Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
PATZ1
|
ENSG00000100105.18 | PATZ1 |
|
KLF4
|
ENSG00000136826.15 | KLF4 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PATZ1 | hg38_v1_chr22_-_31345770_31345785 | -0.70 | 1.7e-05 | Click! |
| KLF4 | hg38_v1_chr9_-_107489754_107489776 | 0.39 | 3.2e-02 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 8.7 | 52.4 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 6.8 | 20.3 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 6.4 | 19.1 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 6.4 | 6.4 | GO:0051231 | spindle elongation(GO:0051231) |
| 4.9 | 19.5 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 4.8 | 14.4 | GO:1903576 | response to L-arginine(GO:1903576) |
| 4.7 | 9.3 | GO:2000309 | positive regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000309) |
| 4.5 | 13.5 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 4.5 | 13.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 3.9 | 57.9 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 3.8 | 22.8 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 3.7 | 33.6 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 3.6 | 10.9 | GO:0042938 | dipeptide transport(GO:0042938) |
| 3.6 | 10.8 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 3.5 | 10.6 | GO:0005999 | xylulose biosynthetic process(GO:0005999) |
| 3.4 | 10.3 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 2.9 | 17.2 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 2.9 | 8.6 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 2.8 | 13.8 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 2.8 | 8.3 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 2.7 | 11.0 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 2.7 | 24.6 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 2.7 | 10.9 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 2.7 | 13.5 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 2.6 | 2.6 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 2.6 | 7.9 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 2.6 | 49.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 2.6 | 7.7 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 2.6 | 7.7 | GO:0005988 | lactose metabolic process(GO:0005988) lactose biosynthetic process(GO:0005989) |
| 2.6 | 12.9 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 2.6 | 7.7 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 2.5 | 12.6 | GO:1902612 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 2.5 | 2.5 | GO:1904030 | negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 2.4 | 9.8 | GO:0003169 | coronary vein morphogenesis(GO:0003169) |
| 2.4 | 9.7 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 2.4 | 19.3 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 2.4 | 2.4 | GO:0090205 | positive regulation of cholesterol metabolic process(GO:0090205) |
| 2.3 | 13.9 | GO:0051012 | microtubule sliding(GO:0051012) |
| 2.3 | 4.5 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 2.2 | 6.7 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 2.2 | 8.8 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 2.2 | 15.4 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) |
| 2.2 | 6.5 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 2.2 | 39.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 2.2 | 8.7 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 2.1 | 8.5 | GO:0036114 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 2.1 | 2.1 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 2.1 | 25.4 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 2.1 | 12.7 | GO:0010899 | regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 2.1 | 2.1 | GO:1902946 | protein localization to early endosome(GO:1902946) |
| 2.1 | 10.4 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 2.1 | 24.9 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 2.1 | 6.2 | GO:1904172 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 2.1 | 4.1 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 2.0 | 8.0 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 2.0 | 7.9 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 1.9 | 3.9 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 1.9 | 11.5 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 1.9 | 1.9 | GO:1900195 | positive regulation of oocyte maturation(GO:1900195) |
| 1.9 | 11.4 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 1.9 | 13.1 | GO:0035900 | response to isolation stress(GO:0035900) |
| 1.9 | 11.2 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 1.9 | 7.5 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 1.9 | 7.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 1.8 | 9.2 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 1.8 | 9.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 1.8 | 12.8 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 1.8 | 7.3 | GO:0090096 | regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 1.8 | 3.6 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 1.8 | 1.8 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 1.8 | 17.7 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 1.8 | 5.3 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 1.7 | 13.9 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 1.7 | 13.8 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 1.7 | 5.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 1.7 | 1.7 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 1.7 | 6.6 | GO:0048627 | myoblast development(GO:0048627) |
| 1.6 | 4.9 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 1.6 | 16.5 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 1.6 | 1.6 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.6 | 4.9 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 1.6 | 3.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 1.6 | 3.2 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 1.6 | 12.9 | GO:0048102 | autophagic cell death(GO:0048102) |
| 1.6 | 6.4 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 1.6 | 9.5 | GO:0070384 | Harderian gland development(GO:0070384) |
| 1.6 | 44.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 1.5 | 4.6 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
| 1.5 | 4.6 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 1.5 | 7.7 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 1.5 | 7.6 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 1.5 | 12.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 1.5 | 4.5 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 1.5 | 12.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.5 | 4.5 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 1.5 | 7.5 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 1.5 | 9.0 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 1.5 | 6.0 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 1.5 | 4.5 | GO:0002588 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 1.5 | 4.5 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 1.5 | 4.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 1.5 | 3.0 | GO:0002159 | desmosome assembly(GO:0002159) |
| 1.5 | 4.4 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 1.5 | 5.9 | GO:0001927 | exocyst assembly(GO:0001927) |
| 1.5 | 5.9 | GO:0035625 | epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 1.5 | 20.6 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 1.5 | 8.8 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 1.5 | 8.8 | GO:0007296 | vitellogenesis(GO:0007296) |
| 1.5 | 1.5 | GO:0070836 | caveola assembly(GO:0070836) |
| 1.5 | 17.5 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 1.5 | 8.7 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 1.4 | 10.1 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 1.4 | 4.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.4 | 7.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 1.4 | 6.9 | GO:0030035 | microspike assembly(GO:0030035) |
| 1.4 | 2.8 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 1.4 | 5.5 | GO:0075528 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 1.4 | 5.5 | GO:0031456 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 1.4 | 4.1 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 1.4 | 5.5 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 1.4 | 4.1 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 1.4 | 5.4 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 1.3 | 2.7 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 1.3 | 1.3 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 1.3 | 11.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 1.3 | 3.9 | GO:0042946 | glucoside transport(GO:0042946) |
| 1.3 | 5.2 | GO:0002934 | desmosome organization(GO:0002934) |
| 1.3 | 19.3 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 1.3 | 3.8 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 1.3 | 3.8 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 1.3 | 5.1 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 1.3 | 5.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 1.3 | 10.2 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 1.3 | 3.8 | GO:0052047 | interaction with other organism via secreted substance involved in symbiotic interaction(GO:0052047) |
| 1.3 | 5.1 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 1.3 | 15.2 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 1.3 | 10.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 1.3 | 7.6 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 1.3 | 3.8 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.2 | 6.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 1.2 | 3.7 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 1.2 | 2.5 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 1.2 | 3.7 | GO:0035425 | autocrine signaling(GO:0035425) |
| 1.2 | 3.7 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 1.2 | 6.1 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 1.2 | 7.3 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 1.2 | 20.6 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 1.2 | 4.8 | GO:0090135 | actin filament branching(GO:0090135) |
| 1.2 | 7.2 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 1.2 | 4.8 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 1.2 | 22.7 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 1.2 | 4.8 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 1.2 | 13.1 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 1.2 | 3.6 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 1.2 | 1.2 | GO:0042747 | circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 1.2 | 2.4 | GO:0042418 | epinephrine biosynthetic process(GO:0042418) |
| 1.2 | 1.2 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 1.2 | 5.9 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 1.2 | 2.3 | GO:0098923 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 1.2 | 7.0 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 1.2 | 3.5 | GO:0060032 | notochord regression(GO:0060032) |
| 1.2 | 2.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 1.2 | 3.5 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 1.2 | 1.2 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 1.2 | 12.7 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 1.1 | 10.3 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
| 1.1 | 6.8 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 1.1 | 9.0 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 1.1 | 5.7 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 1.1 | 3.4 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 1.1 | 7.9 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 1.1 | 3.3 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 1.1 | 3.3 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 1.1 | 2.2 | GO:0014028 | notochord formation(GO:0014028) |
| 1.1 | 5.5 | GO:0009082 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 1.1 | 4.4 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 1.1 | 12.0 | GO:0045176 | apical protein localization(GO:0045176) |
| 1.1 | 4.3 | GO:0042377 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 1.1 | 3.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 1.1 | 3.3 | GO:0033078 | extrathymic T cell differentiation(GO:0033078) |
| 1.1 | 1.1 | GO:1902823 | negative regulation of late endosome to lysosome transport(GO:1902823) |
| 1.1 | 1.1 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 1.1 | 7.5 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 1.1 | 23.5 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 1.1 | 6.4 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 1.1 | 3.2 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 1.0 | 4.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 1.0 | 3.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 1.0 | 3.1 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 1.0 | 1.0 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 1.0 | 1.0 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 1.0 | 4.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 1.0 | 10.3 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 1.0 | 2.1 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 1.0 | 1.0 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 1.0 | 9.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 1.0 | 23.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 1.0 | 5.1 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 1.0 | 2.0 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 1.0 | 24.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 1.0 | 3.0 | GO:0043465 | fermentation(GO:0006113) regulation of fermentation(GO:0043465) |
| 1.0 | 4.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 1.0 | 9.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 1.0 | 4.0 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 1.0 | 6.0 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 1.0 | 5.0 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 1.0 | 27.6 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 1.0 | 3.9 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 1.0 | 6.9 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 1.0 | 2.9 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 1.0 | 3.9 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 1.0 | 1.0 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 1.0 | 7.8 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.0 | 1.0 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
| 1.0 | 3.9 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 1.0 | 8.7 | GO:0046836 | glycolipid transport(GO:0046836) |
| 1.0 | 6.7 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
| 1.0 | 8.6 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 1.0 | 5.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 1.0 | 2.9 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 1.0 | 3.8 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.9 | 38.0 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.9 | 13.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.9 | 9.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.9 | 6.6 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.9 | 4.7 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.9 | 2.8 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.9 | 6.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.9 | 0.9 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.9 | 3.7 | GO:0042335 | cuticle development(GO:0042335) |
| 0.9 | 14.9 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.9 | 15.9 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.9 | 4.7 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.9 | 2.8 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.9 | 0.9 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.9 | 2.8 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.9 | 0.9 | GO:0032105 | negative regulation of response to extracellular stimulus(GO:0032105) negative regulation of response to nutrient levels(GO:0032108) |
| 0.9 | 12.0 | GO:0009629 | response to gravity(GO:0009629) |
| 0.9 | 5.5 | GO:0031337 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.9 | 9.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.9 | 5.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.9 | 1.8 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.9 | 9.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.9 | 2.7 | GO:0038158 | granulocyte colony-stimulating factor signaling pathway(GO:0038158) |
| 0.9 | 16.4 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.9 | 16.4 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.9 | 19.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.9 | 1.8 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.9 | 10.8 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.9 | 0.9 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.9 | 13.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.9 | 0.9 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.9 | 6.1 | GO:0030421 | defecation(GO:0030421) |
| 0.9 | 2.6 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.9 | 7.8 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.9 | 4.4 | GO:0003383 | apical constriction(GO:0003383) |
| 0.9 | 5.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.9 | 2.6 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.9 | 18.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.9 | 9.5 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.9 | 1.7 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.9 | 7.8 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.9 | 2.6 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.9 | 4.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.9 | 10.3 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.9 | 3.4 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.9 | 0.9 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.9 | 4.3 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.9 | 9.4 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.9 | 0.9 | GO:0050666 | regulation of sulfur amino acid metabolic process(GO:0031335) regulation of homocysteine metabolic process(GO:0050666) |
| 0.9 | 4.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.9 | 1.7 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.8 | 3.4 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.8 | 3.3 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.8 | 8.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.8 | 15.0 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.8 | 5.0 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.8 | 14.1 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.8 | 4.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.8 | 2.5 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.8 | 4.9 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.8 | 4.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.8 | 8.2 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) |
| 0.8 | 3.3 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.8 | 4.1 | GO:0042109 | lymphotoxin A production(GO:0032641) lymphotoxin A biosynthetic process(GO:0042109) |
| 0.8 | 4.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.8 | 1.6 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.8 | 0.8 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.8 | 2.4 | GO:0036510 | trimming of terminal mannose on C branch(GO:0036510) |
| 0.8 | 2.4 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.8 | 2.4 | GO:1901073 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.8 | 1.6 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.8 | 2.4 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.8 | 4.0 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.8 | 2.4 | GO:0018395 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.8 | 2.4 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
| 0.8 | 14.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.8 | 5.5 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.8 | 8.5 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.8 | 3.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.8 | 2.3 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.8 | 2.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.8 | 10.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.8 | 2.3 | GO:0070650 | endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.8 | 12.3 | GO:0060022 | hard palate development(GO:0060022) |
| 0.8 | 4.6 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.8 | 0.8 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.8 | 3.0 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.8 | 1.5 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.8 | 0.8 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.8 | 5.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.8 | 1.5 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.7 | 2.2 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.7 | 2.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.7 | 13.4 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.7 | 3.0 | GO:0003290 | atrial septum secundum morphogenesis(GO:0003290) |
| 0.7 | 1.5 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.7 | 12.6 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.7 | 2.9 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.7 | 0.7 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.7 | 2.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.7 | 4.4 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.7 | 2.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.7 | 1.5 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.7 | 3.6 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
| 0.7 | 2.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.7 | 4.3 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.7 | 5.8 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.7 | 2.2 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.7 | 20.3 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.7 | 10.1 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) |
| 0.7 | 2.9 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.7 | 2.2 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.7 | 2.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.7 | 5.8 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.7 | 2.9 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.7 | 2.9 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.7 | 4.3 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.7 | 8.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.7 | 4.9 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.7 | 2.8 | GO:0030047 | actin modification(GO:0030047) |
| 0.7 | 1.4 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.7 | 6.3 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.7 | 2.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.7 | 16.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.7 | 0.7 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.7 | 20.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.7 | 4.9 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.7 | 7.0 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.7 | 4.9 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 0.7 | 2.8 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.7 | 2.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.7 | 2.7 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.7 | 3.4 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.7 | 2.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.7 | 1.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.7 | 1.4 | GO:1905049 | negative regulation of metallopeptidase activity(GO:1905049) |
| 0.7 | 2.0 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.7 | 0.7 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.7 | 2.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.7 | 6.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.7 | 2.0 | GO:0021722 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.7 | 6.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.7 | 6.0 | GO:0046618 | drug export(GO:0046618) |
| 0.7 | 4.0 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.7 | 5.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.7 | 2.0 | GO:2000669 | negative regulation of dendritic cell apoptotic process(GO:2000669) |
| 0.7 | 1.3 | GO:0002543 | activation of blood coagulation via clotting cascade(GO:0002543) |
| 0.7 | 4.0 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.7 | 1.3 | GO:0032499 | detection of peptidoglycan(GO:0032499) |
| 0.7 | 0.7 | GO:0071306 | cellular response to vitamin E(GO:0071306) |
| 0.7 | 3.3 | GO:1990426 | homologous recombination-dependent replication fork processing(GO:1990426) |
| 0.7 | 3.9 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.7 | 9.2 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.7 | 8.5 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.7 | 1.3 | GO:0060699 | regulation of endoribonuclease activity(GO:0060699) |
| 0.7 | 0.7 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.7 | 5.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.6 | 3.9 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.6 | 1.9 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.6 | 19.5 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.6 | 3.9 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.6 | 13.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.6 | 5.2 | GO:0010713 | negative regulation of collagen metabolic process(GO:0010713) |
| 0.6 | 0.6 | GO:0006565 | L-serine catabolic process(GO:0006565) |
| 0.6 | 25.1 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.6 | 0.6 | GO:0044335 | canonical Wnt signaling pathway involved in neural crest cell differentiation(GO:0044335) |
| 0.6 | 2.6 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.6 | 3.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.6 | 1.3 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.6 | 3.8 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.6 | 1.3 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.6 | 2.5 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.6 | 3.8 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.6 | 1.9 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.6 | 3.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.6 | 20.8 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.6 | 1.9 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.6 | 1.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.6 | 0.6 | GO:0060264 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.6 | 1.9 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.6 | 9.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.6 | 1.9 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.6 | 4.3 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
| 0.6 | 6.8 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.6 | 2.5 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.6 | 1.9 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.6 | 1.8 | GO:1904603 | regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904596) negative regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904597) regulation of advanced glycation end-product receptor activity(GO:1904603) negative regulation of advanced glycation end-product receptor activity(GO:1904604) negative regulation of connective tissue replacement(GO:1905204) |
| 0.6 | 1.8 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.6 | 1.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.6 | 3.7 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.6 | 0.6 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.6 | 7.9 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.6 | 1.8 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.6 | 7.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.6 | 9.1 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.6 | 3.0 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.6 | 1.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.6 | 12.7 | GO:0046629 | gamma-delta T cell activation(GO:0046629) |
| 0.6 | 5.4 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.6 | 7.9 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.6 | 10.9 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.6 | 3.0 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.6 | 1.8 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.6 | 3.6 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.6 | 1.8 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.6 | 8.4 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.6 | 2.4 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.6 | 3.6 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.6 | 3.0 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.6 | 0.6 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.6 | 5.3 | GO:0046078 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) dUMP metabolic process(GO:0046078) |
| 0.6 | 2.9 | GO:0015862 | uridine transport(GO:0015862) |
| 0.6 | 65.7 | GO:0070268 | cornification(GO:0070268) |
| 0.6 | 8.8 | GO:0015816 | glycine transport(GO:0015816) |
| 0.6 | 29.2 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.6 | 4.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.6 | 4.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.6 | 5.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.6 | 29.0 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.6 | 9.8 | GO:1904261 | positive regulation of extracellular matrix assembly(GO:1901203) regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.6 | 2.3 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.6 | 0.6 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.6 | 13.3 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.6 | 1.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.6 | 4.0 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.6 | 2.3 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.6 | 10.3 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.6 | 1.7 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.6 | 8.5 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.6 | 2.8 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.6 | 0.6 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.6 | 7.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.6 | 4.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.6 | 15.8 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.6 | 6.8 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.6 | 0.6 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.6 | 0.6 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.6 | 9.5 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.6 | 0.6 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.6 | 3.4 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.6 | 1.7 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.6 | 3.4 | GO:0097384 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) cellular lipid biosynthetic process(GO:0097384) |
| 0.6 | 23.4 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.6 | 7.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.6 | 23.3 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.6 | 15.5 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.6 | 1.7 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.5 | 2.2 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
| 0.5 | 8.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.5 | 23.5 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.5 | 18.0 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.5 | 0.5 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.5 | 1.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.5 | 1.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.5 | 15.2 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.5 | 0.5 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.5 | 2.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.5 | 1.6 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) negative regulation of adrenergic receptor signaling pathway(GO:0071878) |
| 0.5 | 1.1 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.5 | 1.1 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.5 | 3.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.5 | 2.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.5 | 2.1 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.5 | 0.5 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.5 | 1.6 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.5 | 2.7 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.5 | 6.3 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.5 | 2.6 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.5 | 1.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.5 | 4.2 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.5 | 0.5 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.5 | 3.7 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.5 | 2.6 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.5 | 2.6 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.5 | 6.8 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.5 | 5.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.5 | 2.1 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
| 0.5 | 4.6 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) |
| 0.5 | 5.7 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.5 | 1.5 | GO:0030728 | ovulation(GO:0030728) |
| 0.5 | 6.2 | GO:0072595 | maintenance of protein localization in organelle(GO:0072595) |
| 0.5 | 2.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.5 | 1.0 | GO:1904761 | negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.5 | 2.5 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.5 | 1.0 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.5 | 1.5 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.5 | 0.5 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.5 | 1.5 | GO:0051710 | regulation of cytolysis in other organism(GO:0051710) positive regulation of cytolysis in other organism(GO:0051714) |
| 0.5 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.5 | 1.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.5 | 4.0 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
| 0.5 | 5.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.5 | 5.5 | GO:1902572 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.5 | 2.0 | GO:0021622 | oculomotor nerve development(GO:0021557) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.5 | 7.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.5 | 4.0 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.5 | 3.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.5 | 1.5 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.5 | 2.0 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.5 | 1.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
| 0.5 | 2.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.5 | 3.0 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.5 | 1.5 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.5 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 1.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 | 1.0 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.5 | 1.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.5 | 0.5 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.5 | 1.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.5 | 2.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.5 | 0.5 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.5 | 2.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.5 | 4.8 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.5 | 0.5 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.5 | 0.5 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.5 | 1.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.5 | 1.4 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.5 | 7.6 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.5 | 1.9 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.5 | 4.7 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.5 | 1.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.5 | 1.9 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.5 | 3.3 | GO:0003360 | brainstem development(GO:0003360) |
| 0.5 | 1.4 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.5 | 1.4 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.5 | 1.4 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 | 2.3 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.5 | 9.3 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.5 | 0.5 | GO:0042534 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.5 | 1.4 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.5 | 5.6 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.5 | 1.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.5 | 0.9 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.5 | 0.5 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.5 | 0.9 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
| 0.5 | 0.9 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
| 0.5 | 0.5 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.5 | 0.5 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.5 | 0.9 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.5 | 0.5 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.5 | 1.8 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 0.5 | 0.5 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.5 | 1.4 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.4 | 2.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.4 | 4.0 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.4 | 0.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.4 | 3.1 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.4 | 1.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.4 | 2.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.4 | 2.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.4 | 2.6 | GO:0060356 | leucine import(GO:0060356) |
| 0.4 | 0.9 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.4 | 1.8 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.4 | 4.8 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.4 | 1.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.4 | 26.2 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.4 | 0.9 | GO:0035854 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.4 | 7.4 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.4 | 0.9 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.4 | 2.2 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.4 | 1.7 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.4 | 2.6 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.4 | 3.8 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.4 | 0.4 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.4 | 1.7 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.4 | 1.7 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.4 | 1.7 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
| 0.4 | 2.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.4 | 0.8 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.4 | 0.8 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.4 | 1.2 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.4 | 0.8 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.4 | 7.0 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.4 | 1.2 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.4 | 0.8 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.4 | 4.9 | GO:0072235 | distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
| 0.4 | 1.2 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.4 | 4.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.4 | 1.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.4 | 3.6 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.4 | 8.1 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.4 | 2.8 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) |
| 0.4 | 13.3 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.4 | 3.6 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.4 | 4.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.4 | 22.4 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) |
| 0.4 | 3.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.4 | 2.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.4 | 17.5 | GO:1901998 | toxin transport(GO:1901998) |
| 0.4 | 1.6 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.4 | 3.6 | GO:0002544 | chronic inflammatory response(GO:0002544) |
| 0.4 | 9.9 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.4 | 0.4 | GO:0001946 | lymphangiogenesis(GO:0001946) |
| 0.4 | 1.2 | GO:1901874 | negative regulation of post-translational protein modification(GO:1901874) |
| 0.4 | 1.2 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.4 | 0.8 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.4 | 0.8 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.4 | 1.2 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.4 | 4.7 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.4 | 1.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.4 | 1.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.4 | 0.8 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.4 | 4.3 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.4 | 4.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.4 | 2.3 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.4 | 1.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.4 | 1.6 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.4 | 4.7 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.4 | 4.2 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.4 | 0.8 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.4 | 4.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.4 | 3.4 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.4 | 1.1 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.4 | 1.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.4 | 1.9 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.4 | 3.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.4 | 0.8 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.4 | 4.9 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.4 | 3.8 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.4 | 1.9 | GO:0007343 | egg activation(GO:0007343) |
| 0.4 | 4.2 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.4 | 1.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.4 | 1.9 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.4 | 0.8 | GO:0007314 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.4 | 0.7 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.4 | 4.9 | GO:2000404 | regulation of T cell migration(GO:2000404) |
| 0.4 | 1.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 | 3.7 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
| 0.4 | 1.1 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
| 0.4 | 2.6 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.4 | 9.7 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.4 | 1.1 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.4 | 0.4 | GO:0051940 | regulation of dopamine uptake involved in synaptic transmission(GO:0051584) regulation of catecholamine uptake involved in synaptic transmission(GO:0051940) |
| 0.4 | 2.2 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.4 | 1.5 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.4 | 1.1 | GO:0009407 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.4 | 30.9 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.4 | 7.3 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.4 | 0.4 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.4 | 0.7 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.4 | 1.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.4 | 2.9 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.4 | 11.7 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.4 | 5.5 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.4 | 4.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.4 | 6.9 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.4 | 5.8 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.4 | 3.2 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.4 | 0.4 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.4 | 2.2 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.4 | 0.7 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.4 | 7.9 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.4 | 1.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.4 | 1.4 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.4 | 0.7 | GO:0045110 | neurofilament bundle assembly(GO:0033693) intermediate filament bundle assembly(GO:0045110) |
| 0.4 | 3.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.4 | 1.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.4 | 6.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.4 | 0.4 | GO:0010193 | response to ozone(GO:0010193) |
| 0.4 | 0.4 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.4 | 1.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.4 | 1.1 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.4 | 0.4 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
| 0.4 | 2.1 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.4 | 1.8 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.4 | 0.4 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.4 | 3.2 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.4 | 0.7 | GO:0030806 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.4 | 3.2 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.4 | 2.5 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.4 | 1.4 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
| 0.4 | 3.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.4 | 1.1 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 | 1.7 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.3 | 7.0 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.3 | 7.7 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.3 | 1.4 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.3 | 5.9 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.3 | 5.6 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.3 | 1.0 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
| 0.3 | 1.0 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.3 | 2.4 | GO:1902590 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.3 | 1.7 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.3 | 4.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.3 | 2.1 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.3 | 0.3 | GO:0048749 | compound eye development(GO:0048749) |
| 0.3 | 2.4 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.3 | 3.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.3 | 4.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.3 | 5.1 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
| 0.3 | 4.4 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.3 | 0.7 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.3 | 3.7 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.3 | 0.3 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.3 | 2.7 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.3 | 1.0 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.3 | 3.4 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.3 | 3.4 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.3 | 4.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.3 | 1.0 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.3 | 2.0 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.3 | 1.3 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.3 | 4.7 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.3 | 0.7 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.3 | 3.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.3 | 1.7 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.3 | 4.0 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.3 | 0.3 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.3 | 3.6 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.3 | 4.3 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.3 | 1.6 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.3 | 1.0 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.3 | 0.7 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.3 | 1.3 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.3 | 1.0 | GO:0015847 | putrescine transport(GO:0015847) |
| 0.3 | 0.3 | GO:0030221 | basophil differentiation(GO:0030221) |
| 0.3 | 3.3 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.3 | 1.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.3 | 3.6 | GO:0042304 | regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.3 | 1.3 | GO:1903286 | regulation of potassium ion import(GO:1903286) |
| 0.3 | 2.3 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.3 | 1.6 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 | 1.6 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.3 | 3.9 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.3 | 4.8 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.3 | 1.0 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.3 | 3.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.3 | 1.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.3 | 1.6 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.3 | 7.7 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
| 0.3 | 4.1 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.3 | 1.3 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.3 | 0.6 | GO:0071626 | mastication(GO:0071626) learned vocalization behavior(GO:0098583) |
| 0.3 | 1.9 | GO:2000852 | regulation of corticosterone secretion(GO:2000852) |
| 0.3 | 4.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.3 | 8.5 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.3 | 2.8 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.3 | 1.3 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.3 | 1.6 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.3 | 2.2 | GO:0032196 | transposition(GO:0032196) |
| 0.3 | 2.5 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.3 | 0.3 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.3 | 2.8 | GO:0051904 | pigment granule transport(GO:0051904) |
| 0.3 | 15.0 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.3 | 0.6 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.3 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.3 | 0.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.3 | 0.6 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.3 | 0.6 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.3 | 2.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.3 | 1.5 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.3 | 0.3 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.3 | 1.5 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.3 | 1.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.3 | 1.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.3 | 0.3 | GO:1902164 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.3 | 2.4 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.3 | 6.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.3 | 3.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.3 | 1.2 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.3 | 0.3 | GO:0050720 | interleukin-1 biosynthetic process(GO:0042222) interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.3 | 0.6 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.3 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.3 | 0.6 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.3 | 1.8 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
| 0.3 | 1.2 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.3 | 3.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 | 2.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.3 | 1.8 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.3 | 0.9 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.3 | 0.3 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.3 | 2.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.3 | 0.3 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.3 | 5.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.3 | 1.2 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
| 0.3 | 0.6 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.3 | 18.4 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.3 | 1.2 | GO:2000434 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 | 1.2 | GO:0002268 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.3 | 0.6 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.3 | 2.1 | GO:0010458 | exit from mitosis(GO:0010458) |
| 0.3 | 1.8 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.3 | 2.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.3 | 0.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.3 | 2.4 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.3 | 0.6 | GO:0090177 | establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.3 | 5.9 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.3 | 1.8 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.3 | 1.5 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.3 | 0.9 | GO:0035573 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.3 | 4.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.3 | 3.2 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.3 | 0.6 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.3 | 0.3 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.3 | 1.4 | GO:0007512 | adult heart development(GO:0007512) |
| 0.3 | 1.4 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 | 0.9 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.3 | 1.1 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
| 0.3 | 2.3 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.3 | 0.6 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.3 | 0.9 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.3 | 1.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.3 | 4.3 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.3 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 | 0.9 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.3 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.3 | 0.6 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.3 | 0.3 | GO:0019068 | virion assembly(GO:0019068) |
| 0.3 | 1.4 | GO:1901907 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.3 | 1.1 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.3 | 2.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.3 | 0.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.3 | 1.4 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.3 | 1.4 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.3 | 7.0 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.3 | 1.4 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.3 | 5.0 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.3 | 2.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.3 | 1.1 | GO:0044108 | calcitriol biosynthetic process from calciol(GO:0036378) cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.3 | 0.8 | GO:0014810 | positive regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014810) |
| 0.3 | 1.1 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.3 | 0.6 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.3 | 1.9 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.3 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.3 | 10.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 | 0.5 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.3 | 3.2 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.3 | 1.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.3 | 12.1 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.3 | 0.5 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.3 | 3.5 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.3 | 1.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.3 | 2.4 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.3 | 1.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.3 | 10.9 | GO:0030042 | actin filament depolymerization(GO:0030042) |
| 0.3 | 0.5 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.3 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.3 | 0.8 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.3 | 2.4 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.3 | 0.3 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.3 | 1.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.3 | 0.8 | GO:0032455 | nerve growth factor processing(GO:0032455) |
| 0.3 | 0.8 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.3 | 2.4 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.3 | 1.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.3 | 4.2 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.3 | 0.5 | GO:0009631 | cold acclimation(GO:0009631) |
| 0.3 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.3 | 3.1 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.3 | 1.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.3 | 3.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.3 | 0.5 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.3 | 0.8 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 | 1.8 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.3 | 0.5 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.3 | 1.0 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.3 | 0.3 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.3 | 3.5 | GO:0032272 | negative regulation of protein polymerization(GO:0032272) |
| 0.3 | 1.5 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.3 | 1.0 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.3 | 0.3 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.3 | 1.8 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.3 | 2.8 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.2 | 1.5 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.2 | 0.7 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.2 | 0.7 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.2 | 0.7 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.2 | 0.5 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.2 | 2.0 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.2 | 0.5 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.2 | 1.0 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.2 | 0.2 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.2 | 5.6 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.2 | 1.9 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.2 | 3.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.2 | 16.5 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.2 | 6.0 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.2 | 0.2 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.2 | 3.8 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.2 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.2 | 1.0 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 | 1.4 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.2 | 0.9 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.2 | 13.2 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.2 | 0.7 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.2 | 0.7 | GO:0030578 | PML body organization(GO:0030578) |
| 0.2 | 1.2 | GO:0060068 | vagina development(GO:0060068) |
| 0.2 | 2.8 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.2 | 0.7 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.2 | 9.2 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.2 | 0.9 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.2 | 3.5 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.2 | 1.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.2 | 1.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.2 | 1.6 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.2 | 0.2 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.2 | 8.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 | 0.7 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.2 | 2.3 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.2 | 2.1 | GO:0030903 | notochord development(GO:0030903) |
| 0.2 | 2.5 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.2 | 4.8 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.2 | 1.8 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 | 2.3 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.2 | 0.7 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.2 | 0.7 | GO:1903259 | exon-exon junction complex disassembly(GO:1903259) |
| 0.2 | 0.7 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.2 | 0.7 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 4.7 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.2 | 0.9 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 | 0.7 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.2 | 3.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.2 | 11.0 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.2 | 0.9 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.2 | 0.4 | GO:0071504 | cellular response to heparin(GO:0071504) |
| 0.2 | 0.7 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.2 | 2.8 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.2 | 3.5 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.2 | 1.5 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 | 1.7 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.2 | 3.1 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
| 0.2 | 11.5 | GO:0042058 | regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.2 | 1.1 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.2 | 0.7 | GO:0071206 | establishment of protein localization to juxtaparanode region of axon(GO:0071206) |
| 0.2 | 0.7 | GO:0048560 | establishment of anatomical structure orientation(GO:0048560) |
| 0.2 | 3.9 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.2 | 0.4 | GO:0032275 | luteinizing hormone secretion(GO:0032275) |
| 0.2 | 1.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 | 0.4 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 | 12.3 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.2 | 0.6 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.2 | 1.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.2 | 0.6 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.2 | 1.3 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.2 | 0.9 | GO:1903935 | response to sodium arsenite(GO:1903935) |
| 0.2 | 0.6 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.2 | 0.9 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 | 17.9 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.2 | 0.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.2 | 0.6 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.2 | 0.2 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.2 | 0.6 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.2 | 4.0 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.2 | 5.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.2 | 0.6 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) positive regulation of oocyte development(GO:0060282) |
| 0.2 | 0.6 | GO:0045072 | regulation of interferon-gamma biosynthetic process(GO:0045072) |
| 0.2 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.2 | 1.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 | 0.2 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.2 | 0.2 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 | 2.7 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.2 | 0.8 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.2 | 0.4 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.2 | 5.2 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.2 | 1.4 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.2 | 1.6 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.2 | 1.4 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.2 | 1.6 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
| 0.2 | 2.9 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.2 | 0.6 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 | 2.0 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 | 0.6 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 | 0.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 1.2 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.2 | 6.6 | GO:2000816 | negative regulation of mitotic sister chromatid separation(GO:2000816) |
| 0.2 | 0.8 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.2 | 0.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 1.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 2.0 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 | 1.6 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.2 | 5.9 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.2 | 1.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.2 | 3.6 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.2 | 4.1 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.2 | 1.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.2 | 1.2 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.2 | 0.6 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.2 | 0.8 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.2 | 2.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.2 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 1.2 | GO:0097319 | fructose transport(GO:0015755) fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.2 | 0.6 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.2 | 1.0 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.2 | 2.3 | GO:0097118 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.2 | 5.0 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.2 | 1.3 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 1.7 | GO:0007189 | adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.2 | 0.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.2 | 1.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.2 | 0.6 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.2 | 1.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.2 | 1.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 0.9 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.2 | 0.9 | GO:0033622 | integrin activation(GO:0033622) |
| 0.2 | 0.7 | GO:0036102 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.2 | 5.5 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.2 | 0.4 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.2 | 1.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 | 0.7 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.5 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.2 | 1.1 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
| 0.2 | 3.8 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.2 | 6.1 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.2 | 1.4 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.2 | 0.7 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 0.7 | GO:1901563 | cellular response to camptothecin(GO:0072757) response to camptothecin(GO:1901563) |
| 0.2 | 0.7 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.2 | 0.5 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.2 | 0.9 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.2 | 1.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.2 | 2.1 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.2 | 2.0 | GO:0001941 | postsynaptic membrane organization(GO:0001941) |
| 0.2 | 1.4 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.2 | 4.1 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.2 | 4.8 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.2 | 6.2 | GO:0070192 | chromosome organization involved in meiotic cell cycle(GO:0070192) |
| 0.2 | 1.2 | GO:0035878 | nail development(GO:0035878) |
| 0.2 | 1.9 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.2 | 4.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.2 | 7.7 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.2 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.2 | 1.6 | GO:0007207 | phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.2 | 1.9 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.2 | 0.5 | GO:0002818 | intracellular defense response(GO:0002818) |
| 0.2 | 5.0 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.2 | 1.2 | GO:2000846 | regulation of corticosteroid hormone secretion(GO:2000846) positive regulation of corticosteroid hormone secretion(GO:2000848) positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 | 2.4 | GO:0090520 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.2 | 2.7 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.2 | 0.9 | GO:1902074 | response to salt(GO:1902074) |
| 0.2 | 0.3 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.2 | 0.5 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.2 | 1.4 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.2 | 1.9 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.2 | 0.3 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.2 | 0.3 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.2 | 1.3 | GO:0050703 | interleukin-1 alpha production(GO:0032610) interleukin-1 alpha secretion(GO:0050703) |
| 0.2 | 8.4 | GO:0009301 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.2 | 0.7 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.2 | 0.5 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.2 | 1.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.2 | 0.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.2 | 0.2 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.2 | 2.2 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.2 | 4.3 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.2 | 1.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 | 1.0 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) |
| 0.2 | 2.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.2 | 0.3 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.2 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 | 0.2 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.2 | 0.2 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.2 | 0.5 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.2 | 2.9 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.2 | 0.2 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.2 | 0.2 | GO:2000665 | interleukin-13 secretion(GO:0072611) regulation of interleukin-13 secretion(GO:2000665) |
| 0.2 | 1.8 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.2 | 0.6 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.2 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.2 | 1.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 0.3 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.2 | 0.5 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.2 | 7.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.2 | 2.4 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.2 | 0.8 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 0.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 1.3 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.2 | 1.3 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.2 | 0.2 | GO:1990569 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.2 | 0.3 | GO:0001993 | regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) |
| 0.2 | 0.6 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.2 | 0.3 | GO:0009750 | response to sucrose(GO:0009744) response to fructose(GO:0009750) response to disaccharide(GO:0034285) |
| 0.2 | 0.9 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 0.2 | 1.2 | GO:0048569 | post-embryonic organ development(GO:0048569) |
| 0.2 | 0.8 | GO:0001825 | blastocyst formation(GO:0001825) |
| 0.2 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.2 | 0.3 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.2 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.2 | 1.1 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.2 | 2.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.2 | 0.2 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.2 | 1.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.2 | 4.9 | GO:0007032 | endosome organization(GO:0007032) |
| 0.2 | 0.5 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.2 | 0.9 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 2.4 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.2 | 0.8 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 | 0.2 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.2 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.2 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.2 | 0.5 | GO:0032759 | TRAIL production(GO:0032639) regulation of TRAIL production(GO:0032679) positive regulation of TRAIL production(GO:0032759) TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.1 | 0.3 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 | 0.4 | GO:0035048 | splicing factor protein import into nucleus(GO:0035048) |
| 0.1 | 0.1 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 3.2 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.1 | 1.0 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 2.3 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 1.5 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.1 | 0.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 1.0 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 | 0.1 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.1 | 0.3 | GO:0098759 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.1 | 0.6 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 1.4 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 1.7 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.1 | 2.4 | GO:0000271 | polysaccharide biosynthetic process(GO:0000271) |
| 0.1 | 0.4 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.1 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.1 | 0.1 | GO:0090134 | mesendoderm migration(GO:0090133) cell migration involved in mesendoderm migration(GO:0090134) |
| 0.1 | 0.7 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.8 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.1 | 0.6 | GO:0032595 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.1 | 1.5 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 0.4 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.1 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.1 | 0.7 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 0.3 | GO:0021764 | amygdala development(GO:0021764) |
| 0.1 | 1.8 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.5 | GO:0042310 | vasoconstriction(GO:0042310) |
| 0.1 | 0.1 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.1 | 0.4 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 2.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.1 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 3.6 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 1.9 | GO:0071731 | response to nitric oxide(GO:0071731) cellular response to nitric oxide(GO:0071732) |
| 0.1 | 2.4 | GO:0019835 | cytolysis(GO:0019835) |
| 0.1 | 0.7 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 1.1 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 1.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.9 | GO:0045132 | meiotic chromosome segregation(GO:0045132) |
| 0.1 | 1.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 1.2 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.1 | 2.3 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 | 0.3 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 | 1.8 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.1 | 0.5 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 | 1.3 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.8 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 | 0.6 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 3.0 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.8 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.4 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 | 0.1 | GO:0097531 | mast cell migration(GO:0097531) |
| 0.1 | 4.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.1 | 0.7 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.1 | 0.5 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 | 1.0 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 1.4 | GO:0015837 | amine transport(GO:0015837) |
| 0.1 | 0.7 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.1 | 0.5 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.1 | 0.6 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 1.0 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.2 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 | 0.6 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 | 1.3 | GO:0045104 | intermediate filament cytoskeleton organization(GO:0045104) |
| 0.1 | 0.5 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 | 1.8 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 | 0.2 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 1.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.1 | 1.4 | GO:0009650 | UV protection(GO:0009650) |
| 0.1 | 0.2 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.1 | 0.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 | 0.5 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.1 | 0.8 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.1 | 1.4 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 1.3 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.1 | 0.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.9 | GO:0071711 | basement membrane organization(GO:0071711) |
| 0.1 | 1.4 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
| 0.1 | 0.7 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.1 | 0.2 | GO:0042426 | choline catabolic process(GO:0042426) |
| 0.1 | 0.7 | GO:0042436 | tryptophan catabolic process(GO:0006569) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 2.6 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.1 | 0.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.1 | 1.5 | GO:0097435 | fibril organization(GO:0097435) |
| 0.1 | 1.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.9 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 0.1 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.1 | 0.3 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.1 | 1.3 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.1 | 6.2 | GO:2000117 | negative regulation of cysteine-type endopeptidase activity(GO:2000117) |
| 0.1 | 0.2 | GO:0032369 | negative regulation of lipid transport(GO:0032369) |
| 0.1 | 0.3 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 | 0.5 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.1 | GO:0010888 | negative regulation of lipid storage(GO:0010888) |
| 0.1 | 0.4 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.4 | GO:0060324 | face development(GO:0060324) |
| 0.1 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.3 | GO:0051125 | regulation of actin nucleation(GO:0051125) |
| 0.1 | 0.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.5 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.1 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
| 0.1 | 0.5 | GO:0070977 | bone maturation(GO:0070977) |
| 0.1 | 4.5 | GO:0003254 | regulation of membrane depolarization(GO:0003254) |
| 0.1 | 0.3 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 2.0 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.1 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.5 | GO:0052150 | modulation by symbiont of host apoptotic process(GO:0052150) |
| 0.1 | 1.3 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 1.3 | GO:0097581 | lamellipodium organization(GO:0097581) |
| 0.1 | 0.9 | GO:0060065 | uterus development(GO:0060065) |
| 0.1 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.1 | 0.4 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 0.3 | GO:0050432 | catecholamine secretion(GO:0050432) |
| 0.1 | 1.4 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 | 12.8 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 0.3 | GO:0055011 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 0.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.1 | 0.2 | GO:1900225 | regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
| 0.1 | 3.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 1.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 1.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.5 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.1 | 0.6 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.3 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.1 | 0.6 | GO:0031113 | regulation of microtubule polymerization(GO:0031113) |
| 0.1 | 0.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.1 | 1.6 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.1 | 0.6 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
| 0.1 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.1 | 0.4 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
| 0.1 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.5 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 1.7 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.1 | 0.3 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.1 | 1.1 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 3.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.3 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 2.6 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.1 | 1.4 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 | 0.3 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.3 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.4 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.4 | GO:0060405 | regulation of penile erection(GO:0060405) |
| 0.1 | 0.5 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.2 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.1 | 0.3 | GO:0043606 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.1 | 1.2 | GO:0033574 | response to testosterone(GO:0033574) |
| 0.1 | 1.1 | GO:0006833 | water transport(GO:0006833) |
| 0.1 | 1.0 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.1 | 0.1 | GO:1904429 | regulation of t-circle formation(GO:1904429) |
| 0.1 | 0.7 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.1 | 0.2 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
| 0.1 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 0.7 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.1 | 3.1 | GO:0006939 | smooth muscle contraction(GO:0006939) |
| 0.1 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.2 | GO:0048753 | pigment granule organization(GO:0048753) |
| 0.1 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.2 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) positive regulation of white fat cell proliferation(GO:0070352) |
| 0.1 | 1.4 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.1 | 0.5 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 0.3 | GO:0051883 | killing of cells in other organism involved in symbiotic interaction(GO:0051883) |
| 0.1 | 1.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.1 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 1.0 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.5 | GO:1900115 | extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
| 0.1 | 0.3 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 | 0.2 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.1 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 3.0 | GO:0001523 | retinoid metabolic process(GO:0001523) |
| 0.1 | 0.4 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 | 1.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 0.6 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.1 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.1 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.2 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 0.2 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.1 | 33.8 | GO:0007264 | small GTPase mediated signal transduction(GO:0007264) |
| 0.1 | 2.7 | GO:0043647 | inositol phosphate metabolic process(GO:0043647) |
| 0.1 | 1.1 | GO:1901685 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.1 | 0.3 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.1 | 0.1 | GO:0014911 | positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.1 | 0.1 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.1 | 0.1 | GO:1903015 | regulation of exo-alpha-sialidase activity(GO:1903015) |
| 0.1 | 0.3 | GO:0001912 | positive regulation of leukocyte mediated cytotoxicity(GO:0001912) |
| 0.1 | 0.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.1 | 0.2 | GO:0032341 | aldosterone metabolic process(GO:0032341) aldosterone biosynthetic process(GO:0032342) |
| 0.1 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.1 | 0.3 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 0.1 | GO:0002775 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| 0.1 | 0.2 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.1 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.1 | 0.6 | GO:0033198 | response to ATP(GO:0033198) |
| 0.1 | 0.8 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
| 0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.1 | 0.1 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.1 | 0.3 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.1 | 0.3 | GO:0050951 | sensory perception of temperature stimulus(GO:0050951) |
| 0.1 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.1 | 0.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
| 0.1 | 0.2 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.1 | 0.1 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.1 | 0.3 | GO:0052697 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.1 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.3 | GO:0030730 | sequestering of triglyceride(GO:0030730) |
| 0.1 | 0.8 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.1 | 0.2 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 0.3 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.1 | 0.3 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.2 | GO:0048535 | lymph node development(GO:0048535) |
| 0.1 | 1.0 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.1 | 1.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.5 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.1 | 0.1 | GO:0002604 | regulation of dendritic cell antigen processing and presentation(GO:0002604) |
| 0.0 | 0.1 | GO:0001207 | histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.0 | 0.7 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.0 | 0.6 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.0 | 0.2 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.6 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 0.0 | 0.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 0.0 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.4 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.4 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 | 0.1 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 | 0.1 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
| 0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.1 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.1 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.2 | GO:0043300 | regulation of leukocyte degranulation(GO:0043300) |
| 0.0 | 0.0 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.0 | 0.4 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.0 | 0.8 | GO:0097553 | calcium ion transmembrane import into cytosol(GO:0097553) calcium ion import into cytosol(GO:1902656) |
| 0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.0 | 0.5 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.1 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.0 | 0.0 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.0 | 0.2 | GO:0008050 | courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
| 0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0043605 | cellular amide catabolic process(GO:0043605) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 1.2 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
| 0.0 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.0 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.0 | 0.1 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.5 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.2 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.0 | 0.1 | GO:0030431 | sleep(GO:0030431) |
| 0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.1 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 | 0.1 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
| 0.0 | 0.1 | GO:0051597 | response to methylmercury(GO:0051597) |
| 0.0 | 0.0 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:0070378 | positive regulation of ERK5 cascade(GO:0070378) |
| 0.0 | 0.0 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.0 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 | 0.8 | GO:0030010 | establishment of cell polarity(GO:0030010) |
| 0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.1 | GO:0033688 | regulation of osteoblast proliferation(GO:0033688) |
| 0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.0 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.0 | 0.3 | GO:1903845 | negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 0.0 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.0 | 1.4 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.0 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to stimulus involved in regulation of muscle adaptation(GO:0014874) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.1 | GO:1902224 | cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
| 0.0 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.5 | 52.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 4.8 | 23.9 | GO:0031523 | Myb complex(GO:0031523) |
| 4.3 | 21.3 | GO:0032449 | CBM complex(GO:0032449) |
| 3.1 | 9.4 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 3.1 | 9.2 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 2.3 | 11.3 | GO:0045160 | myosin I complex(GO:0045160) |
| 2.2 | 13.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 2.1 | 6.4 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 2.1 | 6.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 2.0 | 42.3 | GO:0005861 | troponin complex(GO:0005861) |
| 2.0 | 30.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 1.9 | 7.7 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 1.8 | 5.4 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 1.7 | 8.4 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 1.6 | 8.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 1.6 | 6.4 | GO:1990032 | parallel fiber(GO:1990032) |
| 1.6 | 9.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 1.5 | 9.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 1.5 | 15.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 1.5 | 3.0 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 1.4 | 4.3 | GO:0098855 | HCN channel complex(GO:0098855) |
| 1.4 | 34.7 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 1.4 | 33.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 1.4 | 5.6 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 1.4 | 9.7 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 1.4 | 4.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 1.4 | 5.4 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 1.3 | 4.0 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 1.3 | 7.9 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 1.3 | 9.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 1.3 | 19.2 | GO:0008091 | spectrin(GO:0008091) |
| 1.3 | 30.7 | GO:0030056 | hemidesmosome(GO:0030056) |
| 1.3 | 3.8 | GO:0000805 | X chromosome(GO:0000805) |
| 1.3 | 10.1 | GO:0000796 | condensin complex(GO:0000796) |
| 1.3 | 7.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 1.2 | 4.9 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 1.2 | 3.7 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 1.2 | 4.9 | GO:0097229 | sperm end piece(GO:0097229) |
| 1.2 | 6.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 1.2 | 7.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 1.2 | 3.5 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 1.2 | 6.9 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 1.1 | 3.4 | GO:0043293 | apoptosome(GO:0043293) |
| 1.1 | 10.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 1.1 | 3.4 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 1.1 | 4.4 | GO:0044393 | microspike(GO:0044393) |
| 1.1 | 5.5 | GO:0031528 | microvillus membrane(GO:0031528) |
| 1.1 | 4.4 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 1.1 | 30.7 | GO:0005614 | interstitial matrix(GO:0005614) |
| 1.1 | 9.6 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 1.1 | 4.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 1.1 | 1.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 1.1 | 1.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 1.1 | 5.3 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 1.0 | 5.2 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 1.0 | 4.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 1.0 | 22.2 | GO:0032433 | filopodium tip(GO:0032433) |
| 1.0 | 17.6 | GO:0090543 | Flemming body(GO:0090543) |
| 1.0 | 39.9 | GO:0005921 | gap junction(GO:0005921) |
| 1.0 | 10.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.9 | 4.7 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.9 | 5.6 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.9 | 3.7 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.9 | 0.9 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.9 | 3.6 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.9 | 2.6 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.9 | 3.5 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.9 | 12.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.9 | 3.4 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.9 | 8.6 | GO:0098645 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 0.8 | 10.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.8 | 9.1 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.8 | 0.8 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.8 | 1.6 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.8 | 4.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.8 | 4.1 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.8 | 8.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.8 | 2.4 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.8 | 6.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.8 | 15.7 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.8 | 14.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.8 | 8.6 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.8 | 7.8 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.8 | 7.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.8 | 4.6 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.8 | 2.3 | GO:1905103 | integral component of lysosomal membrane(GO:1905103) |
| 0.8 | 6.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.8 | 3.8 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.8 | 24.9 | GO:0030057 | desmosome(GO:0030057) |
| 0.7 | 9.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.7 | 2.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.7 | 6.6 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.7 | 8.7 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.7 | 2.2 | GO:0033593 | BRCA2-MAGE-D1 complex(GO:0033593) |
| 0.7 | 12.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.7 | 2.8 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.7 | 2.8 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.7 | 3.5 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.7 | 35.0 | GO:0002102 | podosome(GO:0002102) |
| 0.7 | 4.7 | GO:0032021 | NELF complex(GO:0032021) |
| 0.7 | 3.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.7 | 2.0 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.7 | 4.0 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.7 | 2.0 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.7 | 1.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.7 | 3.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.7 | 14.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.6 | 1.9 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.6 | 5.1 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.6 | 4.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.6 | 1.3 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.6 | 58.3 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.6 | 1.9 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.6 | 0.6 | GO:0071942 | XPC complex(GO:0071942) |
| 0.6 | 5.5 | GO:0043219 | lateral loop(GO:0043219) |
| 0.6 | 7.9 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.6 | 4.8 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.6 | 10.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.6 | 2.4 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.6 | 2.3 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.6 | 4.6 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.6 | 45.5 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.6 | 4.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.6 | 5.7 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.6 | 5.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.6 | 7.2 | GO:0045120 | pronucleus(GO:0045120) |
| 0.6 | 6.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.6 | 5.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.6 | 13.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.5 | 3.3 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.5 | 1.6 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.5 | 2.2 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.5 | 0.5 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.5 | 36.8 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.5 | 5.3 | GO:0051286 | cell tip(GO:0051286) |
| 0.5 | 0.5 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.5 | 2.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.5 | 10.1 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.5 | 4.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.5 | 2.1 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.5 | 2.6 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.5 | 2.1 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.5 | 5.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.5 | 8.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.5 | 15.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.5 | 9.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.5 | 2.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.5 | 1.5 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.5 | 1.5 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.5 | 2.5 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.5 | 2.0 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.5 | 1.5 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.5 | 1.9 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.5 | 33.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.5 | 8.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.5 | 52.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.5 | 9.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.5 | 12.8 | GO:1990752 | microtubule end(GO:1990752) |
| 0.5 | 2.4 | GO:0044308 | axonal spine(GO:0044308) |
| 0.5 | 3.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.5 | 15.6 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.5 | 3.3 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.5 | 1.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.5 | 1.9 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.5 | 4.2 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.5 | 0.9 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.5 | 2.8 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.5 | 38.9 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.5 | 5.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.5 | 5.0 | GO:0005638 | lamin filament(GO:0005638) |
| 0.4 | 3.6 | GO:0032155 | cell division site(GO:0032153) cell division site part(GO:0032155) |
| 0.4 | 2.7 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.4 | 1.8 | GO:1990879 | CST complex(GO:1990879) |
| 0.4 | 14.1 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.4 | 0.4 | GO:0000811 | GINS complex(GO:0000811) |
| 0.4 | 1.7 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.4 | 26.1 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.4 | 3.0 | GO:0000801 | central element(GO:0000801) |
| 0.4 | 2.2 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.4 | 2.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.4 | 3.4 | GO:0032059 | bleb(GO:0032059) |
| 0.4 | 7.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.4 | 7.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.4 | 1.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.4 | 1.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.4 | 5.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.4 | 1.3 | GO:0061200 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.4 | 0.4 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.4 | 1.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.4 | 13.9 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.4 | 3.7 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.4 | 4.9 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.4 | 5.7 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.4 | 20.4 | GO:0030673 | axolemma(GO:0030673) |
| 0.4 | 1.6 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.4 | 0.8 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.4 | 1.6 | GO:0033643 | host cell part(GO:0033643) |
| 0.4 | 3.5 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.4 | 9.7 | GO:0042627 | chylomicron(GO:0042627) |
| 0.4 | 1.9 | GO:0097060 | synaptic membrane(GO:0097060) |
| 0.4 | 3.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.4 | 1.5 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.4 | 6.0 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.4 | 0.4 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.4 | 3.0 | GO:0071546 | pi-body(GO:0071546) |
| 0.4 | 2.2 | GO:0031417 | NatC complex(GO:0031417) |
| 0.4 | 45.1 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.4 | 0.4 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.4 | 8.0 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.4 | 4.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.4 | 2.5 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.4 | 17.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.4 | 2.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.4 | 1.8 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.4 | 5.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.3 | 2.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
| 0.3 | 6.3 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.3 | 3.8 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.3 | 6.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.3 | 0.7 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.3 | 13.0 | GO:0043034 | costamere(GO:0043034) |
| 0.3 | 1.7 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.3 | 13.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.3 | 2.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.3 | 1.0 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.3 | 11.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.3 | 1.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.3 | 2.6 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.6 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.3 | 3.5 | GO:0070449 | elongin complex(GO:0070449) |
| 0.3 | 6.4 | GO:0099738 | cell cortex region(GO:0099738) |
| 0.3 | 0.3 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.3 | 5.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.3 | 3.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.3 | 0.9 | GO:0030137 | COPI-coated vesicle(GO:0030137) COPI-coated vesicle membrane(GO:0030663) |
| 0.3 | 2.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.3 | 4.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.3 | 0.6 | GO:1990742 | microvesicle(GO:1990742) |
| 0.3 | 2.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.3 | 0.9 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.3 | 1.5 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.3 | 2.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.3 | 0.9 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.3 | 23.3 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.3 | 8.5 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.3 | 4.8 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.3 | 0.9 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.3 | 0.6 | GO:0071547 | piP-body(GO:0071547) |
| 0.3 | 1.2 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.3 | 0.9 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 0.3 | 1.5 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.3 | 5.8 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.3 | 0.3 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.3 | 2.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.3 | 9.9 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.3 | 7.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.3 | 1.4 | GO:0043203 | axon hillock(GO:0043203) |
| 0.3 | 24.5 | GO:0005901 | caveola(GO:0005901) |
| 0.3 | 0.8 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.3 | 0.6 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.3 | 1.4 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.3 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.3 | 151.5 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.3 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.3 | 3.7 | GO:0010369 | chromocenter(GO:0010369) |
| 0.3 | 0.8 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.3 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.3 | 5.0 | GO:0000145 | exocyst(GO:0000145) |
| 0.3 | 3.4 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.3 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.3 | 4.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.3 | 0.8 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.3 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.3 | 3.8 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.2 | 29.8 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.2 | 3.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.2 | 1.7 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.2 | 1.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.2 | 1.7 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.2 | 1.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.2 | 1.2 | GO:0035363 | histone locus body(GO:0035363) |
| 0.2 | 2.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.2 | 0.5 | GO:1990462 | omegasome(GO:1990462) |
| 0.2 | 0.7 | GO:0019031 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.2 | 0.7 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.2 | 0.7 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.2 | 4.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.2 | 0.5 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.2 | 23.5 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.2 | 34.4 | GO:0030027 | lamellipodium(GO:0030027) |
| 0.2 | 1.1 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.2 | 19.0 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.2 | 2.4 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.2 | 0.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.2 | 15.6 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.2 | 1.5 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.2 | 5.0 | GO:0046930 | pore complex(GO:0046930) |
| 0.2 | 1.7 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.2 | 20.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.2 | 0.6 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.2 | 1.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.2 | 0.4 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.2 | 0.6 | GO:0043512 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.2 | 0.2 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.2 | 0.8 | GO:0005602 | complement component C1 complex(GO:0005602) |
| 0.2 | 0.4 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
| 0.2 | 8.8 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.2 | 0.6 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.2 | 1.0 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 0.2 | GO:1902710 | GABA receptor complex(GO:1902710) |
| 0.2 | 1.0 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.2 | 0.8 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.2 | 1.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 27.4 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.2 | 27.4 | GO:0001726 | ruffle(GO:0001726) |
| 0.2 | 1.0 | GO:0005749 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.2 | 4.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.2 | 1.9 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 0.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.2 | 0.8 | GO:0031672 | A band(GO:0031672) |
| 0.2 | 0.9 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.2 | 1.9 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 0.9 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.2 | 1.3 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.2 | 7.9 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.2 | 0.9 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.2 | 0.6 | GO:0030894 | replisome(GO:0030894) |
| 0.2 | 0.9 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.2 | 13.9 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.2 | 8.6 | GO:0000922 | spindle pole(GO:0000922) |
| 0.2 | 0.9 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 0.4 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.2 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
| 0.2 | 2.4 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.2 | 8.6 | GO:0005884 | actin filament(GO:0005884) |
| 0.2 | 3.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 0.4 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.2 | 2.7 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 0.7 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 12.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.2 | 4.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.2 | 2.0 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.2 | 0.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.2 | 0.5 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.2 | 3.8 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.2 | 12.8 | GO:0005604 | basement membrane(GO:0005604) |
| 0.2 | 1.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 2.4 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 1.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.2 | 0.8 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.2 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 0.6 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.2 | 2.0 | GO:0000800 | lateral element(GO:0000800) |
| 0.2 | 0.3 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.2 | 11.2 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.2 | 0.9 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.2 | 0.5 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.2 | 8.9 | GO:0045121 | membrane raft(GO:0045121) |
| 0.2 | 1.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 24.5 | GO:0031968 | organelle outer membrane(GO:0031968) |
| 0.1 | 3.7 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 0.3 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.7 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.4 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.1 | 1.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.4 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 8.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 3.1 | GO:0098827 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 13.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 1.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 1.0 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.1 | 0.8 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 9.6 | GO:0031983 | vesicle lumen(GO:0031983) cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
| 0.1 | 0.9 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.4 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 0.1 | 0.4 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 1.3 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 1.4 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 7.5 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.1 | 2.9 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.1 | 0.6 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.3 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.1 | 1.4 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 23.7 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
| 0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.5 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.1 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 1.0 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.4 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 23.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.1 | 1.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 1.4 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 5.0 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 2.0 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 1.1 | GO:0032797 | SMN complex(GO:0032797) |
| 0.1 | 0.3 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 3.9 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 9.5 | GO:0000776 | kinetochore(GO:0000776) |
| 0.1 | 0.3 | GO:0071753 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 0.1 | 8.5 | GO:0034705 | potassium channel complex(GO:0034705) |
| 0.1 | 0.6 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.3 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.1 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.1 | 153.9 | GO:0005615 | extracellular space(GO:0005615) |
| 0.1 | 0.5 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.1 | 1.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.5 | GO:0000243 | commitment complex(GO:0000243) |
| 0.1 | 0.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 3.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 0.6 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 1.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.3 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.1 | 1.3 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.1 | 0.9 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.3 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 1.7 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.1 | 0.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 1.6 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.3 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.1 | 0.5 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 0.1 | 0.4 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 1.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 5.9 | GO:0005938 | cell cortex(GO:0005938) |
| 0.1 | 1.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 1.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 0.7 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 0.7 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 3.0 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 1.4 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.1 | 2.6 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 2.1 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 1.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.4 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.1 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 15.2 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 0.1 | 0.1 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 0.5 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
| 0.1 | 0.7 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 1.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.1 | 1.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 4.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.5 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 2.0 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.1 | 1.2 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 1.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.1 | 0.5 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 4.9 | GO:0044309 | neuron spine(GO:0044309) |
| 0.1 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 1.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 1.4 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.1 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 1.5 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.1 | 1.3 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 6.8 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| 0.0 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 23.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 1.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.5 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 2.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 1.1 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 4.4 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.1 | GO:0097414 | glial cytoplasmic inclusion(GO:0097409) classical Lewy body(GO:0097414) Lewy neurite(GO:0097462) Lewy body corona(GO:1990038) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.0 | 1.3 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.2 | GO:0097450 | astrocyte end-foot(GO:0097450) glial limiting end-foot(GO:0097451) |
| 0.0 | 2.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 1.2 | GO:0042581 | specific granule(GO:0042581) |
| 0.0 | 108.3 | GO:0005829 | cytosol(GO:0005829) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.0 | GO:0044391 | ribosomal subunit(GO:0044391) |
| 0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 4.5 | GO:0009986 | cell surface(GO:0009986) |
| 0.0 | 0.8 | GO:0098794 | postsynapse(GO:0098794) |
| 0.0 | 0.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.4 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 2.0 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.9 | 17.8 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 5.7 | 17.0 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 4.9 | 19.5 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 4.5 | 13.4 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 3.8 | 15.4 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 3.8 | 22.8 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 3.4 | 10.3 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 3.3 | 16.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 3.2 | 44.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 2.9 | 2.9 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 2.7 | 13.7 | GO:0030395 | lactose binding(GO:0030395) |
| 2.7 | 13.4 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 2.6 | 7.9 | GO:0030290 | sphingolipid activator protein activity(GO:0030290) beta-N-acetylgalactosaminidase activity(GO:0032428) |
| 2.6 | 12.9 | GO:0032810 | sterol response element binding(GO:0032810) |
| 2.6 | 2.6 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
| 2.5 | 9.8 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 2.4 | 26.9 | GO:0042731 | PH domain binding(GO:0042731) |
| 2.4 | 9.7 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 2.4 | 12.0 | GO:0004802 | transketolase activity(GO:0004802) |
| 2.3 | 11.7 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 2.3 | 11.4 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 2.3 | 6.8 | GO:0008431 | vitamin E binding(GO:0008431) |
| 2.2 | 8.9 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 2.2 | 15.4 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 2.1 | 8.6 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 2.0 | 10.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 2.0 | 8.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 2.0 | 10.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 2.0 | 6.0 | GO:0080023 | 3R-hydroxyacyl-CoA dehydratase activity(GO:0080023) |
| 2.0 | 8.0 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 2.0 | 21.7 | GO:0034618 | arginine binding(GO:0034618) |
| 2.0 | 23.5 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 1.9 | 5.8 | GO:0070704 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
| 1.9 | 3.8 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 1.9 | 9.4 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 1.9 | 5.6 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 1.9 | 11.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 1.9 | 7.4 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 1.8 | 1.8 | GO:0004031 | aldehyde oxidase activity(GO:0004031) |
| 1.8 | 5.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 1.8 | 5.4 | GO:0004056 | argininosuccinate lyase activity(GO:0004056) |
| 1.8 | 7.2 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 1.8 | 7.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 1.7 | 13.9 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 1.7 | 5.2 | GO:0004639 | phosphoribosylaminoimidazole carboxylase activity(GO:0004638) phosphoribosylaminoimidazolesuccinocarboxamide synthase activity(GO:0004639) |
| 1.7 | 5.1 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 1.7 | 5.1 | GO:0000252 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) sterol-4-alpha-carboxylate 3-dehydrogenase (decarboxylating) activity(GO:0047012) |
| 1.7 | 21.5 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 1.6 | 4.8 | GO:0016419 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 1.6 | 20.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 1.5 | 15.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 1.5 | 7.4 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 1.5 | 7.4 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 1.4 | 8.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 1.4 | 11.4 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 1.4 | 11.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 1.4 | 12.3 | GO:0043426 | MRF binding(GO:0043426) |
| 1.4 | 1.4 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 1.3 | 11.9 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 1.3 | 4.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 1.3 | 4.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 1.3 | 2.6 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 1.3 | 6.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 1.3 | 3.9 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 1.3 | 6.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 1.3 | 5.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 1.3 | 3.9 | GO:0042947 | glucoside transmembrane transporter activity(GO:0042947) |
| 1.3 | 2.6 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 1.3 | 6.4 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 1.3 | 7.6 | GO:1990254 | keratin filament binding(GO:1990254) |
| 1.3 | 7.6 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 1.2 | 23.7 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 1.2 | 6.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 1.2 | 12.3 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 1.2 | 3.6 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 1.2 | 13.1 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 1.2 | 7.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 1.2 | 4.7 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 1.2 | 3.5 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 1.2 | 3.5 | GO:0016794 | guanosine-3',5'-bis(diphosphate) 3'-diphosphatase activity(GO:0008893) diphosphoric monoester hydrolase activity(GO:0016794) |
| 1.2 | 4.7 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 1.2 | 7.0 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 1.2 | 17.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 1.1 | 11.5 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 1.1 | 21.8 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 1.1 | 1.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 1.1 | 4.4 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 1.1 | 12.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 1.1 | 5.5 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 1.1 | 5.5 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 1.1 | 1.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 1.1 | 3.2 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 1.1 | 11.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 1.1 | 16.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 1.1 | 6.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 1.0 | 4.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 1.0 | 2.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 1.0 | 3.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 1.0 | 5.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 1.0 | 3.1 | GO:1903135 | cupric ion binding(GO:1903135) |
| 1.0 | 4.1 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 1.0 | 5.1 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 1.0 | 4.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 1.0 | 20.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 1.0 | 6.9 | GO:0005497 | androgen binding(GO:0005497) |
| 1.0 | 13.8 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 1.0 | 2.9 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 1.0 | 9.6 | GO:0050692 | DBD domain binding(GO:0050692) |
| 1.0 | 3.8 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 1.0 | 4.8 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 1.0 | 8.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.9 | 19.7 | GO:0019841 | retinol binding(GO:0019841) |
| 0.9 | 11.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.9 | 1.9 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.9 | 1.8 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.9 | 17.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.9 | 4.6 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.9 | 9.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.9 | 1.8 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.9 | 20.6 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.9 | 3.6 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.9 | 2.6 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.9 | 19.4 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.9 | 2.6 | GO:0000247 | C-8 sterol isomerase activity(GO:0000247) |
| 0.9 | 6.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.9 | 5.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.9 | 7.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.9 | 8.7 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.9 | 3.5 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.9 | 6.1 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.9 | 3.4 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.9 | 9.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.9 | 8.5 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.9 | 2.6 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.9 | 28.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.8 | 9.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.8 | 5.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.8 | 16.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.8 | 7.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.8 | 3.3 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.8 | 2.5 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.8 | 4.9 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.8 | 13.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.8 | 4.9 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.8 | 6.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.8 | 18.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.8 | 0.8 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.8 | 4.0 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.8 | 2.4 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.8 | 4.8 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.8 | 7.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.8 | 2.4 | GO:0070815 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.8 | 3.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.8 | 2.4 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.8 | 6.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.8 | 5.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.8 | 2.3 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 0.8 | 11.5 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.8 | 22.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.8 | 2.3 | GO:0044714 | GTP diphosphatase activity(GO:0036219) 2-hydroxy-adenosine triphosphate pyrophosphatase activity(GO:0044713) 2-hydroxy-(deoxy)adenosine-triphosphate pyrophosphatase activity(GO:0044714) ATP diphosphatase activity(GO:0047693) |
| 0.8 | 9.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.8 | 3.0 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.8 | 3.0 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.8 | 239.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.8 | 4.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.8 | 3.8 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.7 | 2.2 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.7 | 4.5 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.7 | 5.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.7 | 4.4 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.7 | 2.9 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.7 | 3.7 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.7 | 2.2 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.7 | 2.9 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.7 | 2.9 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.7 | 8.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.7 | 4.3 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.7 | 2.9 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.7 | 7.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.7 | 2.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.7 | 2.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.7 | 2.8 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.7 | 27.7 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.7 | 9.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.7 | 17.6 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.7 | 2.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.7 | 2.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.7 | 11.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.7 | 9.0 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.7 | 4.8 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.7 | 1.4 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.7 | 0.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.7 | 2.0 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.7 | 2.0 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.7 | 8.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.7 | 2.7 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.7 | 12.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.7 | 2.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.7 | 2.0 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.7 | 14.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.7 | 8.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.7 | 2.0 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 0.7 | 2.0 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.7 | 0.7 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.7 | 2.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.7 | 0.7 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.7 | 3.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.6 | 13.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.6 | 1.9 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.6 | 0.6 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
| 0.6 | 12.8 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.6 | 0.6 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.6 | 6.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.6 | 1.9 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.6 | 0.6 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.6 | 5.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.6 | 8.8 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.6 | 6.9 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.6 | 1.3 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.6 | 3.8 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.6 | 6.3 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.6 | 6.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.6 | 1.8 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
| 0.6 | 3.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.6 | 1.8 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.6 | 3.7 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.6 | 1.8 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.6 | 1.8 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.6 | 3.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.6 | 4.8 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.6 | 4.2 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.6 | 3.6 | GO:0071253 | connexin binding(GO:0071253) |
| 0.6 | 7.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.6 | 2.9 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.6 | 1.2 | GO:0030343 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.6 | 23.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.6 | 3.5 | GO:0016807 | cysteine-type carboxypeptidase activity(GO:0016807) cysteine-type exopeptidase activity(GO:0070004) |
| 0.6 | 2.3 | GO:0047298 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.6 | 2.9 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.6 | 1.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.6 | 15.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.6 | 2.9 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.6 | 4.6 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.6 | 6.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.6 | 1.1 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.6 | 1.1 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.6 | 5.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.6 | 2.3 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.6 | 0.6 | GO:0047115 | trans-1,2-dihydrobenzene-1,2-diol dehydrogenase activity(GO:0047115) |
| 0.6 | 2.8 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.6 | 1.7 | GO:0004750 | ribulose-phosphate 3-epimerase activity(GO:0004750) |
| 0.6 | 3.4 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.6 | 1.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.6 | 3.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.6 | 3.9 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.6 | 4.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.6 | 1.7 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.5 | 1.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.5 | 3.8 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.5 | 2.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.5 | 5.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.5 | 1.6 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.5 | 1.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.5 | 48.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.5 | 2.7 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.5 | 2.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.5 | 8.0 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.5 | 9.6 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.5 | 3.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.5 | 4.2 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.5 | 2.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.5 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.5 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.5 | 7.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.5 | 2.6 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.5 | 6.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.5 | 1.6 | GO:0031755 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.5 | 1.0 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.5 | 2.1 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.5 | 6.3 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.5 | 2.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.5 | 24.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.5 | 3.6 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.5 | 8.7 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.5 | 2.0 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.5 | 5.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.5 | 2.5 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.5 | 7.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.5 | 3.0 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.5 | 1.5 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.5 | 2.0 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.5 | 9.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.5 | 1.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.5 | 14.7 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.5 | 3.4 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.5 | 19.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.5 | 1.9 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.5 | 9.7 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.5 | 1.5 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.5 | 6.8 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.5 | 1.0 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.5 | 1.5 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.5 | 10.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.5 | 1.4 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.5 | 2.4 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.5 | 12.5 | GO:0070888 | E-box binding(GO:0070888) |
| 0.5 | 1.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.5 | 9.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.5 | 11.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.5 | 14.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.5 | 9.5 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.5 | 2.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.5 | 2.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.5 | 2.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.5 | 9.3 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.5 | 21.4 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.5 | 7.0 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.5 | 2.3 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.5 | 1.9 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
| 0.5 | 27.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.5 | 4.6 | GO:0005536 | glucose binding(GO:0005536) |
| 0.5 | 8.7 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.5 | 1.4 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.4 | 4.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.4 | 56.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.4 | 2.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.4 | 197.5 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.4 | 3.1 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.4 | 1.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.4 | 3.1 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) |
| 0.4 | 4.0 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.4 | 4.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.4 | 0.4 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.4 | 7.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.4 | 1.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.4 | 1.3 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.4 | 1.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.4 | 1.7 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.4 | 1.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.4 | 1.3 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.4 | 4.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.4 | 3.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.4 | 3.8 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.4 | 7.9 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.4 | 1.2 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.4 | 2.9 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.4 | 2.9 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.4 | 4.9 | GO:0005521 | lamin binding(GO:0005521) |
| 0.4 | 9.0 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.4 | 1.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.4 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.4 | 8.0 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.4 | 0.4 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.4 | 1.2 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.4 | 8.7 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.4 | 2.0 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.4 | 11.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.4 | 1.6 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.4 | 2.4 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.4 | 1.6 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.4 | 7.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.4 | 1.6 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.4 | 11.7 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.4 | 1.2 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.4 | 1.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.4 | 36.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.4 | 5.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.4 | 1.1 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.4 | 5.7 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.4 | 1.5 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.4 | 3.0 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.4 | 1.1 | GO:0004577 | N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase activity(GO:0004577) |
| 0.4 | 19.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.4 | 1.9 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.4 | 7.4 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.4 | 4.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.4 | 1.1 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.4 | 9.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.4 | 2.9 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.4 | 0.4 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.4 | 9.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.4 | 1.8 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.4 | 0.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.4 | 5.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.4 | 2.2 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.4 | 4.7 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.4 | 0.7 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.4 | 1.8 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.4 | 2.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.4 | 2.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.4 | 0.7 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.4 | 1.8 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.4 | 11.1 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.4 | 1.8 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.4 | 1.4 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.4 | 2.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.4 | 1.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.4 | 1.4 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.3 | 3.1 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.3 | 0.7 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.3 | 2.1 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.3 | 2.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.3 | 1.7 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.3 | 3.8 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.3 | 4.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.3 | 2.8 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.3 | 1.0 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.3 | 1.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.3 | 2.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.3 | 0.7 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.3 | 2.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.3 | 1.7 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.3 | 2.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.3 | 5.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.3 | 1.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 3.4 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.3 | 0.7 | GO:0000035 | acyl binding(GO:0000035) |
| 0.3 | 7.1 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.3 | 37.9 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.3 | 1.3 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.3 | 1.0 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.3 | 7.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.3 | 2.3 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.3 | 1.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.3 | 29.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.3 | 23.6 | GO:0019003 | GDP binding(GO:0019003) |
| 0.3 | 2.0 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.3 | 0.7 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.3 | 1.0 | GO:0015489 | polyamine transmembrane transporter activity(GO:0015203) putrescine transmembrane transporter activity(GO:0015489) |
| 0.3 | 1.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.3 | 9.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.3 | 2.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.3 | 1.0 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 0.3 | 1.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.3 | 4.8 | GO:0046790 | virion binding(GO:0046790) |
| 0.3 | 3.2 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.3 | 7.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.3 | 4.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.3 | 1.3 | GO:0001626 | nociceptin receptor activity(GO:0001626) |
| 0.3 | 1.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.3 | 9.3 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.3 | 9.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.3 | 3.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.3 | 0.9 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.3 | 12.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.3 | 3.9 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.3 | 4.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.3 | 3.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.3 | 1.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.3 | 0.3 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.3 | 2.4 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.3 | 7.4 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.3 | 1.8 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.3 | 2.6 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.3 | 0.9 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.3 | 1.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.3 | 2.9 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.3 | 3.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.3 | 2.9 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.3 | 2.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.3 | 1.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.3 | 1.7 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.3 | 1.7 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.3 | 1.1 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.3 | 2.5 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.3 | 1.1 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.3 | 0.8 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.3 | 1.7 | GO:0052846 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.3 | 0.8 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.3 | 0.8 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.3 | 2.5 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.3 | 1.4 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.3 | 0.6 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.3 | 1.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.3 | 4.3 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.3 | 2.7 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.3 | 27.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.3 | 0.3 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.3 | 0.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 2.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.3 | 12.0 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.3 | 4.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.3 | 1.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.3 | 3.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.3 | 0.8 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.3 | 33.3 | GO:0002020 | protease binding(GO:0002020) |
| 0.3 | 1.0 | GO:0019960 | C-X3-C chemokine receptor activity(GO:0016495) C-X3-C chemokine binding(GO:0019960) |
| 0.3 | 1.5 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.3 | 0.3 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.3 | 7.7 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.3 | 2.8 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.3 | 1.0 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.3 | 25.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.2 | 1.5 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.2 | 2.0 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.2 | 8.5 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.2 | 39.9 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.2 | 1.7 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 0.5 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.2 | 2.0 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.2 | 1.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.2 | 0.7 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.2 | 3.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.2 | 1.0 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.2 | 2.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.2 | 1.0 | GO:0008478 | pyridoxal kinase activity(GO:0008478) lithium ion binding(GO:0031403) |
| 0.2 | 1.0 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.2 | 1.7 | GO:0004945 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.2 | 14.8 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.2 | 1.7 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 1.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.2 | 2.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.2 | 1.4 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.2 | 2.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.2 | 4.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.2 | 2.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.2 | 1.4 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.2 | 0.2 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.2 | 10.1 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.2 | 3.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.2 | 0.9 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.2 | 2.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 0.5 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.2 | 1.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.2 | 2.9 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 1.6 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 0.2 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.2 | 2.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.2 | 1.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.2 | 0.9 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.2 | 12.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.2 | 1.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.2 | 4.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.2 | 0.7 | GO:0035473 | lipase binding(GO:0035473) |
| 0.2 | 2.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.2 | 1.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.2 | 1.5 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.2 | 0.6 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.2 | 93.9 | GO:0030695 | GTPase regulator activity(GO:0030695) |
| 0.2 | 1.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.2 | 2.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.2 | 0.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.2 | 4.9 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.2 | 0.9 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.2 | 0.6 | GO:0005163 | nerve growth factor receptor binding(GO:0005163) |
| 0.2 | 0.9 | GO:0004341 | gluconolactonase activity(GO:0004341) |
| 0.2 | 2.5 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.2 | 3.8 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.2 | 21.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.2 | 3.3 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.2 | 6.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.2 | 1.6 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.2 | 2.7 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.2 | 2.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.2 | 2.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.2 | 0.2 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.2 | 1.4 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.2 | 1.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.2 | 0.8 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.2 | 0.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.2 | 1.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 0.2 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.2 | 0.8 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.2 | 0.6 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 7.5 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.2 | 6.7 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
| 0.2 | 6.2 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.2 | 6.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.2 | 6.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.2 | 1.2 | GO:0070061 | fructose binding(GO:0070061) |
| 0.2 | 1.5 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.2 | 0.6 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.2 | 3.6 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.2 | 0.6 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.2 | 0.9 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.2 | 3.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.2 | 1.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 0.4 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.2 | 5.0 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.2 | 20.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.2 | 0.6 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.2 | 4.9 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.2 | 1.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.2 | 0.4 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.2 | 3.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.2 | 5.0 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.2 | 0.4 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 1.8 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 0.5 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.2 | 3.9 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.2 | 2.7 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.2 | 6.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.2 | 0.9 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.2 | 0.5 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.2 | 1.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 1.1 | GO:0042835 | BRE binding(GO:0042835) |
| 0.2 | 0.5 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.2 | 0.7 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.2 | 0.2 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 0.2 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 1.0 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 0.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.2 | 2.8 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.2 | 4.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.2 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 0.8 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.2 | 0.2 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.2 | 0.5 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 0.5 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.2 | 0.5 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) |
| 0.2 | 0.6 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.2 | 0.6 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.2 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 1.3 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.2 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.2 | 2.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.2 | 0.5 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.2 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.2 | 0.8 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 0.9 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 0.6 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.2 | 0.3 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.2 | 0.9 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.2 | 0.6 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.2 | 5.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.2 | 0.8 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.2 | 0.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 1.0 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 2.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.1 | 1.8 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.1 | 0.3 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 2.6 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.6 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 2.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 7.7 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 2.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.1 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.1 | 0.4 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
| 0.1 | 0.6 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.1 | 1.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.1 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.1 | 1.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.1 | 0.7 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 2.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 1.5 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.9 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.1 | 0.7 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 2.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.5 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 12.3 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 0.4 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.1 | 7.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 1.5 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 6.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.9 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 1.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 3.2 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 1.0 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 8.6 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.1 | 14.8 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
| 0.1 | 5.1 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.1 | 1.0 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 2.6 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.4 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.1 | 0.5 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 5.8 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.1 | 1.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.5 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.6 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 1.5 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.1 | 2.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 1.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.1 | GO:0047750 | cholestenol delta-isomerase activity(GO:0047750) |
| 0.1 | 0.5 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 1.4 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.1 | 0.6 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.1 | 1.2 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.1 | 0.3 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 3.3 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 1.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.1 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.1 | 2.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.4 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 2.8 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 9.7 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 2.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.1 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 1.6 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 1.3 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 1.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
| 0.1 | 0.2 | GO:0033265 | choline binding(GO:0033265) |
| 0.1 | 1.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.6 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.0 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.6 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.6 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.4 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.1 | 2.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 3.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.3 | GO:0002046 | opsin binding(GO:0002046) |
| 0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 3.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.1 | 0.4 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.1 | 1.7 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 1.0 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.1 | 0.2 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.1 | 1.6 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.3 | GO:0004773 | steryl-sulfatase activity(GO:0004773) |
| 0.1 | 0.2 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 0.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 1.9 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.7 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.9 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.1 | 0.2 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 3.1 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.1 | 2.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 1.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.2 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.1 | 0.5 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.8 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.1 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 2.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.4 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 2.0 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 3.3 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.8 | GO:0015250 | water channel activity(GO:0015250) |
| 0.1 | 0.5 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.1 | 3.2 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 1.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 23.6 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
| 0.1 | 1.0 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.5 | GO:0035586 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) purinergic receptor activity(GO:0035586) |
| 0.1 | 1.1 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 0.2 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 1.9 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.6 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.6 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.9 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.3 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.1 | 0.3 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 1.6 | GO:0005549 | odorant binding(GO:0005549) |
| 0.1 | 0.6 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 0.3 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 1.1 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.4 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.1 | 2.4 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.0 | 0.2 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.0 | 1.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 4.3 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.3 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.0 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 2.4 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 1.4 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 7.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 2.1 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 1.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.2 | GO:0032396 | HLA-B specific inhibitory MHC class I receptor activity(GO:0030109) inhibitory MHC class I receptor activity(GO:0032396) |
| 0.0 | 0.1 | GO:0030613 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.4 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 2.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.1 | GO:0036505 | prosaposin receptor activity(GO:0036505) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 3.3 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
| 0.0 | 0.2 | GO:0004473 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.3 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.5 | GO:0008527 | taste receptor activity(GO:0008527) bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.0 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.1 | GO:0001855 | complement component C4b binding(GO:0001855) complement component C4b receptor activity(GO:0001861) complement component C3b receptor activity(GO:0004877) |
| 0.0 | 0.0 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.3 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
| 0.0 | 0.1 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 1.2 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.0 | GO:0003973 | (S)-2-hydroxy-acid oxidase activity(GO:0003973) very-long-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052852) long-chain-(S)-2-hydroxy-long-chain-acid oxidase activity(GO:0052853) medium-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052854) |
| 0.0 | 0.0 | GO:0000773 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.0 | 0.0 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.0 | 0.0 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.0 | GO:0034512 | box C/D snoRNA binding(GO:0034512) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 24.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 1.2 | 75.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 1.1 | 21.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 1.0 | 61.2 | PID RAS PATHWAY | Regulation of Ras family activation |
| 1.0 | 60.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.9 | 10.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.9 | 12.8 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.9 | 9.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.8 | 18.3 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.8 | 18.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.8 | 43.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.8 | 1.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.7 | 18.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.7 | 45.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.7 | 17.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.7 | 4.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.7 | 18.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.6 | 2.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.6 | 12.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.6 | 3.7 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.6 | 34.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.6 | 30.6 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.6 | 73.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.6 | 7.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.6 | 21.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.6 | 45.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.5 | 5.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.5 | 31.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.5 | 0.5 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.5 | 161.5 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.5 | 14.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.5 | 9.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.4 | 16.8 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.4 | 10.5 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.4 | 9.9 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.4 | 25.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.4 | 10.9 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.4 | 26.4 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.4 | 10.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.4 | 14.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.4 | 2.4 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.4 | 0.8 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.4 | 13.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.4 | 7.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.4 | 5.7 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.4 | 9.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.4 | 8.4 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.4 | 7.7 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.3 | 4.5 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.3 | 5.5 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.3 | 19.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.3 | 4.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.3 | 2.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.3 | 2.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.3 | 10.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.3 | 4.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.3 | 6.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.3 | 3.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.3 | 11.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.3 | 16.7 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.3 | 8.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.3 | 12.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.3 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.3 | 5.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.3 | 7.9 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.3 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.3 | 6.0 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.3 | 5.9 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.3 | 2.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.3 | 7.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.3 | 10.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.3 | 5.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.3 | 5.0 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.3 | 4.7 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.3 | 8.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.3 | 12.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.3 | 8.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.3 | 9.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.2 | 3.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.2 | 2.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.2 | 1.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.2 | 9.4 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.2 | 13.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.2 | 7.6 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.2 | 8.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.2 | 1.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.2 | 1.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 1.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.2 | 0.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.2 | 9.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.2 | 2.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.2 | 6.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.2 | 18.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.2 | 6.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.2 | 1.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.2 | 4.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.2 | 3.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.2 | 63.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.2 | 2.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.2 | 1.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.2 | 7.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.2 | 1.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.2 | 0.5 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.1 | 1.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.9 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.1 | 3.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 2.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 2.5 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 1.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 3.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 10.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 2.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 3.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 2.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 1.4 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 1.1 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 3.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 3.4 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 4.3 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 1.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 1.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 2.0 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 0.4 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 2.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 1.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 3.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 1.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 7.3 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 6.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 1.6 | 23.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 1.5 | 36.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 1.5 | 26.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 1.5 | 2.9 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 1.4 | 9.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 1.4 | 4.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 1.3 | 84.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 1.2 | 45.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 1.2 | 10.8 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 1.2 | 17.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 1.2 | 30.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 1.2 | 43.9 | REACTOME KINESINS | Genes involved in Kinesins |
| 1.1 | 46.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 1.1 | 1.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 1.1 | 23.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 1.0 | 18.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 1.0 | 49.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 1.0 | 17.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.9 | 6.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.9 | 22.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.9 | 2.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.9 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.9 | 13.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.9 | 21.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.9 | 0.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.9 | 13.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.8 | 17.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.8 | 28.6 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.8 | 24.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.7 | 5.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.7 | 20.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.7 | 11.6 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.7 | 15.8 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.7 | 14.0 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.7 | 28.6 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.7 | 20.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.7 | 4.8 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.7 | 30.0 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.7 | 5.4 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.7 | 17.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.6 | 21.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.6 | 13.4 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.6 | 17.1 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.6 | 19.0 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.6 | 1.8 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.6 | 12.7 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.6 | 23.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.6 | 9.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.6 | 1.7 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.6 | 2.9 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.6 | 9.6 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.6 | 13.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.6 | 9.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.6 | 14.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.5 | 18.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.5 | 16.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.5 | 6.8 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.5 | 11.5 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.5 | 13.0 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.5 | 16.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.5 | 10.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.5 | 26.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.5 | 10.8 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.5 | 20.0 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.5 | 9.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.5 | 12.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.5 | 12.7 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.4 | 2.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.4 | 6.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.4 | 4.4 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.4 | 6.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.4 | 2.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.4 | 6.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.4 | 8.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.4 | 3.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.4 | 9.1 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.4 | 3.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.4 | 12.4 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.4 | 4.8 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.4 | 5.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.4 | 36.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.4 | 5.7 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.4 | 23.7 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.3 | 4.2 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.3 | 3.1 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.3 | 23.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.3 | 26.7 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.3 | 29.6 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.3 | 1.0 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.3 | 6.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.3 | 2.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.3 | 9.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.3 | 7.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.3 | 5.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.3 | 13.0 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.3 | 9.9 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.3 | 3.6 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.3 | 0.3 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.3 | 5.9 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.3 | 24.1 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.3 | 10.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.3 | 4.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.3 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.3 | 4.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.3 | 5.9 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
| 0.3 | 40.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.3 | 6.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.3 | 9.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.3 | 7.1 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.3 | 14.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.3 | 3.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.3 | 28.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.3 | 3.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.3 | 1.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 4.3 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.2 | 1.7 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.2 | 3.4 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.2 | 3.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 3.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.2 | 0.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 3.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.2 | 2.5 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.2 | 7.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.2 | 1.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.2 | 4.0 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.2 | 4.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 5.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.2 | 1.3 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.2 | 6.9 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.2 | 4.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.2 | 1.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.2 | 4.3 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.2 | 6.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.2 | 1.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.2 | 5.0 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.2 | 5.2 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.2 | 4.4 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.2 | 2.6 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.2 | 2.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.2 | 3.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 0.5 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.2 | 4.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.2 | 0.5 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.2 | 5.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.2 | 1.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 2.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.2 | 3.5 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.2 | 2.6 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.2 | 0.9 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.2 | 3.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.2 | 3.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 24.9 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.1 | 2.2 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 16.2 | REACTOME MEMBRANE TRAFFICKING | Genes involved in Membrane Trafficking |
| 0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 3.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 3.1 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.1 | 1.9 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 3.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 2.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.1 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 1.6 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 3.5 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.1 | 5.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 3.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.1 | 4.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 2.5 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 2.9 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 3.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 0.4 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 0.4 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.1 | 1.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 1.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 2.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 6.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 15.8 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.1 | 3.9 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 10.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 8.7 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.1 | 1.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.1 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 1.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 2.5 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.1 | 6.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 0.7 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 1.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.3 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.1 | 1.2 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.1 | 8.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 1.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 1.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 1.2 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.7 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 1.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 1.0 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 3.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 1.7 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 1.5 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
| 0.0 | 1.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 2.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.8 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 2.3 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.4 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 1.4 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.5 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.1 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |