Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MAFB
|
ENSG00000204103.4 | MAFB |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MAFB | hg38_v1_chr20_-_40689228_40689244 | -0.66 | 8.3e-05 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.5 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.5 | 4.9 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.5 | 1.6 | GO:0060559 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 0.5 | 1.0 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.5 | 2.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.5 | 6.6 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.5 | 2.5 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.5 | 1.5 | GO:1900081 | regulation of cellular amine catabolic process(GO:0033241) negative regulation of cellular amine catabolic process(GO:0033242) negative regulation of the force of heart contraction(GO:0098736) regulation of arginine catabolic process(GO:1900081) negative regulation of arginine catabolic process(GO:1900082) regulation of citrulline biosynthetic process(GO:1903248) negative regulation of citrulline biosynthetic process(GO:1903249) negative regulation of cellular amino acid biosynthetic process(GO:2000283) |
| 0.4 | 2.5 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.4 | 1.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.4 | 2.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.4 | 1.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) fast-twitch skeletal muscle fiber contraction(GO:0031443) relaxation of skeletal muscle(GO:0090076) |
| 0.4 | 2.2 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.4 | 1.1 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.3 | 1.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) cellular response to iron(III) ion(GO:0071283) |
| 0.3 | 1.0 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.3 | 1.3 | GO:0052509 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.3 | 1.0 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
| 0.3 | 8.6 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.3 | 1.0 | GO:1903572 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.3 | 1.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.3 | 1.2 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.3 | 1.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 | 0.6 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.3 | 1.1 | GO:0048627 | myoblast development(GO:0048627) |
| 0.3 | 1.4 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.3 | 0.8 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.3 | 0.8 | GO:0071484 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) retinal cell apoptotic process(GO:1990009) |
| 0.3 | 0.3 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 0.3 | 1.3 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.2 | 1.0 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.2 | 0.7 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 | 2.0 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.2 | 0.7 | GO:1905237 | response to cyclosporin A(GO:1905237) positive regulation of response to drug(GO:2001025) |
| 0.2 | 0.7 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 | 1.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.2 | 0.5 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.2 | 0.7 | GO:1901874 | negative regulation of post-translational protein modification(GO:1901874) |
| 0.2 | 1.4 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.2 | 1.4 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.2 | 1.8 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 0.7 | GO:0060435 | bronchiole development(GO:0060435) |
| 0.2 | 0.9 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.2 | 1.3 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.2 | 0.6 | GO:0030719 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.2 | 0.8 | GO:0006175 | adenosine salvage(GO:0006169) dATP biosynthetic process(GO:0006175) |
| 0.2 | 1.4 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.2 | 0.6 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.2 | 1.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 | 0.8 | GO:0051710 | regulation of cytolysis in other organism(GO:0051710) |
| 0.2 | 0.8 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.2 | 0.8 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.2 | 0.6 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.2 | 0.7 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 2.2 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.2 | 0.9 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.2 | 0.6 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.2 | 0.6 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.2 | 0.9 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 | 0.5 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.2 | 1.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.2 | 0.5 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 0.2 | 0.5 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.2 | 0.5 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.2 | 0.7 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.2 | 0.7 | GO:0060474 | positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.2 | 1.4 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.2 | 1.2 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.2 | 0.5 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.2 | 0.7 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.2 | 2.0 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 | 1.8 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.2 | 0.5 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.2 | 0.8 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.2 | 0.5 | GO:0051821 | negative regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010768) transmission of virus(GO:0019089) dissemination or transmission of symbiont from host(GO:0044007) dissemination or transmission of organism from other organism involved in symbiotic interaction(GO:0051821) |
| 0.2 | 0.6 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 0.5 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.2 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.2 | 0.6 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.2 | 2.0 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.2 | 0.6 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.1 | 0.4 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.1 | 0.6 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.1 | 0.7 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 0.9 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.4 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.1 | 0.7 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 1.9 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.1 | 0.4 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.6 | GO:0060577 | pulmonary vein morphogenesis(GO:0060577) |
| 0.1 | 1.3 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.4 | GO:1990258 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.1 | 1.5 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 3.0 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 0.8 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 0.7 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.1 | 0.4 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.1 | 0.5 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.7 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 | 1.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.4 | GO:0044830 | modulation by host of viral RNA genome replication(GO:0044830) positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.1 | 1.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 1.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 0.6 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.1 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.1 | 2.9 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 0.4 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) |
| 0.1 | 0.4 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.1 | 0.5 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.1 | 1.2 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 0.5 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 0.6 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 0.8 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.4 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.1 | 0.5 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.4 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.5 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 0.1 | 1.4 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.3 | GO:0035498 | carnosine metabolic process(GO:0035498) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0072144 | glomerular mesangial cell development(GO:0072144) |
| 0.1 | 0.6 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 0.1 | 0.7 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.2 | GO:1902304 | positive regulation of potassium ion export(GO:1902304) |
| 0.1 | 0.3 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 | 0.3 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.1 | 0.3 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) histone H3-R2 methylation(GO:0034970) |
| 0.1 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.1 | 1.0 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.1 | 0.6 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 0.4 | GO:0032904 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 | 0.3 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.5 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.6 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.1 | 1.2 | GO:0015820 | leucine transport(GO:0015820) |
| 0.1 | 0.7 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
| 0.1 | 1.7 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.5 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.5 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.1 | 0.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.4 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 | 0.3 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.1 | 1.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.3 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 1.5 | GO:0090178 | regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.1 | 0.6 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 | 0.7 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.9 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.6 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.4 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 | 0.3 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 | 0.4 | GO:1905165 | regulation of lysosomal protein catabolic process(GO:1905165) |
| 0.1 | 3.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 | 0.7 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.4 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.1 | 0.5 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.1 | 1.4 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.1 | 2.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 | 0.8 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 | 0.3 | GO:1900244 | positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 0.2 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.1 | 0.5 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.6 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.1 | 0.3 | GO:0002159 | desmosome assembly(GO:0002159) dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.1 | 1.0 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.7 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.9 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.1 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.1 | 0.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 | 0.3 | GO:1903598 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) positive regulation of gap junction assembly(GO:1903598) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 0.1 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.1 | 0.3 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 | 0.3 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.4 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 4.5 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 1.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.2 | GO:0010931 | macrophage tolerance induction(GO:0010931) regulation of macrophage tolerance induction(GO:0010932) positive regulation of macrophage tolerance induction(GO:0010933) |
| 0.1 | 0.3 | GO:0071110 | protein biotinylation(GO:0009305) response to biotin(GO:0070781) histone biotinylation(GO:0071110) |
| 0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.9 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
| 0.1 | 0.2 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.1 | 0.7 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 1.2 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.2 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.1 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.1 | 0.7 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.7 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 1.6 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.7 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.7 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 | 1.3 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 | 1.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.4 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.2 | GO:0032348 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.1 | 0.3 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 | 0.1 | GO:1902256 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.1 | 0.4 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.5 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 0.3 | GO:0019086 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) late viral transcription(GO:0019086) positive regulation of transcription by glucose(GO:0046016) |
| 0.1 | 1.7 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.2 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 0.6 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.1 | 0.1 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.7 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.5 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.1 | GO:0051343 | positive regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051343) |
| 0.1 | 0.3 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 | 0.2 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 | 1.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.5 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 | 0.4 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.5 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 | 0.1 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.2 | GO:0006532 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
| 0.1 | 0.1 | GO:0032900 | negative regulation of neurotrophin production(GO:0032900) |
| 0.1 | 0.2 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.6 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.4 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.1 | 0.2 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.1 | 0.1 | GO:0051834 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.1 | 1.6 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 1.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.5 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.1 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
| 0.1 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.9 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 0.4 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.2 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.3 | GO:2000504 | regulation of Fas signaling pathway(GO:1902044) positive regulation of blood vessel remodeling(GO:2000504) |
| 0.1 | 0.1 | GO:1904782 | negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) |
| 0.1 | 0.8 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.2 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 1.3 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 0.2 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.2 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) negative regulation of synapse maturation(GO:2000297) |
| 0.1 | 0.2 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 | 0.5 | GO:0030807 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) |
| 0.1 | 0.2 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.1 | 0.4 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.3 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 | 0.7 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.6 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 0.6 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) midbrain morphogenesis(GO:1904693) |
| 0.1 | 0.2 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.1 | 1.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.5 | GO:0060068 | vagina development(GO:0060068) |
| 0.1 | 0.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 1.4 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.1 | 0.4 | GO:0048570 | notochord morphogenesis(GO:0048570) |
| 0.1 | 0.6 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.1 | 1.5 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 | 0.2 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 | 0.4 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.1 | 0.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 0.8 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.2 | GO:0038156 | interleukin-5-mediated signaling pathway(GO:0038043) interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.1 | 0.2 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.1 | 0.3 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.1 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) |
| 0.0 | 0.8 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.7 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.6 | GO:0052697 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 1.0 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.7 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.3 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.9 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.5 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.1 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.0 | 0.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 1.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.8 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.9 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.2 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.0 | 0.5 | GO:0000050 | urea cycle(GO:0000050) |
| 0.0 | 0.8 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.3 | GO:0010710 | calcium-independent cell-matrix adhesion(GO:0007161) regulation of collagen catabolic process(GO:0010710) |
| 0.0 | 0.1 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.0 | 0.6 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.0 | 0.7 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.0 | 3.3 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 0.1 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 | 0.3 | GO:0072343 | pancreatic stellate cell proliferation(GO:0072343) response to metformin(GO:1901558) regulation of pancreatic stellate cell proliferation(GO:2000229) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.0 | 0.9 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.3 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.0 | 0.5 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.0 | 0.4 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.2 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 2.0 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.6 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.0 | GO:0015827 | tryptophan transport(GO:0015827) |
| 0.0 | 0.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.9 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 1.4 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.0 | 0.9 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.0 | 0.3 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.0 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.4 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.4 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.1 | GO:0018194 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 0.4 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.2 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.0 | 2.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0061643 | vagus nerve morphogenesis(GO:0021644) chemorepulsion of branchiomotor axon(GO:0021793) chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.0 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.1 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.9 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.4 | GO:0072662 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.1 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.1 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.1 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.0 | 0.3 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.5 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.4 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.6 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.7 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 1.4 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 0.2 | GO:0003360 | brainstem development(GO:0003360) |
| 0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 1.7 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.9 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.0 | 0.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 1.5 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.0 | 0.5 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.5 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
| 0.0 | 0.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.4 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.2 | GO:0006772 | thiamine metabolic process(GO:0006772) |
| 0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.3 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.2 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 1.8 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 0.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.3 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.4 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.2 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.0 | 0.6 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.1 | GO:0039023 | positive regulation of polarized epithelial cell differentiation(GO:0030862) pronephric nephron morphogenesis(GO:0039007) pronephric nephron tubule morphogenesis(GO:0039008) pronephric nephron tubule development(GO:0039020) pronephric duct development(GO:0039022) pronephric duct morphogenesis(GO:0039023) Kupffer's vesicle development(GO:0070121) |
| 0.0 | 0.3 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.2 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.0 | 0.0 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.0 | 2.7 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.3 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.0 | 0.3 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.0 | 2.1 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.1 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.0 | 0.2 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.0 | 0.8 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.1 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.3 | GO:0097107 | postsynaptic density assembly(GO:0097107) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.4 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.0 | 0.2 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.1 | GO:0060018 | basophil differentiation(GO:0030221) astrocyte fate commitment(GO:0060018) mast cell differentiation(GO:0060374) |
| 0.0 | 0.2 | GO:0070305 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.0 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.1 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 | 0.1 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.0 | 0.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 1.9 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.3 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.5 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.0 | 0.7 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.0 | 0.4 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 | 0.0 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.0 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.0 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.0 | 0.2 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.0 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.9 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.7 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.0 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.1 | GO:0033152 | B cell lineage commitment(GO:0002326) immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.6 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.1 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 | 0.5 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 | 1.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.3 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.0 | 0.4 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0031456 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.0 | 0.2 | GO:0048569 | post-embryonic organ development(GO:0048569) |
| 0.0 | 1.2 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 | 2.2 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 | 0.5 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.0 | 0.3 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.2 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.0 | 0.6 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.7 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.0 | 1.2 | GO:0030834 | regulation of actin filament depolymerization(GO:0030834) |
| 0.0 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.1 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.4 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.0 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.5 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.6 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 0.1 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.4 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.3 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.0 | 0.3 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.0 | 0.2 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.1 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.2 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.5 | GO:0006833 | water transport(GO:0006833) |
| 0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.1 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) regulation of interleukin-1 alpha secretion(GO:0050705) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.0 | 0.7 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.0 | 0.6 | GO:0000732 | strand displacement(GO:0000732) |
| 0.0 | 0.1 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
| 0.0 | 0.1 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.5 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.2 | GO:0055026 | negative regulation of cardiac muscle tissue development(GO:0055026) |
| 0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.7 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.2 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.4 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.0 | 0.5 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 2.1 | GO:1990830 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 1.3 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.6 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:0072505 | phosphate ion homeostasis(GO:0055062) divalent inorganic anion homeostasis(GO:0072505) trivalent inorganic anion homeostasis(GO:0072506) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.7 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
| 0.0 | 0.9 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.9 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.0 | 0.2 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.3 | GO:0040032 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.4 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) |
| 0.0 | 0.0 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.5 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.8 | GO:0051784 | negative regulation of nuclear division(GO:0051784) |
| 0.0 | 0.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 1.7 | GO:0008037 | cell recognition(GO:0008037) |
| 0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.2 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 | 0.6 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 | 0.0 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.4 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 | 0.1 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.1 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0099515 | vesicle transport along actin filament(GO:0030050) actin filament-based transport(GO:0099515) |
| 0.0 | 0.4 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.5 | GO:0042304 | regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.0 | 0.2 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.0 | 0.1 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
| 0.0 | 0.3 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.0 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.0 | 2.8 | GO:0030216 | keratinocyte differentiation(GO:0030216) |
| 0.0 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.0 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.5 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.0 | 0.1 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.0 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.0 | 0.4 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.0 | 0.1 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.1 | GO:1990564 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.3 | GO:0046464 | triglyceride catabolic process(GO:0019433) neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.0 | 0.2 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.4 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.0 | 0.5 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 0.0 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
| 0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.2 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.4 | 2.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 3.8 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.3 | 0.8 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.3 | 1.0 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.2 | 1.4 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 1.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 3.0 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 0.8 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.2 | 0.7 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 1.5 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 0.5 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.2 | 1.4 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 1.6 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.7 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.1 | 0.7 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.7 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 1.5 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.4 | GO:1902737 | dendritic filopodium(GO:1902737) |
| 0.1 | 1.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.1 | 1.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.9 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 1.0 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.4 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.1 | 0.5 | GO:1990742 | microvesicle(GO:1990742) |
| 0.1 | 0.7 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 0.5 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 0.3 | GO:0034677 | integrin alpha7-beta1 complex(GO:0034677) |
| 0.1 | 1.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.6 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.5 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 1.1 | GO:0070449 | elongin complex(GO:0070449) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.2 | GO:1905103 | integral component of lysosomal membrane(GO:1905103) |
| 0.1 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.7 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 1.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.3 | GO:0097229 | sperm end piece(GO:0097229) |
| 0.1 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 1.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.4 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.4 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.1 | 1.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.3 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.1 | 1.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 8.7 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 1.0 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.3 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.6 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.5 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.3 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 2.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 1.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 2.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.2 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.1 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 1.2 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.4 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 1.2 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.1 | 0.7 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 0.2 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.4 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 1.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.7 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.4 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 2.4 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 1.0 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.7 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.0 | 1.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.3 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.3 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.7 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.2 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.0 | 0.1 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.0 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 3.9 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 1.8 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 1.1 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.4 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.8 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.3 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.0 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.5 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.6 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 2.7 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.1 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.0 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 1.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.5 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 1.0 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.9 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.3 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 2.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.3 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 1.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.0 | 1.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 1.5 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 1.9 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 2.1 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.0 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.5 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.4 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 2.0 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 2.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.4 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 10.9 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.1 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.1 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 3.7 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.1 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 2.7 | GO:0034703 | cation channel complex(GO:0034703) |
| 0.0 | 1.0 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 1.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 1.2 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.9 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 1.2 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.5 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.0 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.6 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.3 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 4.0 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 1.2 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 2.0 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.0 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 2.1 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 1.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.9 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.7 | 6.6 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.6 | 2.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.5 | 1.5 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.4 | 2.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 2.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.3 | 2.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.3 | 1.3 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.3 | 1.9 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.3 | 0.8 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.3 | 0.8 | GO:0004056 | argininosuccinate lyase activity(GO:0004056) |
| 0.2 | 0.7 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.2 | 0.7 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.2 | 0.7 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.2 | 1.1 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.2 | 0.7 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.2 | 1.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.2 | 0.8 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.2 | 2.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.2 | 1.6 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 1.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.2 | 0.7 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 0.9 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.2 | 0.6 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 0.2 | 2.4 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.2 | 2.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.2 | 4.0 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.2 | 1.0 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.2 | 0.5 | GO:0016419 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.2 | 0.5 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.2 | 0.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.2 | 1.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.2 | 1.7 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 0.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 3.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.2 | 0.5 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.4 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.6 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.1 | 1.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 0.7 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 0.4 | GO:0004021 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 0.1 | 0.5 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.1 | 0.4 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 0.7 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 1.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 2.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.5 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.1 | 0.7 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 1.0 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.9 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 0.7 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.1 | 0.5 | GO:0015198 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.4 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.7 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.1 | 0.4 | GO:0080023 | 3R-hydroxyacyl-CoA dehydratase activity(GO:0080023) |
| 0.1 | 1.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.3 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.1 | 0.3 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 1.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 2.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 0.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.5 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.1 | 0.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 1.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 1.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.5 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.1 | 0.5 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.6 | GO:0016807 | cysteine-type carboxypeptidase activity(GO:0016807) cysteine-type exopeptidase activity(GO:0070004) |
| 0.1 | 1.2 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 0.3 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.1 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.6 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.4 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.1 | 0.5 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.1 | 0.4 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.1 | 2.0 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 1.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 0.3 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.1 | 0.6 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.4 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.3 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.1 | 0.6 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 0.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.7 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.3 | GO:0004077 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 0.1 | 0.9 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 1.4 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.1 | 0.5 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 1.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 1.3 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.6 | GO:0050816 | phosphoserine binding(GO:0050815) phosphothreonine binding(GO:0050816) |
| 0.1 | 1.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 2.3 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.1 | 0.2 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.1 | 0.6 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.4 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.2 | GO:0004639 | phosphoribosylaminoimidazole carboxylase activity(GO:0004638) phosphoribosylaminoimidazolesuccinocarboxamide synthase activity(GO:0004639) |
| 0.1 | 0.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 1.5 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.3 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 1.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.5 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.4 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.1 | 0.4 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.2 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.1 | 2.0 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 0.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.4 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.9 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.7 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.4 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.5 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.2 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 1.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 0.2 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.1 | 2.0 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.2 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 0.1 | 0.4 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 1.8 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.1 | 0.2 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 0.8 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.1 | 0.9 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.2 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.1 | 0.2 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.1 | 1.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 2.3 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 0.3 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.2 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-5 receptor activity(GO:0004914) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 1.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 1.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.5 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.5 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.0 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.2 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 1.7 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 3.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.5 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 1.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.3 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 5.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 1.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 1.6 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.3 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.4 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 1.1 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.4 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.7 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 1.0 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.2 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.4 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 1.1 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.3 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 1.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.1 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.1 | GO:0000035 | acyl binding(GO:0000035) |
| 0.0 | 1.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.4 | GO:1901612 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.5 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 1.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 1.1 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0019777 | Atg12 transferase activity(GO:0019777) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.5 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 1.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.3 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.0 | 0.1 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.7 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.7 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 1.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 1.8 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 1.0 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.0 | 0.7 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.0 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.0 | 1.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.3 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.7 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.0 | 0.2 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.9 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.3 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.3 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.0 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.1 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 3.7 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.1 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) ethanolaminephosphotransferase activity(GO:0004307) |
| 0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.6 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
| 0.0 | 0.1 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.0 | 2.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.6 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 1.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.4 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.1 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 6.5 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
| 0.0 | 0.1 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 0.4 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.3 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.1 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.0 | 0.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 1.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 1.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.0 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.0 | GO:0005135 | interleukin-3 receptor binding(GO:0005135) |
| 0.0 | 0.5 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 2.2 | GO:0005126 | cytokine receptor binding(GO:0005126) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 1.2 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.0 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.6 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.0 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) pyrimidine ribonucleotide binding(GO:0032557) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.0 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 7.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 3.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 3.8 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 3.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 2.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 1.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 3.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 3.9 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 2.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 3.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 1.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.7 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 4.5 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 2.0 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 2.4 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 1.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 1.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.7 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 1.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.6 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 1.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 2.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 1.4 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.4 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.6 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 7.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 1.9 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.7 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.3 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 3.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 3.8 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 2.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 4.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 2.9 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 4.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 2.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 3.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 1.4 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 2.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 3.5 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.1 | 2.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 1.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 1.4 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 1.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 4.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 1.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 0.8 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 2.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 1.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 4.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 2.3 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 1.8 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 1.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 0.6 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 1.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 1.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.5 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.8 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 1.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 2.3 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.6 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 1.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 1.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 2.8 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 1.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.6 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 2.2 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 2.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.9 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.6 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 2.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 2.4 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.8 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.4 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 1.0 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.6 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 1.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 1.0 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.4 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 2.3 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 1.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.4 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.7 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.7 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.5 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
| 0.0 | 1.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |