Motif ID: PAX6
Z-value: 0.563
Transcription factors associated with PAX6:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| PAX6 | ENSG00000007372.16 | PAX6 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PAX6 | hg19_v2_chr11_-_31839488_31839515 | 0.16 | 4.5e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.9 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.3 | 1.1 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.2 | 0.5 | GO:0033242 | regulation of cellular amine catabolic process(GO:0033241) negative regulation of cellular amine catabolic process(GO:0033242) negative regulation of the force of heart contraction(GO:0098736) regulation of arginine catabolic process(GO:1900081) negative regulation of arginine catabolic process(GO:1900082) regulation of citrulline biosynthetic process(GO:1903248) negative regulation of citrulline biosynthetic process(GO:1903249) negative regulation of cellular amino acid biosynthetic process(GO:2000283) |
| 0.2 | 0.5 | GO:2000910 | negative regulation of cholesterol import(GO:0060621) negative regulation of sterol import(GO:2000910) |
| 0.1 | 1.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.7 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.1 | 0.5 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.1 | 0.8 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.3 | GO:0035669 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 0.8 | GO:0015820 | leucine transport(GO:0015820) proline transmembrane transport(GO:0035524) |
| 0.1 | 0.9 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.1 | 1.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.1 | 0.5 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.1 | 1.1 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.3 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 1.0 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.3 | GO:0072086 | specification of loop of Henle identity(GO:0072086) pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 0.3 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.1 | 0.3 | GO:0002351 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.1 | 0.5 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.4 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 | 0.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.2 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.0 | 0.3 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.0 | 0.1 | GO:0072579 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.0 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.3 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.2 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.0 | 0.3 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.2 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.1 | GO:2000296 | negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 0.0 | 0.2 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.2 | GO:1903764 | regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 | 0.3 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.0 | 0.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:0098907 | protein localization to M-band(GO:0036309) regulation of SA node cell action potential(GO:0098907) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0039506 | modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.0 | 0.4 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.2 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.2 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.0 | 0.2 | GO:1900004 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 | 0.1 | GO:0006581 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.1 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 1.3 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.8 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.4 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.2 | GO:0009058 | biosynthetic process(GO:0009058) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.5 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 | 0.0 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.0 | 0.2 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.5 | GO:0021522 | spinal cord motor neuron differentiation(GO:0021522) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.3 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
| 0.2 | 0.8 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 1.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 1.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.4 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.1 | 0.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 0.5 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 1.0 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.5 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.9 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.3 | 0.8 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.2 | 0.8 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.2 | 0.8 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.5 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.1 | 0.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 1.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.7 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.8 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.1 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.0 | 0.1 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.0 | 0.2 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 1.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.2 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 0.5 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.2 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.2 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.2 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.7 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.9 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.5 | PID_CONE_PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.8 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.6 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 1.0 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.3 | PID_DNA_PK_PATHWAY | DNA-PK pathway in nonhomologous end joining |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.9 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.8 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 1.0 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.0 | 0.4 | REACTOME_SIGNALING_BY_FGFR3_MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.7 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.3 | REACTOME_IKK_COMPLEX_RECRUITMENT_MEDIATED_BY_RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.5 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.5 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.8 | REACTOME_INHIBITION_OF_VOLTAGE_GATED_CA2_CHANNELS_VIA_GBETA_GAMMA_SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.5 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.6 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.4 | REACTOME_BRANCHED_CHAIN_AMINO_ACID_CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME_ABACAVIR_TRANSPORT_AND_METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.2 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.2 | REACTOME_TRAFFICKING_AND_PROCESSING_OF_ENDOSOMAL_TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.7 | REACTOME_DARPP_32_EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.5 | REACTOME_NEP_NS2_INTERACTS_WITH_THE_CELLULAR_EXPORT_MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.2 | REACTOME_ANDROGEN_BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.5 | REACTOME_RECYCLING_PATHWAY_OF_L1 | Genes involved in Recycling pathway of L1 |
