GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxi1
|
ENSMUSG00000047861.2 | forkhead box I1 |
Foxo1
|
ENSMUSG00000044167.5 | forkhead box O1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Foxo1 | mm10_v2_chr3_+_52268337_52268388 | -0.14 | 4.2e-01 | Click! |
Foxi1 | mm10_v2_chr11_-_34208085_34208092 | 0.03 | 8.6e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr11_-_102365111 | 5.94 |
ENSMUST00000006749.9
|
Slc4a1
|
solute carrier family 4 (anion exchanger), member 1 |
chr5_-_138170992 | 4.85 |
ENSMUST00000139983.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr12_+_109452833 | 4.62 |
ENSMUST00000056110.8
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
chr7_+_110772604 | 4.39 |
ENSMUST00000005829.6
|
Ampd3
|
adenosine monophosphate deaminase 3 |
chr5_-_138171248 | 4.20 |
ENSMUST00000153867.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr17_+_40811089 | 4.07 |
ENSMUST00000024721.7
|
Rhag
|
Rhesus blood group-associated A glycoprotein |
chr5_-_138171216 | 3.90 |
ENSMUST00000147920.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr8_-_85380964 | 3.77 |
ENSMUST00000122452.1
|
Mylk3
|
myosin light chain kinase 3 |
chr4_-_87806296 | 3.46 |
ENSMUST00000126353.1
ENSMUST00000149357.1 |
Mllt3
|
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 3 |
chr11_+_32276400 | 3.39 |
ENSMUST00000020531.2
|
Hba-x
|
hemoglobin X, alpha-like embryonic chain in Hba complex |
chr1_+_40439627 | 3.24 |
ENSMUST00000097772.3
|
Il1rl1
|
interleukin 1 receptor-like 1 |
chr1_-_171281181 | 3.08 |
ENSMUST00000073120.4
|
Ppox
|
protoporphyrinogen oxidase |
chr14_-_70630149 | 2.94 |
ENSMUST00000022694.9
|
Dmtn
|
dematin actin binding protein |
chr11_-_99438143 | 2.92 |
ENSMUST00000017743.2
|
Krt20
|
keratin 20 |
chr16_-_76022266 | 2.89 |
ENSMUST00000114240.1
|
Samsn1
|
SAM domain, SH3 domain and nuclear localization signals, 1 |
chr1_+_40439767 | 2.81 |
ENSMUST00000173514.1
|
Il1rl1
|
interleukin 1 receptor-like 1 |
chr15_+_80623499 | 2.80 |
ENSMUST00000043149.7
|
Grap2
|
GRB2-related adaptor protein 2 |
chr10_+_115817247 | 2.70 |
ENSMUST00000035563.7
ENSMUST00000080630.3 ENSMUST00000179196.1 |
Tspan8
|
tetraspanin 8 |
chrX_+_9885622 | 2.67 |
ENSMUST00000067529.2
ENSMUST00000086165.3 |
Sytl5
|
synaptotagmin-like 5 |
chr6_+_121636173 | 2.62 |
ENSMUST00000032203.7
|
A2m
|
alpha-2-macroglobulin |
chr10_-_21160925 | 2.59 |
ENSMUST00000020158.6
|
Myb
|
myeloblastosis oncogene |
chr1_-_132367879 | 2.55 |
ENSMUST00000142609.1
|
Tmcc2
|
transmembrane and coiled-coil domains 2 |
chr4_-_154928545 | 2.51 |
ENSMUST00000152687.1
|
Tnfrsf14
|
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
chr16_-_22161450 | 2.47 |
ENSMUST00000115379.1
|
Igf2bp2
|
insulin-like growth factor 2 mRNA binding protein 2 |
chr3_+_153844209 | 2.38 |
ENSMUST00000044089.3
|
Asb17
|
ankyrin repeat and SOCS box-containing 17 |
chr8_+_70373541 | 2.31 |
ENSMUST00000003659.7
|
Comp
|
cartilage oligomeric matrix protein |
chr17_+_47505043 | 2.29 |
ENSMUST00000182129.1
ENSMUST00000171031.1 |
Ccnd3
|
cyclin D3 |
chr3_+_51661209 | 2.23 |
ENSMUST00000161590.1
|
Mgst2
|
microsomal glutathione S-transferase 2 |
chr4_+_11191726 | 2.23 |
ENSMUST00000029866.9
ENSMUST00000108324.3 |
Ccne2
|
cyclin E2 |
chr17_+_47505117 | 2.21 |
ENSMUST00000183044.1
ENSMUST00000037333.10 |
Ccnd3
|
cyclin D3 |
chr15_-_79285502 | 2.19 |
ENSMUST00000165408.1
|
Baiap2l2
|
BAI1-associated protein 2-like 2 |
chr4_+_34893772 | 2.19 |
ENSMUST00000029975.3
ENSMUST00000135871.1 ENSMUST00000108130.1 |
Cga
|
glycoprotein hormones, alpha subunit |
chr17_+_47505149 | 2.15 |
ENSMUST00000183177.1
ENSMUST00000182848.1 |
Ccnd3
|
cyclin D3 |
chr15_-_79285470 | 2.13 |
ENSMUST00000170955.1
|
Baiap2l2
|
BAI1-associated protein 2-like 2 |
chr17_+_47505211 | 2.11 |
ENSMUST00000182935.1
ENSMUST00000182506.1 |
Ccnd3
|
cyclin D3 |
chr14_+_27000362 | 2.07 |
ENSMUST00000035433.8
|
Hesx1
|
homeobox gene expressed in ES cells |
chr3_-_27153861 | 2.06 |
ENSMUST00000108300.1
ENSMUST00000108298.2 |
Ect2
|
ect2 oncogene |
chr3_-_27153782 | 2.05 |
ENSMUST00000175857.1
ENSMUST00000177055.1 ENSMUST00000176535.1 |
Ect2
|
ect2 oncogene |
chr17_+_5799491 | 2.04 |
ENSMUST00000181484.1
|
3300005D01Rik
|
RIKEN cDNA 3300005D01 gene |
chr3_-_106167564 | 2.02 |
ENSMUST00000063062.8
|
Chi3l3
|
chitinase 3-like 3 |
chr8_+_21391811 | 2.02 |
ENSMUST00000120874.3
|
Gm21002
|
predicted gene, 21002 |
chr1_+_136467958 | 1.99 |
ENSMUST00000047817.6
|
Kif14
|
kinesin family member 14 |
chr3_-_27153844 | 1.99 |
ENSMUST00000176242.2
ENSMUST00000176780.1 |
Ect2
|
ect2 oncogene |
chrX_+_164140447 | 1.98 |
ENSMUST00000073973.4
|
Ace2
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 2 |
chr2_+_14873656 | 1.96 |
ENSMUST00000114718.1
ENSMUST00000114719.1 |
Cacnb2
|
calcium channel, voltage-dependent, beta 2 subunit |
chr13_-_66851513 | 1.95 |
ENSMUST00000169322.1
|
Gm17404
|
predicted gene, 17404 |
chr1_+_40515362 | 1.94 |
ENSMUST00000027237.5
|
Il18rap
|
interleukin 18 receptor accessory protein |
chr11_+_5569679 | 1.88 |
ENSMUST00000109856.1
ENSMUST00000109855.1 ENSMUST00000118112.2 |
Ankrd36
|
ankyrin repeat domain 36 |
chr2_-_84822546 | 1.85 |
ENSMUST00000028471.5
|
Smtnl1
|
smoothelin-like 1 |
chr14_-_79301623 | 1.85 |
ENSMUST00000022595.7
|
Rgcc
|
regulator of cell cycle |
chr11_+_74619594 | 1.84 |
ENSMUST00000100866.2
|
E130309D14Rik
|
RIKEN cDNA E130309D14 gene |
chr15_-_103252810 | 1.84 |
ENSMUST00000154510.1
|
Nfe2
|
nuclear factor, erythroid derived 2 |
chr17_+_5799616 | 1.80 |
ENSMUST00000181392.1
|
3300005D01Rik
|
RIKEN cDNA 3300005D01 gene |
chr17_+_29114142 | 1.77 |
ENSMUST00000141797.1
ENSMUST00000132262.1 ENSMUST00000141239.1 ENSMUST00000138816.1 |
Gm16194
|
predicted gene 16194 |
chr11_+_32286946 | 1.77 |
ENSMUST00000101387.3
|
Hbq1b
|
hemoglobin, theta 1B |
chr1_-_144775419 | 1.77 |
ENSMUST00000027603.3
|
Rgs18
|
regulator of G-protein signaling 18 |
chr4_-_46404224 | 1.74 |
ENSMUST00000107764.2
|
Hemgn
|
hemogen |
chr3_-_52104891 | 1.73 |
ENSMUST00000121440.1
|
Maml3
|
mastermind like 3 (Drosophila) |
chr5_-_148392810 | 1.72 |
ENSMUST00000138257.1
|
Slc7a1
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
chrX_+_68761839 | 1.71 |
ENSMUST00000069731.5
|
Fmr1nb
|
fragile X mental retardation 1 neighbor |
chr9_+_96196246 | 1.69 |
ENSMUST00000165120.2
ENSMUST00000034982.9 |
Tfdp2
|
transcription factor Dp 2 |
chr18_-_47333311 | 1.68 |
ENSMUST00000126684.1
ENSMUST00000156422.1 |
Sema6a
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6A |
chr8_-_53638945 | 1.65 |
ENSMUST00000047768.4
|
Neil3
|
nei like 3 (E. coli) |
chr7_-_103853199 | 1.63 |
ENSMUST00000033229.3
|
Hbb-y
|
hemoglobin Y, beta-like embryonic chain |
chr14_+_51853699 | 1.62 |
ENSMUST00000169070.1
ENSMUST00000074477.6 |
Ear6
|
eosinophil-associated, ribonuclease A family, member 6 |
chrX_+_163911401 | 1.61 |
ENSMUST00000140845.1
|
Ap1s2
|
adaptor-related protein complex 1, sigma 2 subunit |
chr9_+_51213683 | 1.60 |
ENSMUST00000034554.7
|
Pou2af1
|
POU domain, class 2, associating factor 1 |
chr10_+_88091070 | 1.60 |
ENSMUST00000048621.7
|
Pmch
|
pro-melanin-concentrating hormone |
chr7_-_67803489 | 1.59 |
ENSMUST00000181235.1
|
4833412C05Rik
|
RIKEN cDNA 4833412C05 gene |
chr5_-_149051300 | 1.58 |
ENSMUST00000110505.1
|
Hmgb1
|
high mobility group box 1 |
chr7_-_38107490 | 1.54 |
ENSMUST00000108023.3
|
Ccne1
|
cyclin E1 |
chrX_+_93675088 | 1.54 |
ENSMUST00000045898.3
|
Pcyt1b
|
phosphate cytidylyltransferase 1, choline, beta isoform |
chr7_+_110773658 | 1.48 |
ENSMUST00000143786.1
|
Ampd3
|
adenosine monophosphate deaminase 3 |
chrX_-_7740206 | 1.47 |
ENSMUST00000128289.1
|
Ccdc120
|
coiled-coil domain containing 120 |
chr19_+_37376359 | 1.46 |
ENSMUST00000012587.3
|
Kif11
|
kinesin family member 11 |
chr16_+_44943678 | 1.43 |
ENSMUST00000114613.2
ENSMUST00000114612.1 ENSMUST00000077178.6 ENSMUST00000048479.7 ENSMUST00000114611.3 ENSMUST00000164007.1 ENSMUST00000171779.1 |
Cd200r3
|
CD200 receptor 3 |
chr6_+_34412334 | 1.41 |
ENSMUST00000007449.8
|
Akr1b7
|
aldo-keto reductase family 1, member B7 |
chr2_-_170406501 | 1.39 |
ENSMUST00000154650.1
|
Bcas1
|
breast carcinoma amplified sequence 1 |
chrX_+_35888808 | 1.37 |
ENSMUST00000033419.6
|
Dock11
|
dedicator of cytokinesis 11 |
chr10_+_82985473 | 1.37 |
ENSMUST00000040110.7
|
Chst11
|
carbohydrate sulfotransferase 11 |
chr4_-_117178726 | 1.36 |
ENSMUST00000153953.1
ENSMUST00000106436.1 |
Kif2c
|
kinesin family member 2C |
chr13_+_104229366 | 1.35 |
ENSMUST00000022227.6
|
Cenpk
|
