Project
Inflammatory response time course, HUVEC (Wada, 2009)
Navigation
Downloads
Results for MECP2
Z-value: 1.77
Motif logo
Transcription factors associated with MECP2
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MECP2
|
ENSG00000169057.24 | MECP2 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MECP2 | hg38_v1_chrX_-_154097731_154097746 | -0.28 | 1.7e-01 | Click! |
Activity profile of MECP2 motif
Sorted Z-values of MECP2 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of MECP2
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 10.3 | GO:1903400 | L-arginine transmembrane transport(GO:1903400) |
| 1.8 | 5.5 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 1.7 | 5.1 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 1.6 | 4.7 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 1.5 | 4.5 | GO:0009720 | detection of hormone stimulus(GO:0009720) |
| 1.5 | 5.9 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 1.5 | 7.3 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 1.3 | 5.3 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 1.2 | 3.6 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 1.1 | 4.4 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 1.1 | 3.3 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 1.1 | 3.3 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 1.1 | 3.3 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 1.0 | 5.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 1.0 | 3.1 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.9 | 2.7 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.9 | 3.6 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.9 | 2.7 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.9 | 3.5 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.9 | 0.9 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.9 | 2.6 | GO:0070429 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.9 | 2.6 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.9 | 5.2 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.9 | 2.6 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.8 | 5.7 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) |
| 0.8 | 3.1 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.7 | 2.1 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 0.7 | 2.1 | GO:2000754 | regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 0.7 | 2.1 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.7 | 4.1 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.7 | 2.7 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.7 | 5.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.7 | 2.0 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.7 | 3.3 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.6 | 1.3 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.6 | 12.7 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.6 | 5.7 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.6 | 1.2 | GO:0032499 | detection of peptidoglycan(GO:0032499) |
| 0.6 | 2.4 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.6 | 3.0 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.6 | 4.6 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.6 | 1.7 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.6 | 3.4 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.6 | 3.4 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.6 | 2.2 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.5 | 0.5 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.5 | 2.2 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.5 | 1.1 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.5 | 1.6 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.5 | 1.6 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.5 | 1.6 | GO:0042946 | glucoside transport(GO:0042946) glycoside transport(GO:1901656) |
| 0.5 | 1.6 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.5 | 5.1 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.5 | 1.5 | GO:0070077 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.5 | 1.5 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.5 | 2.0 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.5 | 1.5 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.5 | 1.5 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.5 | 1.9 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.5 | 1.4 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.5 | 2.4 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.5 | 2.4 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.5 | 1.9 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.5 | 1.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.5 | 3.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.5 | 1.4 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.5 | 2.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.4 | 1.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.4 | 6.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.4 | 1.3 | GO:0070340 | central nervous system myelin formation(GO:0032289) detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.4 | 1.7 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.4 | 2.6 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.4 | 1.7 | GO:0021836 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.4 | 1.7 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.4 | 4.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.4 | 6.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.4 | 0.8 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.4 | 2.8 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.4 | 3.2 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.4 | 6.7 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.4 | 0.4 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.4 | 2.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.4 | 0.4 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.4 | 2.3 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.4 | 1.1 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.4 | 4.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.4 | 1.1 | GO:0072034 | renal vesicle induction(GO:0072034) |
| 0.4 | 1.5 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.4 | 1.1 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.4 | 0.7 | GO:1902214 | regulation of interleukin-4-mediated signaling pathway(GO:1902214) |
| 0.4 | 0.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.4 | 2.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.4 | 2.8 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.3 | 1.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 | 3.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 1.0 | GO:0033078 | extrathymic T cell differentiation(GO:0033078) regulation of extrathymic T cell differentiation(GO:0033082) sebum secreting cell proliferation(GO:1990654) |
| 0.3 | 1.7 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.3 | 0.7 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.3 | 0.3 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.3 | 3.0 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.3 | 1.3 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.3 | 0.3 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.3 | 0.3 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.3 | 1.7 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.3 | 2.0 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.3 | 0.7 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.3 | 3.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.3 | 2.3 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.3 | 1.3 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.3 | 1.3 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.3 | 11.0 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.3 | 2.6 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.3 | 1.3 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.3 | 2.5 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.3 | 0.3 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.3 | 0.9 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 1.3 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.3 | 1.9 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) |
| 0.3 | 2.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.3 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.3 | 0.9 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.3 | 4.6 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.3 | 3.7 | GO:0030578 | PML body organization(GO:0030578) |
| 0.3 | 0.6 | GO:1902523 | positive regulation of protein K63-linked ubiquitination(GO:1902523) |
| 0.3 | 0.9 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.3 | 1.5 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.3 | 0.9 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.3 | 0.6 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.3 | 0.3 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.3 | 1.5 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.3 | 0.9 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.3 | 1.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.3 | 1.5 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 | 2.3 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.3 | 1.7 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.3 | 1.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.3 | 1.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.3 | 0.9 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.3 | 2.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.3 | 0.3 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.3 | 0.8 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.3 | 0.8 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.3 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.3 | 2.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 0.8 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.3 | 1.1 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.3 | 0.8 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.3 | 0.5 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.3 | 1.6 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.3 | 1.1 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.3 | 2.7 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.3 | 1.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 | 0.3 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.3 | 0.8 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.3 | 2.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.3 | 0.8 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.3 | 0.8 | GO:0021551 | central nervous system morphogenesis(GO:0021551) cardiac muscle tissue regeneration(GO:0061026) |
| 0.3 | 0.8 | GO:0060458 | right lung development(GO:0060458) |
| 0.3 | 0.8 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.3 | 1.0 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.3 | 1.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.3 | 1.8 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.3 | 1.5 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.3 | 1.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.3 | 2.3 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 1.0 | GO:1904782 | negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) |
| 0.2 | 0.7 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.2 | 2.0 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.2 | 1.2 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.2 | 1.5 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 1.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.2 | 1.5 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.2 | 3.7 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 0.2 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.2 | 0.7 | GO:1902905 | positive regulation of fibril organization(GO:1902905) |
| 0.2 | 0.2 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.2 | 0.7 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.2 | 0.7 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.2 | 5.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.2 | 2.9 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 6.7 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 1.4 | GO:0002353 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.2 | 1.2 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.2 | 0.2 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
| 0.2 | 0.7 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.2 | 0.9 | GO:1903382 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.2 | 0.9 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 2.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 | 0.7 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.2 | 0.7 | GO:0035732 | nitric oxide storage(GO:0035732) |
| 0.2 | 0.7 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.2 | 0.7 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.2 | 0.5 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.2 | 1.8 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 | 0.9 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.2 | 0.4 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
| 0.2 | 0.7 | GO:1902594 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.2 | 2.4 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.2 | 0.7 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.2 | 3.9 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.2 | 0.4 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.2 | 2.4 | GO:1903944 | negative regulation of myoblast fusion(GO:1901740) regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 | 1.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.2 | 1.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.2 | 1.7 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 0.8 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 0.6 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.2 | 1.2 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
| 0.2 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 2.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.2 | 0.6 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 0.6 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.2 | 0.8 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.2 | 0.2 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.2 | 0.8 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.2 | 1.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 0.6 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.2 | 1.0 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 | 0.6 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.2 | 1.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.2 | 0.4 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.2 | 1.2 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.2 | 1.2 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.2 | 1.1 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.2 | 0.4 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.2 | 2.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.2 | 1.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.2 | 1.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 | 0.6 | GO:0046077 | dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 0.2 | 1.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.2 | 0.9 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.2 | 0.4 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.2 | 0.4 | GO:0051563 | smooth endoplasmic reticulum calcium ion homeostasis(GO:0051563) |
| 0.2 | 0.9 | GO:1903333 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
| 0.2 | 3.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 | 0.2 | GO:0070433 | negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.2 | 0.6 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.2 | 1.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 0.7 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.2 | 1.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.2 | 0.2 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.2 | 0.2 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 | 0.5 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.2 | 2.4 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 0.2 | 0.5 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.2 | 0.5 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.2 | 0.7 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.2 | 1.3 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.2 | 0.4 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.2 | 0.7 | GO:0046223 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.2 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 2.1 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.2 | 3.7 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.2 | 0.5 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.2 | 0.7 | GO:0002543 | activation of blood coagulation via clotting cascade(GO:0002543) |
| 0.2 | 0.9 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.2 | 0.9 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 | 1.2 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.2 | 0.9 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.2 | 0.7 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 0.2 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.2 | 1.7 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.2 | 0.7 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.2 | 1.2 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.2 | 0.5 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.2 | 0.5 | GO:0060022 | hard palate development(GO:0060022) |
| 0.2 | 0.7 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 | 2.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.2 | 1.5 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 | 0.7 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.2 | 0.7 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.2 | 0.5 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.2 | 1.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.2 | 0.2 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.2 | 1.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 1.5 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.2 | 0.8 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.2 | 1.4 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.2 | 0.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 0.3 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.2 | 1.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.2 | 0.8 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 1.4 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.2 | 0.3 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.2 | 0.9 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.2 | 1.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.2 | 0.8 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.2 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.2 | 1.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.2 | 1.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 | 0.8 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.2 | 0.6 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.2 | 0.5 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.2 | 0.5 | GO:0090298 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.2 | 0.8 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.2 | 1.5 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.2 | 0.5 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 2.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.3 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 0.1 | 0.6 | GO:1902963 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 | 0.6 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.1 | 0.4 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 1.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.7 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.4 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.1 | 0.1 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 1.0 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.1 | 1.2 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.4 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 4.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.9 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.1 | 0.3 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.1 | 1.1 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.1 | 1.0 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:0003343 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.1 | 1.7 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.1 | GO:0089718 | amino acid import across plasma membrane(GO:0089718) |
| 0.1 | 0.8 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.1 | 0.7 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 0.6 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.1 | 1.3 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 | 0.3 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.1 | 1.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 0.1 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.1 | 0.3 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 | 0.1 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.1 | 4.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 0.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 1.1 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.5 | GO:0043305 | negative regulation of mast cell degranulation(GO:0043305) |
| 0.1 | 0.1 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 0.1 | 0.3 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 0.4 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 1.9 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.3 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.1 | 0.4 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.1 | 0.4 | GO:0061163 | endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.1 | 0.1 | GO:1902524 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.1 | 0.4 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) |
| 0.1 | 1.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.4 | GO:0035698 | CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.1 | 0.4 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 | 0.4 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.1 | 0.5 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 7.3 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.1 | 0.6 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 0.5 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 1.5 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 | 1.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.5 | GO:1904800 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 | 1.0 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 2.9 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.1 | 0.5 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.1 | 0.4 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.1 | 1.8 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.4 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.1 | 0.4 | GO:2000439 | positive regulation of monocyte extravasation(GO:2000439) |
| 0.1 | 1.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.5 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.5 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 0.7 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.1 | 0.2 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.1 | 0.2 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.1 | 1.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.1 | 2.0 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.4 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.1 | 0.6 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 4.5 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.1 | 0.4 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 0.1 | 0.4 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.1 | 0.8 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 | 0.5 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 1.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.4 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 1.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.9 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.8 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.1 | 1.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.6 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.1 | 0.5 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 1.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.7 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.5 | GO:0032913 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.1 | 0.7 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.3 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.9 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 1.7 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
| 0.1 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.7 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 0.5 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.1 | 0.9 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.5 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.2 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 | 1.8 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.1 | 0.7 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.8 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.1 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 1.7 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.1 | 0.2 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.1 | 0.1 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.3 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.6 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) positive regulation of chronic inflammatory response(GO:0002678) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
| 0.1 | 0.9 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.1 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.1 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 1.2 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.3 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.1 | 2.3 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.8 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.1 | 0.1 | GO:1901421 | regulation of response to alcohol(GO:1901419) positive regulation of response to alcohol(GO:1901421) |
| 0.1 | 0.7 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.2 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 0.1 | 0.2 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.1 | 0.5 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.9 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 1.7 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.4 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.1 | 0.3 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
| 0.1 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 3.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.6 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.1 | 0.7 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.1 | 0.5 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.3 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.1 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.4 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.5 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.1 | 2.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.2 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.1 | 1.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.3 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 0.1 | 0.9 | GO:0000423 | macromitophagy(GO:0000423) |
| 0.1 | 2.4 | GO:1903541 | regulation of exosomal secretion(GO:1903541) |
| 0.1 | 0.2 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 2.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.1 | 1.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.2 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.7 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 0.4 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.5 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.6 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 1.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 | 0.8 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.5 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.1 | 0.4 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 1.6 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.2 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 1.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 4.3 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.4 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.6 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 1.9 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.1 | 0.4 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 0.1 | 9.9 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.1 | 0.9 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.1 | 0.3 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.1 | 2.5 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 | 0.6 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.3 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 0.3 | GO:1902161 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 | 2.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 0.3 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.1 | 0.3 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.1 | 0.5 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.4 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.1 | 0.8 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.7 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 1.2 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.1 | 1.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.3 | GO:0010768 | negative regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010768) transmission of virus(GO:0019089) dissemination or transmission of symbiont from host(GO:0044007) dissemination or transmission of organism from other organism involved in symbiotic interaction(GO:0051821) |
| 0.1 | 0.7 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 2.5 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 | 0.9 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.8 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.6 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 9.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.3 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.1 | 0.8 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.1 | 0.8 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.3 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.1 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 0.5 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.1 | 0.5 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.7 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 | 0.9 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.4 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.3 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 0.2 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 1.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 1.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.1 | 0.5 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 0.7 | GO:0046476 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) glycosylceramide biosynthetic process(GO:0046476) |
| 0.1 | 1.0 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 1.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 | 0.6 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.3 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.1 | 1.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.7 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.6 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.1 | 0.3 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.1 | 1.0 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.1 | 1.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 4.7 | GO:1903307 | positive regulation of regulated secretory pathway(GO:1903307) |
| 0.1 | 0.8 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.1 | 0.4 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.6 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.1 | 2.0 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.3 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.8 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 4.6 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.1 | 1.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.3 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
| 0.1 | 0.2 | GO:1903259 | exon-exon junction complex disassembly(GO:1903259) |
| 0.1 | 0.2 | GO:0034241 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.1 | 5.5 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.1 | 0.9 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 1.6 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 1.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.2 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 | 0.9 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 1.9 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.1 | 0.2 | GO:0003099 | positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 1.3 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.1 | 0.3 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.9 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 1.4 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.5 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 | 0.3 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.1 | 0.2 | GO:0099540 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.1 | 1.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.5 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.1 | 0.2 | GO:0045357 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
| 0.1 | 0.2 | GO:0039656 | modulation by virus of host gene expression(GO:0039656) |
| 0.1 | 1.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.1 | 2.4 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.9 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.6 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 0.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.3 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 1.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.1 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 1.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.4 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.1 | 0.4 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.1 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 0.3 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.1 | 0.2 | GO:1990910 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
| 0.1 | 0.1 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.1 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.7 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
| 0.1 | 0.1 | GO:0001878 | response to yeast(GO:0001878) |
| 0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.1 | 0.3 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.1 | 0.8 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.1 | 0.2 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.9 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.3 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 | 0.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 1.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.3 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.1 | 0.5 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 1.6 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.3 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.6 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.3 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.1 | 0.3 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.1 | 0.2 | GO:0071362 | cellular response to ether(GO:0071362) |
| 0.1 | 2.2 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.1 | 0.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.1 | 0.2 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.1 | 0.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.1 | 3.5 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.2 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 2.5 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.1 | 0.6 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.3 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.1 | 0.2 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.1 | 0.4 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.3 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.1 | 0.9 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 2.4 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.1 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 8.1 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.1 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 2.0 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 2.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 2.2 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.7 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.6 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.7 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.9 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 | 1.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.1 | 0.2 | GO:0006147 | guanine catabolic process(GO:0006147) |
| 0.1 | 0.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.1 | 0.4 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.1 | 1.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 0.2 | GO:0072023 | thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.1 | 0.1 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.1 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.3 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.5 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.1 | 0.3 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 1.1 | GO:0007567 | parturition(GO:0007567) |
| 0.1 | 1.3 | GO:0060334 | regulation of response to interferon-gamma(GO:0060330) regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 | 1.3 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 | 0.2 | GO:1904640 | response to methionine(GO:1904640) |
| 0.1 | 0.7 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 | 0.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.7 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.4 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 1.6 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.1 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.1 | 0.3 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 | 0.7 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.1 | 0.7 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.7 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.1 | 0.2 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.1 | 0.2 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 1.8 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 | 0.2 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.3 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 2.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.1 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) |
| 0.1 | 0.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.5 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 4.1 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 | 0.2 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.5 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.1 | 1.6 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.1 | 0.6 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 1.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 2.0 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 2.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.8 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.1 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 1.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 2.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.7 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.1 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.2 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.1 | 0.6 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 1.0 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.1 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.5 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.2 | GO:1903576 | response to L-arginine(GO:1903576) |
| 0.1 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 1.7 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 0.2 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.2 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.2 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) stem cell fate determination(GO:0048867) |
| 0.1 | 0.7 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.1 | 0.9 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.3 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.3 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.1 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 | 0.0 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.0 | 0.1 | GO:0097068 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 1.0 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 1.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.1 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.0 | 0.6 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.2 | GO:1900101 | regulation of endoplasmic reticulum unfolded protein response(GO:1900101) |
| 0.0 | 0.1 | GO:0018012 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 0.7 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.1 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.2 | GO:0001999 | renal response to blood flow involved in circulatory renin-angiotensin regulation of systemic arterial blood pressure(GO:0001999) renin secretion into blood stream(GO:0002001) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.0 | 0.7 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.0 | 2.3 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.2 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.0 | 0.1 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.0 | 0.6 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.8 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.2 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.1 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 | 0.6 | GO:0051923 | sulfation(GO:0051923) |
| 0.0 | 0.8 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.5 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.6 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.5 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.0 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.0 | 0.1 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.0 | 0.6 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.2 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.1 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.0 | 1.1 | GO:0045921 | positive regulation of exocytosis(GO:0045921) |
| 0.0 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 1.1 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.9 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.9 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.3 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.6 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.0 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.3 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 | 0.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:1904350 | regulation of protein catabolic process in the vacuole(GO:1904350) positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.0 | 0.1 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.0 | 0.2 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.4 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.2 | GO:0060356 | leucine import(GO:0060356) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.2 | GO:0032472 | Golgi calcium ion homeostasis(GO:0032468) Golgi calcium ion transport(GO:0032472) |
| 0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.5 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 2.5 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 0.0 | 0.5 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.0 | 0.2 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.0 | 0.0 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.0 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.0 | 0.1 | GO:0090301 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.0 | 1.4 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.4 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.0 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.3 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:1901731 | positive regulation of platelet aggregation(GO:1901731) regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 1.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.4 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 | 0.3 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.0 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0006212 | uracil catabolic process(GO:0006212) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.0 | 0.2 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.0 | 1.1 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.5 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:1903233 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.2 | GO:0048296 | regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.0 | 0.3 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0060437 | lung growth(GO:0060437) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.1 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 | 0.2 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 1.4 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.4 | GO:0014848 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.0 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
| 0.0 | 0.3 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.3 | GO:0097435 | fibril organization(GO:0097435) |
| 0.0 | 0.7 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 | 0.1 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.0 | 0.9 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.4 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.0 | 0.1 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.0 | 0.1 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 | 0.3 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.2 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 1.2 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
| 0.0 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.4 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
| 0.0 | 0.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 | 0.1 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.6 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.2 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.4 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.3 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.2 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.0 | 0.4 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.4 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.3 | GO:1904407 | positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.0 | 0.0 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.0 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
| 0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.1 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.4 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.0 | 0.4 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.0 | 0.1 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.0 | 0.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.2 | GO:0070266 | necroptotic process(GO:0070266) |
| 0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.3 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.0 | 0.1 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.0 | 0.1 | GO:0042262 | DNA protection(GO:0042262) |
| 0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.0 | 0.1 | GO:0010193 | response to ozone(GO:0010193) |
| 0.0 | 8.8 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.0 | 0.2 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 | 0.1 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.0 | 0.3 | GO:0010460 | positive regulation of heart rate(GO:0010460) |
| 0.0 | 0.2 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.2 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.0 | GO:2001279 | regulation of prostaglandin biosynthetic process(GO:0031392) negative regulation of prostaglandin biosynthetic process(GO:0031393) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.0 | 0.0 | GO:0002568 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) post-embryonic camera-type eye development(GO:0031077) T cell receptor V(D)J recombination(GO:0033153) |
| 0.0 | 0.0 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.9 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.0 | GO:0051708 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.1 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.5 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.0 | GO:0009631 | cold acclimation(GO:0009631) |
| 0.0 | 0.0 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.0 | 0.0 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
| 0.0 | 0.1 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.2 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
| 0.0 | 2.4 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.0 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.0 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.0 | 0.0 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.2 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.0 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.0 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.0 | 0.2 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.0 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.2 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.0 | 0.0 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.1 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
| 0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.1 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) |
| 0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.0 | GO:0015824 | proline transport(GO:0015824) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 5.9 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 1.4 | 11.3 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.9 | 2.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.8 | 3.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.8 | 5.5 | GO:0042825 | TAP complex(GO:0042825) |
| 0.7 | 3.4 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.6 | 5.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.5 | 2.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.5 | 4.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.5 | 5.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.5 | 1.5 | GO:0030689 | Noc complex(GO:0030689) |
| 0.5 | 4.4 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.4 | 7.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.4 | 1.3 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.4 | 2.5 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.4 | 1.3 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.4 | 1.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.4 | 0.4 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.4 | 1.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.4 | 0.4 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.4 | 0.4 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.3 | 1.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.3 | 5.7 | GO:0032059 | bleb(GO:0032059) |
| 0.3 | 1.3 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.3 | 1.3 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 0.3 | 1.0 | GO:0060987 | lipid tube(GO:0060987) |
| 0.3 | 1.5 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.3 | 2.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.3 | 0.9 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.3 | 1.5 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.3 | 1.1 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.3 | 0.3 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.2 | 1.0 | GO:1990879 | CST complex(GO:1990879) |
| 0.2 | 1.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.2 | 0.7 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.2 | 0.9 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.2 | 1.6 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.2 | 2.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 0.7 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.2 | 2.7 | GO:0070449 | elongin complex(GO:0070449) |
| 0.2 | 3.6 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 1.3 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 1.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 0.6 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.2 | 0.6 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.2 | 2.5 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.2 | 0.8 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.2 | 4.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.2 | 3.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.2 | 0.4 | GO:0044393 | microspike(GO:0044393) |
| 0.2 | 1.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.2 | 1.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.2 | 1.9 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.2 | 4.4 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.2 | 0.7 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.2 | 1.8 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.2 | 0.5 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.2 | 0.7 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.2 | 1.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 0.9 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.2 | 0.5 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.2 | 1.9 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 2.4 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.2 | 0.5 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.2 | 0.5 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.2 | 0.7 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.2 | 1.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 2.7 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.2 | 0.7 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 0.8 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 0.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.2 | 1.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 0.5 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.2 | 0.8 | GO:0031523 | Myb complex(GO:0031523) |
| 0.2 | 0.2 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.2 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 0.8 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.1 | 0.4 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 0.4 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.1 | 0.6 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 4.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.1 | 2.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 0.8 | GO:0061200 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.1 | 0.4 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 4.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 0.4 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 1.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.4 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 0.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.5 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 0.5 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 1.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.1 | 0.7 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.1 | 1.6 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 2.8 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 1.3 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 1.0 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.7 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.1 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.5 | GO:1990742 | microvesicle(GO:1990742) |
| 0.1 | 2.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.5 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.6 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 2.8 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.4 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.1 | 4.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.1 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.8 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.4 | GO:0097229 | sperm end piece(GO:0097229) |
| 0.1 | 1.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.9 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.6 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 0.1 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 0.9 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.3 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.1 | 1.4 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 4.5 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 2.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.6 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 0.7 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.1 | 5.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.6 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.1 | 0.3 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.1 | 0.9 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.3 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.6 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.1 | 1.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.1 | 0.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 1.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.6 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.1 | 0.3 | GO:0008623 | CHRAC(GO:0008623) |
| 0.1 | 1.2 | GO:0032797 | SMN complex(GO:0032797) |
| 0.1 | 0.8 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.7 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 2.3 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.1 | 0.6 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.6 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.3 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.9 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 2.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.5 | GO:0033179 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 2.5 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.1 | 1.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.5 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.6 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 4.4 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.8 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.7 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.4 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.5 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 1.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.8 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.0 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 1.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 0.2 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.9 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.1 | GO:0030849 | autosome(GO:0030849) |
| 0.1 | 0.7 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.5 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 0.5 | GO:0042599 | lamellar body(GO:0042599) |
| 0.1 | 4.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 2.9 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.6 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 1.0 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.5 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.9 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.6 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.3 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.4 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 2.7 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.5 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 1.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.2 | GO:0036030 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) protease inhibitor complex(GO:0097179) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.1 | 1.5 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 9.6 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 1.5 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 5.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 0.3 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 2.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 1.4 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 0.8 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.5 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.3 | GO:0005927 | muscle tendon junction(GO:0005927) cuticular plate(GO:0032437) |
| 0.0 | 0.9 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 22.4 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.2 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.2 | GO:0060201 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.0 | 0.6 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 1.0 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.7 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.2 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.0 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 1.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.9 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.0 | 7.2 | GO:0044452 | nucleolar part(GO:0044452) |
| 0.0 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 1.6 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.8 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 2.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.0 | 0.5 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.3 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 1.7 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.4 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.4 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.0 | 3.7 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.7 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 2.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.3 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0005589 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 3.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.1 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.0 | 0.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.8 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.0 | 0.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 2.9 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.1 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 3.2 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) phagolysosome(GO:0032010) |
| 0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 2.5 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.0 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
| 0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 2.0 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 2.0 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 3.3 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 1.1 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 1.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.1 | GO:0019012 | virion(GO:0019012) virion part(GO:0044423) |
| 0.0 | 0.2 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.1 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 1.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 6.7 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 10.3 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 1.7 | 5.1 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 1.1 | 4.4 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.9 | 2.7 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.9 | 2.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.9 | 3.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.8 | 6.6 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.8 | 2.4 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.8 | 1.6 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.8 | 3.0 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.7 | 7.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.7 | 2.9 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) |
| 0.7 | 2.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.7 | 4.1 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.6 | 2.5 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.6 | 2.9 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.6 | 4.6 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.6 | 2.3 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.6 | 1.7 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.6 | 2.2 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.5 | 1.6 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.5 | 5.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.5 | 1.6 | GO:0042947 | glucoside transmembrane transporter activity(GO:0042947) |
| 0.5 | 3.1 | GO:0042806 | fucose binding(GO:0042806) |
| 0.5 | 2.0 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.5 | 1.5 | GO:0033749 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.5 | 1.5 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.5 | 2.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.5 | 0.5 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 0.5 | 2.5 | GO:0004803 | transposase activity(GO:0004803) |
| 0.5 | 4.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.5 | 2.9 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.5 | 1.4 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.5 | 3.3 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.5 | 1.4 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.5 | 2.3 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.5 | 7.7 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.4 | 1.3 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.4 | 1.3 | GO:0016154 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 0.4 | 1.3 | GO:0004056 | argininosuccinate lyase activity(GO:0004056) |
| 0.4 | 1.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.4 | 2.9 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.4 | 2.0 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.4 | 1.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.4 | 0.4 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.4 | 1.5 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.4 | 1.5 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.4 | 2.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.3 | 7.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.3 | 1.0 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.3 | 1.3 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.3 | 1.0 | GO:0004314 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.3 | 1.0 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.3 | 1.6 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.3 | 1.0 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.3 | 1.3 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.3 | 2.5 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.3 | 0.9 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.3 | 2.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.3 | 0.9 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.3 | 3.4 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.3 | 0.9 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.3 | 3.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.3 | 2.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 0.9 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.3 | 1.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.3 | 0.8 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.3 | 1.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.3 | 1.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.3 | 4.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.3 | 2.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.3 | 3.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.3 | 1.3 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.3 | 0.8 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.3 | 1.3 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.3 | 2.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.3 | 2.9 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.3 | 2.3 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.3 | 1.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.3 | 1.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.3 | 0.8 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.3 | 1.3 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.2 | 0.7 | GO:0045145 | single-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0045145) |
| 0.2 | 3.7 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 0.7 | GO:0047315 | kynurenine-glyoxylate transaminase activity(GO:0047315) |
| 0.2 | 0.7 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.2 | 0.7 | GO:0035730 | S-nitrosoglutathione binding(GO:0035730) dinitrosyl-iron complex binding(GO:0035731) |
| 0.2 | 1.1 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.2 | 0.9 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.2 | 0.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.2 | 0.9 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.2 | 4.0 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.2 | 2.7 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.2 | 1.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 1.1 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.2 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.2 | 1.9 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 0.9 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 0.2 | 5.1 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.2 | 1.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.2 | 0.6 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.2 | 0.4 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.2 | 1.9 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.2 | 1.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.2 | 0.8 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.2 | 0.8 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.2 | 1.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.2 | 1.2 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.2 | 0.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.2 | 0.8 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.2 | 1.6 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.2 | 0.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 5.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 3.2 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.2 | 0.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 0.6 | GO:0000252 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) sterol-4-alpha-carboxylate 3-dehydrogenase (decarboxylating) activity(GO:0047012) |
| 0.2 | 2.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 6.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 1.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.2 | 0.9 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.2 | 0.4 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.2 | 0.7 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.2 | 0.7 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.2 | 1.8 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.2 | 1.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.2 | 0.5 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.2 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.2 | 2.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.2 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.2 | 0.7 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.2 | 2.6 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.2 | 0.2 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.2 | 0.5 | GO:0033842 | N-acetyl-beta-glucosaminyl-glycoprotein 4-beta-N-acetylgalactosaminyltransferase activity(GO:0033842) |
| 0.2 | 0.5 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.2 | 4.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 1.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.2 | 1.7 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.2 | 1.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.2 | 4.7 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 1.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.2 | 1.7 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 1.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 1.0 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.2 | 1.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 2.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.2 | 1.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.2 | 2.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.2 | 0.5 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 1.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 2.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.2 | 1.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.2 | 1.1 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 0.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 1.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 8.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.2 | 1.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 2.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 0.5 | GO:0004577 | N-acetylglucosaminyldiphosphodolichol N-acetylglucosaminyltransferase activity(GO:0004577) |
| 0.2 | 0.5 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.2 | 0.5 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.2 | 1.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.2 | 0.8 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.2 | 6.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 2.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 1.7 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.7 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 1.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.9 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.1 | 3.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 2.0 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.1 | 1.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 1.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 2.0 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.4 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.1 | 2.5 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 1.6 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 1.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 0.6 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 2.7 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.1 | 0.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.1 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.1 | 0.8 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 4.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 1.6 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 2.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 2.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 1.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.4 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.1 | 0.8 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.9 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 2.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 0.5 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.8 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 0.4 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.6 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 1.5 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 2.7 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.5 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 1.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.3 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.1 | 1.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.5 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.7 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 0.1 | 0.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.5 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 1.0 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.4 | GO:0004418 | hydroxymethylbilane synthase activity(GO:0004418) |
| 0.1 | 0.5 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.5 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 0.4 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.1 | 1.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.9 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.1 | 1.7 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.3 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.7 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.1 | 0.2 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.1 | 1.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.9 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 2.7 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 0.7 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.5 | GO:0042282 | hydroxymethylglutaryl-CoA reductase (NADPH) activity(GO:0004420) hydroxymethylglutaryl-CoA reductase activity(GO:0042282) |
| 0.1 | 0.3 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 0.6 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 7.0 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 0.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.7 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.5 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
| 0.1 | 0.9 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.4 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.1 | 0.5 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.1 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 2.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.3 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.1 | 0.3 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.1 | 1.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.6 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 1.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 1.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 3.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.4 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.1 | 0.7 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 2.8 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.3 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 0.1 | 1.5 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 1.0 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.7 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 3.4 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.1 | 0.4 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 1.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 1.7 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.1 | 0.5 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.3 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.7 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.9 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.2 | GO:0031753 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.1 | 0.5 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.1 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.6 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 0.5 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 2.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 1.5 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.1 | 1.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 1.0 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
| 0.1 | 2.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 6.6 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 0.9 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.6 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 2.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 1.6 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 1.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.3 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
| 0.1 | 1.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.3 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.1 | 1.0 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.4 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.6 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.1 | 13.1 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.1 | 0.8 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.7 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.9 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 1.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.2 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.8 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.6 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.4 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 0.5 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.4 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 1.9 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 1.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 0.2 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.1 | 0.3 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 1.4 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 1.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.2 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.1 | 0.3 | GO:0032567 | dGTPase activity(GO:0008832) triphosphoric monoester hydrolase activity(GO:0016793) guanyl deoxyribonucleotide binding(GO:0032560) dGTP binding(GO:0032567) |
| 0.1 | 0.2 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.6 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.7 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.7 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.9 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.8 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.4 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 0.3 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.1 | 0.9 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.1 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.1 | 0.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 2.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 1.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 1.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.5 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 5.4 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.9 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 1.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.1 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.1 | 0.2 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.1 | 1.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.2 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.1 | 0.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.7 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 1.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.3 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.1 | 0.3 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 0.4 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 4.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 1.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.4 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.3 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.7 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.5 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.3 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.1 | 0.2 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) epinephrine binding(GO:0051379) norepinephrine binding(GO:0051380) |
| 0.1 | 1.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 3.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.7 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 1.0 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 2.7 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 3.3 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.7 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 1.7 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 0.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.1 | 0.9 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.5 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.1 | 1.5 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 3.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.2 | GO:0052854 | (S)-2-hydroxy-acid oxidase activity(GO:0003973) very-long-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052852) long-chain-(S)-2-hydroxy-long-chain-acid oxidase activity(GO:0052853) medium-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052854) |
| 0.1 | 2.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 2.6 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.1 | 0.1 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.1 | 0.3 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.2 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.1 | 0.3 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.1 | 0.1 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.1 | 1.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.3 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.1 | 0.3 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.1 | 1.3 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.2 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 0.7 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 1.4 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 1.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 1.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 2.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.8 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 16.9 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.5 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 2.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.9 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.9 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.2 | GO:0032041 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 1.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.6 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.8 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 7.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.4 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 3.1 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) RNA-dependent ATPase activity(GO:0008186) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 0.4 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.6 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.4 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.8 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 1.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 1.0 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 2.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.0 | 1.2 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.7 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.7 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 1.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.2 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.2 | GO:1901338 | dopamine binding(GO:0035240) catecholamine binding(GO:1901338) |
| 0.0 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 2.5 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
| 0.0 | 1.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 1.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 15.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.0 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.3 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.4 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.3 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.8 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.1 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.5 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.0 | 1.4 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.0 | 0.1 | GO:0000248 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
| 0.0 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 1.0 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 1.6 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.1 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.5 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.1 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 1.4 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.3 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 0.2 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.3 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.4 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 2.5 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 2.1 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.8 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.0 | 0.2 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.2 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.0 | 0.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.1 | GO:0030613 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.9 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.0 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 5.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 2.0 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 4.1 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 1.1 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.0 | 1.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 1.7 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 2.3 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.4 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.0 | 0.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.0 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.1 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 1.0 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.0 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.0 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.2 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.0 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.0 | 0.1 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.0 | 0.3 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.1 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.0 | 0.0 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.0 | 0.0 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.1 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.0 | 0.0 | GO:0052830 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0036505 | prosaposin receptor activity(GO:0036505) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 24.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.3 | 0.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.2 | 3.9 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.2 | 0.4 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.2 | 8.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.2 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.2 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 1.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.2 | 7.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.2 | 1.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.2 | 2.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 7.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 5.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 2.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 2.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 3.7 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 1.8 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 7.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 4.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 2.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.4 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 1.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 4.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 4.9 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.5 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 2.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.8 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 7.7 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 1.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 2.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 0.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 1.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 9.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 2.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 7.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 4.8 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.5 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 1.9 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 5.0 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 2.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.1 | 4.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 0.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 0.8 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 2.0 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.4 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 1.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 4.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 4.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 1.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 6.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 4.3 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 4.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 1.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 4.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 1.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 3.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 1.0 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 1.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.6 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 1.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.9 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 4.5 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 2.2 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 3.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.6 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 1.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.4 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 2.7 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.7 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.8 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.7 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 2.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.6 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 1.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.8 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.7 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 4.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 5.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 3.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.3 | 5.1 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.3 | 10.5 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.3 | 5.6 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.2 | 2.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 2.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 13.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 0.7 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.2 | 8.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.2 | 4.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 5.2 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.2 | 9.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.2 | 19.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.2 | 6.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.2 | 4.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.2 | 0.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.2 | 2.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 3.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.2 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 0.9 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.2 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.2 | 0.3 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.2 | 2.7 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 3.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 3.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 2.7 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.1 | 2.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 6.0 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 6.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 10.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 4.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 6.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.1 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.1 | 0.4 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 1.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 3.9 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 3.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 1.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 5.1 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 0.2 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.1 | 2.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 6.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 5.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 8.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.9 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 3.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 0.7 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.1 | 0.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 2.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 1.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 1.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 4.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 2.0 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 1.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.1 | 1.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 1.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.8 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 2.7 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 2.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.9 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 1.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 2.8 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 1.6 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 8.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 2.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 2.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 1.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 1.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 1.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 4.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.5 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 2.8 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.1 | 0.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 1.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.8 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 3.7 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 2.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.8 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.1 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
| 0.0 | 2.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 1.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 1.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 1.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.7 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 1.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 1.1 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 1.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 1.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 7.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.7 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 1.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 1.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.4 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.0 | 6.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 4.3 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.8 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 1.9 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 1.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 1.0 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.3 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 1.0 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |