
0.8 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.2 |
1.4 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.2 |
1.2 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
1.0 |
GO:0002829 |
negative regulation of type 2 immune response(GO:0002829) |
| 0.2 |
0.6 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.2 |
1.4 |
GO:0033183 |
negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 |
0.2 |
GO:0042713 |
sperm ejaculation(GO:0042713) |
| 0.2 |
0.8 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.2 |
0.6 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 |
0.6 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 0.2 |
2.5 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 0.2 |
3.9 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.2 |
0.6 |
GO:0000354 |
cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.2 |
0.8 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.2 |
1.5 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 |
0.8 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.2 |
1.2 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 |
0.6 |
GO:1900454 |
positive regulation of long term synaptic depression(GO:1900454) |
| 0.2 |
1.9 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.2 |
0.6 |
GO:1904247 |
positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 |
2.3 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.2 |
1.9 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) |
| 0.2 |
0.8 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.2 |
3.0 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.2 |
0.9 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 |
3.4 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.2 |
1.5 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.2 |
0.4 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 |
0.7 |
GO:0006542 |
glutamine biosynthetic process(GO:0006542) |
| 0.2 |
2.4 |
GO:0060412 |
ventricular septum morphogenesis(GO:0060412) |
| 0.2 |
1.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.2 |
2.0 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.2 |
0.7 |
GO:0045023 |
G0 to G1 transition(GO:0045023) |
| 0.2 |
0.5 |
GO:0060168 |
positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.2 |
1.5 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 |
2.2 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.2 |
0.4 |
GO:0003174 |
mitral valve development(GO:0003174) |
| 0.2 |
2.2 |
GO:0015886 |
heme transport(GO:0015886) iron coordination entity transport(GO:1901678) |
| 0.2 |
0.2 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 |
10.7 |
GO:0014047 |
glutamate secretion(GO:0014047) |
| 0.2 |
0.4 |
GO:2000109 |
regulation of macrophage apoptotic process(GO:2000109) |
| 0.2 |
0.2 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.2 |
0.5 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.2 |
1.8 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.2 |
0.7 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 |
0.2 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.2 |
1.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.2 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 |
1.8 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.2 |
0.9 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.2 |
1.8 |
GO:0048557 |
embryonic digestive tract morphogenesis(GO:0048557) |
| 0.2 |
1.1 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.2 |
2.3 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.2 |
1.6 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 |
0.2 |
GO:0070666 |
regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.2 |
0.4 |
GO:0061045 |
negative regulation of wound healing(GO:0061045) |
| 0.2 |
4.2 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 |
4.0 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.2 |
0.2 |
GO:0051683 |
establishment of Golgi localization(GO:0051683) |
| 0.2 |
0.5 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 |
1.6 |
GO:0043634 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.2 |
0.2 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.2 |
1.9 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 |
3.1 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.2 |
0.7 |
GO:0072180 |
mesonephric duct morphogenesis(GO:0072180) |
| 0.2 |
0.3 |
GO:2001180 |
negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.2 |
3.8 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.2 |
2.6 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 |
0.7 |
GO:0097056 |
selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.2 |
1.0 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.2 |
2.2 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
0.3 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 |
1.4 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 |
0.2 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.2 |
1.0 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.2 |
0.5 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 |
0.3 |
GO:0071636 |
positive regulation of transforming growth factor beta production(GO:0071636) |
| 0.2 |
1.0 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 |
0.3 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.2 |
1.5 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.2 |
0.8 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 |
1.2 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 |
0.5 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.2 |
0.8 |
GO:0000727 |
double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 |
1.3 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.2 |
0.5 |
GO:0009436 |
glyoxylate catabolic process(GO:0009436) |
| 0.2 |
0.2 |
GO:0002933 |
lipid hydroxylation(GO:0002933) |
| 0.2 |
0.8 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.2 |
2.8 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.2 |
0.2 |
GO:0051450 |
myoblast proliferation(GO:0051450) regulation of myoblast proliferation(GO:2000291) |
| 0.2 |
1.1 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 |
3.3 |
GO:0036149 |
phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.2 |
2.9 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.2 |
1.0 |
GO:0036111 |
very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.2 |
0.3 |
GO:1903233 |
regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.2 |
0.2 |
GO:0033625 |
positive regulation of integrin activation(GO:0033625) |
| 0.2 |
0.3 |
GO:0060218 |
hematopoietic stem cell differentiation(GO:0060218) |
| 0.2 |
0.8 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.2 |
0.8 |
GO:1904764 |
negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.2 |
0.8 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 |
0.5 |
GO:0031112 |
positive regulation of microtubule polymerization or depolymerization(GO:0031112) positive regulation of microtubule polymerization(GO:0031116) |
| 0.2 |
0.2 |
GO:0061740 |
protein targeting to lysosome involved in chaperone-mediated autophagy(GO:0061740) |
| 0.2 |
0.9 |
GO:1902525 |
regulation of protein monoubiquitination(GO:1902525) |
| 0.2 |
0.6 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.2 |
0.5 |
GO:0006286 |
base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.2 |
1.7 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.2 |
0.5 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.2 |
0.8 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.2 |
0.6 |
GO:0003157 |
endocardium development(GO:0003157) |
| 0.2 |
2.5 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
0.5 |
GO:0006625 |
protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.2 |
0.2 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.2 |
0.5 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 |
1.2 |
GO:0007379 |
segment specification(GO:0007379) |
| 0.2 |
2.0 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.2 |
1.2 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 |
3.7 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
1.1 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.2 |
0.3 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.2 |
2.0 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 |
0.8 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.2 |
0.5 |
GO:1904397 |
negative regulation of neuromuscular junction development(GO:1904397) |
| 0.2 |
0.2 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.2 |
5.2 |
GO:1904837 |
beta-catenin-TCF complex assembly(GO:1904837) |
| 0.2 |
0.2 |
GO:0098915 |
membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.2 |
0.2 |
GO:0061056 |
sclerotome development(GO:0061056) |
| 0.2 |
0.6 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.2 |
0.3 |
GO:0006210 |
pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 |
0.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 |
17.3 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.4 |
GO:0097477 |
spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.1 |
0.6 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 0.1 |
0.1 |
GO:0035026 |
leading edge cell differentiation(GO:0035026) |
| 0.1 |
0.1 |
GO:0060448 |
dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 |
0.4 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 |
0.3 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 |
0.7 |
GO:1902896 |
terminal web assembly(GO:1902896) |
| 0.1 |
0.1 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 |
0.4 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.1 |
GO:1901299 |
negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
| 0.1 |
0.9 |
GO:0014877 |
response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 |
0.6 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.1 |
0.1 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 |
2.6 |
GO:0046069 |
cGMP catabolic process(GO:0046069) |
| 0.1 |
0.7 |
GO:0007595 |
lactation(GO:0007595) |
| 0.1 |
0.7 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 |
0.9 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 |
0.6 |
GO:0060313 |
negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 |
0.4 |
GO:0035408 |
histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 |
0.3 |
GO:0010452 |
histone H3-K36 methylation(GO:0010452) |
| 0.1 |
0.6 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 |
0.3 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.1 |
1.0 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.1 |
0.7 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.1 |
0.4 |
GO:0031548 |
regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.1 |
0.7 |
GO:1903751 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 |
0.3 |
GO:0002232 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 |
0.4 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 |
0.6 |
GO:2000259 |
positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 |
0.4 |
GO:0010286 |
heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 |
2.1 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 |
1.1 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.4 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 |
1.0 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.1 |
0.4 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.1 |
0.4 |
GO:0050428 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 |
1.9 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.1 |
0.7 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.1 |
1.1 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.7 |
GO:0043578 |
nuclear matrix organization(GO:0043578) |
| 0.1 |
0.3 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.1 |
0.5 |
GO:0051103 |
DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 |
1.2 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.8 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.1 |
0.3 |
GO:0007439 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.1 |
0.4 |
GO:0021904 |
dorsal/ventral neural tube patterning(GO:0021904) |
| 0.1 |
2.3 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
4.0 |
GO:0043949 |
regulation of cAMP-mediated signaling(GO:0043949) |
| 0.1 |
2.0 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 |
1.3 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.1 |
0.3 |
GO:1904954 |
canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.1 |
0.5 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 |
0.4 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.3 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 |
0.1 |
GO:0055096 |
lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.1 |
0.4 |
GO:0048859 |
formation of anatomical boundary(GO:0048859) |
| 0.1 |
0.5 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 |
0.1 |
GO:1902774 |
late endosome to lysosome transport(GO:1902774) |
| 0.1 |
0.3 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.1 |
0.8 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 |
0.3 |
GO:0016137 |
glycoside metabolic process(GO:0016137) |
| 0.1 |
3.9 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
0.5 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 |
0.1 |
GO:0003220 |
left ventricular cardiac muscle tissue morphogenesis(GO:0003220) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 |
1.5 |
GO:0015866 |
ADP transport(GO:0015866) |
| 0.1 |
1.2 |
GO:0071798 |
response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 |
0.5 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 |
1.3 |
GO:0043967 |
histone H4 acetylation(GO:0043967) |
| 0.1 |
1.5 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.1 |
1.9 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
0.3 |
GO:0034182 |
regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.1 |
0.6 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.1 |
0.8 |
GO:1903385 |
regulation of homophilic cell adhesion(GO:1903385) |
| 0.1 |
2.6 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.1 |
1.7 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.1 |
1.9 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.1 |
0.2 |
GO:1902567 |
negative regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034125) negative regulation of eosinophil activation(GO:1902567) |
| 0.1 |
0.7 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.1 |
0.2 |
GO:0033387 |
putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 |
0.1 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 |
2.7 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.1 |
1.3 |
GO:1900151 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 |
0.5 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.1 |
1.8 |
GO:0007097 |
nuclear migration(GO:0007097) |
| 0.1 |
0.1 |
GO:0021569 |
rhombomere 3 development(GO:0021569) |
| 0.1 |
1.5 |
GO:0006677 |
glycosylceramide metabolic process(GO:0006677) |
| 0.1 |
0.4 |
GO:0035234 |
ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 |
1.1 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.1 |
0.1 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 |
0.8 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.1 |
0.4 |
GO:1904808 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 |
2.9 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.1 |
0.4 |
GO:0070541 |
response to platinum ion(GO:0070541) |
| 0.1 |
0.7 |
GO:0019048 |
modulation by virus of host morphology or physiology(GO:0019048) |
| 0.1 |
3.0 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.1 |
0.1 |
GO:0000480 |
endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 |
0.9 |
GO:0023035 |
CD40 signaling pathway(GO:0023035) |
| 0.1 |
0.4 |
GO:0050823 |
peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.1 |
0.2 |
GO:0014015 |
positive regulation of gliogenesis(GO:0014015) |
| 0.1 |
0.4 |
GO:0070676 |
intralumenal vesicle formation(GO:0070676) |
| 0.1 |
1.1 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 |
0.2 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 |
10.7 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.1 |
1.4 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.3 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 |
0.9 |
GO:0009048 |
dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.5 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.1 |
0.5 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
1.3 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 |
9.6 |
GO:0032436 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.1 |
2.5 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 |
0.1 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 |
1.1 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
1.1 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.1 |
0.5 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 |
1.5 |
GO:0019722 |
calcium-mediated signaling(GO:0019722) |
| 0.1 |
1.6 |
GO:0035640 |
exploration behavior(GO:0035640) |
| 0.1 |
1.1 |
GO:1904886 |
beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 |
0.6 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.3 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 |
1.0 |
GO:0035933 |
glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.1 |
1.7 |
GO:0060044 |
negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.1 |
0.2 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.1 |
0.3 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 |
0.7 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.1 |
0.5 |
GO:0034128 |
regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 |
0.5 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.1 |
4.5 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
1.6 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.1 |
0.3 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.1 |
0.9 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 |
0.3 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.8 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.1 |
0.6 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.1 |
1.1 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
1.1 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.1 |
GO:0010269 |
response to selenium ion(GO:0010269) |
| 0.1 |
0.2 |
GO:1901079 |
positive regulation of relaxation of muscle(GO:1901079) |
| 0.1 |
0.1 |
GO:2000425 |
regulation of apoptotic cell clearance(GO:2000425) |
| 0.1 |
0.6 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.1 |
0.8 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.1 |
0.4 |
GO:0010387 |
COP9 signalosome assembly(GO:0010387) |
| 0.1 |
1.0 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 |
0.8 |
GO:0042733 |
embryonic digit morphogenesis(GO:0042733) |
| 0.1 |
4.5 |
GO:0002223 |
stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.1 |
0.4 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
1.0 |
GO:0016075 |
rRNA catabolic process(GO:0016075) |
| 0.1 |
0.1 |
GO:1904933 |
regulation of cell proliferation in midbrain(GO:1904933) |
| 0.1 |
3.6 |
GO:0014904 |
myotube cell development(GO:0014904) |
| 0.1 |
0.2 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 |
0.4 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 |
0.4 |
GO:1904383 |
response to sodium phosphate(GO:1904383) |
| 0.1 |
0.8 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.1 |
0.7 |
GO:0060509 |
Type I pneumocyte differentiation(GO:0060509) |
| 0.1 |
0.9 |
GO:2000622 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 |
0.4 |
GO:0010517 |
regulation of phospholipase activity(GO:0010517) |
| 0.1 |
1.9 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 |
1.6 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.4 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 |
0.6 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 |
0.2 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.1 |
0.3 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 |
0.4 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 |
4.7 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.4 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.1 |
0.3 |
GO:1902035 |
positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 |
1.0 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.3 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 |
0.9 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 |
0.6 |
GO:0031340 |
positive regulation of vesicle fusion(GO:0031340) |
| 0.1 |
0.6 |
GO:0021514 |
ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.1 |
0.5 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.1 |
0.1 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 |
2.8 |
GO:0072348 |
sulfur compound transport(GO:0072348) |
| 0.1 |
0.9 |
GO:0015812 |
gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 |
1.5 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.1 |
0.8 |
GO:0051481 |
negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 |
1.6 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
0.5 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.4 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.4 |
GO:0001514 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
7.9 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.7 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.2 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.2 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 |
0.6 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
0.3 |
GO:1902996 |
regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 |
5.5 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 |
0.2 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 |
0.3 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 |
0.2 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 |
0.6 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
2.9 |
GO:0048488 |
synaptic vesicle endocytosis(GO:0048488) |
| 0.1 |
0.3 |
GO:1902530 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 |
2.5 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.1 |
0.8 |
GO:0061418 |
regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 |
1.0 |
GO:0097396 |
response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 |
0.2 |
GO:0046502 |
uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.1 |
0.7 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 |
0.4 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 |
7.7 |
GO:0007286 |
spermatid development(GO:0007286) |
| 0.1 |
0.8 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.1 |
0.3 |
GO:1903170 |
negative regulation of calcium ion transmembrane transport(GO:1903170) |
| 0.1 |
1.2 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.1 |
0.4 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
0.5 |
GO:0000077 |
DNA damage checkpoint(GO:0000077) |
| 0.1 |
0.1 |
GO:0061365 |
positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.1 |
0.2 |
GO:0010891 |
negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 |
2.6 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
1.0 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.1 |
0.2 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 |
0.3 |
GO:0086018 |
SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) |
| 0.1 |
0.4 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.1 |
0.1 |
GO:0014916 |
regulation of lung blood pressure(GO:0014916) |
| 0.1 |
0.1 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.1 |
0.3 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 |
0.2 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 |
0.2 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 |
0.3 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.1 |
0.9 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.1 |
2.3 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
0.1 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
| 0.1 |
0.7 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.1 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 |
0.5 |
GO:2000696 |
regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.1 |
0.2 |
GO:0070681 |
glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 |
0.3 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.1 |
0.3 |
GO:0035549 |
positive regulation of interferon-beta secretion(GO:0035549) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 |
1.4 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 |
0.2 |
GO:0007231 |
osmosensory signaling pathway(GO:0007231) |
| 0.1 |
0.2 |
GO:0036309 |
protein localization to M-band(GO:0036309) |
| 0.1 |
0.2 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 |
0.3 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.1 |
0.7 |
GO:0090218 |
positive regulation of lipid kinase activity(GO:0090218) |
| 0.1 |
0.2 |
GO:2000329 |
peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
| 0.1 |
0.3 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.1 |
0.4 |
GO:1905225 |
response to thyrotropin-releasing hormone(GO:1905225) |
| 0.1 |
0.2 |
GO:0016098 |
monoterpenoid metabolic process(GO:0016098) |
| 0.1 |
0.6 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
0.4 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.1 |
0.3 |
GO:0043128 |
regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 |
0.5 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.1 |
0.2 |
GO:0044205 |
'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 |
0.2 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 |
0.1 |
GO:1903020 |
positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.1 |
0.2 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.1 |
0.1 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.1 |
0.4 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.2 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
0.1 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.1 |
0.5 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.1 |
GO:0097267 |
omega-hydroxylase P450 pathway(GO:0097267) |
| 0.1 |
0.1 |
GO:0038109 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 |
0.2 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 |
0.6 |
GO:0015781 |
pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 |
0.1 |
GO:1901800 |
positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.1 |
5.5 |
GO:0046323 |
glucose import(GO:0046323) |
| 0.1 |
0.4 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
0.2 |
GO:0090219 |
negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 |
0.4 |
GO:0033240 |
positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.1 |
0.2 |
GO:1904152 |
regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 |
0.3 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 |
0.2 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.1 |
0.1 |
GO:0048793 |
pronephros development(GO:0048793) |
| 0.1 |
1.1 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 |
0.1 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.1 |
0.4 |
GO:1902659 |
regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 |
1.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
0.1 |
GO:0090100 |
positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.1 |
0.3 |
GO:0035136 |
embryonic forelimb morphogenesis(GO:0035115) forelimb morphogenesis(GO:0035136) |
| 0.1 |
0.1 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.1 |
0.4 |
GO:0007617 |
mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.1 |
0.7 |
GO:0070525 |
tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 |
0.6 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 |
0.2 |
GO:0048515 |
spermatid differentiation(GO:0048515) |
| 0.1 |
0.9 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.4 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.3 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.1 |
0.9 |
GO:2000821 |
regulation of grooming behavior(GO:2000821) |
| 0.1 |
0.6 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.1 |
0.7 |
GO:0019054 |
modulation by virus of host process(GO:0019054) |
| 0.1 |
0.7 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.1 |
0.1 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 |
0.3 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.1 |
0.1 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.1 |
GO:0019430 |
removal of superoxide radicals(GO:0019430) |
| 0.1 |
0.1 |
GO:0042494 |
detection of bacterial lipoprotein(GO:0042494) |
| 0.1 |
0.1 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
3.0 |
GO:0046513 |
ceramide biosynthetic process(GO:0046513) |
| 0.1 |
0.4 |
GO:0052055 |
modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 |
1.2 |
GO:0061512 |
protein localization to cilium(GO:0061512) |
| 0.1 |
0.3 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
0.5 |
GO:0046676 |
negative regulation of insulin secretion(GO:0046676) |
| 0.1 |
0.1 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 |
0.3 |
GO:0090102 |
cochlea development(GO:0090102) |
| 0.1 |
0.5 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 |
0.3 |
GO:0051281 |
positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.1 |
0.5 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
0.3 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
0.5 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.1 |
0.1 |
GO:0072708 |
response to sorbitol(GO:0072708) cellular response to sorbitol(GO:0072709) |
| 0.1 |
2.1 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 0.1 |
0.4 |
GO:2000778 |
positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.1 |
0.2 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.1 |
2.1 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.1 |
1.1 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
0.6 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) |
| 0.1 |
1.9 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.1 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.3 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 |
0.2 |
GO:0010716 |
negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.1 |
0.5 |
GO:0061098 |
positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.1 |
0.3 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 |
0.2 |
GO:2000870 |
oocyte growth(GO:0001555) progesterone secretion(GO:0042701) regulation of progesterone secretion(GO:2000870) |
| 0.1 |
0.4 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
0.1 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 |
0.4 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 |
7.1 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
1.2 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.2 |
GO:0071503 |
response to heparin(GO:0071503) |
| 0.1 |
0.1 |
GO:0016476 |
regulation of embryonic cell shape(GO:0016476) |
| 0.1 |
0.2 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 |
3.2 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.5 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.1 |
0.4 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 |
0.2 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 |
0.1 |
GO:0002625 |
regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.1 |
0.7 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.1 |
0.1 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 |
0.5 |
GO:0006264 |
mitochondrial DNA replication(GO:0006264) |
| 0.1 |
0.2 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 |
0.1 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 |
0.5 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 |
0.2 |
GO:0031247 |
actin rod assembly(GO:0031247) |
| 0.1 |
0.8 |
GO:0032201 |
telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 |
0.1 |
GO:0006581 |
acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 |
0.2 |
GO:0071675 |
mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.1 |
0.3 |
GO:0008090 |
retrograde axonal transport(GO:0008090) |
| 0.1 |
0.1 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 0.1 |
0.3 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.3 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 |
0.2 |
GO:0005986 |
sucrose biosynthetic process(GO:0005986) cellular response to magnesium ion(GO:0071286) |
| 0.1 |
0.6 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 |
0.1 |
GO:0060263 |
regulation of respiratory burst(GO:0060263) |
| 0.1 |
0.2 |
GO:0003339 |
regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.1 |
0.2 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.1 |
0.2 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 |
0.1 |
GO:0002724 |
regulation of T cell cytokine production(GO:0002724) |
| 0.1 |
0.1 |
GO:1903347 |
negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 |
0.2 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.1 |
0.1 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.2 |
GO:0039663 |
fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.1 |
0.2 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.9 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.1 |
0.3 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.1 |
0.3 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.1 |
0.4 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.1 |
GO:0021675 |
nerve development(GO:0021675) |
| 0.1 |
0.2 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.1 |
0.2 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.1 |
0.2 |
GO:0050913 |
sensory perception of bitter taste(GO:0050913) |
| 0.1 |
0.1 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.1 |
0.2 |
GO:0032971 |
regulation of muscle filament sliding(GO:0032971) |
| 0.1 |
2.1 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.8 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
0.2 |
GO:1903697 |
negative regulation of microvillus assembly(GO:1903697) |
| 0.1 |
0.1 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 |
0.2 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.1 |
0.6 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 |
0.2 |
GO:0032026 |
response to magnesium ion(GO:0032026) |
| 0.1 |
0.5 |
GO:0035810 |
positive regulation of urine volume(GO:0035810) |
| 0.1 |
0.2 |
GO:0015840 |
urea transport(GO:0015840) |
| 0.1 |
0.1 |
GO:0014870 |
response to muscle inactivity(GO:0014870) |
| 0.1 |
0.1 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 |
0.2 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 |
0.9 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
0.6 |
GO:0050684 |
regulation of mRNA processing(GO:0050684) |
| 0.0 |
0.6 |
GO:0006782 |
protoporphyrinogen IX biosynthetic process(GO:0006782) protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
0.5 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.0 |
0.3 |
GO:0044130 |
negative regulation of growth of symbiont in host(GO:0044130) |
| 0.0 |
1.6 |
GO:0032608 |
interferon-beta production(GO:0032608) |
| 0.0 |
0.2 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.0 |
0.0 |
GO:0050666 |
regulation of sulfur amino acid metabolic process(GO:0031335) regulation of homocysteine metabolic process(GO:0050666) |
| 0.0 |
0.1 |
GO:0048247 |
lymphocyte chemotaxis(GO:0048247) |
| 0.0 |
0.4 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.0 |
0.6 |
GO:0046951 |
ketone body biosynthetic process(GO:0046951) |
| 0.0 |
0.5 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.0 |
0.1 |
GO:0051881 |
regulation of mitochondrial membrane potential(GO:0051881) |
| 0.0 |
0.1 |
GO:0070424 |
regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.0 |
0.2 |
GO:0014744 |
positive regulation of muscle adaptation(GO:0014744) |
| 0.0 |
0.1 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 |
0.4 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 |
0.0 |
GO:0045763 |
regulation of glutamine family amino acid metabolic process(GO:0000820) negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.0 |
0.5 |
GO:0060292 |
long term synaptic depression(GO:0060292) |
| 0.0 |
0.1 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.0 |
0.3 |
GO:1903748 |
negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 |
0.2 |
GO:0010902 |
positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.0 |
0.3 |
GO:0035745 |
T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 |
0.1 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 |
0.1 |
GO:1902410 |
lysosomal membrane organization(GO:0097212) mitotic cytokinetic process(GO:1902410) positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.0 |
0.2 |
GO:0038110 |
interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 |
0.0 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.0 |
0.1 |
GO:0051231 |
spindle elongation(GO:0051231) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 |
0.3 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.0 |
GO:1902804 |
negative regulation of synaptic vesicle transport(GO:1902804) negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.0 |
0.1 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.0 |
0.2 |
GO:2001295 |
malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 |
0.1 |
GO:1904044 |
response to aldosterone(GO:1904044) |
| 0.0 |
0.2 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 |
0.5 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.0 |
0.0 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.0 |
0.1 |
GO:0002673 |
regulation of acute inflammatory response(GO:0002673) |
| 0.0 |
0.1 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.0 |
0.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 |
1.6 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.0 |
0.0 |
GO:0035791 |
platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.0 |
0.1 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 |
0.2 |
GO:1901018 |
positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 |
0.2 |
GO:0070861 |
regulation of protein exit from endoplasmic reticulum(GO:0070861) |
| 0.0 |
0.0 |
GO:0090185 |
negative regulation of kidney development(GO:0090185) |
| 0.0 |
0.2 |
GO:0048298 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 |
2.1 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.1 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 |
0.1 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 |
0.2 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 |
1.6 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 |
0.4 |
GO:0045742 |
positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 |
0.2 |
GO:2000660 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.0 |
0.1 |
GO:0048485 |
sympathetic nervous system development(GO:0048485) |
| 0.0 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.0 |
0.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.1 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.2 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.0 |
0.2 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.0 |
1.8 |
GO:0006283 |
transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 |
0.1 |
GO:0055009 |
atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 |
0.4 |
GO:0032309 |
icosanoid secretion(GO:0032309) |
| 0.0 |
1.3 |
GO:0046710 |
GDP metabolic process(GO:0046710) |
| 0.0 |
0.1 |
GO:0098780 |
response to mitochondrial depolarisation(GO:0098780) |
| 0.0 |
0.6 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 |
0.1 |
GO:0015991 |
ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 |
1.0 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.1 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 |
1.1 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.3 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 |
0.1 |
GO:1901202 |
negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 |
0.4 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.4 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 |
0.1 |
GO:2001178 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 |
0.7 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.0 |
0.3 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.0 |
0.1 |
GO:0045324 |
late endosome to vacuole transport(GO:0045324) |
| 0.0 |
0.6 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
0.1 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 |
1.3 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 |
0.6 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.1 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 |
0.0 |
GO:0043407 |
negative regulation of MAP kinase activity(GO:0043407) |
| 0.0 |
0.1 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.0 |
0.2 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.0 |
0.2 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.0 |
0.5 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.3 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 |
0.2 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.0 |
0.1 |
GO:0031296 |
B cell costimulation(GO:0031296) |
| 0.0 |
0.1 |
GO:0019933 |
cAMP-mediated signaling(GO:0019933) |
| 0.0 |
0.1 |
GO:1904292 |
regulation of ERAD pathway(GO:1904292) |
| 0.0 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 |
0.1 |
GO:0006423 |
cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 |
0.2 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 |
0.1 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 |
0.3 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 |
0.5 |
GO:0060314 |
regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 |
0.4 |
GO:0070911 |
global genome nucleotide-excision repair(GO:0070911) |
| 0.0 |
1.7 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.1 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 |
0.1 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.0 |
0.9 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.0 |
2.3 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.0 |
0.2 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.0 |
0.0 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 |
0.2 |
GO:0070293 |
renal absorption(GO:0070293) |
| 0.0 |
0.0 |
GO:0015942 |
formate metabolic process(GO:0015942) |
| 0.0 |
0.1 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 |
0.1 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.0 |
0.8 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.2 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.0 |
0.1 |
GO:0009149 |
pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 |
0.1 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.0 |
0.2 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.2 |
GO:0021615 |
glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 |
0.1 |
GO:0038188 |
cholecystokinin signaling pathway(GO:0038188) |
| 0.0 |
0.1 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.0 |
0.1 |
GO:0043044 |
ATP-dependent chromatin remodeling(GO:0043044) |
| 0.0 |
1.3 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.1 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.0 |
0.1 |
GO:0033137 |
negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 |
0.2 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.0 |
0.3 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 |
0.1 |
GO:0016246 |
RNA interference(GO:0016246) |
| 0.0 |
0.4 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 |
0.1 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 |
0.1 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.0 |
0.1 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 0.0 |
0.1 |
GO:0048149 |
behavioral response to ethanol(GO:0048149) |
| 0.0 |
0.2 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.0 |
1.5 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.0 |
0.0 |
GO:0003211 |
cardiac ventricle formation(GO:0003211) |
| 0.0 |
3.1 |
GO:0006333 |
chromatin assembly or disassembly(GO:0006333) |
| 0.0 |
0.2 |
GO:0032097 |
positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.0 |
0.9 |
GO:0032874 |
positive regulation of stress-activated MAPK cascade(GO:0032874) |
| 0.0 |
0.1 |
GO:0036336 |
dendritic cell migration(GO:0036336) |
| 0.0 |
0.2 |
GO:0006574 |
valine catabolic process(GO:0006574) |
| 0.0 |
0.3 |
GO:0007274 |
neuromuscular synaptic transmission(GO:0007274) |
| 0.0 |
0.2 |
GO:2000758 |
positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.0 |
0.1 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.0 |
0.0 |
GO:0090069 |
regulation of ribosome biogenesis(GO:0090069) |
| 0.0 |
0.0 |
GO:1900449 |
regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 |
0.1 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 |
0.2 |
GO:1990001 |
inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 |
0.1 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.0 |
0.3 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.2 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.2 |
GO:0048148 |
behavioral response to cocaine(GO:0048148) |
| 0.0 |
0.6 |
GO:0006099 |
tricarboxylic acid cycle(GO:0006099) |
| 0.0 |
0.0 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.0 |
0.1 |
GO:2000272 |
negative regulation of receptor activity(GO:2000272) |
| 0.0 |
0.2 |
GO:0043555 |
regulation of translation in response to stress(GO:0043555) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.1 |
GO:0008628 |
hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.0 |
0.4 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
0.1 |
GO:0010575 |
positive regulation of vascular endothelial growth factor production(GO:0010575) |
| 0.0 |
1.7 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 |
0.0 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.0 |
0.2 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 |
0.0 |
GO:0021533 |
cell differentiation in hindbrain(GO:0021533) |
| 0.0 |
0.2 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 |
0.0 |
GO:0010360 |
negative regulation of anion channel activity(GO:0010360) |
| 0.0 |
0.0 |
GO:0061357 |
positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 |
0.1 |
GO:0050976 |
sensory perception of touch(GO:0050975) detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
| 0.0 |
0.3 |
GO:0032735 |
positive regulation of interleukin-12 production(GO:0032735) |
| 0.0 |
0.1 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 |
0.1 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.0 |
0.1 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 |
0.0 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 |
0.0 |
GO:0010573 |
vascular endothelial growth factor production(GO:0010573) |
| 0.0 |
0.2 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 |
0.1 |
GO:0090611 |
ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 |
0.3 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 |
0.0 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.0 |
0.2 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 |
0.1 |
GO:0007625 |
grooming behavior(GO:0007625) |
| 0.0 |
0.1 |
GO:0071715 |
icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.0 |
0.0 |
GO:0061469 |
regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 |
0.5 |
GO:0048864 |
stem cell development(GO:0048864) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.0 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.0 |
0.1 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0042339 |
keratan sulfate biosynthetic process(GO:0018146) keratan sulfate metabolic process(GO:0042339) |
| 0.0 |
0.4 |
GO:0006584 |
catecholamine metabolic process(GO:0006584) catechol-containing compound metabolic process(GO:0009712) |
| 0.0 |
0.0 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.0 |
0.2 |
GO:0086012 |
membrane depolarization during cardiac muscle cell action potential(GO:0086012) |
| 0.0 |
0.1 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 |
0.0 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 |
0.1 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 |
0.1 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.1 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.2 |
GO:0046320 |
regulation of fatty acid oxidation(GO:0046320) |
| 0.0 |
0.2 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 |
0.1 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.0 |
0.1 |
GO:0060124 |
positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 |
0.2 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.0 |
0.2 |
GO:0006303 |
double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 |
0.1 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.0 |
0.1 |
GO:0021563 |
glossopharyngeal nerve development(GO:0021563) |
| 0.0 |
0.1 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 |
0.0 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 |
0.9 |
GO:0030509 |
BMP signaling pathway(GO:0030509) |
| 0.0 |
0.2 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.1 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 |
0.3 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.0 |
1.9 |
GO:0030449 |
regulation of complement activation(GO:0030449) |
| 0.0 |
5.4 |
GO:0007283 |
spermatogenesis(GO:0007283) |
| 0.0 |
0.0 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 |
0.6 |
GO:0015949 |
nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 |
0.1 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.0 |
0.3 |
GO:0061099 |
negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 |
0.0 |
GO:0086091 |
regulation of heart rate by cardiac conduction(GO:0086091) |
| 0.0 |
0.1 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.0 |
0.1 |
GO:0010508 |
positive regulation of autophagy(GO:0010508) |
| 0.0 |
0.0 |
GO:0046070 |
dGTP metabolic process(GO:0046070) |
| 0.0 |
0.0 |
GO:0048865 |
stem cell fate commitment(GO:0048865) |
| 0.0 |
0.0 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.0 |
GO:0034661 |
ncRNA catabolic process(GO:0034661) |
| 0.0 |
0.1 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.0 |
0.0 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.1 |
GO:0014029 |
neural crest formation(GO:0014029) |
| 0.0 |
0.1 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.0 |
0.1 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 |
0.1 |
GO:0009651 |
response to salt stress(GO:0009651) |
| 0.0 |
0.1 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.0 |
0.0 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 |
0.0 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.0 |
0.0 |
GO:1902548 |
negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.0 |
3.1 |
GO:0000375 |
RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 |
0.0 |
GO:0051135 |
positive regulation of NK T cell activation(GO:0051135) |
| 0.0 |
0.0 |
GO:0003025 |
regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 |
0.0 |
GO:1900222 |
negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.0 |
0.1 |
GO:0031124 |
RNA 3'-end processing(GO:0031123) mRNA 3'-end processing(GO:0031124) |
| 0.0 |
0.0 |
GO:0001767 |
establishment of lymphocyte polarity(GO:0001767) |
| 0.0 |
0.1 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 |
0.0 |
GO:0051926 |
negative regulation of calcium ion transport(GO:0051926) |
| 0.0 |
0.0 |
GO:0008588 |
release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 |
0.0 |
GO:0048668 |
collateral sprouting(GO:0048668) |
| 0.0 |
0.5 |
GO:0097202 |
activation of cysteine-type endopeptidase activity(GO:0097202) |