Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
HIC1
|
ENSG00000177374.13 | HIC1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| HIC1 | hg38_v1_chr17_+_2055094_2055110 | 0.54 | 2.2e-03 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_-_2139382 | 2.25 |
ENST00000416167.7
|
IGF2
|
insulin like growth factor 2 |
| chr19_+_8364146 | 1.76 |
ENST00000301455.7
ENST00000393962.6 |
ANGPTL4
|
angiopoietin like 4 |
| chr13_+_110307276 | 1.30 |
ENST00000360467.7
ENST00000650540.1 |
COL4A2
|
collagen type IV alpha 2 chain |
| chr4_-_108762964 | 1.28 |
ENST00000512646.5
ENST00000411864.6 ENST00000296486.8 ENST00000510706.5 |
ETNPPL
|
ethanolamine-phosphate phospho-lyase |
| chr14_+_64704380 | 1.25 |
ENST00000247226.13
ENST00000394691.7 |
PLEKHG3
|
pleckstrin homology and RhoGEF domain containing G3 |
| chr4_-_56656304 | 1.21 |
ENST00000503639.7
|
HOPX
|
HOP homeobox |
| chr18_+_36297661 | 1.19 |
ENST00000257209.8
ENST00000590592.5 ENST00000359247.8 |
FHOD3
|
formin homology 2 domain containing 3 |
| chr4_-_56656448 | 1.18 |
ENST00000553379.6
|
HOPX
|
HOP homeobox |
| chr4_-_56656507 | 1.18 |
ENST00000381255.7
ENST00000317745.11 ENST00000555760.6 ENST00000556614.6 |
HOPX
|
HOP homeobox |
| chr8_-_23404076 | 1.18 |
ENST00000524168.1
ENST00000389131.8 ENST00000523833.2 ENST00000519243.1 |
LOXL2
|
lysyl oxidase like 2 |
| chr1_+_1615839 | 1.07 |
ENST00000378712.5
|
MIB2
|
MIB E3 ubiquitin protein ligase 2 |
| chr10_+_11742361 | 1.06 |
ENST00000379215.9
ENST00000420401.5 |
ECHDC3
|
enoyl-CoA hydratase domain containing 3 |
| chr12_+_53097656 | 1.05 |
ENST00000301464.4
|
IGFBP6
|
insulin like growth factor binding protein 6 |
| chr2_-_27495185 | 1.02 |
ENST00000264703.4
|
FNDC4
|
fibronectin type III domain containing 4 |
| chr16_+_1706163 | 1.02 |
ENST00000250894.8
ENST00000673691.1 ENST00000356010.9 ENST00000610761.2 |
MAPK8IP3
|
mitogen-activated protein kinase 8 interacting protein 3 |
| chr14_+_32934383 | 1.01 |
ENST00000551634.6
|
NPAS3
|
neuronal PAS domain protein 3 |
| chr10_-_17617235 | 1.00 |
ENST00000466335.1
|
HACD1
|
3-hydroxyacyl-CoA dehydratase 1 |
| chr18_+_79863668 | 1.00 |
ENST00000316249.3
|
KCNG2
|
potassium voltage-gated channel modifier subfamily G member 2 |
| chr2_-_224039278 | 0.98 |
ENST00000409304.6
ENST00000258405.9 ENST00000454956.1 |
SERPINE2
|
serpin family E member 2 |
| chr20_+_62708827 | 0.94 |
ENST00000370501.4
|
NTSR1
|
neurotensin receptor 1 |
| chr1_-_43453902 | 0.93 |
ENST00000372430.9
ENST00000372432.5 ENST00000583037.5 |
HYI
|
hydroxypyruvate isomerase (putative) |
| chr12_+_53046969 | 0.93 |
ENST00000379902.7
|
TNS2
|
tensin 2 |
| chr2_-_31138429 | 0.91 |
ENST00000349752.10
|
GALNT14
|
polypeptide N-acetylgalactosaminyltransferase 14 |
| chr11_+_95089804 | 0.91 |
ENST00000278505.5
|
ENDOD1
|
endonuclease domain containing 1 |
| chr1_-_43453792 | 0.89 |
ENST00000372434.5
ENST00000486909.1 |
HYI
|
hydroxypyruvate isomerase (putative) |
| chr16_-_79599902 | 0.86 |
ENST00000569649.1
|
MAF
|
MAF bZIP transcription factor |
| chr1_-_43453716 | 0.85 |
ENST00000372433.5
|
HYI
|
hydroxypyruvate isomerase (putative) |
| chr2_+_23385170 | 0.84 |
ENST00000486442.6
|
KLHL29
|
kelch like family member 29 |
| chr18_-_23662810 | 0.83 |
ENST00000322980.13
|
ANKRD29
|
ankyrin repeat domain 29 |
| chr12_+_4809176 | 0.83 |
ENST00000280684.3
|
KCNA6
|
potassium voltage-gated channel subfamily A member 6 |
| chr18_+_23689439 | 0.82 |
ENST00000313654.14
|
LAMA3
|
laminin subunit alpha 3 |
| chr5_+_6633421 | 0.82 |
ENST00000274192.7
|
SRD5A1
|
steroid 5 alpha-reductase 1 |
| chr10_+_17229267 | 0.82 |
ENST00000224237.9
|
VIM
|
vimentin |
| chr3_+_52246204 | 0.81 |
ENST00000409502.7
|
PPM1M
|
protein phosphatase, Mg2+/Mn2+ dependent 1M |
| chr2_+_207711534 | 0.81 |
ENST00000392209.7
|
CCNYL1
|
cyclin Y like 1 |
| chr18_+_23689609 | 0.80 |
ENST00000399516.7
|
LAMA3
|
laminin subunit alpha 3 |
| chr19_-_15232399 | 0.80 |
ENST00000221730.8
|
EPHX3
|
epoxide hydrolase 3 |
| chr15_+_63048576 | 0.79 |
ENST00000559281.6
|
TPM1
|
tropomyosin 1 |
| chr13_-_43786889 | 0.77 |
ENST00000261488.10
|
ENOX1
|
ecto-NOX disulfide-thiol exchanger 1 |
| chr1_-_8026283 | 0.77 |
ENST00000474874.5
ENST00000469499.5 ENST00000377482.10 |
ERRFI1
|
ERBB receptor feedback inhibitor 1 |
| chr15_-_70096604 | 0.76 |
ENST00000559048.5
ENST00000560939.5 ENST00000440567.7 ENST00000557907.5 ENST00000558379.5 ENST00000559929.5 |
TLE3
|
TLE family member 3, transcriptional corepressor |
| chr18_-_23662868 | 0.75 |
ENST00000586087.1
ENST00000592179.6 |
ANKRD29
|
ankyrin repeat domain 29 |
| chr2_-_31138041 | 0.74 |
ENST00000324589.9
|
GALNT14
|
polypeptide N-acetylgalactosaminyltransferase 14 |
| chrX_-_107775951 | 0.74 |
ENST00000315660.8
ENST00000372384.6 ENST00000502650.1 ENST00000506724.1 |
TSC22D3
|
TSC22 domain family member 3 |
| chr6_-_131063207 | 0.74 |
ENST00000530481.5
|
EPB41L2
|
erythrocyte membrane protein band 4.1 like 2 |
| chr14_-_52695543 | 0.73 |
ENST00000395686.8
|
ERO1A
|
endoplasmic reticulum oxidoreductase 1 alpha |
| chr19_-_41353904 | 0.72 |
ENST00000221930.6
|
TGFB1
|
transforming growth factor beta 1 |
| chr21_+_46286623 | 0.72 |
ENST00000397691.1
|
YBEY
|
ybeY metalloendoribonuclease |
| chrX_-_107775740 | 0.71 |
ENST00000372383.9
|
TSC22D3
|
TSC22 domain family member 3 |
| chr9_+_75890639 | 0.71 |
ENST00000545128.5
|
PCSK5
|
proprotein convertase subtilisin/kexin type 5 |
| chr1_-_84893166 | 0.71 |
ENST00000370611.4
|
LPAR3
|
lysophosphatidic acid receptor 3 |
| chr16_+_66604782 | 0.71 |
ENST00000565003.5
|
CMTM3
|
CKLF like MARVEL transmembrane domain containing 3 |
| chr3_+_52246158 | 0.71 |
ENST00000296487.8
|
PPM1M
|
protein phosphatase, Mg2+/Mn2+ dependent 1M |
| chr16_+_2019777 | 0.70 |
ENST00000566435.4
|
NPW
|
neuropeptide W |
| chr1_-_25906457 | 0.69 |
ENST00000426559.6
|
STMN1
|
stathmin 1 |
| chr11_+_63813384 | 0.69 |
ENST00000294244.9
|
SPINDOC
|
spindlin interactor and repressor of chromatin binding |
| chr20_+_3786772 | 0.69 |
ENST00000344256.10
ENST00000379598.9 |
CDC25B
|
cell division cycle 25B |
| chr6_-_105179952 | 0.69 |
ENST00000254765.4
|
POPDC3
|
popeye domain containing 3 |
| chr3_+_101849505 | 0.69 |
ENST00000326151.9
ENST00000326172.9 |
NFKBIZ
|
NFKB inhibitor zeta |
| chr19_+_41354145 | 0.69 |
ENST00000604123.5
|
TMEM91
|
transmembrane protein 91 |
| chr11_+_118607579 | 0.68 |
ENST00000530708.4
|
PHLDB1
|
pleckstrin homology like domain family B member 1 |
| chr12_-_94650506 | 0.68 |
ENST00000261226.9
|
TMCC3
|
transmembrane and coiled-coil domain family 3 |
| chr12_-_121800558 | 0.68 |
ENST00000546227.5
|
RHOF
|
ras homolog family member F, filopodia associated |
| chr9_+_67859398 | 0.68 |
ENST00000620792.1
|
ANKRD20A1
|
ankyrin repeat domain 20 family member A1 |
| chr3_+_52245721 | 0.67 |
ENST00000323588.9
|
PPM1M
|
protein phosphatase, Mg2+/Mn2+ dependent 1M |
| chr19_+_5805018 | 0.67 |
ENST00000303212.3
|
NRTN
|
neurturin |
| chr2_+_172556007 | 0.67 |
ENST00000392571.6
|
PDK1
|
pyruvate dehydrogenase kinase 1 |
| chr8_-_141001217 | 0.67 |
ENST00000522684.5
ENST00000524357.5 ENST00000521332.5 ENST00000524040.5 ENST00000519881.5 ENST00000520045.5 |
PTK2
|
protein tyrosine kinase 2 |
| chr9_-_69672341 | 0.67 |
ENST00000265381.7
|
APBA1
|
amyloid beta precursor protein binding family A member 1 |
| chr5_+_38845824 | 0.65 |
ENST00000502536.5
|
OSMR
|
oncostatin M receptor |
| chr3_+_190514102 | 0.64 |
ENST00000434491.5
ENST00000422940.5 ENST00000317757.7 |
IL1RAP
|
interleukin 1 receptor accessory protein |
| chr2_+_31234144 | 0.64 |
ENST00000322054.10
|
EHD3
|
EH domain containing 3 |
| chr12_+_70366277 | 0.64 |
ENST00000258111.5
|
KCNMB4
|
potassium calcium-activated channel subfamily M regulatory beta subunit 4 |
| chr3_+_12287899 | 0.63 |
ENST00000643888.2
|
PPARG
|
peroxisome proliferator activated receptor gamma |
| chr10_-_119542683 | 0.63 |
ENST00000369103.3
|
RGS10
|
regulator of G protein signaling 10 |
| chr7_-_1160144 | 0.62 |
ENST00000397083.6
ENST00000401903.5 ENST00000316495.8 |
ZFAND2A
|
zinc finger AN1-type containing 2A |
| chr9_+_17579059 | 0.62 |
ENST00000380607.5
|
SH3GL2
|
SH3 domain containing GRB2 like 2, endophilin A1 |
| chr2_+_207711631 | 0.61 |
ENST00000295414.8
ENST00000420822.1 ENST00000339882.9 |
CCNYL1
|
cyclin Y like 1 |
| chr4_+_4387078 | 0.61 |
ENST00000504171.1
|
NSG1
|
neuronal vesicle trafficking associated 1 |
| chr7_+_48089257 | 0.61 |
ENST00000436673.5
ENST00000395564.9 |
UPP1
|
uridine phosphorylase 1 |
| chr17_-_78925376 | 0.61 |
ENST00000262768.11
|
TIMP2
|
TIMP metallopeptidase inhibitor 2 |
| chr3_+_12287962 | 0.60 |
ENST00000643197.2
ENST00000644622.2 |
PPARG
|
peroxisome proliferator activated receptor gamma |
| chr1_+_205504592 | 0.60 |
ENST00000506784.5
ENST00000360066.6 |
CDK18
|
cyclin dependent kinase 18 |
| chr6_-_46735693 | 0.60 |
ENST00000537365.1
|
PLA2G7
|
phospholipase A2 group VII |
| chr22_-_18024513 | 0.60 |
ENST00000441493.7
|
MICAL3
|
microtubule associated monooxygenase, calponin and LIM domain containing 3 |
| chr17_+_6071075 | 0.60 |
ENST00000574232.5
ENST00000539421.1 |
WSCD1
|
WSC domain containing 1 |
| chr10_+_122461545 | 0.59 |
ENST00000368984.8
|
HTRA1
|
HtrA serine peptidase 1 |
| chr8_+_22165358 | 0.59 |
ENST00000306349.13
ENST00000306385.10 |
BMP1
|
bone morphogenetic protein 1 |
| chr1_-_21937300 | 0.59 |
ENST00000374695.8
|
HSPG2
|
heparan sulfate proteoglycan 2 |
| chr15_+_63048535 | 0.59 |
ENST00000560959.5
|
TPM1
|
tropomyosin 1 |
| chr3_+_136819069 | 0.59 |
ENST00000393079.3
ENST00000446465.3 |
SLC35G2
|
solute carrier family 35 member G2 |
| chr3_-_197298092 | 0.59 |
ENST00000392382.6
|
DLG1
|
discs large MAGUK scaffold protein 1 |
| chr12_+_26121984 | 0.59 |
ENST00000538142.5
|
SSPN
|
sarcospan |
| chr16_+_396743 | 0.58 |
ENST00000454619.5
|
NME4
|
NME/NM23 nucleoside diphosphate kinase 4 |
| chr12_+_130162456 | 0.58 |
ENST00000539839.1
ENST00000229030.5 |
FZD10
|
frizzled class receptor 10 |
| chr2_-_10080411 | 0.58 |
ENST00000381813.4
|
CYS1
|
cystin 1 |
| chr1_-_39771348 | 0.58 |
ENST00000327582.5
|
OXCT2
|
3-oxoacid CoA-transferase 2 |
| chr2_-_131492380 | 0.58 |
ENST00000309451.7
|
MZT2A
|
mitotic spindle organizing protein 2A |
| chr11_+_66011994 | 0.57 |
ENST00000312134.3
|
CST6
|
cystatin E/M |
| chr1_+_205504644 | 0.57 |
ENST00000429964.7
ENST00000443813.6 |
CDK18
|
cyclin dependent kinase 18 |
| chr12_-_6647393 | 0.57 |
ENST00000536350.5
ENST00000414226.6 ENST00000229243.7 ENST00000546114.1 |
ACRBP
|
acrosin binding protein |
| chr10_-_119536533 | 0.57 |
ENST00000392865.5
|
RGS10
|
regulator of G protein signaling 10 |
| chr9_+_22446808 | 0.57 |
ENST00000325870.3
|
DMRTA1
|
DMRT like family A1 |
| chr13_+_20703677 | 0.57 |
ENST00000682841.1
|
IL17D
|
interleukin 17D |
| chr10_-_124744254 | 0.57 |
ENST00000280780.6
|
FAM53B
|
family with sequence similarity 53 member B |
| chr5_-_172454308 | 0.56 |
ENST00000636523.1
ENST00000519643.5 |
SH3PXD2B
|
SH3 and PX domains 2B |
| chr9_+_128411715 | 0.56 |
ENST00000420034.5
ENST00000372842.5 |
CERCAM
|
cerebral endothelial cell adhesion molecule |
| chr8_-_141000937 | 0.56 |
ENST00000520892.5
|
PTK2
|
protein tyrosine kinase 2 |
| chr3_+_50155305 | 0.56 |
ENST00000002829.8
ENST00000426511.5 |
SEMA3F
|
semaphorin 3F |
| chr7_-_158829519 | 0.56 |
ENST00000251527.10
ENST00000652148.1 |
ESYT2
|
extended synaptotagmin 2 |
| chr1_-_6180265 | 0.56 |
ENST00000262450.8
|
CHD5
|
chromodomain helicase DNA binding protein 5 |
| chrX_+_154458274 | 0.56 |
ENST00000369682.4
|
PLXNA3
|
plexin A3 |
| chr10_+_73911104 | 0.56 |
ENST00000446342.5
ENST00000372764.4 |
PLAU
|
plasminogen activator, urokinase |
| chr11_+_119149029 | 0.56 |
ENST00000619701.5
|
ABCG4
|
ATP binding cassette subfamily G member 4 |
| chr11_-_125496122 | 0.55 |
ENST00000527534.1
ENST00000278919.8 ENST00000366139.3 |
FEZ1
|
fasciculation and elongation protein zeta 1 |
| chr7_+_146116772 | 0.55 |
ENST00000361727.8
|
CNTNAP2
|
contactin associated protein 2 |
| chr6_+_147508645 | 0.55 |
ENST00000367474.2
|
SAMD5
|
sterile alpha motif domain containing 5 |
| chr11_-_61816985 | 0.55 |
ENST00000350997.12
|
FADS1
|
fatty acid desaturase 1 |
| chr2_-_164621461 | 0.54 |
ENST00000446413.6
ENST00000263915.8 |
GRB14
|
growth factor receptor bound protein 14 |
| chr3_+_12287859 | 0.54 |
ENST00000309576.11
ENST00000397015.7 |
PPARG
|
peroxisome proliferator activated receptor gamma |
| chr10_+_35336486 | 0.54 |
ENST00000374704.8
|
CCNY
|
cyclin Y |
| chr15_-_78131433 | 0.53 |
ENST00000557846.5
ENST00000258930.8 |
CIB2
|
calcium and integrin binding family member 2 |
| chr22_+_37560472 | 0.53 |
ENST00000430687.1
ENST00000249014.5 |
CDC42EP1
|
CDC42 effector protein 1 |
| chr12_-_107761113 | 0.53 |
ENST00000228437.10
|
PRDM4
|
PR/SET domain 4 |
| chr2_+_241687059 | 0.53 |
ENST00000636051.1
|
ING5
|
inhibitor of growth family member 5 |
| chr15_-_83284645 | 0.53 |
ENST00000345382.7
|
BNC1
|
basonuclin 1 |
| chr2_-_101387453 | 0.53 |
ENST00000324768.6
|
CREG2
|
cellular repressor of E1A stimulated genes 2 |
| chr19_-_38256339 | 0.53 |
ENST00000591291.5
ENST00000301242.9 |
PPP1R14A
|
protein phosphatase 1 regulatory inhibitor subunit 14A |
| chr15_+_63048436 | 0.53 |
ENST00000334895.10
ENST00000404484.9 ENST00000558910.3 ENST00000317516.12 |
TPM1
|
tropomyosin 1 |
| chr16_-_46831043 | 0.52 |
ENST00000565112.1
|
C16orf87
|
chromosome 16 open reading frame 87 |
| chr9_+_100473140 | 0.52 |
ENST00000374879.5
|
TMEFF1
|
transmembrane protein with EGF like and two follistatin like domains 1 |
| chr16_-_56425424 | 0.52 |
ENST00000290649.10
|
AMFR
|
autocrine motility factor receptor |
| chr17_-_81961177 | 0.52 |
ENST00000409678.8
|
NOTUM
|
notum, palmitoleoyl-protein carboxylesterase |
| chr4_-_98658582 | 0.52 |
ENST00000305798.8
|
TSPAN5
|
tetraspanin 5 |
| chr3_-_9553796 | 0.52 |
ENST00000287585.8
|
LHFPL4
|
LHFPL tetraspan subfamily member 4 |
| chr3_+_50155024 | 0.52 |
ENST00000414301.5
ENST00000450338.5 ENST00000413852.5 |
SEMA3F
|
semaphorin 3F |
| chr19_-_38256513 | 0.52 |
ENST00000347262.8
ENST00000591585.1 |
PPP1R14A
|
protein phosphatase 1 regulatory inhibitor subunit 14A |
| chr21_+_33403466 | 0.51 |
ENST00000405436.5
|
IFNGR2
|
interferon gamma receptor 2 |
| chrX_+_21940693 | 0.51 |
ENST00000404933.7
ENST00000379404.5 |
SMS
|
spermine synthase |
| chrX_-_129654946 | 0.51 |
ENST00000429967.3
|
APLN
|
apelin |
| chr4_+_3766348 | 0.51 |
ENST00000509482.1
ENST00000330055.7 |
ADRA2C
|
adrenoceptor alpha 2C |
| chr1_-_46604283 | 0.51 |
ENST00000341183.9
ENST00000649800.1 ENST00000650026.1 ENST00000650508.1 ENST00000496619.6 |
MKNK1
|
MAPK interacting serine/threonine kinase 1 |
| chr1_+_15409858 | 0.51 |
ENST00000375980.9
|
EFHD2
|
EF-hand domain family member D2 |
| chr14_+_105474781 | 0.51 |
ENST00000550577.5
ENST00000538259.2 ENST00000329146.9 |
CRIP2
|
cysteine rich protein 2 |
| chr17_+_15945101 | 0.51 |
ENST00000304222.3
|
ADORA2B
|
adenosine A2b receptor |
| chr2_+_130963642 | 0.51 |
ENST00000409303.6
|
ARHGEF4
|
Rho guanine nucleotide exchange factor 4 |
| chr4_+_4387039 | 0.50 |
ENST00000621129.4
|
NSG1
|
neuronal vesicle trafficking associated 1 |
| chr17_-_44363839 | 0.50 |
ENST00000293443.12
|
FAM171A2
|
family with sequence similarity 171 member A2 |
| chr11_+_842824 | 0.50 |
ENST00000397396.5
ENST00000397397.7 |
TSPAN4
|
tetraspanin 4 |
| chr11_+_120511708 | 0.50 |
ENST00000638419.1
ENST00000527524.8 |
GRIK4
|
glutamate ionotropic receptor kainate type subunit 4 |
| chr7_-_87059624 | 0.50 |
ENST00000444627.5
|
ELAPOR2
|
endosome-lysosome associated apoptosis and autophagy regulator family member 2 |
| chr16_+_2009870 | 0.49 |
ENST00000567649.1
|
NPW
|
neuropeptide W |
| chr15_-_78131521 | 0.49 |
ENST00000539011.5
|
CIB2
|
calcium and integrin binding family member 2 |
| chr9_+_75088498 | 0.49 |
ENST00000346234.7
|
OSTF1
|
osteoclast stimulating factor 1 |
| chr10_+_87863595 | 0.49 |
ENST00000371953.8
|
PTEN
|
phosphatase and tensin homolog |
| chr1_-_197146688 | 0.49 |
ENST00000294732.11
|
ASPM
|
assembly factor for spindle microtubules |
| chr12_+_119178920 | 0.49 |
ENST00000281938.7
|
HSPB8
|
heat shock protein family B (small) member 8 |
| chrX_-_110318062 | 0.49 |
ENST00000372059.6
ENST00000262844.10 |
AMMECR1
|
AMMECR nuclear protein 1 |
| chr8_-_41309434 | 0.49 |
ENST00000220772.8
|
SFRP1
|
secreted frizzled related protein 1 |
| chr1_-_20486197 | 0.49 |
ENST00000375078.4
|
CAMK2N1
|
calcium/calmodulin dependent protein kinase II inhibitor 1 |
| chr21_+_33403391 | 0.49 |
ENST00000290219.11
ENST00000381995.5 |
IFNGR2
|
interferon gamma receptor 2 |
| chr7_-_151167692 | 0.49 |
ENST00000297537.5
|
GBX1
|
gastrulation brain homeobox 1 |
| chrX_+_38561530 | 0.48 |
ENST00000378482.7
ENST00000286824.6 |
TSPAN7
|
tetraspanin 7 |
| chr22_-_50251210 | 0.48 |
ENST00000448072.5
ENST00000216271.10 |
HDAC10
|
histone deacetylase 10 |
| chr22_+_23070496 | 0.48 |
ENST00000615612.2
|
GNAZ
|
G protein subunit alpha z |
| chr9_-_75088140 | 0.48 |
ENST00000361092.9
ENST00000376811.5 |
NMRK1
|
nicotinamide riboside kinase 1 |
| chr19_-_50639827 | 0.48 |
ENST00000593901.5
ENST00000600079.6 |
SYT3
|
synaptotagmin 3 |
| chr6_-_35688907 | 0.48 |
ENST00000539068.5
ENST00000357266.9 |
FKBP5
|
FKBP prolyl isomerase 5 |
| chr16_+_69105636 | 0.48 |
ENST00000569188.6
|
HAS3
|
hyaluronan synthase 3 |
| chr1_-_46604214 | 0.48 |
ENST00000371946.9
ENST00000428112.7 ENST00000529170.6 ENST00000371945.10 |
MKNK1
|
MAPK interacting serine/threonine kinase 1 |
| chr16_-_85751112 | 0.48 |
ENST00000602766.1
|
C16orf74
|
chromosome 16 open reading frame 74 |
| chr11_+_842807 | 0.48 |
ENST00000397411.6
|
TSPAN4
|
tetraspanin 4 |
| chr11_+_450255 | 0.48 |
ENST00000308020.6
|
PTDSS2
|
phosphatidylserine synthase 2 |
| chr12_+_119178953 | 0.47 |
ENST00000674542.1
|
HSPB8
|
heat shock protein family B (small) member 8 |
| chr6_+_160348367 | 0.47 |
ENST00000275300.3
|
SLC22A3
|
solute carrier family 22 member 3 |
| chr22_+_19723525 | 0.47 |
ENST00000366425.4
|
GP1BB
|
glycoprotein Ib platelet subunit beta |
| chr14_+_104689588 | 0.47 |
ENST00000330634.11
ENST00000392634.9 ENST00000675482.1 ENST00000398337.8 |
INF2
|
inverted formin 2 |
| chr16_-_15056060 | 0.47 |
ENST00000287706.8
ENST00000624579.3 ENST00000622833.4 |
NTAN1
|
N-terminal asparagine amidase |
| chr9_-_75088198 | 0.47 |
ENST00000376808.8
|
NMRK1
|
nicotinamide riboside kinase 1 |
| chr16_-_79600727 | 0.46 |
ENST00000326043.5
|
MAF
|
MAF bZIP transcription factor |
| chr16_+_397209 | 0.46 |
ENST00000382940.8
|
NME4
|
NME/NM23 nucleoside diphosphate kinase 4 |
| chr2_+_172556039 | 0.46 |
ENST00000410055.5
ENST00000282077.8 |
PDK1
|
pyruvate dehydrogenase kinase 1 |
| chr7_-_24757413 | 0.46 |
ENST00000645220.1
ENST00000409970.6 |
GSDME
|
gasdermin E |
| chr3_+_58008350 | 0.46 |
ENST00000490882.5
ENST00000358537.7 ENST00000429972.6 ENST00000682871.1 ENST00000295956.9 |
FLNB
|
filamin B |
| chr11_+_64291992 | 0.46 |
ENST00000394525.6
|
KCNK4
|
potassium two pore domain channel subfamily K member 4 |
| chr6_+_7726089 | 0.46 |
ENST00000283147.7
|
BMP6
|
bone morphogenetic protein 6 |
| chr11_+_65787056 | 0.46 |
ENST00000335987.8
|
OVOL1
|
ovo like transcriptional repressor 1 |
| chr11_+_126355894 | 0.46 |
ENST00000530591.5
ENST00000534083.5 |
ST3GAL4
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
| chr7_-_87059639 | 0.46 |
ENST00000450689.7
|
ELAPOR2
|
endosome-lysosome associated apoptosis and autophagy regulator family member 2 |
| chr12_-_109880527 | 0.46 |
ENST00000318348.9
|
GLTP
|
glycolipid transfer protein |
| chr11_-_45665578 | 0.46 |
ENST00000308064.7
|
CHST1
|
carbohydrate sulfotransferase 1 |
| chr22_+_44752552 | 0.46 |
ENST00000389774.6
ENST00000356099.11 ENST00000396119.6 ENST00000336963.8 ENST00000412433.5 |
ARHGAP8
|
Rho GTPase activating protein 8 |
| chr16_-_85750951 | 0.45 |
ENST00000602675.5
|
C16orf74
|
chromosome 16 open reading frame 74 |
| chr10_-_87094761 | 0.45 |
ENST00000684338.1
ENST00000684201.1 ENST00000277865.5 |
GLUD1
|
glutamate dehydrogenase 1 |
| chr19_+_45340736 | 0.45 |
ENST00000391946.7
|
KLC3
|
kinesin light chain 3 |
| chr1_-_208244375 | 0.45 |
ENST00000367033.4
|
PLXNA2
|
plexin A2 |
| chr5_+_38846002 | 0.45 |
ENST00000274276.8
|
OSMR
|
oncostatin M receptor |
| chr19_+_45340760 | 0.45 |
ENST00000585434.5
|
KLC3
|
kinesin light chain 3 |
| chrX_-_101659796 | 0.45 |
ENST00000431597.5
ENST00000458024.5 ENST00000413506.5 ENST00000440675.5 ENST00000328766.9 ENST00000356824.9 |
ARMCX2
|
armadillo repeat containing X-linked 2 |
| chr16_-_85751028 | 0.45 |
ENST00000284245.9
ENST00000602914.1 |
C16orf74
|
chromosome 16 open reading frame 74 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.4 | 2.2 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.4 | 1.1 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.4 | 2.5 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.3 | 2.6 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.3 | 1.2 | GO:0052509 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.3 | 0.9 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.3 | 0.8 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.2 | 0.9 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.2 | 0.9 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 2.2 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.2 | 0.6 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.2 | 0.8 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.2 | 0.6 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.2 | 0.6 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.2 | 0.5 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.2 | 1.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.2 | 1.7 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.2 | 0.5 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.2 | 1.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 1.0 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.2 | 0.5 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.2 | 2.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.2 | 0.5 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.2 | 0.6 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.2 | 0.9 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.2 | 0.5 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.2 | 0.8 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 0.5 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.2 | 0.5 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.2 | 0.8 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 1.0 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.1 | 0.4 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 0.4 | GO:0070079 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.1 | 1.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.4 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 0.4 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 1.1 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.1 | 0.4 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.9 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.5 | GO:0035625 | negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.4 | GO:0060367 | subpallium cell proliferation in forebrain(GO:0022012) lateral ganglionic eminence cell proliferation(GO:0022018) lambdoid suture morphogenesis(GO:0060366) sagittal suture morphogenesis(GO:0060367) anterior semicircular canal development(GO:0060873) lateral semicircular canal development(GO:0060875) |
| 0.1 | 0.6 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 0.4 | GO:0060129 | corticotropin hormone secreting cell differentiation(GO:0060128) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) mesendoderm migration(GO:0090133) cell migration involved in mesendoderm migration(GO:0090134) |
| 0.1 | 0.2 | GO:2000583 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.1 | 0.5 | GO:0048627 | myoblast development(GO:0048627) |
| 0.1 | 2.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.3 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.3 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.7 | GO:0016036 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 3.0 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.4 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.6 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.1 | 0.2 | GO:2000683 | regulation of cellular response to X-ray(GO:2000683) |
| 0.1 | 0.5 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.1 | 0.6 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.4 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.1 | 0.6 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.6 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.6 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.1 | 0.5 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.1 | 0.5 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.1 | 0.3 | GO:2000466 | negative regulation of glycogen (starch) synthase activity(GO:2000466) |
| 0.1 | 0.4 | GO:1900450 | negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) |
| 0.1 | 0.5 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.1 | 0.3 | GO:0072720 | response to dithiothreitol(GO:0072720) |
| 0.1 | 0.6 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.1 | 1.3 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 0.1 | 0.9 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.5 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.4 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.1 | 0.7 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.3 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 1.2 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.1 | 0.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.7 | GO:0032966 | negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.1 | 1.5 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 1.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 2.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 1.8 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.1 | 0.3 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.1 | 0.5 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 0.6 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
| 0.1 | 0.3 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.1 | 1.6 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 0.3 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.5 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.5 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.1 | 1.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.1 | 0.4 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.4 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 | 0.2 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.1 | 0.1 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.6 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.2 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.1 | 1.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.3 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.2 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 0.3 | GO:0003068 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 1.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.1 | 0.3 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.2 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 1.3 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.3 | GO:0060268 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 0.7 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.5 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.1 | 0.5 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 0.8 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.1 | 0.3 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 | 0.3 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.5 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 1.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.4 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 | 0.4 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.2 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.1 | 0.2 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.2 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.1 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.2 | GO:0002339 | B cell selection(GO:0002339) |
| 0.1 | 0.2 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.1 | 0.9 | GO:0051608 | histamine transport(GO:0051608) |
| 0.1 | 0.6 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 | 0.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.7 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.1 | 1.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.2 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.2 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.2 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.1 | 0.3 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.2 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.1 | 1.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.3 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 | 0.9 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.1 | 0.6 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.2 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.1 | 1.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.2 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.1 | 0.6 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.2 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.0 | 0.8 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 | 0.7 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 1.0 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 2.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.7 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.1 | GO:0072061 | hexitol metabolic process(GO:0006059) inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.2 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.0 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.2 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.0 | 1.1 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 1.8 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.3 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
| 0.0 | 0.6 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.0 | 0.1 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.0 | 0.1 | GO:0021658 | rhombomere morphogenesis(GO:0021593) rhombomere 3 morphogenesis(GO:0021658) |
| 0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.9 | GO:0046033 | AMP metabolic process(GO:0046033) |
| 0.0 | 0.7 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.4 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 1.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.2 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
| 0.0 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.4 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.6 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.6 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 | 0.2 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.0 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.8 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.3 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.0 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) terminal web assembly(GO:1902896) |
| 0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.8 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.0 | 0.7 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.2 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.0 | 0.1 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 1.2 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.0 | 0.3 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.0 | 0.1 | GO:1900533 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.0 | 0.2 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.7 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 1.0 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.1 | GO:1902905 | positive regulation of fibril organization(GO:1902905) |
| 0.0 | 0.4 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.2 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.4 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.0 | 0.6 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) pronephric nephron development(GO:0039019) |
| 0.0 | 0.4 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
| 0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.1 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.0 | 0.1 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.2 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.3 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.5 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.6 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.8 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 0.3 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.0 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.0 | 0.1 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.0 | 0.8 | GO:0010962 | regulation of glycogen biosynthetic process(GO:0005979) regulation of glucan biosynthetic process(GO:0010962) |
| 0.0 | 0.2 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.0 | 0.1 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.0 | 0.5 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 | 0.3 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.4 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.0 | 0.1 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.1 | GO:0005999 | xylulose biosynthetic process(GO:0005999) |
| 0.0 | 0.7 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.3 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 0.3 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.9 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.3 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.2 | GO:0046218 | tryptophan catabolic process(GO:0006569) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.7 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.1 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.0 | 0.1 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.0 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.9 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 1.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.7 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.6 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.4 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.0 | 0.0 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 | 0.0 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
| 0.0 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.5 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.3 | GO:0010452 | histone H3-K36 methylation(GO:0010452) peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.7 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 1.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.0 | 0.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.2 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.2 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.0 | 0.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.0 | 0.1 | GO:0090500 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.0 | 0.0 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.0 | 0.3 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.4 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.3 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
| 0.0 | 0.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.4 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.6 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.0 | 0.5 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.4 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.4 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.6 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 0.2 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
| 0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.5 | GO:0000271 | polysaccharide biosynthetic process(GO:0000271) |
| 0.0 | 1.1 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.4 | GO:0030325 | adrenal gland development(GO:0030325) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.0 | GO:0072204 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.0 | 0.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.3 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.2 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.1 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.2 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.0 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) |
| 0.0 | 0.0 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.3 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.5 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.4 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.2 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.0 | 0.1 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
| 0.0 | 0.5 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.1 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.0 | 0.3 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.4 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.0 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.3 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.2 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.2 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.0 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.3 | GO:0048265 | response to pain(GO:0048265) |
| 0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.0 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.0 | 0.0 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.7 | GO:0030042 | actin filament depolymerization(GO:0030042) |
| 0.0 | 0.1 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.3 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.4 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.3 | 0.8 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.2 | 1.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 0.7 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.2 | 1.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 2.1 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.2 | 1.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 1.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.2 | 0.5 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.2 | 2.4 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 1.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.9 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.9 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.7 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 2.0 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.4 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.9 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 1.0 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.1 | 0.4 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 1.8 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 1.0 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.2 | GO:0032419 | extrinsic component of lysosome membrane(GO:0032419) |
| 0.1 | 0.2 | GO:1905103 | integral component of lysosomal membrane(GO:1905103) |
| 0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.4 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 1.2 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 0.3 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 0.3 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.1 | 0.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.3 | GO:0032449 | CBM complex(GO:0032449) |
| 0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.2 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.6 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.3 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.0 | 0.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.4 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.5 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.5 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 3.0 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 1.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.9 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.1 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 2.4 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 1.0 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.0 | 3.6 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.0 | 0.9 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.4 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.1 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.0 | 0.7 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.1 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 1.0 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 2.3 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.2 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.4 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.1 | GO:0005595 | collagen type XII trimer(GO:0005595) |
| 0.0 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.5 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 1.0 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 2.6 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.0 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 1.0 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.5 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 1.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.5 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.0 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.3 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 1.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.2 | GO:0032432 | actin filament bundle(GO:0032432) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 0.6 | 1.7 | GO:0080023 | 3R-hydroxyacyl-CoA dehydratase activity(GO:0080023) |
| 0.5 | 1.4 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.3 | 0.9 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.3 | 1.0 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.2 | 0.9 | GO:0061769 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.2 | 2.6 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 1.2 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.2 | 0.9 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.2 | 2.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.2 | 0.8 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.2 | 1.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 0.8 | GO:0002060 | purine nucleobase binding(GO:0002060) glycogen phosphorylase activity(GO:0008184) |
| 0.2 | 1.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.6 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.2 | 0.6 | GO:0070704 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
| 0.2 | 1.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.2 | 0.5 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 0.8 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.2 | 0.5 | GO:0051800 | inositol-1,3,4,5-tetrakisphosphate 3-phosphatase activity(GO:0051717) phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
| 0.2 | 0.8 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 1.4 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 0.9 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 1.0 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.1 | 1.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.4 | GO:0033746 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 0.6 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.6 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.8 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.4 | GO:0019981 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) ciliary neurotrophic factor binding(GO:0070119) |
| 0.1 | 0.4 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 0.6 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.5 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 2.6 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.5 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 0.4 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.1 | 0.6 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.1 | 0.8 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 0.3 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 2.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 1.7 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.3 | GO:0031755 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.1 | 0.5 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 1.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.4 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 0.9 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.1 | 0.4 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 2.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 0.4 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.1 | 0.4 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 0.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.1 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.8 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 0.3 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.1 | 1.3 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.7 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 0.6 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.2 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 1.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.4 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.7 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.2 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.1 | 0.4 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.1 | 0.7 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.3 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.4 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 0.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.2 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.2 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.3 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.4 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.1 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.9 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.1 | 2.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.6 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.5 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.4 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.3 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 1.0 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 1.0 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.2 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.2 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.0 | 0.2 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.2 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.0 | 0.5 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 1.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.2 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 1.0 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.7 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.4 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 1.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.3 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.3 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.3 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.5 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.9 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.2 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.0 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 1.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 1.1 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.4 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.2 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.0 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 1.0 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 2.7 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.0 | 3.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 1.8 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.3 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.2 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 2.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.0 | 0.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 1.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.1 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.5 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.1 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.3 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.0 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.0 | 1.5 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 1.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.0 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.2 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.0 | GO:0001626 | nociceptin receptor activity(GO:0001626) |
| 0.0 | 0.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 1.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 0.5 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 1.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 3.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 1.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 2.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 2.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 1.4 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 1.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 1.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 1.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.8 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.6 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 1.4 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.9 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.8 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 1.5 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 1.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 6.3 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.8 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.8 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.8 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 1.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 1.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.1 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.5 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.4 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.9 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 3.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 1.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.5 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.9 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 2.5 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 1.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 2.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 1.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 0.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 0.8 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 3.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 1.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 2.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 1.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 1.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 1.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 1.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 4.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 2.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.7 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 1.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.9 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.8 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 1.4 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.0 | 0.6 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.6 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
| 0.0 | 0.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.4 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.8 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.4 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 1.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 1.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 1.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 1.1 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 1.8 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.5 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 2.7 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 2.0 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |