| 0.3 |
0.9 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 |
1.2 |
GO:2000768 |
positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.2 |
0.5 |
GO:0021919 |
BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 0.2 |
0.5 |
GO:0018874 |
benzoate metabolic process(GO:0018874) |
| 0.2 |
0.6 |
GO:0032972 |
regulation of muscle filament sliding speed(GO:0032972) |
| 0.1 |
0.9 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.1 |
0.1 |
GO:0019605 |
butyrate metabolic process(GO:0019605) |
| 0.1 |
0.5 |
GO:0090119 |
vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 |
0.4 |
GO:0003051 |
angiotensin-mediated drinking behavior(GO:0003051) |
| 0.1 |
0.1 |
GO:0009217 |
purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.1 |
0.4 |
GO:2000118 |
regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 |
0.5 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 |
0.1 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 |
0.8 |
GO:0018879 |
biphenyl metabolic process(GO:0018879) |
| 0.1 |
0.1 |
GO:0071335 |
submandibular salivary gland formation(GO:0060661) hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.1 |
0.3 |
GO:0051758 |
homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 |
0.4 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 |
0.4 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.1 |
1.2 |
GO:0060083 |
smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 |
0.3 |
GO:0001983 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 0.1 |
0.4 |
GO:1902499 |
positive regulation of protein autoubiquitination(GO:1902499) |
| 0.1 |
0.1 |
GO:1902214 |
regulation of interleukin-4-mediated signaling pathway(GO:1902214) |
| 0.1 |
0.3 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 |
0.7 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.1 |
0.2 |
GO:0001808 |
negative regulation of type IV hypersensitivity(GO:0001808) |
| 0.1 |
0.2 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 |
0.3 |
GO:0009107 |
lipoate biosynthetic process(GO:0009107) |
| 0.1 |
0.4 |
GO:0002415 |
immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.1 |
0.3 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
0.5 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.1 |
0.2 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.1 |
0.3 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.1 |
0.2 |
GO:2000824 |
negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 |
0.2 |
GO:0060931 |
sinoatrial node cell development(GO:0060931) |
| 0.1 |
0.6 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 0.1 |
0.4 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.1 |
0.2 |
GO:0021558 |
trochlear nerve development(GO:0021558) |
| 0.1 |
0.2 |
GO:0000294 |
nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 |
0.2 |
GO:0014839 |
myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 |
0.1 |
GO:0042488 |
positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
| 0.1 |
0.2 |
GO:0035283 |
central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.1 |
0.1 |
GO:0042668 |
auditory receptor cell fate determination(GO:0042668) |
| 0.1 |
0.2 |
GO:2000612 |
thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.1 |
0.2 |
GO:1900111 |
positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 |
0.2 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.1 |
0.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.4 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.1 |
0.2 |
GO:0090675 |
intermicrovillar adhesion(GO:0090675) |
| 0.1 |
0.2 |
GO:0072579 |
molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.1 |
0.2 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 |
0.2 |
GO:2000566 |
positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.1 |
0.2 |
GO:0090294 |
nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.1 |
0.5 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.1 |
0.3 |
GO:1903597 |
negative regulation of gap junction assembly(GO:1903597) |
| 0.1 |
0.3 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 |
0.2 |
GO:2000364 |
regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 |
0.1 |
GO:1900182 |
positive regulation of protein localization to nucleus(GO:1900182) |
| 0.1 |
0.2 |
GO:2000449 |
CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
| 0.1 |
0.3 |
GO:0010902 |
positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.1 |
0.4 |
GO:0002803 |
positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 |
0.2 |
GO:0071393 |
cellular response to progesterone stimulus(GO:0071393) |
| 0.1 |
0.4 |
GO:0035624 |
receptor transactivation(GO:0035624) |
| 0.1 |
0.1 |
GO:0002625 |
regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.1 |
0.2 |
GO:1904448 |
negative regulation of gamma-aminobutyric acid secretion(GO:0014053) aspartate secretion(GO:0061528) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.1 |
0.2 |
GO:1902714 |
negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 |
0.3 |
GO:1902202 |
regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 |
0.1 |
GO:0032811 |
negative regulation of epinephrine secretion(GO:0032811) |
| 0.1 |
0.2 |
GO:0016539 |
intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 |
0.3 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.1 |
0.1 |
GO:1903233 |
regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.1 |
0.1 |
GO:0035793 |
positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.1 |
0.3 |
GO:0070383 |
DNA cytosine deamination(GO:0070383) |
| 0.1 |
0.4 |
GO:1900239 |
phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 |
0.1 |
GO:0060697 |
positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.1 |
0.3 |
GO:0006311 |
meiotic gene conversion(GO:0006311) |
| 0.1 |
0.4 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.1 |
0.4 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
0.2 |
GO:2000870 |
regulation of progesterone secretion(GO:2000870) |
| 0.1 |
0.2 |
GO:2000866 |
positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
| 0.1 |
0.3 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.1 |
0.2 |
GO:0033242 |
regulation of cellular amine catabolic process(GO:0033241) negative regulation of cellular amine catabolic process(GO:0033242) negative regulation of the force of heart contraction(GO:0098736) regulation of arginine catabolic process(GO:1900081) negative regulation of arginine catabolic process(GO:1900082) regulation of citrulline biosynthetic process(GO:1903248) negative regulation of citrulline biosynthetic process(GO:1903249) negative regulation of cellular amino acid biosynthetic process(GO:2000283) |
| 0.1 |
0.1 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.1 |
0.4 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.1 |
0.1 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 |
0.1 |
GO:1902954 |
regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.1 |
0.1 |
GO:1990869 |
response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
| 0.1 |
0.2 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 |
2.1 |
GO:0050913 |
sensory perception of bitter taste(GO:0050913) |
| 0.1 |
0.4 |
GO:0071926 |
endocannabinoid signaling pathway(GO:0071926) |
| 0.1 |
0.7 |
GO:0015747 |
urate transport(GO:0015747) |
| 0.1 |
0.1 |
GO:0051462 |
cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.1 |
0.5 |
GO:0014744 |
positive regulation of muscle adaptation(GO:0014744) |
| 0.1 |
0.3 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 |
0.1 |
GO:0044788 |
modulation by host of viral process(GO:0044788) positive regulation by host of viral process(GO:0044794) |
| 0.1 |
0.3 |
GO:0010133 |
proline catabolic process to glutamate(GO:0010133) |
| 0.1 |
0.2 |
GO:0070105 |
positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 |
0.2 |
GO:0018057 |
peptidyl-lysine oxidation(GO:0018057) |
| 0.1 |
0.1 |
GO:0008211 |
glucocorticoid metabolic process(GO:0008211) |
| 0.0 |
2.2 |
GO:0015991 |
ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 |
0.2 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.0 |
0.1 |
GO:0021577 |
hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) lateral motor column neuron migration(GO:0097477) |
| 0.0 |
0.1 |
GO:0003358 |
noradrenergic neuron development(GO:0003358) |
| 0.0 |
0.2 |
GO:1990502 |
dense core granule maturation(GO:1990502) |
| 0.0 |
0.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 |
0.0 |
GO:0046619 |
optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.0 |
0.2 |
GO:0042746 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.0 |
0.0 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 0.0 |
0.1 |
GO:0032824 |
natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.0 |
0.3 |
GO:1903575 |
cornified envelope assembly(GO:1903575) |
| 0.0 |
0.1 |
GO:0031630 |
regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 0.0 |
0.8 |
GO:0015812 |
gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 |
0.3 |
GO:0009730 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 |
0.1 |
GO:0090024 |
negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.0 |
0.0 |
GO:0042220 |
response to cocaine(GO:0042220) |
| 0.0 |
0.0 |
GO:0021782 |
glial cell development(GO:0021782) |
| 0.0 |
0.0 |
GO:0060775 |
mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.0 |
0.1 |
GO:0038183 |
bile acid signaling pathway(GO:0038183) |
| 0.0 |
0.2 |
GO:1904823 |
pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.0 |
0.3 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.0 |
0.1 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.0 |
0.7 |
GO:0036006 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.0 |
0.1 |
GO:1900365 |
positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 |
0.1 |
GO:0002522 |
leukocyte migration involved in immune response(GO:0002522) |
| 0.0 |
0.3 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 |
0.2 |
GO:0021633 |
optic nerve structural organization(GO:0021633) |
| 0.0 |
0.4 |
GO:0001554 |
luteolysis(GO:0001554) |
| 0.0 |
0.2 |
GO:0009996 |
negative regulation of cell fate specification(GO:0009996) |
| 0.0 |
0.3 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 |
0.1 |
GO:0043163 |
cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.0 |
0.0 |
GO:0002386 |
immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 |
0.1 |
GO:0060455 |
negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 |
0.1 |
GO:0097051 |
establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 |
0.0 |
GO:0045342 |
MHC class II biosynthetic process(GO:0045342) regulation of MHC class II biosynthetic process(GO:0045346) |
| 0.0 |
1.2 |
GO:0021895 |
cerebral cortex neuron differentiation(GO:0021895) |
| 0.0 |
0.6 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 |
0.1 |
GO:2000977 |
regulation of forebrain neuron differentiation(GO:2000977) |
| 0.0 |
0.1 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.0 |
0.0 |
GO:0045763 |
negative regulation of cellular amino acid metabolic process(GO:0045763) regulation of glutamate metabolic process(GO:2000211) |
| 0.0 |
0.1 |
GO:0045210 |
negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
| 0.0 |
0.1 |
GO:0045141 |
meiotic telomere clustering(GO:0045141) |
| 0.0 |
0.2 |
GO:0019556 |
histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.0 |
0.1 |
GO:1904924 |
negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.0 |
0.0 |
GO:1905232 |
cellular response to L-glutamate(GO:1905232) |
| 0.0 |
0.2 |
GO:0098707 |
ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.0 |
0.0 |
GO:0032079 |
positive regulation of deoxyribonuclease activity(GO:0032077) positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.0 |
0.1 |
GO:0010966 |
regulation of phosphate transport(GO:0010966) |
| 0.0 |
0.2 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.0 |
0.4 |
GO:0015840 |
urea transport(GO:0015840) |
| 0.0 |
0.0 |
GO:0051135 |
positive regulation of NK T cell activation(GO:0051135) |
| 0.0 |
0.1 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.0 |
0.2 |
GO:2001151 |
regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.0 |
0.1 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.0 |
0.5 |
GO:0098828 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 |
0.1 |
GO:0044278 |
cell wall disruption in other organism(GO:0044278) |
| 0.0 |
0.3 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.0 |
0.0 |
GO:0007518 |
myoblast fate determination(GO:0007518) |
| 0.0 |
0.3 |
GO:0010756 |
positive regulation of plasminogen activation(GO:0010756) |
| 0.0 |
0.4 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.0 |
1.0 |
GO:0001829 |
trophectodermal cell differentiation(GO:0001829) |
| 0.0 |
0.5 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 |
1.2 |
GO:0036152 |
phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 |
0.8 |
GO:0045187 |
regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.0 |
0.2 |
GO:0010897 |
negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.0 |
0.3 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 |
0.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 |
0.2 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 |
0.1 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.0 |
0.1 |
GO:0003032 |
detection of oxygen(GO:0003032) uterine wall breakdown(GO:0042704) |
| 0.0 |
0.1 |
GO:0021831 |
embryonic olfactory bulb interneuron precursor migration(GO:0021831) chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.0 |
0.6 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.0 |
0.3 |
GO:1903764 |
regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 |
0.1 |
GO:0014734 |
skeletal muscle hypertrophy(GO:0014734) |
| 0.0 |
0.1 |
GO:0071400 |
cellular response to oleic acid(GO:0071400) |
| 0.0 |
0.1 |
GO:0048570 |
notochord morphogenesis(GO:0048570) |
| 0.0 |
0.1 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.0 |
0.7 |
GO:0019614 |
catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 |
0.4 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.0 |
0.7 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.0 |
0.1 |
GO:2000777 |
positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.0 |
0.0 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.0 |
0.1 |
GO:0030186 |
melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 |
0.3 |
GO:0034371 |
chylomicron remodeling(GO:0034371) |
| 0.0 |
0.1 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.0 |
0.3 |
GO:0060750 |
prostate epithelial cord elongation(GO:0060523) epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.0 |
0.1 |
GO:0038193 |
thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 |
0.0 |
GO:0070585 |
protein localization to mitochondrion(GO:0070585) |
| 0.0 |
0.1 |
GO:0002023 |
reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 |
0.1 |
GO:0036515 |
serotonergic neuron axon guidance(GO:0036515) |
| 0.0 |
0.1 |
GO:0042713 |
sperm ejaculation(GO:0042713) |
| 0.0 |
0.1 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.0 |
0.1 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 |
0.2 |
GO:0006196 |
AMP catabolic process(GO:0006196) |
| 0.0 |
0.1 |
GO:0019417 |
sulfur oxidation(GO:0019417) |
| 0.0 |
0.2 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 |
0.1 |
GO:0061074 |
regulation of neural retina development(GO:0061074) |
| 0.0 |
0.5 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 |
0.0 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.0 |
0.3 |
GO:0045345 |
positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 |
0.1 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 |
0.1 |
GO:0033686 |
positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 |
0.1 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.0 |
0.1 |
GO:0003285 |
septum secundum development(GO:0003285) |
| 0.0 |
0.2 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.0 |
0.1 |
GO:0060214 |
endocardium formation(GO:0060214) |
| 0.0 |
0.1 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 |
0.1 |
GO:0045925 |
positive regulation of female receptivity(GO:0045925) |
| 0.0 |
0.2 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.0 |
0.0 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 |
0.1 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 |
0.2 |
GO:2000490 |
negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 |
0.1 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.0 |
0.1 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.0 |
0.1 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
0.0 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 |
0.1 |
GO:0007497 |
posterior midgut development(GO:0007497) |
| 0.0 |
0.2 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 |
0.3 |
GO:0046618 |
drug export(GO:0046618) |
| 0.0 |
0.1 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
| 0.0 |
0.3 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 |
0.1 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.0 |
0.0 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.0 |
0.0 |
GO:0046838 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) |
| 0.0 |
0.1 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.0 |
0.5 |
GO:0060088 |
auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 |
0.2 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.0 |
0.1 |
GO:0006051 |
mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 |
0.1 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.0 |
0.1 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.0 |
0.2 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.3 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 |
0.0 |
GO:2001184 |
positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 |
0.1 |
GO:0042335 |
cuticle development(GO:0042335) |
| 0.0 |
0.1 |
GO:0010446 |
response to alkaline pH(GO:0010446) |
| 0.0 |
0.1 |
GO:0098759 |
response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.0 |
0.2 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.0 |
0.6 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.0 |
0.1 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.0 |
0.1 |
GO:0006522 |
alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.0 |
0.1 |
GO:0098582 |
innate vocalization behavior(GO:0098582) |
| 0.0 |
0.8 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 0.0 |
0.1 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.0 |
0.1 |
GO:0000706 |
meiotic DNA double-strand break processing(GO:0000706) double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.0 |
0.1 |
GO:0060406 |
positive regulation of penile erection(GO:0060406) |
| 0.0 |
0.1 |
GO:0021586 |
pons maturation(GO:0021586) |
| 0.0 |
0.1 |
GO:0061365 |
positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 |
0.1 |
GO:0072237 |
metanephric proximal tubule development(GO:0072237) |
| 0.0 |
0.3 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 |
0.1 |
GO:0002584 |
negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.0 |
0.1 |
GO:0031959 |
mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.0 |
0.1 |
GO:0021684 |
cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 |
0.2 |
GO:0090649 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 |
0.2 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.0 |
0.4 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.0 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.0 |
0.4 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.0 |
0.1 |
GO:0006579 |
amino-acid betaine catabolic process(GO:0006579) |
| 0.0 |
0.1 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.0 |
0.1 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.0 |
0.6 |
GO:0090084 |
negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 |
0.6 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.0 |
0.0 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 |
0.1 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.0 |
0.0 |
GO:0060022 |
hard palate development(GO:0060022) |
| 0.0 |
0.2 |
GO:0060125 |
negative regulation of growth hormone secretion(GO:0060125) |
| 0.0 |
0.4 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.0 |
0.1 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.0 |
0.2 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.0 |
3.5 |
GO:0070268 |
cornification(GO:0070268) |
| 0.0 |
0.1 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.0 |
0.0 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.0 |
0.1 |
GO:0051103 |
DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 |
0.1 |
GO:0060684 |
epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 |
0.2 |
GO:0099638 |
endosome to plasma membrane protein transport(GO:0099638) |
| 0.0 |
0.1 |
GO:1904954 |
canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.0 |
0.1 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.0 |
0.1 |
GO:0033861 |
negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 |
0.1 |
GO:0019856 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 |
0.1 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 |
0.1 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 |
0.1 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.0 |
0.1 |
GO:1900738 |
positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 |
0.2 |
GO:0070197 |
meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 |
0.5 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.0 |
0.1 |
GO:0032802 |
low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 |
0.2 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.5 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.0 |
0.0 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.0 |
0.1 |
GO:0014034 |
neural crest cell fate commitment(GO:0014034) |
| 0.0 |
0.1 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 |
0.6 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.0 |
0.1 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.0 |
0.3 |
GO:0043578 |
nuclear matrix organization(GO:0043578) |
| 0.0 |
0.1 |
GO:0098746 |
fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.0 |
0.1 |
GO:1900155 |
regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 |
0.1 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.0 |
0.1 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.0 |
0.1 |
GO:0072233 |
thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.0 |
0.1 |
GO:1904953 |
Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
| 0.0 |
0.0 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.0 |
0.1 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.0 |
0.2 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 |
0.1 |
GO:0050712 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.0 |
0.1 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.0 |
0.1 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.0 |
0.0 |
GO:0061582 |
intestinal epithelial cell migration(GO:0061582) |
| 0.0 |
0.4 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.0 |
0.1 |
GO:0051138 |
positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 |
0.1 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 |
0.1 |
GO:1900108 |
negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 |
0.4 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.5 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.1 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 |
0.1 |
GO:0001819 |
positive regulation of cytokine production(GO:0001819) |
| 0.0 |
0.1 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 |
0.1 |
GO:0051934 |
dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.0 |
0.1 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 0.0 |
0.1 |
GO:2001038 |
regulation of cellular response to drug(GO:2001038) |
| 0.0 |
0.1 |
GO:1904764 |
negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.0 |
0.2 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 |
0.1 |
GO:0043932 |
ossification involved in bone remodeling(GO:0043932) |
| 0.0 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.1 |
GO:0038188 |
cholecystokinin signaling pathway(GO:0038188) |
| 0.0 |
0.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.0 |
0.2 |
GO:0010819 |
regulation of T cell chemotaxis(GO:0010819) |
| 0.0 |
0.1 |
GO:1902990 |
mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.0 |
0.1 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.0 |
0.1 |
GO:0070781 |
response to biotin(GO:0070781) |
| 0.0 |
0.1 |
GO:0038110 |
interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 |
0.1 |
GO:0099540 |
synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 |
0.1 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.0 |
0.1 |
GO:0035026 |
leading edge cell differentiation(GO:0035026) |
| 0.0 |
0.1 |
GO:0043605 |
cellular amide catabolic process(GO:0043605) |
| 0.0 |
0.2 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 |
0.0 |
GO:0090004 |
positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 |
0.4 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.1 |
GO:0046167 |
glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 |
0.2 |
GO:0060211 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 |
0.2 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 |
0.0 |
GO:0015811 |
sulfur amino acid transport(GO:0000101) L-cystine transport(GO:0015811) |
| 0.0 |
0.1 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 |
0.5 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 |
0.1 |
GO:1904209 |
regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.0 |
0.2 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.0 |
0.1 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.0 |
0.1 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.0 |
0.0 |
GO:0014043 |
negative regulation of neuron maturation(GO:0014043) |
| 0.0 |
0.1 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.0 |
0.1 |
GO:0019747 |
regulation of isoprenoid metabolic process(GO:0019747) |
| 0.0 |
0.1 |
GO:0086092 |
regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
| 0.0 |
0.1 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.2 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) |
| 0.0 |
0.1 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.1 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 |
0.1 |
GO:0006427 |
histidyl-tRNA aminoacylation(GO:0006427) |
| 0.0 |
0.1 |
GO:1902299 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.0 |
0.1 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 |
0.2 |
GO:2000622 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.1 |
GO:0038171 |
cannabinoid signaling pathway(GO:0038171) |
| 0.0 |
0.5 |
GO:0030207 |
chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 |
0.5 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.0 |
0.1 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.0 |
0.1 |
GO:0045007 |
depurination(GO:0045007) |
| 0.0 |
0.1 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.0 |
0.1 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 |
0.2 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 |
0.1 |
GO:0019046 |
release from viral latency(GO:0019046) |
| 0.0 |
0.2 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.0 |
0.2 |
GO:2000172 |
regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 |
0.4 |
GO:0007597 |
blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 |
0.1 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 |
0.1 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 |
0.0 |
GO:0032707 |
negative regulation of interleukin-23 production(GO:0032707) |
| 0.0 |
0.1 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.0 |
0.0 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 0.0 |
0.0 |
GO:0022605 |
oogenesis stage(GO:0022605) |
| 0.0 |
0.3 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.0 |
0.0 |
GO:1903181 |
regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) regulation of cellular amino acid biosynthetic process(GO:2000282) |
| 0.0 |
0.1 |
GO:0038155 |
interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.0 |
0.0 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.0 |
0.1 |
GO:0072092 |
ureteric bud invasion(GO:0072092) |
| 0.0 |
0.1 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.0 |
0.1 |
GO:0038043 |
interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.0 |
0.1 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.0 |
0.0 |
GO:0002874 |
regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.0 |
0.1 |
GO:0070233 |
negative regulation of T cell apoptotic process(GO:0070233) |
| 0.0 |
0.0 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 |
0.6 |
GO:0035338 |
long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 |
0.2 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 |
0.0 |
GO:0060592 |
mammary gland formation(GO:0060592) |
| 0.0 |
0.1 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.0 |
0.2 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.0 |
0.2 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 |
0.0 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 |
0.1 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 |
0.3 |
GO:0090360 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 |
0.1 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 |
0.4 |
GO:0044117 |
growth of symbiont in host(GO:0044117) regulation of growth of symbiont in host(GO:0044126) |
| 0.0 |
0.0 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.0 |
0.2 |
GO:0042996 |
regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 |
0.6 |
GO:0046710 |
GDP metabolic process(GO:0046710) |
| 0.0 |
0.4 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.0 |
0.4 |
GO:0033141 |
positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 |
0.1 |
GO:0070458 |
cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 |
0.1 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.0 |
0.1 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 |
0.0 |
GO:0045082 |
positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.0 |
0.1 |
GO:0071477 |
hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 |
0.1 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 |
0.1 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 |
0.1 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.0 |
0.1 |
GO:0045836 |
positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 |
0.1 |
GO:0001694 |
histamine biosynthetic process(GO:0001694) |
| 0.0 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 |
0.0 |
GO:0030886 |
negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 |
0.1 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.0 |
0.1 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.0 |
0.1 |
GO:0000480 |
endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 |
0.0 |
GO:1903923 |
protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 0.0 |
0.1 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 |
0.1 |
GO:0007439 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.0 |
0.4 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.0 |
0.2 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.0 |
0.1 |
GO:0033687 |
osteoblast proliferation(GO:0033687) |
| 0.0 |
0.1 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 |
0.1 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 |
0.2 |
GO:0010801 |
negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 |
0.1 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.0 |
0.2 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.0 |
0.3 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 |
0.1 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.0 |
0.1 |
GO:0072156 |
distal tubule morphogenesis(GO:0072156) |
| 0.0 |
0.1 |
GO:0046878 |
positive regulation of saliva secretion(GO:0046878) |
| 0.0 |
0.1 |
GO:0033031 |
positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 |
0.1 |
GO:0009597 |
detection of virus(GO:0009597) |
| 0.0 |
0.0 |
GO:0010286 |
heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.0 |
0.1 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.0 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.0 |
0.1 |
GO:0070305 |
response to cGMP(GO:0070305) |
| 0.0 |
0.1 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.0 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.0 |
0.1 |
GO:0071798 |
response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 |
0.1 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 |
0.6 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.6 |
GO:0022400 |
regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.0 |
0.1 |
GO:0009624 |
response to nematode(GO:0009624) |
| 0.0 |
0.0 |
GO:0018307 |
enzyme active site formation(GO:0018307) |
| 0.0 |
0.0 |
GO:1902303 |
negative regulation of potassium ion export(GO:1902303) |
| 0.0 |
0.1 |
GO:0098704 |
fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.0 |
0.1 |
GO:0060484 |
lung-associated mesenchyme development(GO:0060484) |
| 0.0 |
0.2 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 |
0.0 |
GO:0072108 |
positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.1 |
GO:0016358 |
dendrite development(GO:0016358) |
| 0.0 |
0.5 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.0 |
0.0 |
GO:0060687 |
regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.0 |
0.1 |
GO:2000370 |
positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 |
0.1 |
GO:0050885 |
neuromuscular process controlling balance(GO:0050885) |
| 0.0 |
0.1 |
GO:2001300 |
lipoxin metabolic process(GO:2001300) |
| 0.0 |
0.0 |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 |
0.0 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 0.0 |
0.0 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) intralumenal vesicle formation(GO:0070676) |
| 0.0 |
0.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 |
0.0 |
GO:1901381 |
positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.0 |
0.1 |
GO:0052551 |
response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.0 |
0.0 |
GO:0070874 |
negative regulation of glycogen metabolic process(GO:0070874) |
| 0.0 |
0.1 |
GO:0034182 |
regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.0 |
0.1 |
GO:1903412 |
response to bile acid(GO:1903412) |
| 0.0 |
0.0 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 0.0 |
0.2 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.1 |
GO:0002290 |
gamma-delta T cell activation involved in immune response(GO:0002290) negative regulation of interferon-beta secretion(GO:0035548) negative regulation of CD8-positive, alpha-beta T cell activation(GO:2001186) regulation of gamma-delta T cell activation involved in immune response(GO:2001191) positive regulation of gamma-delta T cell activation involved in immune response(GO:2001193) |
| 0.0 |
0.2 |
GO:0044557 |
relaxation of smooth muscle(GO:0044557) |
| 0.0 |
0.0 |
GO:0042116 |
macrophage activation(GO:0042116) |
| 0.0 |
0.2 |
GO:0051150 |
regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 |
0.0 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) |
| 0.0 |
0.3 |
GO:0030517 |
negative regulation of axon extension(GO:0030517) |
| 0.0 |
0.1 |
GO:0071233 |
cellular response to leucine(GO:0071233) |
| 0.0 |
0.1 |
GO:0048755 |
branching morphogenesis of a nerve(GO:0048755) |
| 0.0 |
0.1 |
GO:0055089 |
fatty acid homeostasis(GO:0055089) |
| 0.0 |
0.1 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 |
0.2 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.0 |
0.0 |
GO:1902075 |
cellular response to salt(GO:1902075) |
| 0.0 |
0.0 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 |
0.0 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.0 |
0.1 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 |
0.1 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.0 |
0.1 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) |
| 0.0 |
0.0 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.0 |
0.0 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 |
0.1 |
GO:0035105 |
sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 |
0.0 |
GO:0031338 |
regulation of vesicle fusion(GO:0031338) |
| 0.0 |
0.0 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.0 |
0.0 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 |
0.0 |
GO:1903288 |
positive regulation of potassium ion import(GO:1903288) |
| 0.0 |
0.0 |
GO:0090399 |
replicative senescence(GO:0090399) |
| 0.0 |
0.1 |
GO:1903944 |
negative regulation of myoblast fusion(GO:1901740) regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.0 |
0.0 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 |
0.1 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 |
0.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.0 |
0.2 |
GO:0039532 |
negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.0 |
0.7 |
GO:1903959 |
regulation of anion transmembrane transport(GO:1903959) |
| 0.0 |
0.3 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.0 |
0.1 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.0 |
0.1 |
GO:1903963 |
arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 |
0.2 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.0 |
0.1 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 |
0.0 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.0 |
0.9 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.2 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 |
0.1 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
0.1 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 |
0.0 |
GO:0021888 |
hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
| 0.0 |
0.1 |
GO:0007603 |
phototransduction, visible light(GO:0007603) |
| 0.0 |
0.1 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 |
0.2 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.0 |
0.1 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 |
0.0 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 |
0.1 |
GO:0017198 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 |
0.1 |
GO:0051122 |
hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 |
0.2 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.4 |
GO:0043551 |
regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 |
0.0 |
GO:0036058 |
filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.0 |
0.0 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.0 |
0.1 |
GO:0055075 |
potassium ion homeostasis(GO:0055075) |
| 0.0 |
0.1 |
GO:1904640 |
response to methionine(GO:1904640) |
| 0.0 |
0.2 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.0 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.0 |
0.1 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 |
0.0 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.0 |
0.0 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.0 |
0.1 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.0 |
GO:1990180 |
mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.0 |
0.1 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.0 |
0.1 |
GO:0061031 |
endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 |
0.0 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.0 |
0.1 |
GO:0097010 |
eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.0 |
0.0 |
GO:0009183 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) purine deoxyribonucleoside diphosphate biosynthetic process(GO:0009183) |
| 0.0 |
0.1 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 |
0.3 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.0 |
0.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.0 |
0.0 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.0 |
GO:0080154 |
regulation of fertilization(GO:0080154) |
| 0.0 |
0.3 |
GO:0007413 |
axonal fasciculation(GO:0007413) |
| 0.0 |
0.1 |
GO:0042148 |
strand invasion(GO:0042148) |
| 0.0 |
0.0 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.0 |
0.0 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 |
0.0 |
GO:0034505 |
tooth mineralization(GO:0034505) |
| 0.0 |
0.2 |
GO:0008038 |
neuron recognition(GO:0008038) |
| 0.0 |
0.1 |
GO:0060371 |
regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.0 |
0.0 |
GO:0032888 |
regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.0 |
0.5 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 |
0.1 |
GO:2000823 |
regulation of androgen receptor activity(GO:2000823) positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 |
0.1 |
GO:0051037 |
regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.0 |
0.1 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.0 |
0.1 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 |
0.1 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.0 |
0.1 |
GO:0060013 |
righting reflex(GO:0060013) |
| 0.0 |
0.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 |
0.1 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.0 |
GO:0018352 |
protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.0 |
0.0 |
GO:0072683 |
T cell extravasation(GO:0072683) |
| 0.0 |
0.1 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 |
0.0 |
GO:0010644 |
cell communication by electrical coupling(GO:0010644) |
| 0.0 |
0.1 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.1 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.0 |
0.1 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.0 |
0.1 |
GO:0001180 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.0 |
0.0 |
GO:0006406 |
mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.0 |
0.0 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 |
0.1 |
GO:0002003 |
angiotensin maturation(GO:0002003) |
| 0.0 |
0.0 |
GO:0060397 |
JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 |
0.0 |
GO:0006425 |
glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 |
0.0 |
GO:2001190 |
positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
| 0.0 |
0.0 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 |
0.0 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 |
0.1 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.0 |
0.1 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.0 |
0.1 |
GO:0006537 |
glutamate biosynthetic process(GO:0006537) |
| 0.0 |
0.1 |
GO:1903788 |
mycotoxin metabolic process(GO:0043385) mycotoxin catabolic process(GO:0043387) aflatoxin metabolic process(GO:0046222) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound metabolic process(GO:1901376) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.0 |
0.1 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.0 |
0.0 |
GO:0009438 |
methylglyoxal metabolic process(GO:0009438) |
| 0.0 |
0.1 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 |
0.1 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 0.0 |
0.0 |
GO:1902613 |
regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.0 |
0.1 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 |
0.0 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.0 |
0.0 |
GO:1900226 |
negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.0 |
0.0 |
GO:0035050 |
embryonic heart tube development(GO:0035050) |
| 0.0 |
0.0 |
GO:0002439 |
chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.0 |
0.0 |
GO:0003164 |
His-Purkinje system development(GO:0003164) bundle of His development(GO:0003166) |
| 0.0 |
0.3 |
GO:0032098 |
regulation of appetite(GO:0032098) |
| 0.0 |
0.0 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 |
0.0 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 |
0.0 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 |
0.3 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 |
0.1 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.0 |
0.7 |
GO:0009988 |
cell-cell recognition(GO:0009988) |
| 0.0 |
0.0 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 |
0.1 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 |
0.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.0 |
0.1 |
GO:0045651 |
positive regulation of macrophage differentiation(GO:0045651) |
| 0.0 |
0.0 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.0 |
0.2 |
GO:0032495 |
response to muramyl dipeptide(GO:0032495) |
| 0.0 |
0.2 |
GO:1902913 |
regulation of melanocyte differentiation(GO:0045634) positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 |
0.0 |
GO:0048266 |
behavioral response to pain(GO:0048266) |
| 0.0 |
0.6 |
GO:1903307 |
positive regulation of regulated secretory pathway(GO:1903307) |
| 0.0 |
0.1 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 0.0 |
0.0 |
GO:1902809 |
regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 |
0.1 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.0 |
0.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.2 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
0.0 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 |
0.1 |
GO:1902915 |
negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 |
0.1 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.0 |
0.0 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.0 |
0.0 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.0 |
GO:0043380 |
memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) positive regulation of memory T cell differentiation(GO:0043382) |
| 0.0 |
0.0 |
GO:0019934 |
cGMP-mediated signaling(GO:0019934) |
| 0.0 |
0.0 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.0 |
0.1 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 |
0.1 |
GO:2000188 |
regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 |
0.1 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 |
0.0 |
GO:0042738 |
exogenous drug catabolic process(GO:0042738) |
| 0.0 |
0.0 |
GO:0006565 |
L-serine catabolic process(GO:0006565) |
| 0.0 |
0.1 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 |
0.0 |
GO:1900126 |
negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 |
0.0 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.0 |
0.0 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.0 |
0.1 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 |
0.1 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
