| 2.8 |
11.2 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 1.8 |
5.5 |
GO:0061188 |
negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 1.7 |
6.9 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 1.6 |
4.7 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 1.4 |
7.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.4 |
4.1 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.3 |
5.3 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 1.3 |
2.5 |
GO:0003274 |
endocardial cushion fusion(GO:0003274) |
| 1.2 |
3.6 |
GO:0021919 |
BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
| 1.2 |
3.5 |
GO:0002514 |
B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 1.2 |
3.5 |
GO:1902725 |
negative regulation of satellite cell differentiation(GO:1902725) |
| 1.1 |
3.4 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 1.0 |
10.4 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 |
8.2 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.0 |
3.0 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.0 |
1.9 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.9 |
2.8 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.9 |
3.6 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.9 |
0.9 |
GO:0046543 |
development of secondary female sexual characteristics(GO:0046543) |
| 0.9 |
5.2 |
GO:0003149 |
membranous septum morphogenesis(GO:0003149) |
| 0.8 |
8.2 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.8 |
6.5 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.8 |
2.4 |
GO:0090076 |
relaxation of skeletal muscle(GO:0090076) |
| 0.8 |
2.4 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.8 |
2.3 |
GO:1904048 |
regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.8 |
2.3 |
GO:0016260 |
selenocysteine biosynthetic process(GO:0016260) |
| 0.8 |
3.1 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 0.8 |
2.3 |
GO:0051097 |
negative regulation of helicase activity(GO:0051097) |
| 0.8 |
0.8 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) |
| 0.8 |
2.3 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.8 |
6.0 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.7 |
2.9 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.7 |
0.7 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.7 |
2.9 |
GO:0072134 |
nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.7 |
2.9 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.7 |
2.2 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.7 |
4.3 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.7 |
0.7 |
GO:0048371 |
lateral mesodermal cell differentiation(GO:0048371) lateral mesodermal cell fate commitment(GO:0048372) lateral mesodermal cell fate specification(GO:0048377) regulation of lateral mesodermal cell fate specification(GO:0048378) |
| 0.7 |
4.7 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.7 |
3.3 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.7 |
3.3 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.6 |
3.2 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.6 |
1.9 |
GO:0015993 |
L-ascorbic acid transport(GO:0015882) molecular hydrogen transport(GO:0015993) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.6 |
2.5 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.6 |
2.5 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.6 |
4.3 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.6 |
3.1 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.6 |
1.8 |
GO:0090403 |
oxidative stress-induced premature senescence(GO:0090403) |
| 0.6 |
2.4 |
GO:0097676 |
histone H3-K36 dimethylation(GO:0097676) |
| 0.6 |
1.8 |
GO:0035283 |
central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.6 |
2.3 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 0.6 |
2.8 |
GO:1901090 |
regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.6 |
1.7 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.6 |
1.1 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.6 |
2.2 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.5 |
1.6 |
GO:0098582 |
innate vocalization behavior(GO:0098582) |
| 0.5 |
1.6 |
GO:1903860 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.5 |
2.7 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.5 |
2.6 |
GO:0019075 |
virus maturation(GO:0019075) |
| 0.5 |
0.5 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.5 |
1.6 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.5 |
2.6 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.5 |
2.0 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.5 |
0.5 |
GO:0034205 |
beta-amyloid formation(GO:0034205) regulation of beta-amyloid formation(GO:1902003) positive regulation of beta-amyloid formation(GO:1902004) |
| 0.5 |
3.0 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.5 |
1.5 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.5 |
0.5 |
GO:0010452 |
histone H3-K36 methylation(GO:0010452) |
| 0.5 |
4.0 |
GO:0071233 |
cellular response to leucine(GO:0071233) |
| 0.5 |
7.0 |
GO:0051256 |
mitotic spindle midzone assembly(GO:0051256) |
| 0.5 |
1.5 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.5 |
1.0 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.5 |
2.0 |
GO:2000820 |
negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.5 |
1.4 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.5 |
2.7 |
GO:0035407 |
histone H3-T11 phosphorylation(GO:0035407) |
| 0.5 |
4.1 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.4 |
0.4 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.4 |
2.2 |
GO:2001168 |
regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.4 |
1.8 |
GO:0009447 |
putrescine catabolic process(GO:0009447) |
| 0.4 |
2.6 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 |
1.3 |
GO:1904504 |
regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.4 |
1.7 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.4 |
9.2 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.4 |
0.4 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.4 |
0.4 |
GO:0002519 |
natural killer cell tolerance induction(GO:0002519) |
| 0.4 |
0.4 |
GO:0009411 |
response to UV(GO:0009411) |
| 0.4 |
0.8 |
GO:0061289 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.4 |
1.3 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) positive regulation of type B pancreatic cell development(GO:2000078) |
| 0.4 |
1.3 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.4 |
1.7 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 |
1.7 |
GO:0070602 |
regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.4 |
1.3 |
GO:0045925 |
positive regulation of female receptivity(GO:0045925) |
| 0.4 |
0.4 |
GO:1904933 |
regulation of cell proliferation in midbrain(GO:1904933) |
| 0.4 |
1.2 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.4 |
1.2 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.4 |
2.8 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.4 |
1.2 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.4 |
1.9 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.4 |
0.8 |
GO:0051604 |
protein maturation(GO:0051604) |
| 0.4 |
1.6 |
GO:0003402 |
planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.4 |
0.8 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.4 |
2.3 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.4 |
6.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.4 |
1.9 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.4 |
2.3 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.4 |
0.7 |
GO:0043153 |
photoperiodism(GO:0009648) entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.4 |
1.5 |
GO:0006542 |
glutamine biosynthetic process(GO:0006542) |
| 0.4 |
6.3 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.4 |
1.1 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.4 |
0.7 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.4 |
1.1 |
GO:0050902 |
leukocyte adhesive activation(GO:0050902) |
| 0.4 |
2.9 |
GO:1901858 |
regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.4 |
1.5 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.4 |
0.7 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.4 |
2.1 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.4 |
4.3 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.4 |
2.1 |
GO:1904381 |
Golgi apparatus mannose trimming(GO:1904381) |
| 0.4 |
0.7 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.3 |
0.3 |
GO:0001502 |
cartilage condensation(GO:0001502) |
| 0.3 |
1.0 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.3 |
1.7 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.3 |
2.3 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.3 |
0.3 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.3 |
2.2 |
GO:0070562 |
regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.3 |
0.3 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.3 |
0.9 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.3 |
1.9 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.3 |
4.1 |
GO:0021514 |
ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.3 |
1.6 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.3 |
0.9 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.3 |
0.3 |
GO:0090240 |
positive regulation of histone H4 acetylation(GO:0090240) |
| 0.3 |
2.5 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.3 |
0.9 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.3 |
2.7 |
GO:0043634 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.3 |
0.6 |
GO:0003408 |
optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.3 |
0.9 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.3 |
1.2 |
GO:0090299 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.3 |
1.2 |
GO:0010157 |
response to chlorate(GO:0010157) |
| 0.3 |
1.5 |
GO:2001076 |
regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.3 |
1.2 |
GO:0032898 |
neurotrophin production(GO:0032898) |
| 0.3 |
2.0 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.3 |
0.9 |
GO:0035669 |
TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.3 |
0.9 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.3 |
2.0 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.3 |
0.9 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.3 |
2.0 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.3 |
2.0 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.3 |
0.8 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.3 |
0.3 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 |
0.3 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.3 |
0.3 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.3 |
0.6 |
GO:0042982 |
amyloid precursor protein metabolic process(GO:0042982) |
| 0.3 |
7.2 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.3 |
0.8 |
GO:0001798 |
positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.3 |
1.3 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.3 |
0.8 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.3 |
2.2 |
GO:0071386 |
cellular response to corticosterone stimulus(GO:0071386) |
| 0.3 |
0.5 |
GO:0060314 |
regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.3 |
3.2 |
GO:0007379 |
segment specification(GO:0007379) |
| 0.3 |
2.9 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 0.3 |
1.1 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.3 |
1.1 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.3 |
3.4 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.3 |
2.1 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.3 |
1.6 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.3 |
0.8 |
GO:0006174 |
dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.3 |
0.8 |
GO:0021966 |
corticospinal neuron axon guidance(GO:0021966) |
| 0.3 |
2.0 |
GO:0030917 |
midbrain-hindbrain boundary development(GO:0030917) |
| 0.3 |
0.3 |
GO:0050655 |
dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.2 |
1.0 |
GO:1904199 |
positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.2 |
1.0 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 |
1.7 |
GO:0070649 |
polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.2 |
6.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.2 |
1.2 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
0.2 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.2 |
2.4 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 |
0.7 |
GO:0060734 |
regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.2 |
1.4 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.2 |
0.7 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 |
1.2 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 |
2.1 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 |
3.0 |
GO:0021694 |
cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 |
0.9 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.2 |
0.7 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 |
2.5 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.2 |
0.7 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 |
0.2 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.2 |
1.6 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.2 |
1.1 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.2 |
2.5 |
GO:0002634 |
regulation of germinal center formation(GO:0002634) |
| 0.2 |
1.1 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.2 |
1.3 |
GO:1901300 |
positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.2 |
0.7 |
GO:0070839 |
divalent metal ion export(GO:0070839) |
| 0.2 |
1.1 |
GO:0045074 |
interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.2 |
1.8 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 |
0.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
0.2 |
GO:0090230 |
regulation of centromere complex assembly(GO:0090230) |
| 0.2 |
0.7 |
GO:0070103 |
regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.2 |
3.5 |
GO:0090360 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 |
0.9 |
GO:0006740 |
NADPH regeneration(GO:0006740) |
| 0.2 |
1.7 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 |
1.3 |
GO:0034163 |
regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.2 |
1.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 |
0.6 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.2 |
1.5 |
GO:0033183 |
negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 |
1.7 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 0.2 |
3.1 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 |
2.7 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
1.0 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 |
0.6 |
GO:0031548 |
regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.2 |
0.4 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.2 |
0.8 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.2 |
0.2 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.2 |
1.8 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.2 |
0.8 |
GO:0072658 |
maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.2 |
0.4 |
GO:1902732 |
positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.2 |
0.8 |
GO:1900248 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.2 |
0.6 |
GO:0071418 |
cellular response to amine stimulus(GO:0071418) |
| 0.2 |
0.6 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.2 |
2.4 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.2 |
4.5 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.2 |
3.2 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.2 |
3.0 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 |
0.8 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.2 |
0.6 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 |
0.6 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 |
2.3 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 |
0.6 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 |
0.6 |
GO:0035521 |
monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.2 |
1.7 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.2 |
0.6 |
GO:0035377 |
transepithelial water transport(GO:0035377) |
| 0.2 |
0.2 |
GO:0071874 |
response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.2 |
3.1 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 |
4.6 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
0.2 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.2 |
1.9 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 |
1.3 |
GO:2000272 |
negative regulation of receptor activity(GO:2000272) |
| 0.2 |
0.6 |
GO:0097477 |
lateral motor column neuron migration(GO:0097477) |
| 0.2 |
2.2 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 |
1.1 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.2 |
3.1 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.2 |
4.4 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 |
0.9 |
GO:1904158 |
axonemal central apparatus assembly(GO:1904158) |
| 0.2 |
5.2 |
GO:0060122 |
inner ear receptor stereocilium organization(GO:0060122) |
| 0.2 |
0.4 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.2 |
1.4 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 |
0.5 |
GO:0070681 |
glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.2 |
0.4 |
GO:0010956 |
negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.2 |
0.4 |
GO:0006541 |
glutamine metabolic process(GO:0006541) |
| 0.2 |
0.2 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.2 |
0.9 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
1.4 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 |
1.6 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.2 |
0.9 |
GO:2001293 |
malonyl-CoA metabolic process(GO:2001293) |
| 0.2 |
1.2 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 |
1.4 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.2 |
0.3 |
GO:0021823 |
cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.2 |
0.2 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 |
1.0 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 0.2 |
0.3 |
GO:0090325 |
regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.2 |
1.5 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
5.3 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.2 |
0.2 |
GO:0003220 |
left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.2 |
2.0 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.2 |
0.5 |
GO:0006864 |
pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.2 |
0.8 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.2 |
3.5 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 |
1.0 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.2 |
0.5 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.2 |
0.5 |
GO:1903751 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.2 |
1.6 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.2 |
1.0 |
GO:0006499 |
N-terminal protein myristoylation(GO:0006499) |
| 0.2 |
0.5 |
GO:1904247 |
positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 |
1.1 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.2 |
0.5 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.2 |
1.0 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 |
0.6 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.2 |
0.5 |
GO:0007595 |
lactation(GO:0007595) |
| 0.2 |
1.1 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 |
0.5 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.2 |
1.4 |
GO:0046831 |
regulation of RNA export from nucleus(GO:0046831) |
| 0.2 |
0.6 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 |
0.6 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
0.5 |
GO:2001301 |
lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.2 |
0.3 |
GO:1900920 |
regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.2 |
5.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
1.1 |
GO:0034088 |
maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 |
1.9 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 |
1.2 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 0.2 |
0.2 |
GO:0071284 |
cellular response to lead ion(GO:0071284) |
| 0.2 |
0.6 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.2 |
1.4 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.2 |
0.6 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 |
0.8 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.2 |
0.5 |
GO:0038178 |
complement component C5a signaling pathway(GO:0038178) |
| 0.2 |
1.1 |
GO:1902047 |
polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.2 |
2.1 |
GO:0006054 |
N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 |
3.9 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 0.2 |
0.9 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.2 |
0.3 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.2 |
1.2 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.2 |
1.1 |
GO:0042339 |
keratan sulfate biosynthetic process(GO:0018146) keratan sulfate metabolic process(GO:0042339) |
| 0.2 |
5.4 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.1 |
0.6 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 |
1.0 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
0.7 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.1 |
1.2 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.1 |
1.2 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 |
6.0 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 |
0.4 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 |
0.6 |
GO:0072156 |
distal tubule morphogenesis(GO:0072156) |
| 0.1 |
0.6 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.1 |
0.1 |
GO:0022038 |
corpus callosum development(GO:0022038) |
| 0.1 |
1.9 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
2.9 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.7 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 |
0.4 |
GO:0070781 |
response to biotin(GO:0070781) |
| 0.1 |
0.1 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 |
1.4 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 |
0.3 |
GO:0003186 |
tricuspid valve morphogenesis(GO:0003186) |
| 0.1 |
0.4 |
GO:0090218 |
positive regulation of lipid kinase activity(GO:0090218) |
| 0.1 |
0.7 |
GO:1904764 |
negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.1 |
1.6 |
GO:0055089 |
fatty acid homeostasis(GO:0055089) |
| 0.1 |
1.8 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 |
0.6 |
GO:0044782 |
cilium organization(GO:0044782) |
| 0.1 |
2.0 |
GO:0045989 |
positive regulation of striated muscle contraction(GO:0045989) |
| 0.1 |
0.8 |
GO:1990822 |
basic amino acid transmembrane transport(GO:1990822) |
| 0.1 |
0.8 |
GO:1990441 |
negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.1 |
1.2 |
GO:0071798 |
response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 |
0.7 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.1 |
0.8 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.4 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
0.9 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
0.7 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.1 |
2.0 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.1 |
0.5 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.1 |
2.4 |
GO:0046069 |
cGMP catabolic process(GO:0046069) |
| 0.1 |
0.3 |
GO:1902723 |
negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 |
0.5 |
GO:1904016 |
response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.1 |
0.4 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.1 |
0.5 |
GO:0035553 |
oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 |
2.6 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 |
1.2 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 |
0.4 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.1 |
0.5 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.1 |
0.3 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.1 |
0.5 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.1 |
0.5 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 |
0.3 |
GO:0036302 |
atrioventricular canal development(GO:0036302) |
| 0.1 |
0.4 |
GO:0015817 |
acyl carnitine transport(GO:0006844) histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) acyl carnitine transmembrane transport(GO:1902616) |
| 0.1 |
0.3 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 |
0.4 |
GO:2000364 |
regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.1 |
0.1 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 |
1.1 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.9 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.1 |
0.5 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.1 |
0.5 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 |
1.1 |
GO:0002414 |
immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 |
0.6 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.1 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 |
1.0 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 |
0.5 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
1.6 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 |
0.4 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 |
0.5 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 |
0.1 |
GO:0014855 |
striated muscle cell proliferation(GO:0014855) |
| 0.1 |
0.4 |
GO:0043602 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.1 |
0.7 |
GO:0051531 |
NFAT protein import into nucleus(GO:0051531) |
| 0.1 |
1.0 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.1 |
0.5 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 |
0.8 |
GO:0006527 |
arginine catabolic process(GO:0006527) |
| 0.1 |
0.8 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 |
1.0 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.1 |
0.8 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
3.1 |
GO:0048864 |
stem cell development(GO:0048864) |
| 0.1 |
0.7 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 |
0.8 |
GO:0001915 |
negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 |
0.2 |
GO:0008050 |
female courtship behavior(GO:0008050) |
| 0.1 |
7.3 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 |
0.8 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.1 |
1.0 |
GO:0086024 |
adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.1 |
0.2 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.1 |
0.3 |
GO:0090310 |
negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.1 |
0.7 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 |
9.5 |
GO:0032418 |
lysosome localization(GO:0032418) |
| 0.1 |
0.3 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 |
0.3 |
GO:0002093 |
auditory receptor cell morphogenesis(GO:0002093) |
| 0.1 |
0.7 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.1 |
0.2 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.1 |
0.2 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 |
0.3 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.1 |
0.9 |
GO:0030473 |
nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.1 |
0.9 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.1 |
0.6 |
GO:0042733 |
embryonic digit morphogenesis(GO:0042733) |
| 0.1 |
0.2 |
GO:0006540 |
glutamate decarboxylation to succinate(GO:0006540) |
| 0.1 |
0.4 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
0.3 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.6 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.3 |
GO:0071529 |
cementum mineralization(GO:0071529) |
| 0.1 |
1.9 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.3 |
GO:0044691 |
tooth eruption(GO:0044691) |
| 0.1 |
0.2 |
GO:0000294 |
nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 |
0.8 |
GO:0010960 |
magnesium ion homeostasis(GO:0010960) |
| 0.1 |
0.8 |
GO:0043555 |
regulation of translation in response to stress(GO:0043555) |
| 0.1 |
0.7 |
GO:0060509 |
Type I pneumocyte differentiation(GO:0060509) |
| 0.1 |
4.4 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.1 |
0.3 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 |
0.2 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 |
1.0 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 |
0.4 |
GO:0001714 |
endodermal cell fate specification(GO:0001714) |
| 0.1 |
0.5 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 |
0.8 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 |
0.2 |
GO:0006711 |
estrogen catabolic process(GO:0006711) |
| 0.1 |
0.3 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.1 |
2.2 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.1 |
1.6 |
GO:0042789 |
mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 |
0.5 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.1 |
0.3 |
GO:0032096 |
negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.1 |
0.1 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.1 |
0.2 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.4 |
GO:1990785 |
response to water-immersion restraint stress(GO:1990785) |
| 0.1 |
0.5 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 |
1.1 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.1 |
0.1 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
1.6 |
GO:0015866 |
ADP transport(GO:0015866) |
| 0.1 |
1.9 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.1 |
2.1 |
GO:1900151 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 |
0.9 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.8 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.1 |
0.6 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
0.4 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 |
0.8 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.6 |
GO:0070294 |
renal sodium ion absorption(GO:0070294) |
| 0.1 |
0.2 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.1 |
0.7 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 |
0.3 |
GO:1902741 |
type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 |
0.3 |
GO:0003064 |
regulation of heart rate by hormone(GO:0003064) |
| 0.1 |
0.7 |
GO:0002371 |
dendritic cell cytokine production(GO:0002371) |
| 0.1 |
2.4 |
GO:0021952 |
central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.1 |
0.1 |
GO:0031443 |
fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 |
0.1 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 |
1.0 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.1 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.1 |
0.3 |
GO:0020027 |
hemoglobin metabolic process(GO:0020027) |
| 0.1 |
0.6 |
GO:0019732 |
antifungal humoral response(GO:0019732) |
| 0.1 |
0.9 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.3 |
GO:0061469 |
regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 |
0.6 |
GO:0090625 |
mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.1 |
0.7 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.1 |
0.4 |
GO:0010730 |
negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.1 |
0.2 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.1 |
8.2 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
1.3 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 |
0.3 |
GO:0052055 |
modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 |
0.4 |
GO:0032097 |
positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 |
0.3 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.2 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 |
0.4 |
GO:0046006 |
regulation of activated T cell proliferation(GO:0046006) |
| 0.1 |
0.1 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.1 |
0.7 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.1 |
2.1 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 |
1.6 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
0.5 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 |
0.3 |
GO:0070902 |
mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.1 |
0.2 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.3 |
GO:0051102 |
DNA ligation involved in DNA recombination(GO:0051102) |
| 0.1 |
2.8 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
1.1 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 |
0.5 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.1 |
0.6 |
GO:0097009 |
energy homeostasis(GO:0097009) |
| 0.1 |
0.9 |
GO:0045329 |
carnitine biosynthetic process(GO:0045329) |
| 0.1 |
0.3 |
GO:0046167 |
glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 |
0.5 |
GO:0009756 |
carbohydrate mediated signaling(GO:0009756) |
| 0.1 |
0.5 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.1 |
0.3 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.1 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 |
0.1 |
GO:0016137 |
glycoside metabolic process(GO:0016137) |
| 0.1 |
0.3 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 |
1.0 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
0.6 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.1 |
1.1 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
0.2 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 |
0.5 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.1 |
1.6 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.3 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 |
0.4 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.1 |
0.3 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.1 |
0.4 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 |
1.0 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.1 |
1.4 |
GO:1904886 |
beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 |
0.2 |
GO:2000562 |
CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 |
0.5 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 |
0.8 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 |
0.2 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 |
0.2 |
GO:0032290 |
peripheral nervous system myelin formation(GO:0032290) |
| 0.1 |
0.5 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 |
0.5 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.2 |
GO:0002752 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 |
0.2 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 |
3.5 |
GO:0032480 |
negative regulation of type I interferon production(GO:0032480) |
| 0.1 |
0.9 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 |
0.2 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.1 |
0.2 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 |
0.1 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
0.5 |
GO:0000101 |
sulfur amino acid transport(GO:0000101) |
| 0.1 |
0.2 |
GO:0003139 |
secondary heart field specification(GO:0003139) |
| 0.1 |
0.5 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
1.8 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.1 |
1.7 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 |
0.2 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 |
1.1 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
2.0 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) |
| 0.1 |
0.5 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.1 |
0.2 |
GO:0071880 |
adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.1 |
10.0 |
GO:0030449 |
regulation of complement activation(GO:0030449) |
| 0.1 |
0.1 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 |
0.2 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.1 |
0.5 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
1.4 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.1 |
GO:0071812 |
regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.1 |
1.3 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.1 |
0.1 |
GO:0055009 |
atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.1 |
0.3 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.1 |
0.3 |
GO:0032355 |
response to estradiol(GO:0032355) |
| 0.1 |
0.2 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
0.4 |
GO:0018022 |
peptidyl-lysine methylation(GO:0018022) |
| 0.1 |
1.1 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
| 0.1 |
1.8 |
GO:0048148 |
behavioral response to cocaine(GO:0048148) |
| 0.1 |
0.2 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.1 |
1.2 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.1 |
0.2 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.1 |
1.9 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.1 |
0.1 |
GO:1902617 |
response to fluoride(GO:1902617) |
| 0.1 |
0.7 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.1 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.1 |
0.3 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 |
0.1 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 |
1.2 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.1 |
0.3 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.1 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 |
0.1 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 |
1.1 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 |
0.5 |
GO:0097056 |
selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.1 |
1.7 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 |
0.2 |
GO:0030505 |
inorganic diphosphate transport(GO:0030505) |
| 0.1 |
0.6 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 |
0.4 |
GO:0098735 |
positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 |
0.5 |
GO:0045007 |
depurination(GO:0045007) |
| 0.1 |
0.3 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.1 |
3.6 |
GO:0035773 |
insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
| 0.1 |
0.2 |
GO:0048859 |
formation of anatomical boundary(GO:0048859) |
| 0.1 |
0.1 |
GO:2001180 |
negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.1 |
0.5 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 0.1 |
3.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
1.0 |
GO:0090084 |
negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 |
0.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.1 |
0.1 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.1 |
0.6 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
0.3 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.1 |
0.2 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
0.1 |
GO:0048807 |
female genitalia morphogenesis(GO:0048807) |
| 0.1 |
0.3 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.3 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.1 |
0.2 |
GO:0019056 |
modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 |
0.5 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.1 |
0.2 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.2 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.1 |
0.5 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.1 |
0.7 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
0.3 |
GO:0002833 |
positive regulation of response to biotic stimulus(GO:0002833) |
| 0.1 |
0.3 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 |
0.6 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 |
0.2 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 |
0.1 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.1 |
0.1 |
GO:1902525 |
regulation of protein monoubiquitination(GO:1902525) |
| 0.1 |
0.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.1 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.3 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.1 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 |
2.1 |
GO:0032878 |
regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.1 |
0.3 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
0.4 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 |
0.7 |
GO:0051298 |
centrosome duplication(GO:0051298) |
| 0.1 |
0.1 |
GO:0071907 |
determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.1 |
0.4 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.1 |
0.2 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.1 |
0.2 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 |
1.1 |
GO:0042135 |
neurotransmitter catabolic process(GO:0042135) |
| 0.1 |
0.4 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.2 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 |
1.1 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 |
0.4 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 |
0.5 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 |
0.2 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.1 |
0.5 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.1 |
3.8 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 |
0.3 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 |
3.7 |
GO:0006891 |
intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 |
0.1 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 0.1 |
0.2 |
GO:1904397 |
negative regulation of neuromuscular junction development(GO:1904397) |
| 0.1 |
0.3 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 |
0.2 |
GO:1905097 |
regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.1 |
0.3 |
GO:0048298 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.1 |
0.2 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 |
0.1 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.1 |
0.1 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.1 |
0.2 |
GO:1904978 |
regulation of endosome organization(GO:1904978) |
| 0.1 |
0.5 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
0.2 |
GO:1903659 |
regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 |
0.6 |
GO:0031498 |
chromatin disassembly(GO:0031498) |
| 0.1 |
0.1 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 |
0.5 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.1 |
0.3 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 |
0.2 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
0.9 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 |
0.9 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.1 |
0.3 |
GO:0030856 |
regulation of epithelial cell differentiation(GO:0030856) |
| 0.1 |
0.4 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
0.1 |
GO:2000564 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.1 |
1.4 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 |
0.4 |
GO:0008090 |
retrograde axonal transport(GO:0008090) |
| 0.1 |
0.2 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.1 |
0.5 |
GO:0070265 |
necrotic cell death(GO:0070265) |
| 0.1 |
0.3 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 0.1 |
0.2 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
0.1 |
GO:0002155 |
regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 |
0.9 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
0.1 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.1 |
0.6 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
3.1 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.1 |
1.2 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
0.9 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.1 |
0.4 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 |
0.2 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 |
0.3 |
GO:0060412 |
ventricular septum morphogenesis(GO:0060412) |
| 0.1 |
1.1 |
GO:0045332 |
phospholipid translocation(GO:0045332) |
| 0.1 |
0.3 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.2 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.1 |
0.3 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 |
0.5 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.1 |
0.5 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.1 |
0.6 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
1.1 |
GO:1990126 |
retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 |
0.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.1 |
1.9 |
GO:0046676 |
negative regulation of insulin secretion(GO:0046676) |
| 0.1 |
0.4 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.0 |
0.3 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.0 |
0.2 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.0 |
0.1 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.0 |
1.7 |
GO:1900740 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.0 |
0.1 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.0 |
0.2 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 0.0 |
1.4 |
GO:0010738 |
regulation of protein kinase A signaling(GO:0010738) |
| 0.0 |
0.2 |
GO:0099540 |
synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 |
0.2 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.0 |
1.4 |
GO:0046839 |
phospholipid dephosphorylation(GO:0046839) |
| 0.0 |
0.2 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 |
0.1 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 |
0.3 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.7 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.1 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.0 |
0.1 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.0 |
4.5 |
GO:0031338 |
regulation of vesicle fusion(GO:0031338) |
| 0.0 |
0.2 |
GO:0097178 |
ruffle assembly(GO:0097178) |
| 0.0 |
0.2 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.0 |
0.2 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.0 |
0.2 |
GO:0018032 |
protein amidation(GO:0018032) |
| 0.0 |
0.4 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.0 |
0.3 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 |
0.1 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.0 |
0.4 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.0 |
0.2 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.0 |
2.6 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.7 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.1 |
GO:0032470 |
positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.0 |
0.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.3 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.6 |
GO:0061512 |
protein localization to cilium(GO:0061512) |
| 0.0 |
3.3 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.6 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.0 |
0.2 |
GO:0035865 |
cellular response to potassium ion(GO:0035865) |
| 0.0 |
0.6 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.0 |
0.1 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.0 |
0.2 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 |
0.5 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.0 |
1.5 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 |
0.1 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.0 |
0.4 |
GO:2000821 |
regulation of grooming behavior(GO:2000821) |
| 0.0 |
0.1 |
GO:0051138 |
positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 |
0.1 |
GO:0046056 |
dADP metabolic process(GO:0046056) |
| 0.0 |
0.3 |
GO:2000278 |
regulation of DNA biosynthetic process(GO:2000278) |
| 0.0 |
0.3 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.0 |
1.7 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.0 |
0.7 |
GO:0006677 |
glycosylceramide metabolic process(GO:0006677) |
| 0.0 |
0.2 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 |
0.4 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 |
0.1 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.0 |
0.1 |
GO:0044854 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.0 |
0.1 |
GO:0042727 |
flavin-containing compound biosynthetic process(GO:0042727) |
| 0.0 |
0.2 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.0 |
0.7 |
GO:2001046 |
positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.0 |
0.2 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.0 |
0.5 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.0 |
0.5 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.4 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 |
0.1 |
GO:1902530 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 |
0.2 |
GO:0019605 |
butyrate metabolic process(GO:0019605) |
| 0.0 |
0.2 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.0 |
0.3 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 |
0.1 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 0.0 |
1.5 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.0 |
0.5 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
1.7 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.5 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 |
0.1 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 |
0.5 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.0 |
0.1 |
GO:0060353 |
regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 |
0.2 |
GO:0032881 |
regulation of polysaccharide metabolic process(GO:0032881) regulation of glycogen metabolic process(GO:0070873) |
| 0.0 |
0.2 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 |
0.1 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 |
0.1 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.0 |
1.2 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.4 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.0 |
0.2 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.0 |
0.3 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.2 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 |
0.2 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 |
0.2 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.0 |
0.2 |
GO:0015870 |
acetylcholine transport(GO:0015870) |
| 0.0 |
0.8 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.0 |
0.2 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 |
0.2 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.0 |
1.2 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.0 |
0.3 |
GO:0015732 |
prostaglandin transport(GO:0015732) |
| 0.0 |
0.7 |
GO:0036148 |
phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 |
0.1 |
GO:0042747 |
circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.0 |
0.4 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.0 |
0.2 |
GO:0002933 |
lipid hydroxylation(GO:0002933) |
| 0.0 |
0.2 |
GO:0034398 |
telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 |
0.2 |
GO:0071028 |
nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 |
0.2 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.0 |
0.3 |
GO:0019240 |
citrulline biosynthetic process(GO:0019240) |
| 0.0 |
0.2 |
GO:0042993 |
positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 |
0.1 |
GO:0042494 |
detection of bacterial lipoprotein(GO:0042494) |
| 0.0 |
0.2 |
GO:0036149 |
phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 |
0.1 |
GO:0019085 |
early viral transcription(GO:0019085) |
| 0.0 |
0.3 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 |
0.2 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 |
0.1 |
GO:1904562 |
phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 |
0.1 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) |
| 0.0 |
0.1 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 0.0 |
0.2 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 |
0.3 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 |
1.7 |
GO:0051453 |
regulation of intracellular pH(GO:0051453) |
| 0.0 |
0.2 |
GO:0002084 |
protein depalmitoylation(GO:0002084) |
| 0.0 |
0.5 |
GO:0016558 |
protein import into peroxisome matrix(GO:0016558) |
| 0.0 |
1.1 |
GO:0005980 |
glycogen catabolic process(GO:0005980) |
| 0.0 |
0.2 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.0 |
0.1 |
GO:0036006 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 |
0.1 |
GO:1901253 |
negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.0 |
0.3 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.0 |
0.3 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.0 |
0.1 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.0 |
0.1 |
GO:0050923 |
regulation of negative chemotaxis(GO:0050923) |
| 0.0 |
0.1 |
GO:0086046 |
membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 |
0.6 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 |
0.2 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
2.5 |
GO:0006687 |
glycosphingolipid metabolic process(GO:0006687) |
| 0.0 |
0.2 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 |
0.1 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 |
0.2 |
GO:1903385 |
regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 |
0.9 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.0 |
0.9 |
GO:0032479 |
regulation of type I interferon production(GO:0032479) |
| 0.0 |
0.1 |
GO:0050435 |
beta-amyloid metabolic process(GO:0050435) |
| 0.0 |
0.0 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.0 |
0.1 |
GO:0042351 |
'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.0 |
0.9 |
GO:0051491 |
positive regulation of filopodium assembly(GO:0051491) |
| 0.0 |
0.1 |
GO:0032007 |
negative regulation of TOR signaling(GO:0032007) |
| 0.0 |
1.6 |
GO:0006363 |
transcription elongation from RNA polymerase I promoter(GO:0006362) termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 |
0.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.5 |
GO:0045954 |
positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 |
0.2 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.0 |
0.1 |
GO:0048485 |
sympathetic nervous system development(GO:0048485) |
| 0.0 |
1.2 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.3 |
GO:0042996 |
regulation of Golgi to plasma membrane protein transport(GO:0042996) |
| 0.0 |
0.9 |
GO:0008542 |
visual learning(GO:0008542) |
| 0.0 |
0.2 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 |
0.1 |
GO:0000423 |
macromitophagy(GO:0000423) |
| 0.0 |
0.3 |
GO:0018216 |
peptidyl-arginine methylation(GO:0018216) peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 |
0.1 |
GO:0051150 |
regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.0 |
0.9 |
GO:1990090 |
cellular response to nerve growth factor stimulus(GO:1990090) |
| 0.0 |
0.1 |
GO:0060148 |
positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 |
0.6 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.0 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.0 |
0.2 |
GO:0010830 |
regulation of myotube differentiation(GO:0010830) |
| 0.0 |
0.0 |
GO:0009217 |
purine deoxyribonucleotide catabolic process(GO:0009155) purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.0 |
0.4 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 |
0.1 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 |
0.1 |
GO:0090669 |
telomerase RNA stabilization(GO:0090669) |
| 0.0 |
0.3 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 |
0.9 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.0 |
0.2 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.0 |
0.2 |
GO:0016075 |
rRNA catabolic process(GO:0016075) |
| 0.0 |
0.1 |
GO:0038193 |
thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 |
0.3 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.0 |
0.4 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 |
0.1 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 |
0.1 |
GO:2000110 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 |
0.1 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.0 |
0.8 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.0 |
0.1 |
GO:2000622 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.1 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 |
0.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.0 |
0.1 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.0 |
0.1 |
GO:0007060 |
male meiosis chromosome segregation(GO:0007060) |
| 0.0 |
0.1 |
GO:0002644 |
negative regulation of tolerance induction(GO:0002644) |
| 0.0 |
0.4 |
GO:0033137 |
negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 |
0.1 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 |
0.2 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 |
0.3 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.0 |
0.3 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 |
0.1 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.0 |
0.1 |
GO:0090398 |
cellular senescence(GO:0090398) |
| 0.0 |
0.3 |
GO:0098828 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 |
0.4 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 |
0.1 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 |
0.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.0 |
0.4 |
GO:0051205 |
protein insertion into membrane(GO:0051205) |
| 0.0 |
0.1 |
GO:0002091 |
negative regulation of receptor internalization(GO:0002091) |
| 0.0 |
0.1 |
GO:0090080 |
positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 |
0.1 |
GO:0045023 |
G0 to G1 transition(GO:0045023) |
| 0.0 |
0.1 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.0 |
0.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.0 |
0.0 |
GO:0045919 |
positive regulation of cytolysis(GO:0045919) |
| 0.0 |
0.3 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 |
0.1 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 |
0.5 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.0 |
0.2 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.0 |
0.1 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 |
0.3 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.3 |
GO:0008213 |
protein methylation(GO:0006479) protein alkylation(GO:0008213) |
| 0.0 |
0.5 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 |
0.4 |
GO:0006622 |
protein targeting to lysosome(GO:0006622) |
| 0.0 |
0.0 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.0 |
0.0 |
GO:0031268 |
pseudopodium organization(GO:0031268) |
| 0.0 |
0.1 |
GO:0072180 |
mesonephric duct morphogenesis(GO:0072180) |
| 0.0 |
0.1 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 |
0.8 |
GO:0043044 |
ATP-dependent chromatin remodeling(GO:0043044) |
| 0.0 |
0.0 |
GO:0071280 |
cellular response to copper ion(GO:0071280) |
| 0.0 |
0.2 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.2 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
0.7 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.0 |
0.0 |
GO:0021590 |
cerebellum maturation(GO:0021590) cerebellar Purkinje cell layer maturation(GO:0021691) cerebellar cortex maturation(GO:0021699) |
| 0.0 |
0.0 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 |
0.0 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 |
0.4 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.0 |
0.1 |
GO:0006424 |
glutamyl-tRNA aminoacylation(GO:0006424) |
| 0.0 |
0.0 |
GO:0046452 |
dihydrofolate metabolic process(GO:0046452) |
| 0.0 |
0.3 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.0 |
0.1 |
GO:0007191 |
adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 |
0.1 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 |
0.1 |
GO:0035063 |
nuclear speck organization(GO:0035063) |
| 0.0 |
0.6 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 |
0.3 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.0 |
0.3 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.1 |
GO:0006098 |
pentose-phosphate shunt(GO:0006098) |
| 0.0 |
0.2 |
GO:1900015 |
regulation of cytokine production involved in inflammatory response(GO:1900015) |
| 0.0 |
0.1 |
GO:0044537 |
regulation of circulating fibrinogen levels(GO:0044537) |
| 0.0 |
0.4 |
GO:0006112 |
energy reserve metabolic process(GO:0006112) |
| 0.0 |
0.1 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 |
0.1 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 |
0.2 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.0 |
1.0 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.1 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.0 |
0.2 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 |
0.1 |
GO:0051968 |
positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.0 |
1.5 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.0 |
0.4 |
GO:0055078 |
sodium ion homeostasis(GO:0055078) |
| 0.0 |
0.1 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.0 |
0.2 |
GO:0075713 |
establishment of viral latency(GO:0019043) establishment of integrated proviral latency(GO:0075713) |
| 0.0 |
0.1 |
GO:0010832 |
negative regulation of myotube differentiation(GO:0010832) |
| 0.0 |
0.0 |
GO:0099624 |
atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.0 |
0.1 |
GO:0030641 |
regulation of cellular pH(GO:0030641) |
| 0.0 |
0.3 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.0 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 |
0.1 |
GO:0045176 |
apical protein localization(GO:0045176) |
| 0.0 |
0.2 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.1 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 |
0.2 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.0 |
0.0 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.2 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
0.2 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.0 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 |
0.2 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
0.1 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.0 |
0.3 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 |
0.1 |
GO:0052805 |
histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 |
0.0 |
GO:0030186 |
melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.0 |
0.1 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 |
0.1 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 |
0.1 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.0 |
0.1 |
GO:0090220 |
chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
| 0.0 |
0.1 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.0 |
GO:0031058 |
positive regulation of histone modification(GO:0031058) positive regulation of chromatin modification(GO:1903310) |
| 0.0 |
0.1 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
0.1 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 |
0.1 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.0 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 |
0.1 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 |
0.3 |
GO:0046473 |
phosphatidic acid metabolic process(GO:0046473) |
| 0.0 |
0.0 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.0 |
1.2 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.1 |
GO:0001975 |
response to amphetamine(GO:0001975) |
| 0.0 |
0.1 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.0 |
0.1 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 |
0.0 |
GO:0000019 |
regulation of mitotic recombination(GO:0000019) |
| 0.0 |
0.1 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.0 |
0.1 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.2 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 |
0.1 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 |
0.1 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.0 |
0.9 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 |
0.1 |
GO:0010816 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 |
0.3 |
GO:0046710 |
GDP metabolic process(GO:0046710) |
| 0.0 |
0.1 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 |
0.2 |
GO:0035338 |
long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 |
0.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 |
0.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.0 |
0.1 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.0 |
0.2 |
GO:0035640 |
exploration behavior(GO:0035640) |
| 0.0 |
0.0 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.0 |
0.1 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 |
0.1 |
GO:0042026 |
protein refolding(GO:0042026) |
| 0.0 |
0.0 |
GO:0071231 |
cellular response to folic acid(GO:0071231) |
| 0.0 |
0.3 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.4 |
GO:0006376 |
mRNA splice site selection(GO:0006376) |
| 0.0 |
0.1 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.0 |
0.0 |
GO:0021988 |
olfactory bulb development(GO:0021772) olfactory lobe development(GO:0021988) |
| 0.0 |
0.1 |
GO:2000778 |
positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.0 |
0.0 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.0 |
0.1 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.0 |
0.1 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.0 |
0.0 |
GO:0061045 |
negative regulation of wound healing(GO:0061045) |
| 0.0 |
0.1 |
GO:0050713 |
negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.0 |
0.1 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.0 |
0.0 |
GO:0034244 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 |
0.2 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.2 |
GO:0035435 |
phosphate ion transmembrane transport(GO:0035435) |
| 0.0 |
0.1 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 |
0.2 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.0 |
0.2 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.0 |
0.2 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |