avrg: GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zfx
|
ENSMUSG00000079509.4 | zinc finger protein X-linked |
Zfp711
|
ENSMUSG00000025529.8 | zinc finger protein 711 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Zfx | mm10_v2_chrX_-_94123087_94123159 | -0.50 | 1.9e-03 | Click! |
Zfp711 | mm10_v2_chrX_+_112615301_112615301 | -0.49 | 2.4e-03 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr10_-_88503952 | 8.40 |
ENSMUST00000020253.8
|
Chpt1
|
choline phosphotransferase 1 |
chr3_-_18243289 | 7.82 |
ENSMUST00000035625.6
|
Cyp7b1
|
cytochrome P450, family 7, subfamily b, polypeptide 1 |
chr4_+_43631935 | 7.38 |
ENSMUST00000030191.8
|
Npr2
|
natriuretic peptide receptor 2 |
chr4_-_61674094 | 6.89 |
ENSMUST00000098040.3
|
Mup18
|
major urinary protein 18 |
chr4_-_60222580 | 6.35 |
ENSMUST00000095058.4
ENSMUST00000163931.1 |
Mup8
|
major urinary protein 8 |
chr10_-_88503912 | 6.16 |
ENSMUST00000117579.1
ENSMUST00000073783.5 |
Chpt1
|
choline phosphotransferase 1 |
chr4_+_63344548 | 5.96 |
ENSMUST00000030044.2
|
Orm1
|
orosomucoid 1 |
chr4_-_60499332 | 5.74 |
ENSMUST00000135953.1
|
Mup1
|
major urinary protein 1 |
chr7_-_97417730 | 5.53 |
ENSMUST00000043077.7
|
Thrsp
|
thyroid hormone responsive |
chr12_+_108334341 | 5.45 |
ENSMUST00000021684.4
|
Cyp46a1
|
cytochrome P450, family 46, subfamily a, polypeptide 1 |
chr11_-_120824098 | 5.45 |
ENSMUST00000055655.7
|
Fasn
|
fatty acid synthase |
chr15_+_76268076 | 5.11 |
ENSMUST00000074173.3
|
Spatc1
|
spermatogenesis and centriole associated 1 |
chr4_-_60421933 | 4.90 |
ENSMUST00000107506.2
ENSMUST00000122381.1 ENSMUST00000118759.1 ENSMUST00000122177.1 |
Mup9
|
major urinary protein 9 |
chr8_+_85492568 | 4.87 |
ENSMUST00000034136.5
|
Gpt2
|
glutamic pyruvate transaminase (alanine aminotransferase) 2 |
chr9_-_98955302 | 4.73 |
ENSMUST00000181706.1
|
Foxl2os
|
forkhead box L2 opposite strand transcript |
chr1_-_192834719 | 4.66 |
ENSMUST00000057543.2
|
A730013G03Rik
|
RIKEN cDNA A730013G03 gene |
chr16_+_44173271 | 4.66 |
ENSMUST00000088356.4
ENSMUST00000169582.1 |
Gm608
|
predicted gene 608 |
chr2_-_181043540 | 4.62 |
ENSMUST00000124400.1
|
Chrna4
|
cholinergic receptor, nicotinic, alpha polypeptide 4 |
chr1_+_74332596 | 4.61 |
ENSMUST00000087225.5
|
Pnkd
|
paroxysmal nonkinesiogenic dyskinesia |
chr4_-_60582152 | 4.57 |
ENSMUST00000098047.2
|
Mup10
|
major urinary protein 10 |
chr9_-_64341145 | 4.17 |
ENSMUST00000120760.1
ENSMUST00000168844.2 |
Dis3l
|
DIS3 mitotic control homolog (S. cerevisiae)-like |
chr10_-_88504073 | 4.14 |
ENSMUST00000117440.1
|
Chpt1
|
choline phosphotransferase 1 |
chr7_+_87246649 | 3.95 |
ENSMUST00000068829.5
ENSMUST00000032781.7 |
Nox4
|
NADPH oxidase 4 |
chr10_+_88459569 | 3.81 |
ENSMUST00000020252.3
ENSMUST00000125612.1 |
Sycp3
|
synaptonemal complex protein 3 |
chr7_-_141276729 | 3.80 |
ENSMUST00000167263.1
ENSMUST00000080654.5 |
Cdhr5
|
cadherin-related family member 5 |
chr4_+_43632185 | 3.73 |
ENSMUST00000107874.2
|
Npr2
|
natriuretic peptide receptor 2 |
chr1_+_74713551 | 3.67 |
ENSMUST00000027356.5
|
Cyp27a1
|
cytochrome P450, family 27, subfamily a, polypeptide 1 |
chr11_-_74925658 | 3.65 |
ENSMUST00000138612.1
ENSMUST00000123855.1 ENSMUST00000128556.1 ENSMUST00000108448.1 ENSMUST00000108447.1 ENSMUST00000065211.2 |
Srr
|
serine racemase |
chr15_+_33083110 | 3.62 |
ENSMUST00000042167.9
|
Cpq
|
carboxypeptidase Q |
chr16_-_18089022 | 3.59 |
ENSMUST00000132241.1
ENSMUST00000139861.1 ENSMUST00000003620.5 |
Prodh
|
proline dehydrogenase |
chr11_+_60105079 | 3.56 |
ENSMUST00000132012.1
|
Rai1
|
retinoic acid induced 1 |
chr4_-_61303998 | 3.50 |
ENSMUST00000071005.8
ENSMUST00000075206.5 |
Mup14
|
major urinary protein 14 |
chr9_-_64341288 | 3.49 |
ENSMUST00000068367.7
|
Dis3l
|
DIS3 mitotic control homolog (S. cerevisiae)-like |
chr8_+_107150621 | 3.48 |
ENSMUST00000034400.3
|
Cyb5b
|
cytochrome b5 type B |
chr13_-_29984219 | 3.47 |
ENSMUST00000146092.1
|
E2f3
|
E2F transcription factor 3 |
chr11_-_74925925 | 3.46 |
ENSMUST00000121738.1
|
Srr
|
serine racemase |
chr14_+_37054818 | 3.41 |
ENSMUST00000120052.1
|
Lrit1
|
leucine-rich repeat, immunoglobulin-like and transmembrane domains 1 |
chr16_+_13903152 | 3.39 |
ENSMUST00000128757.1
|
Mpv17l
|
Mpv17 transgene, kidney disease mutant-like |
chr7_-_80401707 | 3.38 |
ENSMUST00000120753.1
|
Furin
|
furin (paired basic amino acid cleaving enzyme) |
chr2_-_102400863 | 3.33 |
ENSMUST00000102573.1
|
Trim44
|
tripartite motif-containing 44 |
chr1_-_180256294 | 3.33 |
ENSMUST00000111108.3
|
Psen2
|
presenilin 2 |
chr9_-_86695897 | 3.30 |
ENSMUST00000034989.8
|
Me1
|
malic enzyme 1, NADP(+)-dependent, cytosolic |
chrX_+_99821021 | 3.19 |
ENSMUST00000096363.2
|
Tmem28
|
transmembrane protein 28 |
chr4_+_60003438 | 3.17 |
ENSMUST00000107517.1
ENSMUST00000107520.1 |
Mup6
|
major urinary protein 6 |
chr17_-_24209377 | 3.16 |
ENSMUST00000024931.4
|
Ntn3
|
netrin 3 |
chr16_+_44173239 | 3.16 |
ENSMUST00000119746.1
|
Gm608
|
predicted gene 608 |
chr4_-_62087261 | 3.15 |
ENSMUST00000107488.3
ENSMUST00000107472.1 ENSMUST00000084531.4 |
Mup3
|
major urinary protein 3 |
chr1_+_78657874 | 3.13 |
ENSMUST00000134566.1
ENSMUST00000142704.1 ENSMUST00000053760.5 |
Acsl3
Utp14b
|
acyl-CoA synthetase long-chain family member 3 UTP14, U3 small nucleolar ribonucleoprotein, homolog B (yeast) |
chr9_+_54863742 | 3.13 |
ENSMUST00000034843.7
|
Ireb2
|
iron responsive element binding protein 2 |
chr7_-_34655500 | 3.12 |
ENSMUST00000032709.1
|
Kctd15
|
potassium channel tetramerisation domain containing 15 |
chr2_-_73386396 | 3.12 |
ENSMUST00000112044.1
ENSMUST00000112043.1 ENSMUST00000076463.5 |
Gpr155
|
G protein-coupled receptor 155 |
chr4_-_59960659 | 3.11 |
ENSMUST00000075973.2
|
Mup4
|
major urinary protein 4 |
chrX_+_36598199 | 3.06 |
ENSMUST00000073339.6
|
Pgrmc1
|
progesterone receptor membrane component 1 |
chr5_+_65764073 | 3.03 |
ENSMUST00000138239.1
ENSMUST00000087264.3 |
N4bp2
|
NEDD4 binding protein 2 |
chr2_-_33371400 | 3.03 |
ENSMUST00000113164.1
ENSMUST00000091039.2 ENSMUST00000042615.6 |
Ralgps1
|
Ral GEF with PH domain and SH3 binding motif 1 |
chr4_-_148159838 | 3.02 |
ENSMUST00000151127.1
ENSMUST00000105705.2 |
Fbxo44
|
F-box protein 44 |
chr4_-_61519467 | 2.97 |
ENSMUST00000095051.5
ENSMUST00000107483.1 |
Mup16
|
major urinary protein 16 |
chr11_-_120784183 | 2.95 |
ENSMUST00000026156.7
|
Rfng
|
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr15_-_10470490 | 2.87 |
ENSMUST00000136591.1
|
Dnajc21
|
DnaJ (Hsp40) homolog, subfamily C, member 21 |
chr4_-_60070411 | 2.83 |
ENSMUST00000079697.3
ENSMUST00000125282.1 ENSMUST00000166098.1 |
Mup7
|
major urinary protein 7 |
chr11_-_50325599 | 2.83 |
ENSMUST00000179865.1
ENSMUST00000020637.8 |
Canx
|
calnexin |
chr3_+_63295815 | 2.81 |
ENSMUST00000029400.1
|
Mme
|
membrane metallo endopeptidase |
chr7_+_143052739 | 2.80 |
ENSMUST00000037941.9
|
Cd81
|
CD81 antigen |
chr4_+_83525540 | 2.76 |
ENSMUST00000053414.6
ENSMUST00000126429.1 |
Ccdc171
|
coiled-coil domain containing 171 |
chr19_+_46131888 | 2.76 |
ENSMUST00000043739.3
|
Elovl3
|
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
chr1_-_153900198 | 2.76 |
ENSMUST00000123490.1
|
5830403L16Rik
|
RIKEN cDNA 5830403L16 gene |
chr4_+_106316187 | 2.73 |
ENSMUST00000165709.1
ENSMUST00000106798.1 ENSMUST00000094933.4 |
Usp24
|
ubiquitin specific peptidase 24 |
chr4_-_62054112 | 2.73 |
ENSMUST00000074018.3
|
Mup20
|
major urinary protein 20 |
chr11_+_35769462 | 2.72 |
ENSMUST00000018990.7
|
Pank3
|
pantothenate kinase 3 |
chr6_+_47454320 | 2.71 |
ENSMUST00000031697.8
|
Cul1
|
cullin 1 |
chr10_-_83337440 | 2.70 |
ENSMUST00000126617.1
|
Slc41a2
|
solute carrier family 41, member 2 |
chr18_+_24205722 | 2.70 |
ENSMUST00000170243.1
|
Galnt1
|
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 1 |
chr18_+_38418946 | 2.69 |
ENSMUST00000025293.3
|
Ndfip1
|
Nedd4 family interacting protein 1 |
chr4_+_33209259 | 2.69 |
ENSMUST00000108159.1
|
Srsf12
|
serine/arginine-rich splicing factor 12 |
chr9_+_108854024 | 2.56 |
ENSMUST00000098376.3
|
Slc26a6
|
solute carrier family 26, member 6 |
chr13_-_9764943 | 2.53 |
ENSMUST00000110634.1
|
Zmynd11
|
zinc finger, MYND domain containing 11 |
chr13_-_9765137 | 2.50 |
ENSMUST00000062658.8
ENSMUST00000130151.1 ENSMUST00000110636.1 ENSMUST00000152725.1 |
Zmynd11
|
zinc finger, MYND domain containing 11 |
chr4_-_105109829 | 2.48 |
ENSMUST00000030243.7
|
Prkaa2
|
protein kinase, AMP-activated, alpha 2 catalytic subunit |
chr12_-_108179210 | 2.48 |
ENSMUST00000125916.2
ENSMUST00000109879.1 |
Setd3
|
SET domain containing 3 |
chr8_+_13159135 | 2.47 |
ENSMUST00000033824.6
|
Lamp1
|
lysosomal-associated membrane protein 1 |
chr11_+_94327984 | 2.46 |
ENSMUST00000107818.2
ENSMUST00000051221.6 |
Ankrd40
|
ankyrin repeat domain 40 |
chr11_+_94328242 | 2.45 |
ENSMUST00000021227.5
|
Ankrd40
|
ankyrin repeat domain 40 |
chr6_+_71494003 | 2.45 |
ENSMUST00000114179.2
|
Rnf103
|
ring finger protein 103 |
chr13_-_66933014 | 2.45 |
ENSMUST00000173773.1
|
Mterfd1
|
MTERF domain containing 1 |
chr5_-_53213447 | 2.45 |
ENSMUST00000031090.6
|
Sel1l3
|
sel-1 suppressor of lin-12-like 3 (C. elegans) |
chr11_-_97280470 | 2.44 |
ENSMUST00000167806.1
ENSMUST00000172108.1 |
Npepps
|
aminopeptidase puromycin sensitive |
chr15_+_59315088 | 2.44 |
ENSMUST00000100640.4
|
Sqle
|
squalene epoxidase |
chr2_-_25469742 | 2.44 |
ENSMUST00000114259.2
ENSMUST00000015234.6 |
Ptgds
|
prostaglandin D2 synthase (brain) |
chr6_+_145746739 | 2.43 |
ENSMUST00000111704.1
|
Rassf8
|
Ras association (RalGDS/AF-6) domain family (N-terminal) member 8 |
chr7_-_81454751 | 2.43 |
ENSMUST00000098331.3
ENSMUST00000178892.1 |
Cpeb1
|
cytoplasmic polyadenylation element binding protein 1 |
chr11_-_61855026 | 2.43 |
ENSMUST00000004920.3
|
Ulk2
|
unc-51 like kinase 2 |
chr18_-_61036189 | 2.42 |
ENSMUST00000025521.8
|
Cdx1
|
caudal type homeobox 1 |
chr7_-_114562945 | 2.41 |
ENSMUST00000119712.1
ENSMUST00000032908.8 |
Cyp2r1
|
cytochrome P450, family 2, subfamily r, polypeptide 1 |
chr7_-_43489967 | 2.40 |
ENSMUST00000107974.1
|
Iglon5
|
IgLON family member 5 |
chr11_-_5950018 | 2.40 |
ENSMUST00000102920.3
|
Gck
|
glucokinase |
chr18_-_88894203 | 2.39 |
ENSMUST00000123826.1
|
Socs6
|
suppressor of cytokine signaling 6 |
chr4_+_116877376 | 2.38 |
ENSMUST00000044823.3
|
Zswim5
|
zinc finger SWIM-type containing 5 |
chr7_-_127026479 | 2.37 |
ENSMUST00000032916.4
|
Maz
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
chrX_-_74023745 | 2.37 |
ENSMUST00000114353.3
ENSMUST00000101458.2 |
Irak1
|
interleukin-1 receptor-associated kinase 1 |
chr9_+_123529843 | 2.37 |
ENSMUST00000026270.7
|
Sacm1l
|
SAC1 (suppressor of actin mutations 1, homolog)-like (S. cerevisiae) |
chr3_-_121815212 | 2.34 |
ENSMUST00000029770.5
|
Abcd3
|
ATP-binding cassette, sub-family D (ALD), member 3 |
chr11_+_103101682 | 2.31 |
ENSMUST00000107040.3
ENSMUST00000140372.1 ENSMUST00000024492.8 ENSMUST00000134884.1 |
Acbd4
|
acyl-Coenzyme A binding domain containing 4 |
chr15_-_78468620 | 2.31 |
ENSMUST00000017086.3
|
Tmprss6
|
transmembrane serine protease 6 |
chr15_+_76696725 | 2.30 |
ENSMUST00000023203.4
|
Gpt
|
glutamic pyruvic transaminase, soluble |
chr17_-_31636631 | 2.30 |
ENSMUST00000135425.1
ENSMUST00000151718.1 ENSMUST00000155814.1 |
Cbs
|
cystathionine beta-synthase |
chr14_+_30715599 | 2.30 |
ENSMUST00000054230.4
|
Sfmbt1
|
Scm-like with four mbt domains 1 |
chr12_+_78226627 | 2.30 |
ENSMUST00000110388.2
ENSMUST00000052472.4 |
Gphn
|
gephyrin |
chr8_-_45358737 | 2.29 |
ENSMUST00000155230.1
ENSMUST00000135912.1 |
Fam149a
|
family with sequence similarity 149, member A |
chr9_+_55326913 | 2.26 |
ENSMUST00000085754.3
ENSMUST00000034862.4 |
AI118078
|
expressed sequence AI118078 |
chr5_-_113993740 | 2.26 |
ENSMUST00000112298.3
|
Ssh1
|
slingshot homolog 1 (Drosophila) |
chr2_+_31470207 | 2.26 |
ENSMUST00000102840.4
|
Ass1
|
argininosuccinate synthetase 1 |
chr11_+_58009064 | 2.26 |
ENSMUST00000071487.6
ENSMUST00000178636.1 |
Larp1
|
La ribonucleoprotein domain family, member 1 |
chr1_-_136260873 | 2.25 |
ENSMUST00000086395.5
|
Gpr25
|
G protein-coupled receptor 25 |
chr3_+_66985700 | 2.24 |
ENSMUST00000046542.6
ENSMUST00000162693.1 |
Rsrc1
|
arginine/serine-rich coiled-coil 1 |
chr3_+_57736056 | 2.23 |
ENSMUST00000041826.9
|
Rnf13
|
ring finger protein 13 |
chr19_-_8131982 | 2.23 |
ENSMUST00000065651.4
|
Slc22a28
|
solute carrier family 22, member 28 |
chr18_+_24709436 | 2.23 |
ENSMUST00000037097.7
|
Fhod3
|
formin homology 2 domain containing 3 |
chr4_+_41135743 | 2.22 |
ENSMUST00000040008.3
|
Ube2r2
|
ubiquitin-conjugating enzyme E2R 2 |
chr18_+_3383223 | 2.21 |
ENSMUST00000162301.1
ENSMUST00000161317.1 |
Cul2
|
cullin 2 |
chr14_+_74732384 | 2.20 |
ENSMUST00000176957.1
|
Esd
|
esterase D/formylglutathione hydrolase |
chr4_-_148160031 | 2.20 |
ENSMUST00000057907.3
|
Fbxo44
|
F-box protein 44 |
chr11_+_52232009 | 2.19 |
ENSMUST00000037324.5
ENSMUST00000166537.1 |
Skp1a
|
S-phase kinase-associated protein 1A |
chr18_-_63692341 | 2.19 |
ENSMUST00000025476.2
|
Txnl1
|
thioredoxin-like 1 |
chr11_+_57801575 | 2.19 |
ENSMUST00000020826.5
|
Sap30l
|
SAP30-like |
chr6_+_56714891 | 2.17 |
ENSMUST00000031805.8
|
Avl9
|
AVL9 homolog (S. cerevisiase) |
chr4_-_61835185 | 2.17 |
ENSMUST00000082287.2
|
Mup5
|
major urinary protein 5 |
chr14_-_29721835 | 2.16 |
ENSMUST00000022567.7
|
Cacna2d3
|
calcium channel, voltage-dependent, alpha2/delta subunit 3 |
chrX_+_13071470 | 2.16 |
ENSMUST00000169594.2
|
Usp9x
|
ubiquitin specific peptidase 9, X chromosome |
chr5_+_72914554 | 2.14 |
ENSMUST00000143829.1
|
Slain2
|
SLAIN motif family, member 2 |
chr11_+_52232183 | 2.13 |
ENSMUST00000109072.1
|
Skp1a
|
S-phase kinase-associated protein 1A |
chr11_-_70700105 | 2.13 |
ENSMUST00000108543.3
ENSMUST00000108542.1 ENSMUST00000108541.2 ENSMUST00000126114.2 ENSMUST00000073625.1 |
Inca1
|
inhibitor of CDK, cyclin A1 interacting protein 1 |
chr6_-_87851011 | 2.13 |
ENSMUST00000113617.1
|
Cnbp
|
cellular nucleic acid binding protein |
chrX_+_100774741 | 2.13 |
ENSMUST00000113735.2
|
Dlg3
|
discs, large homolog 3 (Drosophila) |
chr14_+_30951486 | 2.12 |
ENSMUST00000050171.8
|
Nek4
|
NIMA (never in mitosis gene a)-related expressed kinase 4 |
chr3_-_107943362 | 2.12 |
ENSMUST00000106683.1
|
Gstm6
|
glutathione S-transferase, mu 6 |
chr1_+_180851131 | 2.11 |
ENSMUST00000038091.6
|
Sde2
|
SDE2 telomere maintenance homolog (S. pombe) |
chr8_-_79294928 | 2.10 |
ENSMUST00000048718.2
|
Mmaa
|
methylmalonic aciduria (cobalamin deficiency) type A |
chr3_-_107943390 | 2.10 |
ENSMUST00000106681.1
|
Gstm6
|
glutathione S-transferase, mu 6 |
chr6_+_71493850 | 2.10 |
ENSMUST00000064637.4
ENSMUST00000114178.1 |
Rnf103
|
ring finger protein 103 |
chr13_-_119755882 | 2.08 |
ENSMUST00000178142.1
|
Nim1
|
serine/threonine-protein kinase NIM1 |
chr11_+_21239279 | 2.08 |
ENSMUST00000006221.7
ENSMUST00000109578.1 |
Vps54
|
vacuolar protein sorting 54 (yeast) |
chr15_+_75993756 | 2.08 |
ENSMUST00000089669.4
|
Mapk15
|
mitogen-activated protein kinase 15 |
chr11_-_100527862 | 2.07 |
ENSMUST00000107385.1
|
Acly
|
ATP citrate lyase |
chr19_+_18670780 | 2.06 |
ENSMUST00000025632.9
|
2410127L17Rik
|
RIKEN cDNA 2410127L17 gene |
chr8_+_46151749 | 2.05 |
ENSMUST00000154040.1
|
4933411K20Rik
|
RIKEN cDNA 4933411K20 gene |
chr7_+_107567445 | 2.05 |
ENSMUST00000120990.1
|
Olfml1
|
olfactomedin-like 1 |
chr10_-_7956223 | 2.04 |
ENSMUST00000146444.1
|
Tab2
|
TGF-beta activated kinase 1/MAP3K7 binding protein 2 |
chr9_+_123366921 | 2.03 |
ENSMUST00000038863.7
|
Lars2
|
leucyl-tRNA synthetase, mitochondrial |
chr4_-_148159571 | 2.03 |
ENSMUST00000167160.1
ENSMUST00000151246.1 |
Fbxo44
|
F-box protein 44 |
chr2_+_163204483 | 2.03 |
ENSMUST00000128999.1
|
Tox2
|
TOX high mobility group box family member 2 |
chr2_+_104027721 | 2.03 |
ENSMUST00000028603.3
|
Fbxo3
|
F-box protein 3 |
chr12_-_24680890 | 2.03 |
ENSMUST00000156453.2
|
Cys1
|
cystin 1 |
chr4_-_62150810 | 2.02 |
ENSMUST00000077719.3
|
Mup21
|
major urinary protein 21 |
chr16_-_97922582 | 2.02 |
ENSMUST00000170757.1
|
C2cd2
|
C2 calcium-dependent domain containing 2 |
chr13_-_66933080 | 2.02 |
ENSMUST00000021991.4
|
Mterfd1
|
MTERF domain containing 1 |
chr3_+_40745332 | 2.00 |
ENSMUST00000159819.1
|
Hspa4l
|
heat shock protein 4 like |
chr18_+_24205937 | 2.00 |
ENSMUST00000164998.1
|
Galnt1
|
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 1 |
chr6_-_52640303 | 1.99 |
ENSMUST00000031788.8
|
Hibadh
|
3-hydroxyisobutyrate dehydrogenase |
chr2_+_122147680 | 1.99 |
ENSMUST00000102476.4
|
B2m
|
beta-2 microglobulin |
chr18_+_36281069 | 1.98 |
ENSMUST00000051301.3
|
Pura
|
purine rich element binding protein A |
chr2_+_18677002 | 1.98 |
ENSMUST00000028071.6
|
Bmi1
|
Bmi1 polycomb ring finger oncogene |
chr14_-_51922773 | 1.98 |
ENSMUST00000089771.2
|
Rnase13
|
ribonuclease, RNase A family, 13 (non-active) |
chr15_-_31367527 | 1.97 |
ENSMUST00000076942.4
ENSMUST00000123325.1 ENSMUST00000110410.2 |
Ankrd33b
|
ankyrin repeat domain 33B |
chr18_+_12643329 | 1.97 |
ENSMUST00000025294.7
|
Ttc39c
|
tetratricopeptide repeat domain 39C |
chr13_-_43480973 | 1.97 |
ENSMUST00000144326.2
|
Ranbp9
|
RAN binding protein 9 |
chr7_+_30553263 | 1.97 |
ENSMUST00000044048.7
|
Hspb6
|
heat shock protein, alpha-crystallin-related, B6 |
chr8_-_64733534 | 1.95 |
ENSMUST00000141021.1
|
Sc4mol
|
sterol-C4-methyl oxidase-like |
chr1_-_91413163 | 1.95 |
ENSMUST00000086851.1
|
Hes6
|
hairy and enhancer of split 6 |
chr8_-_91134027 | 1.94 |
ENSMUST00000125257.1
|
Aktip
|
thymoma viral proto-oncogene 1 interacting protein |
chr1_-_75191923 | 1.94 |
ENSMUST00000040689.8
|
Atg9a
|
autophagy related 9A |
chr4_+_148130883 | 1.94 |
ENSMUST00000084129.2
|
Mad2l2
|
MAD2 mitotic arrest deficient-like 2 |
chr1_-_57406443 | 1.92 |
ENSMUST00000160837.1
ENSMUST00000161780.1 |
Tyw5
|
tRNA-yW synthesizing protein 5 |
chrX_-_9662950 | 1.92 |
ENSMUST00000033519.2
|
Dynlt3
|
dynein light chain Tctex-type 3 |
chr3_-_107943705 | 1.92 |
ENSMUST00000106680.1
ENSMUST00000106684.1 ENSMUST00000106685.2 |
Gstm6
|
glutathione S-transferase, mu 6 |
chr17_-_56716788 | 1.91 |
ENSMUST00000067931.5
|
Vmac
|
vimentin-type intermediate filament associated coiled-coil protein |
chr2_-_33371486 | 1.91 |
ENSMUST00000113165.1
|
Ralgps1
|
Ral GEF with PH domain and SH3 binding motif 1 |
chr4_-_133339283 | 1.91 |
ENSMUST00000043305.7
|
Wdtc1
|
WD and tetratricopeptide repeats 1 |
chr7_+_65644884 | 1.91 |
ENSMUST00000032728.8
|
Tarsl2
|
threonyl-tRNA synthetase-like 2 |
chr10_+_7589788 | 1.91 |
ENSMUST00000134346.1
ENSMUST00000019931.5 |
Lrp11
|
low density lipoprotein receptor-related protein 11 |
chr4_-_133339238 | 1.90 |
ENSMUST00000105906.1
|
Wdtc1
|
WD and tetratricopeptide repeats 1 |
chr10_+_62071014 | 1.90 |
ENSMUST00000053865.5
|
Gm5424
|
predicted gene 5424 |
chr13_-_24937585 | 1.90 |
ENSMUST00000037615.6
|
Aldh5a1
|
aldhehyde dehydrogenase family 5, subfamily A1 |
chr11_+_86484647 | 1.90 |
ENSMUST00000020827.6
|
Rnft1
|
ring finger protein, transmembrane 1 |
chr16_+_90220742 | 1.89 |
ENSMUST00000023707.9
|
Sod1
|
superoxide dismutase 1, soluble |
chr11_-_100527896 | 1.89 |
ENSMUST00000107389.1
ENSMUST00000007131.9 |
Acly
|
ATP citrate lyase |
chr7_-_141193934 | 1.88 |
ENSMUST00000026572.4
ENSMUST00000168550.1 ENSMUST00000097957.4 |
Hras
|
Harvey rat sarcoma virus oncogene |
chr9_+_53301571 | 1.88 |
ENSMUST00000051014.1
|
Exph5
|
exophilin 5 |
chr7_-_34654342 | 1.88 |
ENSMUST00000108069.1
|
Kctd15
|
potassium channel tetramerisation domain containing 15 |
chr19_-_29805989 | 1.88 |
ENSMUST00000177155.1
ENSMUST00000059484.7 |
9930021J03Rik
|
RIKEN cDNA 9930021J03 gene |
chr8_+_127064107 | 1.88 |
ENSMUST00000162536.1
ENSMUST00000026921.6 ENSMUST00000162665.1 ENSMUST00000160766.1 ENSMUST00000162602.1 ENSMUST00000162531.1 ENSMUST00000160581.1 ENSMUST00000161355.1 ENSMUST00000159537.1 |
Pard3
|
par-3 (partitioning defective 3) homolog (C. elegans) |
chr3_+_40745430 | 1.87 |
ENSMUST00000077083.6
|
Hspa4l
|
heat shock protein 4 like |
chr1_+_78657825 | 1.86 |
ENSMUST00000035779.8
|
Acsl3
|
acyl-CoA synthetase long-chain family member 3 |
chr11_-_105944412 | 1.85 |
ENSMUST00000019734.4
ENSMUST00000184269.1 ENSMUST00000150563.1 |
Cyb561
|
cytochrome b-561 |
chr7_-_133776681 | 1.85 |
ENSMUST00000130182.1
ENSMUST00000106139.1 |
Dhx32
|
DEAH (Asp-Glu-Ala-His) box polypeptide 32 |
chr11_-_113708952 | 1.85 |
ENSMUST00000106617.1
|
Cpsf4l
|
cleavage and polyadenylation specific factor 4-like |
chr5_-_138994935 | 1.84 |
ENSMUST00000046901.7
ENSMUST00000076095.7 |
Pdgfa
|
platelet derived growth factor, alpha |
chr9_-_54560138 | 1.84 |
ENSMUST00000041901.6
|
Cib2
|
calcium and integrin binding family member 2 |
chr16_+_64851991 | 1.83 |
ENSMUST00000067744.7
|
Cggbp1
|
CGG triplet repeat binding protein 1 |
chr5_+_30921556 | 1.83 |
ENSMUST00000031053.8
|
Khk
|
ketohexokinase |
chr19_-_4042165 | 1.83 |
ENSMUST00000042700.9
|
Gstp2
|
glutathione S-transferase, pi 2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.1 | 18.7 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
1.8 | 5.5 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
1.6 | 4.8 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
1.4 | 14.5 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
1.4 | 7.0 | GO:0032902 | nerve growth factor production(GO:0032902) |
1.4 | 6.9 | GO:0070178 | D-serine metabolic process(GO:0070178) |
1.2 | 3.7 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) |
1.2 | 3.7 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
1.2 | 1.2 | GO:0045077 | negative regulation of interferon-gamma biosynthetic process(GO:0045077) |
1.2 | 4.8 | GO:0006522 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
1.2 | 4.6 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
1.1 | 1.1 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
1.1 | 3.2 | GO:0006562 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
1.0 | 9.4 | GO:0035754 | B cell chemotaxis(GO:0035754) |
1.0 | 3.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
1.0 | 4.1 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
1.0 | 3.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
1.0 | 6.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
1.0 | 3.1 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
1.0 | 3.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
1.0 | 4.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
1.0 | 2.0 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
1.0 | 2.9 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
1.0 | 2.9 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
1.0 | 2.9 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
0.9 | 1.9 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.9 | 2.8 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.9 | 0.9 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.9 | 3.7 | GO:0061625 | fructose catabolic process(GO:0006001) response to sucrose(GO:0009744) response to disaccharide(GO:0034285) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.9 | 4.6 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.9 | 2.7 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.9 | 2.6 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.9 | 3.4 | GO:1904412 | regulation of cardiac ventricle development(GO:1904412) |
0.9 | 2.6 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.9 | 3.4 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.8 | 0.8 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.8 | 1.7 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.8 | 2.5 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.8 | 5.0 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.8 | 8.2 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.8 | 2.5 | GO:0043323 | positive regulation of natural killer cell degranulation(GO:0043323) |
0.8 | 2.4 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.8 | 2.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.8 | 5.5 | GO:0070054 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
0.8 | 3.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.8 | 8.6 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.8 | 2.3 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.7 | 0.7 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.7 | 2.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.7 | 2.2 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.7 | 0.7 | GO:0042196 | chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.7 | 5.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.7 | 3.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.7 | 0.7 | GO:0035973 | aggrephagy(GO:0035973) |
0.7 | 2.8 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.7 | 2.1 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
0.7 | 3.5 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
0.7 | 3.4 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
0.7 | 2.7 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
0.7 | 2.0 | GO:0031590 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.7 | 2.7 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.7 | 0.7 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.7 | 2.0 | GO:1901355 | response to rapamycin(GO:1901355) |
0.7 | 1.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.7 | 2.0 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.7 | 2.0 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.7 | 4.6 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.6 | 2.6 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.6 | 2.6 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.6 | 0.6 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.6 | 2.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.6 | 3.2 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.6 | 1.9 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.6 | 5.7 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.6 | 3.8 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.6 | 6.3 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.6 | 0.6 | GO:1904173 | regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
0.6 | 1.9 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.6 | 1.8 | GO:0060466 | activation of meiosis involved in egg activation(GO:0060466) |
0.6 | 5.5 | GO:0046449 | creatinine metabolic process(GO:0046449) |
0.6 | 1.8 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
0.6 | 1.8 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.6 | 6.7 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.6 | 2.4 | GO:0030091 | protein repair(GO:0030091) |
0.6 | 1.8 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.6 | 1.2 | GO:0090427 | activation of meiosis(GO:0090427) |
0.6 | 3.6 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.6 | 3.5 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.6 | 1.8 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) |
0.6 | 0.6 | GO:1990535 | neuron projection maintenance(GO:1990535) |
0.6 | 1.1 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
0.6 | 3.3 | GO:0034756 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
0.6 | 3.3 | GO:0001757 | somite specification(GO:0001757) |
0.5 | 3.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.5 | 1.6 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
0.5 | 1.6 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
0.5 | 2.2 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.5 | 2.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.5 | 3.7 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.5 | 2.1 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
0.5 | 2.1 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.5 | 1.5 | GO:0009073 | tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
0.5 | 1.5 | GO:1990166 | protein localization to site of double-strand break(GO:1990166) |
0.5 | 0.5 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
0.5 | 1.5 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.5 | 1.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.5 | 0.5 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
0.5 | 4.0 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.5 | 1.5 | GO:0002842 | positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
0.5 | 2.5 | GO:0009414 | response to water deprivation(GO:0009414) |
0.5 | 1.0 | GO:0046512 | sphingosine biosynthetic process(GO:0046512) |
0.5 | 2.0 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.5 | 1.5 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.5 | 1.9 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.5 | 2.9 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.5 | 2.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.5 | 1.9 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.5 | 1.4 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
0.5 | 2.8 | GO:0003383 | apical constriction(GO:0003383) |
0.5 | 3.8 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.5 | 3.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.5 | 5.6 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.5 | 1.4 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.5 | 1.4 | GO:1903002 | regulation of lipid transport across blood brain barrier(GO:1903000) positive regulation of lipid transport across blood brain barrier(GO:1903002) |
0.5 | 3.2 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.5 | 1.4 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
0.5 | 0.5 | GO:0097384 | cellular lipid biosynthetic process(GO:0097384) |
0.5 | 3.2 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
0.5 | 2.3 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.4 | 1.3 | GO:0046370 | fructose biosynthetic process(GO:0046370) |
0.4 | 0.9 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
0.4 | 1.8 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.4 | 2.2 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.4 | 2.7 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.4 | 1.3 | GO:0006154 | adenosine catabolic process(GO:0006154) |
0.4 | 5.3 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
0.4 | 0.4 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
0.4 | 1.3 | GO:1905223 | epicardium morphogenesis(GO:1905223) |
0.4 | 1.3 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.4 | 0.4 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.4 | 1.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.4 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.4 | 1.3 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
0.4 | 1.7 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.4 | 3.0 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.4 | 1.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.4 | 5.0 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.4 | 1.7 | GO:0034031 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
0.4 | 0.8 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.4 | 3.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.4 | 1.7 | GO:0003165 | Purkinje myocyte development(GO:0003165) |
0.4 | 7.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.4 | 1.2 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.4 | 2.0 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.4 | 1.2 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.4 | 1.6 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.4 | 1.2 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.4 | 0.8 | GO:1903181 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
0.4 | 0.8 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.4 | 1.6 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.4 | 1.2 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
0.4 | 2.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.4 | 1.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.4 | 1.6 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.4 | 1.2 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
0.4 | 14.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.4 | 2.4 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.4 | 1.2 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.4 | 1.2 | GO:1900247 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
0.4 | 1.9 | GO:0044805 | late nucleophagy(GO:0044805) |
0.4 | 5.8 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.4 | 8.2 | GO:0006101 | citrate metabolic process(GO:0006101) |
0.4 | 2.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.4 | 1.5 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.4 | 3.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.4 | 0.4 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.4 | 6.9 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.4 | 1.5 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.4 | 2.3 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.4 | 1.9 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.4 | 2.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.4 | 1.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.4 | 3.8 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.4 | 1.9 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.4 | 1.9 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.4 | 2.2 | GO:1902998 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
0.4 | 1.1 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
0.4 | 2.6 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.4 | 2.6 | GO:0001302 | replicative cell aging(GO:0001302) |
0.4 | 1.9 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.4 | 2.6 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.4 | 1.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.4 | 2.9 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.4 | 1.5 | GO:0003360 | brainstem development(GO:0003360) |
0.4 | 3.6 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
0.4 | 4.7 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.4 | 2.5 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.4 | 1.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.4 | 2.2 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.4 | 0.7 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.4 | 1.8 | GO:0044331 | cell-cell adhesion mediated by cadherin(GO:0044331) |
0.4 | 2.5 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.4 | 1.4 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
0.4 | 0.7 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.4 | 3.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.4 | 1.1 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
0.4 | 2.5 | GO:0006983 | ER overload response(GO:0006983) |
0.4 | 0.4 | GO:0015744 | succinate transport(GO:0015744) |
0.4 | 5.6 | GO:0010225 | response to UV-C(GO:0010225) |
0.4 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.4 | 1.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.4 | 0.7 | GO:0010877 | lipid transport involved in lipid storage(GO:0010877) |
0.3 | 0.3 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
0.3 | 1.4 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
0.3 | 0.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.3 | 2.4 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.3 | 1.4 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
0.3 | 1.0 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.3 | 1.0 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.3 | 0.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.3 | 1.0 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.3 | 2.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.3 | 1.7 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.3 | 1.4 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.3 | 1.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 1.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.3 | 2.0 | GO:1900145 | regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) |
0.3 | 2.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.3 | 2.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.3 | 2.0 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.3 | 1.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.3 | 1.3 | GO:0016240 | autophagosome docking(GO:0016240) |
0.3 | 1.7 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.3 | 0.3 | GO:0007172 | signal complex assembly(GO:0007172) |
0.3 | 0.6 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
0.3 | 1.3 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.3 | 0.6 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.3 | 3.9 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.3 | 1.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.3 | 1.6 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.3 | 1.0 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
0.3 | 1.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.3 | 1.0 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.3 | 0.6 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.3 | 1.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.3 | 0.9 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
0.3 | 1.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.3 | 0.9 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.3 | 0.9 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
0.3 | 9.0 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.3 | 0.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.3 | 1.2 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.3 | 1.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.3 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.3 | 1.2 | GO:2000292 | regulation of defecation(GO:2000292) negative regulation of defecation(GO:2000293) |
0.3 | 1.2 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.3 | 1.2 | GO:0034769 | basement membrane disassembly(GO:0034769) |
0.3 | 1.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.3 | 2.8 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.3 | 12.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.3 | 4.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.3 | 0.3 | GO:0060701 | negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) |
0.3 | 0.6 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.3 | 1.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
0.3 | 2.1 | GO:0030242 | pexophagy(GO:0030242) |
0.3 | 0.9 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.3 | 1.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.3 | 1.2 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 2.7 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.3 | 2.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.3 | 0.6 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.3 | 4.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.3 | 1.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.3 | 1.2 | GO:1901582 | post-embryonic appendage morphogenesis(GO:0035120) post-embryonic limb morphogenesis(GO:0035127) post-embryonic forelimb morphogenesis(GO:0035128) telomeric repeat-containing RNA transcription(GO:0097393) telomeric repeat-containing RNA transcription from RNA pol II promoter(GO:0097394) regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901580) negative regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901581) positive regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901582) |
0.3 | 3.5 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.3 | 3.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.3 | 0.6 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.3 | 0.3 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.3 | 0.9 | GO:1990859 | cellular response to endothelin(GO:1990859) |
0.3 | 2.0 | GO:0015862 | uridine transport(GO:0015862) |
0.3 | 0.6 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.3 | 2.6 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
0.3 | 2.6 | GO:0009301 | snRNA transcription(GO:0009301) |
0.3 | 1.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
0.3 | 1.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.3 | 0.3 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.3 | 2.5 | GO:0071569 | protein ufmylation(GO:0071569) |
0.3 | 0.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.3 | 1.4 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.3 | 2.8 | GO:0046959 | habituation(GO:0046959) |
0.3 | 1.4 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.3 | 0.6 | GO:1990401 | embryonic lung development(GO:1990401) |
0.3 | 1.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.3 | 0.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.3 | 1.1 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.3 | 0.3 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.3 | 0.8 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.3 | 2.7 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.3 | 1.9 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.3 | 0.8 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.3 | 1.9 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.3 | 0.5 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.3 | 0.5 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.3 | 3.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.3 | 0.3 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
0.3 | 0.8 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.3 | 1.3 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.3 | 1.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.3 | 0.8 | GO:0019858 | cytosine metabolic process(GO:0019858) |
0.3 | 4.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.3 | 1.1 | GO:0035553 | oxidative single-stranded RNA demethylation(GO:0035553) |
0.3 | 1.1 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.3 | 1.6 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.3 | 9.0 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.3 | 3.4 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.3 | 1.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.3 | 3.4 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.3 | 1.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.3 | 0.5 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
0.3 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.3 | 0.8 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.3 | 1.3 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.3 | 6.8 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.3 | 1.0 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
0.3 | 0.8 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.3 | 1.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.3 | 0.8 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.3 | 2.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.3 | 1.3 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.3 | 1.8 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.3 | 0.8 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
0.3 | 0.8 | GO:0021759 | globus pallidus development(GO:0021759) |
0.3 | 0.8 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.3 | 2.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.3 | 2.8 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
0.3 | 1.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.3 | 2.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.3 | 2.8 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.3 | 1.0 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.3 | 1.8 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.3 | 0.3 | GO:0046949 | fatty-acyl-CoA biosynthetic process(GO:0046949) |
0.2 | 1.0 | GO:0045358 | negative regulation of interferon-beta biosynthetic process(GO:0045358) |
0.2 | 1.0 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.2 | 0.7 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.2 | 0.7 | GO:1903286 | regulation of potassium ion import(GO:1903286) |
0.2 | 2.0 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.2 | 1.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 2.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.2 | 2.0 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.2 | 2.0 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.2 | 0.7 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
0.2 | 1.5 | GO:0015679 | plasma membrane copper ion transport(GO:0015679) copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
0.2 | 3.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.2 | 0.2 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
0.2 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.2 | 0.2 | GO:0046619 | optic placode formation(GO:0001743) optic placode formation involved in camera-type eye formation(GO:0046619) |
0.2 | 1.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.2 | 1.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.2 | 0.7 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.2 | 1.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.2 | 0.7 | GO:0061075 | cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
0.2 | 2.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.2 | 0.2 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.2 | 0.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.2 | 0.7 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.2 | 3.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.2 | 0.5 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.2 | 1.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.7 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.2 | 0.5 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.2 | 0.7 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.2 | 5.6 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.2 | 0.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.2 | GO:0002465 | peripheral T cell tolerance induction(GO:0002458) peripheral tolerance induction(GO:0002465) |
0.2 | 0.5 | GO:0006507 | GPI anchor release(GO:0006507) |
0.2 | 0.2 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
0.2 | 0.9 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.2 | 3.9 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 1.4 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 0.7 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.2 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.2 | 1.8 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.2 | 9.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.2 | 0.9 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.2 | 2.5 | GO:0097421 | liver regeneration(GO:0097421) |
0.2 | 0.7 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
0.2 | 0.9 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.7 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.2 | 0.2 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.2 | 9.7 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.2 | 0.7 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.2 | 1.1 | GO:0043366 | beta selection(GO:0043366) |
0.2 | 0.7 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.2 | 0.9 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
0.2 | 0.7 | GO:0061193 | taste bud development(GO:0061193) |
0.2 | 0.2 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
0.2 | 1.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.2 | 0.7 | GO:1904811 | dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
0.2 | 0.7 | GO:0051775 | response to redox state(GO:0051775) |
0.2 | 0.2 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.2 | 0.9 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 1.9 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.2 | 5.4 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.2 | 0.2 | GO:1903273 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
0.2 | 2.8 | GO:0099563 | modification of synaptic structure(GO:0099563) |
0.2 | 0.6 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.2 | 0.9 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.2 | 0.9 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.2 | 1.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 0.6 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.2 | 0.4 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.2 | 1.5 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
0.2 | 0.4 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.2 | 0.2 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.2 | 0.4 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.2 | 1.9 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.2 | 1.0 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.2 | 0.6 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.2 | 1.0 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) tyrosine catabolic process(GO:0006572) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.2 | 9.4 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.2 | 0.6 | GO:1902605 | heterotrimeric G-protein complex assembly(GO:1902605) |
0.2 | 0.8 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.2 | 3.1 | GO:0044804 | nucleophagy(GO:0044804) |
0.2 | 1.4 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.2 | 1.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 1.6 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.2 | 1.8 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.2 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.2 | 1.0 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.2 | 0.4 | GO:0002188 | translation reinitiation(GO:0002188) |
0.2 | 0.4 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.2 | 0.6 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 0.6 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.2 | 3.6 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.2 | 1.4 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.2 | 2.5 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.2 | 0.8 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.2 | 0.4 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
0.2 | 1.0 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
0.2 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.2 | 1.0 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
0.2 | 1.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.4 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.2 | 1.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.2 | 0.6 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.2 | 1.0 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 1.7 | GO:0070842 | aggresome assembly(GO:0070842) |
0.2 | 7.2 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.2 | 2.7 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.2 | 0.6 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.2 | 0.8 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 0.6 | GO:0060785 | regulation of apoptosis involved in tissue homeostasis(GO:0060785) |
0.2 | 1.7 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.2 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.2 | 1.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 0.6 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
0.2 | 0.9 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.2 | 0.4 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.2 | 0.7 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.2 | 0.2 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
0.2 | 1.7 | GO:0051665 | membrane raft localization(GO:0051665) |
0.2 | 1.5 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.2 | 1.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.2 | 6.1 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.2 | 1.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.2 | 0.6 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.2 | 0.5 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 1.6 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.2 | 0.4 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.2 | 0.4 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
0.2 | 0.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.2 | 0.2 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.2 | 0.5 | GO:0046032 | ADP catabolic process(GO:0046032) |
0.2 | 1.6 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.2 | 1.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.2 | 11.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.2 | 0.5 | GO:0030862 | positive regulation of polarized epithelial cell differentiation(GO:0030862) |
0.2 | 2.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.2 | 0.7 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.2 | 1.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 1.6 | GO:0060717 | chorion development(GO:0060717) |
0.2 | 1.1 | GO:0097502 | mannosylation(GO:0097502) |
0.2 | 0.2 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
0.2 | 0.4 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
0.2 | 2.7 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.2 | 0.5 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.2 | 1.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 1.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.2 | 2.3 | GO:0042407 | cristae formation(GO:0042407) |
0.2 | 1.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 1.8 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.2 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 1.0 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
0.2 | 0.3 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
0.2 | 1.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.2 | 0.5 | GO:2000836 | positive regulation of androgen secretion(GO:2000836) positive regulation of testosterone secretion(GO:2000845) |
0.2 | 1.4 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.2 | 0.9 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.2 | 0.5 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.2 | 1.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.2 | 8.8 | GO:0022900 | electron transport chain(GO:0022900) |
0.2 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.2 | 0.3 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
0.2 | 0.8 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.2 | 0.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.2 | 0.8 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.2 | 1.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.2 | 0.5 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.2 | 1.2 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.2 | 1.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.2 | 0.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.2 | 1.0 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.2 | 1.5 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.2 | 0.5 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.2 | 0.5 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.2 | 0.3 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.2 | 2.3 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.2 | 1.7 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 2.8 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.2 | 0.2 | GO:1904109 | positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
0.2 | 2.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.2 | 2.8 | GO:0000338 | protein deneddylation(GO:0000338) |
0.2 | 0.7 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.2 | 1.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.2 | 0.2 | GO:1901630 | negative regulation of presynaptic membrane organization(GO:1901630) |
0.2 | 0.8 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.2 | 0.5 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.2 | 1.1 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
0.2 | 0.3 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.2 | 2.7 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.2 | 1.5 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.2 | 1.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 1.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.2 | 0.6 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.5 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
0.2 | 1.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.2 | 0.3 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.2 | 1.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.2 | 0.2 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
0.2 | 0.8 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.2 | 1.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.2 | 0.6 | GO:0097298 | regulation of nucleus size(GO:0097298) |
0.2 | 0.6 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.2 | 0.5 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
0.2 | 1.1 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.2 | 0.9 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 0.8 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
0.2 | 0.8 | GO:1902952 | positive regulation of dendritic spine maintenance(GO:1902952) |
0.2 | 0.5 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.2 | 1.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.2 | 1.4 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.2 | 0.3 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.2 | 1.9 | GO:0036503 | ERAD pathway(GO:0036503) |
0.2 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.2 | 0.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.2 | 0.5 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.2 | 6.6 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.2 | 0.6 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.2 | 0.2 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 0.8 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.2 | 0.6 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.2 | 0.5 | GO:0016598 | protein arginylation(GO:0016598) |
0.2 | 0.9 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.2 | 0.5 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.2 | 3.7 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.2 | 1.1 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.2 | 2.0 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.2 | 0.3 | GO:0034312 | diol biosynthetic process(GO:0034312) |
0.2 | 0.5 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.2 | 0.5 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.2 | 0.6 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.2 | 0.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.2 | 0.3 | GO:2000485 | regulation of glutamine transport(GO:2000485) |
0.2 | 0.3 | GO:1904478 | regulation of intestinal absorption(GO:1904478) |
0.2 | 0.6 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.2 | 0.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.2 | 0.3 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.2 | 0.5 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.4 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.9 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.7 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 1.3 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 3.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.6 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 1.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 1.9 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.9 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 1.3 | GO:2000576 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.4 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.6 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.4 | GO:1904457 | positive regulation of neuronal action potential(GO:1904457) |
0.1 | 0.3 | GO:0046967 | cytosol to ER transport(GO:0046967) |
0.1 | 1.9 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.1 | 0.4 | GO:0051866 | general adaptation syndrome(GO:0051866) |
0.1 | 0.4 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.1 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.1 | 0.4 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
0.1 | 3.1 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 2.5 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.4 | GO:0001788 | antibody-dependent cellular cytotoxicity(GO:0001788) |
0.1 | 0.4 | GO:0021502 | columnar/cuboidal epithelial cell maturation(GO:0002069) neural fold elevation formation(GO:0021502) intestinal epithelial cell maturation(GO:0060574) |
0.1 | 0.4 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.1 | 0.4 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
0.1 | 0.3 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.6 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.6 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.1 | 1.6 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.7 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.5 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.1 | 1.4 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 1.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 1.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.5 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.3 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 0.4 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.1 | 0.4 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.1 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.3 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.3 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.1 | 1.6 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 2.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.1 | 0.5 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.4 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.8 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.5 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.1 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
0.1 | 0.4 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
0.1 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 1.2 | GO:0050892 | intestinal absorption(GO:0050892) |
0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 0.5 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.5 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 1.0 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.3 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 1.0 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.4 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.1 | 2.7 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.1 | 0.3 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.1 | 0.4 | GO:0051305 | meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
0.1 | 0.6 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.1 | 1.7 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.1 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 3.6 | GO:0046677 | response to antibiotic(GO:0046677) |
0.1 | 0.6 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.1 | 0.5 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.1 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
0.1 | 0.6 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.1 | 1.6 | GO:0060416 | response to growth hormone(GO:0060416) |
0.1 | 0.8 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.1 | 1.9 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.1 | 0.8 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
0.1 | 1.5 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 1.0 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 1.9 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.6 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 1.5 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.1 | 0.5 | GO:0051341 | regulation of oxidoreductase activity(GO:0051341) |
0.1 | 0.4 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.6 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 1.5 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
0.1 | 4.1 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.1 | 0.7 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.5 | GO:1903028 | asymmetric Golgi ribbon formation(GO:0090164) regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
0.1 | 0.2 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.9 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 1.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 5.4 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.1 | 0.7 | GO:0006547 | histidine metabolic process(GO:0006547) |
0.1 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.5 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
0.1 | 1.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.7 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 3.1 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.1 | 1.8 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.1 | 0.6 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.2 | GO:0048840 | otolith development(GO:0048840) |
0.1 | 0.6 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.6 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.2 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.1 | 0.5 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 2.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 1.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.5 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
0.1 | 0.6 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 1.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.9 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 1.7 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.2 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.1 | 0.3 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.9 | GO:0036093 | germ cell proliferation(GO:0036093) |
0.1 | 3.9 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 0.6 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 2.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.1 | 0.7 | GO:1901908 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.1 | 3.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.1 | 0.6 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.3 | GO:0050779 | RNA destabilization(GO:0050779) |
0.1 | 1.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 2.0 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 12.6 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.1 | 0.7 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.1 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
0.1 | 0.3 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.4 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.1 | 0.3 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) response to methylglyoxal(GO:0051595) regulation of histone H3-K27 acetylation(GO:1901674) negative regulation of histone H3-K27 acetylation(GO:1901675) |
0.1 | 0.2 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.7 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 1.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.1 | 0.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 1.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.2 | GO:0034141 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 1.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 5.7 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.1 | 0.5 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.3 | GO:0042823 | pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
0.1 | 0.5 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 2.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.6 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.4 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.4 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.1 | 0.1 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.1 | 0.5 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
0.1 | 1.0 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.1 | 5.3 | GO:0070646 | protein modification by small protein removal(GO:0070646) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.8 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.5 | GO:0042048 | olfactory behavior(GO:0042048) |
0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.7 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.4 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.1 | 0.6 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.7 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.1 | 0.3 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.1 | 1.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
0.1 | 0.4 | GO:0006415 | translational termination(GO:0006415) |
0.1 | 0.8 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.1 | 0.4 | GO:1902045 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.3 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.1 | 0.2 | GO:0090003 | regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
0.1 | 0.3 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.6 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.7 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
0.1 | 0.4 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 2.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.4 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.1 | 1.3 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.4 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.1 | 1.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 1.6 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.1 | 0.4 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.4 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.1 | 0.7 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.5 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.1 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 7.1 | GO:0006457 | protein folding(GO:0006457) |
0.1 | 0.2 | GO:0048069 | eye pigmentation(GO:0048069) |
0.1 | 0.6 | GO:0098877 | neurotransmitter receptor transport to plasma membrane(GO:0098877) |
0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.5 | GO:1903351 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
0.1 | 0.4 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.1 | 0.4 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 1.0 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.1 | 2.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.1 | 1.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.5 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.3 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.1 | 0.5 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.1 | 0.5 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.3 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.1 | 0.3 | GO:0060523 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) prostate epithelial cord elongation(GO:0060523) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) branch elongation involved in salivary gland morphogenesis(GO:0060667) prostate gland morphogenetic growth(GO:0060737) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.1 | 0.3 | GO:2000619 | negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.1 | 0.6 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.2 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.4 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.1 | 0.5 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 1.3 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 1.0 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.1 | 3.2 | GO:0060612 | adipose tissue development(GO:0060612) |
0.1 | 1.0 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.1 | 2.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.4 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
0.1 | 0.3 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.1 | 0.2 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.3 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
0.1 | 0.2 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.8 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.8 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.3 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.1 | 0.3 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.1 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.1 | 0.3 | GO:0090153 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
0.1 | 0.4 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.1 | 0.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.3 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.1 | 0.5 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.1 | 1.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.9 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.1 | GO:0002874 | chronic inflammatory response to antigenic stimulus(GO:0002439) regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.1 | 6.3 | GO:0008033 | tRNA processing(GO:0008033) |
0.1 | 0.2 | GO:0032908 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.1 | GO:1904868 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
0.1 | 0.9 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.6 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.1 | 0.5 | GO:0015669 | gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
0.1 | 0.8 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 2.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 1.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.1 | 0.2 | GO:0070268 | cornification(GO:0070268) |
0.1 | 0.2 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.1 | 0.2 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:1902527 | regulation of protein monoubiquitination(GO:1902525) positive regulation of protein monoubiquitination(GO:1902527) |
0.1 | 0.3 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.5 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.3 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
0.1 | 1.1 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.1 | 0.2 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.1 | 0.1 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) |
0.1 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.3 | GO:1902477 | defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.1 | 0.8 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.1 | 1.0 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.1 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.2 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.1 | 1.3 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 0.4 | GO:0097491 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.1 | 0.3 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.7 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.5 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.1 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.1 | 1.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.4 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.7 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 1.4 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 0.1 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
0.1 | 0.6 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.8 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.1 | 0.3 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.1 | 1.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.1 | 0.7 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 0.9 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.1 | GO:0034033 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.1 | 0.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.5 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.1 | 0.3 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.1 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.1 | 0.7 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.4 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.2 | GO:0051030 | snRNA transport(GO:0051030) |
0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.6 | GO:0021854 | hypothalamus development(GO:0021854) |
0.1 | 0.8 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.8 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.1 | 0.1 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
0.1 | 0.3 | GO:1904453 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.1 | 0.1 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
0.1 | 0.4 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.5 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.8 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.4 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.6 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.2 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.1 | 0.5 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.2 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.1 | 0.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.4 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.2 | GO:0009397 | 10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
0.1 | 0.7 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.1 | 1.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.2 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.1 | 1.6 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.3 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.1 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 0.4 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.1 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 1.0 | GO:0002673 | regulation of acute inflammatory response(GO:0002673) |
0.1 | 0.2 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.1 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.1 | 1.6 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.4 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.4 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.1 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.1 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.2 | GO:0015866 | ADP transport(GO:0015866) |
0.1 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.4 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.1 | 0.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.8 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.1 | 0.1 | GO:0003285 | septum secundum development(GO:0003285) |
0.1 | 0.9 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.1 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.1 | 0.2 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
0.1 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 1.6 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.1 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.3 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 1.0 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 1.3 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.3 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.4 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.0 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.0 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.2 | GO:0051012 | microtubule sliding(GO:0051012) |
0.0 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.6 | GO:0034340 | response to type I interferon(GO:0034340) |
0.0 | 3.8 | GO:0035308 | negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.2 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.0 | 0.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.0 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.5 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 1.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.0 | 0.2 | GO:0046880 | regulation of follicle-stimulating hormone secretion(GO:0046880) |
0.0 | 0.2 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.2 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.1 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
0.0 | 0.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 1.0 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 1.7 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
0.0 | 0.1 | GO:0033577 | protein glycosylation in endoplasmic reticulum(GO:0033577) |
0.0 | 0.4 | GO:0051608 | histamine transport(GO:0051608) |
0.0 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.4 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.0 | 0.2 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.5 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.5 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.4 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.0 | GO:0038001 | paracrine signaling(GO:0038001) |
0.0 | 0.3 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.0 | 0.4 | GO:0003094 | glomerular filtration(GO:0003094) |
0.0 | 0.9 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.0 | 0.1 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.0 | 0.4 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.0 | 0.1 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.0 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.0 | 0.0 | GO:0090647 | modulation of age-related behavioral decline(GO:0090647) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.2 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
0.0 | 0.4 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 1.0 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.0 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.4 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.7 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.0 | GO:0002524 | hypersensitivity(GO:0002524) |
0.0 | 0.2 | GO:1904358 | positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
0.0 | 0.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 2.7 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.7 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) |
0.0 | 0.4 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.9 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.2 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.0 | 0.3 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.7 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.5 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.2 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0021934 | hindbrain tangential cell migration(GO:0021934) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.4 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.1 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.0 | 0.0 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 1.9 | GO:0006821 | chloride transport(GO:0006821) |
0.0 | 0.1 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 1.4 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
0.0 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 1.1 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.1 | GO:0042053 | regulation of dopamine metabolic process(GO:0042053) |
0.0 | 0.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0006404 | MAPK import into nucleus(GO:0000189) RNA import into nucleus(GO:0006404) |
0.0 | 1.4 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.5 | GO:0006399 | tRNA metabolic process(GO:0006399) |
0.0 | 6.2 | GO:0051603 | proteolysis involved in cellular protein catabolic process(GO:0051603) |
0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.0 | GO:0099543 | trans-synaptic signaling by soluble gas(GO:0099543) trans-synaptic signaling by nitric oxide(GO:0099548) |
0.0 | 0.6 | GO:0042168 | heme metabolic process(GO:0042168) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.5 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 1.1 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.0 | GO:1902950 | regulation of dendritic spine maintenance(GO:1902950) |
0.0 | 0.2 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.0 | 4.6 | GO:0007608 | sensory perception of smell(GO:0007608) |
0.0 | 0.1 | GO:0002369 | T cell cytokine production(GO:0002369) |
0.0 | 0.4 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.0 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
0.0 | 0.2 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.0 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.1 | GO:0051280 | negative regulation of release of sequestered calcium ion into cytosol(GO:0051280) positive regulation of sequestering of calcium ion(GO:0051284) |
0.0 | 0.2 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.3 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.3 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.3 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.0 | 0.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.0 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0010984 | regulation of lipoprotein particle clearance(GO:0010984) |
0.0 | 0.5 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.0 | GO:1904953 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 4.0 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
1.2 | 3.6 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
1.0 | 7.2 | GO:0070695 | FHF complex(GO:0070695) |
0.9 | 6.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.9 | 2.6 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.9 | 3.4 | GO:0000802 | transverse filament(GO:0000802) |
0.8 | 4.2 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
0.8 | 2.5 | GO:0032010 | phagolysosome(GO:0032010) |
0.7 | 3.6 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.7 | 2.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.7 | 2.8 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
0.7 | 8.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.6 | 1.9 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.6 | 1.9 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.6 | 10.8 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.6 | 3.1 | GO:0030891 | VCB complex(GO:0030891) |
0.6 | 5.8 | GO:0042587 | glycogen granule(GO:0042587) |
0.6 | 1.7 | GO:0044317 | rod spherule(GO:0044317) |
0.5 | 0.5 | GO:0097636 | intrinsic component of autophagosome membrane(GO:0097636) integral component of autophagosome membrane(GO:0097637) |
0.5 | 4.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.5 | 1.0 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.5 | 2.9 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.5 | 2.9 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.4 | 4.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.4 | 1.8 | GO:0071942 | XPC complex(GO:0071942) |
0.4 | 1.8 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
0.4 | 4.8 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.4 | 5.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.4 | 6.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.4 | 3.8 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.4 | 1.7 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.4 | 2.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.4 | 0.8 | GO:0060187 | cell pole(GO:0060187) |
0.4 | 5.3 | GO:0043219 | lateral loop(GO:0043219) |
0.4 | 2.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
0.4 | 1.6 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
0.4 | 1.2 | GO:0018444 | translation release factor complex(GO:0018444) |
0.4 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.4 | 1.6 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
0.4 | 4.6 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.4 | 0.4 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.4 | 3.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.4 | 10.0 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.4 | 7.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.4 | 1.5 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
0.4 | 2.9 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.4 | 2.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.4 | 1.8 | GO:0072487 | MSL complex(GO:0072487) |
0.4 | 1.8 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.3 | 2.8 | GO:1990357 | terminal web(GO:1990357) |
0.3 | 1.4 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.3 | 2.1 | GO:0000938 | GARP complex(GO:0000938) |
0.3 | 1.4 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.3 | 1.0 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.3 | 1.9 | GO:0071817 | MMXD complex(GO:0071817) |
0.3 | 3.5 | GO:0070852 | cell body fiber(GO:0070852) |
0.3 | 6.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.3 | 1.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.3 | 3.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.3 | 16.2 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.3 | 0.9 | GO:0036019 | endolysosome(GO:0036019) |
0.3 | 0.9 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.3 | 2.1 | GO:0097413 | Lewy body(GO:0097413) |
0.3 | 1.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.3 | 4.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.3 | 2.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.3 | 1.2 | GO:1990707 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
0.3 | 2.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.3 | 1.7 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.3 | 1.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 1.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.3 | 1.4 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.3 | 0.8 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.3 | 1.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.3 | 1.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.3 | 0.8 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.3 | 5.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.3 | 3.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.3 | 1.4 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.3 | 0.8 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
0.3 | 1.9 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.3 | 1.1 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.3 | 1.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.3 | 1.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.3 | 1.1 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.3 | 0.3 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.3 | 6.8 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.3 | 6.7 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.3 | 3.6 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.3 | 2.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 2.0 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.3 | 2.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.3 | 0.8 | GO:0035061 | interchromatin granule(GO:0035061) |
0.2 | 2.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.2 | 7.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.2 | 2.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.2 | 1.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.2 | 1.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 3.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.2 | 0.7 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.2 | 1.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.2 | 2.6 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 0.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.2 | 1.6 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 0.7 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 2.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.2 | 0.2 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.2 | 2.0 | GO:0030478 | actin cap(GO:0030478) |
0.2 | 1.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.2 | 0.9 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.2 | 0.9 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.2 | 4.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.2 | 0.7 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.2 | 0.7 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.2 | 2.4 | GO:0034464 | BBSome(GO:0034464) |
0.2 | 1.3 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.2 | 3.0 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.2 | 9.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.2 | 1.5 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.2 | 1.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.2 | 1.0 | GO:1990130 | Iml1 complex(GO:1990130) |
0.2 | 12.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.2 | 0.6 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 1.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.2 | 1.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.2 | 0.8 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 1.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.2 | 2.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 1.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 22.5 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.2 | 0.2 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
0.2 | 1.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.2 | 1.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.2 | 2.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 3.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.2 | 1.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.2 | 1.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.2 | 8.9 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.2 | 3.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.2 | 0.6 | GO:0098855 | HCN channel complex(GO:0098855) |
0.2 | 1.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.2 | 3.8 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.2 | 0.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 2.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 3.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.2 | 1.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 0.7 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
0.2 | 0.4 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.2 | 0.5 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 1.0 | GO:0000235 | astral microtubule(GO:0000235) |
0.2 | 2.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.2 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 0.8 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
0.2 | 31.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 5.4 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.2 | 0.8 | GO:0070826 | paraferritin complex(GO:0070826) |
0.2 | 2.4 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.2 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.2 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
0.2 | 9.2 | GO:0034707 | chloride channel complex(GO:0034707) |
0.2 | 0.6 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.2 | 0.5 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.2 | 1.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.2 | 1.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.2 | 0.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.2 | 2.3 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 1.4 | GO:0031983 | vesicle lumen(GO:0031983) |
0.2 | 1.5 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.2 | 0.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 8.5 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 3.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 5.9 | GO:0070469 | respiratory chain(GO:0070469) |
0.1 | 6.8 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.9 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.4 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.7 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.4 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.1 | 0.6 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.6 | GO:0090537 | CERF complex(GO:0090537) |
0.1 | 0.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.7 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 4.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 1.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 1.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 0.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 4.2 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 1.8 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.8 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.4 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.1 | 1.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 1.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.5 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 6.3 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 6.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 1.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.5 | GO:0044307 | dendritic branch(GO:0044307) |
0.1 | 3.5 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 1.2 | GO:0044754 | autolysosome(GO:0044754) |
0.1 | 2.4 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.5 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 1.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.6 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 3.8 | GO:0090544 | BAF-type complex(GO:0090544) |
0.1 | 0.3 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.1 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 4.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 1.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 1.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 1.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 1.5 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.8 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 2.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 5.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 2.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 2.6 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.6 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 1.6 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 1.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 1.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.1 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.8 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 2.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.7 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 1.5 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 141.6 | GO:0005739 | mitochondrion(GO:0005739) |
0.1 | 0.3 | GO:0060473 | cortical granule(GO:0060473) |
0.1 | 1.3 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 1.8 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.2 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.1 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.2 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.1 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.1 | 2.2 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.2 | GO:0043512 | inhibin A complex(GO:0043512) |
0.1 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.6 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 1.9 | GO:0045095 | keratin filament(GO:0045095) |
0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.1 | 0.2 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.6 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 0.5 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 2.1 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 0.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 3.7 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 1.5 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.6 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.1 | 1.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.7 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 0.6 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 0.8 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.1 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.7 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 2.4 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.9 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.5 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.3 | GO:0044305 | calyx of Held(GO:0044305) |
0.1 | 10.1 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.1 | 0.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 0.4 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 20.4 | GO:0045177 | apical part of cell(GO:0045177) |
0.1 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 1.6 | GO:0001533 | cornified envelope(GO:0001533) |
0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.5 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.8 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.2 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
0.0 | 1.8 | GO:0044298 | cell body membrane(GO:0044298) |
0.0 | 0.3 | GO:0071664 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.2 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 7.1 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.2 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.9 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.8 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.2 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.0 | 6.7 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.0 | GO:0030690 | Noc1p-Noc2p complex(GO:0030690) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0070985 | TFIIK complex(GO:0070985) |
0.0 | 0.1 | GO:0001740 | Barr body(GO:0001740) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.3 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.0 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.0 | 0.0 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.9 | 19.4 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
2.8 | 8.5 | GO:0005186 | pheromone activity(GO:0005186) |
2.7 | 8.1 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
2.4 | 12.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
1.9 | 7.5 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
1.5 | 1.5 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
1.5 | 4.4 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
1.5 | 4.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
1.3 | 4.0 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
1.3 | 3.9 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
1.3 | 3.8 | GO:0098809 | nitrite reductase activity(GO:0098809) |
1.2 | 3.7 | GO:0004454 | ketohexokinase activity(GO:0004454) |
1.1 | 3.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
1.1 | 5.3 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
1.0 | 3.1 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
1.0 | 2.9 | GO:0008940 | nitrate reductase activity(GO:0008940) |
1.0 | 5.7 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.9 | 8.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.9 | 3.6 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.9 | 2.7 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.9 | 5.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.9 | 3.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.9 | 2.6 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.8 | 2.5 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.8 | 4.2 | GO:0032810 | sterol response element binding(GO:0032810) |
0.8 | 0.8 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.8 | 3.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.8 | 2.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.8 | 4.7 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.8 | 2.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.7 | 3.7 | GO:1990254 | keratin filament binding(GO:1990254) |
0.7 | 3.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.7 | 2.9 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.7 | 3.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.7 | 2.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.7 | 3.5 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.7 | 3.5 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.7 | 2.1 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) |
0.7 | 1.4 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.7 | 4.1 | GO:0002135 | CTP binding(GO:0002135) |
0.7 | 6.8 | GO:0008494 | translation activator activity(GO:0008494) |
0.7 | 2.0 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.7 | 3.4 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.7 | 2.0 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.6 | 0.6 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) |
0.6 | 3.2 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.6 | 2.6 | GO:0019970 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.6 | 1.9 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.6 | 1.9 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.6 | 2.5 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.6 | 3.5 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
0.6 | 2.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.6 | 1.7 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
0.6 | 0.6 | GO:0005009 | insulin-activated receptor activity(GO:0005009) |
0.6 | 2.3 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.6 | 3.4 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.6 | 0.6 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.5 | 3.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.5 | 3.8 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.5 | 4.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.5 | 11.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.5 | 3.0 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.5 | 7.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.5 | 2.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.5 | 2.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.5 | 1.5 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.5 | 2.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.5 | 1.4 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
0.5 | 1.4 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.5 | 1.4 | GO:0032142 | single guanine insertion binding(GO:0032142) |
0.5 | 1.4 | GO:0046911 | metal chelating activity(GO:0046911) |
0.5 | 2.8 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.5 | 1.8 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.5 | 4.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.5 | 1.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.5 | 2.3 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.5 | 3.6 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.4 | 1.8 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.4 | 2.2 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.4 | 1.8 | GO:0036033 | mediator complex binding(GO:0036033) |
0.4 | 1.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.4 | 2.7 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.4 | 2.7 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.4 | 0.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.4 | 2.6 | GO:0004103 | choline kinase activity(GO:0004103) |
0.4 | 1.3 | GO:0005118 | sevenless binding(GO:0005118) |
0.4 | 3.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.4 | 2.6 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.4 | 2.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.4 | 1.3 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
0.4 | 2.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.4 | 2.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.4 | 1.6 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
0.4 | 2.0 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.4 | 1.2 | GO:0030977 | taurine binding(GO:0030977) |
0.4 | 0.8 | GO:0070404 | NADH binding(GO:0070404) |
0.4 | 2.0 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.4 | 1.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.4 | 3.6 | GO:0046790 | virion binding(GO:0046790) |
0.4 | 1.6 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.4 | 1.5 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.4 | 1.2 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.4 | 2.7 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.4 | 3.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.4 | 1.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.4 | 7.3 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.4 | 1.1 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.4 | 2.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.4 | 1.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.4 | 4.5 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.4 | 1.1 | GO:0032564 | dATP binding(GO:0032564) |
0.4 | 3.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.4 | 8.9 | GO:0005550 | pheromone binding(GO:0005550) |
0.4 | 1.5 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.4 | 1.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.4 | 1.8 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.4 | 1.5 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.4 | 7.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.4 | 2.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.4 | 1.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.4 | 0.4 | GO:0004998 | transferrin receptor activity(GO:0004998) |
0.4 | 1.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.4 | 1.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.4 | 1.1 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.4 | 1.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 2.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.4 | 0.7 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.4 | 0.4 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.4 | 1.4 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
0.4 | 1.4 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.3 | 1.4 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
0.3 | 1.4 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.3 | 8.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.3 | 21.9 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.3 | 3.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.3 | 1.7 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.3 | 1.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.3 | 1.3 | GO:0000010 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.3 | 1.0 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.3 | 1.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.3 | 9.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.3 | 0.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.3 | 3.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.3 | 1.0 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.3 | 8.6 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
0.3 | 10.6 | GO:0016896 | exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.3 | 4.9 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.3 | 3.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.3 | 1.9 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.3 | 1.6 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.3 | 11.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.3 | 1.9 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.3 | 1.9 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.3 | 1.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.3 | 5.0 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
0.3 | 2.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.3 | 4.9 | GO:0046977 | TAP binding(GO:0046977) |
0.3 | 1.2 | GO:1903135 | cupric ion binding(GO:1903135) |
0.3 | 1.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 1.8 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.3 | 1.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.3 | 0.6 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.3 | 3.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.3 | 0.3 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.3 | 1.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.3 | 1.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.3 | 1.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.3 | 3.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.4 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.3 | 0.9 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.3 | 0.9 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.3 | 1.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 7.6 | GO:0008483 | transaminase activity(GO:0008483) |
0.3 | 3.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.3 | 2.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.3 | 1.4 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.3 | 0.8 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.3 | 1.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.3 | 1.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.3 | 1.6 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.3 | 1.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.3 | 0.8 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
0.3 | 0.8 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.3 | 1.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.3 | 0.8 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 1.9 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.3 | 1.3 | GO:2001070 | starch binding(GO:2001070) |
0.3 | 0.8 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.3 | 2.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.3 | 0.8 | GO:0045159 | myosin II binding(GO:0045159) |
0.3 | 3.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.2 | 1.0 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.2 | 2.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.2 | 10.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.2 | 2.7 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.2 | 4.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 1.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 1.0 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.2 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.2 | 2.2 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.2 | 0.7 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.2 | 3.6 | GO:0070628 | proteasome binding(GO:0070628) |
0.2 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.2 | 1.7 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 1.4 | GO:0097016 | L27 domain binding(GO:0097016) |
0.2 | 0.2 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.2 | 3.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.2 | 0.5 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.2 | 0.9 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.2 | 1.8 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.2 | 0.9 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.2 | 4.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.2 | 1.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.2 | 1.3 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.2 | 0.7 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.2 | 10.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.2 | 0.7 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.2 | 3.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 0.7 | GO:0019002 | GMP binding(GO:0019002) |
0.2 | 2.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.2 | 0.6 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.2 | 6.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.2 | 4.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.2 | 4.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.2 | 0.8 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
0.2 | 2.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.2 | 3.9 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.2 | 1.2 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 3.1 | GO:0031386 | protein tag(GO:0031386) |
0.2 | 1.0 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.2 | 0.6 | GO:0031208 | POZ domain binding(GO:0031208) |
0.2 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.2 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 1.4 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 2.0 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.2 | 3.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.2 | 2.0 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.2 | 0.6 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.2 | 2.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.2 | 4.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.2 | 1.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 0.6 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.2 | 0.8 | GO:0003681 | bent DNA binding(GO:0003681) |
0.2 | 0.6 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.2 | 0.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 4.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.2 | 2.5 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.2 | 0.9 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.2 | 0.6 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
0.2 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 1.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.2 | 3.7 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.2 | 0.9 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
0.2 | 0.6 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
0.2 | 0.2 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.2 | 2.6 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.2 | 0.7 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.2 | 3.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 1.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 4.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.2 | 2.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 1.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.2 | 0.9 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
0.2 | 3.0 | GO:0071949 | FAD binding(GO:0071949) |
0.2 | 2.8 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.2 | 1.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 0.5 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.2 | 0.3 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.2 | 3.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 2.6 | GO:0016594 | glycine binding(GO:0016594) |
0.2 | 0.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.2 | 0.9 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.2 | 1.2 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 4.4 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.2 | 0.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.2 | 16.4 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.2 | 1.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 0.8 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
0.2 | 0.8 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.2 | 3.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 1.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.2 | 1.8 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.2 | 0.7 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
0.2 | 0.8 | GO:0070287 | ferritin receptor activity(GO:0070287) |
0.2 | 0.8 | GO:0015100 | cadmium ion transmembrane transporter activity(GO:0015086) lead ion transmembrane transporter activity(GO:0015094) vanadium ion transmembrane transporter activity(GO:0015100) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
0.2 | 3.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.2 | 3.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 0.6 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.2 | 0.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.2 | 0.3 | GO:0031403 | lithium ion binding(GO:0031403) vitamin B6 binding(GO:0070279) |
0.2 | 0.8 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.2 | 3.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.2 | 1.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.2 | 0.5 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.2 | 0.6 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
0.2 | 0.5 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
0.2 | 1.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.2 | 1.4 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.2 | 3.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.2 | 3.6 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.2 | 0.8 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.2 | 0.6 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.2 | 5.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.2 | 0.6 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
0.2 | 3.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 1.7 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.2 | 0.8 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.2 | 0.6 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.2 | 0.9 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.2 | 1.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.2 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.2 | 11.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.2 | 1.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 0.5 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.2 | 0.5 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.2 | 1.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.2 | 0.8 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.2 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.9 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 38.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.1 | 0.4 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 1.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 1.3 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 1.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 1.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.6 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 1.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 2.1 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 3.8 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 2.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 1.5 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.4 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.1 | 0.6 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.4 | GO:0005110 | frizzled-2 binding(GO:0005110) |
0.1 | 0.7 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.1 | 1.8 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 7.1 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 3.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.1 | 0.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 1.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.1 | 1.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 2.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.9 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 2.7 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.1 | 0.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.2 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.1 | 0.4 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.1 | 1.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.5 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 1.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.8 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 3.9 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
0.1 | 1.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.1 | 2.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 1.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 1.6 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.5 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 6.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 2.4 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.1 | 0.9 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.1 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 1.8 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 1.5 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 0.5 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.5 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.1 | 4.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.5 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.5 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 1.5 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 1.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 3.4 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.1 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.7 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 0.5 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.6 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.5 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 3.3 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.5 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 1.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.9 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.7 | GO:0008486 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.1 | 0.5 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.8 | GO:0004875 | complement receptor activity(GO:0004875) |
0.1 | 0.3 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.3 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 1.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.7 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 6.7 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 5.1 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.9 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.1 | 3.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.5 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.1 | 0.6 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.1 | 0.9 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.1 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.3 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
0.1 | 1.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.4 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.1 | 1.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 1.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 3.0 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.1 | 0.5 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 0.3 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
0.1 | 0.8 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 1.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 1.5 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 2.8 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.1 | 2.0 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.1 | 3.5 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.1 | 0.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 1.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 1.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 4.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.1 | 0.2 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.4 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.4 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.3 | GO:0070002 | glutamic-type peptidase activity(GO:0070002) |
0.1 | 0.4 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.1 | 0.3 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.1 | 1.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 2.1 | GO:0005402 | cation:sugar symporter activity(GO:0005402) |
0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 1.6 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.2 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.5 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 0.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.3 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 3.1 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 0.9 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 1.1 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 1.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 2.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 5.0 | GO:0020037 | heme binding(GO:0020037) |
0.1 | 0.5 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
0.1 | 1.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 1.8 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 0.8 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 1.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.4 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
0.1 | 2.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 1.4 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.8 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.2 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 1.2 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.6 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 1.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 3.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 0.6 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 3.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 1.5 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.1 | 0.2 | GO:0043176 | amine binding(GO:0043176) |
0.1 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) A2A adenosine receptor binding(GO:0031687) |
0.1 | 0.3 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.1 | 0.2 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.1 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.1 | 0.2 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.1 | 0.3 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 0.1 | GO:0098770 | FBXO family protein binding(GO:0098770) |
0.1 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.7 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.3 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.1 | 0.3 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 2.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 1.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 1.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.4 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 1.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 1.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.5 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 1.0 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.8 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 0.1 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 1.5 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.8 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
0.1 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.1 | 0.2 | GO:0001566 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.9 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 0.4 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 0.7 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.2 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.1 | 0.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.1 | 0.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.0 | 3.7 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.4 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.2 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) |
0.0 | 2.3 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 11.4 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
0.0 | 0.8 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.5 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.0 | 0.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 1.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 1.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 1.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.4 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 1.4 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.3 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 1.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.3 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.1 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
0.0 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 5.5 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 1.4 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 1.3 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.3 | GO:0005165 | neurotrophin receptor binding(GO:0005165) |
0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.5 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.5 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.3 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.0 | 0.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.0 | 0.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 1.4 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 2.1 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.7 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
0.0 | 0.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 1.3 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.0 | 2.2 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.1 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.2 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.2 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.4 | GO:0034062 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
0.0 | 0.1 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.0 | 0.3 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.2 | GO:0051540 | iron-sulfur cluster binding(GO:0051536) 2 iron, 2 sulfur cluster binding(GO:0051537) metal cluster binding(GO:0051540) |
0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.0 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 2.8 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.2 | GO:0051287 | NAD binding(GO:0051287) |
0.0 | 0.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.3 | 1.4 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.3 | 7.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.3 | 1.7 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.3 | 14.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.2 | 1.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.2 | 0.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.2 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 2.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.2 | 5.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.2 | 0.6 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.2 | 2.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.2 | 3.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.2 | 5.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.2 | 10.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.2 | 3.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 1.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.2 | 1.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.2 | 1.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 10.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 8.2 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 5.2 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 6.7 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 1.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 3.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 1.0 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 2.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 0.5 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.1 | 2.1 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 1.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.4 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 0.7 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 1.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 4.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 2.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 1.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 3.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 1.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.5 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 2.3 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 0.6 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.2 | PID ATM PATHWAY | ATM pathway |
0.1 | 2.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 3.1 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 1.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.8 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 5.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 1.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 2.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 1.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 2.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 3.6 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.6 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 1.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 2.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 1.1 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 1.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.9 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 15.9 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.8 | 11.5 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.8 | 3.3 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.7 | 2.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.6 | 6.6 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.5 | 6.8 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.5 | 6.9 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.5 | 17.2 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.5 | 9.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.5 | 14.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.5 | 6.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.5 | 2.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.5 | 13.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.4 | 6.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.4 | 10.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.4 | 5.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.4 | 9.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.3 | 5.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.3 | 4.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.3 | 9.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.3 | 4.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.3 | 5.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.3 | 4.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.3 | 5.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.3 | 0.8 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.3 | 5.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.3 | 2.8 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.3 | 2.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.3 | 5.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.3 | 4.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.3 | 6.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.2 | 3.5 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 0.7 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.2 | 4.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.2 | 1.7 | REACTOME TRANSMEMBRANE TRANSPORT OF SMALL MOLECULES | Genes involved in Transmembrane transport of small molecules |
0.2 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.2 | 0.2 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
0.2 | 2.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.2 | 12.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.2 | 5.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 4.9 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 2.5 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.2 | 0.4 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 3.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 0.6 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.2 | 2.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.2 | 4.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.2 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.2 | 14.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.2 | 9.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.2 | 0.6 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 4.0 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.2 | 11.0 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.2 | 0.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.2 | 3.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.2 | 3.7 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.2 | 2.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 7.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 2.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.2 | 7.1 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.2 | 4.8 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.2 | 1.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.2 | 2.3 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.2 | 3.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.2 | 4.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 0.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.2 | 4.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 3.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 2.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 4.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 0.4 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 1.9 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 1.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 2.3 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 15.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.7 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 2.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 2.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 3.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.0 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 24.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.6 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.1 | 1.6 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 3.9 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.1 | 2.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 1.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 1.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 3.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.9 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 1.7 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 1.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 1.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 1.6 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 2.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.9 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 1.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 2.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 3.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 5.0 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 1.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 4.5 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.1 | 6.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.8 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 1.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.5 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 5.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 0.8 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.1 | 2.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 1.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 0.6 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 0.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.1 | 1.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 2.2 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 2.5 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.9 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.7 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 3.8 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 1.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 1.0 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.5 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.6 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |