Motif ID: RAD21_SMC3
Z-value: 1.474
Transcription factors associated with RAD21_SMC3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| RAD21 | ENSG00000164754.8 | RAD21 |
| SMC3 | ENSG00000108055.9 | SMC3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| SMC3 | hg19_v2_chr10_+_112327425_112327516 | -0.58 | 2.7e-03 | Click! |
| RAD21 | hg19_v2_chr8_-_117886955_117887105 | 0.02 | 9.3e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 9.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.9 | 2.6 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.8 | 2.5 | GO:0030264 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) |
| 0.8 | 3.2 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.7 | 2.1 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.6 | 5.7 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.6 | 1.8 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.6 | 4.7 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.6 | 3.5 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.6 | 2.2 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.5 | 1.6 | GO:0033242 | regulation of cellular amine catabolic process(GO:0033241) negative regulation of cellular amine catabolic process(GO:0033242) negative regulation of the force of heart contraction(GO:0098736) regulation of arginine catabolic process(GO:1900081) negative regulation of arginine catabolic process(GO:1900082) regulation of citrulline biosynthetic process(GO:1903248) negative regulation of citrulline biosynthetic process(GO:1903249) negative regulation of cellular amino acid biosynthetic process(GO:2000283) |
| 0.4 | 2.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.4 | 1.7 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.4 | 1.3 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.4 | 1.3 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.4 | 3.7 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.4 | 2.7 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.4 | 3.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.4 | 1.2 | GO:0045360 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.4 | 1.1 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.4 | 1.1 | GO:0019285 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.4 | 1.1 | GO:0060490 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.4 | 1.1 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.3 | 1.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.3 | 5.7 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.3 | 1.0 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.3 | 1.3 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.3 | 2.6 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.3 | 0.3 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.3 | 2.0 | GO:0098602 | single organism cell adhesion(GO:0098602) |
| 0.3 | 6.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.3 | 1.5 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.3 | 0.8 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.2 | 1.2 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 1.0 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.2 | 1.2 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 | 2.4 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.2 | 3.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 0.9 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.2 | 2.4 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.2 | 0.9 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.2 | 0.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.2 | 1.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.2 | 1.0 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
| 0.2 | 1.8 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.2 | 0.2 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
| 0.2 | 2.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.2 | 1.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 | 1.9 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.2 | 1.2 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.2 | 1.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.2 | 1.1 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.2 | 2.3 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.2 | 1.1 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.2 | 1.4 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.2 | 0.7 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.2 | 1.2 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.2 | 1.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.5 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.2 | 0.6 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 0.2 | 0.8 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.2 | 2.9 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 1.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 2.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 3.0 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 1.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
| 0.1 | 1.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.1 | 0.5 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.3 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 | 1.7 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 3.3 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.1 | 0.4 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.5 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 0.1 | 0.8 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.5 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 2.4 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.6 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 | 11.7 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.1 | 0.8 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 2.2 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.1 | 2.6 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 | 1.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.8 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 1.5 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.8 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 0.3 | GO:0010212 | response to ionizing radiation(GO:0010212) |
| 0.1 | 3.2 | GO:1903846 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 0.4 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 1.9 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 | 0.4 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.2 | GO:0034136 | B-1 B cell homeostasis(GO:0001922) negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.1 | 0.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.5 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.5 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.3 | GO:0060266 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.1 | 0.3 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.6 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.1 | 1.3 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.1 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.1 | 1.0 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.3 | GO:1903597 | negative regulation of gap junction assembly(GO:1903597) |
| 0.1 | 0.4 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.1 | 5.9 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.3 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.5 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 | 0.3 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.2 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 3.6 | GO:0097435 | fibril organization(GO:0097435) |
| 0.1 | 0.4 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.1 | 1.3 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 | 0.3 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 0.7 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.1 | 0.8 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 | 0.2 | GO:1901889 | negative regulation of cell junction assembly(GO:1901889) |
| 0.1 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.5 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.6 | GO:1902074 | response to salt(GO:1902074) |
| 0.1 | 0.7 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 1.5 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.2 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 | 0.1 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.0 | 1.2 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.4 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.4 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 1.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 2.6 | GO:0006739 | NADP metabolic process(GO:0006739) |
| 0.0 | 0.7 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.8 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.6 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 1.6 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.9 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.2 | GO:0014826 | cellular magnesium ion homeostasis(GO:0010961) vein smooth muscle contraction(GO:0014826) |
| 0.0 | 0.5 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.6 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.2 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 1.7 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 1.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.4 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.8 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 3.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 1.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.0 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.2 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.0 | 0.3 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 1.7 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.0 | 0.8 | GO:1990830 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.0 | 0.7 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 1.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.1 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.1 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.0 | 2.6 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 0.4 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.8 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 1.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:1901165 | negative regulation of MDA-5 signaling pathway(GO:0039534) positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.4 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.7 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.4 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 1.7 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.0 | 0.0 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
| 0.0 | 0.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.0 | 0.3 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 2.0 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.6 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 1.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.1 | GO:0018283 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) proprioception(GO:0019230) |
| 0.0 | 2.1 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.3 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.6 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.4 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.0 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.5 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 1.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 1.2 | GO:0019233 | sensory perception of pain(GO:0019233) |
| 0.0 | 1.2 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.7 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 6.5 | GO:0010506 | regulation of autophagy(GO:0010506) |
| 0.0 | 1.6 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.0 | 1.2 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.6 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 0.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.8 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 2.0 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.5 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.1 | GO:0051962 | positive regulation of nervous system development(GO:0051962) |
| 0.0 | 1.7 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.3 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.0 | 0.5 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.5 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.6 | GO:0051693 | actin filament capping(GO:0051693) |
| 0.0 | 0.1 | GO:0060828 | regulation of canonical Wnt signaling pathway(GO:0060828) |
| 0.0 | 0.8 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
| 0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.0 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.1 | GO:0019441 | tryptophan catabolic process to kynurenine(GO:0019441) |
| 0.0 | 0.0 | GO:0002585 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.0 | 1.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.3 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 | 0.9 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.0 | 0.3 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 0.9 | GO:0016234 | inclusion body(GO:0016234) |
| 0.6 | 3.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.5 | 2.7 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.5 | 9.1 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) bleb(GO:0032059) |
| 0.5 | 5.7 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.3 | 2.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 1.7 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 5.7 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 0.9 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.2 | 6.1 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 2.5 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.2 | 1.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 0.7 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.2 | 1.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 2.0 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 1.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 15.4 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 1.7 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.4 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.1 | 0.4 | GO:0097134 | Y chromosome(GO:0000806) cyclin A2-CDK2 complex(GO:0097124) cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 1.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.5 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 1.0 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.8 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.5 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 1.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 1.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 1.2 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 0.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 7.3 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.1 | 0.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.4 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.5 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.6 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 1.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 1.2 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 3.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.6 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.8 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.1 | 1.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.8 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 4.3 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.1 | 1.2 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 1.6 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.8 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 1.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 3.7 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 2.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 1.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.8 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.5 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.9 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 3.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.5 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 2.1 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 1.8 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 3.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.2 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.0 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 1.7 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 2.0 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 4.0 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 2.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.9 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 2.6 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.7 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 9.7 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.4 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 1.5 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 3.9 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 1.7 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 0.4 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 4.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 3.7 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 2.8 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 1.4 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 1.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 2.2 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 1.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 6.0 | GO:0043025 | neuronal cell body(GO:0043025) |
| 0.0 | 1.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 2.9 | GO:0016324 | apical plasma membrane(GO:0016324) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.8 | 2.5 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.8 | 3.2 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.5 | 1.6 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.5 | 4.8 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.5 | 2.6 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.5 | 1.6 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.4 | 1.8 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.4 | 2.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.4 | 6.6 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.4 | 5.7 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.4 | 1.2 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.4 | 1.2 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.4 | 2.6 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.4 | 1.5 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.3 | 1.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 1.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.3 | 1.8 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.3 | 2.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.3 | 0.8 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.2 | 0.7 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.2 | 0.7 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 2.4 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 1.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.2 | 1.9 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 5.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 1.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.2 | 6.0 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.2 | 0.8 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.2 | 1.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.2 | 2.4 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.2 | 0.8 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.1 | 1.5 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 3.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.4 | GO:0052726 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.1 | 1.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 9.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.5 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 1.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.5 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 0.4 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.1 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 1.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 1.7 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 2.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 1.7 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.5 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 2.7 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
| 0.1 | 0.4 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.4 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 1.6 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 9.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 1.3 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 1.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 3.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.1 | 1.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 1.7 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 1.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.8 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.4 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.1 | 1.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 1.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 3.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.7 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 2.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 2.5 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.1 | 1.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.2 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.1 | 1.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.0 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.1 | 1.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.6 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.3 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.4 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.9 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 6.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 1.7 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 2.9 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.0 | 0.8 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.9 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 1.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.2 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 1.0 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.8 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 1.7 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.0 | 1.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.2 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.0 | 0.8 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 1.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.6 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 1.3 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.6 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 4.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.4 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.2 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.1 | GO:0051800 | phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
| 0.0 | 0.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 1.5 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 9.8 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.4 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 2.1 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.6 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.8 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.3 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 4.1 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 4.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.4 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 9.7 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 1.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.4 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 1.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.4 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.7 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.0 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 1.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.8 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.3 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.4 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.7 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 1.2 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 0.6 | GO:0051219 | phosphoprotein binding(GO:0051219) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 8.6 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 0.1 | 3.4 | PID_ERBB_NETWORK_PATHWAY | ErbB receptor signaling network |
| 0.1 | 4.5 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 5.8 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 2.4 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.1 | 3.8 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 1.4 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 2.7 | PID_IL8_CXCR1_PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 5.9 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 1.3 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
| 0.0 | 4.6 | PID_LKB1_PATHWAY | LKB1 signaling events |
| 0.0 | 3.0 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 0.0 | 0.4 | SA_TRKA_RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.6 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.9 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 2.0 | PID_RHOA_PATHWAY | RhoA signaling pathway |
| 0.0 | 0.8 | ST_B_CELL_ANTIGEN_RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.8 | PID_EPHB_FWD_PATHWAY | EPHB forward signaling |
| 0.0 | 7.2 | PID_P53_DOWNSTREAM_PATHWAY | Direct p53 effectors |
| 0.0 | 1.4 | ST_G_ALPHA_I_PATHWAY | G alpha i Pathway |
| 0.0 | 0.3 | PID_IL5_PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.0 | PID_IL27_PATHWAY | IL27-mediated signaling events |
| 0.0 | 2.8 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 1.0 | PID_IL1_PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.0 | 1.0 | PID_HDAC_CLASSII_PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.8 | PID_THROMBIN_PAR1_PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 1.4 | PID_FGF_PATHWAY | FGF signaling pathway |
| 0.0 | 0.8 | PID_PI3KCI_PATHWAY | Class I PI3K signaling events |
| 0.0 | 1.5 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.6 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 6.0 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.6 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
| 0.0 | 5.1 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 1.3 | PID_P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.3 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | PID_ENDOTHELIN_PATHWAY | Endothelins |
| 0.0 | 0.8 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.6 | PID_FOXO_PATHWAY | FoxO family signaling |
| 0.0 | 0.2 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 1.3 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 1.2 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.3 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.3 | PID_NCADHERIN_PATHWAY | N-cadherin signaling events |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 14.2 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 16.9 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 3.7 | REACTOME_HYALURONAN_METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 2.8 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 0.8 | REACTOME_FGFR1_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.1 | 0.4 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 3.4 | REACTOME_SHC1_EVENTS_IN_ERBB4_SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 1.8 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.0 | REACTOME_NFKB_IS_ACTIVATED_AND_SIGNALS_SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 1.4 | REACTOME_FGFR4_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.2 | REACTOME_NEF_MEDIATED_DOWNREGULATION_OF_MHC_CLASS_I_COMPLEX_CELL_SURFACE_EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.9 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.6 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 1.3 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 1.6 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 1.2 | REACTOME_SPRY_REGULATION_OF_FGF_SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 3.1 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 3.4 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 1.2 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.3 | REACTOME_REGULATION_OF_RHEB_GTPASE_ACTIVITY_BY_AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 3.8 | REACTOME_NRAGE_SIGNALS_DEATH_THROUGH_JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 1.9 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.4 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 1.7 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 2.8 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 1.4 | REACTOME_INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.5 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 2.6 | REACTOME_CYTOCHROME_P450_ARRANGED_BY_SUBSTRATE_TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.3 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 1.3 | REACTOME_ADHERENS_JUNCTIONS_INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.9 | REACTOME_RIP_MEDIATED_NFKB_ACTIVATION_VIA_DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 2.3 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 1.2 | REACTOME_DEGRADATION_OF_THE_EXTRACELLULAR_MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 1.5 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 2.3 | REACTOME_G_ALPHA_Z_SIGNALLING_EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.3 | REACTOME_FRS2_MEDIATED_CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 2.6 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 3.0 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.8 | REACTOME_INTEGRIN_ALPHAIIB_BETA3_SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.0 | 0.4 | REACTOME_ABACAVIR_TRANSPORT_AND_METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.2 | REACTOME_AKT_PHOSPHORYLATES_TARGETS_IN_THE_CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.6 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.9 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 1.0 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.7 | REACTOME_ANTIGEN_PRESENTATION_FOLDING_ASSEMBLY_AND_PEPTIDE_LOADING_OF_CLASS_I_MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.8 | REACTOME_INTERACTION_BETWEEN_L1_AND_ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.5 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.5 | REACTOME_CA_DEPENDENT_EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 3.2 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.6 | REACTOME_BETA_DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 1.1 | REACTOME_MRNA_3_END_PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 1.6 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.4 | REACTOME_ALPHA_LINOLENIC_ACID_ALA_METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 1.5 | REACTOME_CDK_MEDIATED_PHOSPHORYLATION_AND_REMOVAL_OF_CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.0 | 4.0 | REACTOME_3_UTR_MEDIATED_TRANSLATIONAL_REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.3 | REACTOME_CLEAVAGE_OF_GROWING_TRANSCRIPT_IN_THE_TERMINATION_REGION_ | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.0 | 2.9 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.5 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.6 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.7 | REACTOME_LATE_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.8 | REACTOME_TRIGLYCERIDE_BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.5 | REACTOME_SRP_DEPENDENT_COTRANSLATIONAL_PROTEIN_TARGETING_TO_MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.5 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.2 | REACTOME_G_ALPHA1213_SIGNALLING_EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 1.5 | REACTOME_TRANSPORT_OF_INORGANIC_CATIONS_ANIONS_AND_AMINO_ACIDS_OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 1.0 | REACTOME_GOLGI_ASSOCIATED_VESICLE_BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.2 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
|
|
|