Mucociliary differentiation, bronchial epithelial cells, human (Ross 2007)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZFX
|
ENSG00000005889.16 | ZFX |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZFX | hg38_v1_chrX_+_24149629_24149696 | 0.38 | 4.0e-02 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0010931 | macrophage tolerance induction(GO:0010931) regulation of macrophage tolerance induction(GO:0010932) positive regulation of macrophage tolerance induction(GO:0010933) |
| 0.5 | 1.4 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.4 | 1.2 | GO:0043465 | fermentation(GO:0006113) regulation of fermentation(GO:0043465) |
| 0.4 | 4.6 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 | 1.0 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.3 | 1.0 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 0.3 | 0.9 | GO:2000777 | positive regulation of oocyte maturation(GO:1900195) positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.3 | 1.5 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.3 | 1.1 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.3 | 1.1 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.3 | 1.1 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 1.0 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.2 | 0.7 | GO:1901254 | modulation by host of viral RNA genome replication(GO:0044830) positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.2 | 2.4 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 0.9 | GO:1900535 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 | 1.4 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 3.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.2 | 1.4 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.2 | 0.7 | GO:0060128 | regulation of calcium-independent cell-cell adhesion(GO:0051040) corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.2 | 0.9 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 | 2.0 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.2 | 1.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.2 | 0.8 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.2 | 0.6 | GO:0042040 | molybdenum incorporation into molybdenum-molybdopterin complex(GO:0018315) metal incorporation into metallo-molybdopterin complex(GO:0042040) glycine receptor clustering(GO:0072579) |
| 0.2 | 0.4 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.2 | 0.6 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.2 | 0.6 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.2 | 1.3 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.2 | 0.5 | GO:0034970 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) histone H3-R2 methylation(GO:0034970) |
| 0.2 | 0.7 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 | 1.1 | GO:0060356 | leucine import(GO:0060356) |
| 0.2 | 0.5 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.2 | 0.5 | GO:0006045 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.2 | 0.5 | GO:0014028 | notochord formation(GO:0014028) |
| 0.2 | 0.7 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.2 | 0.8 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.2 | 0.5 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.2 | 3.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.2 | 0.6 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.2 | 1.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.2 | 0.5 | GO:0071314 | cellular response to cocaine(GO:0071314) cellular response to luteinizing hormone stimulus(GO:0071373) |
| 0.2 | 1.2 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.2 | 0.9 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.2 | 0.5 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.2 | 0.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.7 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 0.7 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.1 | 0.4 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 0.4 | GO:1990009 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) retinal cell apoptotic process(GO:1990009) |
| 0.1 | 0.3 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.6 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.1 | 0.6 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) negative regulation of type B pancreatic cell development(GO:2000077) |
| 0.1 | 3.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.4 | GO:1902958 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.1 | 0.7 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 1.3 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.3 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) chemorepulsion of axon(GO:0061643) |
| 0.1 | 0.5 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.9 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.1 | 0.4 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.1 | 0.4 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.1 | 0.6 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 | 0.4 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.1 | 0.4 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.1 | 1.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 1.0 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 1.6 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 | 0.7 | GO:0071279 | cellular response to cobalt ion(GO:0071279) |
| 0.1 | 0.6 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 0.1 | 0.5 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 | 0.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.6 | GO:0042851 | L-alanine metabolic process(GO:0042851) L-alanine catabolic process(GO:0042853) |
| 0.1 | 0.8 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 1.4 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 | 1.5 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.9 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.4 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 | 0.3 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.1 | 0.3 | GO:0003169 | coronary vein morphogenesis(GO:0003169) neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of retinal ganglion cell axon guidance(GO:1902336) regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.1 | 0.4 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.3 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.1 | GO:1903181 | negative regulation of late endosome to lysosome transport(GO:1902823) regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.1 | 0.4 | GO:0033122 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.1 | 0.3 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 0.3 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.8 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.2 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.4 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) aspartate secretion(GO:0061528) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.1 | 0.3 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 | 0.4 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.1 | 1.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 | 1.0 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.7 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
| 0.1 | 0.2 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.1 | 0.4 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.1 | 1.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.3 | GO:0060266 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.1 | 0.9 | GO:1903243 | negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) lung vasculature development(GO:0060426) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.1 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.5 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.7 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.6 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 | 0.1 | GO:0090205 | positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.3 | GO:0016476 | calcium-dependent cell-matrix adhesion(GO:0016340) regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 0.6 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 1.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.3 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 0.4 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 0.3 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.7 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.7 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 2.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 1.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 0.7 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 1.7 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.1 | 0.2 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) |
| 0.1 | 0.5 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.1 | 0.5 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 0.8 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 1.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.4 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.5 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 1.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.4 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.1 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.1 | 0.2 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.5 | GO:0048570 | notochord morphogenesis(GO:0048570) |
| 0.1 | 0.4 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 1.2 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.1 | 0.4 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 1.8 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.2 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.4 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.1 | 0.4 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.3 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.1 | 0.2 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.1 | 0.4 | GO:1903923 | protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 0.1 | 0.1 | GO:1903911 | positive regulation of receptor clustering(GO:1903911) |
| 0.1 | 0.8 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 1.8 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.2 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.1 | 0.2 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.1 | 0.3 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.2 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.1 | 0.1 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.1 | 0.5 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.2 | GO:0071206 | establishment of protein localization to juxtaparanode region of axon(GO:0071206) |
| 0.1 | 0.2 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.1 | 0.5 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.2 | GO:1901874 | negative regulation of post-translational protein modification(GO:1901874) |
| 0.1 | 1.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.1 | 0.2 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.4 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.1 | 0.3 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.6 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 | 0.5 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.1 | 0.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.6 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 1.0 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.4 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.6 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.5 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.1 | 0.2 | GO:1903676 | regulation of cap-dependent translational initiation(GO:1903674) positive regulation of cap-dependent translational initiation(GO:1903676) |
| 0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.4 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.1 | 0.2 | GO:0043323 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.1 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 0.9 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.9 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.1 | 0.9 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 1.4 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.2 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.8 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.0 | 0.4 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:2000176 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 | 0.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.2 | GO:0090472 | viral protein processing(GO:0019082) negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.0 | 0.2 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.6 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.7 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 1.7 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.8 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 1.0 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
| 0.0 | 0.1 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
| 0.0 | 0.3 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.6 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.0 | 0.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.0 | 0.2 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.4 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.2 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.3 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.0 | 0.7 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.1 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.0 | 0.2 | GO:0019230 | pathogenesis(GO:0009405) proprioception(GO:0019230) positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.0 | 0.3 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.4 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.2 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.0 | 0.4 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.2 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.3 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.0 | 0.3 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.7 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.7 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.2 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.0 | 0.1 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.0 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0019521 | pentose-phosphate shunt, oxidative branch(GO:0009051) aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.0 | 0.2 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 0.0 | 0.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.5 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 1.4 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 0.5 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
| 0.0 | 0.3 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 | 0.2 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.0 | 0.1 | GO:2000642 | intralumenal vesicle formation(GO:0070676) negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.0 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.4 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.0 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 1.0 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.3 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 | 0.1 | GO:0098583 | mastication(GO:0071626) learned vocalization behavior(GO:0098583) |
| 0.0 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.2 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.2 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 2.0 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.5 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 1.7 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.2 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.0 | 0.1 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 | 0.8 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 | 0.1 | GO:1904908 | negative regulation of maintenance of sister chromatid cohesion(GO:0034092) negative regulation of maintenance of mitotic sister chromatid cohesion(GO:0034183) maintenance of mitotic sister chromatid cohesion, telomeric(GO:0099403) mitotic sister chromatid cohesion, telomeric(GO:0099404) regulation of maintenance of mitotic sister chromatid cohesion, telomeric(GO:1904907) negative regulation of maintenance of mitotic sister chromatid cohesion, telomeric(GO:1904908) |
| 0.0 | 0.1 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.5 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.0 | 0.1 | GO:1903762 | positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.0 | 0.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.1 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.0 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.0 | 0.1 | GO:0003290 | septum secundum development(GO:0003285) atrial septum secundum morphogenesis(GO:0003290) |
| 0.0 | 0.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 1.7 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 0.2 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 1.4 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.2 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.1 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.0 | 0.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 1.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.0 | 0.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.8 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 0.2 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.3 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.5 | GO:0043536 | positive regulation of blood vessel endothelial cell migration(GO:0043536) |
| 0.0 | 0.2 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.0 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.5 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 0.2 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 | 0.5 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.5 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.5 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 | 1.8 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.0 | 2.0 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.5 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 | 0.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.5 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.2 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 2.0 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.1 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 1.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.3 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 1.0 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.2 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.0 | 0.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.6 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.3 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.7 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.2 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.0 | 0.1 | GO:0060754 | regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.3 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.0 | 0.1 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 0.1 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.0 | 0.2 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.4 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.0 | 0.5 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.5 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 1.7 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 1.8 | GO:0003254 | regulation of membrane depolarization(GO:0003254) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.4 | GO:0000022 | mitotic spindle elongation(GO:0000022) |
| 0.0 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.2 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.1 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 | 0.2 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.3 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.4 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.2 | GO:0045938 | positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.0 | 0.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.6 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.0 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0048560 | establishment of anatomical structure orientation(GO:0048560) |
| 0.0 | 2.0 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 1.6 | GO:0000422 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.3 | GO:0051608 | histamine transport(GO:0051608) |
| 0.0 | 0.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.6 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 2.2 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 | 0.3 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.0 | 0.2 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 1.1 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.2 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.8 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.4 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.0 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.0 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.0 | 0.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.9 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.2 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.1 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.2 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.2 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.0 | 0.5 | GO:0030511 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.1 | GO:0060699 | regulation of endoribonuclease activity(GO:0060699) |
| 0.0 | 0.1 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.0 | 0.2 | GO:0033598 | mammary gland epithelial cell proliferation(GO:0033598) |
| 0.0 | 0.5 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.0 | 0.3 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.3 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.7 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.1 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.6 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.4 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.2 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.3 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.0 | 0.2 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
| 0.0 | 0.1 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.8 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.9 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.2 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 0.6 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.1 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.0 | 0.1 | GO:0014877 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.1 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.0 | 0.1 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.2 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.3 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.5 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.0 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.8 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.3 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.2 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.2 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.0 | 0.8 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 2.2 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.0 | 0.1 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.7 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.3 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.1 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.0 | 0.1 | GO:0071110 | protein biotinylation(GO:0009305) histone biotinylation(GO:0071110) |
| 0.0 | 0.5 | GO:0019363 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.2 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.2 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.0 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.2 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.0 | 0.0 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.0 | 0.3 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.0 | 0.2 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.3 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.7 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.0 | 0.1 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 1.1 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
| 0.0 | 0.0 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.0 | 0.2 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.0 | GO:1903006 | flavin adenine dinucleotide metabolic process(GO:0072387) regulation of protein K63-linked deubiquitination(GO:1903004) positive regulation of protein K63-linked deubiquitination(GO:1903006) |
| 0.0 | 0.0 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.1 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.7 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.4 | GO:0043259 | laminin-10 complex(GO:0043259) laminin-11 complex(GO:0043260) |
| 0.4 | 1.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.4 | 1.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.3 | 1.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.3 | 1.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.2 | 1.2 | GO:0032449 | CBM complex(GO:0032449) |
| 0.2 | 0.7 | GO:1902737 | dendritic filopodium(GO:1902737) |
| 0.2 | 0.9 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.2 | 1.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 0.9 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.2 | 0.7 | GO:0034677 | integrin alpha7-beta1 complex(GO:0034677) |
| 0.2 | 1.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.2 | 2.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 0.2 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.2 | 1.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.2 | 0.6 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.2 | 0.5 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.1 | 1.6 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.4 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 1.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.8 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 1.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 1.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.6 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 2.7 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.4 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 0.5 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.5 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 0.5 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.8 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.6 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 1.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 2.1 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.1 | 1.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.3 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.1 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 0.6 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 0.7 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 1.5 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.7 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 1.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.8 | GO:0097486 | multivesicular body lumen(GO:0097486) |
| 0.1 | 0.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 0.2 | GO:0071756 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 0.1 | 1.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 1.0 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.1 | 0.3 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.1 | 0.3 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 1.8 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 1.3 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.2 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.0 | 0.8 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 1.0 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.6 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 1.0 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.6 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.5 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.0 | 0.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.3 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 1.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 2.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.8 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.0 | 3.1 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.6 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 2.0 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 2.4 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.1 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.8 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.9 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 2.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 2.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 3.3 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 1.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.2 | GO:0032059 | bleb(GO:0032059) |
| 0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.0 | 3.1 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 1.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.1 | GO:1990879 | CST complex(GO:1990879) |
| 0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.2 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 2.2 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 1.8 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 2.5 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.2 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 1.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 1.7 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 0.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 0.8 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.8 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 1.0 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 1.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.7 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 1.3 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.7 | GO:0042641 | actomyosin(GO:0042641) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0016420 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.4 | 3.8 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.3 | 0.9 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.3 | 1.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.3 | 0.8 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.2 | 0.7 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.2 | 0.9 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.2 | 0.9 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.2 | 0.6 | GO:0000252 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) sterol-4-alpha-carboxylate 3-dehydrogenase (decarboxylating) activity(GO:0047012) |
| 0.2 | 0.8 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.2 | 0.6 | GO:0061599 | nitrate reductase activity(GO:0008940) molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.2 | 2.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 0.8 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.2 | 0.6 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 0.2 | 0.6 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 0.9 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.2 | 0.9 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.2 | 0.7 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
| 0.2 | 1.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 1.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.7 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.2 | 0.5 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 1.0 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.4 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 0.8 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.4 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 0.8 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.5 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.1 | 1.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.5 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 0.4 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 1.3 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.8 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 1.7 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.1 | 0.4 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 1.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 0.6 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.1 | 0.4 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.4 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 0.6 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 0.4 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 2.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.9 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.5 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.1 | 0.7 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 2.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.4 | GO:0032145 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 1.2 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.5 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.3 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.7 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 0.4 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.1 | 1.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.6 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.4 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.1 | 0.4 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.1 | 0.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.4 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.3 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 1.5 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.9 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.9 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.7 | GO:0098639 | C-X3-C chemokine binding(GO:0019960) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.2 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.8 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.2 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.1 | 0.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.1 | 0.2 | GO:0016717 | C-5 sterol desaturase activity(GO:0000248) oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) sterol desaturase activity(GO:0070704) |
| 0.1 | 1.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.2 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.1 | 0.4 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 1.3 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 1.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.3 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.1 | 0.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.1 | 1.5 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 1.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 5.9 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.7 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.1 | GO:0019144 | ADP-sugar diphosphatase activity(GO:0019144) |
| 0.1 | 1.6 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.8 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 1.8 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 1.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.4 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 1.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.5 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.2 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 0.2 | GO:0008457 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.1 | 0.6 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.3 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 1.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 2.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 1.1 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 3.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.1 | 0.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 0.3 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 1.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.5 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 0.2 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 0.1 | 0.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 0.5 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.2 | GO:0070644 | 9-cis retinoic acid receptor activity(GO:0004886) vitamin D response element binding(GO:0070644) |
| 0.0 | 0.9 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.8 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
| 0.0 | 0.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.3 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.1 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.0 | 0.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.3 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.0 | 0.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.0 | 0.6 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.7 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.2 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.0 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 1.2 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 1.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 1.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.4 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 1.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.5 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.4 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.1 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.0 | 0.6 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.1 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.8 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.0 | 0.6 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 1.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.0 | 0.3 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.3 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.5 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 1.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.0 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.1 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 1.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 3.4 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 1.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 4.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.8 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 0.0 | 0.4 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.9 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.0 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.2 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.5 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 2.2 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.4 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 1.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.8 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 1.6 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.6 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.0 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 2.2 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 3.1 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.7 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.6 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 1.0 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.2 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.0 | 0.1 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
| 0.0 | 0.2 | GO:0030614 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
| 0.0 | 0.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0047750 | cholestenol delta-isomerase activity(GO:0047750) |
| 0.0 | 1.7 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) |
| 0.0 | 1.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.7 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.4 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 0.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.1 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.4 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.3 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 4.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.2 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.8 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.4 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 2.6 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0018271 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 0.0 | 1.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 4.0 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.0 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.4 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.0 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.6 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.0 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.7 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.7 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 1.9 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 2.5 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 4.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 1.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 3.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 1.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 1.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 2.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 4.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.6 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 2.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.8 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.6 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 1.7 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 7.2 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.4 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 1.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 1.5 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 1.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 1.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.8 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.8 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.7 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 1.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.4 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.6 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 1.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 5.2 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.7 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.7 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 3.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.3 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.4 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 4.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 1.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.6 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 2.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 0.7 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 1.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 1.6 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.1 | 1.8 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 3.4 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 0.8 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 1.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 1.0 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 2.2 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 0.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 2.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 1.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 1.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 1.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 1.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.4 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 1.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 1.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.7 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 1.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 1.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.5 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 1.1 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 1.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 1.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.0 | 1.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 2.0 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.3 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 3.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 1.9 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.7 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.2 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.7 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.6 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 2.0 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 2.1 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 1.7 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.3 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.4 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.2 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.5 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 1.0 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |