| 3.5 |
13.8 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 3.4 |
17.0 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.8 |
5.4 |
GO:0061188 |
negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 1.7 |
5.2 |
GO:1904899 |
regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 1.7 |
6.6 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 1.6 |
4.9 |
GO:1903410 |
lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 1.6 |
6.2 |
GO:0070662 |
mast cell proliferation(GO:0070662) |
| 1.5 |
4.6 |
GO:1903568 |
negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 1.5 |
4.6 |
GO:0034059 |
response to anoxia(GO:0034059) |
| 1.5 |
6.0 |
GO:0072134 |
nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 1.4 |
4.3 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) |
| 1.4 |
7.0 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.4 |
1.4 |
GO:0060411 |
cardiac septum morphogenesis(GO:0060411) |
| 1.2 |
1.2 |
GO:0045976 |
negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 1.2 |
3.6 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 1.2 |
3.6 |
GO:0035283 |
central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.1 |
3.4 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.1 |
5.6 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 1.1 |
12.3 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 1.1 |
3.3 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 1.1 |
1.1 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 1.1 |
38.1 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 1.1 |
2.1 |
GO:1900151 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 1.1 |
3.2 |
GO:0016260 |
selenocysteine biosynthetic process(GO:0016260) |
| 1.1 |
4.2 |
GO:0035720 |
intraciliary anterograde transport(GO:0035720) |
| 1.0 |
3.1 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 1.0 |
3.1 |
GO:1905072 |
apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) |
| 1.0 |
7.1 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 1.0 |
3.8 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.9 |
1.9 |
GO:0098937 |
dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
| 0.9 |
3.7 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.9 |
1.9 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.9 |
2.8 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.9 |
12.0 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.9 |
6.4 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.9 |
2.7 |
GO:0003147 |
neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.9 |
2.7 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.9 |
0.9 |
GO:0098751 |
bone cell development(GO:0098751) |
| 0.9 |
2.7 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.9 |
2.7 |
GO:0042351 |
'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.8 |
1.7 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.8 |
2.4 |
GO:2001301 |
lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.8 |
13.9 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.8 |
2.4 |
GO:0032203 |
telomere formation via telomerase(GO:0032203) |
| 0.8 |
2.4 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.8 |
18.4 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 0.8 |
2.4 |
GO:0006864 |
pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.8 |
4.7 |
GO:1904381 |
Golgi apparatus mannose trimming(GO:1904381) |
| 0.8 |
1.6 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.8 |
0.8 |
GO:0051292 |
nuclear pore organization(GO:0006999) nuclear pore complex assembly(GO:0051292) |
| 0.8 |
3.1 |
GO:0097195 |
pilomotor reflex(GO:0097195) |
| 0.7 |
3.7 |
GO:0006203 |
dGTP catabolic process(GO:0006203) |
| 0.7 |
2.2 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.7 |
2.9 |
GO:0033387 |
putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.7 |
4.4 |
GO:0010734 |
protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.7 |
14.5 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.7 |
0.7 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.7 |
6.8 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.7 |
2.7 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.7 |
6.0 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.7 |
2.0 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.6 |
3.2 |
GO:0002415 |
immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.6 |
12.2 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.6 |
1.3 |
GO:0003099 |
positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.6 |
3.2 |
GO:1901090 |
regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.6 |
1.9 |
GO:1904882 |
telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.6 |
1.2 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.6 |
7.2 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.6 |
6.6 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.6 |
1.8 |
GO:0032223 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.6 |
2.4 |
GO:0046452 |
dihydrofolate metabolic process(GO:0046452) |
| 0.6 |
1.8 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.6 |
1.8 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.6 |
5.8 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.6 |
2.9 |
GO:0071500 |
cellular response to nitrosative stress(GO:0071500) |
| 0.6 |
1.7 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.6 |
2.3 |
GO:0043335 |
protein unfolding(GO:0043335) |
| 0.6 |
1.7 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.6 |
0.6 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.6 |
0.6 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.6 |
1.1 |
GO:1903400 |
L-arginine transmembrane transport(GO:1903400) |
| 0.6 |
2.3 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.6 |
3.4 |
GO:0006021 |
inositol biosynthetic process(GO:0006021) |
| 0.6 |
2.8 |
GO:0045074 |
interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.6 |
2.2 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 0.6 |
4.5 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.6 |
0.6 |
GO:0042137 |
sequestering of neurotransmitter(GO:0042137) |
| 0.6 |
2.8 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.6 |
3.9 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.6 |
2.8 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.5 |
0.5 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.5 |
3.8 |
GO:0097338 |
response to clozapine(GO:0097338) |
| 0.5 |
7.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.5 |
1.6 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.5 |
3.3 |
GO:1902998 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.5 |
0.5 |
GO:0002519 |
natural killer cell tolerance induction(GO:0002519) |
| 0.5 |
26.9 |
GO:0042073 |
intraciliary transport(GO:0042073) |
| 0.5 |
0.5 |
GO:0032618 |
interleukin-15 production(GO:0032618) |
| 0.5 |
1.1 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.5 |
1.6 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.5 |
2.1 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.5 |
3.2 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.5 |
2.1 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.5 |
1.6 |
GO:1904048 |
regulation of spontaneous neurotransmitter secretion(GO:1904048) |
| 0.5 |
2.6 |
GO:0019075 |
virus maturation(GO:0019075) |
| 0.5 |
1.6 |
GO:1902595 |
regulation of DNA replication origin binding(GO:1902595) |
| 0.5 |
1.5 |
GO:0033214 |
iron assimilation(GO:0033212) iron assimilation by chelation and transport(GO:0033214) positive regulation of bone mineralization involved in bone maturation(GO:1900159) negative regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000308) |
| 0.5 |
2.0 |
GO:0097676 |
histone H3-K36 dimethylation(GO:0097676) |
| 0.5 |
3.6 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.5 |
1.5 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.5 |
0.5 |
GO:0060844 |
arterial endothelial cell fate commitment(GO:0060844) |
| 0.5 |
0.5 |
GO:2000017 |
positive regulation of determination of dorsal identity(GO:2000017) |
| 0.5 |
3.5 |
GO:0000710 |
meiotic mismatch repair(GO:0000710) |
| 0.5 |
0.5 |
GO:0070602 |
regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.5 |
1.5 |
GO:0009436 |
glyoxylate catabolic process(GO:0009436) |
| 0.5 |
2.5 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.5 |
1.5 |
GO:0015729 |
thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.5 |
0.5 |
GO:0071106 |
coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.5 |
1.5 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.5 |
2.0 |
GO:1902361 |
mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.5 |
2.0 |
GO:0046271 |
phenylpropanoid catabolic process(GO:0046271) |
| 0.5 |
2.9 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.5 |
1.5 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.5 |
2.9 |
GO:0014038 |
regulation of Schwann cell differentiation(GO:0014038) |
| 0.5 |
1.4 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.5 |
0.5 |
GO:0046642 |
negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.5 |
1.4 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.5 |
1.4 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.5 |
2.3 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.5 |
0.9 |
GO:0043633 |
polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.5 |
1.9 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.5 |
1.4 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.5 |
4.6 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.5 |
3.2 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.5 |
0.9 |
GO:0071655 |
granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) |
| 0.5 |
7.8 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.5 |
4.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.5 |
1.4 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.5 |
1.4 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.5 |
0.5 |
GO:0002386 |
immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.5 |
1.4 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.5 |
1.8 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.5 |
5.5 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.5 |
2.7 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.5 |
1.4 |
GO:0034553 |
respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.4 |
1.3 |
GO:0035470 |
positive regulation of vascular wound healing(GO:0035470) |
| 0.4 |
1.3 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.4 |
1.3 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.4 |
1.8 |
GO:0035521 |
monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.4 |
3.1 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.4 |
1.3 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) fasciculation of motor neuron axon(GO:0097156) |
| 0.4 |
0.9 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 0.4 |
0.4 |
GO:0060734 |
regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.4 |
2.2 |
GO:0072313 |
metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.4 |
2.2 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.4 |
3.4 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.4 |
2.5 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.4 |
2.9 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.4 |
2.5 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.4 |
3.8 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.4 |
1.3 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.4 |
0.8 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.4 |
3.3 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.4 |
2.9 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.4 |
1.7 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.4 |
0.4 |
GO:2000583 |
regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.4 |
2.9 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.4 |
0.4 |
GO:0021903 |
rostrocaudal neural tube patterning(GO:0021903) |
| 0.4 |
1.2 |
GO:0043095 |
regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.4 |
0.4 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.4 |
1.6 |
GO:0030037 |
actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.4 |
2.4 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 0.4 |
0.4 |
GO:0072229 |
proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.4 |
3.6 |
GO:0071798 |
response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.4 |
1.2 |
GO:1901253 |
negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.4 |
1.2 |
GO:0098904 |
regulation of AV node cell action potential(GO:0098904) |
| 0.4 |
2.4 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.4 |
0.4 |
GO:0021684 |
cell differentiation in hindbrain(GO:0021533) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.4 |
0.4 |
GO:0006925 |
inflammatory cell apoptotic process(GO:0006925) |
| 0.4 |
2.0 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.4 |
3.9 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.4 |
0.4 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.4 |
1.6 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.4 |
1.6 |
GO:0042986 |
positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.4 |
2.7 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.4 |
0.4 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.4 |
0.8 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.4 |
1.2 |
GO:0048203 |
vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.4 |
1.1 |
GO:0042727 |
flavin-containing compound biosynthetic process(GO:0042727) |
| 0.4 |
0.4 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.4 |
9.2 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.4 |
3.1 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.4 |
1.9 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.4 |
2.3 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.4 |
0.8 |
GO:0010634 |
positive regulation of epithelial cell migration(GO:0010634) |
| 0.4 |
1.9 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.4 |
0.8 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.4 |
1.9 |
GO:1903788 |
mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.4 |
2.2 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.4 |
3.0 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 0.4 |
3.7 |
GO:0035907 |
dorsal aorta development(GO:0035907) |
| 0.4 |
5.6 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
1.1 |
GO:0090076 |
relaxation of skeletal muscle(GO:0090076) |
| 0.4 |
1.5 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.4 |
4.8 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.4 |
0.4 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.4 |
8.8 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.4 |
1.5 |
GO:0006542 |
glutamine biosynthetic process(GO:0006542) |
| 0.4 |
0.4 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.4 |
1.8 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.4 |
0.4 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.4 |
1.8 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.4 |
0.7 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.4 |
2.9 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.4 |
0.4 |
GO:0048389 |
intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
| 0.4 |
0.4 |
GO:2001267 |
regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
| 0.4 |
2.1 |
GO:1900133 |
regulation of renin secretion into blood stream(GO:1900133) |
| 0.4 |
2.1 |
GO:0015798 |
myo-inositol transport(GO:0015798) |
| 0.4 |
1.4 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.4 |
1.1 |
GO:0046075 |
dTTP metabolic process(GO:0046075) |
| 0.4 |
1.4 |
GO:0031117 |
positive regulation of microtubule depolymerization(GO:0031117) |
| 0.4 |
1.8 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.4 |
1.1 |
GO:1900039 |
positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.4 |
1.1 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.3 |
0.7 |
GO:0045925 |
positive regulation of female receptivity(GO:0045925) |
| 0.3 |
3.1 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.3 |
1.0 |
GO:0045360 |
regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.3 |
0.3 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.3 |
3.4 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.3 |
1.0 |
GO:1902303 |
negative regulation of potassium ion export(GO:1902303) |
| 0.3 |
1.0 |
GO:0097327 |
response to antineoplastic agent(GO:0097327) |
| 0.3 |
1.0 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.3 |
1.3 |
GO:0060633 |
negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.3 |
1.0 |
GO:0001798 |
positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.3 |
2.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.3 |
1.0 |
GO:0051102 |
DNA ligation involved in DNA recombination(GO:0051102) |
| 0.3 |
0.3 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.3 |
1.0 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.3 |
1.0 |
GO:0002023 |
reduction of food intake in response to dietary excess(GO:0002023) |
| 0.3 |
0.3 |
GO:1904016 |
response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.3 |
1.0 |
GO:0006655 |
phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.3 |
1.0 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 |
0.3 |
GO:1904322 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.3 |
2.0 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 |
0.7 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.3 |
0.3 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.3 |
8.6 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.3 |
1.6 |
GO:0021885 |
cerebral cortex cell migration(GO:0021795) forebrain cell migration(GO:0021885) |
| 0.3 |
1.6 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 |
1.6 |
GO:0051167 |
glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.3 |
0.3 |
GO:0033591 |
response to L-ascorbic acid(GO:0033591) |
| 0.3 |
2.6 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.3 |
3.2 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.3 |
1.0 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 0.3 |
1.6 |
GO:0034144 |
negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.3 |
2.6 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.3 |
5.5 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.3 |
2.6 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.3 |
1.0 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.3 |
0.3 |
GO:0015883 |
FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.3 |
1.3 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.3 |
0.9 |
GO:0021823 |
cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.3 |
0.6 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 |
7.6 |
GO:0016254 |
preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.3 |
0.6 |
GO:2000562 |
CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 |
0.9 |
GO:2000395 |
regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.3 |
0.3 |
GO:2000364 |
regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.3 |
0.6 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.3 |
0.9 |
GO:0019521 |
aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.3 |
1.2 |
GO:1901985 |
positive regulation of protein acetylation(GO:1901985) |
| 0.3 |
0.9 |
GO:0035904 |
aorta development(GO:0035904) |
| 0.3 |
8.1 |
GO:0006068 |
ethanol catabolic process(GO:0006068) |
| 0.3 |
0.6 |
GO:0002528 |
regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.3 |
1.2 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.3 |
2.2 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.3 |
1.8 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.3 |
6.3 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.3 |
0.9 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.3 |
0.6 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.3 |
0.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.3 |
0.9 |
GO:1902824 |
positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.3 |
1.5 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.3 |
0.3 |
GO:0048302 |
isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
| 0.3 |
0.6 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.3 |
0.9 |
GO:1905007 |
positive regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905007) |
| 0.3 |
0.3 |
GO:0071469 |
cellular response to alkaline pH(GO:0071469) |
| 0.3 |
2.7 |
GO:0045023 |
G0 to G1 transition(GO:0045023) |
| 0.3 |
0.6 |
GO:0061289 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.3 |
1.5 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.3 |
0.9 |
GO:0043602 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.3 |
1.7 |
GO:1901300 |
positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.3 |
0.9 |
GO:0009138 |
pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.3 |
1.4 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 |
0.6 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.3 |
0.6 |
GO:0038109 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.3 |
1.4 |
GO:1900920 |
regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.3 |
1.1 |
GO:2000672 |
negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.3 |
0.6 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
| 0.3 |
0.3 |
GO:0035815 |
positive regulation of renal sodium excretion(GO:0035815) |
| 0.3 |
0.3 |
GO:0050965 |
detection of temperature stimulus(GO:0016048) detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.3 |
0.8 |
GO:0031548 |
regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.3 |
1.4 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 |
0.8 |
GO:0032764 |
negative regulation of mast cell cytokine production(GO:0032764) |
| 0.3 |
2.5 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.3 |
0.6 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.3 |
0.6 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.3 |
1.1 |
GO:1900224 |
positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.3 |
5.2 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.3 |
0.8 |
GO:0046167 |
glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.3 |
1.1 |
GO:0090403 |
oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 |
0.8 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.3 |
2.5 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.3 |
1.1 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.3 |
2.5 |
GO:0061470 |
T follicular helper cell differentiation(GO:0061470) |
| 0.3 |
0.3 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.3 |
0.3 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.3 |
0.8 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 |
0.3 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.3 |
2.2 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.3 |
3.2 |
GO:0002115 |
store-operated calcium entry(GO:0002115) |
| 0.3 |
0.8 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.3 |
3.8 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 |
1.3 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.3 |
1.1 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.3 |
0.3 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.3 |
0.5 |
GO:1904204 |
regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.3 |
0.8 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.3 |
0.3 |
GO:0015813 |
L-glutamate transport(GO:0015813) |
| 0.3 |
1.0 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.3 |
1.0 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
0.8 |
GO:0035404 |
histone-serine phosphorylation(GO:0035404) |
| 0.3 |
1.0 |
GO:0034224 |
cellular response to zinc ion starvation(GO:0034224) |
| 0.3 |
1.0 |
GO:0002503 |
peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.3 |
1.3 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.3 |
1.6 |
GO:0055005 |
ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 |
1.0 |
GO:0006740 |
NADPH regeneration(GO:0006740) |
| 0.3 |
1.3 |
GO:1904764 |
negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.3 |
1.0 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.3 |
0.5 |
GO:0035936 |
testosterone secretion(GO:0035936) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.3 |
1.3 |
GO:0035608 |
protein deglutamylation(GO:0035608) |
| 0.3 |
1.0 |
GO:0045872 |
positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.3 |
0.8 |
GO:1901202 |
negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.3 |
0.8 |
GO:2000786 |
positive regulation of autophagosome assembly(GO:2000786) |
| 0.3 |
0.8 |
GO:1902530 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.3 |
1.3 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.3 |
1.3 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.3 |
4.0 |
GO:1902260 |
negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.3 |
1.3 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.3 |
2.5 |
GO:0060180 |
female mating behavior(GO:0060180) |
| 0.3 |
3.0 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 |
0.7 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 |
0.5 |
GO:2000564 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.2 |
1.2 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
1.0 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.2 |
0.2 |
GO:0021896 |
forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.2 |
0.7 |
GO:0070781 |
response to biotin(GO:0070781) |
| 0.2 |
3.7 |
GO:0001514 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.2 |
0.2 |
GO:0002590 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.2 |
1.0 |
GO:0097045 |
phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.2 |
0.7 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.2 |
1.4 |
GO:0034670 |
chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.2 |
0.5 |
GO:0060462 |
lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.2 |
0.5 |
GO:0046502 |
uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
| 0.2 |
1.4 |
GO:0070560 |
protein secretion by platelet(GO:0070560) |
| 0.2 |
0.2 |
GO:0034088 |
maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.2 |
0.2 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.2 |
1.2 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.2 |
3.1 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
0.9 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.2 |
0.7 |
GO:0060152 |
peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.2 |
0.7 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 |
1.4 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.2 |
0.2 |
GO:2000291 |
regulation of myoblast proliferation(GO:2000291) |
| 0.2 |
0.9 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.2 |
0.5 |
GO:0008045 |
motor neuron axon guidance(GO:0008045) |
| 0.2 |
0.9 |
GO:0072602 |
interleukin-4 secretion(GO:0072602) |
| 0.2 |
4.1 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.2 |
0.7 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.2 |
0.7 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.2 |
1.8 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
0.7 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.2 |
1.3 |
GO:0015853 |
adenine transport(GO:0015853) |
| 0.2 |
3.3 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.2 |
0.2 |
GO:0042350 |
GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.2 |
3.1 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 |
0.7 |
GO:0050823 |
peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.2 |
0.2 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.2 |
0.7 |
GO:0033341 |
regulation of collagen binding(GO:0033341) |
| 0.2 |
0.9 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.2 |
1.3 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.2 |
0.7 |
GO:0043012 |
regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.2 |
1.3 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.4 |
GO:0010956 |
negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
| 0.2 |
1.3 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 |
1.5 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.2 |
0.6 |
GO:1904247 |
positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.2 |
0.2 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.2 |
0.6 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.2 |
0.2 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.2 |
0.2 |
GO:0014042 |
positive regulation of neuron maturation(GO:0014042) |
| 0.2 |
0.2 |
GO:0060742 |
epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.2 |
1.7 |
GO:0060509 |
Type I pneumocyte differentiation(GO:0060509) |
| 0.2 |
2.5 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.2 |
2.1 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.2 |
1.5 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 |
0.8 |
GO:0010730 |
negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.2 |
7.7 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 |
1.0 |
GO:1900114 |
positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.2 |
0.8 |
GO:0043324 |
eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.2 |
0.2 |
GO:0071284 |
cellular response to lead ion(GO:0071284) |
| 0.2 |
1.4 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.2 |
0.6 |
GO:2000521 |
negative regulation of immunological synapse formation(GO:2000521) |
| 0.2 |
0.4 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.2 |
1.0 |
GO:0045629 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 |
0.2 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.2 |
1.4 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.2 |
3.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 |
0.8 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.2 |
0.4 |
GO:1902732 |
positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.2 |
0.6 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 |
0.6 |
GO:0015783 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 |
0.8 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.2 |
5.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
3.8 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.2 |
43.4 |
GO:0060271 |
cilium morphogenesis(GO:0060271) |
| 0.2 |
2.2 |
GO:0097502 |
mannosylation(GO:0097502) |
| 0.2 |
0.4 |
GO:0071468 |
cellular response to acidic pH(GO:0071468) |
| 0.2 |
0.8 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.2 |
0.2 |
GO:0060448 |
dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.2 |
0.6 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 |
2.2 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.2 |
0.6 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.2 |
1.2 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 |
0.2 |
GO:0007227 |
signal transduction downstream of smoothened(GO:0007227) |
| 0.2 |
0.6 |
GO:0050902 |
leukocyte adhesive activation(GO:0050902) |
| 0.2 |
2.9 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.2 |
3.3 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.2 |
8.4 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.2 |
2.1 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.2 |
0.2 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.2 |
0.8 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.2 |
0.6 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 |
1.2 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.2 |
0.4 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.2 |
0.8 |
GO:0051083 |
'de novo' cotranslational protein folding(GO:0051083) |
| 0.2 |
0.8 |
GO:0048698 |
regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.2 |
1.9 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 |
0.4 |
GO:0030185 |
nitric oxide transport(GO:0030185) |
| 0.2 |
0.8 |
GO:1990418 |
response to insulin-like growth factor stimulus(GO:1990418) |
| 0.2 |
3.8 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.2 |
0.4 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.2 |
0.7 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.2 |
1.5 |
GO:1902741 |
interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.2 |
1.3 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 |
0.6 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.2 |
1.8 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 |
0.9 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.2 |
0.7 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.2 |
1.5 |
GO:0001302 |
replicative cell aging(GO:0001302) |
| 0.2 |
1.1 |
GO:0072600 |
establishment of protein localization to Golgi(GO:0072600) |
| 0.2 |
0.5 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 |
3.1 |
GO:0045008 |
depyrimidination(GO:0045008) |
| 0.2 |
0.4 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 |
0.5 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 |
1.8 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 |
0.4 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
3.2 |
GO:0030205 |
dermatan sulfate metabolic process(GO:0030205) |
| 0.2 |
1.4 |
GO:0070091 |
glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.2 |
0.5 |
GO:0060406 |
positive regulation of penile erection(GO:0060406) |
| 0.2 |
0.2 |
GO:0046125 |
thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 |
0.4 |
GO:1901569 |
leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.2 |
0.9 |
GO:0002032 |
desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.2 |
0.9 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 |
0.5 |
GO:1903281 |
regulation of calcium:sodium antiporter activity(GO:1903279) positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.2 |
0.5 |
GO:0035494 |
SNARE complex disassembly(GO:0035494) |
| 0.2 |
0.5 |
GO:0090343 |
positive regulation of cell aging(GO:0090343) |
| 0.2 |
1.4 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.2 |
1.4 |
GO:0044782 |
cilium organization(GO:0044782) |
| 0.2 |
0.5 |
GO:0033385 |
geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.2 |
0.4 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.2 |
0.4 |
GO:0007231 |
osmosensory signaling pathway(GO:0007231) |
| 0.2 |
1.1 |
GO:1903949 |
positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.2 |
0.2 |
GO:1900110 |
negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.2 |
1.6 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.2 |
0.2 |
GO:0060767 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.2 |
0.7 |
GO:0032898 |
neurotrophin production(GO:0032898) |
| 0.2 |
0.9 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 |
1.0 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
0.9 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 |
0.9 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 |
1.2 |
GO:0034138 |
toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.2 |
0.9 |
GO:0071386 |
cellular response to corticosterone stimulus(GO:0071386) |
| 0.2 |
0.9 |
GO:2001293 |
malonyl-CoA metabolic process(GO:2001293) |
| 0.2 |
0.3 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.2 |
3.7 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 |
0.5 |
GO:0038178 |
complement component C5a signaling pathway(GO:0038178) |
| 0.2 |
0.3 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.2 |
0.3 |
GO:1900369 |
negative regulation of RNA interference(GO:1900369) |
| 0.2 |
0.2 |
GO:0015917 |
aminophospholipid transport(GO:0015917) |
| 0.2 |
1.5 |
GO:0097646 |
calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.2 |
0.3 |
GO:0071030 |
nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
| 0.2 |
0.5 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.2 |
2.0 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 |
2.0 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.2 |
1.8 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.2 |
0.2 |
GO:0034128 |
negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.2 |
0.2 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.2 |
0.7 |
GO:0033277 |
abortive mitotic cell cycle(GO:0033277) |
| 0.2 |
0.3 |
GO:1904417 |
regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.2 |
2.1 |
GO:0006490 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.2 |
0.7 |
GO:0072367 |
regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.2 |
0.2 |
GO:0071316 |
cellular response to nicotine(GO:0071316) |
| 0.2 |
2.1 |
GO:0010510 |
acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 |
0.5 |
GO:0006174 |
dADP phosphorylation(GO:0006174) dGDP phosphorylation(GO:0006186) AMP phosphorylation(GO:0006756) CDP phosphorylation(GO:0061508) dAMP phosphorylation(GO:0061565) CMP phosphorylation(GO:0061566) dCMP phosphorylation(GO:0061567) GDP phosphorylation(GO:0061568) UDP phosphorylation(GO:0061569) dCDP phosphorylation(GO:0061570) TDP phosphorylation(GO:0061571) |
| 0.2 |
0.6 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.2 |
0.8 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.2 |
0.3 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.2 |
0.2 |
GO:1901374 |
acetate ester transport(GO:1901374) |
| 0.2 |
0.2 |
GO:0072237 |
metanephric proximal tubule development(GO:0072237) |
| 0.2 |
0.5 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.2 |
0.5 |
GO:2000095 |
regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
| 0.2 |
1.4 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 |
0.6 |
GO:0042789 |
mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.2 |
0.5 |
GO:0031340 |
positive regulation of vesicle fusion(GO:0031340) |
| 0.2 |
0.5 |
GO:0008588 |
release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.2 |
0.6 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.2 |
0.3 |
GO:0070432 |
regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.2 |
0.8 |
GO:1904977 |
lymphatic endothelial cell migration(GO:1904977) |
| 0.2 |
0.5 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.2 |
1.1 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.2 |
4.1 |
GO:0032007 |
negative regulation of TOR signaling(GO:0032007) |
| 0.2 |
0.6 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.2 |
0.2 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 |
0.5 |
GO:1990569 |
UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.2 |
0.6 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.2 |
1.5 |
GO:0010265 |
SCF complex assembly(GO:0010265) |
| 0.2 |
1.8 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.2 |
0.3 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.1 |
0.7 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 |
0.1 |
GO:0002183 |
cytoplasmic translational initiation(GO:0002183) |
| 0.1 |
2.1 |
GO:0019614 |
catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.1 |
1.0 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.3 |
GO:0021819 |
layer formation in cerebral cortex(GO:0021819) |
| 0.1 |
0.6 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 |
0.4 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 |
3.1 |
GO:0016075 |
rRNA catabolic process(GO:0016075) |
| 0.1 |
0.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
1.3 |
GO:0006552 |
leucine catabolic process(GO:0006552) |
| 0.1 |
1.8 |
GO:0021694 |
cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.1 |
1.5 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
1.0 |
GO:0021522 |
spinal cord motor neuron differentiation(GO:0021522) |
| 0.1 |
1.2 |
GO:2000121 |
regulation of removal of superoxide radicals(GO:2000121) |
| 0.1 |
0.1 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 |
2.5 |
GO:0031573 |
intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 |
0.6 |
GO:0002414 |
immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 |
0.3 |
GO:0015919 |
peroxisomal membrane transport(GO:0015919) |
| 0.1 |
2.8 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 |
1.9 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
1.0 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.1 |
0.4 |
GO:0045829 |
negative regulation of isotype switching(GO:0045829) |
| 0.1 |
0.1 |
GO:0031392 |
regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.1 |
0.6 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.1 |
0.1 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 |
0.6 |
GO:0039506 |
modulation by virus of host molecular function(GO:0039506) suppression by virus of host molecular function(GO:0039507) suppression by virus of host catalytic activity(GO:0039513) modulation by virus of host catalytic activity(GO:0039516) suppression by virus of host cysteine-type endopeptidase activity involved in apoptotic process(GO:0039650) negative regulation by symbiont of host catalytic activity(GO:0052053) negative regulation by symbiont of host molecular function(GO:0052056) modulation by symbiont of host catalytic activity(GO:0052148) |
| 0.1 |
2.0 |
GO:0006054 |
N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 |
0.7 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 |
0.4 |
GO:0035915 |
pore formation in membrane of other organism(GO:0035915) |
| 0.1 |
0.4 |
GO:0003157 |
endocardium development(GO:0003157) |
| 0.1 |
0.1 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
0.4 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.8 |
GO:0031848 |
protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 |
2.3 |
GO:0017121 |
phospholipid scrambling(GO:0017121) |
| 0.1 |
0.8 |
GO:0098967 |
exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 |
2.1 |
GO:0007097 |
nuclear migration(GO:0007097) |
| 0.1 |
2.8 |
GO:0006293 |
nucleotide-excision repair, preincision complex stabilization(GO:0006293) |
| 0.1 |
1.6 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 |
1.3 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 |
1.4 |
GO:0044341 |
sodium-dependent phosphate transport(GO:0044341) |
| 0.1 |
0.8 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 |
0.1 |
GO:0002644 |
negative regulation of tolerance induction(GO:0002644) |
| 0.1 |
0.6 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 |
0.6 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.1 |
0.7 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.1 |
0.4 |
GO:0036500 |
ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 |
0.3 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.1 |
0.3 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 |
0.1 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.3 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 |
1.8 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 |
5.6 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 |
0.4 |
GO:1904924 |
negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 |
0.4 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 |
1.4 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.3 |
GO:2001160 |
histone H3-K79 methylation(GO:0034729) regulation of histone H3-K79 methylation(GO:2001160) positive regulation of histone H3-K79 methylation(GO:2001162) |
| 0.1 |
1.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 |
0.5 |
GO:0033685 |
negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.1 |
0.7 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) |
| 0.1 |
0.4 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
0.1 |
GO:0070673 |
response to interleukin-18(GO:0070673) |
| 0.1 |
1.2 |
GO:0070294 |
renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 |
0.3 |
GO:0048009 |
insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 |
0.7 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.1 |
0.3 |
GO:0061010 |
gall bladder development(GO:0061010) |
| 0.1 |
0.3 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.1 |
0.3 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 |
1.5 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.5 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.3 |
GO:0046709 |
IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 |
2.1 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 |
0.4 |
GO:0046416 |
D-amino acid metabolic process(GO:0046416) |
| 0.1 |
1.3 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 |
1.2 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.1 |
1.3 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.1 |
0.1 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.1 |
3.0 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 |
0.8 |
GO:0042733 |
embryonic digit morphogenesis(GO:0042733) |
| 0.1 |
0.9 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.1 |
0.3 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 |
0.9 |
GO:2000857 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 |
0.3 |
GO:0070417 |
cellular response to cold(GO:0070417) |
| 0.1 |
0.4 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.5 |
GO:0010922 |
positive regulation of phosphatase activity(GO:0010922) |
| 0.1 |
0.6 |
GO:0043967 |
histone H4 acetylation(GO:0043967) |
| 0.1 |
0.4 |
GO:0071028 |
nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 |
0.3 |
GO:0090669 |
telomerase RNA stabilization(GO:0090669) |
| 0.1 |
0.1 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
0.6 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 |
2.6 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 |
1.0 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
0.3 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.1 |
0.4 |
GO:0070839 |
divalent metal ion export(GO:0070839) |
| 0.1 |
1.0 |
GO:0071499 |
cellular response to laminar fluid shear stress(GO:0071499) |
| 0.1 |
3.0 |
GO:0031498 |
chromatin disassembly(GO:0031498) |
| 0.1 |
0.5 |
GO:0071934 |
thiamine transmembrane transport(GO:0071934) |
| 0.1 |
0.6 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.1 |
0.2 |
GO:0015819 |
lysine transport(GO:0015819) L-lysine transport(GO:1902022) |
| 0.1 |
0.9 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
1.6 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.9 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 |
1.0 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 |
1.5 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 |
0.5 |
GO:0035234 |
ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 |
0.4 |
GO:0071421 |
manganese ion transmembrane transport(GO:0071421) |
| 0.1 |
0.4 |
GO:0033483 |
gas homeostasis(GO:0033483) |
| 0.1 |
1.7 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 |
1.9 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
0.6 |
GO:1902047 |
polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 |
0.1 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 |
0.4 |
GO:0014055 |
acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
| 0.1 |
0.4 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 |
1.8 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 |
1.1 |
GO:0060452 |
positive regulation of cardiac muscle contraction(GO:0060452) |
| 0.1 |
0.5 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
0.1 |
GO:0061549 |
sympathetic ganglion development(GO:0061549) |
| 0.1 |
1.8 |
GO:0006458 |
'de novo' protein folding(GO:0006458) |
| 0.1 |
0.4 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.1 |
1.2 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 |
0.1 |
GO:0050787 |
detoxification of mercury ion(GO:0050787) |
| 0.1 |
1.2 |
GO:0043153 |
entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 |
0.7 |
GO:1901908 |
diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 |
0.4 |
GO:0044346 |
fibroblast apoptotic process(GO:0044346) |
| 0.1 |
11.1 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.3 |
GO:0070681 |
glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 |
1.2 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.1 |
0.1 |
GO:0015870 |
acetylcholine transport(GO:0015870) |
| 0.1 |
6.1 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.1 |
0.3 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.1 |
0.1 |
GO:2000425 |
regulation of apoptotic cell clearance(GO:2000425) |
| 0.1 |
0.1 |
GO:0016064 |
immunoglobulin mediated immune response(GO:0016064) B cell mediated immunity(GO:0019724) |
| 0.1 |
1.0 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.1 |
0.3 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 |
0.1 |
GO:0060038 |
cardiac muscle cell proliferation(GO:0060038) |
| 0.1 |
0.8 |
GO:0060314 |
regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.1 |
0.6 |
GO:0010960 |
magnesium ion homeostasis(GO:0010960) |
| 0.1 |
0.1 |
GO:2000645 |
negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 |
0.3 |
GO:0000354 |
cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.1 |
0.5 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.1 |
0.8 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
3.1 |
GO:0070911 |
global genome nucleotide-excision repair(GO:0070911) |
| 0.1 |
2.0 |
GO:1903206 |
negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.1 |
0.1 |
GO:0030309 |
poly-N-acetyllactosamine metabolic process(GO:0030309) |
| 0.1 |
2.4 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.9 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.1 |
GO:0006266 |
DNA ligation(GO:0006266) |
| 0.1 |
1.1 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 |
0.2 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.2 |
GO:2001178 |
mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 |
1.6 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.1 |
0.4 |
GO:0085020 |
protein K27-linked ubiquitination(GO:0044314) protein K6-linked ubiquitination(GO:0085020) |
| 0.1 |
0.4 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 |
0.4 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 |
0.7 |
GO:0016137 |
glycoside metabolic process(GO:0016137) |
| 0.1 |
0.4 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 |
0.9 |
GO:0009304 |
tRNA transcription(GO:0009304) |
| 0.1 |
0.5 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 |
0.7 |
GO:0034983 |
peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 |
0.2 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
0.1 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.1 |
0.3 |
GO:0035408 |
histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 |
0.4 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.1 |
0.9 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 |
0.2 |
GO:0009651 |
response to salt stress(GO:0009651) |
| 0.1 |
0.4 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.1 |
0.9 |
GO:0033014 |
tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 |
0.2 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.1 |
1.2 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.2 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 |
0.1 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.1 |
0.3 |
GO:0060449 |
bud elongation involved in lung branching(GO:0060449) |
| 0.1 |
0.8 |
GO:0050428 |
purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.1 |
0.5 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.1 |
0.5 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.1 |
0.3 |
GO:0006286 |
base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
| 0.1 |
0.1 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 |
0.2 |
GO:0052314 |
phytoalexin metabolic process(GO:0052314) |
| 0.1 |
0.3 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 |
3.5 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.1 |
0.7 |
GO:0090240 |
positive regulation of histone H4 acetylation(GO:0090240) |
| 0.1 |
0.2 |
GO:0097343 |
ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 |
0.7 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 |
0.4 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.1 |
0.5 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 |
0.2 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 |
0.4 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.1 |
0.1 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.1 |
0.5 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.1 |
0.5 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 0.1 |
0.1 |
GO:0010446 |
response to alkaline pH(GO:0010446) |
| 0.1 |
0.2 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.1 |
0.6 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
2.3 |
GO:0097242 |
beta-amyloid clearance(GO:0097242) |
| 0.1 |
0.1 |
GO:0060149 |
negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) negative regulation of gene silencing(GO:0060969) |
| 0.1 |
0.1 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 |
0.6 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 |
0.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
1.5 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.9 |
GO:1900044 |
regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.1 |
0.2 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 |
0.2 |
GO:1900744 |
regulation of p38MAPK cascade(GO:1900744) |
| 0.1 |
0.3 |
GO:0021650 |
vestibulocochlear nerve formation(GO:0021650) |
| 0.1 |
0.4 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.1 |
0.1 |
GO:2000137 |
negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 0.1 |
0.5 |
GO:1901318 |
negative regulation of sperm motility(GO:1901318) |
| 0.1 |
1.3 |
GO:1901522 |
positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.1 |
0.3 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.1 |
0.4 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.1 |
0.5 |
GO:1900077 |
negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.1 |
0.2 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 |
0.3 |
GO:0050916 |
sensory perception of sweet taste(GO:0050916) |
| 0.1 |
0.4 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
0.1 |
GO:0045622 |
regulation of T-helper cell differentiation(GO:0045622) |
| 0.1 |
0.1 |
GO:0042487 |
regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.1 |
0.2 |
GO:0046827 |
regulation of protein export from nucleus(GO:0046825) positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 |
0.2 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.1 |
8.3 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.4 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 |
0.3 |
GO:0044205 |
'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 |
0.3 |
GO:0002232 |
leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
1.2 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.1 |
1.2 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 |
2.3 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.1 |
1.1 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.5 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.1 |
0.2 |
GO:0000479 |
endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.1 |
0.1 |
GO:0008543 |
fibroblast growth factor receptor signaling pathway(GO:0008543) |
| 0.1 |
0.5 |
GO:1902659 |
regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 |
1.4 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.1 |
0.3 |
GO:1902161 |
regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 |
4.5 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.3 |
GO:0009258 |
10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 |
0.4 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 |
0.2 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 |
0.1 |
GO:0000478 |
endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.1 |
0.8 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 |
0.6 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.1 |
0.3 |
GO:0042489 |
negative regulation of odontogenesis of dentin-containing tooth(GO:0042489) |
| 0.1 |
0.1 |
GO:1903659 |
regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 |
0.5 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 |
0.2 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 |
0.3 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.1 |
0.7 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
3.8 |
GO:1904837 |
beta-catenin-TCF complex assembly(GO:1904837) |
| 0.1 |
1.2 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 |
0.2 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.1 |
0.2 |
GO:1903670 |
regulation of sprouting angiogenesis(GO:1903670) |
| 0.1 |
0.2 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 0.1 |
0.7 |
GO:0051531 |
NFAT protein import into nucleus(GO:0051531) |
| 0.1 |
0.5 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.1 |
2.3 |
GO:0019184 |
nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 |
0.3 |
GO:0036309 |
protein localization to M-band(GO:0036309) |
| 0.1 |
0.6 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 |
0.2 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.1 |
0.2 |
GO:1904796 |
regulation of core promoter binding(GO:1904796) |
| 0.1 |
0.6 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.2 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 |
0.2 |
GO:2000696 |
regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.1 |
0.7 |
GO:0044211 |
CTP salvage(GO:0044211) |
| 0.1 |
0.5 |
GO:2000568 |
memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 |
3.5 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.1 |
0.6 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 |
0.4 |
GO:0097112 |
gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.1 |
0.4 |
GO:0002230 |
positive regulation of defense response to virus by host(GO:0002230) |
| 0.1 |
0.3 |
GO:0052055 |
modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 |
0.3 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.1 |
1.8 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 |
0.3 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
1.7 |
GO:0010248 |
establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 |
0.1 |
GO:0014839 |
myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 |
0.6 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 |
0.3 |
GO:0042414 |
epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 |
0.8 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 |
0.3 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.1 |
0.4 |
GO:1903587 |
regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 |
0.3 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.6 |
GO:0070649 |
meiotic cytokinesis(GO:0033206) polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 |
0.4 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
0.6 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.1 |
0.6 |
GO:0002084 |
protein depalmitoylation(GO:0002084) |
| 0.1 |
0.3 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.1 |
0.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 |
0.3 |
GO:0070902 |
mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.1 |
0.2 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 0.1 |
0.5 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 |
0.8 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.6 |
GO:2001028 |
positive regulation of endothelial cell chemotaxis(GO:2001028) |
| 0.1 |
0.5 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.3 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.1 |
0.6 |
GO:0032230 |
positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.1 |
0.6 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 |
1.3 |
GO:0031935 |
regulation of chromatin silencing(GO:0031935) |
| 0.1 |
0.1 |
GO:0001767 |
establishment of lymphocyte polarity(GO:0001767) |
| 0.1 |
0.4 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.3 |
GO:0050712 |
negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 |
0.3 |
GO:0015808 |
L-alanine transport(GO:0015808) |
| 0.1 |
0.3 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.5 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.1 |
2.7 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 |
0.2 |
GO:0048075 |
positive regulation of eye pigmentation(GO:0048075) |
| 0.1 |
0.1 |
GO:0021590 |
cerebellum maturation(GO:0021590) cerebellar Purkinje cell layer maturation(GO:0021691) cerebellar cortex maturation(GO:0021699) |
| 0.1 |
0.2 |
GO:1902525 |
regulation of protein monoubiquitination(GO:1902525) |
| 0.1 |
0.2 |
GO:0044691 |
tooth eruption(GO:0044691) |
| 0.1 |
0.2 |
GO:1904383 |
response to sodium phosphate(GO:1904383) |
| 0.1 |
0.9 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.1 |
0.7 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
4.1 |
GO:0006904 |
vesicle docking involved in exocytosis(GO:0006904) |
| 0.1 |
1.7 |
GO:0032012 |
regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 |
0.6 |
GO:0043987 |
histone H3-S10 phosphorylation(GO:0043987) |
| 0.1 |
0.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.1 |
GO:0010759 |
positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 |
0.2 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 |
0.6 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.4 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 |
0.2 |
GO:0051386 |
regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 |
0.6 |
GO:1902035 |
positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 |
0.4 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 |
0.1 |
GO:0060211 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 |
0.7 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.1 |
0.2 |
GO:2000317 |
peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
| 0.1 |
0.5 |
GO:0032329 |
serine transport(GO:0032329) |
| 0.1 |
2.5 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.1 |
1.2 |
GO:0016574 |
histone ubiquitination(GO:0016574) |
| 0.1 |
0.2 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.7 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.1 |
0.3 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 |
0.3 |
GO:0055014 |
atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 |
1.7 |
GO:0001510 |
RNA methylation(GO:0001510) |
| 0.1 |
0.3 |
GO:1904588 |
cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.1 |
2.2 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 |
1.9 |
GO:0051491 |
positive regulation of filopodium assembly(GO:0051491) |
| 0.1 |
1.8 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 |
0.2 |
GO:0060168 |
positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 |
3.4 |
GO:0032729 |
positive regulation of interferon-gamma production(GO:0032729) |
| 0.1 |
0.8 |
GO:0035864 |
response to potassium ion(GO:0035864) |
| 0.1 |
0.1 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 |
0.4 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
0.7 |
GO:0046929 |
negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 |
0.1 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 |
0.4 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 |
0.6 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.1 |
0.3 |
GO:0090116 |
C-5 methylation of cytosine(GO:0090116) |
| 0.1 |
1.1 |
GO:0070129 |
regulation of mitochondrial translation(GO:0070129) |
| 0.1 |
0.1 |
GO:0050684 |
regulation of mRNA processing(GO:0050684) |
| 0.1 |
2.6 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.2 |
GO:0090611 |
ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 |
1.1 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.3 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 |
0.1 |
GO:0042987 |
amyloid precursor protein catabolic process(GO:0042987) |
| 0.1 |
0.4 |
GO:0036111 |
very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.1 |
0.3 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.1 |
0.3 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.1 |
1.1 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
4.4 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 |
0.1 |
GO:0045075 |
interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 |
0.4 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.1 |
5.0 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 |
0.4 |
GO:0021997 |
neural plate axis specification(GO:0021997) |
| 0.1 |
0.3 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 |
0.1 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.1 |
1.1 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
0.5 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
1.1 |
GO:0090360 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 |
0.6 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
1.1 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.1 |
0.1 |
GO:0072709 |
cellular response to sorbitol(GO:0072709) |
| 0.1 |
0.6 |
GO:0034454 |
microtubule anchoring at centrosome(GO:0034454) |
| 0.1 |
0.4 |
GO:0060433 |
bronchus development(GO:0060433) |
| 0.1 |
0.2 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.1 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.1 |
0.1 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.1 |
20.9 |
GO:0000209 |
protein polyubiquitination(GO:0000209) |
| 0.1 |
0.1 |
GO:0060147 |
regulation of posttranscriptional gene silencing(GO:0060147) regulation of gene silencing by RNA(GO:0060966) |
| 0.1 |
0.7 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.1 |
0.1 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 |
0.1 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.1 |
0.1 |
GO:0070424 |
regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.1 |
1.2 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 |
0.1 |
GO:0043385 |
mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.1 |
0.6 |
GO:0019317 |
fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.1 |
0.2 |
GO:2000359 |
regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.1 |
6.5 |
GO:0035308 |
negative regulation of protein dephosphorylation(GO:0035308) |
| 0.1 |
2.2 |
GO:0000301 |
retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.1 |
0.3 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 |
0.7 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 |
1.7 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.1 |
0.1 |
GO:1900113 |
negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 |
0.7 |
GO:0031054 |
pre-miRNA processing(GO:0031054) |
| 0.1 |
0.1 |
GO:1990502 |
dense core granule maturation(GO:1990502) |
| 0.1 |
0.3 |
GO:1904220 |
regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 |
0.2 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.5 |
GO:0034058 |
endosomal vesicle fusion(GO:0034058) |
| 0.1 |
1.1 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.1 |
0.5 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.1 |
0.8 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.1 |
0.1 |
GO:0038162 |
erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.1 |
0.6 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.1 |
0.2 |
GO:1904354 |
negative regulation of telomere capping(GO:1904354) |
| 0.1 |
1.3 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.2 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.1 |
0.8 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.1 |
0.9 |
GO:0007094 |
mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.1 |
1.0 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
0.1 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
0.8 |
GO:0030889 |
negative regulation of B cell proliferation(GO:0030889) |
| 0.1 |
0.3 |
GO:0042738 |
exogenous drug catabolic process(GO:0042738) |
| 0.1 |
0.3 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.7 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.3 |
GO:0032801 |
receptor catabolic process(GO:0032801) |
| 0.1 |
0.3 |
GO:2000503 |
positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 |
0.4 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.1 |
GO:0001991 |
regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 |
0.1 |
GO:0002320 |
lymphoid progenitor cell differentiation(GO:0002320) |
| 0.1 |
0.1 |
GO:0002371 |
dendritic cell cytokine production(GO:0002371) |
| 0.1 |
0.2 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 |
0.2 |
GO:0033512 |
L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 |
0.2 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.1 |
0.2 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) |
| 0.1 |
0.2 |
GO:0070295 |
renal water absorption(GO:0070295) |
| 0.1 |
1.6 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
0.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.7 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
0.4 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.1 |
3.0 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.1 |
0.4 |
GO:0030421 |
defecation(GO:0030421) |
| 0.1 |
0.7 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.1 |
0.5 |
GO:0051547 |
regulation of keratinocyte migration(GO:0051547) |
| 0.1 |
0.9 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.1 |
0.4 |
GO:0019532 |
oxalate transport(GO:0019532) |
| 0.1 |
0.5 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 |
0.1 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.1 |
GO:1902992 |
negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.1 |
3.9 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.2 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.1 |
0.3 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.1 |
GO:1902299 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 |
0.2 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 |
0.4 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.1 |
0.1 |
GO:0035745 |
T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 |
0.1 |
GO:0050868 |
negative regulation of T cell activation(GO:0050868) |
| 0.1 |
0.3 |
GO:0010902 |
positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 0.1 |
0.1 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.1 |
0.1 |
GO:0035455 |
response to interferon-alpha(GO:0035455) |
| 0.1 |
0.1 |
GO:0090191 |
negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.1 |
1.5 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.1 |
0.8 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 |
0.6 |
GO:0006942 |
regulation of striated muscle contraction(GO:0006942) |
| 0.1 |
0.1 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.1 |
0.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.2 |
GO:0038193 |
thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 |
0.1 |
GO:0060313 |
negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 |
5.8 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.1 |
1.0 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.4 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.1 |
0.2 |
GO:0006114 |
glycerol biosynthetic process(GO:0006114) |
| 0.1 |
0.5 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 |
0.1 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.1 |
GO:0007468 |
regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 |
0.3 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 |
0.2 |
GO:0046519 |
sphingoid metabolic process(GO:0046519) |
| 0.1 |
0.1 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.1 |
0.2 |
GO:0071529 |
cementum mineralization(GO:0071529) |
| 0.1 |
0.4 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 |
0.6 |
GO:0046951 |
ketone body biosynthetic process(GO:0046951) |
| 0.1 |
0.6 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 |
0.6 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.1 |
0.2 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 |
0.3 |
GO:0001781 |
neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.1 |
0.3 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.1 |
0.5 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.1 |
0.7 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.1 |
0.8 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.1 |
0.3 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.1 |
GO:0061469 |
regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 |
0.1 |
GO:0032571 |
response to vitamin K(GO:0032571) |
| 0.1 |
2.4 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.8 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.1 |
1.8 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.1 |
0.7 |
GO:0016024 |
CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 |
0.4 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
5.8 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.3 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.4 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.1 |
0.3 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.1 |
0.6 |
GO:0042921 |
glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.1 |
0.1 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 |
0.3 |
GO:0060154 |
cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 |
1.5 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
0.3 |
GO:0036336 |
dendritic cell migration(GO:0036336) |
| 0.0 |
0.1 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.0 |
0.4 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.0 |
0.0 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 |
0.9 |
GO:0010830 |
regulation of myotube differentiation(GO:0010830) |
| 0.0 |
0.5 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.0 |
0.4 |
GO:0040014 |
regulation of multicellular organism growth(GO:0040014) |
| 0.0 |
0.3 |
GO:0075713 |
establishment of integrated proviral latency(GO:0075713) |
| 0.0 |
0.2 |
GO:1904851 |
positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.0 |
0.0 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.0 |
0.2 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 |
2.1 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.0 |
0.1 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.0 |
0.1 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 |
0.2 |
GO:0046073 |
dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.0 |
0.3 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 |
0.5 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.0 |
0.1 |
GO:0002887 |
negative regulation of myeloid leukocyte mediated immunity(GO:0002887) |
| 0.0 |
0.6 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.0 |
0.8 |
GO:1904886 |
beta-catenin destruction complex disassembly(GO:1904886) |
| 0.0 |
1.2 |
GO:0006891 |
intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 |
0.1 |
GO:0000472 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 |
1.2 |
GO:0014904 |
myotube cell development(GO:0014904) |
| 0.0 |
0.2 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.0 |
0.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 |
0.1 |
GO:0010971 |
positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 |
0.7 |
GO:0045956 |
positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 |
0.1 |
GO:0043320 |
natural killer cell degranulation(GO:0043320) |
| 0.0 |
0.2 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.2 |
GO:0006574 |
valine catabolic process(GO:0006574) |
| 0.0 |
0.4 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.2 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.0 |
0.2 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 |
0.2 |
GO:0002645 |
positive regulation of tolerance induction(GO:0002645) |
| 0.0 |
0.2 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 |
0.2 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.3 |
GO:0008090 |
retrograde axonal transport(GO:0008090) |
| 0.0 |
0.9 |
GO:0018107 |
peptidyl-threonine phosphorylation(GO:0018107) |
| 0.0 |
0.2 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.2 |
GO:0046500 |
S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 |
0.3 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.1 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.0 |
0.0 |
GO:0051792 |
medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 |
0.2 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.0 |
0.1 |
GO:0070142 |
synaptic vesicle budding(GO:0070142) |
| 0.0 |
0.1 |
GO:0019048 |
modulation by virus of host morphology or physiology(GO:0019048) |
| 0.0 |
0.3 |
GO:0035435 |
phosphate ion transmembrane transport(GO:0035435) |
| 0.0 |
0.2 |
GO:0016246 |
RNA interference(GO:0016246) |
| 0.0 |
0.4 |
GO:0016558 |
protein import into peroxisome matrix(GO:0016558) |
| 0.0 |
0.1 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 |
0.1 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.0 |
0.0 |
GO:0033625 |
positive regulation of integrin activation(GO:0033625) |
| 0.0 |
0.2 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 |
0.0 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 |
0.3 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.0 |
0.2 |
GO:0048147 |
negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 |
0.1 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.0 |
0.4 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.0 |
0.2 |
GO:2000152 |
regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 |
0.1 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.0 |
0.5 |
GO:0071379 |
cellular response to prostaglandin stimulus(GO:0071379) |
| 0.0 |
0.1 |
GO:0003374 |
dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 |
0.5 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 |
0.1 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 |
0.1 |
GO:0043666 |
regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 |
0.0 |
GO:0048146 |
positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 |
0.0 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 |
0.4 |
GO:0048003 |
antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 |
0.0 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.0 |
0.4 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 |
0.1 |
GO:0046098 |
guanine metabolic process(GO:0046098) |
| 0.0 |
0.7 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.0 |
0.7 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 |
0.1 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.0 |
0.1 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.0 |
0.1 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 |
0.2 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 |
0.2 |
GO:0098727 |
maintenance of cell number(GO:0098727) |
| 0.0 |
0.1 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 |
0.1 |
GO:1904152 |
regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 |
0.0 |
GO:1903412 |
response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
| 0.0 |
0.0 |
GO:0002437 |
inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 |
0.4 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.0 |
0.0 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 |
0.1 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.0 |
0.1 |
GO:0090649 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 |
0.3 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
2.3 |
GO:0002223 |
stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
| 0.0 |
0.1 |
GO:0006581 |
acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 |
2.0 |
GO:0006672 |
ceramide metabolic process(GO:0006672) |
| 0.0 |
0.2 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.0 |
0.1 |
GO:0044827 |
modulation by host of viral genome replication(GO:0044827) |
| 0.0 |
0.0 |
GO:0021910 |
smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
| 0.0 |
0.1 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 |
2.4 |
GO:0048024 |
regulation of mRNA splicing, via spliceosome(GO:0048024) |
| 0.0 |
1.3 |
GO:0038111 |
interleukin-7-mediated signaling pathway(GO:0038111) response to interleukin-7(GO:0098760) cellular response to interleukin-7(GO:0098761) |
| 0.0 |
0.1 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 |
0.2 |
GO:0048149 |
behavioral response to ethanol(GO:0048149) |
| 0.0 |
0.9 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.0 |
0.1 |
GO:0015742 |
alpha-ketoglutarate transport(GO:0015742) |
| 0.0 |
0.1 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.0 |
0.2 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 |
0.2 |
GO:0009157 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) |
| 0.0 |
0.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 |
0.1 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
0.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.1 |
GO:1990001 |
inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 |
0.1 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 |
0.4 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 |
0.0 |
GO:0051103 |
DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 |
0.1 |
GO:0006896 |
Golgi to vacuole transport(GO:0006896) |
| 0.0 |
0.3 |
GO:1901018 |
positive regulation of potassium ion transmembrane transporter activity(GO:1901018) |
| 0.0 |
0.6 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.1 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0006711 |
estrogen catabolic process(GO:0006711) |
| 0.0 |
0.1 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 |
0.1 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.3 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 |
0.1 |
GO:1900245 |
positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 |
0.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.0 |
0.4 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 |
0.3 |
GO:0031282 |
regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 |
0.0 |
GO:0006288 |
base-excision repair, DNA ligation(GO:0006288) |
| 0.0 |
0.1 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 |
0.3 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.0 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.0 |
0.1 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 0.0 |
1.1 |
GO:0015949 |
nucleobase-containing small molecule interconversion(GO:0015949) |
| 0.0 |
0.2 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.1 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.0 |
0.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.2 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.0 |
0.1 |
GO:0009635 |
response to herbicide(GO:0009635) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.1 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 |
0.2 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.0 |
GO:0070202 |
regulation of establishment of protein localization to chromosome(GO:0070202) |
| 0.0 |
0.2 |
GO:0099515 |
vesicle transport along actin filament(GO:0030050) actin filament-based transport(GO:0099515) |
| 0.0 |
0.1 |
GO:0090219 |
negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 |
0.1 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.0 |
0.1 |
GO:0010813 |
neuropeptide catabolic process(GO:0010813) |
| 0.0 |
0.1 |
GO:0019566 |
arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
| 0.0 |
0.6 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.0 |
0.5 |
GO:0042026 |
protein refolding(GO:0042026) |
| 0.0 |
0.1 |
GO:0007379 |
segment specification(GO:0007379) |
| 0.0 |
0.2 |
GO:0018022 |
peptidyl-lysine methylation(GO:0018022) |
| 0.0 |
0.0 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.0 |
0.0 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) |
| 0.0 |
0.2 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.0 |
2.3 |
GO:0018410 |
C-terminal protein amino acid modification(GO:0018410) |
| 0.0 |
0.0 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 |
0.0 |
GO:0006883 |
cellular sodium ion homeostasis(GO:0006883) |
| 0.0 |
0.0 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.0 |
0.1 |
GO:0090102 |
cochlea development(GO:0090102) |
| 0.0 |
0.1 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.0 |
0.0 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.0 |
0.1 |
GO:0032096 |
negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.0 |
0.2 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 |
0.1 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 |
0.0 |
GO:0033198 |
response to ATP(GO:0033198) |
| 0.0 |
0.1 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 |
0.1 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.0 |
0.2 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
1.2 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.1 |
GO:0002369 |
T cell cytokine production(GO:0002369) |
| 0.0 |
0.2 |
GO:0048296 |
regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.0 |
0.4 |
GO:0097194 |
execution phase of apoptosis(GO:0097194) |
| 0.0 |
5.9 |
GO:0000375 |
RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 |
0.1 |
GO:0090398 |
cellular senescence(GO:0090398) |
| 0.0 |
0.1 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 |
0.3 |
GO:0036258 |
multivesicular body assembly(GO:0036258) |
| 0.0 |
0.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.0 |
GO:2000389 |
regulation of neutrophil extravasation(GO:2000389) |
| 0.0 |
0.1 |
GO:0002291 |
T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 |
0.7 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.1 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.0 |
0.5 |
GO:0007339 |
binding of sperm to zona pellucida(GO:0007339) |
| 0.0 |
0.2 |
GO:0046579 |
positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.0 |
0.3 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.0 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 |
0.0 |
GO:0043313 |
regulation of neutrophil degranulation(GO:0043313) |
| 0.0 |
0.1 |
GO:0045351 |
type I interferon biosynthetic process(GO:0045351) |
| 0.0 |
0.1 |
GO:0010310 |
regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 |
0.0 |
GO:0007079 |
mitotic chromosome movement towards spindle pole(GO:0007079) chromosome movement towards spindle pole(GO:0051305) |
| 0.0 |
0.1 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 |
0.1 |
GO:0033146 |
regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
| 0.0 |
0.6 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.0 |
0.0 |
GO:1902075 |
cellular response to salt(GO:1902075) response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 |
0.5 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.0 |
0.1 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.3 |
GO:0034204 |
lipid translocation(GO:0034204) |
| 0.0 |
0.1 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.0 |
0.1 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 |
0.1 |
GO:1902896 |
terminal web assembly(GO:1902896) |
| 0.0 |
0.0 |
GO:0002522 |
leukocyte migration involved in immune response(GO:0002522) |
| 0.0 |
0.1 |
GO:0036003 |
positive regulation of transcription from RNA polymerase II promoter in response to stress(GO:0036003) |
| 0.0 |
0.2 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.0 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.0 |
0.1 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 |
0.1 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 |
0.0 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 |
0.0 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
0.0 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 |
0.1 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 0.0 |
0.2 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 |
0.0 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.0 |
0.0 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 |
0.0 |
GO:0060763 |
mammary duct terminal end bud growth(GO:0060763) |
| 0.0 |
0.0 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.0 |
0.3 |
GO:0043620 |
regulation of DNA-templated transcription in response to stress(GO:0043620) |
| 0.0 |
0.0 |
GO:0048859 |
formation of anatomical boundary(GO:0048859) |
| 0.0 |
0.1 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.0 |
1.5 |
GO:0007286 |
spermatid development(GO:0007286) |
| 0.0 |
0.1 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 |
0.2 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 |
0.0 |
GO:0002091 |
negative regulation of receptor internalization(GO:0002091) |
| 0.0 |
0.0 |
GO:0002507 |
tolerance induction(GO:0002507) |
| 0.0 |
0.0 |
GO:0021772 |
olfactory bulb development(GO:0021772) |
| 0.0 |
0.0 |
GO:0050655 |
dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 |
0.1 |
GO:0045026 |
plasma membrane fusion(GO:0045026) |
| 0.0 |
0.0 |
GO:1903860 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) regulation of branching morphogenesis of a nerve(GO:2000172) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 |
0.0 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 |
0.0 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.2 |
GO:0051865 |
protein autoubiquitination(GO:0051865) |
| 0.0 |
0.1 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.0 |
0.5 |
GO:0051965 |
positive regulation of synapse assembly(GO:0051965) |
| 0.0 |
0.2 |
GO:0006853 |
carnitine shuttle(GO:0006853) |
| 0.0 |
0.0 |
GO:0014003 |
oligodendrocyte development(GO:0014003) |
| 0.0 |
0.1 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.1 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.0 |
0.3 |
GO:0007205 |
protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 |
0.0 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.0 |
0.0 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 0.0 |
1.6 |
GO:0006367 |
transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 |
0.4 |
GO:0006383 |
transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 |
0.1 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.0 |
0.0 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