centromere protein K |
chr13_+_21717626 | 1.33 |
ENSMUST00000091754.2
|
Hist1h3h
|
histone cluster 1, H3h |
chr4_-_133967235 | 1.32 |
ENSMUST00000123234.1
|
Hmgn2
|
high mobility group nucleosomal binding domain 2 |
chr4_+_134315112 | 1.29 |
ENSMUST00000105875.1
ENSMUST00000030638.6 |
Trim63
|
tripartite motif-containing 63 |
chr1_-_45503282 | 1.28 |
ENSMUST00000086430.4
|
Col5a2
|
collagen, type V, alpha 2 |
chrX_-_9256899 | 1.28 |
ENSMUST00000115553.2
|
Gm14862
|
predicted gene 14862 |
chr9_+_65890237 | 1.27 |
ENSMUST00000045802.6
|
2810417H13Rik
|
RIKEN cDNA 2810417H13 gene |
chr4_-_87806276 | 1.27 |
ENSMUST00000148059.1
|
Mllt3
|
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 3 |
chr2_-_127133909 | 1.27 |
ENSMUST00000110387.3
|
Ncaph
|
non-SMC condensin I complex, subunit H |
chr7_-_115824699 | 1.26 |
ENSMUST00000169129.1
|
Sox6
|
SRY-box containing gene 6 |
chr13_-_98815408 | 1.26 |
ENSMUST00000040340.8
ENSMUST00000099277.4 ENSMUST00000179563.1 ENSMUST00000109403.1 |
Fcho2
|
FCH domain only 2 |
chr19_+_47228804 | 1.25 |
ENSMUST00000111807.3
|
Neurl1a
|
neuralized homolog 1A (Drosophila) |
chr2_+_130277157 | 1.25 |
ENSMUST00000028890.8
ENSMUST00000159373.1 |
Nop56
|
NOP56 ribonucleoprotein |
chr7_+_43351378 | 1.25 |
ENSMUST00000012798.7
ENSMUST00000122423.1 ENSMUST00000121494.1 |
Siglec5
|
sialic acid binding Ig-like lectin 5 |
chr10_+_37139558 | 1.24 |
ENSMUST00000062667.3
|
5930403N24Rik
|
RIKEN cDNA 5930403N24 gene |
chr1_+_107535508 | 1.24 |
ENSMUST00000182198.1
|
Serpinb10
|
serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 10 |
chr1_-_133753681 | 1.24 |
ENSMUST00000125659.1
ENSMUST00000165602.2 ENSMUST00000048953.7 |
Atp2b4
|
ATPase, Ca++ transporting, plasma membrane 4 |
chr7_-_24760311 | 1.24 |
ENSMUST00000063956.5
|
Cd177
|
CD177 antigen |
chr8_+_66386292 | 1.23 |
ENSMUST00000039540.5
ENSMUST00000110253.2 |
March1
|
membrane-associated ring finger (C3HC4) 1 |
chr12_+_109734969 | 1.23 |
ENSMUST00000182268.1
ENSMUST00000181543.2 ENSMUST00000183116.1 |
Mirg
|
miRNA containing gene |
chr14_+_11227511 | 1.22 |
ENSMUST00000080237.3
|
Rpl21-ps4
|
ribosomal protein L21, pseudogene 4 |
chr17_-_35085609 | 1.21 |
ENSMUST00000038507.6
|
Ly6g6f
|
lymphocyte antigen 6 complex, locus G6F |
chr7_+_79660196 | 1.21 |
ENSMUST00000035977.7
|
Ticrr
|
TOPBP1-interacting checkpoint and replication regulator |
chr12_-_4874341 | 1.20 |
ENSMUST00000137337.1
ENSMUST00000045921.7 |
Mfsd2b
|
major facilitator superfamily domain containing 2B |
chr4_+_52439235 | 1.19 |
ENSMUST00000117280.1
ENSMUST00000102915.3 ENSMUST00000142227.1 |
Smc2
|
structural maintenance of chromosomes 2 |
chr15_+_35296090 | 1.19 |
ENSMUST00000022952.4
|
Osr2
|
odd-skipped related 2 |
chr11_+_69045640 | 1.18 |
ENSMUST00000108666.1
ENSMUST00000021277.5 |
Aurkb
|
aurora kinase B |
chr2_-_168601620 | 1.18 |
ENSMUST00000171689.1
ENSMUST00000137451.1 |
Nfatc2
|
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 2 |
chr1_-_126738167 | 1.17 |
ENSMUST00000160693.1
|
Nckap5
|
NCK-associated protein 5 |
chrX_+_68761875 | 1.17 |
ENSMUST00000114647.1
|
Fmr1nb
|
fragile X mental retardation 1 neighbor |
chr9_-_21963568 | 1.17 |
ENSMUST00000006397.5
|
Epor
|
erythropoietin receptor |
chr12_+_109549157 | 1.17 |
ENSMUST00000128458.1
ENSMUST00000150851.1 |
Meg3
|
maternally expressed 3 |
chr11_+_69095217 | 1.16 |
ENSMUST00000101004.2
|
Per1
|
period circadian clock 1 |
chr11_-_101551837 | 1.16 |
ENSMUST00000017290.4
|
Brca1
|
breast cancer 1 |
chrX_+_159697308 | 1.16 |
ENSMUST00000123433.1
|
Sh3kbp1
|
SH3-domain kinase binding protein 1 |
chr13_-_100775844 | 1.15 |
ENSMUST00000075550.3
|
Cenph
|
centromere protein H |
chrX_-_102250940 | 1.14 |
ENSMUST00000134887.1
|
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr13_+_5861489 | 1.13 |
ENSMUST00000000080.6
|
Klf6
|
Kruppel-like factor 6 |
chr15_+_61985540 | 1.13 |
ENSMUST00000159327.1
ENSMUST00000167731.1 |
Myc
|
myelocytomatosis oncogene |
chr14_+_55765956 | 1.12 |
ENSMUST00000057569.3
|
Ltb4r1
|
leukotriene B4 receptor 1 |
chr11_-_102925086 | 1.11 |
ENSMUST00000021311.9
|
Kif18b
|
kinesin family member 18B |
chr12_+_111971545 | 1.11 |
ENSMUST00000079009.5
|
Tdrd9
|
tudor domain containing 9 |
chr16_+_17146937 | 1.11 |
ENSMUST00000115706.1
ENSMUST00000069064.4 |
Ydjc
|
YdjC homolog (bacterial) |
chr12_-_111980751 | 1.11 |
ENSMUST00000170525.1
|
BC048943
|
cDNA sequence BC048943 |
chr16_-_18811972 | 1.10 |
ENSMUST00000000028.7
ENSMUST00000115585.1 |
Cdc45
|
cell division cycle 45 |
chr12_+_71136848 | 1.10 |
ENSMUST00000149564.1
ENSMUST00000045907.8 |
2700049A03Rik
|
RIKEN cDNA 2700049A03 gene |
chr6_+_8520008 | 1.09 |
ENSMUST00000162567.1
ENSMUST00000161217.1 |
Glcci1
|
glucocorticoid induced transcript 1 |
chr9_-_60838200 | 1.09 |
ENSMUST00000063858.7
|
Gm9869
|
predicted gene 9869 |
chr2_+_131133497 | 1.09 |
ENSMUST00000110225.1
|
Gm11037
|
predicted gene 11037 |
chr10_+_20347788 | 1.09 |
ENSMUST00000169712.1
|
Mtfr2
|
mitochondrial fission regulator 2 |
chr15_+_61985377 | 1.08 |
ENSMUST00000161976.1
ENSMUST00000022971.7 |
Myc
|
myelocytomatosis oncogene |
chr14_-_87141114 | 1.08 |
ENSMUST00000168889.1
|
Diap3
|
diaphanous homolog 3 (Drosophila) |
chr15_+_79348061 | 1.07 |
ENSMUST00000163691.1
|
Maff
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein F (avian) |
chr6_-_7693110 | 1.07 |
ENSMUST00000126303.1
|
Asns
|
asparagine synthetase |
chr2_+_174450678 | 1.06 |
ENSMUST00000016399.5
|
Tubb1
|
tubulin, beta 1 class VI |
chr6_-_70792155 | 1.06 |
ENSMUST00000066134.5
|
Rpia
|
ribose 5-phosphate isomerase A |
chr14_-_60086832 | 1.05 |
ENSMUST00000080368.5
|
Atp8a2
|
ATPase, aminophospholipid transporter-like, class I, type 8A, member 2 |
chr18_-_60501983 | 1.04 |
ENSMUST00000042710.6
|
Smim3
|
small integral membrane protein 3 |
chr7_+_80186835 | 1.04 |
ENSMUST00000107383.1
ENSMUST00000032754.7 |
Sema4b
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
chr16_-_74411292 | 1.03 |
ENSMUST00000117200.1
|
Robo2
|
roundabout homolog 2 (Drosophila) |
chr5_+_110330697 | 1.03 |
ENSMUST00000112481.1
|
Pole
|
polymerase (DNA directed), epsilon |
chr15_-_58324161 | 1.03 |
ENSMUST00000022985.1
|
Klhl38
|
kelch-like 38 |
chr4_+_11191354 | 1.03 |
ENSMUST00000170901.1
|
Ccne2
|
cyclin E2 |
chr2_+_128126030 | 1.03 |
ENSMUST00000089634.5
ENSMUST00000019281.7 ENSMUST00000110341.2 ENSMUST00000103211.1 ENSMUST00000103210.1 |
Bcl2l11
|
BCL2-like 11 (apoptosis facilitator) |
chr5_-_149051604 | 1.02 |
ENSMUST00000093196.4
|
Hmgb1
|
high mobility group box 1 |
chr17_+_40115358 | 1.02 |
ENSMUST00000061746.7
|
Gm7148
|
predicted gene 7148 |
chr18_-_70141568 | 1.02 |
ENSMUST00000121693.1
|
Rab27b
|
RAB27b, member RAS oncogene family |
chr2_+_119047116 | 1.02 |
ENSMUST00000152380.1
ENSMUST00000099542.2 |
Casc5
|
cancer susceptibility candidate 5 |
chr6_-_56369625 | 1.01 |
ENSMUST00000170774.1
ENSMUST00000168944.1 ENSMUST00000166890.1 |
Pde1c
|
phosphodiesterase 1C |
chr9_-_32928928 | 1.01 |
ENSMUST00000185169.1
|
RP24-308I2.1
|
RP24-308I2.1 |
chr7_+_110774240 | 1.01 |
ENSMUST00000147587.1
|
Ampd3
|
adenosine monophosphate deaminase 3 |
chrX_-_102252154 | 1.01 |
ENSMUST00000050551.3
|
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr15_+_74714832 | 1.01 |
ENSMUST00000023265.3
|
Psca
|
prostate stem cell antigen |
chr3_-_36571952 | 1.00 |
ENSMUST00000029270.3
|
Ccna2
|
cyclin A2 |
chr1_-_89933290 | 1.00 |
ENSMUST00000036954.7
|
Gbx2
|
gastrulation brain homeobox 2 |
chr2_+_118598209 | 1.00 |
ENSMUST00000038341.7
|
Bub1b
|
budding uninhibited by benzimidazoles 1 homolog, beta (S. cerevisiae) |
chr7_+_99535652 | 0.99 |
ENSMUST00000032995.8
ENSMUST00000162404.1 |
Arrb1
|
arrestin, beta 1 |
chr6_+_90619241 | 0.99 |
ENSMUST00000032177.8
|
Slc41a3
|
solute carrier family 41, member 3 |
chr9_+_78615501 | 0.99 |
ENSMUST00000093812.4
|
Cd109
|
CD109 antigen |
chr11_-_12027958 | 0.98 |
ENSMUST00000109654.1
|
Grb10
|
growth factor receptor bound protein 10 |
chr12_+_95695350 | 0.98 |
ENSMUST00000110117.1
|
Flrt2
|
fibronectin leucine rich transmembrane protein 2 |
chr19_+_53329413 | 0.98 |
ENSMUST00000025998.7
|
Mxi1
|
Max interacting protein 1 |
chr3_+_51661167 | 0.97 |
ENSMUST00000099106.3
|
Mgst2
|
microsomal glutathione S-transferase 2 |
chr7_-_103813913 | 0.97 |
ENSMUST00000098192.3
|
Hbb-bt
|
hemoglobin, beta adult t chain |
chr14_+_55853997 | 0.96 |
ENSMUST00000100529.3
|
Nynrin
|
NYN domain and retroviral integrase containing |
chr9_-_58741543 | 0.96 |
ENSMUST00000098674.4
|
2410076I21Rik
|
RIKEN cDNA 2410076I21 gene |
chr1_+_153751859 | 0.96 |
ENSMUST00000182538.1
|
Rnasel
|
ribonuclease L (2', 5'-oligoisoadenylate synthetase-dependent) |
chr2_-_170194033 | 0.95 |
ENSMUST00000180625.1
|
Gm17619
|
predicted gene, 17619 |
chr14_-_56085214 | 0.95 |
ENSMUST00000015594.7
|
Mcpt8
|
mast cell protease 8 |
chr1_+_40084764 | 0.95 |
ENSMUST00000027243.7
|
Il1r2
|
interleukin 1 receptor, type II |
chr17_+_43568269 | 0.94 |
ENSMUST00000024706.5
|
Pla2g7
|
phospholipase A2, group VII (platelet-activating factor acetylhydrolase, plasma) |
chr15_+_79347534 | 0.92 |
ENSMUST00000096350.3
|
Maff
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein F (avian) |
chr11_+_34047115 | 0.92 |
ENSMUST00000109329.1
ENSMUST00000169878.2 |
Lcp2
|
lymphocyte cytosolic protein 2 |
chr19_-_11623643 | 0.92 |
ENSMUST00000164792.1
ENSMUST00000025583.5 |
Ms4a2
|
membrane-spanning 4-domains, subfamily A, member 2 |
chrX_+_68761890 | 0.92 |
ENSMUST00000071848.6
|
Fmr1nb
|
fragile X mental retardation 1 neighbor |
chr4_-_43499608 | 0.90 |
ENSMUST00000136005.1
ENSMUST00000054538.6 |
Arhgef39
|
Rho guanine nucleotide exchange factor (GEF) 39 |
chr2_+_84839395 | 0.90 |
ENSMUST00000146816.1
ENSMUST00000028469.7 |
Slc43a1
|
solute carrier family 43, member 1 |
chr3_-_92588982 | 0.90 |
ENSMUST00000098888.5
|
Smcp
|
sperm mitochondria-associated cysteine-rich protein |
chr18_-_36197343 | 0.90 |
ENSMUST00000115713.1
ENSMUST00000115712.1 |
Nrg2
|
neuregulin 2 |
chr16_+_32756336 | 0.90 |
ENSMUST00000135753.1
|
Muc4
|
mucin 4 |
chr15_+_54410755 | 0.90 |
ENSMUST00000036737.3
|
Colec10
|
collectin sub-family member 10 |
chr7_-_45211877 | 0.89 |
ENSMUST00000033057.7
|
Dkkl1
|
dickkopf-like 1 |
chrX_+_21484532 | 0.89 |
ENSMUST00000089188.2
|
Agtr2
|
angiotensin II receptor, type 2 |
chr4_-_117182623 | 0.89 |
ENSMUST00000065896.2
|
Kif2c
|
kinesin family member 2C |
chr7_+_19291070 | 0.88 |
ENSMUST00000108468.3
|
Rtn2
|
reticulon 2 (Z-band associated protein) |
chr6_-_25690729 | 0.88 |
ENSMUST00000054867.6
|
Gpr37
|
G protein-coupled receptor 37 |
chr12_-_99883429 | 0.88 |
ENSMUST00000046485.3
|
Efcab11
|
EF-hand calcium binding domain 11 |
chr7_+_120843551 | 0.88 |
ENSMUST00000106489.1
ENSMUST00000143279.1 |
Eef2k
|
eukaryotic elongation factor-2 kinase |
chrX_-_88760312 | 0.88 |
ENSMUST00000182943.1
|
Gm27000
|
predicted gene, 27000 |
chr11_+_11489266 | 0.87 |
ENSMUST00000109678.1
|
4930415F15Rik
|
RIKEN cDNA 4930415F15 gene |
chr8_+_21025545 | 0.87 |
ENSMUST00000076754.2
|
Defa21
|
defensin, alpha, 21 |
chr15_-_99651580 | 0.87 |
ENSMUST00000171908.1
ENSMUST00000171702.1 ENSMUST00000109581.2 ENSMUST00000169810.1 ENSMUST00000023756.5 |
Racgap1
|
Rac GTPase-activating protein 1 |
chr17_+_43568096 | 0.87 |
ENSMUST00000167214.1
|
Pla2g7
|
phospholipase A2, group VII (platelet-activating factor acetylhydrolase, plasma) |
chr3_+_84666192 | 0.86 |
ENSMUST00000107682.1
|
Tmem154
|
transmembrane protein 154 |
chr13_+_104228929 | 0.86 |
ENSMUST00000070761.3
|
Cenpk
|
centromere protein K |
chr7_+_110777653 | 0.86 |
ENSMUST00000148292.1
|
Ampd3
|
adenosine monophosphate deaminase 3 |
chrX_-_104671048 | 0.85 |
ENSMUST00000042070.5
|
Zdhhc15
|
zinc finger, DHHC domain containing 15 |
chr16_-_22657182 | 0.85 |
ENSMUST00000023578.7
|
Dgkg
|
diacylglycerol kinase, gamma |
chr10_+_60349318 | 0.85 |
ENSMUST00000105459.1
|
4632428N05Rik
|
RIKEN cDNA 4632428N05 gene |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 13.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
1.4 | 4.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
1.0 | 2.9 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
0.9 | 0.9 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
0.9 | 2.6 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
0.9 | 2.6 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
0.9 | 7.7 | GO:0032264 | IMP salvage(GO:0032264) |
0.8 | 4.5 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
0.7 | 3.7 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.7 | 2.0 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
0.7 | 2.0 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.6 | 5.0 | GO:0015671 | oxygen transport(GO:0015671) |
0.6 | 1.8 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.6 | 2.2 | GO:0044330 | canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
0.5 | 2.1 | GO:0071104 | response to interleukin-9(GO:0071104) |
0.5 | 1.6 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.5 | 1.6 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
0.5 | 2.1 | GO:0015801 | angiotensin-mediated drinking behavior(GO:0003051) aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.5 | 1.5 | GO:1901254 | regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
0.5 | 5.5 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.4 | 2.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.4 | 1.3 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
0.4 | 1.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.4 | 9.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.4 | 1.3 | GO:2000373 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.4 | 7.5 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.4 | 1.2 | GO:0090172 | microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
0.4 | 1.2 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
0.4 | 1.1 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.4 | 1.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.4 | 1.8 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.3 | 1.0 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
0.3 | 1.0 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.3 | 5.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.3 | 1.3 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.3 | 1.0 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
0.3 | 0.7 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.3 | 1.3 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.3 | 1.8 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.3 | 1.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.3 | 0.8 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.3 | 1.3 | GO:0070837 | xenobiotic transport(GO:0042908) dehydroascorbic acid transport(GO:0070837) |
0.3 | 0.3 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.3 | 1.1 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.3 | 7.4 | GO:0014823 | response to activity(GO:0014823) |
0.3 | 1.3 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
0.3 | 3.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.3 | 0.8 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 1.0 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.3 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.3 | 1.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.3 | 0.8 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
0.3 | 1.8 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.2 | 6.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.2 | 2.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 1.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.2 | 0.7 | GO:0033189 | response to vitamin A(GO:0033189) |
0.2 | 1.2 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.2 | 1.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.9 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.2 | 2.5 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.2 | 5.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.2 | 0.9 | GO:0035566 | renin-angiotensin regulation of aldosterone production(GO:0002018) regulation of metanephros size(GO:0035566) |
0.2 | 0.7 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
0.2 | 1.3 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.2 | 0.6 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.2 | 0.6 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
0.2 | 1.6 | GO:0015074 | DNA integration(GO:0015074) |
0.2 | 1.2 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.2 | 1.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.2 | 2.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.2 | 0.8 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.6 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
0.2 | 1.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.2 | 0.8 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
0.2 | 0.4 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
0.2 | 2.1 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.2 | 4.7 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.2 | 1.5 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.2 | 0.6 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 0.6 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
0.2 | 0.9 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.2 | 0.7 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.2 | 0.5 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.2 | 0.7 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.2 | 0.9 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.2 | 1.8 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.2 | 0.2 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
0.2 | 0.5 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
0.2 | 1.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.2 | 0.3 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.2 | 0.5 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
0.2 | 1.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.2 | 0.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.2 | 1.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 0.5 | GO:0014891 | striated muscle atrophy(GO:0014891) |
0.2 | 1.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 0.6 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.2 | 1.3 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.2 | 2.5 | GO:0015809 | arginine transport(GO:0015809) |
0.1 | 0.4 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.9 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) |
0.1 | 2.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 2.8 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.6 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 1.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 0.5 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
0.1 | 0.5 | GO:1902943 | regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) positive regulation of gastro-intestinal system smooth muscle contraction(GO:1904306) |
0.1 | 0.7 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.1 | 1.3 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 1.0 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.4 | GO:0070543 | response to linoleic acid(GO:0070543) |
0.1 | 0.5 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.3 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.1 | 0.4 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.4 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
0.1 | 1.3 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 0.5 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.1 | 0.5 | GO:0033367 | protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
0.1 | 0.4 | GO:0071725 | detection of bacterial lipopeptide(GO:0070340) response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 0.5 | GO:1900108 | sequestering of BMP in extracellular matrix(GO:0035582) negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.9 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 0.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 1.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.1 | 2.4 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 1.5 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.7 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.1 | 0.6 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 1.6 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 1.4 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.3 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
0.1 | 0.3 | GO:0009753 | sesquiterpenoid metabolic process(GO:0006714) response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
0.1 | 0.6 | GO:0090669 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) telomerase RNA stabilization(GO:0090669) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.4 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.4 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.8 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.3 | GO:0003127 | detection of nodal flow(GO:0003127) detection of endogenous stimulus(GO:0009726) |
0.1 | 0.4 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.1 | 1.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 0.3 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) |
0.1 | 0.9 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.1 | 1.8 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.3 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.3 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.8 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.1 | 0.3 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
0.1 | 0.4 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.8 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.6 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.3 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.3 | GO:1904732 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.1 | 0.7 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.1 | 0.3 | GO:0030824 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
0.1 | 1.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.4 | GO:0098953 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
0.1 | 2.9 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.1 | 0.9 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 0.9 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 1.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.4 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.1 | 1.5 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.9 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.6 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.6 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.1 | 0.5 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.5 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.6 | GO:0070197 | nuclear matrix organization(GO:0043578) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) nuclear matrix anchoring at nuclear membrane(GO:0090292) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.1 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
0.1 | 0.3 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 2.2 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.1 | 0.7 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 2.5 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.4 | GO:2001205 | negative regulation of osteoclast development(GO:2001205) |
0.1 | 1.2 | GO:0051383 | kinetochore organization(GO:0051383) |
0.1 | 0.4 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.3 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.3 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
0.1 | 0.5 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.2 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.1 | 0.3 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.1 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.1 | 0.2 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.1 | 0.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.4 | GO:0021631 | optic nerve morphogenesis(GO:0021631) negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.1 | 0.3 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
0.1 | 0.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.4 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.1 | 0.8 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.8 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.4 | GO:1902564 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.5 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.1 | 0.5 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.1 | 0.5 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) |
0.1 | 0.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.4 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.1 | 0.2 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.4 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.1 | 0.3 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.1 | GO:0036292 | DNA rewinding(GO:0036292) |
0.1 | 0.3 | GO:0042125 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
0.1 | 0.3 | GO:0014841 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
0.1 | 0.5 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.3 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.1 | 0.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 0.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.1 | 0.2 | GO:2000845 | positive regulation of testosterone secretion(GO:2000845) |
0.1 | 0.3 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.3 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 2.6 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.1 | 0.1 | GO:0002448 | mast cell mediated immunity(GO:0002448) |
0.1 | 0.4 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.1 | 0.5 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.1 | 1.2 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 0.4 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.1 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.1 | 0.7 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 1.0 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.2 | GO:1990743 | protein sialylation(GO:1990743) |
0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.3 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
0.1 | 0.7 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.2 | GO:0036451 | cap mRNA methylation(GO:0036451) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.7 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.3 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.9 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.4 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 1.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.6 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.1 | 0.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.1 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.1 | 0.4 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.1 | 0.7 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 0.2 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.1 | 1.7 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.1 | 0.4 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.6 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.1 | 0.1 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
0.1 | 0.3 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.2 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
0.0 | 0.3 | GO:1902748 | melanocyte migration(GO:0097324) positive regulation of lens fiber cell differentiation(GO:1902748) |
0.0 | 1.2 | GO:1901739 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.3 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 1.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 1.0 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.6 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.0 | 0.7 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.0 | 1.8 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 1.4 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.4 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.1 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
0.0 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 1.5 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 1.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 1.3 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.0 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.1 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.0 | 1.8 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
0.0 | 0.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.6 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.7 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.5 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.2 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.2 | GO:0060032 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
0.0 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.3 | GO:0060921 | cardiac pacemaker cell differentiation(GO:0060920) sinoatrial node cell differentiation(GO:0060921) cardiac pacemaker cell development(GO:0060926) sinoatrial node cell development(GO:0060931) |
0.0 | 0.4 | GO:0033292 | T-tubule organization(GO:0033292) protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) regulation of SA node cell action potential(GO:0098907) |
0.0 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.4 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.7 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 1.2 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.4 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.6 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.1 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
0.0 | 0.4 | GO:0035878 | nail development(GO:0035878) |
0.0 | 1.9 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 0.2 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.3 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
0.0 | 0.3 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.0 | 0.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.7 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.8 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.5 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.5 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
0.0 | 0.3 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 1.1 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 4.1 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.5 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.2 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 1.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.4 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.3 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 0.2 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.1 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.0 | 0.1 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.4 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 1.1 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.6 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.2 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.3 | GO:0010650 | positive regulation of cell communication by electrical coupling(GO:0010650) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
0.0 | 0.1 | GO:0002355 | detection of tumor cell(GO:0002355) |
0.0 | 0.6 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.6 | GO:0002504 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.4 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.1 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.0 | 0.5 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.3 | GO:1900120 | regulation of receptor binding(GO:1900120) |
0.0 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.6 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.2 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.1 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.0 | 0.8 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.0 | 0.3 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 1.1 | GO:0071514 | genetic imprinting(GO:0071514) |
0.0 | 0.2 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 1.0 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 1.5 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
0.0 | 0.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.2 | GO:0045974 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.3 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.5 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.3 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.4 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.1 | GO:0090220 | telomere localization(GO:0034397) meiotic telomere clustering(GO:0045141) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
0.0 | 1.2 | GO:0045576 | mast cell activation(GO:0045576) |
0.0 | 1.1 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:2000407 | regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.2 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.6 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.4 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.3 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.2 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 1.1 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.0 | 0.6 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.2 | GO:0030903 | notochord development(GO:0030903) |
0.0 | 0.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.2 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.5 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.9 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.0 | 0.0 | GO:0048050 | B cell negative selection(GO:0002352) post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.4 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.4 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.0 | 0.1 | GO:0030220 | platelet formation(GO:0030220) |
0.0 | 0.1 | GO:1902475 | L-glutamate transmembrane transport(GO:0089711) L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
0.0 | 0.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.4 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.3 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.1 | GO:1905050 | positive regulation of metallopeptidase activity(GO:1905050) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.5 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.2 | GO:0032674 | regulation of interleukin-5 production(GO:0032674) |
0.0 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.1 | GO:0086027 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
0.0 | 0.4 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
0.0 | 0.2 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 1.4 | GO:0007051 | spindle organization(GO:0007051) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.8 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
0.0 | 0.2 | GO:0070670 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.4 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.4 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.0 | 0.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.4 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.2 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.0 | 0.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.5 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.0 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.2 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.2 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.1 | GO:0071231 | neural crest cell migration involved in heart formation(GO:0003147) cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.0 | 0.0 | GO:0090273 | somatostatin secretion(GO:0070253) regulation of somatostatin secretion(GO:0090273) |
0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.2 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 7.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
1.1 | 3.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
1.0 | 14.7 | GO:0042555 | MCM complex(GO:0042555) |
0.7 | 6.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.7 | 2.9 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.6 | 1.8 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.4 | 1.3 | GO:0098835 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.4 | 1.5 | GO:1902737 | viral replication complex(GO:0019034) dendritic filopodium(GO:1902737) |
0.4 | 1.1 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
0.4 | 2.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.4 | 4.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.4 | 1.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.3 | 1.4 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.3 | 0.3 | GO:0042585 | germinal vesicle(GO:0042585) |
0.3 | 2.8 | GO:0001939 | female pronucleus(GO:0001939) |
0.2 | 2.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 2.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 1.0 | GO:0008623 | CHRAC(GO:0008623) |
0.2 | 1.0 | GO:0030870 | Mre11 complex(GO:0030870) |
0.2 | 1.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 1.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.2 | 1.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.2 | 0.9 | GO:0014802 | terminal cisterna(GO:0014802) |
0.2 | 1.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 1.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.2 | 1.4 | GO:0070187 | telosome(GO:0070187) |
0.2 | 0.8 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
0.2 | 0.6 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 1.1 | GO:0071547 | piP-body(GO:0071547) |
0.2 | 10.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.2 | 1.2 | GO:0000796 | condensin complex(GO:0000796) |
0.2 | 1.0 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.2 | 0.9 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.6 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.8 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.4 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
0.1 | 5.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.8 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 1.4 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.1 | 0.6 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.5 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 6.4 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.5 | GO:0034715 | U7 snRNP(GO:0005683) pICln-Sm protein complex(GO:0034715) |
0.1 | 0.4 | GO:0099522 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
0.1 | 1.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.1 | 3.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 1.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.1 | 0.6 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.5 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.2 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.5 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.7 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.7 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.7 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.1 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 5.6 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.2 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.1 | 1.9 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.7 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.6 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 1.2 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.9 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.6 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 1.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 2.8 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 1.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 1.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 2.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.6 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 1.0 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.7 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 3.5 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.3 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.1 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 1.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.6 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 3.1 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.4 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 1.2 | GO:0002102 | podosome(GO:0002102) |
0.0 | 3.3 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.6 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 3.1 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
0.0 | 0.8 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.8 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 2.9 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 3.3 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.3 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.7 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.5 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 1.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 7.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 1.2 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.2 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.8 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 2.4 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.5 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 3.6 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
0.0 | 0.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 1.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.6 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.5 | GO:0034704 | calcium channel complex(GO:0034704) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 6.1 | GO:0002113 | interleukin-33 binding(GO:0002113) |
0.9 | 2.8 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.9 | 2.6 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.9 | 7.7 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.8 | 1.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.8 | 3.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
0.7 | 2.6 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.6 | 4.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.6 | 2.5 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.6 | 1.7 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.6 | 3.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.5 | 2.5 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.4 | 1.3 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
0.4 | 1.7 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.4 | 15.1 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.4 | 2.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 2.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.3 | 1.0 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
0.3 | 2.5 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.3 | 1.5 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.3 | 1.2 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.3 | 6.0 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.3 | 2.1 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.3 | 0.9 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
0.3 | 1.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) D-glucose transmembrane transporter activity(GO:0055056) |
0.3 | 1.1 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.3 | 0.8 | GO:0045352 | interleukin-1, Type II receptor binding(GO:0005151) interleukin-1 Type I receptor antagonist activity(GO:0045352) interleukin-1 Type II receptor antagonist activity(GO:0045353) |
0.3 | 1.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.2 | 1.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.2 | 1.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.9 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.2 | 0.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 0.9 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.2 | 4.1 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.2 | 3.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 1.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.2 | 0.6 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.2 | 0.8 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.2 | 10.5 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.2 | 2.2 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.2 | 1.4 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 0.8 | GO:0004092 | carnitine O-acetyltransferase activity(GO:0004092) |
0.2 | 0.8 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.2 | 0.6 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.2 | 1.8 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 0.5 | GO:0052739 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.2 | 0.7 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.2 | 0.7 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.2 | 0.7 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.2 | 0.5 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.2 | 1.5 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.2 | 0.5 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 5.0 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.2 | 1.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.2 | 0.7 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 0.5 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 0.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.2 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 0.5 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.2 | 0.5 | GO:0070737 | protein-glycine ligase activity, elongating(GO:0070737) |
0.1 | 2.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 1.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 2.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 4.7 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 2.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 1.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 0.6 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.1 | 0.7 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.4 | GO:0035500 | MH2 domain binding(GO:0035500) |
0.1 | 0.4 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
0.1 | 1.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 1.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.5 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.4 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.1 | 0.4 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 1.0 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.1 | 2.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.7 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.3 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.1 | 1.1 | GO:1903136 | cuprous ion binding(GO:1903136) |
0.1 | 0.7 | GO:0035184 | nucleosomal histone binding(GO:0031493) histone threonine kinase activity(GO:0035184) |
0.1 | 0.4 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) |
0.1 | 1.8 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0034188 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
0.1 | 2.6 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.5 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.1 | 0.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.3 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
0.1 | 1.6 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.6 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.1 | 0.4 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.3 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.6 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.3 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
0.1 | 0.3 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.1 | 1.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.3 | GO:0035827 | rubidium ion transmembrane transporter activity(GO:0035827) |
0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 1.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 11.6 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.1 | 2.9 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 1.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.8 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.3 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.1 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.1 | 0.4 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 1.1 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.2 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 1.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 1.0 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.7 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.3 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.3 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 1.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.5 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.1 | 0.3 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 0.5 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.1 | 0.3 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.2 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 2.1 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.1 | 0.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.5 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.3 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 1.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.4 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 1.6 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.5 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.7 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.1 | 0.6 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 0.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 3.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 1.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 2.8 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.0 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 1.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.8 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.0 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.2 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.3 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 1.1 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 2.9 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 1.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.2 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.0 | 1.4 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 1.3 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.0 | 0.5 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.3 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.7 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 1.6 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 1.1 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.9 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 2.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 1.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.5 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 1.6 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.5 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 1.0 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 1.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.7 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 4.6 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 2.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.7 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 1.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 1.1 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.3 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 1.6 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.1 | GO:0097617 | annealing activity(GO:0097617) |
0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.2 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 2.1 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.5 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.6 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.6 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 1.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.3 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.7 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.0 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.7 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.3 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 1.0 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.9 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.0 | 0.8 | GO:0004896 | cytokine receptor activity(GO:0004896) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 6.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.3 | 15.0 | PID ATR PATHWAY | ATR signaling pathway |
0.3 | 4.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.2 | 11.8 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 6.4 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 7.3 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 1.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 2.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 4.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 2.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 3.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 2.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 6.7 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 0.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 2.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 0.9 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.4 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.5 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 2.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 2.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 1.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 1.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 2.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 1.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.4 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 1.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 1.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 1.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.8 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 1.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 3.0 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.8 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 1.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 1.3 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.6 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.7 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 1.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.8 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 2.3 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 2.0 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.5 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 1.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.3 | PID ATM PATHWAY | ATM pathway |
0.0 | 1.5 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 1.0 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.7 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 3.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 15.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.4 | 7.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 2.7 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.3 | 1.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.2 | 6.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.2 | 9.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.2 | 3.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.2 | 3.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 4.7 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 3.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 13.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 2.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 3.8 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 4.5 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 3.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 0.4 | REACTOME DEFENSINS | Genes involved in Defensins |
0.1 | 1.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 9.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 1.0 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.1 | 1.4 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 0.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 1.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.1 | 1.0 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 3.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 1.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 2.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.1 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 1.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 2.8 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 2.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 7.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 1.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 0.8 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 1.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 2.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.4 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.8 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 6.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 2.1 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.9 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.5 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.2 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
0.0 | 0.8 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 1.4 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.0 | 0.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 5.3 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.3 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.4 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 1.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 1.7 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.3 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 1.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.9 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.0 | 0.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 2.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.2 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 4.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.4 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.3 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.5 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.4 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 1.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.2 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |