Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TWIST1
|
ENSG00000122691.13 | TWIST1 |
|
SNAI1
|
ENSG00000124216.4 | SNAI1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TWIST1 | hg38_v1_chr7_-_19117625_19117645 | 0.28 | 1.3e-01 | Click! |
| SNAI1 | hg38_v1_chr20_+_49982969_49982989 | 0.18 | 3.4e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 11.5 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 1.6 | 4.8 | GO:0060623 | regulation of chromosome condensation(GO:0060623) cellular response to iron(III) ion(GO:0071283) |
| 1.4 | 7.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 1.1 | 3.2 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) regulation of chromatin silencing at telomere(GO:0031938) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 1.0 | 3.0 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 1.0 | 3.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) xanthine metabolic process(GO:0046110) negative regulation of mucus secretion(GO:0070256) |
| 0.9 | 3.4 | GO:0006169 | adenosine salvage(GO:0006169) dATP biosynthetic process(GO:0006175) |
| 0.8 | 3.1 | GO:1900085 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 0.7 | 2.1 | GO:0060032 | notochord regression(GO:0060032) |
| 0.6 | 3.2 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.6 | 1.9 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.6 | 3.7 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.6 | 2.4 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
| 0.6 | 1.7 | GO:2000412 | positive regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000309) positive regulation of thymocyte migration(GO:2000412) |
| 0.6 | 2.8 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.5 | 5.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.5 | 10.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.5 | 2.4 | GO:0070295 | transformation of host cell by virus(GO:0019087) renal water absorption(GO:0070295) |
| 0.5 | 2.4 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.5 | 6.2 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.5 | 3.3 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.5 | 2.7 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.4 | 1.3 | GO:0034769 | basement membrane disassembly(GO:0034769) |
| 0.4 | 1.3 | GO:0070650 | endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.4 | 1.7 | GO:0090472 | viral protein processing(GO:0019082) negative regulation of neurotrophin production(GO:0032900) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.4 | 0.8 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.4 | 1.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 | 1.2 | GO:1903572 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.4 | 1.2 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.4 | 1.2 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.4 | 1.5 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.4 | 1.1 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) positive regulation of cytolysis in other organism(GO:0051714) |
| 0.4 | 4.9 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.4 | 3.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.4 | 1.1 | GO:1902908 | negative regulation of transforming growth factor beta2 production(GO:0032912) negative regulation of hair follicle maturation(GO:0048817) regulation of melanosome transport(GO:1902908) |
| 0.3 | 1.0 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.3 | 2.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.3 | 1.0 | GO:0042662 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) negative regulation of mesodermal cell fate specification(GO:0042662) regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.3 | 2.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.3 | 0.7 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.3 | 1.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 1.9 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 0.9 | GO:0008615 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.3 | 3.6 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.3 | 0.9 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.3 | 0.9 | GO:0007309 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.3 | 1.4 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.3 | 3.1 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.3 | 1.7 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.3 | 0.8 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.3 | 0.8 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.3 | 3.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.3 | 1.8 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.3 | 0.8 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.3 | 1.5 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.3 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 | 0.7 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.2 | 1.7 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
| 0.2 | 0.5 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.2 | 1.2 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.2 | 2.7 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.2 | 2.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.2 | 0.7 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.2 | 0.9 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.2 | 1.6 | GO:0060750 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.2 | 0.9 | GO:0018106 | peptidyl-histidine phosphorylation(GO:0018106) |
| 0.2 | 1.1 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.2 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.2 | 0.9 | GO:0055011 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.2 | 0.4 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 | 0.9 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 0.6 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.2 | 0.6 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 | 1.2 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.2 | 1.0 | GO:0046963 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.2 | 1.5 | GO:0015705 | iodide transport(GO:0015705) |
| 0.2 | 0.8 | GO:1900535 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 | 3.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.2 | 0.6 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.2 | 4.5 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.2 | 0.5 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.2 | 0.7 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 1.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 0.7 | GO:0048627 | myoblast development(GO:0048627) |
| 0.2 | 0.7 | GO:0021592 | fourth ventricle development(GO:0021592) |
| 0.2 | 0.5 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 1.4 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.2 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.2 | 0.8 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.2 | 0.9 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.2 | 1.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.2 | 0.5 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.2 | 0.8 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.2 | 7.6 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.2 | 0.6 | GO:0010903 | negative regulation of very-low-density lipoprotein particle remodeling(GO:0010903) regulation of high-density lipoprotein particle clearance(GO:0010982) negative regulation of cholesterol import(GO:0060621) negative regulation of sterol import(GO:2000910) |
| 0.2 | 0.8 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.1 | 0.4 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 0.1 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.1 | 0.4 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 0.4 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 1.9 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.8 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.8 | GO:0051708 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 | 0.7 | GO:0010193 | response to ozone(GO:0010193) |
| 0.1 | 0.3 | GO:2000724 | positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.1 | 2.1 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.4 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.4 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 | 0.4 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.1 | 0.4 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 1.6 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.1 | 0.5 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.7 | GO:2000667 | positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.1 | 1.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.5 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 | 1.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.5 | GO:0051563 | smooth endoplasmic reticulum calcium ion homeostasis(GO:0051563) |
| 0.1 | 2.8 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.4 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.1 | 1.2 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 3.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 1.9 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.4 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 2.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.3 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 5.3 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.1 | 0.4 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 | 0.4 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.1 | 0.5 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.5 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.4 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 1.2 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.1 | 0.5 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.3 | GO:0051695 | actin filament uncapping(GO:0051695) |
| 0.1 | 0.9 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.3 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.1 | 0.3 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.1 | 0.4 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 1.4 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.1 | 0.3 | GO:2000813 | negative regulation of barbed-end actin filament capping(GO:2000813) |
| 0.1 | 11.6 | GO:0070268 | cornification(GO:0070268) |
| 0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 1.7 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 0.8 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.3 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 | 0.4 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.1 | 3.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 2.8 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.8 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.3 | GO:0070079 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.1 | 1.7 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 1.0 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.5 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.1 | 0.7 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.1 | 0.5 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 0.4 | GO:0090647 | modulation of age-related behavioral decline(GO:0090647) |
| 0.1 | 0.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.7 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 2.6 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 2.3 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.1 | 4.0 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.1 | 4.9 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.1 | 0.5 | GO:0031337 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 2.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.5 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.2 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.1 | 0.2 | GO:1905073 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.1 | 0.8 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 1.4 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.1 | 0.6 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:0048880 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) sensory system development(GO:0048880) |
| 0.1 | 0.6 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.4 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 | 0.9 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 0.7 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 2.7 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.1 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.5 | GO:2000852 | regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.3 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 0.6 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 0.4 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.1 | 0.4 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.1 | 0.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.3 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.1 | 0.5 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 4.1 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.2 | GO:0009720 | detection of hormone stimulus(GO:0009720) |
| 0.1 | 0.9 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.1 | 0.3 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 | 1.4 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.1 | 4.0 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.1 | 0.3 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 0.7 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.6 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 0.2 | GO:0034241 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.1 | 0.2 | GO:0031456 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.1 | 0.6 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
| 0.1 | 0.1 | GO:0002876 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of chronic inflammatory response to antigenic stimulus(GO:0002876) |
| 0.1 | 0.6 | GO:1905098 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.1 | 0.9 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.1 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.5 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.2 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 0.2 | GO:1902961 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.1 | 0.7 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.3 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.3 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 2.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.9 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.1 | 0.9 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 | 1.0 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.1 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.9 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.2 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.2 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.3 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 2.9 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.4 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 1.9 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 1.1 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.7 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 | 0.5 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.6 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.4 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.2 | GO:0045425 | response to molecule of fungal origin(GO:0002238) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) beta selection(GO:0043366) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) cellular response to molecule of fungal origin(GO:0071226) |
| 0.0 | 3.6 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.5 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.3 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 | 0.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 3.0 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.6 | GO:1903764 | regulation of potassium ion export across plasma membrane(GO:1903764) |
| 0.0 | 0.7 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.3 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.8 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 1.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.4 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 1.4 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.4 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 | 0.2 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.1 | GO:1904640 | response to methionine(GO:1904640) |
| 0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.0 | 1.1 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.4 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.5 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:1904204 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.0 | 0.5 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.2 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 2.7 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.5 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 1.6 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.6 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.4 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.4 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.0 | 0.2 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.6 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.5 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 1.0 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.4 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.2 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.0 | 0.6 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.5 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 0.3 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.0 | 0.8 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.3 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.7 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.9 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 1.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 4.0 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.3 | GO:0042711 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.0 | 0.9 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.2 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 0.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.1 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.0 | 0.7 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.8 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 5.6 | GO:0048813 | dendrite morphogenesis(GO:0048813) |
| 0.0 | 0.2 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 | 0.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.3 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.0 | 0.2 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0021634 | optic nerve formation(GO:0021634) optic chiasma development(GO:0061360) regulation of optic nerve formation(GO:2000595) positive regulation of optic nerve formation(GO:2000597) |
| 0.0 | 0.7 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.3 | GO:1902572 | negative regulation of serine-type endopeptidase activity(GO:1900004) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.5 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.7 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.6 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.6 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.8 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.6 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
| 0.0 | 1.2 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.0 | 0.7 | GO:0045104 | intermediate filament cytoskeleton organization(GO:0045104) |
| 0.0 | 0.3 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.1 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 1.6 | GO:0071349 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.1 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.0 | 0.5 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.3 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.1 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.1 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
| 0.0 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.2 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.0 | 1.4 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.3 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.1 | GO:0070378 | positive regulation of ERK5 cascade(GO:0070378) |
| 0.0 | 0.7 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.3 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.0 | 0.8 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.3 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 1.4 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.0 | 0.1 | GO:0032599 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.3 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.4 | GO:0072662 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 1.0 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.4 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.1 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.3 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.5 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.3 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.0 | 1.1 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.5 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.6 | GO:0014743 | regulation of muscle hypertrophy(GO:0014743) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.7 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
| 0.0 | 0.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.4 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.5 | GO:0051693 | actin filament capping(GO:0051693) |
| 0.0 | 0.2 | GO:0009304 | transcription initiation from RNA polymerase III promoter(GO:0006384) tRNA transcription(GO:0009304) |
| 0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.4 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.0 | 0.4 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.0 | 0.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.1 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.5 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.2 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.2 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.2 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.2 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.2 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.0 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 1.4 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.5 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.0 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.0 | GO:0045556 | TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.0 | 0.0 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.0 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 | 0.0 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.2 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.6 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.3 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.3 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.1 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.2 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 11.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 1.4 | 7.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 1.1 | 3.2 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.6 | 3.8 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.6 | 9.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.6 | 1.7 | GO:0071065 | dense core granule membrane(GO:0032127) alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 0.4 | 1.2 | GO:0043259 | laminin-10 complex(GO:0043259) laminin-11 complex(GO:0043260) |
| 0.4 | 1.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.4 | 2.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.4 | 10.1 | GO:0005922 | connexon complex(GO:0005922) |
| 0.4 | 2.8 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.3 | 1.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.3 | 1.0 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.3 | 3.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.2 | 3.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.2 | 4.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.2 | 1.3 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.2 | 0.6 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.2 | 1.5 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 1.1 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.2 | 0.5 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 0.8 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 4.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 0.5 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 3.6 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 2.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 2.0 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 3.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 6.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.3 | GO:0071753 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 0.1 | 0.3 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 3.8 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 1.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.3 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.1 | 0.4 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.1 | 1.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.7 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 1.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.1 | 0.9 | GO:0071546 | pi-body(GO:0071546) |
| 0.1 | 0.3 | GO:0070685 | macropinocytic cup(GO:0070685) |
| 0.1 | 0.5 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.6 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.4 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 0.3 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.4 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.1 | 3.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 0.7 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 7.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 5.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.8 | GO:0032059 | bleb(GO:0032059) |
| 0.1 | 0.6 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 5.8 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 3.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.9 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 5.5 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 2.5 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.1 | 1.2 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.2 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.2 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 1.0 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.0 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.0 | 2.2 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.9 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.2 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.6 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.4 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.0 | 1.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.0 | 1.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 0.0 | 1.2 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.6 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 2.0 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 4.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 2.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 1.7 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.4 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.9 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) Flemming body(GO:0090543) |
| 0.0 | 0.3 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 2.2 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 1.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 5.5 | GO:0030027 | lamellipodium(GO:0030027) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 2.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 1.9 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.2 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 3.3 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 2.0 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 1.7 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 1.0 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.5 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.2 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.3 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.3 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.3 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.4 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 1.5 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 3.4 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.8 | 4.8 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.8 | 3.1 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.7 | 2.2 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.7 | 2.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.6 | 2.4 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.5 | 2.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.5 | 2.4 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.5 | 2.8 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.4 | 2.0 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.4 | 2.7 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.4 | 1.5 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.4 | 3.0 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.4 | 1.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.3 | 6.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.3 | 0.9 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.3 | 3.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.3 | 3.5 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.3 | 7.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.3 | 1.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.3 | 2.8 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 5.9 | GO:0019841 | retinol binding(GO:0019841) |
| 0.3 | 2.7 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.3 | 2.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.3 | 1.9 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.3 | 1.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 2.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 0.7 | GO:0004315 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.2 | 1.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.2 | 0.7 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.2 | 3.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 1.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.2 | 4.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 1.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 0.8 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.2 | 1.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.2 | 1.0 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.2 | 1.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 1.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.2 | 1.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.2 | 2.6 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.2 | 0.5 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.2 | 0.6 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 2.8 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 0.1 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 0.1 | 1.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.1 | 2.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.8 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.9 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.4 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.1 | 0.4 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.1 | 1.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.4 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 2.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 0.6 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 2.6 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 1.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 39.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.4 | GO:0051990 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.1 | 1.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.6 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.5 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.9 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 1.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.9 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 0.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.1 | 0.5 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 0.4 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.4 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.1 | 1.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.4 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 3.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 2.6 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.4 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.1 | 0.5 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.9 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 1.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 12.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.4 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.1 | 0.6 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.1 | 0.4 | GO:0047804 | cysteine-S-conjugate beta-lyase activity(GO:0047804) L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.1 | 0.3 | GO:0033749 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.1 | 10.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 1.0 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 0.7 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 1.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 2.6 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.1 | 0.3 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
| 0.1 | 5.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.4 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.3 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 0.7 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.1 | 0.5 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.2 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 0.7 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.2 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.2 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 0.1 | 0.8 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.4 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.5 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 1.0 | GO:0048019 | co-receptor binding(GO:0039706) receptor antagonist activity(GO:0048019) |
| 0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 1.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 2.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.2 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.1 | 0.7 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 1.8 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.1 | 0.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.8 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 1.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 0.8 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.6 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.1 | 0.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 1.4 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.1 | 0.9 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 1.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.2 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.1 | 0.6 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.9 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.2 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 0.5 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.7 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.2 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.2 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.8 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 1.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.5 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 4.8 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.3 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.0 | 0.5 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.2 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.0 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 1.0 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 1.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 1.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 1.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 6.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 1.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.7 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.9 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.2 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.4 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.7 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 1.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 6.3 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.3 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.0 | 1.9 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 1.3 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.8 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.9 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 1.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 5.0 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 1.1 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.8 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.0 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.3 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 1.3 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 3.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.3 | GO:0055106 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 1.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 1.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0016524 | latrotoxin receptor activity(GO:0016524) |
| 0.0 | 0.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.7 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.2 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 1.0 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.1 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.0 | 1.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.1 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.0 | 0.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 2.8 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.4 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.4 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.0 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 2.9 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 1.7 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 1.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 1.0 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.2 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.4 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 1.0 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 1.2 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 1.1 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 1.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.9 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 3.9 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 8.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.2 | 10.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 5.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 1.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 2.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 3.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 10.9 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 2.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 5.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 7.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 4.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 4.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 4.2 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.9 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 1.9 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 0.8 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.3 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 1.6 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 1.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 3.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 1.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.3 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 1.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 1.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 2.9 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 2.8 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 1.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 12.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 9.2 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 1.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 1.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.8 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 1.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 1.4 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 2.1 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 1.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.9 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 2.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 2.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 1.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.1 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 1.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 2.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 1.9 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.7 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.6 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 10.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.3 | 5.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.3 | 4.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.3 | 6.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.2 | 3.6 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 12.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 3.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 4.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 4.7 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 4.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.2 | 4.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 2.6 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 7.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 3.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 2.8 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 3.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 3.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 3.1 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 3.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 2.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.4 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 2.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 1.3 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 2.1 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 1.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 2.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.9 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 0.7 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 2.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.0 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 1.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 1.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.8 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.8 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 1.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 1.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 1.8 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
| 0.0 | 1.6 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 1.0 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 1.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 8.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.5 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 1.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 1.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 2.6 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 4.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 1.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 1.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 2.6 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
| 0.0 | 1.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.5 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 1.1 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.7 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.7 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.7 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.5 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.3 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.7 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 1.5 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |