| 7.9 |
23.7 |
GO:0046586 |
regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 7.2 |
21.6 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 7.0 |
41.9 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 5.6 |
16.7 |
GO:0006535 |
cysteine biosynthetic process from serine(GO:0006535) |
| 5.0 |
5.0 |
GO:0051231 |
spindle elongation(GO:0051231) |
| 4.5 |
13.6 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 4.2 |
4.2 |
GO:1903923 |
protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 4.0 |
7.9 |
GO:0009620 |
response to fungus(GO:0009620) |
| 3.9 |
11.7 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 3.5 |
10.5 |
GO:0006154 |
adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
| 3.5 |
10.5 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 3.5 |
31.1 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 3.3 |
9.8 |
GO:0035419 |
activation of MAPK activity involved in innate immune response(GO:0035419) |
| 3.2 |
12.6 |
GO:0006218 |
uridine catabolic process(GO:0006218) |
| 3.2 |
12.6 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 3.1 |
3.1 |
GO:0031397 |
negative regulation of protein ubiquitination(GO:0031397) |
| 2.9 |
8.8 |
GO:0051780 |
mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 2.8 |
8.3 |
GO:1903570 |
regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 2.6 |
2.6 |
GO:1903895 |
negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 2.6 |
20.5 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 2.5 |
2.5 |
GO:0042159 |
lipoprotein catabolic process(GO:0042159) |
| 2.5 |
14.7 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 2.4 |
2.4 |
GO:0060557 |
positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 2.4 |
7.3 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 2.4 |
2.4 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 2.3 |
9.4 |
GO:0046086 |
adenosine biosynthetic process(GO:0046086) |
| 2.3 |
9.3 |
GO:0019322 |
pentose biosynthetic process(GO:0019322) |
| 2.3 |
6.9 |
GO:0060178 |
regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 2.2 |
2.2 |
GO:0003169 |
coronary vein morphogenesis(GO:0003169) |
| 2.2 |
8.8 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 2.2 |
8.7 |
GO:1902613 |
regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 2.1 |
17.1 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 2.1 |
2.1 |
GO:0046102 |
inosine metabolic process(GO:0046102) |
| 2.1 |
6.3 |
GO:0043163 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 2.1 |
6.3 |
GO:0035674 |
tricarboxylic acid transmembrane transport(GO:0035674) |
| 2.0 |
6.1 |
GO:2000777 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 2.0 |
18.3 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 2.0 |
6.1 |
GO:0019072 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 2.0 |
15.8 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 2.0 |
2.0 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 2.0 |
9.8 |
GO:0001923 |
B-1 B cell differentiation(GO:0001923) |
| 2.0 |
9.8 |
GO:0090402 |
oncogene-induced cell senescence(GO:0090402) |
| 2.0 |
15.7 |
GO:0036486 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
| 1.9 |
1.9 |
GO:0021695 |
cerebellar cortex development(GO:0021695) |
| 1.9 |
3.9 |
GO:0032499 |
detection of peptidoglycan(GO:0032499) |
| 1.9 |
11.6 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 1.9 |
7.7 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 1.9 |
5.8 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 1.9 |
7.6 |
GO:0090170 |
regulation of Golgi inheritance(GO:0090170) |
| 1.9 |
5.7 |
GO:0005988 |
lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 1.9 |
5.6 |
GO:0044771 |
meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 1.9 |
14.8 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 1.8 |
5.5 |
GO:1905166 |
negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 1.8 |
11.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.8 |
5.4 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 1.8 |
10.8 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 1.8 |
12.5 |
GO:0035900 |
response to isolation stress(GO:0035900) |
| 1.8 |
5.3 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 1.8 |
5.3 |
GO:1901350 |
cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 1.8 |
21.3 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 1.8 |
1.8 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 1.8 |
8.8 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 1.8 |
37.1 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 1.8 |
7.0 |
GO:0033123 |
positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 1.8 |
5.3 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.8 |
1.8 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.8 |
8.8 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 1.7 |
5.2 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 1.7 |
5.2 |
GO:2001037 |
tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 1.7 |
5.2 |
GO:0000412 |
histone peptidyl-prolyl isomerization(GO:0000412) |
| 1.7 |
3.5 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 1.7 |
5.2 |
GO:0021558 |
trochlear nerve development(GO:0021558) |
| 1.7 |
5.2 |
GO:0019242 |
methylglyoxal biosynthetic process(GO:0019242) |
| 1.7 |
6.9 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 1.7 |
10.3 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 1.7 |
8.5 |
GO:0010609 |
mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 1.7 |
5.0 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 1.7 |
1.7 |
GO:0030311 |
poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 1.6 |
3.3 |
GO:1902728 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 1.6 |
11.4 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 1.6 |
4.9 |
GO:0031938 |
regulation of chromatin silencing at telomere(GO:0031938) |
| 1.6 |
4.9 |
GO:0043449 |
cellular alkene metabolic process(GO:0043449) |
| 1.6 |
4.9 |
GO:0034970 |
histone H3-R2 methylation(GO:0034970) |
| 1.6 |
4.8 |
GO:0021896 |
forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 1.6 |
41.7 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 1.6 |
6.4 |
GO:1990869 |
response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
| 1.6 |
4.7 |
GO:0045062 |
extrathymic T cell selection(GO:0045062) |
| 1.6 |
7.9 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 1.6 |
1.6 |
GO:0090205 |
positive regulation of cholesterol metabolic process(GO:0090205) |
| 1.6 |
4.7 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.5 |
3.1 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 1.5 |
1.5 |
GO:0042420 |
dopamine catabolic process(GO:0042420) |
| 1.5 |
9.1 |
GO:1904684 |
negative regulation of metalloendopeptidase activity(GO:1904684) |
| 1.5 |
7.5 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 1.5 |
4.5 |
GO:0042450 |
arginine biosynthetic process via ornithine(GO:0042450) |
| 1.5 |
4.5 |
GO:0045994 |
positive regulation of translational initiation by iron(GO:0045994) |
| 1.5 |
24.0 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 1.5 |
3.0 |
GO:0002159 |
desmosome assembly(GO:0002159) |
| 1.5 |
43.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 1.5 |
1.5 |
GO:0051125 |
regulation of actin nucleation(GO:0051125) |
| 1.5 |
5.9 |
GO:0036109 |
alpha-linolenic acid metabolic process(GO:0036109) |
| 1.5 |
5.9 |
GO:2000230 |
negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 1.5 |
7.3 |
GO:0070384 |
Harderian gland development(GO:0070384) |
| 1.4 |
8.7 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.4 |
4.3 |
GO:0071790 |
spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 1.4 |
8.6 |
GO:0051005 |
negative regulation of lipoprotein lipase activity(GO:0051005) |
| 1.4 |
4.3 |
GO:1900085 |
negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 1.4 |
5.7 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 1.4 |
15.5 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 1.4 |
4.2 |
GO:0006500 |
N-terminal protein palmitoylation(GO:0006500) |
| 1.4 |
7.0 |
GO:0033490 |
cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 1.4 |
2.8 |
GO:1905167 |
positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 1.4 |
18.0 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 1.4 |
2.8 |
GO:0010982 |
regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 1.4 |
4.1 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 1.4 |
11.0 |
GO:0010767 |
regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 1.4 |
2.7 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.4 |
2.7 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 1.4 |
6.8 |
GO:0032487 |
regulation of Rap protein signal transduction(GO:0032487) |
| 1.3 |
1.3 |
GO:1901895 |
negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 1.3 |
13.4 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 1.3 |
5.4 |
GO:0070981 |
L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 1.3 |
4.0 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 1.3 |
13.3 |
GO:0035583 |
sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 1.3 |
5.3 |
GO:0003308 |
negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
| 1.3 |
6.6 |
GO:1904744 |
positive regulation of telomeric DNA binding(GO:1904744) |
| 1.3 |
9.2 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 1.3 |
1.3 |
GO:0002585 |
positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 1.3 |
1.3 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 1.3 |
7.8 |
GO:0022614 |
membrane to membrane docking(GO:0022614) |
| 1.3 |
2.6 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 1.3 |
2.6 |
GO:0010887 |
negative regulation of cholesterol storage(GO:0010887) |
| 1.3 |
7.8 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 1.3 |
3.9 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 1.3 |
3.9 |
GO:0048627 |
myoblast development(GO:0048627) |
| 1.3 |
2.6 |
GO:0033078 |
extrathymic T cell differentiation(GO:0033078) |
| 1.3 |
2.6 |
GO:0010165 |
response to X-ray(GO:0010165) |
| 1.3 |
16.6 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 1.3 |
3.8 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 1.3 |
6.4 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 1.3 |
5.1 |
GO:0001188 |
RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 1.3 |
5.1 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 1.3 |
13.8 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 1.3 |
5.0 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 1.2 |
7.5 |
GO:0034436 |
glycoprotein transport(GO:0034436) |
| 1.2 |
6.2 |
GO:0061143 |
alveolar primary septum development(GO:0061143) |
| 1.2 |
5.0 |
GO:0099640 |
axo-dendritic protein transport(GO:0099640) |
| 1.2 |
1.2 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 1.2 |
3.7 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 1.2 |
3.6 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 1.2 |
3.6 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 1.2 |
27.6 |
GO:1901897 |
regulation of relaxation of cardiac muscle(GO:1901897) |
| 1.2 |
1.2 |
GO:0099543 |
retrograde trans-synaptic signaling(GO:0098917) retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 1.2 |
1.2 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.2 |
5.9 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 1.2 |
5.9 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 1.2 |
12.9 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 1.2 |
17.6 |
GO:1904778 |
regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 1.2 |
1.2 |
GO:1900195 |
positive regulation of oocyte maturation(GO:1900195) |
| 1.2 |
11.6 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 1.2 |
3.5 |
GO:0045658 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 1.2 |
1.2 |
GO:1902954 |
regulation of early endosome to recycling endosome transport(GO:1902954) |
| 1.2 |
4.6 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 1.2 |
3.5 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 1.2 |
7.0 |
GO:0051012 |
microtubule sliding(GO:0051012) |
| 1.2 |
13.9 |
GO:0036155 |
acylglycerol acyl-chain remodeling(GO:0036155) |
| 1.2 |
2.3 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 1.1 |
6.9 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 1.1 |
9.1 |
GO:0006572 |
tyrosine catabolic process(GO:0006572) |
| 1.1 |
15.9 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 1.1 |
5.7 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 1.1 |
3.4 |
GO:0042700 |
luteinizing hormone signaling pathway(GO:0042700) |
| 1.1 |
3.4 |
GO:0046521 |
sphingoid catabolic process(GO:0046521) |
| 1.1 |
3.4 |
GO:1904481 |
response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 1.1 |
2.3 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 1.1 |
5.6 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 1.1 |
1.1 |
GO:0002856 |
negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 1.1 |
4.5 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 1.1 |
5.6 |
GO:0061146 |
Peyer's patch morphogenesis(GO:0061146) |
| 1.1 |
7.8 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 1.1 |
3.4 |
GO:0050894 |
determination of affect(GO:0050894) |
| 1.1 |
14.5 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.1 |
8.9 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 1.1 |
4.4 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 1.1 |
4.4 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 1.1 |
4.4 |
GO:0046125 |
thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 1.1 |
24.3 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 1.1 |
3.3 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 1.1 |
3.3 |
GO:1902019 |
regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 1.1 |
27.5 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 1.1 |
4.4 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 1.1 |
5.5 |
GO:0036324 |
vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 1.1 |
5.4 |
GO:0061767 |
negative regulation of lung blood pressure(GO:0061767) |
| 1.1 |
9.8 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 1.1 |
4.3 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 1.1 |
1.1 |
GO:0007195 |
adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 1.1 |
1.1 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.1 |
5.3 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 1.1 |
3.2 |
GO:0018153 |
isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 1.1 |
8.5 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.1 |
8.5 |
GO:0038060 |
nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 1.1 |
3.2 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 1.0 |
5.2 |
GO:0090131 |
mesenchyme migration(GO:0090131) |
| 1.0 |
3.1 |
GO:0086098 |
angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 1.0 |
2.1 |
GO:0010661 |
positive regulation of muscle cell apoptotic process(GO:0010661) |
| 1.0 |
4.2 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 1.0 |
1.0 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 1.0 |
11.3 |
GO:0010993 |
regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 1.0 |
1.0 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 1.0 |
10.3 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 1.0 |
3.1 |
GO:0002276 |
basophil activation involved in immune response(GO:0002276) |
| 1.0 |
12.3 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 1.0 |
3.0 |
GO:0042418 |
epinephrine biosynthetic process(GO:0042418) |
| 1.0 |
3.0 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 1.0 |
1.0 |
GO:0002461 |
tolerance induction dependent upon immune response(GO:0002461) |
| 1.0 |
9.1 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 1.0 |
3.0 |
GO:0042361 |
menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 1.0 |
2.0 |
GO:0070383 |
DNA cytosine deamination(GO:0070383) |
| 1.0 |
3.0 |
GO:0060613 |
fat pad development(GO:0060613) |
| 1.0 |
1.0 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 1.0 |
4.0 |
GO:0035425 |
autocrine signaling(GO:0035425) |
| 1.0 |
12.8 |
GO:0030949 |
positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 1.0 |
1.0 |
GO:0071373 |
cellular response to luteinizing hormone stimulus(GO:0071373) |
| 1.0 |
8.7 |
GO:0046618 |
drug export(GO:0046618) |
| 1.0 |
1.9 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 1.0 |
2.9 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 1.0 |
1.9 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 1.0 |
3.8 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.0 |
5.7 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.9 |
5.7 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.9 |
0.9 |
GO:0097191 |
extrinsic apoptotic signaling pathway(GO:0097191) |
| 0.9 |
1.9 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.9 |
1.9 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.9 |
1.9 |
GO:0043473 |
pigmentation(GO:0043473) |
| 0.9 |
6.6 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.9 |
4.7 |
GO:0071802 |
negative regulation of podosome assembly(GO:0071802) |
| 0.9 |
6.5 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.9 |
5.6 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.9 |
3.7 |
GO:0090135 |
actin filament branching(GO:0090135) |
| 0.9 |
5.5 |
GO:0071321 |
cellular response to cGMP(GO:0071321) |
| 0.9 |
2.8 |
GO:0035623 |
regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) |
| 0.9 |
6.4 |
GO:0010629 |
negative regulation of gene expression(GO:0010629) |
| 0.9 |
3.7 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.9 |
23.6 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.9 |
2.7 |
GO:1904298 |
positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.9 |
4.5 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.9 |
15.3 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.9 |
14.3 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.9 |
6.3 |
GO:0060027 |
convergent extension involved in gastrulation(GO:0060027) |
| 0.9 |
5.4 |
GO:0019346 |
homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.9 |
0.9 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.9 |
2.6 |
GO:0014740 |
negative regulation of muscle hyperplasia(GO:0014740) |
| 0.9 |
4.4 |
GO:1901503 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.9 |
3.5 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.9 |
1.8 |
GO:0060978 |
angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.9 |
0.9 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.9 |
2.6 |
GO:0006422 |
aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.9 |
2.6 |
GO:0060823 |
canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.9 |
3.5 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.9 |
1.7 |
GO:0042481 |
regulation of odontogenesis(GO:0042481) |
| 0.9 |
2.6 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.9 |
12.1 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.9 |
4.3 |
GO:0007070 |
negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.9 |
1.7 |
GO:1901656 |
glycoside transport(GO:1901656) |
| 0.9 |
2.6 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.9 |
2.6 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.9 |
2.6 |
GO:0036333 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.9 |
8.5 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.9 |
1.7 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.9 |
3.4 |
GO:0097010 |
eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.9 |
23.8 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.8 |
0.8 |
GO:1902256 |
apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.8 |
5.1 |
GO:1903575 |
cornified envelope assembly(GO:1903575) |
| 0.8 |
0.8 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.8 |
2.5 |
GO:0019860 |
uracil metabolic process(GO:0019860) |
| 0.8 |
1.7 |
GO:0036496 |
regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.8 |
1.7 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.8 |
4.2 |
GO:1900425 |
negative regulation of defense response to bacterium(GO:1900425) |
| 0.8 |
0.8 |
GO:0070945 |
neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.8 |
2.5 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.8 |
2.5 |
GO:0010752 |
regulation of cGMP-mediated signaling(GO:0010752) |
| 0.8 |
6.6 |
GO:0042532 |
negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.8 |
0.8 |
GO:0060721 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.8 |
2.5 |
GO:0036058 |
filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.8 |
3.3 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.8 |
0.8 |
GO:0043585 |
nose morphogenesis(GO:0043585) |
| 0.8 |
2.4 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 0.8 |
0.8 |
GO:0036480 |
neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.8 |
3.2 |
GO:0010760 |
negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.8 |
8.1 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.8 |
8.1 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.8 |
3.2 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.8 |
2.4 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.8 |
2.4 |
GO:1903691 |
positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.8 |
2.4 |
GO:1903926 |
signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.8 |
2.4 |
GO:0035879 |
plasma membrane lactate transport(GO:0035879) |
| 0.8 |
3.1 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.8 |
1.6 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.8 |
5.5 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 0.8 |
2.3 |
GO:0018208 |
peptidyl-proline modification(GO:0018208) |
| 0.8 |
2.3 |
GO:1903028 |
positive regulation of opsonization(GO:1903028) |
| 0.8 |
1.5 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.8 |
2.3 |
GO:0014707 |
branchiomeric skeletal muscle development(GO:0014707) |
| 0.8 |
0.8 |
GO:1904580 |
regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.8 |
3.8 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.8 |
2.3 |
GO:0052047 |
interaction with other organism via secreted substance involved in symbiotic interaction(GO:0052047) |
| 0.8 |
0.8 |
GO:0032330 |
regulation of chondrocyte differentiation(GO:0032330) |
| 0.8 |
3.8 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.8 |
2.3 |
GO:0045210 |
FasL biosynthetic process(GO:0045210) |
| 0.8 |
3.0 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.8 |
2.3 |
GO:0009258 |
10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.8 |
3.0 |
GO:0019264 |
glycine biosynthetic process from serine(GO:0019264) |
| 0.8 |
2.3 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.8 |
2.3 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.8 |
3.0 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.8 |
12.0 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.7 |
9.0 |
GO:0060083 |
smooth muscle contraction involved in micturition(GO:0060083) |
| 0.7 |
10.5 |
GO:2000587 |
negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.7 |
3.0 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 0.7 |
5.2 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 0.7 |
2.2 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.7 |
4.4 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.7 |
3.0 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.7 |
6.6 |
GO:0036010 |
protein localization to endosome(GO:0036010) |
| 0.7 |
4.4 |
GO:0044878 |
mitotic cytokinesis checkpoint(GO:0044878) |
| 0.7 |
1.5 |
GO:0060426 |
lung vasculature development(GO:0060426) |
| 0.7 |
2.9 |
GO:1902766 |
skeletal muscle satellite cell migration(GO:1902766) |
| 0.7 |
5.1 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.7 |
5.8 |
GO:1903593 |
regulation of histamine secretion by mast cell(GO:1903593) |
| 0.7 |
3.6 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.7 |
0.7 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 0.7 |
4.4 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.7 |
2.2 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.7 |
0.7 |
GO:1901079 |
positive regulation of relaxation of muscle(GO:1901079) |
| 0.7 |
0.7 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.7 |
2.1 |
GO:0019285 |
glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.7 |
2.8 |
GO:0019427 |
acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.7 |
3.6 |
GO:0099590 |
neurotransmitter receptor internalization(GO:0099590) |
| 0.7 |
1.4 |
GO:0033625 |
positive regulation of integrin activation(GO:0033625) |
| 0.7 |
1.4 |
GO:0051665 |
membrane raft localization(GO:0051665) |
| 0.7 |
2.8 |
GO:0017198 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.7 |
2.1 |
GO:0038026 |
reelin-mediated signaling pathway(GO:0038026) |
| 0.7 |
0.7 |
GO:0002717 |
positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.7 |
3.5 |
GO:0033274 |
response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.7 |
2.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.7 |
2.1 |
GO:0021586 |
pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.7 |
4.2 |
GO:0007079 |
mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.7 |
14.5 |
GO:0035589 |
G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.7 |
6.9 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.7 |
4.1 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.7 |
2.1 |
GO:0072186 |
metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) |
| 0.7 |
7.6 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.7 |
1.4 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.7 |
2.7 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.7 |
0.7 |
GO:0019249 |
lactate biosynthetic process(GO:0019249) |
| 0.7 |
2.7 |
GO:0046340 |
diacylglycerol catabolic process(GO:0046340) |
| 0.7 |
4.8 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.7 |
4.8 |
GO:0021842 |
directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.7 |
4.1 |
GO:0009082 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.7 |
8.8 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.7 |
0.7 |
GO:0002826 |
negative regulation of T-helper 1 type immune response(GO:0002826) negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.7 |
3.3 |
GO:0071492 |
cellular response to UV-A(GO:0071492) |
| 0.7 |
1.3 |
GO:1904338 |
regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.7 |
10.0 |
GO:0014041 |
regulation of neuron maturation(GO:0014041) |
| 0.7 |
4.7 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.7 |
6.7 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.7 |
2.0 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.7 |
5.3 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.7 |
2.7 |
GO:0044501 |
modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.7 |
0.7 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.7 |
4.0 |
GO:0098887 |
neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) |
| 0.7 |
2.0 |
GO:0035625 |
epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.7 |
2.6 |
GO:0032185 |
septin cytoskeleton organization(GO:0032185) |
| 0.7 |
0.7 |
GO:0050717 |
positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.7 |
3.3 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.7 |
2.6 |
GO:0070141 |
response to UV-A(GO:0070141) |
| 0.6 |
10.4 |
GO:0007172 |
signal complex assembly(GO:0007172) |
| 0.6 |
0.6 |
GO:0060081 |
membrane hyperpolarization(GO:0060081) |
| 0.6 |
1.9 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.6 |
0.6 |
GO:0032425 |
positive regulation of mismatch repair(GO:0032425) |
| 0.6 |
3.9 |
GO:0050666 |
regulation of sulfur amino acid metabolic process(GO:0031335) regulation of homocysteine metabolic process(GO:0050666) |
| 0.6 |
0.6 |
GO:0060455 |
negative regulation of gastric acid secretion(GO:0060455) |
| 0.6 |
2.6 |
GO:0021564 |
vagus nerve development(GO:0021564) |
| 0.6 |
28.1 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.6 |
2.6 |
GO:1904448 |
negative regulation of gamma-aminobutyric acid secretion(GO:0014053) aspartate secretion(GO:0061528) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.6 |
14.0 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.6 |
4.5 |
GO:1902746 |
regulation of lens fiber cell differentiation(GO:1902746) |
| 0.6 |
1.9 |
GO:0045359 |
positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.6 |
0.6 |
GO:0006565 |
L-serine catabolic process(GO:0006565) |
| 0.6 |
5.1 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.6 |
1.3 |
GO:0006975 |
DNA damage induced protein phosphorylation(GO:0006975) |
| 0.6 |
1.3 |
GO:0070859 |
positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.6 |
2.5 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.6 |
5.0 |
GO:0046078 |
pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) dUMP metabolic process(GO:0046078) |
| 0.6 |
1.8 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.6 |
3.1 |
GO:0030047 |
actin modification(GO:0030047) |
| 0.6 |
1.8 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.6 |
1.8 |
GO:0021938 |
ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.6 |
3.7 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.6 |
6.7 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.6 |
3.1 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.6 |
7.9 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.6 |
4.3 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.6 |
2.4 |
GO:1902044 |
regulation of Fas signaling pathway(GO:1902044) |
| 0.6 |
1.2 |
GO:0002625 |
regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.6 |
4.2 |
GO:0043622 |
cortical microtubule organization(GO:0043622) |
| 0.6 |
6.7 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.6 |
6.7 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.6 |
4.8 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.6 |
3.0 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.6 |
0.6 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.6 |
1.2 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.6 |
2.4 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.6 |
3.0 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.6 |
1.2 |
GO:0035507 |
regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.6 |
3.6 |
GO:0006366 |
transcription from RNA polymerase II promoter(GO:0006366) |
| 0.6 |
0.6 |
GO:1903423 |
positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.6 |
8.3 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.6 |
3.5 |
GO:0051918 |
negative regulation of fibrinolysis(GO:0051918) |
| 0.6 |
29.6 |
GO:0046580 |
negative regulation of Ras protein signal transduction(GO:0046580) |
| 0.6 |
3.5 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.6 |
2.4 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.6 |
0.6 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 0.6 |
0.6 |
GO:1901078 |
negative regulation of relaxation of muscle(GO:1901078) |
| 0.6 |
0.6 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.6 |
4.1 |
GO:1904417 |
regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.6 |
1.2 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.6 |
1.8 |
GO:0035672 |
oligopeptide transmembrane transport(GO:0035672) |
| 0.6 |
1.7 |
GO:0007538 |
primary sex determination(GO:0007538) |
| 0.6 |
0.6 |
GO:0006971 |
hypotonic response(GO:0006971) |
| 0.6 |
4.0 |
GO:0051461 |
positive regulation of corticotropin secretion(GO:0051461) |
| 0.6 |
1.2 |
GO:0048550 |
negative regulation of pinocytosis(GO:0048550) |
| 0.6 |
4.0 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.6 |
0.6 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.6 |
1.7 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.6 |
5.2 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.6 |
1.1 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.6 |
6.9 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.6 |
2.9 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.6 |
6.3 |
GO:0043320 |
natural killer cell degranulation(GO:0043320) |
| 0.6 |
3.4 |
GO:0014051 |
gamma-aminobutyric acid secretion(GO:0014051) |
| 0.6 |
5.1 |
GO:0032495 |
response to muramyl dipeptide(GO:0032495) |
| 0.6 |
0.6 |
GO:0051414 |
response to cortisol(GO:0051414) |
| 0.6 |
0.6 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.6 |
2.8 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.6 |
0.6 |
GO:0043006 |
activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.6 |
0.6 |
GO:0009256 |
10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.6 |
1.1 |
GO:0050807 |
regulation of synapse organization(GO:0050807) |
| 0.6 |
3.3 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.6 |
7.8 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.6 |
3.9 |
GO:0044387 |
negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.6 |
4.4 |
GO:0097039 |
protein linear polyubiquitination(GO:0097039) |
| 0.6 |
1.1 |
GO:1905049 |
negative regulation of metallopeptidase activity(GO:1905049) |
| 0.6 |
1.7 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.5 |
2.2 |
GO:0071484 |
cellular response to light intensity(GO:0071484) |
| 0.5 |
2.2 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.5 |
2.7 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.5 |
4.9 |
GO:0032966 |
negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.5 |
3.8 |
GO:0090178 |
regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) |
| 0.5 |
3.8 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.5 |
2.2 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.5 |
1.6 |
GO:1902490 |
regulation of sperm capacitation(GO:1902490) |
| 0.5 |
1.6 |
GO:0038195 |
urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.5 |
1.6 |
GO:0060265 |
positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 0.5 |
1.6 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.5 |
6.9 |
GO:0016601 |
Rac protein signal transduction(GO:0016601) |
| 0.5 |
2.1 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.5 |
0.5 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.5 |
0.5 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.5 |
0.5 |
GO:1902744 |
negative regulation of lamellipodium organization(GO:1902744) |
| 0.5 |
2.1 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.5 |
1.6 |
GO:0072719 |
cellular response to cisplatin(GO:0072719) |
| 0.5 |
1.1 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.5 |
6.3 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.5 |
3.7 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.5 |
1.6 |
GO:1903697 |
negative regulation of microvillus assembly(GO:1903697) |
| 0.5 |
6.8 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.5 |
0.5 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.5 |
1.6 |
GO:0034201 |
response to oleic acid(GO:0034201) |
| 0.5 |
0.5 |
GO:0071877 |
regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.5 |
1.6 |
GO:0002439 |
chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.5 |
11.0 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.5 |
0.5 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.5 |
2.1 |
GO:0042747 |
circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.5 |
2.6 |
GO:1904674 |
positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.5 |
4.1 |
GO:0001780 |
neutrophil homeostasis(GO:0001780) |
| 0.5 |
4.1 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.5 |
3.1 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 0.5 |
1.0 |
GO:0032641 |
lymphotoxin A production(GO:0032641) lymphotoxin A biosynthetic process(GO:0042109) |
| 0.5 |
1.5 |
GO:0070142 |
synaptic vesicle budding(GO:0070142) |
| 0.5 |
2.1 |
GO:0002090 |
regulation of receptor internalization(GO:0002090) |
| 0.5 |
1.5 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.5 |
3.1 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 |
2.0 |
GO:0021559 |
trigeminal nerve development(GO:0021559) |
| 0.5 |
2.6 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.5 |
2.0 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.5 |
1.0 |
GO:0001172 |
transcription, RNA-templated(GO:0001172) |
| 0.5 |
2.0 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.5 |
1.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.5 |
1.0 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.5 |
0.5 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.5 |
7.0 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.5 |
3.0 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.5 |
2.5 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.5 |
2.5 |
GO:0018243 |
protein O-linked glycosylation via threonine(GO:0018243) |
| 0.5 |
1.0 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.5 |
2.0 |
GO:0036269 |
swimming behavior(GO:0036269) |
| 0.5 |
2.5 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.5 |
1.0 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.5 |
7.4 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.5 |
3.0 |
GO:0009113 |
purine nucleobase biosynthetic process(GO:0009113) |
| 0.5 |
2.5 |
GO:0001706 |
endoderm formation(GO:0001706) |
| 0.5 |
0.5 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.5 |
1.5 |
GO:0042270 |
protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.5 |
1.5 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.5 |
14.7 |
GO:0030517 |
negative regulation of axon extension(GO:0030517) |
| 0.5 |
1.0 |
GO:0071158 |
positive regulation of cell cycle arrest(GO:0071158) |
| 0.5 |
9.3 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.5 |
0.5 |
GO:0003241 |
growth involved in heart morphogenesis(GO:0003241) |
| 0.5 |
4.4 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.5 |
2.4 |
GO:0035811 |
negative regulation of urine volume(GO:0035811) |
| 0.5 |
3.9 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.5 |
2.9 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.5 |
1.5 |
GO:0097051 |
establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.5 |
1.0 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.5 |
2.4 |
GO:0003322 |
pancreatic A cell development(GO:0003322) |
| 0.5 |
1.4 |
GO:0098746 |
fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.5 |
2.9 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
10.6 |
GO:0035767 |
endothelial cell chemotaxis(GO:0035767) |
| 0.5 |
6.2 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.5 |
1.0 |
GO:1905123 |
regulation of glucosylceramidase activity(GO:1905123) |
| 0.5 |
17.2 |
GO:0061620 |
glycolytic process through fructose-6-phosphate(GO:0061615) glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.5 |
3.3 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.5 |
2.4 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.5 |
1.4 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.5 |
6.6 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.5 |
2.4 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) |
| 0.5 |
7.1 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.5 |
1.9 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.5 |
1.9 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.5 |
2.3 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.5 |
1.9 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.5 |
0.9 |
GO:0021812 |
neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.5 |
7.9 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.5 |
2.8 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.5 |
0.9 |
GO:0002384 |
hepatic immune response(GO:0002384) |
| 0.5 |
6.9 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.5 |
1.4 |
GO:0097187 |
dentinogenesis(GO:0097187) |
| 0.5 |
0.9 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 |
2.3 |
GO:0090306 |
spindle assembly involved in meiosis(GO:0090306) |
| 0.5 |
1.4 |
GO:2000354 |
regulation of ovarian follicle development(GO:2000354) |
| 0.5 |
3.2 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.5 |
1.4 |
GO:1903243 |
negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.5 |
0.5 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.5 |
4.6 |
GO:0045717 |
negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.5 |
3.7 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.5 |
1.8 |
GO:0036510 |
trimming of terminal mannose on C branch(GO:0036510) |
| 0.5 |
0.5 |
GO:0002543 |
activation of blood coagulation via clotting cascade(GO:0002543) |
| 0.5 |
0.5 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 0.5 |
1.4 |
GO:0030968 |
endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.5 |
9.5 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.5 |
4.1 |
GO:0007256 |
activation of JNKK activity(GO:0007256) |
| 0.5 |
5.9 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.5 |
6.3 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.4 |
22.9 |
GO:0050690 |
regulation of defense response to virus by virus(GO:0050690) |
| 0.4 |
1.8 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) inositol phosphate-mediated signaling(GO:0048016) |
| 0.4 |
1.3 |
GO:0000117 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.4 |
1.3 |
GO:0021503 |
neural fold bending(GO:0021503) |
| 0.4 |
3.1 |
GO:0009972 |
cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.4 |
2.7 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.4 |
0.4 |
GO:0090259 |
regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 0.4 |
4.9 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.4 |
3.1 |
GO:0006537 |
glutamate biosynthetic process(GO:0006537) |
| 0.4 |
1.3 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 0.4 |
2.7 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.4 |
4.8 |
GO:0010968 |
regulation of microtubule nucleation(GO:0010968) |
| 0.4 |
1.3 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.4 |
1.8 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.4 |
21.9 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.4 |
0.9 |
GO:0039534 |
negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.4 |
1.7 |
GO:0003335 |
corneocyte development(GO:0003335) |
| 0.4 |
1.3 |
GO:0035054 |
embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.4 |
0.9 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.4 |
20.4 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.4 |
6.1 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.4 |
7.4 |
GO:0019371 |
cyclooxygenase pathway(GO:0019371) |
| 0.4 |
5.2 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.4 |
4.7 |
GO:0010991 |
regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.4 |
5.2 |
GO:0045078 |
positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.4 |
0.9 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.4 |
3.9 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.4 |
4.7 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.4 |
0.4 |
GO:0031000 |
response to caffeine(GO:0031000) |
| 0.4 |
0.4 |
GO:0071362 |
cellular response to ether(GO:0071362) |
| 0.4 |
0.4 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.4 |
1.7 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.4 |
2.1 |
GO:0042631 |
cellular response to water deprivation(GO:0042631) |
| 0.4 |
0.4 |
GO:0034694 |
response to prostaglandin(GO:0034694) |
| 0.4 |
2.1 |
GO:0044571 |
[2Fe-2S] cluster assembly(GO:0044571) |
| 0.4 |
2.5 |
GO:0038172 |
interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.4 |
1.7 |
GO:0042853 |
L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.4 |
14.2 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.4 |
0.4 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.4 |
1.7 |
GO:0033686 |
positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.4 |
8.3 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.4 |
0.4 |
GO:0048850 |
hypophysis morphogenesis(GO:0048850) |
| 0.4 |
2.5 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.4 |
0.4 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.4 |
0.8 |
GO:0086042 |
cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.4 |
2.1 |
GO:0021936 |
regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.4 |
7.0 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.4 |
1.2 |
GO:0006007 |
glucose catabolic process(GO:0006007) |
| 0.4 |
1.2 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.4 |
0.4 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.4 |
1.6 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.4 |
1.2 |
GO:0090149 |
mitochondrial membrane fission(GO:0090149) |
| 0.4 |
0.4 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.4 |
0.8 |
GO:0032196 |
transposition(GO:0032196) |
| 0.4 |
2.4 |
GO:0009407 |
toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.4 |
0.8 |
GO:0060484 |
lung-associated mesenchyme development(GO:0060484) |
| 0.4 |
1.2 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.4 |
0.8 |
GO:1900273 |
positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.4 |
1.2 |
GO:0045591 |
positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.4 |
0.4 |
GO:0009822 |
alkaloid catabolic process(GO:0009822) |
| 0.4 |
1.6 |
GO:0010269 |
response to selenium ion(GO:0010269) |
| 0.4 |
0.8 |
GO:0060585 |
regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.4 |
0.4 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 0.4 |
2.0 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.4 |
2.0 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 0.4 |
1.2 |
GO:0018199 |
peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) peptidyl-glutamine modification(GO:0018199) |
| 0.4 |
1.6 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) |
| 0.4 |
0.8 |
GO:0014848 |
urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.4 |
1.6 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.4 |
1.6 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 |
4.3 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.4 |
1.6 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.4 |
1.2 |
GO:0070120 |
ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.4 |
1.6 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.4 |
2.3 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.4 |
0.8 |
GO:0038123 |
toll-like receptor TLR1:TLR2 signaling pathway(GO:0038123) response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.4 |
5.5 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.4 |
1.2 |
GO:0042137 |
sequestering of neurotransmitter(GO:0042137) |
| 0.4 |
1.2 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.4 |
3.9 |
GO:0098734 |
macromolecule depalmitoylation(GO:0098734) |
| 0.4 |
3.1 |
GO:0002329 |
pre-B cell differentiation(GO:0002329) |
| 0.4 |
6.2 |
GO:0001556 |
oocyte maturation(GO:0001556) |
| 0.4 |
0.8 |
GO:0060319 |
primitive erythrocyte differentiation(GO:0060319) |
| 0.4 |
2.3 |
GO:2000252 |
negative regulation of feeding behavior(GO:2000252) |
| 0.4 |
1.1 |
GO:0031125 |
rRNA 3'-end processing(GO:0031125) |
| 0.4 |
1.5 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.4 |
0.8 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.4 |
1.9 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.4 |
5.7 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.4 |
4.9 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.4 |
3.0 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.4 |
1.9 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.4 |
0.4 |
GO:0060940 |
epithelial to mesenchymal transition involved in cardiac fibroblast development(GO:0060940) |
| 0.4 |
3.0 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.4 |
4.1 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.4 |
4.5 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.4 |
1.1 |
GO:0070970 |
interleukin-2 secretion(GO:0070970) |
| 0.4 |
2.2 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.4 |
2.9 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.4 |
4.4 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.4 |
2.2 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.4 |
4.8 |
GO:0030502 |
negative regulation of bone mineralization(GO:0030502) |
| 0.4 |
8.0 |
GO:0000281 |
mitotic cytokinesis(GO:0000281) |
| 0.4 |
4.0 |
GO:0018202 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.4 |
1.8 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.4 |
2.2 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.4 |
0.7 |
GO:0010728 |
regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.4 |
0.7 |
GO:0071451 |
cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.4 |
4.4 |
GO:0050965 |
detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.4 |
2.5 |
GO:0035898 |
parathyroid hormone secretion(GO:0035898) |
| 0.4 |
2.9 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.4 |
1.4 |
GO:0010816 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.4 |
2.5 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.4 |
5.0 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.4 |
3.6 |
GO:0035634 |
response to stilbenoid(GO:0035634) |
| 0.4 |
1.1 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.4 |
0.4 |
GO:0061303 |
cornea development in camera-type eye(GO:0061303) |
| 0.4 |
0.4 |
GO:0010749 |
regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.4 |
0.4 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.4 |
2.9 |
GO:0010724 |
regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.4 |
1.8 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.4 |
1.4 |
GO:0071651 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.4 |
1.4 |
GO:1904647 |
response to rotenone(GO:1904647) |
| 0.4 |
1.8 |
GO:1904179 |
positive regulation of adipose tissue development(GO:1904179) |
| 0.4 |
0.7 |
GO:0001992 |
regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.4 |
0.4 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.4 |
2.1 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.4 |
2.8 |
GO:0001542 |
ovulation from ovarian follicle(GO:0001542) |
| 0.4 |
2.1 |
GO:0007528 |
neuromuscular junction development(GO:0007528) |
| 0.4 |
37.6 |
GO:0070268 |
cornification(GO:0070268) |
| 0.4 |
1.8 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.4 |
15.1 |
GO:0042339 |
keratan sulfate metabolic process(GO:0042339) |
| 0.3 |
0.7 |
GO:0009757 |
hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.3 |
1.0 |
GO:0007198 |
adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.3 |
0.7 |
GO:0060574 |
intestinal epithelial cell maturation(GO:0060574) |
| 0.3 |
1.4 |
GO:0009225 |
nucleotide-sugar metabolic process(GO:0009225) |
| 0.3 |
1.7 |
GO:0019556 |
histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.3 |
0.7 |
GO:1904751 |
positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.3 |
3.1 |
GO:0046135 |
pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.3 |
4.5 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.3 |
0.3 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) optic nerve structural organization(GO:0021633) |
| 0.3 |
1.7 |
GO:0002666 |
positive regulation of T cell tolerance induction(GO:0002666) |
| 0.3 |
1.7 |
GO:0071442 |
positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.3 |
1.4 |
GO:0001806 |
type IV hypersensitivity(GO:0001806) |
| 0.3 |
0.7 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.3 |
1.4 |
GO:2000543 |
positive regulation of gastrulation(GO:2000543) |
| 0.3 |
2.1 |
GO:0072025 |
distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) |
| 0.3 |
5.4 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.3 |
1.7 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
2.4 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.3 |
3.7 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.3 |
1.7 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.3 |
1.7 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.3 |
1.3 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.3 |
2.3 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.3 |
0.3 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.3 |
1.0 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.3 |
2.0 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.3 |
2.6 |
GO:0001845 |
phagolysosome assembly(GO:0001845) |
| 0.3 |
1.7 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) |
| 0.3 |
2.0 |
GO:0060215 |
primitive hemopoiesis(GO:0060215) |
| 0.3 |
0.7 |
GO:0001927 |
exocyst assembly(GO:0001927) |
| 0.3 |
0.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.3 |
4.9 |
GO:0032292 |
myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.3 |
0.7 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.3 |
1.0 |
GO:0090287 |
regulation of cellular response to growth factor stimulus(GO:0090287) |
| 0.3 |
4.9 |
GO:0016242 |
negative regulation of macroautophagy(GO:0016242) |
| 0.3 |
0.3 |
GO:1902527 |
positive regulation of protein monoubiquitination(GO:1902527) |
| 0.3 |
1.3 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.3 |
0.7 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.3 |
1.6 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 |
1.0 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.3 |
1.3 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
0.3 |
GO:0010652 |
regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.3 |
3.2 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.3 |
8.4 |
GO:0046627 |
negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.3 |
0.3 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.3 |
2.3 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.3 |
0.6 |
GO:0006554 |
lysine catabolic process(GO:0006554) |
| 0.3 |
3.5 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.3 |
0.3 |
GO:1903433 |
regulation of constitutive secretory pathway(GO:1903433) |
| 0.3 |
1.6 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.3 |
2.9 |
GO:1900004 |
negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.3 |
0.3 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.3 |
2.6 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.3 |
1.0 |
GO:0072579 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.3 |
7.7 |
GO:1900087 |
positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.3 |
0.6 |
GO:0033602 |
negative regulation of dopamine secretion(GO:0033602) |
| 0.3 |
1.6 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.3 |
1.6 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.3 |
0.6 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.3 |
1.6 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.3 |
1.3 |
GO:0030728 |
ovulation(GO:0030728) |
| 0.3 |
3.1 |
GO:0035385 |
Roundabout signaling pathway(GO:0035385) |
| 0.3 |
0.9 |
GO:0032103 |
positive regulation of response to external stimulus(GO:0032103) |
| 0.3 |
15.7 |
GO:0008088 |
axo-dendritic transport(GO:0008088) |
| 0.3 |
0.9 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.3 |
1.3 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.3 |
0.6 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) demethylation(GO:0070988) |
| 0.3 |
1.9 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.3 |
2.5 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.3 |
1.2 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.3 |
0.9 |
GO:0030432 |
peristalsis(GO:0030432) |
| 0.3 |
11.2 |
GO:1902850 |
microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.3 |
14.8 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.3 |
0.9 |
GO:0060022 |
hard palate development(GO:0060022) |
| 0.3 |
0.3 |
GO:0035412 |
regulation of catenin import into nucleus(GO:0035412) |
| 0.3 |
0.9 |
GO:0048752 |
semicircular canal morphogenesis(GO:0048752) |
| 0.3 |
1.2 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.3 |
8.9 |
GO:0014046 |
dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.3 |
0.9 |
GO:0006424 |
glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.3 |
3.4 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.3 |
1.2 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.3 |
0.9 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.3 |
0.6 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.3 |
0.6 |
GO:0006425 |
glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.3 |
4.0 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.3 |
0.6 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.3 |
1.2 |
GO:0019856 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 |
0.3 |
GO:0032410 |
negative regulation of transporter activity(GO:0032410) |
| 0.3 |
0.3 |
GO:1903898 |
negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.3 |
5.4 |
GO:0007176 |
regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.3 |
1.8 |
GO:2000609 |
regulation of thyroid hormone generation(GO:2000609) |
| 0.3 |
8.1 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.3 |
1.8 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.3 |
1.2 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.3 |
4.8 |
GO:0090140 |
regulation of mitochondrial fission(GO:0090140) |
| 0.3 |
0.9 |
GO:1904729 |
negative regulation of intestinal phytosterol absorption(GO:0010949) regulation of intestinal cholesterol absorption(GO:0030300) negative regulation of intestinal cholesterol absorption(GO:0045796) intestinal phytosterol absorption(GO:0060752) regulation of intestinal lipid absorption(GO:1904729) negative regulation of intestinal lipid absorption(GO:1904730) |
| 0.3 |
2.1 |
GO:0010642 |
negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
| 0.3 |
1.8 |
GO:0072526 |
pyridine-containing compound catabolic process(GO:0072526) |
| 0.3 |
9.9 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 |
0.6 |
GO:1900155 |
regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.3 |
0.9 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 |
6.0 |
GO:0034656 |
nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.3 |
0.6 |
GO:0014034 |
neural crest cell fate commitment(GO:0014034) |
| 0.3 |
0.9 |
GO:1901873 |
regulation of post-translational protein modification(GO:1901873) |
| 0.3 |
1.2 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.3 |
0.3 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.3 |
0.6 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.3 |
3.0 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.3 |
18.0 |
GO:0030049 |
muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.3 |
3.5 |
GO:0090168 |
Golgi reassembly(GO:0090168) |
| 0.3 |
1.2 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.3 |
0.6 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.3 |
0.3 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 0.3 |
0.9 |
GO:0032252 |
secretory granule localization(GO:0032252) |
| 0.3 |
0.9 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.3 |
0.9 |
GO:1905205 |
positive regulation of connective tissue replacement(GO:1905205) |
| 0.3 |
2.0 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.3 |
1.7 |
GO:0032069 |
regulation of nuclease activity(GO:0032069) |
| 0.3 |
2.0 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.3 |
1.7 |
GO:0006929 |
substrate-dependent cell migration(GO:0006929) |
| 0.3 |
1.7 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.3 |
1.2 |
GO:1903969 |
mammary gland fat development(GO:0060611) regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) regulation of response to macrophage colony-stimulating factor(GO:1903969) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) positive regulation of microglial cell migration(GO:1904141) |
| 0.3 |
0.3 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.3 |
1.4 |
GO:0007135 |
meiosis II(GO:0007135) |
| 0.3 |
1.2 |
GO:0001828 |
inner cell mass cellular morphogenesis(GO:0001828) |
| 0.3 |
2.0 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.3 |
2.0 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.3 |
0.9 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.3 |
0.3 |
GO:1903903 |
regulation of establishment of T cell polarity(GO:1903903) |
| 0.3 |
0.3 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.3 |
9.1 |
GO:1904659 |
hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.3 |
2.0 |
GO:0071806 |
protein transmembrane transport(GO:0071806) |
| 0.3 |
0.6 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.3 |
0.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.3 |
0.8 |
GO:0035304 |
regulation of protein dephosphorylation(GO:0035304) |
| 0.3 |
0.3 |
GO:1903555 |
regulation of tumor necrosis factor superfamily cytokine production(GO:1903555) |
| 0.3 |
1.1 |
GO:0000050 |
urea cycle(GO:0000050) |
| 0.3 |
0.3 |
GO:0072114 |
pronephros morphogenesis(GO:0072114) |
| 0.3 |
1.9 |
GO:0035690 |
cellular response to drug(GO:0035690) |
| 0.3 |
1.4 |
GO:0051149 |
positive regulation of muscle cell differentiation(GO:0051149) |
| 0.3 |
0.8 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.3 |
4.1 |
GO:0010919 |
regulation of inositol phosphate biosynthetic process(GO:0010919) |
| 0.3 |
0.6 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.3 |
0.8 |
GO:1900453 |
negative regulation of long term synaptic depression(GO:1900453) |
| 0.3 |
0.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.3 |
0.5 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.3 |
7.4 |
GO:0045776 |
negative regulation of blood pressure(GO:0045776) |
| 0.3 |
1.1 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
4.1 |
GO:1903861 |
positive regulation of dendrite extension(GO:1903861) |
| 0.3 |
1.4 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.3 |
0.5 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.3 |
0.8 |
GO:0048266 |
behavioral response to pain(GO:0048266) |
| 0.3 |
0.8 |
GO:0010458 |
exit from mitosis(GO:0010458) |
| 0.3 |
2.2 |
GO:0032700 |
negative regulation of interleukin-17 production(GO:0032700) |
| 0.3 |
0.3 |
GO:0090345 |
cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.3 |
5.9 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.3 |
8.8 |
GO:0033046 |
negative regulation of sister chromatid segregation(GO:0033046) negative regulation of chromosome segregation(GO:0051985) |
| 0.3 |
1.1 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.3 |
0.3 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.3 |
0.8 |
GO:0009443 |
pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.3 |
0.5 |
GO:0032096 |
negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.3 |
0.8 |
GO:0090116 |
C-5 methylation of cytosine(GO:0090116) |
| 0.3 |
0.5 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.3 |
0.5 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.3 |
14.0 |
GO:0003254 |
regulation of membrane depolarization(GO:0003254) |
| 0.3 |
0.3 |
GO:0071306 |
cellular response to vitamin E(GO:0071306) |
| 0.3 |
0.3 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.3 |
0.3 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.3 |
2.6 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.3 |
11.5 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) |
| 0.3 |
1.0 |
GO:1904354 |
negative regulation of telomere capping(GO:1904354) |
| 0.3 |
1.6 |
GO:0045104 |
intermediate filament cytoskeleton organization(GO:0045104) |
| 0.3 |
2.1 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 |
1.6 |
GO:1901908 |
diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.3 |
0.5 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.3 |
1.0 |
GO:0009227 |
nucleotide-sugar catabolic process(GO:0009227) |
| 0.3 |
19.7 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.3 |
0.8 |
GO:0002881 |
microglial cell activation involved in immune response(GO:0002282) negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.3 |
1.0 |
GO:0090009 |
primitive streak formation(GO:0090009) |
| 0.3 |
5.2 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.3 |
1.8 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.3 |
0.5 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.3 |
0.3 |
GO:0043931 |
ossification involved in bone maturation(GO:0043931) |
| 0.3 |
0.5 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.3 |
0.5 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.3 |
0.8 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.3 |
1.8 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 0.3 |
0.8 |
GO:1904328 |
regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.3 |
1.3 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.3 |
10.5 |
GO:0035036 |
sperm-egg recognition(GO:0035036) |
| 0.3 |
0.8 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.3 |
0.8 |
GO:0007271 |
synaptic transmission, cholinergic(GO:0007271) |
| 0.3 |
1.3 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.3 |
1.0 |
GO:0070266 |
necroptotic process(GO:0070266) |
| 0.3 |
1.8 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.3 |
1.3 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.3 |
1.0 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.3 |
1.8 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.3 |
0.5 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.3 |
0.3 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.2 |
0.7 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 |
1.5 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.2 |
1.7 |
GO:0090160 |
Golgi to lysosome transport(GO:0090160) |
| 0.2 |
0.7 |
GO:0090175 |
regulation of establishment of planar polarity(GO:0090175) |
| 0.2 |
5.0 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.2 |
0.7 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 |
0.5 |
GO:0030101 |
natural killer cell activation(GO:0030101) |
| 0.2 |
2.5 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
1.2 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.2 |
1.2 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.2 |
2.9 |
GO:0071526 |
semaphorin-plexin signaling pathway(GO:0071526) |
| 0.2 |
3.2 |
GO:0035728 |
response to hepatocyte growth factor(GO:0035728) |
| 0.2 |
0.7 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.2 |
2.4 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 |
0.2 |
GO:0097252 |
renal protein absorption(GO:0097017) oligodendrocyte apoptotic process(GO:0097252) |
| 0.2 |
0.7 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.2 |
0.7 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.2 |
1.0 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.2 |
0.5 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.2 |
2.4 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.2 |
2.7 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 |
3.9 |
GO:2001197 |
regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.2 |
0.2 |
GO:0046833 |
positive regulation of RNA export from nucleus(GO:0046833) |
| 0.2 |
1.0 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 0.2 |
2.4 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.2 |
3.6 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.2 |
0.5 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.2 |
0.5 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.2 |
0.7 |
GO:0060474 |
positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.2 |
0.9 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.2 |
0.7 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 |
1.7 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.2 |
0.9 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.2 |
0.9 |
GO:1903597 |
negative regulation of gap junction assembly(GO:1903597) |
| 0.2 |
3.8 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
1.6 |
GO:0045176 |
apical protein localization(GO:0045176) |
| 0.2 |
3.3 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.2 |
4.7 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.2 |
4.0 |
GO:1901385 |
regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.2 |
0.2 |
GO:1900449 |
regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.2 |
5.4 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.2 |
0.9 |
GO:0045950 |
regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
| 0.2 |
0.7 |
GO:0090675 |
intermicrovillar adhesion(GO:0090675) |
| 0.2 |
1.6 |
GO:0048845 |
venous blood vessel morphogenesis(GO:0048845) |
| 0.2 |
0.7 |
GO:0045415 |
negative regulation of interleukin-8 biosynthetic process(GO:0045415) negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.2 |
0.5 |
GO:0048537 |
mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.2 |
0.5 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.2 |
5.5 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 |
1.4 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 |
0.7 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.2 |
1.1 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.2 |
0.9 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.2 |
1.1 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.2 |
0.2 |
GO:0007518 |
myoblast fate determination(GO:0007518) |
| 0.2 |
4.3 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.2 |
0.2 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.2 |
1.6 |
GO:1902743 |
regulation of lamellipodium organization(GO:1902743) |
| 0.2 |
0.9 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.2 |
2.0 |
GO:0071498 |
cellular response to fluid shear stress(GO:0071498) |
| 0.2 |
2.7 |
GO:0036124 |
histone H3-K9 trimethylation(GO:0036124) |
| 0.2 |
2.7 |
GO:1902592 |
viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.2 |
3.6 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.2 |
0.7 |
GO:0044376 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 |
0.4 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 |
1.1 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.2 |
0.4 |
GO:0051342 |
regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.2 |
0.7 |
GO:0033045 |
regulation of sister chromatid segregation(GO:0033045) |
| 0.2 |
0.7 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) |
| 0.2 |
2.0 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.2 |
0.2 |
GO:0060268 |
negative regulation of respiratory burst(GO:0060268) |
| 0.2 |
1.1 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.2 |
0.7 |
GO:0003358 |
noradrenergic neuron development(GO:0003358) |
| 0.2 |
1.1 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.2 |
0.2 |
GO:1902218 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) |
| 0.2 |
3.5 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.2 |
7.4 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.2 |
0.9 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.2 |
0.2 |
GO:0050653 |
chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.2 |
0.9 |
GO:0046035 |
CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.2 |
5.7 |
GO:2000300 |
regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.2 |
0.9 |
GO:0001881 |
receptor recycling(GO:0001881) |
| 0.2 |
0.9 |
GO:0010735 |
positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.2 |
0.4 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 |
1.1 |
GO:0090090 |
negative regulation of canonical Wnt signaling pathway(GO:0090090) |
| 0.2 |
1.1 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.2 |
16.2 |
GO:0000079 |
regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.2 |
0.4 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.2 |
0.2 |
GO:1904037 |
positive regulation of epithelial cell apoptotic process(GO:1904037) |
| 0.2 |
0.2 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.2 |
0.2 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.2 |
0.6 |
GO:0048213 |
Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.2 |
0.6 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 0.2 |
0.4 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 |
0.4 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.2 |
0.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 |
0.4 |
GO:0043418 |
homocysteine catabolic process(GO:0043418) |
| 0.2 |
1.5 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.2 |
18.0 |
GO:0009301 |
snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.2 |
0.6 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.2 |
0.8 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.2 |
0.8 |
GO:0097498 |
endothelial tube lumen extension(GO:0097498) |
| 0.2 |
4.5 |
GO:0043001 |
Golgi to plasma membrane protein transport(GO:0043001) |
| 0.2 |
1.4 |
GO:0060088 |
auditory receptor cell stereocilium organization(GO:0060088) |
| 0.2 |
0.4 |
GO:0050772 |
positive regulation of axonogenesis(GO:0050772) |
| 0.2 |
11.7 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.2 |
0.4 |
GO:1990138 |
neuron projection extension(GO:1990138) |
| 0.2 |
0.4 |
GO:0035313 |
wound healing, spreading of epidermal cells(GO:0035313) |
| 0.2 |
1.8 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.2 |
1.4 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 |
0.4 |
GO:1902172 |
keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.2 |
2.2 |
GO:0002098 |
tRNA wobble uridine modification(GO:0002098) |
| 0.2 |
1.0 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.2 |
1.2 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.2 |
0.4 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.2 |
0.8 |
GO:0044107 |
cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.2 |
0.4 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.2 |
0.4 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
0.6 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 |
5.2 |
GO:0061003 |
positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.2 |
1.2 |
GO:0061053 |
somite development(GO:0061053) |
| 0.2 |
1.4 |
GO:0050703 |
interleukin-1 alpha secretion(GO:0050703) |
| 0.2 |
0.8 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.2 |
0.4 |
GO:0010579 |
regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.2 |
4.0 |
GO:0045824 |
negative regulation of innate immune response(GO:0045824) |
| 0.2 |
1.4 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.2 |
0.2 |
GO:0002328 |
pro-B cell differentiation(GO:0002328) |
| 0.2 |
0.2 |
GO:0060841 |
venous blood vessel development(GO:0060841) |
| 0.2 |
2.5 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.2 |
1.0 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.2 |
0.2 |
GO:0043650 |
dicarboxylic acid biosynthetic process(GO:0043650) |
| 0.2 |
0.6 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.2 |
2.9 |
GO:0097435 |
fibril organization(GO:0097435) |
| 0.2 |
1.6 |
GO:0007189 |
adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.2 |
0.2 |
GO:1901988 |
negative regulation of cell cycle phase transition(GO:1901988) |
| 0.2 |
1.0 |
GO:0045109 |
intermediate filament organization(GO:0045109) |
| 0.2 |
0.6 |
GO:0010831 |
positive regulation of myotube differentiation(GO:0010831) |
| 0.2 |
1.5 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.2 |
0.8 |
GO:0060828 |
regulation of canonical Wnt signaling pathway(GO:0060828) |
| 0.2 |
7.1 |
GO:0042267 |
natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.2 |
0.4 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.2 |
1.5 |
GO:0021942 |
radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.2 |
1.7 |
GO:0045598 |
regulation of fat cell differentiation(GO:0045598) |
| 0.2 |
0.8 |
GO:0010793 |
regulation of mRNA export from nucleus(GO:0010793) |
| 0.2 |
3.0 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.2 |
9.5 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.2 |
0.2 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.2 |
0.6 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 |
0.2 |
GO:0033619 |
membrane protein proteolysis(GO:0033619) |
| 0.2 |
1.3 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.2 |
0.6 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
| 0.2 |
0.8 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 |
0.8 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.2 |
0.2 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 |
0.6 |
GO:1904640 |
response to methionine(GO:1904640) |
| 0.2 |
1.1 |
GO:0071711 |
basement membrane organization(GO:0071711) |
| 0.2 |
0.6 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.2 |
0.9 |
GO:0045651 |
positive regulation of macrophage differentiation(GO:0045651) |
| 0.2 |
0.7 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 |
1.1 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.2 |
0.7 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.2 |
0.9 |
GO:0035965 |
cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.2 |
0.7 |
GO:0033512 |
L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.2 |
2.0 |
GO:0061577 |
calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.2 |
0.4 |
GO:0080154 |
regulation of fertilization(GO:0080154) |
| 0.2 |
0.5 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.2 |
8.1 |
GO:0043928 |
exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.2 |
1.1 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.2 |
0.2 |
GO:0032609 |
interferon-gamma production(GO:0032609) |
| 0.2 |
0.2 |
GO:1902563 |
regulation of neutrophil activation(GO:1902563) |
| 0.2 |
0.5 |
GO:0060674 |
placenta blood vessel development(GO:0060674) |
| 0.2 |
0.5 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.2 |
0.4 |
GO:0060900 |
embryonic camera-type eye formation(GO:0060900) |
| 0.2 |
0.2 |
GO:0019448 |
cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.2 |
0.5 |
GO:0097475 |
motor neuron migration(GO:0097475) |
| 0.2 |
0.4 |
GO:2001225 |
regulation of chloride transport(GO:2001225) |
| 0.2 |
3.0 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.2 |
2.5 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.2 |
0.7 |
GO:0030282 |
bone mineralization(GO:0030282) |
| 0.2 |
0.2 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.2 |
0.2 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.2 |
1.4 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.2 |
0.3 |
GO:2001184 |
positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.2 |
0.9 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.2 |
0.2 |
GO:0009074 |
aromatic amino acid family catabolic process(GO:0009074) |
| 0.2 |
1.4 |
GO:0007207 |
phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.2 |
4.7 |
GO:0051496 |
positive regulation of stress fiber assembly(GO:0051496) |
| 0.2 |
0.3 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.2 |
0.7 |
GO:0055014 |
atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.2 |
0.3 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.2 |
0.3 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.2 |
0.5 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.2 |
0.2 |
GO:1904885 |
beta-catenin destruction complex assembly(GO:1904885) |
| 0.2 |
3.9 |
GO:0050919 |
negative chemotaxis(GO:0050919) |
| 0.2 |
0.5 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.2 |
0.5 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.2 |
1.0 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.2 |
1.2 |
GO:0033005 |
positive regulation of mast cell activation(GO:0033005) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.2 |
0.8 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.2 |
6.0 |
GO:0030834 |
regulation of actin filament depolymerization(GO:0030834) |
| 0.2 |
1.2 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.2 |
0.5 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.2 |
0.2 |
GO:0031443 |
fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.2 |
0.2 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.2 |
2.0 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.2 |
1.2 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.2 |
0.5 |
GO:0006625 |
protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.2 |
3.8 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.2 |
0.7 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.2 |
0.7 |
GO:0045586 |
regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.2 |
0.3 |
GO:0002428 |
antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.2 |
0.8 |
GO:0035878 |
nail development(GO:0035878) |
| 0.2 |
1.2 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.2 |
0.2 |
GO:2000861 |
estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.2 |
0.7 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.2 |
2.0 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.2 |
0.3 |
GO:0051923 |
sulfation(GO:0051923) |
| 0.2 |
1.1 |
GO:0070544 |
histone H3-K36 demethylation(GO:0070544) |
| 0.2 |
1.0 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
1.0 |
GO:0031061 |
negative regulation of histone methylation(GO:0031061) |
| 0.2 |
1.3 |
GO:0048569 |
post-embryonic organ development(GO:0048569) |
| 0.2 |
0.3 |
GO:0034351 |
regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.2 |
1.0 |
GO:0075044 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.2 |
4.7 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
1.0 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.2 |
0.3 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.2 |
0.8 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.2 |
0.2 |
GO:0010543 |
regulation of platelet activation(GO:0010543) |
| 0.2 |
1.1 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.2 |
1.6 |
GO:0009304 |
tRNA transcription(GO:0009304) |
| 0.2 |
1.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.2 |
6.3 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.2 |
3.4 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.2 |
1.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.2 |
0.2 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.2 |
8.6 |
GO:0030819 |
positive regulation of cAMP biosynthetic process(GO:0030819) |
| 0.2 |
2.0 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.2 |
1.2 |
GO:0097118 |
neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.2 |
0.2 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) |
| 0.2 |
0.8 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.2 |
0.2 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.2 |
0.3 |
GO:0071941 |
nitrogen cycle metabolic process(GO:0071941) |
| 0.2 |
0.3 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.2 |
0.2 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.2 |
0.9 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.2 |
0.9 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.2 |
0.2 |
GO:0050893 |
sensory processing(GO:0050893) |
| 0.2 |
0.9 |
GO:0046398 |
UDP-glucuronate biosynthetic process(GO:0006065) UDP-glucuronate metabolic process(GO:0046398) |
| 0.2 |
0.3 |
GO:0032679 |
TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) |
| 0.1 |
1.2 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 |
0.3 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.3 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
0.1 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 |
0.1 |
GO:0022410 |
circadian sleep/wake cycle process(GO:0022410) circadian sleep/wake cycle, sleep(GO:0050802) |
| 0.1 |
7.1 |
GO:0042147 |
retrograde transport, endosome to Golgi(GO:0042147) |
| 0.1 |
2.2 |
GO:0031958 |
corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 |
2.8 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.1 |
GO:0051932 |
synaptic transmission, GABAergic(GO:0051932) |
| 0.1 |
0.4 |
GO:1900227 |
positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.1 |
0.6 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.1 |
3.8 |
GO:0032456 |
endocytic recycling(GO:0032456) |
| 0.1 |
1.9 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
0.6 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
0.6 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.1 |
0.4 |
GO:0006102 |
isocitrate metabolic process(GO:0006102) |
| 0.1 |
0.7 |
GO:0042426 |
choline catabolic process(GO:0042426) |
| 0.1 |
0.9 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.1 |
0.9 |
GO:0032468 |
Golgi calcium ion homeostasis(GO:0032468) |
| 0.1 |
0.3 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.1 |
0.4 |
GO:1904327 |
protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.1 |
0.7 |
GO:1902866 |
regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 |
1.0 |
GO:0032402 |
establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
| 0.1 |
1.9 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.1 |
2.2 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.4 |
GO:0044539 |
long-chain fatty acid import(GO:0044539) |
| 0.1 |
0.3 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 |
0.3 |
GO:0042421 |
norepinephrine biosynthetic process(GO:0042421) |
| 0.1 |
1.1 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.1 |
2.7 |
GO:0003298 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
1.4 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 |
3.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 |
0.3 |
GO:1904098 |
regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 |
1.6 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.1 |
0.3 |
GO:0032696 |
negative regulation of interleukin-13 production(GO:0032696) |
| 0.1 |
1.3 |
GO:0030220 |
platelet formation(GO:0030220) |
| 0.1 |
0.3 |
GO:0048341 |
paraxial mesoderm formation(GO:0048341) |
| 0.1 |
0.1 |
GO:2000106 |
regulation of leukocyte apoptotic process(GO:2000106) |
| 0.1 |
0.6 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 |
0.1 |
GO:0032720 |
negative regulation of tumor necrosis factor production(GO:0032720) |
| 0.1 |
1.2 |
GO:0070131 |
positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 |
1.4 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.1 |
0.3 |
GO:0042130 |
negative regulation of T cell proliferation(GO:0042130) |
| 0.1 |
0.4 |
GO:0060397 |
JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.1 |
0.4 |
GO:2001020 |
regulation of response to DNA damage stimulus(GO:2001020) |
| 0.1 |
0.4 |
GO:0051934 |
dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.1 |
0.1 |
GO:0090003 |
regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.1 |
0.4 |
GO:0061357 |
positive regulation of Wnt protein secretion(GO:0061357) |
| 0.1 |
1.2 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.1 |
0.4 |
GO:0014820 |
tonic smooth muscle contraction(GO:0014820) |
| 0.1 |
0.4 |
GO:0050777 |
negative regulation of immune response(GO:0050777) |
| 0.1 |
0.7 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.1 |
0.9 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.8 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 |
0.1 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 |
0.3 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.1 |
4.2 |
GO:0007032 |
endosome organization(GO:0007032) |
| 0.1 |
0.4 |
GO:0010756 |
positive regulation of plasminogen activation(GO:0010756) |
| 0.1 |
0.3 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.1 |
1.6 |
GO:2000369 |
regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 |
0.7 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.1 |
0.1 |
GO:1904292 |
regulation of ERAD pathway(GO:1904292) |
| 0.1 |
0.3 |
GO:0015864 |
pyrimidine nucleoside transport(GO:0015864) |
| 0.1 |
0.3 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
1.6 |
GO:1903963 |
arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.1 |
0.1 |
GO:0019062 |
virion attachment to host cell(GO:0019062) |
| 0.1 |
0.4 |
GO:0015746 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 |
2.3 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
0.4 |
GO:0048703 |
embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 |
0.1 |
GO:0071287 |
cellular response to manganese ion(GO:0071287) |
| 0.1 |
0.4 |
GO:1904781 |
positive regulation of protein localization to centrosome(GO:1904781) |
| 0.1 |
0.5 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.3 |
GO:0098759 |
response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.1 |
0.3 |
GO:0043605 |
cellular amide catabolic process(GO:0043605) |
| 0.1 |
0.4 |
GO:0055006 |
cardiac cell development(GO:0055006) |
| 0.1 |
0.4 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
0.4 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 |
1.9 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 |
1.1 |
GO:0010976 |
positive regulation of neuron projection development(GO:0010976) |
| 0.1 |
0.8 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.1 |
0.3 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.1 |
0.1 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 |
0.3 |
GO:0035270 |
endocrine system development(GO:0035270) |
| 0.1 |
1.5 |
GO:0015837 |
amine transport(GO:0015837) |
| 0.1 |
1.6 |
GO:1900274 |
regulation of phospholipase C activity(GO:1900274) |
| 0.1 |
5.6 |
GO:0006939 |
smooth muscle contraction(GO:0006939) |
| 0.1 |
2.7 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.1 |
2.6 |
GO:0000271 |
polysaccharide biosynthetic process(GO:0000271) |
| 0.1 |
0.6 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.1 |
0.4 |
GO:0016094 |
polyprenol biosynthetic process(GO:0016094) |
| 0.1 |
0.2 |
GO:0032689 |
negative regulation of interferon-gamma production(GO:0032689) |
| 0.1 |
0.4 |
GO:0071504 |
cellular response to heparin(GO:0071504) |
| 0.1 |
0.5 |
GO:0035635 |
entry of bacterium into host cell(GO:0035635) |
| 0.1 |
0.7 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.1 |
0.6 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
9.0 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.1 |
0.2 |
GO:0070664 |
negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) negative regulation of leukocyte proliferation(GO:0070664) |
| 0.1 |
0.4 |
GO:0016098 |
monoterpenoid metabolic process(GO:0016098) |
| 0.1 |
0.2 |
GO:0097091 |
synaptic vesicle clustering(GO:0097091) |
| 0.1 |
1.6 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.2 |
GO:0050902 |
leukocyte adhesive activation(GO:0050902) |
| 0.1 |
0.5 |
GO:0060326 |
cell chemotaxis(GO:0060326) |
| 0.1 |
0.2 |
GO:1900226 |
regulation of NLRP3 inflammasome complex assembly(GO:1900225) negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.1 |
1.0 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.1 |
0.1 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 |
1.0 |
GO:0098787 |
mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 |
0.6 |
GO:0048103 |
somatic stem cell division(GO:0048103) |
| 0.1 |
0.1 |
GO:0060026 |
convergent extension(GO:0060026) |
| 0.1 |
3.5 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.6 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
3.2 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.1 |
0.5 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.4 |
GO:1990168 |
protein K33-linked deubiquitination(GO:1990168) |
| 0.1 |
0.5 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.1 |
0.5 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.1 |
0.3 |
GO:0046532 |
regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 |
0.2 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.1 |
1.5 |
GO:0006782 |
protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.1 |
0.3 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.1 |
0.7 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.1 |
0.3 |
GO:1903146 |
regulation of mitophagy(GO:1903146) |
| 0.1 |
0.7 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.1 |
0.2 |
GO:0061582 |
intestinal epithelial cell migration(GO:0061582) |
| 0.1 |
0.7 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
2.2 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.1 |
0.2 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.1 |
0.7 |
GO:0016050 |
vesicle organization(GO:0016050) |
| 0.1 |
1.0 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.1 |
0.2 |
GO:0002586 |
regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 |
2.7 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 |
1.0 |
GO:0097396 |
response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 |
4.2 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.1 |
0.1 |
GO:0090398 |
cellular senescence(GO:0090398) |
| 0.1 |
0.7 |
GO:0002903 |
negative regulation of B cell apoptotic process(GO:0002903) |
| 0.1 |
0.7 |
GO:0051715 |
cytolysis in other organism(GO:0051715) |
| 0.1 |
2.8 |
GO:1903959 |
regulation of anion transmembrane transport(GO:1903959) |
| 0.1 |
0.4 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 |
0.9 |
GO:0034378 |
chylomicron assembly(GO:0034378) |
| 0.1 |
0.8 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
0.3 |
GO:0006423 |
cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 |
0.2 |
GO:0000432 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 |
0.2 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 0.1 |
0.5 |
GO:0030299 |
intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.1 |
0.9 |
GO:0007272 |
ensheathment of neurons(GO:0007272) axon ensheathment(GO:0008366) |
| 0.1 |
1.2 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 |
0.8 |
GO:0046487 |
glyoxylate metabolic process(GO:0046487) |
| 0.1 |
0.1 |
GO:0060926 |
cardiac pacemaker cell development(GO:0060926) |
| 0.1 |
0.6 |
GO:0014887 |
muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.1 |
0.4 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 |
0.7 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.1 |
0.2 |
GO:0000729 |
DNA double-strand break processing(GO:0000729) |
| 0.1 |
0.2 |
GO:0051957 |
positive regulation of amino acid transport(GO:0051957) |
| 0.1 |
0.1 |
GO:0051216 |
cartilage development(GO:0051216) |
| 0.1 |
3.0 |
GO:0048013 |
ephrin receptor signaling pathway(GO:0048013) |
| 0.1 |
0.4 |
GO:2000535 |
regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 |
1.7 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
1.1 |
GO:0051898 |
negative regulation of protein kinase B signaling(GO:0051898) |
| 0.1 |
0.4 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.1 |
GO:0060438 |
trachea development(GO:0060438) |
| 0.1 |
1.7 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.1 |
0.2 |
GO:0030262 |
apoptotic nuclear changes(GO:0030262) |
| 0.1 |
0.8 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.1 |
0.7 |
GO:0035518 |
histone H2A monoubiquitination(GO:0035518) |
| 0.1 |
1.2 |
GO:2000772 |
regulation of cellular senescence(GO:2000772) |
| 0.1 |
0.4 |
GO:0040033 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 |
0.2 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 |
1.6 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 |
0.2 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.1 |
0.4 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.1 |
0.3 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.1 |
0.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.7 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) |
| 0.1 |
0.6 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.1 |
0.4 |
GO:0071469 |
cellular response to alkaline pH(GO:0071469) |
| 0.1 |
0.6 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.1 |
0.3 |
GO:0007585 |
respiratory gaseous exchange(GO:0007585) |
| 0.1 |
2.3 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.1 |
2.5 |
GO:0030516 |
regulation of axon extension(GO:0030516) |
| 0.1 |
0.2 |
GO:0071692 |
protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.1 |
2.3 |
GO:0005980 |
glycogen catabolic process(GO:0005980) |
| 0.1 |
0.5 |
GO:0032350 |
regulation of hormone metabolic process(GO:0032350) |
| 0.1 |
0.7 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 |
0.1 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.1 |
0.7 |
GO:0031034 |
myosin filament assembly(GO:0031034) |
| 0.1 |
0.9 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.1 |
2.0 |
GO:0019233 |
sensory perception of pain(GO:0019233) |
| 0.1 |
1.6 |
GO:0042994 |
cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.1 |
1.0 |
GO:0097369 |
sodium ion import(GO:0097369) |
| 0.1 |
1.1 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.1 |
1.5 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.1 |
0.3 |
GO:0044803 |
multi-organism membrane organization(GO:0044803) |
| 0.1 |
0.2 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.1 |
0.2 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.1 |
0.5 |
GO:0051001 |
negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.1 |
0.6 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
0.3 |
GO:0002818 |
intracellular defense response(GO:0002818) |
| 0.1 |
0.3 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.9 |
GO:0014866 |
skeletal myofibril assembly(GO:0014866) |
| 0.1 |
0.1 |
GO:0050976 |
sensory perception of touch(GO:0050975) detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
| 0.1 |
0.1 |
GO:0050885 |
neuromuscular process controlling balance(GO:0050885) |
| 0.1 |
0.1 |
GO:1901490 |
regulation of lymphangiogenesis(GO:1901490) |
| 0.1 |
0.1 |
GO:0042092 |
type 2 immune response(GO:0042092) |
| 0.1 |
0.2 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.9 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.1 |
2.5 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.8 |
GO:0071847 |
TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 |
0.3 |
GO:0051354 |
negative regulation of oxidoreductase activity(GO:0051354) |
| 0.1 |
0.2 |
GO:0006210 |
pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 |
0.4 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.1 |
0.3 |
GO:0072268 |
pattern specification involved in metanephros development(GO:0072268) |
| 0.1 |
9.3 |
GO:1902476 |
chloride transmembrane transport(GO:1902476) |
| 0.1 |
2.8 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
0.1 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.1 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 |
0.1 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.1 |
0.8 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 |
0.3 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.1 |
0.3 |
GO:0018194 |
N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.1 |
0.2 |
GO:0034140 |
negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 |
0.5 |
GO:0006040 |
amino sugar metabolic process(GO:0006040) |
| 0.1 |
0.3 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 |
0.8 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
0.1 |
GO:0042427 |
serotonin biosynthetic process(GO:0042427) |
| 0.1 |
0.3 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.1 |
0.6 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.2 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.1 |
0.5 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
0.3 |
GO:0044210 |
'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 |
0.1 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.1 |
0.2 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
0.3 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.7 |
GO:0061088 |
regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 |
0.3 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 0.1 |
0.2 |
GO:0009120 |
deoxyribonucleoside metabolic process(GO:0009120) |
| 0.1 |
0.8 |
GO:0090025 |
regulation of monocyte chemotaxis(GO:0090025) |
| 0.1 |
0.1 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 |
0.2 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 |
0.2 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.1 |
0.4 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.1 |
1.0 |
GO:0015804 |
neutral amino acid transport(GO:0015804) |
| 0.1 |
0.2 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
1.9 |
GO:0022400 |
regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.1 |
0.3 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.1 |
1.4 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.1 |
0.7 |
GO:1903799 |
negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 |
0.2 |
GO:0002456 |
T cell mediated immunity(GO:0002456) |
| 0.1 |
0.1 |
GO:0048146 |
positive regulation of fibroblast proliferation(GO:0048146) |
| 0.1 |
0.3 |
GO:0045022 |
early endosome to late endosome transport(GO:0045022) |
| 0.1 |
2.4 |
GO:0035235 |
ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.1 |
0.3 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.5 |
GO:0050951 |
sensory perception of temperature stimulus(GO:0050951) |
| 0.1 |
1.0 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.1 |
0.2 |
GO:0036015 |
response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.1 |
1.0 |
GO:0070306 |
lens fiber cell differentiation(GO:0070306) |
| 0.1 |
0.6 |
GO:0001964 |
startle response(GO:0001964) |
| 0.1 |
0.2 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.1 |
0.4 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.1 |
0.1 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.1 |
1.0 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 |
0.6 |
GO:0021670 |
lateral ventricle development(GO:0021670) |
| 0.1 |
0.1 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.1 |
1.0 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 |
0.4 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.1 |
GO:0055008 |
cardiac muscle tissue morphogenesis(GO:0055008) |
| 0.1 |
0.3 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.1 |
0.1 |
GO:0070316 |
regulation of G0 to G1 transition(GO:0070316) |
| 0.1 |
0.4 |
GO:0035641 |
locomotory exploration behavior(GO:0035641) |
| 0.1 |
0.1 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
0.3 |
GO:0051447 |
negative regulation of meiotic nuclear division(GO:0045835) negative regulation of meiotic cell cycle(GO:0051447) |
| 0.1 |
0.3 |
GO:0009753 |
response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.1 |
0.1 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.1 |
0.1 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.3 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.1 |
0.1 |
GO:1904823 |
pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 |
0.1 |
GO:0097484 |
dendrite extension(GO:0097484) |
| 0.1 |
0.2 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.1 |
3.0 |
GO:2000117 |
negative regulation of cysteine-type endopeptidase activity(GO:2000117) |
| 0.1 |
0.3 |
GO:0044843 |
cell cycle G1/S phase transition(GO:0044843) |
| 0.1 |
0.4 |
GO:0001911 |
negative regulation of leukocyte mediated cytotoxicity(GO:0001911) negative regulation of T cell mediated cytotoxicity(GO:0001915) negative regulation of cell killing(GO:0031342) |
| 0.1 |
0.3 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.1 |
0.3 |
GO:0060638 |
mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.1 |
0.2 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 |
0.3 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
0.1 |
GO:0070245 |
positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.1 |
0.2 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.1 |
0.1 |
GO:0010675 |
regulation of cellular carbohydrate metabolic process(GO:0010675) |
| 0.1 |
0.1 |
GO:1902723 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 |
0.9 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.1 |
1.3 |
GO:0050710 |
negative regulation of cytokine secretion(GO:0050710) |
| 0.1 |
0.2 |
GO:0035909 |
aorta morphogenesis(GO:0035909) |
| 0.1 |
0.1 |
GO:0070849 |
response to epidermal growth factor(GO:0070849) |
| 0.1 |
1.9 |
GO:0071377 |
cellular response to glucagon stimulus(GO:0071377) |
| 0.1 |
0.4 |
GO:1901989 |
positive regulation of cell cycle phase transition(GO:1901989) |
| 0.1 |
0.1 |
GO:0008306 |
associative learning(GO:0008306) |
| 0.1 |
8.5 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 |
0.1 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.1 |
0.2 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 |
0.7 |
GO:0003229 |
ventricular cardiac muscle tissue development(GO:0003229) |
| 0.1 |
0.2 |
GO:0006427 |
histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 |
0.8 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.1 |
0.4 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.1 |
0.6 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.1 |
0.9 |
GO:0044804 |
nucleophagy(GO:0044804) |
| 0.1 |
0.1 |
GO:0046320 |
regulation of fatty acid oxidation(GO:0046320) |
| 0.1 |
0.1 |
GO:2000380 |
regulation of mesoderm development(GO:2000380) |
| 0.1 |
0.1 |
GO:0045471 |
response to ethanol(GO:0045471) |
| 0.1 |
0.2 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.1 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
1.3 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 |
0.4 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 |
0.1 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.1 |
GO:0008050 |
courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
| 0.1 |
0.6 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.1 |
0.6 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 |
0.1 |
GO:0019086 |
late viral transcription(GO:0019086) |
| 0.1 |
0.3 |
GO:0090257 |
regulation of muscle system process(GO:0090257) |
| 0.1 |
0.2 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 |
0.5 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.1 |
0.3 |
GO:0060324 |
face development(GO:0060324) |
| 0.1 |
0.1 |
GO:0014741 |
negative regulation of cardiac muscle hypertrophy(GO:0010614) negative regulation of muscle hypertrophy(GO:0014741) |
| 0.1 |
0.1 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.9 |
GO:2000249 |
regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.1 |
0.2 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 |
0.2 |
GO:0018874 |
benzoate metabolic process(GO:0018874) |
| 0.1 |
0.4 |
GO:0071461 |
cellular response to redox state(GO:0071461) |
| 0.1 |
0.4 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
1.7 |
GO:0006636 |
unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.1 |
0.1 |
GO:1900736 |
regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.1 |
0.1 |
GO:0003025 |
regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 |
0.2 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.1 |
1.2 |
GO:0006306 |
DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
| 0.1 |
0.1 |
GO:0015783 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 |
0.3 |
GO:0002281 |
macrophage activation involved in immune response(GO:0002281) |
| 0.1 |
0.1 |
GO:1903055 |
positive regulation of extracellular matrix organization(GO:1903055) |
| 0.1 |
0.4 |
GO:0046950 |
cellular ketone body metabolic process(GO:0046950) |
| 0.1 |
0.1 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.1 |
0.3 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 |
0.2 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 |
0.2 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.1 |
0.1 |
GO:0036093 |
male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.1 |
0.1 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.4 |
GO:0043536 |
positive regulation of blood vessel endothelial cell migration(GO:0043536) |
| 0.1 |
0.2 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.1 |
0.3 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.1 |
0.1 |
GO:0031112 |
positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
| 0.1 |
0.1 |
GO:0034145 |
positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.1 |
0.2 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.1 |
0.3 |
GO:0098703 |
calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 |
1.9 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.1 |
0.2 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.1 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
21.4 |
GO:0007264 |
small GTPase mediated signal transduction(GO:0007264) |
| 0.0 |
0.2 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 |
0.1 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.0 |
0.1 |
GO:0072367 |
regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 |
0.3 |
GO:2000052 |
positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 |
0.0 |
GO:0090312 |
positive regulation of protein deacetylation(GO:0090312) |
| 0.0 |
0.1 |
GO:1901978 |
positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 |
0.3 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 |
0.1 |
GO:0048075 |
positive regulation of eye pigmentation(GO:0048075) |
| 0.0 |
0.4 |
GO:1900363 |
regulation of mRNA polyadenylation(GO:1900363) |
| 0.0 |
0.1 |
GO:1903936 |
response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 |
0.3 |
GO:0010644 |
cell communication by electrical coupling(GO:0010644) |
| 0.0 |
0.1 |
GO:0070344 |
fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) |
| 0.0 |
0.2 |
GO:2000330 |
memory T cell differentiation(GO:0043379) positive regulation of T-helper 17 cell differentiation(GO:2000321) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
| 0.0 |
0.0 |
GO:0006531 |
aspartate metabolic process(GO:0006531) |
| 0.0 |
0.4 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.0 |
0.2 |
GO:0010885 |
regulation of cholesterol storage(GO:0010885) |
| 0.0 |
0.6 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 |
0.5 |
GO:0000394 |
RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 |
0.0 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 |
0.0 |
GO:0008356 |
asymmetric cell division(GO:0008356) |
| 0.0 |
0.1 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.0 |
0.0 |
GO:0002215 |
defense response to nematode(GO:0002215) |
| 0.0 |
0.0 |
GO:0003160 |
endocardium morphogenesis(GO:0003160) |
| 0.0 |
0.3 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.0 |
0.1 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 |
0.8 |
GO:1901222 |
regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.0 |
0.3 |
GO:0046823 |
negative regulation of protein import into nucleus(GO:0042308) negative regulation of nucleocytoplasmic transport(GO:0046823) negative regulation of protein import(GO:1904590) |
| 0.0 |
0.0 |
GO:1990034 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.0 |
0.4 |
GO:1901071 |
glucosamine-containing compound metabolic process(GO:1901071) |
| 0.0 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.2 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.0 |
0.3 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.3 |
GO:0031167 |
rRNA methylation(GO:0031167) |
| 0.0 |
0.3 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.0 |
0.2 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.0 |
0.3 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 |
0.1 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.0 |
0.1 |
GO:0000393 |
spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 |
0.1 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 |
0.7 |
GO:0001825 |
blastocyst formation(GO:0001825) |
| 0.0 |
0.7 |
GO:0002220 |
innate immune response activating cell surface receptor signaling pathway(GO:0002220) stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 |
0.3 |
GO:0007131 |
reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.0 |
GO:0010888 |
negative regulation of lipid storage(GO:0010888) |
| 0.0 |
0.0 |
GO:0090656 |
t-circle formation(GO:0090656) |
| 0.0 |
0.0 |
GO:0071071 |
regulation of phospholipid biosynthetic process(GO:0071071) |
| 0.0 |
0.4 |
GO:0007597 |
blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 |
0.0 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 |
0.3 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 |
0.1 |
GO:2000273 |
positive regulation of receptor activity(GO:2000273) |
| 0.0 |
0.0 |
GO:0046968 |
peptide antigen transport(GO:0046968) |
| 0.0 |
0.1 |
GO:2001178 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 |
0.0 |
GO:0009624 |
response to nematode(GO:0009624) |
| 0.0 |
0.4 |
GO:0031952 |
regulation of protein autophosphorylation(GO:0031952) |
| 0.0 |
0.2 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 |
0.1 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.0 |
0.0 |
GO:0002418 |
immune response to tumor cell(GO:0002418) |
| 0.0 |
0.0 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.2 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 |
0.1 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 0.0 |
0.1 |
GO:0051604 |
protein maturation(GO:0051604) |
| 0.0 |
0.6 |
GO:0035418 |
protein localization to synapse(GO:0035418) |
| 0.0 |
0.1 |
GO:0010044 |
response to aluminum ion(GO:0010044) |
| 0.0 |
0.2 |
GO:0032660 |
regulation of interleukin-17 production(GO:0032660) |
| 0.0 |
0.1 |
GO:0006893 |
Golgi to plasma membrane transport(GO:0006893) |
| 0.0 |
0.1 |
GO:0032717 |
negative regulation of interleukin-8 production(GO:0032717) |
| 0.0 |
0.1 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.0 |
0.0 |
GO:0051281 |
positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 |
0.1 |
GO:0002526 |
acute inflammatory response(GO:0002526) |
| 0.0 |
0.2 |
GO:0001832 |
blastocyst growth(GO:0001832) |
| 0.0 |
0.1 |
GO:0099525 |
presynaptic dense core granule exocytosis(GO:0099525) |
| 0.0 |
0.1 |
GO:1990418 |
response to insulin-like growth factor stimulus(GO:1990418) |
| 0.0 |
0.1 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
0.5 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.0 |
0.1 |
GO:0098815 |
modulation of excitatory postsynaptic potential(GO:0098815) |
| 0.0 |
0.7 |
GO:0008037 |
cell recognition(GO:0008037) |
| 0.0 |
0.2 |
GO:0052696 |
flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.0 |
2.4 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 |
0.1 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 |
0.0 |
GO:0046629 |
gamma-delta T cell activation(GO:0046629) |
| 0.0 |
0.1 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.0 |
0.1 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 |
0.3 |
GO:0051480 |
regulation of cytosolic calcium ion concentration(GO:0051480) |
| 0.0 |
0.1 |
GO:0009253 |
peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 |
0.5 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.0 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 |
0.1 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.0 |
0.1 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.0 |
0.2 |
GO:0051897 |
positive regulation of protein kinase B signaling(GO:0051897) |
| 0.0 |
0.2 |
GO:0001954 |
positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 |
0.7 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.0 |
0.4 |
GO:0007041 |
lysosomal transport(GO:0007041) |
| 0.0 |
0.0 |
GO:0016056 |
rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 |
0.2 |
GO:1900116 |
extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.0 |
0.0 |
GO:2000272 |
negative regulation of receptor activity(GO:2000272) |
| 0.0 |
0.0 |
GO:1903573 |
negative regulation of response to endoplasmic reticulum stress(GO:1903573) |
| 0.0 |
0.1 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.0 |
0.0 |
GO:0046473 |
phosphatidic acid metabolic process(GO:0046473) |
| 0.0 |
0.0 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) fasciculation of motor neuron axon(GO:0097156) |
| 0.0 |
0.1 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 |
0.0 |
GO:0006089 |
lactate metabolic process(GO:0006089) |
| 0.0 |
0.1 |
GO:0048483 |
autonomic nervous system development(GO:0048483) |
| 0.0 |
0.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.0 |
GO:0098779 |
mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.0 |
0.0 |
GO:0007620 |
copulation(GO:0007620) |
| 0.0 |
0.1 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 |
0.1 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 |
0.2 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 |
0.1 |
GO:0030730 |
sequestering of triglyceride(GO:0030730) |
| 0.0 |
0.0 |
GO:0072092 |
ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 |
0.3 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.1 |
GO:0035810 |
positive regulation of urine volume(GO:0035810) |
| 0.0 |
0.1 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.0 |
0.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.0 |
0.0 |
GO:0032354 |
response to follicle-stimulating hormone(GO:0032354) |
| 0.0 |
0.1 |
GO:0045959 |
regulation of complement activation, classical pathway(GO:0030450) negative regulation of complement activation, classical pathway(GO:0045959) |
| 0.0 |
0.1 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.0 |
0.1 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.0 |
0.3 |
GO:0006509 |
membrane protein ectodomain proteolysis(GO:0006509) |
| 0.0 |
0.1 |
GO:0006734 |
NADH metabolic process(GO:0006734) |
| 0.0 |
0.0 |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 |
0.1 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.0 |
0.0 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 |
0.0 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 |
0.0 |
GO:0008212 |
mineralocorticoid biosynthetic process(GO:0006705) mineralocorticoid metabolic process(GO:0008212) |
| 0.0 |
0.1 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 |
0.1 |
GO:0035247 |
peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.0 |
0.0 |
GO:0001694 |
histamine biosynthetic process(GO:0001694) |
| 0.0 |
0.5 |
GO:0007030 |
Golgi organization(GO:0007030) |
| 0.0 |
0.1 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 |
0.5 |
GO:0036498 |
IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 |
0.0 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.0 |
0.0 |
GO:0003050 |
regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 |
0.0 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 |
0.1 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.0 |
0.0 |
GO:1900003 |
regulation of serine-type endopeptidase activity(GO:1900003) regulation of serine-type peptidase activity(GO:1902571) |
